From 3c74b0bbd930ef84d5399991c03adda1558aadb8 Mon Sep 17 00:00:00 2001
From: Dries007 <admin@dries007.net>
Date: Wed, 7 Feb 2018 20:56:27 +0100
Subject: [PATCH] Update terminal lib to new version, enabled autoscroll

---
 .../resources/static/css/jquery.terminal.css  |  608 +-
 .../static/css/jquery.terminal.min.css        |    8 +-
 .../resources/static/js/jquery.terminal.js    | 5830 +++++++++++------
 .../static/js/jquery.terminal.min.js          |   11 +-
 .../resources/static/js/unix_formatting.js    |  162 +-
 .../resources/templates/serverconsole.ftl     |    9 +-
 6 files changed, 4556 insertions(+), 2072 deletions(-)

diff --git a/src/main/resources/static/css/jquery.terminal.css b/src/main/resources/static/css/jquery.terminal.css
index 12c2e8f..9873474 100644
--- a/src/main/resources/static/css/jquery.terminal.css
+++ b/src/main/resources/static/css/jquery.terminal.css
@@ -4,15 +4,15 @@
  *  __ / // // // // // _  // _// // / / // _  // _//     // //  \/ // _ \/ /
  * /  / // // // // // ___// / / // / / // ___// / / / / // // /\  // // / /__
  * \___//____ \\___//____//_/ _\_  / /_//____//_/ /_/ /_//_//_/ /_/ \__\_\___/
- *           \/              /____/                              version 0.11.23
+ *           \/              /____/                              version 1.11.4
  * http://terminal.jcubic.pl
  *
  * This file is part of jQuery Terminal.
  *
- * Copyright (c) 2011-2016 Jakub Jankiewicz <http://jcubic.pl>
+ * Copyright (c) 2011-2018 Jakub Jankiewicz <http://jcubic.pl>
  * Released under the MIT license
  *
- * Date: Sun, 08 Jan 2017 11:44:40 +0000
+ * Date: Sat, 27 Jan 2018 15:44:40 +0000
  */
 .terminal .terminal-output .format, .cmd .format,
 .cmd .prompt, .cmd .prompt div, .terminal .terminal-output div div{
@@ -36,100 +36,87 @@
     position: absolute;
     left: -16px;
     top: 0;
-    width: 10px;
+    width: 20px;
     height: 16px;
     /* this seems to work after all on Android */
     /*left: -99999px;
     clip: rect(1px,1px,1px,1px);
     /* on desktop textarea appear when paste */
-    /*
+    /* opacity is needed for Edge and IE
     opacity: 0.01;
     filter: alpha(opacity = 0.01);
-    filter: progid:DXImageTransform.Microsoft.Alpha(opacity=0.01);
-    */
+    filter: progid:DXImageTransform.Microsoft.Alpha(opacity=0.01);*/
     background: transparent;
     border: none;
     color: transparent;
     outline: none;
     padding: 0;
     resize: none;
-    z-index: 0;
+    z-index: 1000;
     overflow: hidden;
+    white-space: pre;
+    text-indent: -9999em; /* better cursor hiding for Safari and IE */
+}
+.terminal img, .terminal value, .terminal audio, .terminal object, .terminal canvas {
+    cursor: default;
 }
 .terminal .error {
     color: #f00;
 }
 .terminal {
-    padding: 10px;
     position: relative;
     /*overflow: hidden;*/
-    overflow: auto;
+    overflow-y: auto;
+    overflow-x: hidden;
+}
+body.terminal {
+    height: 100vh;
+    margin: 0;
+}
+.terminal > div {
+    height: 100%;
 }
 .cmd {
     padding: 0;
-    height: 1.3em;
     position: relative;
     /*margin-top: 3px; */
+    float: left;
+    padding-bottom: 3px;
+}
+.terminal a[tabindex="1000"],
+.terminal a[tabindex="1000"]:active,
+.terminal a[tabindex="1000"]:focus {
+    outline: none;
 }
-.terminal .inverted, .cmd .inverted, .cmd .cursor.blink {
+.terminal .inverted, .cmd .inverted {
     background-color: #aaa;
     color: #000;
 }
+.cmd .cursor {
+    border-bottom: 3px solid transparent;
+    margin-bottom: -3px;
+    background-clip: content-box;
+}
 .cmd .cursor.blink {
     -webkit-animation: terminal-blink 1s infinite steps(1, start);
        -moz-animation: terminal-blink 1s infinite steps(1, start);
         -ms-animation: terminal-blink 1s infinite steps(1, start);
             animation: terminal-blink 1s infinite steps(1, start);
+    border-left: 1px solid transparent;
+    margin-left: -1px;
 }
-@-webkit-keyframes terminal-blink {
-  0%, 100% {
-      background-color: #000;
-      color: #aaa;
-  }
-  50% {
-      background-color: #bbb;
-      color: #000;
-  }
-}
-
-@-ms-keyframes terminal-blink {
-  0%, 100% {
-      background-color: #000;
-      color: #aaa;
-  }
-  50% {
-      background-color: #bbb;
-      color: #000;
-  }
-}
-
-@-moz-keyframes terminal-blink {
-  0%, 100% {
-      background-color: #000;
-      color: #aaa;
-  }
-  50% {
-      background-color: #bbb;
-      color: #000;
-  }
-}
-@keyframes terminal-blink {
-  0%, 100% {
-      background-color: #000;
-      color: #aaa;
-  }
-  50% {
-      background-color: #bbb; /* not #aaa because it's seems there is Google Chrome bug */
-      color: #000;
-  }
+.bar.terminal .inverted, .bar.cmd .inverted {
+    border-left-color: #aaa;
 }
-
 .terminal .terminal-output div div, .cmd .prompt {
     display: block;
     line-height: 14px;
     height: auto;
 }
-.cmd .prompt {
+.terminal .terminal-output > div:not(.raw) div {
+    white-space: nowrap;
+}
+.cmd .prompt > span {
     float: left;
 }
 .terminal, .cmd {
@@ -139,50 +126,43 @@
     background-color: #000;
     font-size: 12px;
     line-height: 14px;
+    box-sizing: border-box;
+    cursor: text;
+}
+.cmd div {
+    clear: both;
 }
-.terminal-output > div {
-    /*padding-top: 3px;*/
+.cmd .prompt + div {
+    clear: right;
+}
+.terminal-output > div > div {
     min-height: 14px;
 }
-.terminal-output > div > div * {
-    word-wrap: break-word; /* when echo html */
+terminal .terminal-output > div {
+    margin-top: -1px;
+}
+.terminal-output > div.raw > div * {
+    overflow-wrap: break-word;
+    word-wrap: break-word;
+}
+.terminal .font {
+    position: absolute;
+    font-size: inherit;
+    width: 1em;
+    height: 1em;
+    top: -100%;
+    left: 0;
+    margin-bottom: 1px;
 }
 .terminal .terminal-output div span {
     display: inline-block;
 }
-.cmd span {
+.cmd > span:not(.prompt) {
     float: left;
-    /*display: inline-block; */
-}
-/* fix double style of selecting text in terminal */
-.terminal-output span, .terminal-output a, .cmd div, .cmd span, .terminal td,
-.terminal pre, .terminal h1, .terminal h2, .terminal h3, .terminal h4,
-.terminal h5, .terminal h6 {
-    -webkit-touch-callout: initial;
-    -webkit-user-select: initial;
-    -khtml-user-select: initial;
-    -moz-user-select: initial;
-    -ms-user-select: initial;
-    user-select: initial;
-}
-.terminal, .terminal-output, .terminal-output div {
-    -webkit-touch-callout: none;
-    -webkit-user-select: none;
-    -khtml-user-select: none;
-    -moz-user-select: none;
-    -ms-user-select: none;
-    user-select: none;
-}
-/* firefox hack */
-@-moz-document url-prefix() {
-    .terminal, .terminal-output, .terminal-output div {
-        -webkit-touch-callout: initial;
-        -webkit-user-select: initial;
-        -khtml-user-select: initial;
-        -moz-user-select: initial;
-        -ms-user-select: initial;
-        user-select: initial;
-    }
+}
+.cmd .prompt span.line {
+    display: block;
+    float: none;
 }
 .terminal table {
     border-collapse: collapse;
@@ -201,8 +181,12 @@
 .terminal .terminal-output div div::-moz-selection,
 .terminal .terminal-output div span::-moz-selection,
 .terminal .terminal-output div div a::-moz-selection,
+.terminal .terminal-output .raw div::-moz-selection,
 .cmd div::-moz-selection,
 .cmd > span::-moz-selection,
+.cmd > span span::-moz-selection,
+.cmd > div::-moz-selection,
+.cmd > div span::-moz-selection,
 .cmd .prompt span::-moz-selection {
     background-color: #aaa;
     color: #000;
@@ -226,10 +210,18 @@
 .terminal .terminal-output div div::selection,
 .terminal .terminal-output div div a::selection,
 .terminal .terminal-output div span::selection,
+.terminal .terminal-output .raw div::selection,
 .cmd div::selection,
 .cmd > span::selection,
+.cmd > span span::selection,
+.cmd > div::selection,
+.cmd > div span::selection,
 .cmd .prompt span::selection {
-    background-color: #aaa;
+    /*
+     * use rgba to fix transparent selection in chrome
+     * http://stackoverflow.com/questions/7224445/css3-selection-behaves-differently-in-ff-chrome
+     */
+    background-color: rgba(170, 170, 170, 0.99);
     color: #000;
 }
 .terminal .terminal-output div.error, .terminal .terminal-output div.error div {
@@ -242,12 +234,442 @@
     width: 100%;
     z-index: 1100;
 }
+.ui-dialog-content .terminal {
+    width: 100%;
+    height: 100%;
+    box-sizing: border-box;
+}
+.ui-dialog .ui-dialog-content.dterm {
+    padding: 0;
+}
 .clear {
     clear: both;
 }
 .terminal a {
     color: #0F60FF;
+    color: var(--link-color, #0F60FF);
 }
 .terminal a:hover {
-    color: red;
+    background: #0F60FF;
+    background: var(--link-color, #0F60FF);
+    color: var(--background, #000);
+    text-decoration: none;
+}
+.terminal .terminal-fill {
+    position: absolute;
+    left: 0;
+    top: -100%;
+    width: 100%;
+    height: 100%;
+    margin: 1px 0 0;
+    border: none;
+    opacity: 0;
+    pointer-events: none;
+    box-sizing: border-box;
+}
+.terminal, .terminal .terminal-fill {
+    padding: 10px;
+}
+@-webkit-keyframes terminal-blink {
+  0%, 100% {
+      background-color: #000;
+      color: #aaa;
+  }
+  50% {
+      background-color: #bbb;
+      color: #000;
+  }
+}
+
+@-ms-keyframes terminal-blink {
+  0%, 100% {
+      background-color: #000;
+      color: #aaa;
+  }
+  50% {
+      background-color: #bbb;
+      color: #000;
+  }
+}
+
+@-moz-keyframes terminal-blink {
+  0%, 100% {
+      background-color: #000;
+      color: #aaa;
+  }
+  50% {
+      background-color: #bbb;
+      color: #000;
+  }
+}
+@keyframes terminal-blink {
+  0%, 100% {
+      background-color: #000;
+      color: #aaa;
+  }
+  50% {
+      background-color: #bbb; /* not #aaa because it's seems there is Google Chrome bug */
+      color: #000;
+  }
+}
+@-webkit-keyframes terminal-bar {
+  0%, 100% {
+      border-left-color: #aaa;
+  }
+  50% {
+      border-left-color: #000;
+  }
+}
+@-ms-keyframes terminal-bar {
+  0%, 100% {
+      border-left-color: #aaa;
+  }
+  50% {
+      border-left-color: #000;
+  }
+}
+@-moz-keyframes terminal-bar {
+  0%, 100% {
+      border-left-color: #aaa;
+  }
+  50% {
+      border-left-color: #000;
+  }
+}
+@keyframes terminal-bar {
+  0%, 100% {
+      border-left-color: #aaa;
+  }
+  50% {
+      border-left-color: #000;
+  }
+}
+@-webkit-keyframes terminal-underline {
+  0%, 100% {
+      border-bottom-color: #aaa;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+  50% {
+      border-bottom-color: #000;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+}
+@-ms-keyframes terminal-underline {
+  0%, 100% {
+      border-bottom-color: #aaa;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+  50% {
+      border-bottom-color: #000;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+}
+@-moz-keyframes terminal-underline {
+  0%, 100% {
+      border-bottom-color: #aaa;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+  50% {
+      border-bottom-color: #000;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+}
+@keyframes terminal-underline {
+  0%, 100% {
+      border-bottom-color: #aaa;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+  50% {
+      border-bottom-color: #000;
+      position: relative;
+      line-height: 12px;
+      margin-top: 1px;
+      border-left: none;
+      margin-left: 0;
+  }
+}
+/* shorthand classes for IE */
+.underline-animation .cursor.blink {
+    border-left: none;
+    -webkit-animation-name: terminal-underline;
+       -moz-animation-name: terminal-underline;
+        -ms-animation-name: terminal-underline;
+            animation-name: terminal-underline;
+}
+.bar-animation .cursor.blink {
+    -webkit-animation-name: terminal-bar;
+       -moz-animation-name: terminal-bar;
+        -ms-animation-name: terminal-bar;
+            animation-name: terminal-bar;
+}
+@supports (--css: variables) {
+    .terminal, .cmd {
+        color: var(--color, #aaa);
+        background-color: var(--background, #000);
+    }
+    .terminal .font {
+        width: calc(var(--size, 1) * 1em);
+        height: calc(var(--size, 1) * 1em);
+    }
+    .terminal span[style*="--length"] {
+        width: calc(var(--length, 1) * var(--char-width) * 1px);
+        display: inline-block;
+    }
+    .terminal, .cmd, .terminal .terminal-output > div > div, .cmd .prompt {
+        font-size: calc(var(--size, 1) * 12px);
+        line-height: calc(var(--size, 1) * 14px);
+    }
+    .terminal .terminal-output > div > div {
+        min-height: calc(var(--size, 1) * 14px);
+    }
+    .terminal .inverted, .cmd .inverted {
+        background-color: var(--color, #aaa);
+        color: var(--background, #000);
+    }
+    .cmd .cursor.blink {
+        -webkit-animation: var(--animation, terminal-blink) 1s infinite steps(1, start);
+           -moz-animation: var(--animation, terminal-blink) 1s infinite steps(1, start);
+            -ms-animation: var(--animation, terminal-blink) 1s infinite steps(1, start);
+                animation: var(--animation, terminal-blink) 1s infinite steps(1, start);
+        color: var(--color, #aaa);
+        background-color: var(--background, #000);
+    }
+    .terminal h1::-moz-selection,
+    .terminal h2::-moz-selection,
+    .terminal h3::-moz-selection,
+    .terminal h4::-moz-selection,
+    .terminal h5::-moz-selection,
+    .terminal h6::-moz-selection,
+    .terminal pre::-moz-selection,
+    .terminal td::-moz-selection,
+    .terminal .terminal-output div div::-moz-selection,
+    .terminal .terminal-output div span::-moz-selection,
+    .terminal .terminal-output div div a::-moz-selection,
+    .cmd div::-moz-selection,
+    .cmd > span::-moz-selection,
+    .cmd > span span::-moz-selection,
+    .cmd > div::-moz-selection,
+    .cmd > div span::-moz-selection,
+    .cmd .prompt span::-moz-selection {
+        background-color: var(--color, #aaa);
+        color: var(--background, #000);
+    }
+    .terminal h1::selection,
+    .terminal h2::selection,
+    .terminal h3::selection,
+    .terminal h4::selection,
+    .terminal h5::selection,
+    .terminal h6::selection,
+    .terminal pre::selection,
+    .terminal td::selection,
+    .terminal .terminal-output div div::selection,
+    .terminal .terminal-output div div a::selection,
+    .terminal .terminal-output div span::selection,
+    .cmd div::selection,
+    .cmd > span::selection,
+    .cmd > span span::selection,
+    .cmd > div::selection,
+    .cmd > div span::selection,
+    .cmd .prompt span::selection {
+        background-color: var(--color, rgba(170, 170, 170, 0.99));
+        color: var(--background, #000);
+    }
+    @-webkit-keyframes terminal-blink {
+      0%, 100% {
+          background-color: var(--background, #000);
+          color: var(--color, #aaa);
+      }
+      50% {
+          background-color: var(--color, #aaa);
+          color: var(--background, #000);
+      }
+    }
+
+    @-ms-keyframes terminal-blink {
+      0%, 100% {
+          background-color: var(--background, #000);
+          color: var(--color, #aaa);
+      }
+      50% {
+          background-color: var(--color, #aaa);
+          color: var(--background, #000);
+      }
+    }
+    @-moz-keyframes terminal-blink {
+      0%, 100% {
+          background-color: var(--background, #000);
+          color: var(--color, #aaa);
+      }
+      50% {
+          background-color: var(--color, #aaa);
+          color: var(--background, #000);
+      }
+    }
+    @keyframes terminal-blink {
+      0%, 100% {
+          background-color: var(--background, #000);
+          color: var(--color, #aaa);
+      }
+      50% {
+          background-color: var(--color, #aaa);
+          color: var(--background, #000);
+      }
+    }
+    @-webkit-keyframes terminal-bar {
+      0%, 100% {
+          border-left-color: var(--background, #000);
+      }
+      50% {
+          border-left-color: var(--color, #aaa);
+      }
+    }
+    @-ms-keyframes terminal-bar {
+      0%, 100% {
+          border-left-color: var(--background, #000);
+      }
+      50% {
+          border-left-color: var(--color, #aaa);
+      }
+    }
+    @-moz-keyframes terminal-bar {
+      0%, 100% {
+          border-left-color: var(--background, #000);
+      }
+      50% {
+          border-left-color: var(--color, #aaa);
+      }
+    }
+    @keyframes terminal-bar {
+      0%, 100% {
+          border-left-color: var(--background, #000);
+      }
+      50% {
+          border-left-color: var(--color, #aaa);
+      }
+    }
+    @-webkit-keyframes terminal-underline {
+      0%, 100% {
+          border-bottom-color: var(--color, #aaa);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+      50% {
+          border-bottom-color: var(--background, #000);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+    }
+    @-ms-keyframes terminal-underline {
+      0%, 100% {
+          border-bottom-color: var(--background, #000);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+      50% {
+          border-bottom-color: var(--color, #aaa);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+    }
+    @-moz-keyframes terminal-underline {
+      0%, 100% {
+          border-bottom-color: var(--background, #000);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+      50% {
+          border-bottom-color: var(--color, #aaa);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+    }
+    @keyframes terminal-underline {
+      0%, 100% {
+          border-bottom-color: var(--background, #000);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+      50% {
+          border-bottom-color: var(--color, #aaa);
+          position: relative;
+          line-height: calc(var(--size, 1) * 12px);
+          margin-top: calc(var(--size, 1) * 1px);
+          border-left: none;
+          margin-left: 0;
+      }
+    }
+}
+/*
+ * overwrite css variables that don't work with selection in Edge
+ */
+@supports (-ms-ime-align:auto) {
+    .terminal h1::selection,
+    .terminal h2::selection,
+    .terminal h3::selection,
+    .terminal h4::selection,
+    .terminal h5::selection,
+    .terminal h6::selection,
+    .terminal pre::selection,
+    .terminal td::selection,
+    .terminal .terminal-output div div::selection,
+    .terminal .terminal-output div div a::selection,
+    .terminal .terminal-output div span::selection,
+    .cmd div::selection,
+    .cmd > span::selection,
+    .cmd > span span::selection,
+    .cmd > div::selection,
+    .cmd > div span::selection,
+    .cmd .prompt span::selection {
+        background-color: rgba(170, 170, 170, 0.99);
+        color: #000;
+    }
 }
diff --git a/src/main/resources/static/css/jquery.terminal.min.css b/src/main/resources/static/css/jquery.terminal.min.css
index 3609d45..6a30e85 100644
--- a/src/main/resources/static/css/jquery.terminal.min.css
+++ b/src/main/resources/static/css/jquery.terminal.min.css
@@ -4,13 +4,13 @@
  *  __ / // // // // // _  // _// // / / // _  // _//     // //  \/ // _ \/ /
  * /  / // // // // // ___// / / // / / // ___// / / / / // // /\  // // / /__
  * \___//____ \\___//____//_/ _\_  / /_//____//_/ /_/ /_//_//_/ /_/ \__\_\___/
- *           \/              /____/                              version 0.11.23
+ *           \/              /____/                              version 1.11.4
  * http://terminal.jcubic.pl
  *
  * This file is part of jQuery Terminal.
  *
- * Copyright (c) 2011-2016 Jakub Jankiewicz <http://jcubic.pl>
+ * Copyright (c) 2011-2018 Jakub Jankiewicz <http://jcubic.pl>
  * Released under the MIT license
  *
- * Date: Sun, 08 Jan 2017 11:44:40 +0000
- */.terminal .terminal-output .format,.cmd .format,.cmd .prompt,.cmd .prompt div,.terminal .terminal-output div div{display:inline-block}.terminal h1,.terminal h2,.terminal h3,.terminal h4,.terminal h5,.terminal h6,.terminal pre,.cmd{margin:0}.terminal h1,.terminal h2,.terminal h3,.terminal h4,.terminal h5,.terminal h6{line-height:1.2em}.cmd .clipboard{position:absolute;left:-16px;top:0;width:10px;height:16px;background:transparent;border:0;color:transparent;outline:0;padding:0;resize:none;z-index:0;overflow:hidden}.terminal .error{color:red}.terminal{padding:10px;position:relative;overflow:auto}.cmd{padding:0;height:1.3em;position:relative}.terminal .inverted,.cmd .inverted,.cmd .cursor.blink{background-color:#aaa;color:#000}.cmd .cursor.blink{-webkit-animation:terminal-blink 1s infinite steps(1,start);-moz-animation:terminal-blink 1s infinite steps(1,start);-ms-animation:terminal-blink 1s infinite steps(1,start);animation:terminal-blink 1s infinite steps(1,start)}@-webkit-keyframes terminal-blink{0%,100%{background-color:#000;color:#aaa}50%{background-color:#bbb;color:#000}}@-ms-keyframes terminal-blink{0%,100%{background-color:#000;color:#aaa}50%{background-color:#bbb;color:#000}}@-moz-keyframes terminal-blink{0%,100%{background-color:#000;color:#aaa}50%{background-color:#bbb;color:#000}}@keyframes terminal-blink{0%,100%{background-color:#000;color:#aaa}50%{background-color:#bbb;color:#000}}.terminal .terminal-output div div,.cmd .prompt{display:block;line-height:14px;height:auto}.cmd .prompt{float:left}.terminal,.cmd{font-family:monospace;color:#aaa;background-color:#000;font-size:12px;line-height:14px}.terminal-output>div{min-height:14px}.terminal-output>div>div *{word-wrap:break-word}.terminal .terminal-output div span{display:inline-block}.cmd span{float:left}.terminal-output span,.terminal-output a,.cmd div,.cmd span,.terminal td,.terminal pre,.terminal h1,.terminal h2,.terminal h3,.terminal h4,.terminal h5,.terminal h6{-webkit-touch-callout:initial;-webkit-user-select:initial;-khtml-user-select:initial;-moz-user-select:initial;-ms-user-select:initial;user-select:initial}.terminal,.terminal-output,.terminal-output div{-webkit-touch-callout:none;-webkit-user-select:none;-khtml-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}@-moz-document url-prefix(){.terminal,.terminal-output,.terminal-output div{-webkit-touch-callout:initial;-webkit-user-select:initial;-khtml-user-select:initial;-moz-user-select:initial;-ms-user-select:initial;user-select:initial}}.terminal table{border-collapse:collapse}.terminal td{border:1px solid #aaa}.terminal h1::-moz-selection,.terminal h2::-moz-selection,.terminal h3::-moz-selection,.terminal h4::-moz-selection,.terminal h5::-moz-selection,.terminal h6::-moz-selection,.terminal pre::-moz-selection,.terminal td::-moz-selection,.terminal .terminal-output div div::-moz-selection,.terminal .terminal-output div span::-moz-selection,.terminal .terminal-output div div a::-moz-selection,.cmd div::-moz-selection,.cmd>span::-moz-selection,.cmd .prompt span::-moz-selection{background-color:#aaa;color:#000}.terminal h1::selection,.terminal h2::selection,.terminal h3::selection,.terminal h4::selection,.terminal h5::selection,.terminal h6::selection,.terminal pre::selection,.terminal td::selection,.terminal .terminal-output div div::selection,.terminal .terminal-output div div a::selection,.terminal .terminal-output div span::selection,.cmd div::selection,.cmd>span::selection,.cmd .prompt span::selection{background-color:#aaa;color:#000}.terminal .terminal-output div.error,.terminal .terminal-output div.error div{color:red}.tilda{position:fixed;top:0;left:0;width:100%;z-index:1100}.clear{clear:both}.terminal a{color:#0f60ff}.terminal a:hover{color:red}
\ No newline at end of file
+ * Date: Sat, 27 Jan 2018 15:44:40 +0000
+ */.cmd .format,.cmd .prompt,.cmd .prompt div,.terminal .terminal-output .format,.terminal .terminal-output div div{display:inline-block}.cmd,.terminal h1,.terminal h2,.terminal h3,.terminal h4,.terminal h5,.terminal h6,.terminal pre{margin:0}.terminal h1,.terminal h2,.terminal h3,.terminal h4,.terminal h5,.terminal h6{line-height:1.2em}.cmd .clipboard{position:absolute;left:-16px;top:0;width:20px;height:16px;background:transparent;border:none;color:transparent;outline:none;padding:0;resize:none;z-index:1;overflow:hidden;white-space:pre;text-indent:-9999em}.terminal audio,.terminal canvas,.terminal img,.terminal object,.terminal value{cursor:default}.terminal .error{color:red}.terminal{position:relative;overflow-y:auto;overflow-x:hidden}body.terminal{height:100vh;margin:0}.terminal>div{height:100%}.cmd{padding:0;position:relative;float:left;padding-bottom:3px}.terminal a[tabindex="1000"],.terminal a[tabindex="1000"]:active,.terminal a[tabindex="1000"]:focus{outline:none}.cmd .inverted,.terminal .inverted{background-color:#aaa;color:#000}.cmd .cursor{border-bottom:3px solid transparent;margin-bottom:-3px;background-clip:content-box}.cmd .cursor.blink{-webkit-animation:a 1s infinite step-start;animation:a 1s infinite step-start;border-left:1px solid transparent;margin-left:-1px}.bar.cmd .inverted,.bar.terminal .inverted{border-left-color:#aaa}.cmd .prompt,.terminal .terminal-output div div{display:block;line-height:14px;height:auto}.terminal .terminal-output>div:not(.raw) div{white-space:nowrap}.cmd .prompt>span{float:left}.cmd,.terminal{font-family:monospace;color:#aaa;background-color:#000;font-size:12px;line-height:14px;box-sizing:border-box;cursor:text}.cmd div{clear:both}.cmd .prompt+div{clear:right}.terminal-output>div>div{min-height:14px}terminal .terminal-output>div{margin-top:-1px}.terminal-output>div.raw>div *{overflow-wrap:break-word;word-wrap:break-word}.terminal .font{position:absolute;font-size:inherit;width:1em;height:1em;top:-100%;left:0;margin-bottom:1px}.terminal .terminal-output div span{display:inline-block}.cmd>span:not(.prompt){float:left}.cmd .prompt span.line{display:block;float:none}.terminal table{border-collapse:collapse}.terminal td{border:1px solid #aaa}.cmd .prompt span::-moz-selection,.cmd>div::-moz-selection,.cmd>div span::-moz-selection,.cmd>span::-moz-selection,.cmd>span span::-moz-selection,.cmd div::-moz-selection,.terminal .terminal-output .raw div::-moz-selection,.terminal .terminal-output div div::-moz-selection,.terminal .terminal-output div div a::-moz-selection,.terminal .terminal-output div span::-moz-selection,.terminal h1::-moz-selection,.terminal h2::-moz-selection,.terminal h3::-moz-selection,.terminal h4::-moz-selection,.terminal h5::-moz-selection,.terminal h6::-moz-selection,.terminal pre::-moz-selection,.terminal td::-moz-selection{background-color:#aaa;color:#000}.cmd .prompt span::selection,.cmd>div::selection,.cmd>div span::selection,.cmd>span::selection,.cmd>span span::selection,.cmd div::selection,.terminal .terminal-output .raw div::selection,.terminal .terminal-output div div::selection,.terminal .terminal-output div div a::selection,.terminal .terminal-output div span::selection,.terminal h1::selection,.terminal h2::selection,.terminal h3::selection,.terminal h4::selection,.terminal h5::selection,.terminal h6::selection,.terminal pre::selection,.terminal td::selection{background-color:hsla(0,0%,67%,.99);color:#000}.terminal .terminal-output div.error,.terminal .terminal-output div.error div{color:red}.tilda{position:fixed;top:0;left:0;width:100%;z-index:2}.ui-dialog-content .terminal{width:100%;height:100%;box-sizing:border-box}.ui-dialog .ui-dialog-content.dterm{padding:0}.clear{clear:both}.terminal a{color:#0f60ff;color:var(--link-color,#0f60ff)}.terminal a:hover{background:#0f60ff;background:var(--link-color,#0f60ff);color:var(--background,#000);text-decoration:none}.terminal .terminal-fill{position:absolute;left:0;top:-100%;width:100%;height:100%;margin:1px 0 0;border:none;opacity:0;pointer-events:none;box-sizing:border-box}.terminal,.terminal .terminal-fill{padding:10px}@-webkit-keyframes a{0%,to{background-color:#000;color:#aaa}50%{background-color:#bbb;color:#000}}@keyframes a{0%,to{background-color:#000;color:#aaa}50%{background-color:#bbb;color:#000}}@-webkit-keyframes b{0%,to{border-left-color:#aaa}50%{border-left-color:#000}}@keyframes b{0%,to{border-left-color:#aaa}50%{border-left-color:#000}}@-webkit-keyframes c{0%,to{border-bottom-color:#aaa;position:relative;line-height:12px;margin-top:1px;border-left:none;margin-left:0}50%{border-bottom-color:#000;position:relative;line-height:12px;margin-top:1px;border-left:none;margin-left:0}}@keyframes c{0%,to{border-bottom-color:#aaa;position:relative;line-height:12px;margin-top:1px;border-left:none;margin-left:0}50%{border-bottom-color:#000;position:relative;line-height:12px;margin-top:1px;border-left:none;margin-left:0}}.underline-animation .cursor.blink{border-left:none;-webkit-animation-name:c;animation-name:c}.bar-animation .cursor.blink{-webkit-animation-name:b;animation-name:b}@supports (--css:variables){.cmd,.terminal{color:var(--color,#aaa);background-color:var(--background,#000)}.terminal .font{width:calc(var(--size, 1) * 1em);height:calc(var(--size, 1) * 1em)}.terminal span[style*="--length"]{width:calc(var(--length, 1) * var(--char-width) * 1px);display:inline-block}.cmd,.cmd .prompt,.terminal,.terminal .terminal-output>div>div{font-size:calc(var(--size, 1) * 12px);line-height:calc(var(--size, 1) * 14px)}.terminal .terminal-output>div>div{min-height:calc(var(--size, 1) * 14px)}.cmd .inverted,.terminal .inverted{background-color:var(--color,#aaa);color:var(--background,#000)}.cmd .cursor.blink{-webkit-animation:var(--animation,a) 1s infinite step-start;animation:var(--animation,a) 1s infinite step-start;color:var(--color,#aaa);background-color:var(--background,#000)}.cmd .prompt span::-moz-selection,.cmd>div::-moz-selection,.cmd>div span::-moz-selection,.cmd>span::-moz-selection,.cmd>span span::-moz-selection,.cmd div::-moz-selection,.terminal .terminal-output div div::-moz-selection,.terminal .terminal-output div div a::-moz-selection,.terminal .terminal-output div span::-moz-selection,.terminal h1::-moz-selection,.terminal h2::-moz-selection,.terminal h3::-moz-selection,.terminal h4::-moz-selection,.terminal h5::-moz-selection,.terminal h6::-moz-selection,.terminal pre::-moz-selection,.terminal td::-moz-selection{background-color:var(--color,#aaa);color:var(--background,#000)}.cmd .prompt span::selection,.cmd>div::selection,.cmd>div span::selection,.cmd>span::selection,.cmd>span span::selection,.cmd div::selection,.terminal .terminal-output div div::selection,.terminal .terminal-output div div a::selection,.terminal .terminal-output div span::selection,.terminal h1::selection,.terminal h2::selection,.terminal h3::selection,.terminal h4::selection,.terminal h5::selection,.terminal h6::selection,.terminal pre::selection,.terminal td::selection{background-color:var(--color,hsla(0,0%,67%,.99));color:var(--background,#000)}@-webkit-keyframes a{0%,to{background-color:var(--background,#000);color:var(--color,#aaa)}50%{background-color:var(--color,#aaa);color:var(--background,#000)}}@keyframes a{0%,to{background-color:var(--background,#000);color:var(--color,#aaa)}50%{background-color:var(--color,#aaa);color:var(--background,#000)}}@-webkit-keyframes b{0%,to{border-left-color:var(--background,#000)}50%{border-left-color:var(--color,#aaa)}}@keyframes b{0%,to{border-left-color:var(--background,#000)}50%{border-left-color:var(--color,#aaa)}}@-webkit-keyframes c{0%,to{border-bottom-color:var(--color,#aaa);position:relative;line-height:calc(var(--size, 1) * 12px);margin-top:calc(var(--size, 1) * 1px);border-left:none;margin-left:0}50%{border-bottom-color:var(--background,#000);position:relative;line-height:calc(var(--size, 1) * 12px);margin-top:calc(var(--size, 1) * 1px);border-left:none;margin-left:0}}@keyframes c{0%,to{border-bottom-color:var(--background,#000);position:relative;line-height:calc(var(--size, 1) * 12px);margin-top:calc(var(--size, 1) * 1px);border-left:none;margin-left:0}50%{border-bottom-color:var(--color,#aaa);position:relative;line-height:calc(var(--size, 1) * 12px);margin-top:calc(var(--size, 1) * 1px);border-left:none;margin-left:0}}}@supports (-ms-ime-align:auto){.cmd .prompt span::selection,.cmd>div::selection,.cmd>div span::selection,.cmd>span::selection,.cmd>span span::selection,.cmd div::selection,.terminal .terminal-output div div::selection,.terminal .terminal-output div div a::selection,.terminal .terminal-output div span::selection,.terminal h1::selection,.terminal h2::selection,.terminal h3::selection,.terminal h4::selection,.terminal h5::selection,.terminal h6::selection,.terminal pre::selection,.terminal td::selection{background-color:hsla(0,0%,67%,.99);color:#000}}
\ No newline at end of file
diff --git a/src/main/resources/static/js/jquery.terminal.js b/src/main/resources/static/js/jquery.terminal.js
index a00b175..a352d81 100644
--- a/src/main/resources/static/js/jquery.terminal.js
+++ b/src/main/resources/static/js/jquery.terminal.js
@@ -4,16 +4,17 @@
  *  __ / // // // // // _  // _// // / / // _  // _//     // //  \/ // _ \/ /
  * /  / // // // // // ___// / / // / / // ___// / / / / // // /\  // // / /__
  * \___//____ \\___//____//_/ _\_  / /_//____//_/ /_/ /_//_//_/ /_/ \__\_\___/
- *           \/              /____/                              version 0.11.23
+ *           \/              /____/                              version 1.11.4
  *
  * This file is part of jQuery Terminal. http://terminal.jcubic.pl
  *
- * Copyright (c) 2010-2016 Jakub Jankiewicz <http://jcubic.pl>
+ * Copyright (c) 2010-2018 Jakub Jankiewicz <http://jcubic.pl/me>
  * Released under the MIT license
  *
  * Contains:
  *
  * Storage plugin Distributed under the MIT License
+ * modified to work from Data URIs that block storage and cookies in Chrome
  * Copyright (c) 2010 Dave Schindler
  *
  * jQuery Timers licenced with the WTFPL
@@ -31,7 +32,7 @@
  * Copyright (c) 2007-2013 Alexandru Marasteanu <hello at alexei dot ro>
  * licensed under 3 clause BSD license
  *
- * Date: Sun, 08 Jan 2017 11:44:38 +0000
+ * Date: Sat, 27 Jan 2018 15:44:36 +0000
  */
 
 /* TODO:
@@ -47,8 +48,10 @@
  * NOTE: json-rpc don't need promises and delegate resume/pause because only
  *       exec can call it and exec call interpreter that work with resume/pause
  */
-
-/* jshint ignore:start */
+/* global location, jQuery, setTimeout, window, global, localStorage, sprintf,
+         setImmediate, IntersectionObserver, MutationObserver, ResizeObserver,
+         wcwidth, module, require, define */
+/* eslint-disable */
 (function(ctx) {
     var sprintf = function() {
         if (!sprintf.cache.hasOwnProperty(arguments[0])) {
@@ -82,7 +85,7 @@
                     arg = argv[cursor++];
                 }
 
-                if (/[^s]/.test(match[8]) && (get_type(arg) != 'number')) {
+                if (/[^s]/.test(match[8]) && (get_type(arg) !== 'number')) {
                     throw(sprintf('[sprintf] expecting number but found %s', get_type(arg)));
                 }
                 switch (match[8]) {
@@ -97,8 +100,8 @@
                     case 'x': arg = arg.toString(16); break;
                     case 'X': arg = arg.toString(16).toUpperCase(); break;
                 }
-                arg = (/[def]/.test(match[8]) && match[3] && arg >= 0 ? '+'+ arg : arg);
-                pad_character = match[4] ? match[4] == '0' ? '0' : match[4].charAt(1) : ' ';
+                arg = (/[def]/.test(match[8]) && match[3] && arg >= 0 ? ' +' + arg : arg);
+                pad_character = match[4] ? match[4] === '0' ? '0' : match[4].charAt(1) : ' ';
                 pad_length = match[6] - String(arg).length;
                 pad = match[6] ? str_repeat(pad_character, pad_length) : '';
                 output.push(match[5] ? arg + pad : pad + arg);
@@ -180,10 +183,55 @@
      */
     ctx.sprintf = sprintf;
     ctx.vsprintf = vsprintf;
-})(typeof global != "undefined" ? global : window);
-/* jshint ignore:end */
-(function($, undefined) {
-    "use strict";
+})(typeof global !== "undefined" ? global : window);
+/* eslint-enable */
+// UMD taken from https://github.com/umdjs/umd
+(function(factory) {
+    if (typeof define === 'function' && define.amd) {
+        // AMD. Register as an anonymous module.
+        define(['jquery'], factory);
+    } else if (typeof module === 'object' && module.exports) {
+        // Node/CommonJS
+        module.exports = function(root, jQuery) {
+            if (jQuery === undefined) {
+                // require('jQuery') returns a factory that requires window to
+                // build a jQuery instance, we normalize how we use modules
+                // that require this pattern but the window provided is a noop
+                // if it's defined (how jquery works)
+                if (typeof window !== 'undefined') {
+                    jQuery = require('jquery');
+                }
+                else {
+                    jQuery = require('jquery')(root);
+                }
+            }
+            factory(jQuery);
+            return jQuery;
+        };
+    } else {
+        // Browser globals
+        factory(jQuery);
+    }
+})(function($, undefined) {
+    'use strict';
+    // -----------------------------------------------------------------------
+    // :: Replacemenet for jQuery 2 deferred objects
+    // -----------------------------------------------------------------------
+    function DelayQueue() {
+        var callbacks = $.Callbacks();
+        var resolved = false;
+        this.resolve = function() {
+            callbacks.fire();
+            resolved = true;
+        };
+        this.add = function(fn) {
+            if (resolved) {
+                fn();
+            } else {
+                callbacks.add(fn);
+            }
+        };
+    }
     // -----------------------------------------------------------------------
     // :: map object to object
     // -----------------------------------------------------------------------
@@ -194,10 +242,20 @@
         });
         return result;
     };
+    $.fn.text_length = function() {
+        return this.map(function() {
+            return $(this).text().length;
+        }).get().reduce(function(a, b) {
+            return a + b;
+        }, 0);
+    };
+    // -----------------------------------------------------------------------
+    // :: Deep clone of objects and arrays
+    // -----------------------------------------------------------------------
     var Clone = {
         clone_object: function(object) {
             var tmp = {};
-            if (typeof object == 'object') {
+            if (typeof object === 'object') {
                 if ($.isArray(object)) {
                     return this.clone_array(object);
                 } else if (object === null) {
@@ -206,7 +264,7 @@
                     for (var key in object) {
                         if ($.isArray(object[key])) {
                             tmp[key] = this.clone_array(object[key]);
-                        } else if (typeof object[key] == 'object') {
+                        } else if (typeof object[key] === 'object') {
                             tmp[key] = this.clone_object(object[key]);
                         } else {
                             tmp[key] = object[key];
@@ -218,11 +276,11 @@
         },
         clone_array: function(array) {
             if (!$.isFunction(Array.prototype.map)) {
-                throw new Error("You'r browser don't support ES5 array map " +
-                                "use es5-shim");
+                throw new Error("Your browser don't support ES5 array map " +
+                                'use es5-shim');
             }
             return array.slice(0).map(function(item) {
-                if (typeof item == 'object') {
+                if (typeof item === 'object') {
                     return this.clone_object(item);
                 } else {
                     return item;
@@ -234,21 +292,28 @@
         return Clone.clone_object(object);
     };
 
-    var hasLS = function () {
-      var testKey = 'test', storage = window.localStorage;
-      try {
-        storage.setItem(testKey, '1');
-        storage.removeItem(testKey);
-        return true;
-      } catch (error) {
-        return false;
-      }
-    };
-
-    /* jshint ignore:start */
+    /* eslint-disable */
     // -----------------------------------------------------------------------
     // :: Storage plugin
     // -----------------------------------------------------------------------
+    var hasLS = function() {
+        try {
+            var testKey = 'test', storage = window.localStorage;
+            storage.setItem(testKey, '1');
+            storage.removeItem(testKey);
+            return true;
+        } catch (error) {
+            return false;
+        }
+    };
+    var hasCookies = function() {
+        try {
+            document.cookie.split(';');
+            return true;
+        } catch (e) {
+            return false;
+        }
+    };
     // Private data
     var isLS = hasLS();
     // Private functions
@@ -316,13 +381,28 @@
     * $.Storage.get("name")
     * $.Storage.remove("name")
     */
-    $.extend({
-        Storage: {
-            set: isLS ? wls : wc,
-            get: isLS ? rls : rc,
-            remove: isLS ? dls : dc
+    var localStorage;
+    if (!hasCookies() && !isLS) {
+        localStorage = {};
+        $.extend({
+            Storage: {
+                set: wls,
+                get: rls,
+                remove: dls
+            }
+        });
+    } else {
+        if (isLS) {
+            localStorage = window.localStorage;
         }
-    });
+        $.extend({
+            Storage: {
+                set: isLS ? wls : wc,
+                get: isLS ? rls : rc,
+                remove: isLS ? dls : dc
+            }
+        });
+    }
     // -----------------------------------------------------------------------
     // :: jQuery Timers
     // -----------------------------------------------------------------------
@@ -480,9 +560,8 @@
             }
         }
     });
-
     if (/(msie) ([\w.]+)/.exec(navigator.userAgent.toLowerCase())) {
-        jQuery(window).one('unload', function() {
+        $(window).one('unload', function() {
             var global = jQuery.timer.global;
             for (var label in global) {
                 if (global.hasOwnProperty(label)) {
@@ -509,7 +588,7 @@
         compliantExecNpcg = /()??/.exec("")[1] === undef, // NPCG: nonparticipating capturing group
         self;
 
-        self = function (str, separator, limit) {
+        self = function(str, separator, limit) {
             // If `separator` is not a regex, use `nativeSplit`
             if (Object.prototype.toString.call(separator) !== "[object RegExp]") {
                 return nativeSplit.call(str, separator, limit);
@@ -545,7 +624,7 @@
                         // Fix browsers whose `exec` methods don't consistently return `undefined` for
                         // nonparticipating capturing groups
                         if (!compliantExecNpcg && match.length > 1) {
-                            match[0].replace(separator2, function () {
+                            match[0].replace(separator2, function() {
                                 for (var i = 1; i < arguments.length - 2; i++) {
                                     if (arguments[i] === undef) {
                                         match[i] = undef;
@@ -577,7 +656,7 @@
         };
 
         // For convenience
-        String.prototype.split = function (separator, limit) {
+        String.prototype.split = function(separator, limit) {
             return self(this, separator, limit);
         };
 
@@ -591,7 +670,7 @@
         var target = this[0];
         var isContentEditable = target.contentEditable === 'true';
         //get
-        if (arguments.length == 0) {
+        if (arguments.length === 0) {
             //HTML5
             if (window.getSelection) {
                 //contenteditable
@@ -630,7 +709,7 @@
             return 0;
         }
         //set
-        if (pos == -1)
+        if (pos === -1)
             pos = this[isContentEditable? 'text' : 'val']().length;
         //HTML5
         if (window.getSelection) {
@@ -651,40 +730,201 @@
             range.collapse(true);
             range.select();
         }
-        if (!isContentEditable)
+        if (!isContentEditable && !this.is(':focus')) {
             target.focus();
+        }
         return pos;
     };
-    /* jshint ignore:end */
+    /* eslint-enable */
+    var requestAnimationFrame =
+        window.requestAnimationFrame ||
+        window.mozRequestAnimationFrame ||
+        window.webkitRequestAnimationFrame ||
+        function(fn) {
+            return setTimeout(fn, 20);
+        };
     // -----------------------------------------------------------------------
-    // :: Split string to array of strings with the same length
+    // :: Cross-browser resize element plugin
+    // :: Taken from ResizeSensor.js file from marcj/css-element-queries (MIT license)
+    // :: not all jQuerifided
     // -----------------------------------------------------------------------
-    function str_parts(str, length) {
-        var result = [];
-        var len = str.length;
-        if (len < length) {
-            return [str];
-        } else if (length < 0) {
-            throw new Error('str_parts: length can\'t be negative'); // '
+    $.fn.resizer = function(callback) {
+        var unbind = arguments[0] === "unbind";
+        if (!unbind && !$.isFunction(callback)) {
+            throw new Error(
+                'Invalid argument, it need to a function or string "unbind".'
+            );
         }
-        for (var i = 0; i < len; i += length) {
-            result.push(str.substring(i, i + length));
+        if (unbind) {
+            callback = $.isFunction(arguments[1]) ? arguments[1] : null;
+        }
+        return this.each(function() {
+            var $this = $(this);
+            var callbacks;
+            if (unbind) {
+                callbacks = $this.data('callbacks');
+                if (callback && callbacks) {
+                    callbacks.remove(callback);
+                    if (!callbacks.has()) {
+                        callbacks = null;
+                    }
+                } else {
+                    callbacks = null;
+                }
+                if (!callbacks) {
+                    $this.removeData('callbacks');
+                    if (window.ResizeObserver) {
+                        var observer = $this.data('observer');
+                        if (observer) {
+                            observer.unobserve(this);
+                            $this.removeData('observer');
+                        }
+                    } else {
+                        $this.find('.resizer').remove();
+                    }
+                }
+            } else if ($this.data('callbacks')) {
+                $(this).data('callbacks').add(callback);
+            } else {
+                callbacks = $.Callbacks();
+                callbacks.add(callback);
+                $this.data('callbacks', callbacks);
+                var resizer;
+                var first = true;
+                if (window.ResizeObserver) {
+                    resizer = new ResizeObserver(function() {
+                        if (!first) {
+                            var callbacks = $this.data('callbacks');
+                            callbacks.fire();
+                        }
+                        first = false;
+                    });
+                    resizer.observe(this);
+                    $this.data('observer', resizer);
+                    return;
+                }
+                var self = this;
+                resizer = $('<div/>').addClass('resizer').appendTo(this)[0];
+                var style =
+                    'position: absolute; left: 0; top: 0; right: 0; bottom: 0; ' +
+                    'overflow: hidden; z-index: -1; visibility: hidden;';
+                var styleChild = 'position: absolute; left: 0; top: 0; transition: 0s;';
+                resizer.style.cssText = style;
+                resizer.innerHTML =
+                    '<div class="resize-sensor-expand" style="' + style + '">' +
+                    '<div style="' + styleChild + '"></div>' + "</div>" +
+                    '<div class="resize-sensor-shrink" style="' + style + '">' +
+                    '<div style="' + styleChild + ' width: 200%; height: 200%"></div>' +
+                    "</div>";
+
+                var expand = resizer.childNodes[0];
+                var expandChild = expand.childNodes[0];
+                var shrink = resizer.childNodes[1];
+                var dirty, rafId, newWidth, newHeight;
+                var lastWidth = self.offsetWidth;
+                var lastHeight = self.offsetHeight;
+
+                var reset = function() {
+                    expandChild.style.width = '100000px';
+                    expandChild.style.height = '100000px';
+
+                    expand.scrollLeft = 100000;
+                    expand.scrollTop = 100000;
+
+                    shrink.scrollLeft = 100000;
+                    shrink.scrollTop = 100000;
+                };
+
+                reset();
+
+                var onResized = function() {
+                    rafId = 0;
+
+                    if (!dirty) {
+                        return;
+                    }
+
+                    lastWidth = newWidth;
+                    lastHeight = newHeight;
+                    callbacks.fire();
+                };
+
+                var onScroll = function() {
+                    newWidth = self.offsetWidth;
+                    newHeight = self.offsetHeight;
+                    dirty = newWidth !== lastWidth || newHeight !== lastHeight;
+
+                    if (dirty && !rafId) {
+                        rafId = requestAnimationFrame(onResized);
+                    }
+
+                    reset();
+                };
+                $(expand).on("scroll", onScroll);
+                $(shrink).on("scroll", onScroll);
+            }
+        });
+    };
+    // -----------------------------------------------------------------------
+    // :: hide elements from screen readers
+    // -----------------------------------------------------------------------
+    function a11y_hide(element) {
+        element.attr({
+            role: 'presentation',
+            'aria-hidden': 'true'
+        });
+    }
+    // ---------------------------------------------------------------------
+    // :: alert only first exception of type
+    // ---------------------------------------------------------------------
+    var excepctions = [];
+    function alert_exception(label, e) {
+        var message = (label ? label + ': ' : '') + exception_message(e);
+        if (excepctions.indexOf(message) === -1) {
+            excepctions.push(message);
+            alert(message + (e.stack ? '\n' + e.stack : ''));
+        }
+    }
+    // ---------------------------------------------------------------------
+    // :; detect if mouse event happen on scrollbar
+    // ---------------------------------------------------------------------
+    function scrollbar_event(e, node) {
+        var left = node.offset().left;
+        return node.outerWidth() <= e.clientX - left;
+    }
+    // ---------------------------------------------------------------------
+    // :: Return exception message as string
+    // ---------------------------------------------------------------------
+    function exception_message(e) {
+        if (typeof e === 'string') {
+            return e;
+        } else if (typeof e.fileName === 'string') {
+            return e.fileName + ': ' + e.message;
+        } else {
+            return e.message;
         }
-        return result;
     }
     // -----------------------------------------------------------------------
     // :: CYCLE DATA STRUCTURE
     // -----------------------------------------------------------------------
-    function Cycle(init) {
-        var data = init ? [init] : [];
+    function Cycle() {
+        var data = [].slice.call(arguments);
         var pos = 0;
         $.extend(this, {
             get: function() {
                 return data;
             },
-            rotate: function() {
-                if (!data.filter(Boolean).length) {
-                    return;
+            index: function() {
+                return pos;
+            },
+            rotate: function(skip) {
+                if (!skip) {
+                    var defined = data.filter(function(item) {
+                        return typeof item !== 'undefined';
+                    });
+                    if (!defined.length) {
+                        return;
+                    }
                 }
                 if (data.length === 1) {
                     return data[0];
@@ -694,10 +934,10 @@
                     } else {
                         ++pos;
                     }
-                    if (data[pos]) {
+                    if (typeof data[pos] !== 'undefined') {
                         return data[pos];
                     } else {
-                        return this.rotate();
+                        return this.rotate(true);
                     }
                 }
             },
@@ -715,6 +955,7 @@
                     }
                 }
                 this.append(item);
+                pos = data.length - 1;
             },
             front: function() {
                 if (data.length) {
@@ -733,6 +974,12 @@
                     return data[index];
                 }
             },
+            map: function(fn) {
+                return data.filter(Boolean).map(fn);
+            },
+            forEach: function(fn) {
+                data.filter(Boolean).forEach(fn);
+            },
             append: function(item) {
                 data.push(item);
             }
@@ -789,35 +1036,43 @@
             data = [];
         } else {
             data = $.Storage.get(storage_key);
-            data = data ? $.parseJSON(data) : [];
+            data = data ? JSON.parse(data) : [];
         }
-        var pos = data.length-1;
+        var pos = data.length - 1;
         $.extend(this, {
             append: function(item) {
                 if (enabled) {
-                    if (data[data.length-1] !== item) {
+                    if (data[data.length - 1] !== item) {
                         data.push(item);
                         if (size && data.length > size) {
                             data = data.slice(-size);
                         }
-                        pos = data.length-1;
+                        pos = data.length - 1;
                         if (!memory) {
                             $.Storage.set(storage_key, JSON.stringify(data));
                         }
                     }
                 }
             },
+            set: function(new_data) {
+                if (new_data instanceof Array) {
+                    data = new_data;
+                    if (!memory) {
+                        $.Storage.set(storage_key, JSON.stringify(data));
+                    }
+                }
+            },
             data: function() {
                 return data;
             },
             reset: function() {
-                pos = data.length-1;
+                pos = data.length - 1;
             },
             last: function() {
-                return data[data.length-1];
+                return data[data.length - 1];
             },
             end: function() {
-                return pos === data.length-1;
+                return pos === data.length - 1;
             },
             position: function() {
                 return pos;
@@ -826,10 +1081,11 @@
                 return data[pos];
             },
             next: function() {
-                if (pos < data.length-1) {
+                var old = pos;
+                if (pos < data.length - 1) {
                     ++pos;
                 }
-                if (pos !== -1) {
+                if (old !== pos) {
                     return data[pos];
                 }
             },
@@ -838,7 +1094,7 @@
                 if (pos > 0) {
                     --pos;
                 }
-                if (old !== -1) {
+                if (old !== pos) {
                     return data[pos];
                 }
             },
@@ -862,35 +1118,35 @@
             }
         });
     }
-    // -----------------------------------------------------------------------
-    var is_paste_supported = (function() {
-        var el = document.createElement('div');
-        el.setAttribute('onpaste', 'return;');
-        return typeof el.onpaste == "function";
-    })();
-    var first_cmd = true;
     // -------------------------------------------------------------------------
     // :: COMMAND LINE PLUGIN
     // -------------------------------------------------------------------------
+    var cmd_index = 0;
     $.fn.cmd = function(options) {
         var self = this;
         var maybe_data = self.data('cmd');
         if (maybe_data) {
             return maybe_data;
         }
+        var id = cmd_index++;
         self.addClass('cmd');
-        self.append('<span class="prompt"></span><span></span>' +
-                    '<span class="cursor">&nbsp;</span><span></span>');
+        self.append('<span class="prompt"></span>');
+        self.append('<div class="cursor-line">' +
+                    '<span></span>' +
+                    '<span class="cursor">&nbsp;</span>' +
+                    '<span></span>' +
+                    '</div>');
+        // a11y: don't read command it's in textarea that's in focus
+        a11y_hide(self.find('.cursor-line'));
         // on mobile the only way to hide textarea on desktop it's needed because
         // textarea show up after focus
         //self.append('<span class="mask"></mask>');
         var clip = $('<textarea>').attr({
             autocapitalize: 'off',
-            spellcheck: 'false'
-        }).addClass('clipboard').appendTo(self);
-        // we don't need this but leave it as a comment just in case
-        //var contentEditable = $('<div contentEditable></div>')
-        //$(document.body).append(contentEditable);
+            spellcheck: 'false',
+            tabindex: 1
+        }).addClass('clipboard').appendTo(self).val(' ');
+
         if (options.width) {
             self.width(options.width);
         }
@@ -905,49 +1161,356 @@
         var command = '';
         var last_command;
         // text from selection using CTRL+SHIFT+C (as in Xterm)
-        var selected_text = '';
         var kill_text = ''; // text from command that kill part of the command
         var position = 0;
         var prompt;
         var enabled;
+        var formatted_position = 0;
         var historySize = options.historySize || 60;
         var name, history;
         var cursor = self.find('.cursor');
         var animation;
+        var restart_animation;
         var paste_count = 0;
+        function get_char_pos(e) {
+            var node = $(e.target);
+            if (node.is('span')) {
+                return node.index() + node.parents('span').prevAll().text_length() +
+                    node.closest('[role="presentation"]')
+                    .prevUntil('.prompt').text_length();
+            } else if (node.is('div[role="presentation"]')) {
+                var index = node.index();
+                var lines = command.split(/\n/).slice(0, index);
+                return lines.reduce(function(pos, line) {
+                    return pos + length(line);
+                }, 0) + (lines.length - 1);
+            }
+        }
+        // IE mapping
+        var key_mapping = {
+            'SPACEBAR': ' ',
+            'UP': 'ARROWUP',
+            'DOWN': 'ARROWDOWN',
+            'LEFT': 'ARROWLEFT',
+            'RIGHT': 'ARROWRIGHT',
+            'DEL': 'DELETE',
+            'MULTIPLY': '*',
+            'DIVIDE': '/',
+            'SUBTRACT': '-',
+            'ADD': '+'
+        };
+        function get_key(e) {
+            if (e.key) {
+                var key = e.key.toUpperCase();
+                if (key_mapping[key]) {
+                    key = key_mapping[key];
+                }
+                if (key === 'CONTROL') {
+                    return 'CTRL';
+                } else {
+                    var combo = [];
+                    if (e.ctrlKey) {
+                        combo.push('CTRL');
+                    }
+                    if (e.metaKey && key !== 'META') {
+                        combo.push('META');
+                    }
+                    if (e.shiftKey && key !== 'SHIFT') {
+                        combo.push('SHIFT');
+                    }
+                    if (e.altKey && key !== 'ALT') {
+                        combo.push('ALT');
+                    }
+                    if (combo.length && key === ' ') {
+                        key = 'SPACEBAR';
+                    }
+                    if (e.key) {
+                        combo.push(key);
+                    }
+                    return combo.join('+');
+                }
+            }
+        }
+        var keymap;
+        var default_keymap = {
+            'ALT+D': function() {
+                self.set(command.slice(0, position) +
+                         command.slice(position).
+                         replace(/ *[^ ]+ *(?= )|[^ ]+$/, ''), true);
+                // chrome jump to address bar
+                return false;
+            },
+            'ENTER': function() {
+                if (history && command && !mask &&
+                    ($.isFunction(options.historyFilter) &&
+                     options.historyFilter(command)) ||
+                    (options.historyFilter instanceof RegExp &&
+                     command.match(options.historyFilter)) ||
+                    !options.historyFilter) {
+                    history.append(command);
+                }
+                var tmp = command;
+                history.reset();
+
+                // for next input event on firefox/android with google keyboard
+                prev_command = '';
+                no_keydown = true;
+
+                self.set('');
+                if (options.commands) {
+                    options.commands(tmp);
+                }
+                if ($.isFunction(prompt)) {
+                    draw_prompt();
+                }
+                clip.val('');
+                return false;
+            },
+            'SHIFT+ENTER': function() {
+                self.insert('\n');
+                return true;
+            },
+            'BACKSPACE': function() {
+                if (reverse_search) {
+                    rev_search_str = rev_search_str.slice(0, -1);
+                    draw_reverse_prompt();
+                } else if (command !== '' && position > 0) {
+                    self['delete'](-1);
+                }
+                // for next input after naitve backspace
+                // we need timeout because we don't want it to trigger
+                // for current input but next one
+                self.oneTime(1, function() {
+                    no_keydown = true;
+                });
+            },
+            'TAB': function() {
+                self.insert('\t');
+            },
+            'CTRL+D': function() {
+                self['delete'](1);
+                return false;
+            },
+            'DELETE': function() {
+                self['delete'](1);
+                return true;
+            },
+            'ARROWUP': prev_history,
+            'CTRL+P': prev_history,
+            'ARROWDOWN': next_history,
+            'CTRL+N': next_history,
+            'ARROWLEFT': left,
+            'CTRL+B': left,
+            'CTRL+ARROWLEFT': function() {
+                // jump to one character after last space before prevoius word
+                var len = position - 1;
+                var pos = 0;
+                if (command[len] === ' ') {
+                    --len;
+                }
+                for (var i = len; i > 0; --i) {
+                    if (command[i] === ' ' && command[i + 1] !== ' ') {
+                        pos = i + 1;
+                        break;
+                    } else if (command[i] === '\n' &&
+                               command[i + 1] !== '\n') {
+                        pos = i;
+                        break;
+                    }
+                }
+                self.position(pos);
+            },
+            'CTRL+R': function() {
+                if (reverse_search) {
+                    reverse_history_search(true);
+                } else {
+                    backup_prompt = prompt;
+                    draw_reverse_prompt();
+                    last_command = command;
+                    self.set('');
+                    redraw();
+                    reverse_search = true;
+                }
+                return false;
+            },
+            'CTRL+G': function() {
+                if (reverse_search) {
+                    prompt = backup_prompt;
+                    draw_prompt();
+                    self.set(last_command);
+                    redraw();
+                    reverse_search = false;
+                    rev_search_str = '';
+                    return false;
+                }
+            },
+            'ARROWRIGHT': right,
+            'CTRL+F': right,
+            'CTRL+ARROWRIGHT': function() {
+                // jump to beginning or end of the word
+                if (command[position] === ' ') {
+                    ++position;
+                }
+                var re = /\S[\n\s]{2,}|[\n\s]+\S?/;
+                var match = command.slice(position).match(re);
+                if (!match || match[0].match(/^\s+$/)) {
+                    self.position(command.length);
+                } else if (match[0][0] !== ' ') {
+                    position += match.index + 1;
+                } else {
+                    position += match.index + match[0].length - 1;
+                    if (match[0][match[0].length - 1] !== ' ') {
+                        --position;
+                    }
+                }
+                redraw();
+            },
+            'F12': return_true, // Allow Firebug
+            'END': end,
+            'CTRL+E': end,
+            'HOME': home,
+            'CTRL+A': home,
+            'SHIFT+INSERT': paste_event,
+            'CTRL+SHIFT+T': return_true, // open closed tab
+            'CTRL+W': function() {
+                // don't work in Chromium (can't prevent close tab)
+                if (command !== '' && position !== 0) {
+                    var m = command.slice(0, position).match(/([^ ]+ *$)/);
+                    if (m[0].length) {
+                        kill_text = self['delete'](-m[0].length);
+                        text_to_clipboard(self, kill_text);
+                    }
+                }
+                return false;
+            },
+            'CTRL+H': function() {
+                if (command !== '' && position > 0) {
+                    self['delete'](-1);
+                }
+                return false;
+            },
+            'CTRL+X': return_true,
+            'CTRL+C': return_true,
+            'CTRL+T': return_true,
+            'CTRL+Y': function() {
+                if (kill_text !== '') {
+                    self.insert(kill_text);
+                }
+            },
+            'CTRL+V': paste_event,
+            'META+V': paste_event,
+            'CTRL+K': function() {
+                if (command.length - position) {
+                    kill_text = self['delete'](command.length - position);
+                    text_to_clipboard(self, kill_text);
+                }
+                return false;
+            },
+            'CTRL+U': function() {
+                if (command !== '' && position !== 0) {
+                    kill_text = self['delete'](-position);
+                    text_to_clipboard(self, kill_text);
+                }
+                return false;
+            },
+            'CTRL+TAB': function() {
+                return false;
+            },
+            'META+`': return_true, // CMD+` switch browser window on Mac
+            'META+R': return_true, // CMD+R page reload in Chrome Mac
+            'META+L': return_true  // CLD+L jump into Ominbox on Chrome Mac
+        };
+        function return_true() {
+            return true;
+        }
+        function paste_event() {
+            clip.val('');
+            paste_count = 0;
+            if (self.isenabled() && !clip.is(':focus')) {
+                clip.trigger('focus', [true]);
+            }
+            clip.one('input', paste);
+            return true;
+        }
+        function prev_history() {
+            if (first_up_history) {
+                last_command = command;
+                self.set(history.current());
+            } else {
+                self.set(history.previous());
+            }
+            first_up_history = false;
+            return false;
+        }
+        function next_history() {
+            self.set(history.end() ? last_command : history.next());
+            return false;
+        }
+        function left() {
+            if (position > 0) {
+                self.position(-1, true);
+                redraw();
+            }
+        }
+        function right() {
+            if (position < command.length) {
+                self.position(1, true);
+            }
+            return false;
+        }
+        function home() {
+            self.position(0);
+        }
+        function end() {
+            self.position(command.length);
+        }
         function mobile_focus() {
             //if (is_touch) {
             var focus = clip.is(':focus');
             if (enabled) {
                 if (!focus) {
-                    clip.focus();
-                    self.oneTime(10, function() {
-                        clip.focus();
-                    });
-                }
-            } else {
-                if (focus) {
-                    clip.blur();
+                    //clip.trigger('focus', [true]);
                 }
+                self.oneTime(10, function() {
+                    if (!clip.is(':focus') && enabled) {
+                        clip.trigger('focus', [true]);
+                    }
+                });
+            } else if (focus && (is_mobile || !enabled)) {
+                clip.trigger('blur', [true]);
             }
         }
         // on mobile you can't delete character if input is empty (event
         // will not fire) so we fake text entry, we could just put dummy
         // data but we put real command and position
-        function fix_textarea() {
+        function fix_textarea(position_only) {
+            if (!self.isenabled()) {
+                return;
+            }
             // delay worked while experimenting
-            self.oneTime(10, function () {
-                clip.val(command);
+            self.oneTime(10, function() {
+                // we use space before command to show select all context menu
+                // idea taken from CodeMirror
+                if (clip.val() !== command && !position_only) {
+                    clip.val(' ' + command);
+                }
                 if (enabled) {
-                    self.oneTime(10, function () {
-                        clip.caret(position);
+                    self.oneTime(10, function() {
+                        try {
+                            // we check first to improve performance
+                            if (clip.caret() !== position + 1) {
+                                clip.caret(position + 1);
+                            }
+                        } catch (e) {
+                            // firefox throw NS_ERROR_FAILURE ignore
+                        }
                     });
                 }
             });
         }
-        // terminal animation don't work on andorid because they animate
+        // terminal animation don't work on android because they animate
         // 2 properties
-        if ((support_animations && !is_android)) {
+        if (support_animations && !is_android) {
             animation = function(toggle) {
                 if (toggle) {
                     cursor.addClass('blink');
@@ -955,6 +1518,12 @@
                     cursor.removeClass('blink');
                 }
             };
+            restart_animation = function() {
+                var new_cursor = cursor.clone();
+                new_cursor.insertBefore(cursor);
+                cursor.remove();
+                cursor = new_cursor;
+            };
         } else {
             var animating = false;
             animation = function(toggle) {
@@ -968,18 +1537,22 @@
                     cursor.removeClass('inverted blink');
                 }
             };
+            restart_animation = function() {
+                animation(false);
+                animation(true);
+            };
         }
         // ---------------------------------------------------------------------
         // :: Blinking cursor function
         // ---------------------------------------------------------------------
-        function blink(i) {
+        function blink() {
             cursor.toggleClass('inverted');
         }
         // ---------------------------------------------------------------------
         // :: Set prompt for reverse search
         // ---------------------------------------------------------------------
         function draw_reverse_prompt() {
-            prompt = "(reverse-i-search)`" + rev_search_str + "': ";
+            prompt = '(reverse-i-search)`' + rev_search_str + "': ";
             draw_prompt();
         }
         // ---------------------------------------------------------------------
@@ -1004,10 +1577,10 @@
                 len -= reverse_search_position;
             }
             if (rev_search_str.length > 0) {
-                for (var j=rev_search_str.length; j>0; j--) {
+                for (var j = rev_search_str.length; j > 0; j--) {
                     save_string = $.terminal.escape_regex(rev_search_str.substring(0, j));
                     regex = new RegExp(save_string);
-                    for (var i=len; i--;) {
+                    for (var i = len; i--;) {
                         if (regex.test(history_data[i])) {
                             reverse_search_position = history_data.length - i;
                             self.position(history_data[i].indexOf(save_string));
@@ -1028,66 +1601,244 @@
         // :: Recalculate number of characters in command line
         // ---------------------------------------------------------------------
         function change_num_chars() {
+            var $prompt = self.find('.prompt').text('&nbsp;');
             var W = self.width();
-            var w = cursor[0].getBoundingClientRect().width;
+            var w = $prompt[0].getBoundingClientRect().width;
             num_chars = Math.floor(W / w);
+            draw_prompt();
         }
         // ---------------------------------------------------------------------
         // :: Split String that fit into command line where first line need to
         // :: fit next to prompt (need to have less characters)
         // ---------------------------------------------------------------------
-        function get_splited_command_line(string) {
-            var first = string.substring(0, num_chars - prompt_len);
-            var rest = string.substring(num_chars - prompt_len);
-            return [first].concat(str_parts(rest, num_chars));
+        function get_splitted_command_line(string) {
+            function split(string) {
+                return $.terminal.split_equal(string, num_chars);
+            }
+            function skip_empty(array) {
+                // we remove lines that are left overs after adding space at the end
+                return array.filter(function(line) {
+                    return !$.terminal.strip(line).match(/^ $/);
+                });
+            }
+            var prompt = prompt_node.text();
+            var re = new RegExp('^' + $.terminal.escape_regex(prompt));
+            var array;
+            if (string.match(/\n/)) {
+                var tmp = string.split('\n');
+                var first_len = num_chars - prompt_len - 1;
+                for (var i = 0; i < tmp.length - 1; ++i) {
+                    tmp[i] += ' ';
+                }
+                // split first line
+                if (strlen(tmp[0]) > first_len) {
+                    array = split(prompt + tmp[0]);
+                    array[0] = array[0].replace(re, '');
+                    array = skip_empty(array);
+                } else {
+                    array = [tmp[0]];
+                }
+                // process rest of the lines
+                for (i = 1; i < tmp.length; ++i) {
+                    if (strlen(tmp[i]) > num_chars) {
+                        var splitted = split(tmp[i]);
+                        if (i < tmp.length - 1) {
+                            splitted = skip_empty(splitted);
+                        }
+                        array = array.concat(splitted);
+                    } else {
+                        array.push(tmp[i]);
+                    }
+                }
+            } else {
+                array = split(prompt + string, num_chars);
+                array[0] = array[0].replace(re, '');
+            }
+            return array;
+        }
+        window.get_splitted_command_line = get_splitted_command_line;
+        // ---------------------------------------------------------------------
+        // :: use custom formatting
+        // ---------------------------------------------------------------------
+        function formatting(string) {
+            // we don't want to format command when user type formatting in
+            string = $.terminal.escape_formatting(string);
+            try {
+                return $.terminal.apply_formatters(string);
+            } catch (e) {
+                alert_exception('[Formatting]', e);
+            }
+        }
+        // ---------------------------------------------------------------------
+        // :: format end encode the string
+        // ---------------------------------------------------------------------
+        function format(string) {
+            return $.terminal.format($.terminal.encode(wrap(string)));
+        }
+        // ---------------------------------------------------------------------
+        // :: function create new string with all characters in it's own
+        // :: formatting - it will only have style if the input is formatting
+        // :: this function is not very usefull so it's not in $.terminal
+        // ---------------------------------------------------------------------
+        function wrap(string) {
+            function formatting(string) {
+                if ($.terminal.is_formatting(string)) {
+                    if (string.match(/\]\\\]/)) {
+                        string = string.replace(/\]\\\]/g, ']\\\\]');
+                    }
+                } else {
+                    if (string.match(/\\$/)) {
+                        string += '\\';
+                    }
+                    string = '[[;;]' + string + ']';
+                }
+                return string;
+            }
+            var len = length(string);
+            if (len === 1) {
+                return formatting(string);
+            }
+            var result = [];
+            // len - 1 break the command line $.terminal.substring will return
+            // empty string for out of bound indexes
+            for (var i = 0; i < len; ++i) {
+                var text = $.terminal.substring(string, i, i + 1);
+                result.push(formatting(text));
+            }
+            return result.join('');
+        }
+        // ---------------------------------------------------------------------
+        // :: shortcut helper
+        // ---------------------------------------------------------------------
+        function length(str) {
+            return $.terminal.length(str);
+        }
+        function substring(str, start, end) {
+            return $.terminal.substring(str, start, end);
+        }
+        // ---------------------------------------------------------------------
+        // :: functions used to calculate position of cursor when formatting
+        // :: change length of output text like with emoji demo
+        // ---------------------------------------------------------------------
+        // :: main function that return corrected cursor position on display
+        // :: if cursor is in the middle of the word that is shorter the before
+        // :: applying formatting then the corrected position is after the word
+        // :: so it stay in place when you move real cursor in the middle
+        // :: of the word
+        // ---------------------------------------------------------------------
+        function get_formatted_position(position) {
+            // only regex formatters can change length of output string
+            var formatters = $.terminal.defaults.formatters.filter(function(formatter) {
+                return formatter instanceof Array;
+            });
+            if (position === 0) {
+                return position;
+            }
+            if (formatters.length) {
+                return formatters.reduce(function(result, frmt) {
+                    var command = result[0];
+                    var position = result[1];
+                    return tracking_replace(command, frmt[0], frmt[1], position);
+                }, [command, position])[1];
+            }
+            return position;
+        }
+        // ---------------------------------------------------------------------
+        // :: source https://stackoverflow.com/a/46756077/387194
+        // ---------------------------------------------------------------------
+        function tracking_replace(string, rex, replacement, position) {
+            var new_string = "";
+            var match;
+            var index = 0;
+            var rep_string;
+            var new_position = position;
+            var start;
+            rex.lastIndex = 0; // Just to be sure
+            while (match = rex.exec(string)) {
+                // Add any of the original string we just skipped
+                var last_index = length(substring(string, 0, rex.lastIndex));
+                start = last_index - length(match[0]);
+                if (index < start) {
+                    new_string += substring(string, index, start);
+                }
+                index = last_index;
+                // Build the replacement string. This just handles $$ and $n,
+                // you may want to add handling for $`, $', and $&.
+                rep_string = replacement.replace(/\$(\$|\d)/g, function(m, c0) {
+                    if (c0 === "$") {
+                        return "$";
+                    }
+                    return match[c0];
+                });
+                // Add on the replacement
+                new_string += rep_string;
+                // If the position is affected...
+                if (start < position) {
+                    // ... update it:
+                    if (last_index < position) {
+                        // It's after the replacement, move it
+                        new_position = Math.max(0,
+                                                new_position +
+                                                length(rep_string) -
+                                                length(match[0]));
+                    } else {
+                        // It's *in* the replacement, put it just after
+                        new_position += length(rep_string) - (position - start);
+                    }
+                }
+            }
+            // Add on any trailing text in the string
+            if (index < length(string)) {
+                new_string += substring(string, index);
+            }
+            // Return the string and the updated position
+            return [new_string, new_position];
         }
         // ---------------------------------------------------------------------
         // :: Function that displays the command line. Split long lines and
         // :: place cursor in the right place
         // ---------------------------------------------------------------------
-        var redraw = (function(self) {
+        var redraw = (function() {
             var before = cursor.prev();
             var after = cursor.next();
+            var cursor_line = cursor.parent();
             // -----------------------------------------------------------------
             // :: Draw line with the cursor
             // -----------------------------------------------------------------
             function draw_cursor_line(string, position) {
-                var len = string.length;
+                var len = length(string);
                 if (position === len) {
-                    before.html($.terminal.encode(string));
+                    before.html(format(string));
                     cursor.html('&nbsp;');
                     after.html('');
                 } else if (position === 0) {
                     before.html('');
-                    //fix for tilda in IE
-                    cursor.html($.terminal.encode(string.slice(0, 1)));
-                    //cursor.html($.terminal.encode(string[0]));
-                    after.html($.terminal.encode(string.slice(1)));
+                    cursor.html(format(substring(string, 0, 1)));
+                    after.html(format(substring(string, 1)));
                 } else {
-                    var before_str = string.slice(0, position);
-                    before.html($.terminal.encode(before_str));
-                    //fix for tilda in IE
-                    var c = string.slice(position, position + 1);
-                    //cursor.html(string[position]);
-                    cursor.html($.terminal.encode(c));
-                    if (position === string.length - 1) {
+                    var before_str = $.terminal.substring(string, 0, position);
+                    before.html(format(before_str));
+                    var c = substring(string, position, position + 1);
+                    cursor.html(format(c));
+                    if (position === len - 1) {
                         after.html('');
                     } else {
-                        after.html($.terminal.encode(string.slice(position + 1)));
+                        after.html(format(substring(string, position + 1)));
                     }
                 }
             }
             function div(string) {
-                return '<div>' + $.terminal.encode(string) + '</div>';
+                return '<div role="presentation" aria-hidden="true">' +
+                    format(string) +
+                    '</div>';
             }
             // -----------------------------------------------------------------
             // :: Display lines after the cursor
             // -----------------------------------------------------------------
             function lines_after(lines) {
-                var last_ins = after;
+                var last_ins = cursor_line;
                 $.each(lines, function(i, line) {
-                    last_ins = $(div(line)).insertAfter(last_ins).
-                        addClass('clear');
+                    last_ins = $(div(line)).insertAfter(last_ins);
                 });
             }
             // -----------------------------------------------------------------
@@ -1095,17 +1846,15 @@
             // -----------------------------------------------------------------
             function lines_before(lines) {
                 $.each(lines, function(i, line) {
-                    before.before(div(line));
+                    cursor_line.before(div(line));
                 });
             }
-            var count = 0;
             // -----------------------------------------------------------------
             // :: Redraw function
             // -----------------------------------------------------------------
             return function() {
                 var string;
-                var str; // max 80 line helper
-                switch(typeof mask) {
+                switch (typeof mask) {
                     case 'boolean':
                         string = mask ? command.replace(/./g, '*') : command;
                         break;
@@ -1113,141 +1862,119 @@
                         string = command.replace(/./g, mask);
                         break;
                 }
-                var i, first_len;
-                self.find('div').remove();
+                var pos = formatted_position;
+                string = formatting(safe(string.replace(/&/g, '&amp;')));
+                var i;
+                self.find('div:not(.cursor-line,.clipboard-wrapper)').remove();
                 before.html('');
                 // long line
-                if (string.length > num_chars - prompt_len - 1 ||
+                if (strlen(text(string)) > num_chars - prompt_len - 1 ||
                     string.match(/\n/)) {
-                    var array;
                     var tabs = string.match(/\t/g);
                     var tabs_rm = tabs ? tabs.length * 3 : 0;
                     //quick tabulation hack
                     if (tabs) {
                         string = string.replace(/\t/g, '\x00\x00\x00\x00');
                     }
-                    // command contains new line characters
-                    if (string.match(/\n/)) {
-                        var tmp = string.split("\n");
-                        first_len = num_chars - prompt_len - 1;
-                        // empty character after each line
-                        for (i=0; i<tmp.length-1; ++i) {
-                            tmp[i] += ' ';
-                        }
-                        // split first line
-                        if (tmp[0].length > first_len) {
-                            array = [tmp[0].substring(0, first_len)];
-                            str = tmp[0].substring(first_len);
-                            array = array.concat(str_parts(str, num_chars));
-                        } else {
-                            array = [tmp[0]];
-                        }
-                        // process rest of the lines
-                        for (i=1; i<tmp.length; ++i) {
-                            if (tmp[i].length > num_chars) {
-                                array = array.concat(str_parts(tmp[i],
-                                                               num_chars));
-                            } else {
-                                array.push(tmp[i]);
-                            }
-                        }
-                    } else {
-                        array = get_splited_command_line(string);
-                    }
+                    var array = get_splitted_command_line(string);
                     if (tabs) {
                         array = $.map(array, function(line) {
                             return line.replace(/\x00\x00\x00\x00/g, '\t');
                         });
                     }
-                    first_len = array[0].length;
+                    var first_len = length(array[0]);
                     //cursor in first line
                     if (first_len === 0 && array.length === 1) {
                         // skip empty line
-                    } else if (position < first_len) {
-                        draw_cursor_line(array[0], position);
+                    } else if (pos < first_len) {
+                        draw_cursor_line(array[0], pos);
+                        lines_after(array.slice(1));
+                    } else if (pos === first_len) {
+                        cursor_line.before(div(array[0]));
+                        draw_cursor_line(array[1] || '', 0);
+                        if (array.length > 1) {
+                            lines_after(array.slice(2));
+                        }
+                    } else if (pos < first_len) {
+                        draw_cursor_line(array[0], pos);
                         lines_after(array.slice(1));
-                    } else if (position === first_len) {
-                        before.before(div(array[0]));
+                    } else if (pos === first_len) {
+                        cursor_line.before(div(array[0]));
                         draw_cursor_line(array[1], 0);
                         lines_after(array.slice(2));
                     } else {
-                        var num_lines = array.length;
-                        var offset = 0;
-                        if (position < first_len) {
-                            draw_cursor_line(array[0], position);
-                            lines_after(array.slice(1));
-                        } else if (position === first_len) {
-                            before.before(div(array[0]));
-                            draw_cursor_line(array[1], 0);
-                            lines_after(array.slice(2));
+                        var last = array.slice(-1)[0];
+                        var len = length(string);
+                        var from_last = len - pos - tabs_rm;
+                        var last_len = length(last);
+                        var new_pos = 0;
+                        if (from_last === -1) {
+                            from_last = 0;
+                        }
+                        if (from_last <= last_len) { // in last line
+                            lines_before(array.slice(0, -1));
+                            if (last_len === from_last) {
+                                new_pos = 0;
+                            } else {
+                                new_pos = last_len - from_last;
+                            }
+                            draw_cursor_line(last, new_pos);
                         } else {
-                            var last = array.slice(-1)[0];
-                            var from_last = string.length - position - tabs_rm;
-                            var last_len = last.length;
-                            var pos = 0;
-                            if (from_last <= last_len) {
-                                lines_before(array.slice(0, -1));
-                                if (last_len === from_last) {
-                                    pos = 0;
+                            // more lines, cursor in the middle
+                            var line_index;
+                            var current;
+                            new_pos = pos;
+                            for (i = 0; i < array.length; ++i) {
+                                var current_len = $.terminal.length(array[i]);
+                                if (new_pos > current_len) {
+                                    new_pos -= current_len;
                                 } else {
-                                    pos = last_len-from_last;
+                                    break;
                                 }
-                                draw_cursor_line(last, pos);
-                            } else {
-                                // in the middle
-                                if (num_lines === 3) {
-                                    str = $.terminal.encode(array[0]);
-                                    before.before('<div>' + str + '</div>');
-                                    draw_cursor_line(array[1],
-                                                     position-first_len-1);
-                                    str = $.terminal.encode(array[2]);
-                                    after.after('<div class="clear">' + str +
-                                                '</div>');
-                                } else {
-                                    // more lines, cursor in the middle
-                                    var line_index;
-                                    var current;
-                                    pos = position;
-                                    for (i=0; i<array.length; ++i) {
-                                        var current_len = array[i].length;
-                                        if (pos > current_len) {
-                                            pos -= current_len;
-                                        } else {
-                                            break;
-                                        }
-                                    }
-                                    current = array[i];
-                                    line_index = i;
-                                    // cursor on first character in line
-                                    if (pos === current.length) {
-                                        pos = 0;
-                                        current = array[++line_index];
-                                    }
-                                    draw_cursor_line(current, pos);
-                                    lines_before(array.slice(0, line_index));
-                                    lines_after(array.slice(line_index+1));
+                            }
+                            current = array[i];
+                            line_index = i;
+                            // cursor on first character in line
+                            if (new_pos === length(current)) {
+                                new_pos = 0;
+                                current = array[++line_index];
+                                if (current === undefined) {
+                                    //should never happen
+                                    var msg = $.terminal.defaults.strings.redrawError;
+                                    throw new Error(msg);
                                 }
                             }
+                            draw_cursor_line(current, new_pos);
+                            lines_before(array.slice(0, line_index));
+                            lines_after(array.slice(line_index + 1));
                         }
                     }
+                } else if (string === '') {
+                    before.html('');
+                    cursor.html('&nbsp;');
+                    after.html('');
                 } else {
-                     if (string === '') {
-                         before.html('');
-                         cursor.html('&nbsp;');
-                         after.html('');
-                     } else {
-                         draw_cursor_line(string, position);
-                     }
+                    draw_cursor_line(string, pos);
                 }
             };
-        })(self);
+        })();
         // ---------------------------------------------------------------------
         // :: Draw prompt that can be a function or a string
         // ---------------------------------------------------------------------
         var draw_prompt = (function() {
             function set(prompt) {
-                prompt_node.html($.terminal.format($.terminal.encode(prompt)));
-                prompt_len = prompt_node.text().length;
+                var lines = $.terminal.split_equal(
+                    $.terminal.encode(prompt),
+                    num_chars
+                );
+                var last_line = $.terminal.format(lines[lines.length - 1]);
+                var formatted = lines.slice(0, -1).map(function(line) {
+                    return '<span class="line">' + $.terminal.format(line) + '</span>';
+                }).concat([last_line]).join('\n');
+                if (prompt_node.html() !== formatted) {
+                    prompt_node.html(formatted);
+                    prompt_len = strlen($('<span>' + last_line + '</span>').text());
+                }
             }
             return function() {
                 switch (typeof prompt) {
@@ -1263,309 +1990,27 @@
         // ---------------------------------------------------------------------
         // :: Paste content to terminal using hidden textarea
         // ---------------------------------------------------------------------
-        function paste(e) {
+        function paste() {
             if (paste_count++ > 0) {
                 return;
             }
-            if (e.originalEvent) {
-                e = e.originalEvent;
-            }
             if (self.isenabled()) {
-                var clip = self.find('textarea');
-                if (!clip.is(':focus')) {
-                    clip.focus();
-                }
                 //wait until Browser insert text to textarea
                 self.oneTime(100, function() {
                     self.insert(clip.val());
-                    clip.val('');
+                    clip.val(command);
                     fix_textarea();
                 });
             }
         }
-        var first_up_history = true;
-        // prevent_keypress - hack for Android that was inserting characters on
-        // backspace
-        var prevent_keypress = false;
-        var no_keypress;
-        // ---------------------------------------------------------------------
-        // :: Keydown Event Handler
-        // ---------------------------------------------------------------------
-        function keydown_event(e) {
-            var result, pos, len;
-            if (enabled) {
-                if ($.isFunction(options.keydown)) {
-                    result = options.keydown(e);
-                    if (result !== undefined) {
-                        //prevent_keypress = true;
-                        return result;
-                    }
-                }
-                if (e.which !== 38 &&
-                    !(e.which === 80 && e.ctrlKey)) {
-                    first_up_history = true;
-                }
-                // arrows / Home / End / ENTER
-                if (reverse_search && (e.which === 35 || e.which === 36 ||
-                                       e.which === 37 || e.which === 38 ||
-                                       e.which === 39 || e.which === 40 ||
-                                       e.which === 13 || e.which === 27)) {
-                    clear_reverse_state();
-                    draw_prompt();
-                    if (e.which === 27) { // ESC
-                        self.set('');
-                    }
-                    redraw();
-                    // finish reverse search and execute normal event handler
-                    /* jshint validthis:true */
-                    keydown_event.call(this, e);
-                } else if (e.altKey) {
-                    // Chrome on Windows sets ctrlKey and altKey for alt
-                    // need to check for alt first
-                    //if (e.which === 18) { // press ALT
-                    if (e.which === 68) { //ALT+D
-                        self.set(command.slice(0, position) +
-                                 command.slice(position).
-                                 replace(/ *[^ ]+ *(?= )|[^ ]+$/, ''), true);
-                        // chrome jump to address bar
-                        return false;
-                    }
-                    return true;
-                } else if (e.keyCode === 13) { //enter
-                    if (e.shiftKey) {
-                        self.insert('\n');
-                    } else {
-                        if (history && command && !mask &&
-                            ($.isFunction(options.historyFilter) &&
-                             options.historyFilter(command)) ||
-                            (options.historyFilter instanceof RegExp &&
-                             command.match(options.historyFilter)) ||
-                            !options.historyFilter) {
-                            history.append(command);
-                        }
-                        var tmp = command;
-                        history.reset();
-                        self.set('');
-                        if (options.commands) {
-                            options.commands(tmp);
-                        }
-                        if ($.isFunction(prompt)) {
-                            draw_prompt();
-                        }
-                        $('.clipboard').val('');
-                    }
-                } else if (e.which === 8) { //backspace
-                    if (reverse_search) {
-                        rev_search_str = rev_search_str.slice(0, -1);
-                        draw_reverse_prompt();
-                    } else {
-                        if (command !== '' && position > 0) {
-                            self['delete'](-1);
-                        }
-                    }
-                    if (is_touch) {
-                        return true; // mobile fix
-                    }
-                } else if (e.which === 67 && e.ctrlKey && e.shiftKey) {
-                    // CTRL+SHIFT+C
-                    selected_text = get_selected_text();
-                } else if (e.which === 86 && e.ctrlKey && e.shiftKey) {
-                    if (selected_text !== '') {
-                        self.insert(selected_text);
-                    }
-                } else if (e.which === 9 && !(e.ctrlKey || e.altKey)) { // TAB
-                    self.insert('\t');
-                } else if (e.which === 46) {
-                    //DELETE
-                    self['delete'](1);
-                    return;
-                } else if (history && (e.which === 38 && !e.ctrlKey) ||
-                           (e.which === 80 && e.ctrlKey)) {
-                    //UP ARROW or CTRL+P
-                    if (first_up_history) {
-                        last_command = command;
-                        self.set(history.current());
-                    } else {
-                        self.set(history.previous());
-                    }
-                    first_up_history = false;
-                } else if (history && (e.which === 40 && !e.ctrlKey) ||
-                           (e.which === 78 && e.ctrlKey)) {
-                    //DOWN ARROW or CTRL+N
-                    self.set(history.end() ? last_command : history.next());
-                } else if (e.which === 37 || (e.which === 66 && e.ctrlKey)) {
-                    //CTRL+LEFT ARROW or CTRL+B
-                    if (e.ctrlKey && e.which !== 66) {
-                        len = position - 1;
-                        pos = 0;
-                        if (command[len] === ' ') {
-                            --len;
-                        }
-                        for (var i = len; i > 0; --i) {
-                            if (command[i] === ' ' && command[i+1] !== ' ') {
-                                pos = i + 1;
-                                break;
-                            } else if (command[i] === '\n' &&
-                                       command[i+1] !== '\n') {
-                                pos = i;
-                                break;
-                            }
-                        }
-                        self.position(pos);
-                    } else {
-                        //LEFT ARROW or CTRL+B
-                        if (position > 0) {
-                            self.position(-1, true);
-                            redraw();
-                        }
-                    }
-                } else if (e.which === 82 && e.ctrlKey) { // CTRL+R
-                    if (reverse_search) {
-                        reverse_history_search(true);
-                    } else {
-                        backup_prompt = prompt;
-                        draw_reverse_prompt();
-                        last_command = command;
-                        self.set('');
-                        redraw();
-                        reverse_search = true;
-                    }
-                } else if (e.which == 71 && e.ctrlKey) { // CTRL+G
-                    if (reverse_search) {
-                        prompt = backup_prompt;
-                        draw_prompt();
-                        self.set(last_command);
-                        redraw();
-                        reverse_search = false;
-                        rev_search_str = '';
-                    }
-                } else if (e.which === 39 ||
-                           (e.which === 70 && e.ctrlKey)) {
-                    //RIGHT ARROW OR CTRL+F
-                    if (e.ctrlKey && e.which !== 70) {
-                        // jump to beginning or end of the word
-                        if (command[position] === ' ') {
-                            ++position;
-                        }
-                        var re = /\S[\n\s]{2,}|[\n\s]+\S?/;
-                        var match = command.slice(position).match(re);
-                        if (!match || match[0].match(/^\s+$/)) {
-                            self.position(command.length);
-                        } else {
-                            if (match[0][0] !== ' ') {
-                                position += match.index + 1;
-                            } else {
-                                position += match.index + match[0].length - 1;
-                                if (match[0][match[0].length-1] !== ' ') {
-                                    --position;
-                                }
-                            }
-                        }
-                        redraw();
-                    } else {
-                        if (position < command.length) {
-                            self.position(1, true);
-                        }
-                    }
-                } else if (e.which === 123) { // F12 - Allow Firebug
-                    return;
-                } else if (e.which === 36) { // HOME
-                    self.position(0);
-                } else if (e.which === 35) { // END
-                    self.position(command.length);
-                } else if (e.shiftKey && e.which == 45) { // Shift+Insert
-                    clip.val(''); // so we get it before paste event
-                    paste_count = 0;
-                    if (!is_paste_supported) {
-                        paste(e);
-                    } else {
-                        clip.focus();
-                    }
-                    return;
-                } else if (e.ctrlKey || e.metaKey) {
-                    if (e.which === 192) { // CMD+` switch browser window on Mac
-                        return;
-                    }
-                    if (e.metaKey) {
-                        if(e.which === 82) { // CMD+r page reload in Chrome Mac
-                            return;
-                        } else if(e.which === 76) {
-                            // CMD+l jump into Omnibox on Chrome Mac
-                            return;
-                        }
-                    }
-                    if (e.shiftKey) { // CTRL+SHIFT+??
-                        if (e.which === 84) {
-                            //CTRL+SHIFT+T open closed tab
-                            return;
-                        }
-                    //} else if (e.altKey) { //ALT+CTRL+??
-                    } else {
-                        if (e.which === 81) { // CTRL+W
-                            // don't work in Chromium (can't prevent close tab)
-                            if (command !== '' && position !== 0) {
-                                var m = command.slice(0, position).match(/([^ ]+ *$)/);
-                                kill_text = self['delete'](-m[0].length);
-                            }
-                            return false;
-                        } else if (e.which === 72) { // CTRL+H
-                            if (command !== '' && position > 0) {
-                                self['delete'](-1);
-                            }
-                            return false;
-                        //NOTE: in opera charCode is undefined
-                        } else if (e.which === 65) {
-                            //CTRL+A
-                            self.position(0);
-                        } else if (e.which === 69) {
-                            //CTRL+E
-                            self.position(command.length);
-                        } else if (e.which === 88 || e.which === 67 ||
-                                   e.which === 84) {
-                            //CTRL+X CTRL+C CTRL+W CTRL+T
-                            return;
-                        } else if (e.which === 89) { // CTRL+Y
-                            if (kill_text !== '') {
-                                self.insert(kill_text);
-                            }
-                        } else if (e.which === 86 || e.which === 118) { // CTRL+V
-                            clip.val('');
-                            paste_count = 0;
-                            if (!is_paste_supported) {
-                                paste(e);
-                            } else {
-                                clip.focus();
-                                clip.on('input', function input(e) {
-                                    paste(e);
-                                    clip.off('input', input);
-                                });
-                            }
-                            return;
-                        } else if (e.which === 75) { // CTRL+K
-                            kill_text = self['delete'](command.length-position);
-                        } else if (e.which === 85) { // CTRL+U
-                            if (command !== '' && position !== 0) {
-                                kill_text = self['delete'](-position);
-                            }
-                        } else if (e.which === 17) { //CTRL+TAB switch tab
-                            return false;
-                        }
-                    }
-                } else {
-                    prevent_keypress = false;
-                    no_keypress = true;
-                    return;
-                }
-                // this will prevent for instance backspace to go back one page
-                //prevent_keypress = true;
-                e.preventDefault();
-            }
-        }
         function fire_change_command() {
             if ($.isFunction(options.onCommandChange)) {
                 options.onCommandChange(command);
             }
         }
+        function crlf(string) {
+            return string.replace(/[\r\n]{2}/g, '\n');
+        }
         // ---------------------------------------------------------------------
         // :: Command Line Methods
         // ---------------------------------------------------------------------
@@ -1574,7 +2019,11 @@
                 if (string !== undefined) {
                     name = string;
                     var enabled = history && history.enabled() || !history;
-                    history = new History(string, historySize, options.history == 'memory');
+                    history = new History(
+                        string,
+                        historySize,
+                        options.history === 'memory'
+                    );
                     // disable new history if old was disabled
                     if (!enabled) {
                         history.disable();
@@ -1603,36 +2052,64 @@
                         command = command.slice(0, position + n) +
                             command.slice(position, command.length);
                         if (!stay) {
-                            self.position(position+n);
-                        } else {
-                            fire_change_command();
+                            self.position(position + n);
                         }
-                    }
-                } else {
-                    if (command !== '' && position < command.length) {
-                        removed = command.slice(position).slice(0, n);
-                        command = command.slice(0, position) +
-                            command.slice(position + n, command.length);
                         fire_change_command();
                     }
+                } else if (command !== '' && position < command.length) {
+                    removed = command.slice(position).slice(0, n);
+                    command = command.slice(0, position) +
+                        command.slice(position + n, command.length);
+                    fire_change_command();
                 }
                 redraw();
                 fix_textarea();
                 return removed;
             },
-            set: function(string, stay) {
+            set: function(string, stay, silent) {
                 if (string !== undefined) {
-                    command = string;
+                    command = crlf(string);
                     if (!stay) {
                         self.position(command.length);
                     }
                     redraw();
                     fix_textarea();
-                    fire_change_command();
+                    if (!silent) {
+                        fire_change_command();
+                    }
                 }
                 return self;
             },
+            keymap: function(new_keymap, value) {
+                function wrap(key, fn) {
+                    return function(e) {
+                        // new keymap function will get default as 2nd argument
+                        return fn(e, default_keymap[key]);
+                    };
+                }
+                if (typeof new_keymap === 'undefined') {
+                    return keymap;
+                } else if (typeof new_keymap === 'string') {
+                    if (typeof value === 'undefined') {
+                        if (keymap[new_keymap]) {
+                            return keymap[new_keymap];
+                        } else if (default_keymap[new_keymap]) {
+                            return default_keymap[new_keymap];
+                        }
+                    } else {
+                        keymap[new_keymap] = wrap(new_keymap, value);
+                    }
+                } else {
+                    keymap = $.extend(
+                        {},
+                        default_keymap,
+                        $.omap(new_keymap || {}, wrap)
+                    );
+                    return self;
+                }
+            },
             insert: function(string, stay) {
+                string = crlf(string);
                 if (position === command.length) {
                     command += string;
                 } else if (position === 0) {
@@ -1648,6 +2125,7 @@
                 }
                 redraw();
                 fire_change_command();
+                fix_textarea();
                 return self;
             },
             get: function() {
@@ -1664,13 +2142,12 @@
             destroy: function() {
                 doc.unbind('keypress.cmd', keypress_event);
                 doc.unbind('keydown.cmd', keydown_event);
-                doc.unbind('paste.cmd', paste);
-                doc.unbind('input.cmd', input);
+                doc.unbind('input.cmd', input_event);
                 self.stopTime('blink', blink);
                 self.find('.cursor').next().remove().end().prev().remove().
                     end().remove();
                 self.find('.prompt, .clipboard').remove();
-                self.removeClass('cmd').removeData('cmd');
+                self.removeClass('cmd').removeData('cmd').off('.cmd');
                 return self;
             },
             prompt: function(user_prompt) {
@@ -1695,28 +2172,58 @@
             },
             position: function(n, relative) {
                 if (typeof n === 'number') {
-                    // if (position !== n) { this don't work, don't know why
                     if (relative) {
                         position += n;
+                    } else if (n < 0) {
+                        position = 0;
+                    } else if (n > command.length) {
+                        position = command.length;
                     } else {
-                        if (n < 0) {
-                            position = 0;
-                        } else if (n > command.length) {
-                            position = command.length;
-                        } else {
-                            position = n;
-                        }
+                        position = n;
                     }
+                    formatted_position = get_formatted_position(position);
                     if ($.isFunction(options.onPositionChange)) {
                         options.onPositionChange(position);
                     }
                     redraw();
-                    fix_textarea();
+                    fix_textarea(true);
                     return self;
                 } else {
                     return position;
                 }
             },
+            display_position: function(n, relative) {
+                if (n === undefined) {
+                    return formatted_position;
+                } else {
+                    var string = formatting(command);
+                    var len = $.terminal.length(string);
+                    var command_len = $.terminal.length(command);
+                    if (len === command_len) {
+                        return self.position(n);
+                    } else {
+                        var new_formatted_pos;
+                        if (relative) {
+                            new_formatted_pos = formatted_position + n;
+                        } else if (n > len) {
+                            new_formatted_pos = len;
+                        } else {
+                            new_formatted_pos = n;
+                        }
+                        // it's faster then reverse algorithm
+                        if (new_formatted_pos === len) {
+                            self.position($.terminal.length(command));
+                        } else {
+                            for (var i = 0; i < command_len; ++i) {
+                                if (new_formatted_pos === get_formatted_position(i)) {
+                                    self.position(i);
+                                }
+                            }
+                        }
+                    }
+                    return self;
+                }
+            },
             visible: (function() {
                 var visible = self.visible;
                 return function() {
@@ -1740,24 +2247,34 @@
                     change_num_chars();
                 }
                 redraw();
+                draw_prompt();
                 return self;
             },
             enable: function() {
-                enabled = true;
-                self.addClass('enabled');
-                clip.caret(position);
-                animation(true);
+                if (!enabled) {
+                    enabled = true;
+                    self.addClass('enabled');
+                    try {
+                        clip.caret(position);
+                    } catch (e) {
+                        // firefox throw NS_ERROR_FAILURE ignore
+                    }
+                    animation(true);
+                    draw_prompt();
+                }
                 mobile_focus();
                 return self;
             },
             isenabled: function() {
                 return enabled;
             },
-            disable: function() {
+            disable: function(focus) {
                 enabled = false;
                 self.removeClass('enabled');
                 animation(false);
-                mobile_focus();
+                if (!focus) {
+                    mobile_focus();
+                }
                 return self;
             },
             mask: function(new_mask) {
@@ -1770,11 +2287,12 @@
                 }
             }
         });
+        //debug_object(self, 'cmd')('display_position');
         // ---------------------------------------------------------------------
         // :: INIT
         // ---------------------------------------------------------------------
         self.name(options.name || options.prompt || '');
-        if (typeof options.prompt == 'string') {
+        if (typeof options.prompt === 'string') {
             prompt = options.prompt;
         } else {
             prompt = '> ';
@@ -1783,118 +2301,492 @@
         if (options.enabled === undefined || options.enabled === true) {
             self.enable();
         }
-        // Keystrokes
-        var object;
+        if (!options.history) {
+            history.disable();
+        }
+        var first_up_history = true;
+        // prevent_keypress - hack for Android that was inserting characters on
+        // backspace
+        var prevent_keypress = false;
+        var dead_key = false;
+        var single_key = false;
+        var no_keypress = false;
+        var no_key = false;
+        var no_keydown = true;
+        var backspace = false;
+        var process = false;
+        var skip_insert;
+        // we hold text before keydown to fix backspace for Android/Chrome/SwiftKey
+        // keyboard that generate keycode 229 for all keys #296
+        var prev_command = '';
+        // ---------------------------------------------------------------------
+        // :: Keydown Event Handler
+        // ---------------------------------------------------------------------
+        function keydown_event(e) {
+            debug('keydown "' + e.key + '" ' + e.fake + ' ' + e.which);
+            process = (e.key || '').toLowerCase() === 'process' || e.which === 0;
+            var result;
+            dead_key = no_keypress && single_key;
+            // special keys don't trigger keypress fix #293
+            try {
+                if (!e.fake) {
+                    single_key = e.key && e.key.length === 1 && !e.ctrlKey;
+                    // chrome on android support key property but it's "Unidentified"
+                    no_key = String(e.key).toLowerCase() === 'unidentified';
+                    backspace = e.key.toUpperCase() === 'BACKSPACE' || e.which === 8;
+                }
+            } catch (exception) {}
+            // keydown created in input will have text already inserted and we
+            // want text before input
+            if (e.key === "Unidentified") {
+                no_keydown = true;
+                // android swift keyboard have always which == 229 we will triger proper
+                // event in input with e.fake == true
+                return;
+            }
+            if (!e.fake) {
+                no_keypress = true;
+                no_keydown = false;
+            }
+            // Meta+V did bind input but it didin't happen because terminal paste
+            // prevent native insert action
+            clip.off('input', paste);
+            var key = get_key(e);
+            if ($.isFunction(options.keydown)) {
+                result = options.keydown(e);
+                if (result !== undefined) {
+                    //prevent_keypress = true;
+                    if (!result) {
+                        skip_insert = true;
+                    }
+                    return result;
+                }
+            }
+            if (enabled) {
+                restart_animation();
+                // CTRL+V don't fire keypress in IE11
+                skip_insert = ['CTRL+V', 'META+V'].indexOf(key) !== -1;
+                if (e.which !== 38 && !(e.which === 80 && e.ctrlKey)) {
+                    first_up_history = true;
+                }
+                // arrows / Home / End / ENTER
+                if (reverse_search && (e.which === 35 || e.which === 36 ||
+                                       e.which === 37 || e.which === 38 ||
+                                       e.which === 39 || e.which === 40 ||
+                                       e.which === 13 || e.which === 27)) {
+                    clear_reverse_state();
+                    draw_prompt();
+                    if (e.which === 27) { // ESC
+                        self.set('');
+                    }
+                    redraw();
+                    // finish reverse search and execute normal event handler
+                    /* jshint validthis:true */
+                    keydown_event.call(this, e);
+                } else if ($.isFunction(keymap[key])) {
+                    result = keymap[key]();
+                    if (result === true) {
+                        return;
+                    }
+                    if (result !== undefined) {
+                        return result;
+                    }
+                } else if (e.altKey) {
+                    return;
+                } else {
+                    prevent_keypress = false;
+                    return;
+                }
+                // this will prevent for instance backspace to go back one page
+                //prevent_keypress = true;
+                //e.preventDefault();
+            }
+        }
         var doc = $(document.documentElement || window);
+        self.keymap(options.keymap || {});
         function keypress_event(e) {
+            debug('keypress "' + e.key + '" ' + e.fake);
             var result;
-            no_keypress = false;
-            if ((e.ctrlKey || e.metaKey) && ([99, 118, 86].indexOf(e.which) !== -1)) {
-                // CTRL+C or CTRL+V
+            if (!e.fake) {
+                no_keypress = false;
+            }
+            if ((e.ctrlKey || e.metaKey) && !e.altKey) {
                 return;
             }
             if (prevent_keypress) {
                 return;
             }
-            if (!reverse_search && $.isFunction(options.keypress)) {
+            if ($.isFunction(options.keypress)) {
                 result = options.keypress(e);
+                if (result !== undefined) {
+                    if (!result) {
+                        skip_insert = true;
+                    }
+                    return result;
+                }
             }
-            //$.terminal.active().echo(JSON.stringify(result));
-            if (result === undefined || result) {
-                if (enabled) {
-                    if ($.inArray(e.which, [38, 13, 0, 8]) > -1 &&
-                        //!(e.which === 40 && e.shiftKey ||
-                        !(e.which === 38 && e.shiftKey)) {
-                        if (e.keyCode == 123) { // for F12 which == 0
-                            return;
-                        }
-                        return false;
-                    } else if (!e.ctrlKey && !(e.altKey && e.which === 100) ||
-                               e.altKey) { // ALT+D
-                        if (reverse_search) {
-                            rev_search_str += String.fromCharCode(e.which);
-                            reverse_history_search();
-                            draw_reverse_prompt();
-                        } else {
-                            self.insert(String.fromCharCode(e.which));
-                        }
-                        return false;
+            if (enabled) {
+                if (e.fake) {
+                    // event created in input, we prevent inserting text
+                    // in different interpreter when keydown called pop
+                    return;
+                }
+                // key polyfill is not correct for keypress
+                // https://github.com/cvan/keyboardevent-key-polyfill/issues/15
+                var key;
+                if (is_key_native() || e.fake) {
+                    key = e.key;
+                    // fixing IE inconsistency #362
+                    var normalized = key.toUpperCase();
+                    if (key_mapping[normalized]) {
+                        key = key_mapping[normalized];
+                    }
+                }
+                if (!key || no_key) {
+                    key = String.fromCharCode(e.which);
+                }
+                if ($.inArray(e.which, [13, 0, 8]) > -1) {
+                    if (e.keyCode === 123) { // for F12 which === 0
+                        return;
+                    }
+                    return false;
+                    // which === 100 - d
+                } else if (key && (!e.ctrlKey || (e.ctrlKey && e.ctrlKey)) &&
+                           (!(e.altKey && e.which === 100) || e.altKey) &&
+                           !dead_key) {
+                    // dead_key are handled by input event
+                    if (reverse_search) {
+                        rev_search_str += key;
+                        reverse_history_search();
+                        draw_reverse_prompt();
+                    } else if (key.length === 1) {
+                        self.insert(key);
                     }
                 }
-            } else {
-                return result;
             }
         }
-        function input(e) {
-            if (no_keypress) {
-                // Some Androids don't fire keypress - #39
-                var val = clip.val();
-                if (val || e.which == 8) {  // #209 ; 8 - backspace
+        function event(type, chr, which) {
+            var event = $.Event(type);
+            event.which = which;
+            event.key = chr;
+            event.fake = true;
+            doc.trigger(event);
+        }
+        function debug(str) {
+            if (false) {
+                console.log(str);
+                //$.terminal.active().echo(str);
+            }
+        }
+        function input_event(e) {
+            debug('input ' + no_keydown + ' || ' + process + ' ((' + no_keypress +
+                  ' || ' + dead_key + ') && !' + skip_insert + ' && (' + single_key +
+                  ' || ' + no_key + ') && !' + backspace + ')');
+            debug(JSON.stringify({
+                data: e.originalEvent.data,
+                inputType: e.originalEvent.data
+            }));
+            // Some Androids don't fire keypress - #39
+            // if there is dead_key we also need to grab real character #158
+            // Firefox/Android with google keyboard don't fire keydown and keyup #319
+            var val = clip.val();
+            if ((no_keydown || process || ((no_keypress || dead_key) && !skip_insert &&
+                                          (single_key || no_key) && !backspace)) &&
+                val !== command) {
+                var pos = position;
+                // backspace is set in keydown if no keydown we need to get new one
+                if (no_keydown) {
+                    var cmd = prev_command;
+                    backspace = cmd.substring(0, cmd.length - 1).length === val.length;
+                }
+                if (reverse_search) {
+                    rev_search_str = val;
+                    reverse_history_search();
+                    draw_reverse_prompt();
+                } else {
+                    var chr = val.substring(position);
+                    if (chr.length === 1 || backspace) {
+                        // we trigger events so keypress and keydown callback work
+                        if (no_keydown) {
+                            var keycode;
+                            if (backspace) {
+                                keycode = 8;
+                            } else {
+                                keycode = chr.toUpperCase().charCodeAt(0);
+                            }
+                            event('keydown', backspace ? 'Backspace' : chr, keycode);
+                        }
+                        if (no_keypress && !backspace) {
+                            event('keypress', chr, chr.charCodeAt(0));
+                        }
+                    }
+                    if (backspace) {
+                        prev_command = command;
+                        return;
+                    }
+                    // if user return false in keydown we don't want to insert text
+                    if (skip_insert) {
+                        skip_insert = false;
+                        return;
+                    }
                     self.set(val);
                 }
+                if (backspace) {
+                    self.position(pos - 1);
+                } else {
+                    // user enter more then one character if click on complete word
+                    // on android
+                    self.position(pos + Math.abs(val.length - prev_command.length));
+                }
             }
+            prev_command = command;
+            skip_insert = false;
+            no_keydown = true;
         }
-        doc.bind('keypress.cmd', keypress_event).bind('keydown.cmd', keydown_event).
-            bind('input.cmd', input);
-        // characters
+        doc.bind('keypress.cmd', keypress_event).bind('keydown.cmd', keydown_event)
+            .bind('input.cmd', input_event);
+        (function() {
+            var was_down = false;
+            var count = 0;
+            self.on('mousedown.cmd', function() {
+                was_down = true;
+            }).on('mouseup.cmd', function(e) {
+                if (e.originalEvent.button === 0 && get_selected_text() === '') {
+                    var name = 'click_' + id;
+                    if (++count === 1) {
+                        var down = was_down;
+                        if (enabled) {
+                            self.oneTime(options.clickTimeout, name, function() {
+                                var $target = $(e.target);
+                                if (!$target.is('.prompt') && down) {
+                                    if (enabled) {
+                                        if ($target.is('.cmd')) {
+                                            self.position(command.length);
+                                        } else {
+                                            self.display_position(get_char_pos(e));
+                                        }
+                                    }
+                                }
+                                count = 0;
+                            });
+                        } else {
+                            count = 0;
+                        }
+                    } else {
+                        self.stopTime(name);
+                        count = 0;
+                    }
+                }
+                was_down = false;
+            });
+        })();
         self.data('cmd', self);
+        if (!('KeyboardEvent' in window && 'key' in window.KeyboardEvent.prototype)) {
+            setTimeout(function() {
+                throw new Error('key event property not supported try ' +
+                                'https://github.com/cvan/keyboardevent-key-polyfill');
+            }, 0);
+        }
         return self;
     }; // cmd plugin
-
     // -------------------------------------------------------------------------
-    // :: TOOLS
-    // -------------------------------------------------------------------------
-    function skip_formatting_count(string) {
-        // this will covert html entities to single characters
-        return $('<div>' + $.terminal.strip(string) + '</div>').text().length;
-    }
+    /* eslint-disable */
+    // https://stackoverflow.com/questions/11381673/detecting-a-mobile-browser
+    var mobile_re = /(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino|android|ipad|playbook|silk/i;
+    var tablet_re = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i;
+    var format_split_re = /(\[\[[!gbiuso]*;[^;]*;[^\]]*\](?:[^\]]*[^\\](\\\\)*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?)/i;
+    var format_parts_re = /\[\[([!gbiuso]*);([^;]*);([^;\]]*);?([^;\]]*);?([^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?/gi;
+    var format_re = /\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?/gi;
+    var format_exist_re = /\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]/gi;
+    var format_full_re = /^\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]$/gi;
+    var color_hex_re = /^#([0-9a-f]{3}|[0-9a-f]{6})$/i;
+    var url_re = /(\bhttps?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\][)])+\b)/gi;
+    var url_nf_re = /\b(https?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\][)])+)\b(?![^[\]]*])/gi;
+    var email_re = /((([^<>('")[\]\\.,;:\s@"]+(\.[^<>()[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,})))/g;
+    var command_re = /((?:"[^"\\]*(?:\\[\S\s][^"\\]*)*"|'[^'\\]*(?:\\[\S\s][^'\\]*)*'|\/[^\/\\]*(?:\\[\S\s][^\/\\]*)*\/[gimy]*(?=\s|$)|(?:\\\s|\S))+)(?=\s|$)/gi;
+    var format_begin_re = /(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;
+    var format_start_re = /^(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;
+    var format_end_re = /\[\[[!gbiuso]*;[^;]*;[^\]]*\]?$/i;
+    var format_exec_re = /(\[\[(?:[^\]]|\\\])+\]\])/;
+    var float_re = /^[-+]?[0-9]*\.?[0-9]+([eE][-+]?[0-9]+)?$/;
+    var re_re = /^\/((?:\\\/|[^/]|\[[^\]]*\/[^\]]*\])+)\/([gimy]*)$/;
+    var unclosed_strings_re = /^(?=((?:[^"']+|"[^"\\]*(?:\\[^][^"\\]*)*"|'[^'\\]*(?:\\[^][^'\\]*)*')*))\1./;
+    /* eslint-enable */
     // -------------------------------------------------------------------------
-    function formatting_count(string) {
-        return string.length - skip_formatting_count(string);
-    }
+    // :: TOOLS
     // -------------------------------------------------------------------------
     // taken from https://hacks.mozilla.org/2011/09/detecting-and-generating-
     // css-animations-in-javascript/
     var support_animations = (function() {
         var animation = false,
-            animationstring = 'animation',
-            keyframeprefix = '',
             domPrefixes = 'Webkit Moz O ms Khtml'.split(' '),
-            pfx  = '',
             elm = document.createElement('div');
-        if (elm.style.animationName) { animation = true; }
+        if (elm.style.animationName) {
+            animation = true;
+        }
         if (animation === false) {
             for (var i = 0; i < domPrefixes.length; i++) {
                 var name = domPrefixes[i] + 'AnimationName';
-                if (elm.style[ name ] !== undefined) {
-                    pfx = domPrefixes[i];
-                    animationstring = pfx + 'Animation';
-                    keyframeprefix = '-' + pfx.toLowerCase() + '-';
+                if (elm.style[name] !== undefined) {
                     animation = true;
                     break;
                 }
             }
         }
+        elm = null;
         return animation;
     })();
     // -------------------------------------------------------------------------
-    var is_android = navigator.userAgent.toLowerCase().indexOf("android") != -1;
+    var is_android = navigator.userAgent.toLowerCase().indexOf('android') !== -1;
     // -------------------------------------------------------------------------
-    var is_touch = (function() {
-        return ('ontouchstart' in window) || window.DocumentTouch &&
-            document instanceof DocumentTouch;
+    var strlen = (function() {
+        if (typeof wcwidth === 'undefined') {
+            return function(string) {
+                return string.length;
+            };
+        } else {
+            return wcwidth;
+        }
     })();
+    function bare_text(string) {
+        if (!string.match(/&/)) {
+            return string;
+        }
+        return $('<span>' + safe(string) + '</span>').text();
+    }
+    function text(string) {
+        return bare_text($.terminal.strip(string));
+    }
+    function safe(string) {
+        if (!string.match(/[<>]/)) {
+            return string;
+        }
+        return string.replace(/>/g, '&gt;').replace(/</g, '&lt;');
+    }
+    // -------------------------------------------------------------------------
+    var is_mobile = (function(a) {
+        var check = false;
+        if (mobile_re.test(a) || tablet_re.test(a.substr(0, 4))) {
+            check = true;
+        }
+        return check;
+    })(navigator.userAgent || navigator.vendor || window.opera);
+    // ---------------------------------------------------------------------
+    // :: Cross-Browser selection utils
+    // ---------------------------------------------------------------------
+    var get_selected_text = (function() {
+        if (window.getSelection || document.getSelection) {
+            return function() {
+                var selection = (window.getSelection || document.getSelection)();
+                if (selection.text) {
+                    return selection.text;
+                } else {
+                    return selection.toString();
+                }
+            };
+        } else if (document.selection && document.selection.type !== "Control") {
+            return function() {
+                return document.selection.createRange().text;
+            };
+        }
+        return function() {
+            return '';
+        };
+    })();
+    // ---------------------------------------------------------------------
+    function text_to_clipboard(container, text) {
+        var $div = $('<div>' + text.replace(/\n/, '<br/>') + '<div>');
+        $div.appendTo('body');
+        select_all($div[0]);
+        try {
+            document.execCommand('copy');
+        } catch (e) {}
+        $div.remove();
+    }
+    // ---------------------------------------------------------------------
+    var get_textarea_selection = (function() {
+        var textarea = document.createElement('textarea');
+        var selectionStart = 'selectionStart' in textarea;
+        textarea = null;
+        if (selectionStart) {
+            return function(textarea) {
+                var length = textarea.selectionEnd - textarea.selectionStart;
+                return textarea.value.substr(textarea.selectionStart, length);
+            };
+        } else if (document.selection) {
+            return function() {
+                var range = document.selection.createRange();
+                return range.text();
+            };
+        } else {
+            return function() {
+                return '';
+            };
+        }
+    })();
+    function clear_textarea_selection(textarea) {
+        textarea.selectionStart = textarea.selectionEnd = 0;
+    }
+    // ---------------------------------------------------------------------
+    var select = (function() {
+        if (window.getSelection) {
+            var selection = window.getSelection();
+            if (selection.setBaseAndExtent) {
+                return function(start, end) {
+                    var selection = window.getSelection();
+                    selection.setBaseAndExtent(start, 0, end, 1);
+                };
+            } else {
+                return function(start, end) {
+                    var selection = window.getSelection();
+                    var range = document.createRange();
+                    range.setStart(start, 0);
+                    range.setEnd(end, end.childNodes.length);
+                    selection.removeAllRanges();
+                    selection.addRange(range);
+                };
+            }
+        } else {
+            return $.noop;
+        }
+    })();
+    // ---------------------------------------------------------------------
+    function select_all(element) {
+        if (window.getSelection) {
+            var selection = window.getSelection();
+            if (selection.setBaseAndExtent) {
+                selection.setBaseAndExtent(element, 0, element, 1);
+            } else if (document.createRange) {
+                var range = document.createRange();
+                range.selectNodeContents(element);
+                selection.removeAllRanges();
+                selection.addRange(range);
+            }
+        }
+    }
     // -------------------------------------------------------------------------
     function process_command(string, fn) {
-        var array = fn(string);
+        var array = string.match(command_re) || [];
         if (array.length) {
             var name = array.shift();
-            var regex = new RegExp('^' + $.terminal.escape_regex(name));
-            var rest = string.replace(regex, '').trim();
+            var args = $.map(array, function(arg) {
+                if (arg.match(/^["']/)) {
+                    arg = arg.replace(/\n/g, '\\u0000\\u0000\\u0000\\u0000');
+                    arg = fn(arg);
+                    return arg.replace(/\x00\x00\x00\x00/g, '\n');
+                }
+                return fn(arg);
+            });
+            var quotes = $.map(array, function(arg) {
+                var m = arg.match(/^(['"]).*\1$/);
+                return m && m[1] || '';
+            });
+            var rest = string.substring(name.length).trim();
             return {
                 command: string,
                 name: name,
-                args: array,
+                args: args,
+                args_quotes: quotes,
                 rest: rest
             };
         } else {
@@ -1902,68 +2794,57 @@
                 command: string,
                 name: '',
                 args: [],
+                args_quotes: quotes,
                 rest: ''
             };
         }
     }
-    // -------------------------------------------------------------------------
-    var format_split_re = /(\[\[[!gbiuso]*;[^;]*;[^\]]*\](?:[^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]?)/i;
-    var format_parts_re = /\[\[([!gbiuso]*);([^;]*);([^;\]]*);?([^;\]]*);?([^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]?/gi;
-    var format_re = /\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]?/gi;
-    var format_exist_re = /\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]/gi;
-    var format_full_re = /^\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]$/gi;
-    var color_hex_re = /^#([0-9a-f]{3}|[0-9a-f]{6})$/i;
-    //var url_re = /https?:\/\/(?:(?!&[^;]+;)[^\s:"'<>)])+/g;
-    //var url_re = /\bhttps?:\/\/(?:(?!&[^;]+;)[^\s"'<>)])+\b/g;
-    var url_re = /(\bhttps?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\]\[)])+\b)/gi;
-    var url_nf_re = /\b(https?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\][)])+)\b(?![^[\]]*])/gi;
-    var email_re = /((([^<>('")[\]\\.,;:\s@\"]+(\.[^<>()[\]\\.,;:\s@\"]+)*)|(\".+\"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,})))/g;
-    var command_re = /('[^']*'|"(\\"|[^"])*"|(?:\/(\\\/|[^\/])+\/[gimy]*)(?=:? |$)|(\\ |[^ ])+|[\w-]+)/gi;
-    var format_begin_re = /(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;
-    var format_start_re = /^(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;
-    var format_last_re = /\[\[[!gbiuso]*;[^;]*;[^\]]*\]?$/i;
-    var format_exec_re = /(\[\[(?:[^\]]|\\\])*\]\])/;
     $.terminal = {
-        version: '0.11.23',
+        version: '1.11.4',
+        date: 'Sat, 27 Jan 2018 15:44:36 +0000',
         // colors from http://www.w3.org/wiki/CSS/Properties/color/keywords
         color_names: [
-            'black', 'silver', 'gray', 'white', 'maroon', 'red', 'purple',
-            'fuchsia', 'green', 'lime', 'olive', 'yellow', 'navy', 'blue',
-            'teal', 'aqua', 'aliceblue', 'antiquewhite', 'aqua', 'aquamarine',
-            'azure', 'beige', 'bisque', 'black', 'blanchedalmond', 'blue',
-            'blueviolet', 'brown', 'burlywood', 'cadetblue', 'chartreuse',
-            'chocolate', 'coral', 'cornflowerblue', 'cornsilk', 'crimson',
-            'cyan', 'darkblue', 'darkcyan', 'darkgoldenrod', 'darkgray',
-            'darkgreen', 'darkgrey', 'darkkhaki', 'darkmagenta',
-            'darkolivegreen', 'darkorange', 'darkorchid', 'darkred',
-            'darksalmon', 'darkseagreen', 'darkslateblue', 'darkslategray',
-            'darkslategrey', 'darkturquoise', 'darkviolet', 'deeppink',
-            'deepskyblue', 'dimgray', 'dimgrey', 'dodgerblue', 'firebrick',
-            'floralwhite', 'forestgreen', 'fuchsia', 'gainsboro', 'ghostwhite',
-            'gold', 'goldenrod', 'gray', 'green', 'greenyellow', 'grey',
-            'honeydew', 'hotpink', 'indianred', 'indigo', 'ivory', 'khaki',
-            'lavender', 'lavenderblush', 'lawngreen', 'lemonchiffon',
-            'lightblue', 'lightcoral', 'lightcyan', 'lightgoldenrodyellow',
-            'lightgray', 'lightgreen', 'lightgrey', 'lightpink', 'lightsalmon',
-            'lightseagreen', 'lightskyblue', 'lightslategray', 'lightslategrey',
-            'lightsteelblue', 'lightyellow', 'lime', 'limegreen', 'linen',
-            'magenta', 'maroon', 'mediumaquamarine', 'mediumblue',
-            'mediumorchid', 'mediumpurple', 'mediumseagreen', 'mediumslateblue',
-            'mediumspringgreen', 'mediumturquoise', 'mediumvioletred',
-            'midnightblue', 'mintcream', 'mistyrose', 'moccasin', 'navajowhite',
-            'navy', 'oldlace', 'olive', 'olivedrab', 'orange', 'orangered',
-            'orchid', 'palegoldenrod', 'palegreen', 'paleturquoise',
-            'palevioletred', 'papayawhip', 'peachpuff', 'peru', 'pink', 'plum',
-            'powderblue', 'purple', 'red', 'rosybrown', 'royalblue',
-            'saddlebrown', 'salmon', 'sandybrown', 'seagreen', 'seashell',
-            'sienna', 'silver', 'skyblue', 'slateblue', 'slategray',
-            'slategrey', 'snow', 'springgreen', 'steelblue', 'tan', 'teal',
-            'thistle', 'tomato', 'turquoise', 'violet', 'wheat', 'white',
-            'whitesmoke', 'yellow', 'yellowgreen'],
+            'transparent', 'currentcolor', 'black', 'silver', 'gray', 'white',
+            'maroon', 'red', 'purple', 'fuchsia', 'green', 'lime', 'olive',
+            'yellow', 'navy', 'blue', 'teal', 'aqua', 'aliceblue',
+            'antiquewhite', 'aqua', 'aquamarine', 'azure', 'beige', 'bisque',
+            'black', 'blanchedalmond', 'blue', 'blueviolet', 'brown',
+            'burlywood', 'cadetblue', 'chartreuse', 'chocolate', 'coral',
+            'cornflowerblue', 'cornsilk', 'crimson', 'cyan', 'darkblue',
+            'darkcyan', 'darkgoldenrod', 'darkgray', 'darkgreen', 'darkgrey',
+            'darkkhaki', 'darkmagenta', 'darkolivegreen', 'darkorange',
+            'darkorchid', 'darkred', 'darksalmon', 'darkseagreen',
+            'darkslateblue', 'darkslategray', 'darkslategrey', 'darkturquoise',
+            'darkviolet', 'deeppink', 'deepskyblue', 'dimgray', 'dimgrey',
+            'dodgerblue', 'firebrick', 'floralwhite', 'forestgreen', 'fuchsia',
+            'gainsboro', 'ghostwhite', 'gold', 'goldenrod', 'gray', 'green',
+            'greenyellow', 'grey', 'honeydew', 'hotpink', 'indianred', 'indigo',
+            'ivory', 'khaki', 'lavender', 'lavenderblush', 'lawngreen',
+            'lemonchiffon', 'lightblue', 'lightcoral', 'lightcyan',
+            'lightgoldenrodyellow', 'lightgray', 'lightgreen', 'lightgrey',
+            'lightpink', 'lightsalmon', 'lightseagreen', 'lightskyblue',
+            'lightslategray', 'lightslategrey', 'lightsteelblue', 'lightyellow',
+            'lime', 'limegreen', 'linen', 'magenta', 'maroon',
+            'mediumaquamarine', 'mediumblue', 'mediumorchid', 'mediumpurple',
+            'mediumseagreen', 'mediumslateblue', 'mediumspringgreen',
+            'mediumturquoise', 'mediumvioletred', 'midnightblue', 'mintcream',
+            'mistyrose', 'moccasin', 'navajowhite', 'navy', 'oldlace', 'olive',
+            'olivedrab', 'orange', 'orangered', 'orchid', 'palegoldenrod',
+            'palegreen', 'paleturquoise', 'palevioletred', 'papayawhip',
+            'peachpuff', 'peru', 'pink', 'plum', 'powderblue', 'purple', 'red',
+            'rosybrown', 'royalblue', 'saddlebrown', 'salmon', 'sandybrown',
+            'seagreen', 'seashell', 'sienna', 'silver', 'skyblue', 'slateblue',
+            'slategray', 'slategrey', 'snow', 'springgreen', 'steelblue', 'tan',
+            'teal', 'thistle', 'tomato', 'turquoise', 'violet', 'wheat',
+            'white', 'whitesmoke', 'yellow', 'yellowgreen'],
+        // for unit tests
+        Cycle: Cycle,
+        History: History,
+        Stack: Stack,
         // ---------------------------------------------------------------------
         // :: Validate html color (it can be name or hex)
         // ---------------------------------------------------------------------
-        valid_color: function(color) {
+        valid_color: function valid_color(color) {
             if (color.match(color_hex_re)) {
                 return true;
             } else {
@@ -1972,49 +2853,202 @@
             }
         },
         // ---------------------------------------------------------------------
+        // :: function check if given string contain invalid strings
+        // ---------------------------------------------------------------------
+        unclosed_strings: function unclosed_strings(string) {
+            return !!string.match(unclosed_strings_re);
+        },
+        // ---------------------------------------------------------------------
         // :: Escape all special regex characters, so it can be use as regex to
         // :: match exact string that contain those characters
         // ---------------------------------------------------------------------
-        escape_regex: function(str) {
-            if (typeof str == 'string') {
-                var special = /([-\\\^$\[\]()+{}?*.|])/g;
+        escape_regex: function escape_regex(str) {
+            if (typeof str === 'string') {
+                var special = /([-\\^$[\]()+{}?*.|])/g;
                 return str.replace(special, '\\$1');
             }
         },
         // ---------------------------------------------------------------------
         // :: test if string contain formatting
         // ---------------------------------------------------------------------
-        have_formatting: function(str) {
-            return typeof str == 'string' && !!str.match(format_exist_re);
+        have_formatting: function have_formatting(str) {
+            return typeof str === 'string' && !!str.match(format_exist_re);
         },
-        is_formatting: function(str) {
-            return typeof str == 'string' && !!str.match(format_full_re);
+        is_formatting: function is_formatting(str) {
+            return typeof str === 'string' && !!str.match(format_full_re);
         },
         // ---------------------------------------------------------------------
         // :: return array of formatting and text between them
         // ---------------------------------------------------------------------
-        format_split: function(str) {
-            return str.split(format_split_re);
+        format_split: function format_split(str) {
+            return str.split(format_split_re).filter(Boolean);
         },
         // ---------------------------------------------------------------------
-        // :: split text into lines with equal length so each line can be
-        // :: rendered separately (text formatting can be longer then a line).
+        // :: helper function used by substring and split_equal it loop over
+        // :: string and execute callback with text count and other data
         // ---------------------------------------------------------------------
-        split_equal: function(str, length, words) {
+        iterate_formatting: function iterate_formatting(string, callback) {
+            function is_space(i) {
+                return string.substring(i - 6, i) === '&nbsp;' ||
+                    string.substring(i - 1, i).match(/\s/);
+            }
+            function match_entity(index) {
+                return string.substring(index).match(/^(&[^;]+;)/);
+            }
             var formatting = false;
             var in_text = false;
-            var prev_format = '';
-            var result = [];
-            // add format text as 5th paramter to formatting it's used for
-            // data attribute in format function
-            var array = str.replace(format_re, function(_, format, text) {
+            var count = 0;
+            var match;
+            var space = -1;
+            var prev_space;
+            var length = 0;
+            for (var i = 0; i < string.length; i++) {
+                match = string.substring(i).match(format_start_re);
+                if (match) {
+                    formatting = match[1];
+                    in_text = false;
+                } else if (formatting) {
+                    if (string[i] === ']') {
+                        if (in_text) {
+                            formatting = '';
+                            in_text = false;
+                        } else {
+                            in_text = true;
+                        }
+                    }
+                } else {
+                    in_text = true;
+                }
+                var not_formatting = (formatting && in_text) || !formatting;
+                var opening = string[i] === '[' && string[i + 1] === '[';
+                if (is_space(i) && (not_formatting || opening)) {
+                    if (space === -1 && prev_space !== i || space !== -1) {
+                        space = i;
+                    }
+                }
+                var braket = string[i].match(/[[\]]/);
+                if (not_formatting) {
+                    // treat entity as one character
+                    if (string[i] === '&') {
+                        match = match_entity(i);
+                        if (match) {
+                            i += match[1].length - 2; // 2 because continue adds 1 to i
+                            continue;
+                        }
+                        ++count;
+                        ++length;
+                    } else if (string[i] === ']' && string[i - 1] === '\\') {
+                        // escape \] counts as one character
+                        --count;
+                        --length;
+                    } else if (!braket) {
+                        ++count;
+                        ++length;
+                    }
+                }
+                if (not_formatting && string[i] !== ']' && !opening) {
+                    if (strlen(string[i]) === 2) {
+                        length++;
+                    }
+                    var data = {
+                        count: count,
+                        index: i,
+                        formatting: formatting,
+                        length: length,
+                        text: in_text,
+                        space: space
+                    };
+                    var ret = callback(data);
+                    if (ret === false) {
+                        break;
+                    } else if (ret) {
+                        if (ret.count !== undefined) {
+                            count = ret.count;
+                        }
+                        if (ret.length !== undefined) {
+                            length = ret.length;
+                        }
+                        if (ret.space !== undefined) {
+                            prev_space = space;
+                            space = ret.space;
+                        }
+                        if (ret.index !== undefined) {
+                            i = ret.index;
+
+                        }
+                    }
+                }
+            }
+        },
+        // ---------------------------------------------------------------------
+        // :: formatting aware substring function
+        // ---------------------------------------------------------------------
+        substring: function substring(string, start_index, end_index) {
+            if (text(string).substring(start_index, end_index) === '') {
+                return '';
+            }
+            var start;
+            var end = string.length;
+            var start_formatting = '';
+            var end_formatting = '';
+            var prev_index;
+            var re = /(&[^;]+);$/;
+            $.terminal.iterate_formatting(string, function(data) {
+                var m;
+                if (start_index && data.count === start_index + 1) {
+                    start = data.index;
+                    m = string.substring(0, start + 1).match(re);
+                    if (m) {
+                        start -= m[1].length;
+                    }
+                    if (data.formatting) {
+                        start_formatting = data.formatting;
+                    }
+                }
+                if (end_index && data.count === end_index + 1) {
+                    end = data.index;
+                    m = string.substring(0, end + 1).match(re);
+                    if (m) {
+                        end -= m[1].length;
+                    }
+                    if (data.formatting) {
+                        end = prev_index + 1;
+                    }
+                }
+                if (end_index && data.count === end_index) {
+                    end_formatting = data.formatting;
+                    prev_index = data.index;
+                }
+            });
+            if (start_index && !start) {
+                return '';
+            }
+            string = start_formatting + string.substring(start, end);
+            if (end_formatting) {
+                string = string.replace(/(\[\[^\]]+)?\]$/, '');
+                string += ']';
+            }
+            return string;
+        },
+        // ---------------------------------------------------------------------
+        // :: add format text as 5th paramter to formatting it's used for
+        // :: data attribute in format function
+        // ---------------------------------------------------------------------
+        normalize: function normalize(string) {
+            return string.replace(format_re, function(_, format, text) {
+                if (text === '') {
+                    return '';
+                }
                 var semicolons = format.match(/;/g).length;
                 // missing semicolons
                 if (semicolons >= 4) {
-                    return _;
-                } else if (semicolons == 2) {
+                    var args = format.split(/;/);
+                    var start = args.slice(0, 4).join(';');
+                    var arg = args.slice(4).join(';');
+                    return '[[' + start + ';' + (arg || text) + ']' + text + ']';
+                } else if (semicolons === 2) {
                     semicolons = ';;';
-                } else if (semicolons == 3) {
+                } else if (semicolons === 3) {
                     semicolons = ';';
                 } else {
                     semicolons = '';
@@ -2025,11 +3059,16 @@
                 var safe = text.replace(/\\\]/g, '&#93;').replace(/\n/g, '\\n').
                     replace(/&nbsp;/g, ' ');
                 return '[[' + format + semicolons + safe + ']' + text + ']';
-            }).split(/\n/g);
-            function is_space() {
-                return line.substring(j-6, j) == '&nbsp;' ||
-                    line.substring(j-1, j) == ' ';
-            }
+            });
+        },
+        // ---------------------------------------------------------------------
+        // :: split text into lines with equal length so each line can be
+        // :: rendered separately (text formatting can be longer then a line).
+        // ---------------------------------------------------------------------
+        split_equal: function split_equal(str, length, keep_words) {
+            var prev_format = '';
+            var result = [];
+            var array = $.terminal.normalize(str).split(/\n/g);
             for (var i = 0, len = array.length; i < len; ++i) {
                 if (array[i] === '') {
                     result.push('');
@@ -2037,119 +3076,185 @@
                 }
                 var line = array[i];
                 var first_index = 0;
-                var count = 0;
                 var output;
-                var space = -1;
-                for (var j=0, jlen=line.length; j<jlen; ++j) {
-                    if (line.substring(j).match(format_start_re)) {
-                        formatting = true;
-                        in_text = false;
-                    } else if (formatting && line[j] === ']') {
-                        if (in_text) {
-                            formatting = false;
-                            in_text = false;
-                        } else {
-                            in_text = true;
-                        }
-                    } else if ((formatting && in_text) || !formatting) {
-                        if (line[j] === '&') { // treat entity as one character
-                            var m = line.substring(j).match(/^(&[^;]+;)/);
-                            if (!m) {
-                                // should never happen if used by terminal,
-                                // because it always calls $.terminal.encode
-                                // before this function
-                                throw new Error("Unclosed html entity in line " +
-                                                (i+1) + ' at char ' + (j+1));
-                            }
-                            j+=m[1].length-2; // because continue adds 1 to j
-                            // if entity is at the end there is no next loop
-                            // issue #77
-                            if (j === jlen-1) {
-                                result.push(output + m[1]);
+                var line_length = line.length;
+                $.terminal.iterate_formatting(line, function(data) {
+                    // we don't iterate over last closing bracket
+                    var last_bracket = data.index === line_length - 2 &&
+                        line[data.index + 1] === ']';
+                    var last_iteraction = data.index === line_length - 1 || last_bracket;
+                    if (data.length >= length || last_iteraction ||
+                        (data.length === length - 1 &&
+                         strlen(line[data.index + 1]) === 2)) {
+                        var can_break = false;
+                        if (keep_words && data.space !== -1) {
+                            var stripped = $.terminal.strip(line.substring(data.space));
+                            // replace html entities with characters
+                            stripped = $('<span>' + stripped + '</span>').text();
+                            // real length, not counting formatting
+                            var text_len = stripped.length;
+                            var limit = data.index + length + 1;
+                            stripped = stripped.substring(0, limit);
+                            if (stripped.match(/\s|&nbsp;/) || limit > text_len) {
+                                can_break = true;
                             }
-                            continue;
-                        } else if (line[j] === ']' && line[j-1] === '\\') {
-                            // escape \] counts as one character
-                            --count;
-                        } else {
-                            ++count;
                         }
-                    }
-                    if (is_space() && ((formatting && in_text) || !formatting ||
-                                      (line[j] === '[' && line[j+1] === '['))) {
-                        space = j;
-                    }
-                    if ((count === length || j === jlen-1) &&
-                        ((formatting && in_text) || !formatting)) {
-                        var text = $.terminal.strip(line.substring(space));
-                        text = $('<span>' + text + '</span>').text();
-                        var text_len = text.length;
-                        text = text.substring(0, j+length+1);
-                        var can_break = !!text.match(/\s/) || j+length+1 > text_len;
-                        if (words && space != -1 && j !== jlen-1 && can_break) {
-                            output = line.substring(first_index, space);
-                            j = space-1;
+                        // if words is true we split at last space and make next loop
+                        // continue where the space where located
+                        if (keep_words && !last_bracket && data.space !== -1 &&
+                            data.index !== line_length - 1 && can_break) {
+                            output = line.substring(first_index, data.space);
+                            var new_index = data.space - 1;
                         } else {
-                            output = line.substring(first_index, j+1);
+                            output = line.substring(first_index, data.index + 1);
                         }
-                        if (words) {
-                            output = output.replace(/(&nbsp;|\s)+$/g, '');
+                        if (keep_words) {
+                            output = output.replace(/^(&nbsp;|\s)+|(&nbsp;|\s)+$/g, '');
                         }
-                        space = -1;
-                        first_index = j+1;
-                        count = 0;
+                        first_index = (new_index || data.index) + 1;
                         if (prev_format) {
+                            var closed_formatting = output.match(/^[^\]]*\]/);
                             output = prev_format + output;
-                            if (output.match(']')) {
+                            if (closed_formatting) {
                                 prev_format = '';
                             }
                         }
-                        // Fix output if formatting not closed
+                        if (last_bracket) {
+                            output += ']';
+                            prev_format = '';
+                        }
                         var matched = output.match(format_re);
                         if (matched) {
-                            var last = matched[matched.length-1];
-                            if (last[last.length-1] !== ']') {
+                            var last = matched[matched.length - 1];
+                            if (last[last.length - 1] !== ']') {
                                 prev_format = last.match(format_begin_re)[1];
                                 output += ']';
-                            } else if (output.match(format_last_re)) {
-                                var line_len = output.length;
-                                // why this line ???
-                                //var f_len = line_len-last[last.length-1].length;
-                                output = output.replace(format_last_re, '');
+                            } else if (output.match(format_end_re)) {
+                                output = output.replace(format_end_re, '');
                                 prev_format = last.match(format_begin_re)[1];
                             }
                         }
+                        output = output.replace(/^(\[\[[^\]]+\])?\]/, '');
                         result.push(output);
+                        // modify loop by returing new data
+                        return {index: new_index, length: 0, space: -1};
                     }
-                }
+                });
             }
             return result;
         },
         // ---------------------------------------------------------------------
-        // :: Encode formating as html for insertion into DOM
+        // :: Escape & that's not part of entity
+        // ---------------------------------------------------------------------
+        amp: function(str) {
+            return str.replace(/&(?!#[0-9]+;|[a-zA-Z]+;)/g, '&amp;');
+        },
+        // ---------------------------------------------------------------------
+        // :: Encode formating as html for insertion into DOM
+        // ---------------------------------------------------------------------
+        encode: function encode(str) {
+            return $.terminal.amp(str).replace(/</g, '&lt;').replace(/>/g, '&gt;')
+                .replace(/ /g, '&nbsp;')
+                .replace(/\t/g, '&nbsp;&nbsp;&nbsp;&nbsp;');
+        },
+        // -----------------------------------------------------------------------
+        // :: Default formatter that allow for nested formatting, example:
+        // :: [[;;#000]hello [[;#f00;]red] world]
+        // -----------------------------------------------------------------------
+        nested_formatting: function nested_formatting(string) {
+            if (!$.terminal.have_formatting(string)) {
+                return string;
+            }
+            var stack = [];
+            var re = /((?:\[\[(?:[^\]]|\\\])+\])?(?:[^\][]|\\\])*\]?)/;
+            var format_re = /(\[\[(?:[^\]]|\\\])+\])[\s\S]*/;
+            return string.split(re).filter(Boolean).map(function(string) {
+                if (string.match(/^\[\[/)) {
+                    if (!$.terminal.is_formatting(string)) {
+                        string += ']';
+                        stack.push(string.replace(format_re, '$1'));
+                    }
+                } else {
+                    var pop = false;
+                    if (string.match(/\]/)) {
+                        pop = true;
+                    }
+                    if (stack.length) {
+                        string = stack[stack.length - 1] + string;
+                    }
+                    if (pop) {
+                        stack.pop();
+                    } else if (stack.length) {
+                        string += ']';
+                    }
+                }
+                return string;
+            }).join('');
+        },
+        // ---------------------------------------------------------------------
+        // :: safe function that will render text as it is
         // ---------------------------------------------------------------------
-        encode: function(str) {
-            // don't escape entities
-            str = str.replace(/&(?!#[0-9]+;|[a-zA-Z]+;)/g, '&amp;');
-            return str.replace(/</g, '&lt;').replace(/>/g, '&gt;')
-                .replace(/ /g, '&nbsp;')
-                .replace(/\t/g, '&nbsp;&nbsp;&nbsp;&nbsp;');
+        escape_formatting: function escape_formatting(string) {
+            return $.terminal.escape_brackets(string);
         },
         // ---------------------------------------------------------------------
-        // :: safe function that will render text as it is
+        // :: apply custom formatters only to text
         // ---------------------------------------------------------------------
-        escape_formatting: function(string) {
-            return $.terminal.escape_brackets($.terminal.encode(string));
+        apply_formatters: function(string) {
+            var formatters = $.terminal.defaults.formatters;
+            var i = 0;
+            try {
+                return formatters.reduce(function(string, formatter) {
+                    i++;
+                    if (typeof formatter === 'function' && formatter.__meta__) {
+                        var ret = formatter(string);
+                        if (typeof ret === 'string') {
+                            return ret;
+                        }
+                    } else {
+                        return $.terminal.format_split(string).map(function(string) {
+                            if ($.terminal.is_formatting(string)) {
+                                return string;
+                            } else {
+                                if (formatter instanceof Array) {
+                                    return string.replace(formatter[0], formatter[1]);
+                                } else if (typeof formatter === 'function') {
+                                    var ret = formatter(string);
+                                    if (typeof ret === 'string') {
+                                        return ret;
+                                    }
+                                }
+                                return string;
+                            }
+                        }).join('');
+                    }
+                    return string;
+                }, string);
+            } catch (e) {
+                throw new Error('Error in formatter [' + (i - 1) + ']');
+            }
         },
         // ---------------------------------------------------------------------
         // :: Replace terminal formatting with html
         // ---------------------------------------------------------------------
-        format: function(str, options) {
+        format: function format(str, options) {
+            function safe_text(string) {
+                if (string.match(/\\]/)) {
+                    string = string.replace(/(\\+)]/g, function(_, slashes) {
+                        if (slashes.length % 2 === 1) {
+                            return ']';
+                        } else {
+                            return slashes.replace(/../, '\\');
+                        }
+                    });
+                }
+                return safe(string);
+            }
             var settings = $.extend({}, {
                 linksNoReferrer: false
             }, options || {});
             if (typeof str === 'string') {
-                //support for formating foo[[u;;]bar]baz[[b;#fff;]quux]zzz
+                // support for formating foo[[u;;]bar]baz[[b;#fff;]quux]zzz
                 var splitted = $.terminal.format_split(str);
                 str = $.map(splitted, function(text) {
                     if (text === '') {
@@ -2170,7 +3275,7 @@
                             if (text === '') {
                                 return ''; //'<span>&nbsp;</span>';
                             }
-                            text = text.replace(/\\]/g, ']');
+                            text = safe_text(text);
                             var style_str = '';
                             if (style.indexOf('b') !== -1) {
                                 style_str += 'font-weight:bold;';
@@ -2192,6 +3297,13 @@
                             if (style.indexOf('i') !== -1) {
                                 style_str += 'font-style:italic;';
                             }
+                            if (typeof wcwidth !== 'undefined') {
+                                var bare = bare_text(text);
+                                var len = strlen(bare);
+                                if (len !== bare.length) {
+                                    style_str += '--length: ' + len + ';';
+                                }
+                            }
                             if ($.terminal.valid_color(color)) {
                                 style_str += 'color:' + color + ';';
                                 if (style.indexOf('g') !== -1) {
@@ -2205,18 +3317,24 @@
                             if (data_text === '') {
                                 data = text;
                             } else {
-                                data = data_text.replace(/&#93;/g, ']');
+                                data = data_text.replace(/&#93;/g, ']')
+                                    .replace(/>/g, '&gt;').replace(/</g, '&lt;');
                             }
                             var result;
                             if (style.indexOf('!') !== -1) {
                                 if (data.match(email_re)) {
-                                    result = '<a href="mailto:' + data + '" ';
+                                    result = '<a href="mailto:' + data + '"';
                                 } else {
-                                    result = '<a target="_blank" href="' + data + '" ';
+                                    result = '<a target="_blank" href="' + data + '"';
                                     if (settings.linksNoReferrer) {
-                                        result += 'rel="noreferrer" ';
+                                        result += ' rel="noreferrer noopener"';
+                                    } else {
+                                        result += ' rel="noopener"';
                                     }
                                 }
+                                // make focus to terminal textarea that will enable
+                                // terminal when pressing tab and terminal is disabled
+                                result += ' tabindex="1000"';
                             } else {
                                 result = '<span';
                             }
@@ -2230,13 +3348,22 @@
                                 result += '>' + text + '</a>';
                             } else {
                                 result += ' data-text="' +
-                                    data.replace('"', '&quote;') + '">' +
+                                    data.replace(/"/g, '&quote;') + '">' +
                                     text + '</span>';
                             }
                             return result;
                         });
                     } else {
-                        return '<span>' + text.replace(/\\\]/g, ']') + '</span>';
+                        text = safe_text(text);
+                        var style = '';
+                        if (typeof wcwidth !== 'undefined') {
+                            var bare = bare_text(text);
+                            var len = strlen(bare);
+                            if (bare.length !== len) {
+                                style = ' style="--length: ' + len + '"';
+                            }
+                        }
+                        return '<span' + style + '>' + text + '</span>';
                     }
                 }).join('');
                 return str.replace(/<span><br\s*\/?><\/span>/gi, '<br/>');
@@ -2247,126 +3374,187 @@
         // ---------------------------------------------------------------------
         // :: Replace brackets with html entities
         // ---------------------------------------------------------------------
-        escape_brackets: function(string) {
+        escape_brackets: function escape_brackets(string) {
             return string.replace(/\[/g, '&#91;').replace(/\]/g, '&#93;');
         },
         // ---------------------------------------------------------------------
+        // :: return number of characters without formatting
+        // ---------------------------------------------------------------------
+        length: function(string) {
+            return text(string).length;
+        },
+        // ---------------------------------------------------------------------
+        // :: return string where array items are in columns padded spaces
+        // ---------------------------------------------------------------------
+        columns: function(array, cols, space) {
+            var lengths = array.map(function(string) {
+                return string.length;
+            });
+            var length = Math.max.apply(null, lengths) + space;
+            if (typeof space === 'undefined') {
+                space = 4;
+            }
+            var columns = Math.floor(cols / length);
+            var lines = [];
+            var line;
+            function push(i) {
+                var pad = new Array(length - array[i].length).join(' ');
+                line.push(array[i] + ((i % columns === 0) ? '' : pad));
+            }
+            if (columns < 2) {
+                return array.join('\n');
+            }
+            for (var i = 0; i < array.length; ++i) {
+                if (i % columns === 0) {
+                    if (line) {
+                        push(i);
+                        lines.push(line.join(''));
+                    }
+                    line = [];
+                } else {
+                    push(i);
+                }
+            }
+            return lines.join('\n');
+        },
+        // ---------------------------------------------------------------------
         // :: Remove formatting from text
         // ---------------------------------------------------------------------
-        strip: function(str) {
-            return str.replace(format_parts_re, '$6');
+        strip: function strip(str) {
+            str = str.replace(format_parts_re, '$6');
+            return str.replace(/(\\?)([[\]])/g, function(whole, slash) {
+                if (slash) {
+                    return whole;
+                } else {
+                    return '';
+                }
+            });
         },
         // ---------------------------------------------------------------------
         // :: Return active terminal
         // ---------------------------------------------------------------------
-        active: function() {
+        active: function active() {
             return terminals.front();
         },
-        // implmentation detail id is always length of terminals Cycle
-        last_id: function() {
+        // ---------------------------------------------------------------------
+        // :: Implmentation detail id is always length of terminals Cycle
+        // ---------------------------------------------------------------------
+        last_id: function last_id() {
             var len = terminals.length();
             if (len) {
                 return len - 1;
             }
         },
-        // keep old as backward compatible
-        parseArguments: function(string) {
-            return $.terminal.parse_arguments(string);
-        },
-        splitArguments: function(string) {
-            return $.terminal.split_arguments(string);
-        },
-        parseCommand: function(string) {
-            return $.terminal.parse_command(string);
-        },
-        splitCommand: function(string) {
-            return $.terminal.split_command(string);
-        },
         // ---------------------------------------------------------------------
-        // :: Function splits arguments and works with strings like
-        // :: 'asd' 'asd\' asd' "asd asd" asd\ 123 -n -b / [^ ]+ / /\s+/ asd\ a
-        // :: it creates a regex and numbers and replaces escape characters in
-        // :: double quotes
+        // :: Function that works with strings like 'asd' 'asd\' asd' "asd asd"
+        // :: asd\ 123 -n -b / [^ ]+ / /\s+/ asd\ a it creates a regex and
+        // :: numbers and replaces escape characters in double quotes
+        // :: if strict is set to false it only strips single and double quotes
+        // :: and escapes spaces
         // ---------------------------------------------------------------------
-        parse_arguments: function(string) {
-            var float_re = /^[-+]?[0-9]*\.?[0-9]+([eE][-+]?[0-9]+)?$/;
-            return $.map(string.match(command_re) || [], function(arg) {
-                if (arg[0] === "'" && arg[arg.length-1] === "'") {
+        parse_argument: function parse_argument(arg, strict) {
+            function parse_string(string) {
+                // remove quotes if before are even number of slashes
+                // we don't remove slases becuase they are handled by JSON.parse
+                //string = string.replace(/([^\\])['"]$/, '$1');
+                if (string.match(/^['"]/)) {
+                    var quote = string[0];
+                    var re = new RegExp("((^|[^\\\\])(?:\\\\\\\\)*)" + quote, "g");
+                    string = string.replace(re, "$1");
+                }
+                // use build in function to parse rest of escaped characters
+                return JSON.parse('"' + string + '"');
+            }
+            if (strict === false) {
+                if (arg[0] === "'" && arg[arg.length - 1] === "'") {
                     return arg.replace(/^'|'$/g, '');
-                } else if (arg[0] === '"' && arg[arg.length-1] === '"') {
-                    arg = arg.replace(/^"|"$/g, '').replace(/\\([" ])/g, '$1');
-                    return arg.replace(/\\\\|\\t|\\n/g, function(string) {
-                        if (string[1] === 't') {
-                            return '\t';
-                        } else if (string[1] === 'n') {
-                            return '\n';
-                        } else {
-                            return '\\';
-                        }
-                    }).replace(/\\x([0-9a-f]+)/gi, function(_, hex) {
-                        return String.fromCharCode(parseInt(hex, 16));
-                    }).replace(/\\0([0-7]+)/g, function(_, oct) {
-                        return String.fromCharCode(parseInt(oct, 8));
-                    });
-                } else if (arg.match(/^\/(\\\/|[^\/])+\/[gimy]*$/)) { // RegEx
-                    var m = arg.match(/^\/([^\/]+)\/([^\/]*)$/);
-                    return new RegExp(m[1], m[2]);
-                } else if (arg.match(/^-?[0-9]+$/)) {
-                    return parseInt(arg, 10);
-                } else if (arg.match(float_re)) {
-                    return parseFloat(arg);
+                } else if (arg[0] === '"' && arg[arg.length - 1] === '"') {
+                    return arg.replace(/^"|"$/g, '').replace(/\\([" ])/g, '$1');
+                } else if (arg.match(/\/.*\/[gimy]*$/)) {
+                    return arg;
+                } else if (arg.match(/['"]]/)) {
+                    // part of arg is in quote
+                    return parse_string(arg);
                 } else {
                     return arg.replace(/\\ /g, ' ');
                 }
-            });
+            }
+            var regex = arg.match(re_re);
+            if (regex) {
+                return new RegExp(regex[1], regex[2]);
+            } else if (arg.match(/['"]/)) {
+                return parse_string(arg);
+            } else if (arg.match(/^-?[0-9]+$/)) {
+                return parseInt(arg, 10);
+            } else if (arg.match(float_re)) {
+                return parseFloat(arg);
+            } else {
+                return arg.replace(/\\(['"() ])/g, '$1');
+            }
+        },
+        // ---------------------------------------------------------------------
+        // :: function split and parse arguments
+        // ---------------------------------------------------------------------
+        parse_arguments: function parse_arguments(string) {
+            return $.map(string.match(command_re) || [], $.terminal.parse_argument);
         },
         // ---------------------------------------------------------------------
-        // :: Split arguments: it only strips single and double quotes and
-        // :: escapes spaces
+        // :: Function split and strips single and double quotes
+        // :: and escapes spaces
         // ---------------------------------------------------------------------
         split_arguments: function(string) {
             return $.map(string.match(command_re) || [], function(arg) {
-                if (arg[0] === "'" && arg[arg.length-1] === "'") {
-                    return arg.replace(/^'|'$/g, '');
-                } else if (arg[0] === '"' && arg[arg.length-1] === '"') {
-                    return arg.replace(/^"|"$/g, '').replace(/\\([" ])/g, '$1');
-                } else if (arg.match(/\/.*\/[gimy]*$/)) {
-                    return arg;
-                } else {
-                    return arg.replace(/\\ /g, ' ');
-                }
+                return $.terminal.parse_argument(arg, false);
             });
         },
         // ---------------------------------------------------------------------
         // :: Function that returns an object {name,args}. Arguments are parsed
         // :: using the function parse_arguments
         // ---------------------------------------------------------------------
-        parse_command: function(string) {
-            return process_command(string, $.terminal.parse_arguments);
+        parse_command: function parse_command(string) {
+            return process_command(string, $.terminal.parse_argument);
         },
         // ---------------------------------------------------------------------
         // :: Same as parse_command but arguments are parsed using split_arguments
         // ---------------------------------------------------------------------
         split_command: function(string) {
-            return process_command(string, $.terminal.split_arguments);
+            return process_command(string, function(arg) {
+                return $.terminal.parse_argument(arg, false);
+            });
         },
         // ---------------------------------------------------------------------
         // :: function executed for each text inside [{ .... }]
         // ---------------------------------------------------------------------
-        extended_command: function(term, string) {
+        extended_command: function extended_command(term, string) {
             try {
                 change_hash = false;
-                term.exec(string, true).then(function() {
+                term.exec(string, true).done(function() {
                     change_hash = true;
                 });
-            } catch(e) {
+            } catch (e) {
                 // error is process in exec
             }
-        }
+        },
+        formatter: new (function() {
+            try {
+                this[Symbol.split] = function(string) {
+                    return $.terminal.format_split(string);
+                };
+                this[Symbol.match] = function(string) {
+                    return string.match(format_re);
+                };
+                this[Symbol.replace] = function(string, replacer) {
+                    return string.replace(format_parts_re, replacer);
+                };
+                this[Symbol.search] = function(string) {
+                    return string.search(format_re);
+                };
+            } catch (e) {
+            }
+        })()
     };
-
     // -----------------------------------------------------------------------
-    // Helper plugins
+    // Helper plugins and functions
     // -----------------------------------------------------------------------
     $.fn.visible = function() {
         return this.css('visibility', 'visible');
@@ -2375,49 +3563,147 @@
         return this.css('visibility', 'hidden');
     };
     // -----------------------------------------------------------------------
+    // :: hack to get scroll element if terminal attached to the body
+    // :: is better then userAgent sniffing because other browsers beside
+    // :: chrome may use body as scroll element instead of html like
+    // :: IE and FireFox
+    // -----------------------------------------------------------------------
+    $.fn.scroll_element = function() {
+        var defaults = $.fn.scroll_element.defaults;
+        return this.map(function() {
+            var $this = $(this);
+            if ($this.is('body')) {
+                if ('scrollingElement' in document) {
+                    return document.scrollingElement;
+                }
+                if ($.fn.scroll_element.cache) {
+                    return $.fn.scroll_element.cache;
+                }
+                var html = $('html');
+                var body = $('body');
+                var scrollTop = body.scrollTop() || html.scrollTop();
+                var pre = $('<pre/>').css(defaults.pre).appendTo('body');
+                $('body,html').scrollTop(10);
+                var scroll_object;
+                if (body.scrollTop() === 10) {
+                    body.scrollTop(scrollTop);
+                    scroll_object = body[0];
+                } else if (html.scrollTop() === 10) {
+                    html.scrollTop(scrollTop);
+                    scroll_object = html[0];
+                }
+                pre.remove();
+                $.fn.scroll_element.cache = scroll_object;
+                return scroll_object;
+            } else {
+                return this;
+            }
+        });
+    };
+    $.fn.scroll_element.defaults = {
+        lines: 2000,
+        pre: {
+            'height': '99999em'
+        }
+    };
+    $.fn.scroll_element.cache;
+    // -----------------------------------------------------------------------
+    function is_key_native() {
+        if (!('KeyboardEvent' in window && 'key' in window.KeyboardEvent.prototype)) {
+            return false;
+        }
+        var proto = window.KeyboardEvent.prototype;
+        var get = Object.getOwnPropertyDescriptor(proto, 'key').get;
+        return get.toString().match(/\[native code\]/);
+    }
+    // -----------------------------------------------------------------------
+    function warn(msg) {
+        msg = '[jQuery Terminal] ' + msg;
+        if (console && console.warn) {
+            console.warn(msg);
+        } else {
+            // prevent catching in outer try..catch
+            setTimeout(function() {
+                throw new Error('WARN: ' + msg);
+            }, 0);
+        }
+    }
+    // -----------------------------------------------------------------------
     // JSON-RPC CALL
     // -----------------------------------------------------------------------
-    var ids = {}; // list of url based id of JSON-RPC
+    var ids = {}; // list of url based ids of JSON-RPC
     $.jrpc = function(url, method, params, success, error) {
-        ids[url] = ids[url] || 0;
-        var request = JSON.stringify({
-           'jsonrpc': '2.0', 'method': method,
-            'params': params, 'id': ++ids[url]});
+        var options;
+        if ($.isPlainObject(url)) {
+            options = url;
+        } else {
+            options = {
+                url: url,
+                method: method,
+                params: params,
+                success: success,
+                error: error
+            };
+        }
+        function validJSONRPC(response) {
+            return $.isNumeric(response.id) &&
+                (typeof response.result !== 'undefined' ||
+                 typeof response.error !== 'undefined');
+        }
+        ids[options.url] = ids[options.url] || 0;
+        var request = {
+            'jsonrpc': '2.0',
+            'method': options.method,
+            'params': options.params,
+            'id': ++ids[options.url]
+        };
         return $.ajax({
-            url: url,
-            data: request,
-            success: function(result, status, jqXHR) {
+            url: options.url,
+            beforeSend: function beforeSend(jxhr, settings) {
+                if ($.isFunction(options.request)) {
+                    options.request(jxhr, request);
+                }
+                settings.data = JSON.stringify(request);
+            },
+            success: function success(response, status, jqXHR) {
                 var content_type = jqXHR.getResponseHeader('Content-Type');
                 if (!content_type.match(/(application|text)\/json/)) {
-                    var msg = 'Response Content-Type is neither application/json nor text/json';
-                    if (console && console.warn) {
-                        console.warn(msg);
-                    } else {
-                        throw new Error('WARN: ' + msg);
-                    }
+                    warn('Response Content-Type is neither application/json' +
+                         ' nor text/json');
                 }
                 var json;
                 try {
-                    json = $.parseJSON(result);
+                    json = JSON.parse(response);
                 } catch (e) {
-                    if (error) {
-                        error(jqXHR, 'Invalid JSON', e);
+                    if (options.error) {
+                        options.error(jqXHR, 'Invalid JSON', e);
                     } else {
                         throw new Error('Invalid JSON');
                     }
                     return;
                 }
-                // don't catch errors in success callback
-                success(json, status, jqXHR);
+                if ($.isFunction(options.response)) {
+                    options.response(jqXHR, json);
+                }
+                if (validJSONRPC(json) || options.method === 'system.describe') {
+                    // don't catch errors in success callback
+                    options.success(json, status, jqXHR);
+                } else if (options.error) {
+                    options.error(jqXHR, 'Invalid JSON-RPC');
+                } else {
+                    throw new Error('Invalid JSON-RPC');
+                }
             },
-            error: error,
+            error: options.error,
             contentType: 'application/json',
             dataType: 'text',
             async: true,
             cache: false,
-            //timeout: 1,
-            type: 'POST'});
+            // timeout: 1,
+            type: 'POST'
+        });
     };
+
     // -----------------------------------------------------------------------
     /*
     function is_scrolled_into_view(elem) {
@@ -2436,13 +3722,23 @@
     // :: DOM at init like with:
     // :: $('<div/>').terminal().echo('foo bar').appendTo('body');
     // -----------------------------------------------------------------------
-    function char_size() {
+    function get_char_size(div) {
         var temp = $('<div class="terminal temp"><div class="cmd"><span cla' +
-                     'ss="cursor">&nbsp;</span></div></div>').appendTo('body');
-        var span = temp.find('span');
+                     'ss="prompt">&nbsp;</span></div></div>').appendTo('body');
+        temp.addClass(div.attr('class'));
+        if (div) {
+            var style = div.attr('style');
+            if (style) {
+                style = style.split(/\s*;\s*/).filter(function(s) {
+                    return !s.match(/display\s*:\s*none/i);
+                }).join(';');
+                temp.attr('style', style);
+            }
+        }
+        var rect = temp.find('span')[0].getBoundingClientRect();
         var result = {
-            width: span.width(),
-            height: span.outerHeight()
+            width: rect.width,
+            height: rect.height
         };
         temp.remove();
         return result;
@@ -2450,158 +3746,175 @@
     // -----------------------------------------------------------------------
     // :: calculate numbers of characters
     // -----------------------------------------------------------------------
-    function get_num_chars(terminal) {
-        var temp = $('<div class="terminal wrap"><span class="cursor">' +
-                     '&nbsp;</span></div>').appendTo('body').css('padding', 0);
-        var span = temp.find('span');
-        var width = span[0].getBoundingClientRect().width;
-        var result = Math.floor(terminal.width() / width);
-        temp.remove();
-        if (have_scrollbars(terminal)) {
-            var SCROLLBAR_WIDTH = 20;
-            // assume that scrollbars are 20px - in my Laptop with
-            // Linux/Chrome they are 16px
-            var margins = terminal.innerWidth() - terminal.width();
-            result -= Math.ceil((SCROLLBAR_WIDTH - margins / 2) / (width-1));
-        }
-        return result;
+    function get_num_chars(terminal, char_size) {
+        var width = terminal.find('.terminal-fill').width();
+        var result = Math.floor(width / char_size.width);
+        // random number to not get NaN in node.js but big enough to
+        // not wrap exception
+        return result || 1000;
     }
     // -----------------------------------------------------------------------
     // :: Calculate number of lines that fit without scroll
     // -----------------------------------------------------------------------
-    function get_num_rows(terminal) {
-        return Math.floor(terminal.height() / char_size().height);
+    function get_num_rows(terminal, char_size) {
+        return Math.floor(terminal.find('.terminal-fill').height() / char_size.height);
     }
     // -----------------------------------------------------------------------
-    // :: Get Selected Text (this is internal because it return text even if
-    // :: it's outside of terminal, is used to paste text to the terminal)
+    // :: try to copy given DOM element text to clipboard
     // -----------------------------------------------------------------------
-    function get_selected_text() {
-        if (window.getSelection || document.getSelection) {
-            var selection = (window.getSelection || document.getSelection)();
-            if (selection.text) {
-                return selection.text;
-            } else {
-                return selection.toString();
-            }
-        } else if (document.selection) {
-            return document.selection.createRange().text;
-        }
+    function all(array, fn) {
+        var same = array.filter(function(item) {
+            return item[fn]() === item;
+        });
+        return same.length === array.length;
     }
-    // -----------------------------------------------------------------------
-    // :: check if div have scrollbars (need to have overflow auto or always)
-    // -----------------------------------------------------------------------
-    function have_scrollbars(div) {
-        if (div.css('overflow') == 'scroll' ||
-            div.css('overflow-y') == 'scroll') {
-            return true;
-        } else if (div.is('body')) {
-            return $("body").height() > $(window).height();
+    function string_case(string) {
+        var array = string.split('');
+        if (all(array, 'toLowerCase')) {
+            return 'lower';
+        } else if (all(array, 'toUpperCase')) {
+            return 'upper';
         } else {
-            return div.get(0).scrollHeight > div.innerHeight();
+            return 'mixed';
         }
     }
+    function same_case(string) {
+        return string_case(string) !== 'mixed';
+    }
     // -----------------------------------------------------------------------
     // :: TERMINAL PLUGIN CODE
     // -----------------------------------------------------------------------
     var version_set = !$.terminal.version.match(/^\{\{/);
-    var copyright = 'Copyright (c) 2011-2016 Jakub Jankiewicz <http://jcubic'+
-        '.pl>';
+    var copyright = 'Copyright (c) 2011-2018 Jakub Jankiewicz <http://jcubic' +
+        '.pl/me>';
     var version_string = version_set ? ' v. ' + $.terminal.version : ' ';
-    //regex is for placing version string aligned to the right
-    var reg = new RegExp(" {" + version_string.length + "}$");
+    // regex is for placing version string aligned to the right
+    var reg = new RegExp(' {' + version_string.length + '}$');
     var name_ver = 'jQuery Terminal Emulator' +
         (version_set ? version_string : '');
     // -----------------------------------------------------------------------
     // :: Terminal Signatures
     // -----------------------------------------------------------------------
     var signatures = [
-        ['jQuery Terminal', '(c) 2011-2016 jcubic'],
+        ['jQuery Terminal', '(c) 2011-2018 jcubic'],
         [name_ver, copyright.replace(/^Copyright | *<.*>/g, '')],
         [name_ver, copyright.replace(/^Copyright /, '')],
-        ['      _______                 ________                        __',
-         '     / / _  /_ ____________ _/__  ___/______________  _____  / /',
-         ' __ / / // / // / _  / _/ // / / / _  / _/     / /  \\/ / _ \\/ /',
-         '/  / / // / // / ___/ // // / / / ___/ // / / / / /\\  / // / /__',
-         '\\___/____ \\\\__/____/_/ \\__ / /_/____/_//_/_/_/ /_/  \\/\\__\\_\\___/',
-         '         \\/          /____/                                   '.replace(reg, ' ') +
-         version_string,
-         copyright],
-        ['      __ _____                     ________                              __',
-         '     / // _  /__ __ _____ ___ __ _/__  ___/__ ___ ______ __ __  __ ___  / /',
-         ' __ / // // // // // _  // _// // / / // _  // _//     // //  \\/ // _ \\/ /',
-         '/  / // // // // // ___// / / // / / // ___// / / / / // // /\\  // // / /__',
-         '\\___//____ \\\\___//____//_/ _\\_  / /_//____//_/ /_/ /_//_//_/ /_/ \\__\\_\\___/',
-         '          \\/              /____/                                          '.replace(reg, '') +
-         version_string,
-         copyright]
+        [
+            '      _______                 ________                        __',
+            '     / / _  /_ ____________ _/__  ___/______________  _____  / /',
+            ' __ / / // / // / _  / _/ // / / / _  / _/     / /  \\/ / _ \\/ /',
+            '/  / / // / // / ___/ // // / / / ___/ // / / / / /\\  / // / /__',
+            '\\___/____ \\\\__/____/_/ \\__ / /_/____/_//_/_/_/ /_/  \\/\\__\\_\\___/',
+            '         \\/          /____/                                   '
+                .replace(reg, ' ') + version_string,
+            copyright
+        ],
+        [
+            '      __ _____                     ________                            ' +
+                '  __',
+            '     / // _  /__ __ _____ ___ __ _/__  ___/__ ___ ______ __ __  __ ___ ' +
+                ' / /',
+            ' __ / // // // // // _  // _// // / / // _  // _//     // //  \\/ // _ ' +
+                '\\/ /',
+            '/  / // // // // // ___// / / // / / // ___// / / / / // // /\\  // // ' +
+                '/ /__',
+            '\\___//____ \\\\___//____//_/ _\\_  / /_//____//_/ /_/ /_//_//_/ /_/ \\' +
+                '__\\_\\___/',
+            ('          \\/              /____/                                     ' +
+             '     ').replace(reg, '') + version_string,
+            copyright
+        ]
     ];
     // -----------------------------------------------------------------------
     // :: Default options
     // -----------------------------------------------------------------------
+    $.terminal.nested_formatting.__meta__ = true;
     $.terminal.defaults = {
         prompt: '> ',
         history: true,
         exit: true,
         clear: true,
         enabled: true,
-        historySize: 60,
         maskChar: '*',
         wrap: true,
         checkArity: true,
         raw: false,
         exceptionHandler: null,
+        pauseEvents: true,
+        softPause: false,
         memory: false,
         cancelableAjax: true,
         processArguments: true,
         linksNoReferrer: false,
         processRPCResponse: null,
-        Token: true, // where this came from?
+        completionEscape: true,
         convertLinks: true,
+        extra: {},
+        tabs: 4,
+        historySize: 60,
         historyState: false,
+        importHistory: false,
+        historyFilter: null,
         echoCommand: true,
         scrollOnEcho: true,
         login: null,
         outputLimit: -1,
-        formatters: [],
+        formatters: [$.terminal.nested_formatting],
         onAjaxError: null,
-		scrollBottomOffset: 20,
+        pasteImage: true,
+        scrollBottomOffset: 20,
+        wordAutocomplete: true,
+        caseSensitiveAutocomplete: true,
+        clickTimeout: 200,
+        request: $.noop,
+        response: $.noop,
+        describe: 'procs',
         onRPCError: null,
         completion: false,
-        historyFilter: null,
         onInit: $.noop,
         onClear: $.noop,
         onBlur: $.noop,
         onFocus: $.noop,
         onTerminalChange: $.noop,
         onExit: $.noop,
+        onPush: $.noop,
+        onPop: $.noop,
         keypress: $.noop,
         keydown: $.noop,
+        onAfterRedraw: $.noop,
+        onEchoCommand: $.noop,
+        onFlush: $.noop,
         strings: {
-            wrongPasswordTryAgain: "Wrong password try again!",
-            wrongPassword: "Wrong password!",
-            ajaxAbortError: "Error while aborting ajax call!",
-            wrongArity: "Wrong number of arguments. Function '%s' expects %s got"+
-                " %s!",
+            comletionParameters: 'From version 1.0.0 completion function need to' +
+                ' have two arguments',
+            wrongPasswordTryAgain: 'Wrong password try again!',
+            wrongPassword: 'Wrong password!',
+            ajaxAbortError: 'Error while aborting ajax call!',
+            wrongArity: "Wrong number of arguments. Function '%s' expects %s got" +
+                ' %s!',
             commandNotFound: "Command '%s' Not Found!",
-            oneRPCWithIgnore: "You can use only one rpc with ignoreSystemDescr"+
-                "ibe",
-            oneInterpreterFunction: "You can't use more than one function (rpc"+
-                "with ignoreSystemDescribe counts as one)",
+            oneRPCWithIgnore: 'You can use only one rpc with describe == false ' +
+                'or rpc without system.describe',
+            oneInterpreterFunction: "You can't use more than one function (rpc " +
+                'without system.describe or with option describe == false count' +
+                 's as one)',
             loginFunctionMissing: "You didn't specify a login function",
-            noTokenError: "Access denied (no token)",
-            serverResponse: "Server responded",
-            wrongGreetings: "Wrong value of greetings parameter",
+            noTokenError: 'Access denied (no token)',
+            serverResponse: 'Server responded',
+            wrongGreetings: 'Wrong value of greetings parameter',
             notWhileLogin: "You can't call `%s' function while in login",
-            loginIsNotAFunction: "Authenticate must be a function",
+            loginIsNotAFunction: 'Authenticate must be a function',
             canExitError: "You can't exit from main interpreter",
-            invalidCompletion: "Invalid completion",
-            invalidSelector: 'Sorry, but terminal said that "%s" is not valid '+
+            invalidCompletion: 'Invalid completion',
+            invalidSelector: 'Sorry, but terminal said that "%s" is not valid ' +
                 'selector!',
             invalidTerminalId: 'Invalid Terminal ID',
-            login: "login",
-            password: "password",
-            recursiveCall: 'Recursive call detected, skip'
+            login: 'login',
+            password: 'password',
+            recursiveCall: 'Recursive call detected, skip',
+            notAString: '%s function: argument is not a string',
+            redrawError: 'Internal error, wrong position in cmd redraw',
+            invalidStrings: 'Command %s have unclosed strings'
         }
     };
     // -------------------------------------------------------------------------
@@ -2616,7 +3929,6 @@
     var change_hash = false; // don't change hash on Init
     var fire_hash_change = true;
     var first_instance = true; // used by history state
-    var last_id;
     $.fn.terminal = function(init_interpreter, options) {
         function StorageHelper(memory) {
             if (memory) {
@@ -2648,7 +3960,10 @@
         // :: helper function
         // ---------------------------------------------------------------------
         function get_processed_command(command) {
-            if ($.isFunction(settings.processArguments)) {
+            if ($.terminal.unclosed_strings(command)) {
+                var string = $.terminal.escape_brackets(command);
+                throw new Error(sprintf(strings().invalidStrings, "`" + string + "`"));
+            } else if ($.isFunction(settings.processArguments)) {
                 return process_command(command, settings.processArguments);
             } else if (settings.processArguments) {
                 return $.terminal.parse_command(command);
@@ -2679,19 +3994,19 @@
             var m = url_spec.match(re);
             if (m) {
                 // TODO: do we need to call pause/resume or return promise?
-                self.pause();
+                self.pause(settings.softPause);
                 $.get(m[1], function(response) {
-                    var prefix = location.href.replace(/[^\/]+$/, '');
+                    var prefix = location.href.replace(/[^/]+$/, '');
                     var file = m[1].replace(prefix, '');
                     self.echo('[[b;white;]' + file + ']');
                     var code = response.split('\n');
-                    var n = +m[2]-1;
-                    self.echo(code.slice(n-2, n+3).map(function(line, i) {
-                        if (i == 2) {
+                    var n = +m[2] - 1;
+                    self.echo(code.slice(n - 2, n + 3).map(function(line, i) {
+                        if (i === 2) {
                             line = '[[;#f00;]' +
                                 $.terminal.escape_brackets(line) + ']';
                         }
-                        return '[' + (n+i) + ']: ' + line;
+                        return '[' + (n + i) + ']: ' + line;
                     }).join('\n')).resume();
                 }, 'text');
             }
@@ -2723,32 +4038,50 @@
         // ---------------------------------------------------------------------
         function make_basic_json_rpc(url, auth) {
             var interpreter = function(method, params) {
-                self.pause();
-                $.jrpc(url, method, params, function(json) {
-                    if (json.error) {
-                        display_json_rpc_error(json.error);
-                    } else {
-                        if ($.isFunction(settings.processRPCResponse)) {
+                self.pause(settings.softPause);
+                $.jrpc({
+                    url: url,
+                    method: method,
+                    params: params,
+                    request: function(jxhr, request) {
+                        try {
+                            settings.request.call(self, jxhr, request, self);
+                        } catch (e) {
+                            display_exception(e, 'USER');
+                        }
+                    },
+                    response: function(jxhr, response) {
+                        try {
+                            settings.response.call(self, jxhr, response, self);
+                        } catch (e) {
+                            display_exception(e, 'USER');
+                        }
+                    },
+                    success: function success(json) {
+                        if (json.error) {
+                            display_json_rpc_error(json.error);
+                        } else if ($.isFunction(settings.processRPCResponse)) {
                             settings.processRPCResponse.call(self, json.result, self);
                         } else {
                             display_object(json.result);
                         }
-                    }
-                    self.resume();
-                }, ajax_error);
+                        self.resume();
+                    },
+                    error: ajax_error
+                });
             };
-            //this is the interpreter function
+            // this is the interpreter function
             return function(command, terminal) {
                 if (command === '') {
                     return;
                 }
                 try {
                     command = get_processed_command(command);
-                } catch(e) {
+                } catch (e) {
                     // exception can be thrown on invalid regex
-                    terminal.error(e.toString());
+                    display_exception(e, 'TERMINAL (get_processed_command)');
                     return;
-                    //throw e; // this will show stack in other try..catch
+                    // throw e; // this will show stack in other try..catch
                 }
                 if (!auth || command.name === 'help') {
                     // allows to call help without a token
@@ -2758,9 +4091,8 @@
                     if (token) {
                         interpreter(command.name, [token].concat(command.args));
                     } else {
-                        //should never happen
-                        terminal.error('&#91;AUTH&#93; ' +
-                                       strings.noTokenError);
+                        // should never happen
+                        terminal.error('&#91;AUTH&#93; ' + strings().noTokenError);
                     }
                 }
             };
@@ -2776,15 +4108,19 @@
                 if (user_command === '') {
                     return;
                 }
-                //command = split_command_line(command);
+                // command = split_command_line(command);
                 var command;
                 try {
                     command = get_processed_command(user_command);
-                } catch(e) {
+                } catch (e) {
                     // exception can be thrown on invalid regex
-                    self.error(e.toString());
+                    if ($.isFunction(settings.exception)) {
+                        settings.exception(e, self);
+                    } else {
+                        self.error(e.toString());
+                    }
                     return;
-                    //throw e; // this will show stack in other try..catch
+                    // throw e; // this will show stack in other try..catch
                 }
                 /*
                 if (login) {
@@ -2800,8 +4136,8 @@
                 var type = $.type(val);
                 if (type === 'function') {
                     if (arity && val.length !== command.args.length) {
-                        self.error("&#91;Arity&#93; " +
-                                   sprintf(strings.wrongArity,
+                        self.error('&#91;Arity&#93; ' +
+                                   sprintf(strings().wrongArity,
                                            command.name,
                                            val.length,
                                            command.args.length));
@@ -2821,15 +4157,12 @@
                         name: command.name,
                         completion: type === 'object' ? commands : undefined
                     });
+                } else if ($.isFunction(fallback)) {
+                    fallback(user_command, self);
+                } else if ($.isFunction(settings.onCommandNotFound)) {
+                    settings.onCommandNotFound.call(self, user_command, self);
                 } else {
-                    if ($.isFunction(fallback)) {
-                        fallback(user_command, self);
-                    } else if ($.isFunction(settings.onCommandNotFound)) {
-                        settings.onCommandNotFound(user_command, self);
-                    } else {
-                        terminal.error(sprintf(strings.commandNotFound,
-                                               command.name));
-                    }
+                    terminal.error(sprintf(strings().commandNotFound, command.name));
                 }
             };
         }
@@ -2840,70 +4173,104 @@
                 settings.onAjaxError.call(self, xhr, status, error);
             } else if (status !== 'abort') {
                 self.error('&#91;AJAX&#93; ' + status + ' - ' +
-                           strings.serverResponse + ': \n' +
+                           strings().serverResponse + ':\n' +
                            $.terminal.escape_brackets(xhr.responseText));
             }
         }
         // ---------------------------------------------------------------------
         function make_json_rpc_object(url, auth, success) {
-            $.jrpc(url, 'system.describe', [], function(ret) {
-                var commands = [];
-                if (ret.procs) {
+            function jrpc_success(json) {
+                if (json.error) {
+                    display_json_rpc_error(json.error);
+                } else if ($.isFunction(settings.processRPCResponse)) {
+                    settings.processRPCResponse.call(self, json.result, self);
+                } else {
+                    display_object(json.result);
+                }
+                self.resume();
+            }
+            function jrpc_request(jxhr, request) {
+                try {
+                    settings.request.call(self, jxhr, request, self);
+                } catch (e) {
+                    display_exception(e, 'USER');
+                }
+            }
+            function jrpc_response(jxhr, response) {
+                try {
+                    settings.response.call(self, jxhr, response, self);
+                } catch (e) {
+                    display_exception(e, 'USER');
+                }
+            }
+            function response(response) {
+                var procs = response;
+                // we check if it's false before we call this function but
+                // it don't hurt to be explicit here
+                if (settings.describe !== '') {
+                    settings.describe.split('.').forEach(function(field) {
+                        procs = procs[field];
+                    });
+                }
+                if (procs && procs.length) {
                     var interpreter_object = {};
-                    $.each(ret.procs, function(_, proc) {
-                        interpreter_object[proc.name] = function() {
-                            var append = auth && proc.name != 'help';
-                            var args = Array.prototype.slice.call(arguments);
-                            var args_len = args.length + (append ? 1 : 0);
-                            if (settings.checkArity && proc.params &&
-                                proc.params.length !== args_len) {
-                                self.error("&#91;Arity&#93; " +
-                                           sprintf(strings.wrongArity,
-                                                   proc.name,
-                                                   proc.params.length,
-                                                   args_len));
-                            } else {
-                                self.pause();
-                                if (append) {
-                                    var token = self.token(true);
-                                    if (token) {
-                                        args = [token].concat(args);
-                                    } else {
-                                        self.error('&#91;AUTH&#93; ' +
-                                                   strings.noTokenError);
-                                    }
-                                }
-                                $.jrpc(url, proc.name, args, function(json) {
-                                    if (json.error) {
-                                        display_json_rpc_error(json.error);
-                                    } else {
-                                        if ($.isFunction(settings.processRPCResponse)) {
-                                            settings.processRPCResponse.call(self,
-                                                                             json.result,
-                                                                             self);
+                    $.each(procs, function(_, proc) {
+                        if ($.isPlainObject(proc) && typeof proc.name === 'string') {
+                            interpreter_object[proc.name] = function() {
+                                var append = auth && proc.name !== 'help';
+                                var args = Array.prototype.slice.call(arguments);
+                                var args_len = args.length + (append ? 1 : 0);
+                                if (settings.checkArity && proc.params &&
+                                    proc.params.length !== args_len) {
+                                    self.error('&#91;Arity&#93; ' +
+                                               sprintf(strings().wrongArity,
+                                                       proc.name,
+                                                       proc.params.length,
+                                                       args_len));
+                                } else {
+                                    self.pause(settings.softPause);
+                                    if (append) {
+                                        var token = self.token(true);
+                                        if (token) {
+                                            args = [token].concat(args);
                                         } else {
-                                            display_object(json.result);
+                                            self.error('&#91;AUTH&#93; ' +
+                                                       strings().noTokenError);
                                         }
                                     }
-                                    self.resume();
-                                }, ajax_error);
-                            }
-                        };
+                                    $.jrpc({
+                                        url: url,
+                                        method: proc.name,
+                                        params: args,
+                                        request: jrpc_request,
+                                        response: jrpc_response,
+                                        success: jrpc_success,
+                                        error: ajax_error
+                                    });
+                                }
+                            };
+                        }
                     });
+                    var login = typeof auth === 'string' ? auth : 'login';
                     interpreter_object.help = interpreter_object.help || function(fn) {
-                        if (typeof fn == 'undefined') {
-                            self.echo('Available commands: ' + ret.procs.map(function(proc) {
+                        if (typeof fn === 'undefined') {
+                            var names = response.procs.map(function(proc) {
                                 return proc.name;
-                            }).join(', ') + ', help');
+                            }).join(', ') + ', help';
+                            self.echo('Available commands: ' + names);
                         } else {
                             var found = false;
-                            $.each(ret.procs, function(_, proc) {
-                                if (proc.name == fn) {
+                            $.each(procs, function(_, proc) {
+                                if (proc.name === fn) {
                                     found = true;
                                     var msg = '';
-                                    msg += '[[bu;#fff;]' + proc.name + ']';
+                                    msg += '[[bu;;]' + proc.name + ']';
                                     if (proc.params) {
-                                        msg += ' ' + proc.params.join(' ');
+                                        var params = proc.params;
+                                        if (auth && proc.name !== login) {
+                                            params = params.slice(1);
+                                        }
+                                        msg += ' ' + params.join(' ');
                                     }
                                     if (proc.help) {
                                         msg += '\n' + proc.help;
@@ -2913,12 +4280,12 @@
                                 }
                             });
                             if (!found) {
-                                if (fn == 'help') {
-                                    self.echo('[[bu;#fff;]help] [method]\ndisplay help ' +
-                                              'for the method or list of methods if not'+
+                                if (fn === 'help') {
+                                    self.echo('[[bu;;]help] [method]\ndisplay help ' +
+                                              'for the method or list of methods if not' +
                                               ' specified');
                                 } else {
-                                    var msg = 'Method `' + fn.toString() + '\' not found ';//'
+                                    var msg = 'Method `' + fn + "' not found ";
                                     self.error(msg);
                                 }
                             }
@@ -2928,8 +4295,17 @@
                 } else {
                     success(null);
                 }
-            }, function() {
-                success(null);
+            }
+            return $.jrpc({
+                url: url,
+                method: 'system.describe',
+                params: [],
+                success: response,
+                request: jrpc_request,
+                response: jrpc_response,
+                error: function error() {
+                    success(null);
+                }
             });
         }
         // ---------------------------------------------------------------------
@@ -2949,21 +4325,25 @@
                         var rest = interpreters.slice(1);
                         var type = $.type(first);
                         if (type === 'string') {
-                            rpc_count++;
-                            self.pause();
-                            if (settings.ignoreSystemDescribe) {
-                                if (rpc_count === 1) {
+                            self.pause(settings.softPause);
+                            if (settings.describe === false) {
+                                if (++rpc_count === 1) {
                                     fn_interpreter = make_basic_json_rpc(first, login);
                                 } else {
-                                    self.error(strings.oneRPCWithIgnore);
+                                    self.error(strings().oneRPCWithIgnore);
                                 }
                                 recur(rest, success);
                             } else {
                                 make_json_rpc_object(first, login, function(new_obj) {
-                                    // will ignore rpc in array that don't have
-                                    // system.describe
                                     if (new_obj) {
                                         $.extend(object, new_obj);
+                                    } else if (++rpc_count === 1) {
+                                        fn_interpreter = make_basic_json_rpc(
+                                            first,
+                                            login
+                                        );
+                                    } else {
+                                        self.error(strings().oneRPCWithIgnore);
                                     }
                                     self.resume();
                                     recur(rest, success);
@@ -2971,7 +4351,7 @@
                             }
                         } else if (type === 'function') {
                             if (fn_interpreter) {
-                                self.error(strings.oneInterpreterFunction);
+                                self.error(strings().oneInterpreterFunction);
                             } else {
                                 fn_interpreter = first;
                             }
@@ -2988,7 +4368,7 @@
                         interpreter: make_object_interpreter(object,
                                                              false,
                                                              login,
-                                                             fn_interpreter),
+                                                             fn_interpreter.bind(self)),
                         completion: Object.keys(object)
                     });
                 });
@@ -3002,7 +4382,7 @@
                     }
                     finalize(object);
                 } else {
-                    self.pause();
+                    self.pause(settings.softPause);
                     make_json_rpc_object(user_intrp, login, function(object) {
                         if (object) {
                             result.interpreter = make_object_interpreter(object,
@@ -3028,8 +4408,9 @@
                 if (type === 'undefined') {
                     user_intrp = $.noop;
                 } else if (type !== 'function') {
-                    throw type + " is invalid interpreter value";
+                    throw new Error(type + ' is invalid interpreter value');
                 }
+                // single function don't need bind
                 finalize({
                     interpreter: user_intrp,
                     completion: settings.completion
@@ -3041,43 +4422,53 @@
         // ---------------------------------------------------------------------
         function make_json_rpc_login(url, login) {
             var method = $.type(login) === 'boolean' ? 'login' : login;
-            return function(user, passwd, callback, term) {
-                self.pause();
-                $.jrpc(url,
-                       method,
-                       [user, passwd],
-                       function(response) {
-                           if (!response.error && response.result) {
-                               callback(response.result);
-                           } else {
-                               // null will trigger message that login fail
-                               callback(null);
-                           }
-                           self.resume();
-                       }, ajax_error);
+            return function(user, passwd, callback) {
+                self.pause(settings.softPause);
+                $.jrpc({
+                    url: url,
+                    method: method,
+                    params: [user, passwd],
+                    request: function(jxhr, request) {
+                        try {
+                            settings.request.call(self, jxhr, request, self);
+                        } catch (e) {
+                            display_exception(e, 'USER');
+                        }
+                    },
+                    response: function(jxhr, response) {
+                        try {
+                            settings.response.call(self, jxhr, response, self);
+                        } catch (e) {
+                            display_exception(e, 'USER');
+                        }
+                    },
+                    success: function success(response) {
+                        if (!response.error && response.result) {
+                            callback(response.result);
+                        } else {
+                            // null will trigger message that login fail
+                            callback(null);
+                        }
+                        self.resume();
+                    },
+                    error: ajax_error
+                });
             };
-            //default name is login so you can pass true
-        }
-        // ---------------------------------------------------------------------
-        // :: Return exception message as string
-        // ---------------------------------------------------------------------
-        function exception_message(e) {
-            if (typeof e === 'string') {
-                return e;
-            } else if (typeof e.fileName === 'string') {
-                return e.fileName + ': ' + e.message;
-            } else {
-                return e.message;
-            }
+            // default name is login so you can pass true
         }
         // ---------------------------------------------------------------------
         // :: display Exception on terminal
         // ---------------------------------------------------------------------
-        function display_exception(e, label) {
+        function display_exception(e, label, silent) {
             if ($.isFunction(settings.exceptionHandler)) {
-                settings.exceptionHandler.call(self, e);
+                settings.exceptionHandler.call(self, e, label);
             } else {
                 self.exception(e, label);
+                if (!silent) {
+                    setTimeout(function() {
+                        throw e;
+                    }, 0);
+                }
             }
         }
         // ---------------------------------------------------------------------
@@ -3097,9 +4488,7 @@
         function validate(label, object) {
             try {
                 if ($.isFunction(object)) {
-                    object(function() {
-                        // don't care
-                    });
+                    object.call(self, $.noop, self);
                 } else if (typeof object !== 'string') {
                     var msg = label + ' must be string or function';
                     throw msg;
@@ -3120,136 +4509,230 @@
         // ---------------------------------------------------------------------
         var output_buffer = [];
         var NEW_LINE = 1;
-        function buffer_line(string, options) {
+        function buffer_line(string, index, options) {
             // urls should always have formatting to keep url if split
-            if (settings.convertLinks && !options.raw) {
-                string = string.replace(email_re, '[[!;;]$1]').
-                    replace(url_nf_re, '[[!;;]$1]');
-            }
-            var formatters = $.terminal.defaults.formatters;
             var i, len;
-            if (!options.raw) {
-                // format using user defined formatters
-                for (i=0; i<formatters.length; ++i) {
-                    try {
-                        if (typeof formatters[i] == 'function') {
-                            var ret = formatters[i](string);
-                            if (typeof ret == 'string') {
-                                string = ret;
-                            }
-                        }
-                    } catch(e) {
-                        //display_exception(e, 'FORMATTING');
-                        alert('formatting error at formatters[' + i + ']\n' +
-                              (e.stack ? e.stack : e));
-                    }
-                }
-                string = $.terminal.encode(string);
-            }
             output_buffer.push(NEW_LINE);
-            if (!options.raw && (string.length > num_chars ||
-                                       string.match(/\n/)) &&
-                ((settings.wrap === true && options.wrap === undefined) ||
-                  settings.wrap === false && options.wrap === true)) {
-                var words = options.keepWords;
-                var array = $.terminal.split_equal(string, num_chars, words);
-                for (i = 0, len = array.length; i < len; ++i) {
-                    if (array[i] === '' || array[i] === '\r') {
-                        output_buffer.push('<span></span>');
-                    } else {
-                        if (options.raw) {
-                            output_buffer.push(array[i]);
+            if (string === '') {
+                // ignore empty string, it can happen if line was a function
+                // that returned empty string in this case whe need to add container
+                // because on update/resize it can return content
+            } else if (!options.raw) {
+                if ((strlen(string) > num_chars ||
+                     string.match(/\n/)) &&
+                    ((settings.wrap === true && options.wrap === undefined) ||
+                     settings.wrap === false && options.wrap === true)) {
+                    var words = options.keepWords;
+                    var array = $.terminal.split_equal(string, num_chars, words);
+                    for (i = 0, len = array.length; i < len; ++i) {
+                        if (array[i] === '' || array[i] === '\r') {
+                            output_buffer.push('<span></span>');
                         } else {
                             output_buffer.push($.terminal.format(array[i], {
                                 linksNoReferrer: settings.linksNoReferrer
                             }));
                         }
                     }
+                } else {
+                    string = $.terminal.normalize(string);
+                    string = $.terminal.format(string, {
+                        linksNoReferrer: settings.linksNoReferrer
+                    });
+                    string.split(/\n/).forEach(function(string) {
+                        output_buffer.push(string);
+                    });
                 }
-            } else if (!options.raw) {
-                string = $.terminal.format(string, {
-                    linksNoReferrer: settings.linksNoReferrer
-                });
-                string.split(/\n/).forEach(function(string) {
-                    output_buffer.push(string);
-                });
             } else {
                 output_buffer.push(string);
             }
-            output_buffer.push(options.finalize);
+            output_buffer.push({
+                finalize: options.finalize,
+                index: index
+            });
         }
         // ---------------------------------------------------------------------
-        function process_line(line, options) {
+        function process_line(line) {
             // prevent exception in display exception
             try {
                 var line_settings = $.extend({
                     exec: true,
                     raw: false,
                     finalize: $.noop
-                }, options || {});
-                var string = $.type(line) === "function" ? line() : line;
-                string = $.type(string) === "string" ? string : String(string);
+                }, line.options || {});
+                var string;
+                var arg = line.string;
+                var is_function = $.type(arg) === 'function';
+                if (is_function) {
+                    arg = arg();
+                }
+                if ($.type(arg) !== 'string') {
+                    if ($.isFunction(settings.parseObject)) {
+                        var ret = settings.parseObject(arg);
+                        if ($.type(ret) === 'string') {
+                            string = ret;
+                        }
+                    } else if (arg instanceof Array) {
+                        string = $.terminal.columns(arg, self.cols(), settings.tabs);
+                    } else {
+                        string = String(arg);
+                    }
+                } else {
+                    string = arg;
+                }
                 if (string !== '') {
-                    if (line_settings.exec) {
-                        string = $.map(string.split(format_exec_re), function(string) {
-                            if (string.match(format_exec_re) &&
-                                !$.terminal.is_formatting(string)) {
-                                // redraw should not execute commands and it have
-                                // and lines variable have all extended commands
-                                string = string.replace(/^\[\[|\]\]$/g, '');
-                                if (prev_command && prev_command.command == string) {
-                                    self.error(strings.recursiveCall);
+                    string = $.map(string.split(format_exec_re), function(string) {
+                        if (string && string.match(format_exec_re) &&
+                            !$.terminal.is_formatting(string)) {
+                            // redraw should not execute commands and it have
+                            // and lines variable have all extended commands
+                            string = string.replace(/^\[\[|\]\]$/g, '');
+                            if (line_settings.exec) {
+                                if (prev_command && prev_command.command === string) {
+                                    self.error(strings().recursiveCall);
                                 } else {
                                     $.terminal.extended_command(self, string);
                                 }
-                                return '';
-                            } else {
-                                return string;
                             }
-                        }).join('');
-                        if (string !== '') {
-                            // string can be empty after removing extended commands
-                            buffer_line(string, line_settings);
+                            return '';
+                        } else {
+                            return string;
                         }
-                    } else {
-                        buffer_line(string, line_settings);
+                    }).join('');
+                    // string can be empty after removing extended commands
+                    if (string !== '') {
+                        if (!line_settings.raw) {
+                            if (settings.convertLinks) {
+                                string = string.replace(email_re, '[[!;;]$1]').
+                                    replace(url_nf_re, '[[!;;]$1]');
+                            }
+                            if (line_settings.formatters) {
+                                try {
+                                    string = $.terminal.apply_formatters(string);
+                                } catch (e) {
+                                    display_exception(e, 'FORMATTING');
+                                }
+                            }
+                            string = $.terminal.encode(string);
+                        }
+                        buffer_line(string, line.index, line_settings);
                     }
                 }
+                if (string === '' && is_function) {
+                    buffer_line(string, line.index, line_settings);
+                }
             } catch (e) {
                 output_buffer = [];
                 // don't display exception if exception throw in terminal
-                alert('[Internal Exception(process_line)]:' +
-                      exception_message(e) + '\n' + e.stack);
+                if ($.isFunction(settings.exceptionHandler)) {
+                    settings.exceptionHandler.call(self, e, 'TERMINAL');
+                } else {
+                    alert_exception('[Internal Exception(process_line)]', e);
+                }
             }
         }
         // ---------------------------------------------------------------------
-        // :: Redraw all lines
+        // :: Update terminal lines
         // ---------------------------------------------------------------------
-        function redraw() {
-            command_line.resize(num_chars);
-            // we don't want reflow while processing lines
-            var detached_output = output.empty().detach();
-            var lines_to_show;
+        function redraw(options) {
+            options = $.extend({}, {
+                // should be used when single line is updated
+                update: false,
+                // should be used if you want to scroll to bottom after redraw
+                scroll: true
+            }, options || {});
+            if (!options.update) {
+                command_line.resize(num_chars);
+                // we don't want reflow while processing lines
+                var detached_output = output.empty().detach();
+            }
+            var lines_to_show = [];
+            // Dead code
             if (settings.outputLimit >= 0) {
                 // flush will limit lines but if there is lot of
                 // lines we don't need to show them and then remove
                 // them from terminal
-                var limit = settings.outputLimit === 0 ?
-                    self.rows() :
-                    settings.outputLimit;
-                lines_to_show = lines.slice(lines.length-limit-1);
+                var limit;
+                if (settings.outputLimit === 0) {
+                    limit = self.rows();
+                } else {
+                    limit = settings.outputLimit;
+                }
+                lines.forEach(function(line, index) {
+                    var string = line[0];
+                    var options = line[1];
+                    if ($.type(string) === 'function') {
+                        string = string();
+                    }
+                    if ($.type(string) !== 'string') {
+                        string = String(string);
+                    }
+                    lines_to_show.push({
+                        string: string,
+                        index: index,
+                        options: options
+                    });
+                });
+                lines_to_show = lines_to_show.slice(lines_to_show.length - limit - 1);
             } else {
-                lines_to_show = lines;
+                lines_to_show = lines.map(function(line, index) {
+                    return {
+                        string: line[0],
+                        index: index,
+                        options: line[1]
+                    };
+                });
             }
             try {
                 output_buffer = [];
                 $.each(lines_to_show, function(i, line) {
-                    process_line.apply(null, line); // line is an array
+                    process_line(line);
                 });
-                command_line.before(detached_output); // reinsert output
-                self.flush();
-            } catch(e) {
-                alert('Exception in redraw\n' + e.stack);
+                if (!options.update) {
+                    command_line.before(detached_output); // reinsert output
+                }
+                self.flush(options);
+                try {
+                    settings.onAfterRedraw.call(self);
+                } catch (e) {
+                    settings.onAfterRedraw = $.noop;
+                    display_exception(e, 'onAfterRedraw');
+                }
+            } catch (e) {
+                if ($.isFunction(settings.exceptionHandler)) {
+                    settings.exceptionHandler.call(self, e, 'TERMINAL (redraw)');
+                } else {
+                    alert_exception('[redraw]', e);
+                }
+            }
+        }
+        // ---------------------------------------------------------------------
+        // :: Function limit output lines based on outputLimit option
+        // ---------------------------------------------------------------------
+        function limit_lines() {
+            if (settings.outputLimit >= 0) {
+                var limit;
+                if (settings.outputLimit === 0) {
+                    limit = self.rows();
+                } else {
+                    limit = settings.outputLimit;
+                }
+                var $lines = output.find('> div > div');
+                if ($lines.length + 1 > limit) {
+                    var max = $lines.length - limit + 1;
+                    var for_remove = $lines.slice(0, max);
+                    // you can't get parent if you remove the
+                    // element so we first get the parent
+                    var parents = for_remove.parent();
+                    for_remove.remove();
+                    parents.each(function() {
+                        var $self = $(this);
+                        if ($self.is(':empty')) {
+                            // there can be divs inside parent that
+                            // was not removed
+                            $self.remove();
+                        }
+                    });
+                }
             }
         }
         // ---------------------------------------------------------------------
@@ -3257,15 +4740,21 @@
         // ---------------------------------------------------------------------
         function show_greetings() {
             if (settings.greetings === undefined) {
-                self.echo(self.signature);
+                // signature have ascii art so it's not suite for screen readers
+                self.echo(self.signature, {finalize: a11y_hide, formatters: false});
             } else if (settings.greetings) {
                 var type = typeof settings.greetings;
                 if (type === 'string') {
                     self.echo(settings.greetings);
                 } else if (type === 'function') {
-                    settings.greetings.call(self, self.echo);
+                    try {
+                        settings.greetings.call(self, self.echo);
+                    } catch (e) {
+                        settings.greetings = null;
+                        display_exception(e, 'greetings');
+                    }
                 } else {
-                    self.error(strings.wrongGreetings);
+                    self.error(strings().wrongGreetings);
                 }
             }
         }
@@ -3273,6 +4762,9 @@
         // :: Display prompt and last command
         // ---------------------------------------------------------------------
         function echo_command(command) {
+            if (typeof command === 'undefined') {
+                command = self.get_command();
+            }
             var prompt = command_line.prompt();
             var mask = command_line.mask();
             switch (typeof mask) {
@@ -3288,18 +4780,34 @@
                     break;
             }
             var options = {
-                finalize: function(div) {
-                    div.addClass('command');
+                finalize: function finalize(div) {
+                    a11y_hide(div.addClass('command'));
+                    try {
+                        settings.onEchoCommand.call(self, div, command);
+                    } catch (e) {
+                        settings.onEchoCommand = $.noop;
+                        self.exception(e);
+                    }
                 }
             };
             if ($.isFunction(prompt)) {
-                prompt(function(string) {
+                var ret = prompt(function(string) {
                     self.echo(string + command, options);
                 });
+                if (ret && ret.then) {
+                    ret.then(function(string) {
+                        if (typeof string === 'string') {
+                            self.echo(string + command, options);
+                        }
+                    });
+                }
             } else {
                 self.echo(prompt + command, options);
             }
         }
+        function have_scrollbar() {
+            return fill.outerWidth() !== self.outerWidth();
+        }
         // ---------------------------------------------------------------------
         // :: Helper function that restore state. Call import_view or exec
         // ---------------------------------------------------------------------
@@ -3307,7 +4815,7 @@
             // spec [terminal_id, state_index, command]
             var terminal = terminals.get()[spec[0]];
             if (!terminal) {
-                throw new Error(strings.invalidTerminalId);
+                throw new Error(strings().invalidTerminalId);
             }
             var command_idx = spec[1];
             if (save_state[command_idx]) { // state exists
@@ -3317,7 +4825,7 @@
                 change_hash = false;
                 var command = spec[2];
                 if (command) {
-                    terminal.exec(command).then(function() {
+                    terminal.exec(command).done(function() {
                         change_hash = true;
                         save_state[command_idx] = terminal.export_view();
                     });
@@ -3344,17 +4852,14 @@
         // :: exeptions from user code and displays them on the terminal
         // ---------------------------------------------------------------------
         var first_command = true;
-        var last_command;
         var resume_callbacks = [];
-        var resume_event_bound = false;
         function commands(command, silent, exec) {
-            last_command = command; // for debug
             // first command store state of the terminal before the command get
             // executed
             if (first_command) {
                 first_command = false;
                 // execHash need first empty command too
-                if (settings.historyState || (settings.execHash && exec)) {
+                if (settings.historyState || settings.execHash && exec) {
                     if (!save_state.length) {
                         // first command in first terminal don't have hash
                         self.save_state();
@@ -3374,13 +4879,20 @@
                 }
                 deferred.resolve();
                 if ($.isFunction(settings.onAfterCommand)) {
-                    settings.onAfterCommand(self, command);
+                    settings.onAfterCommand.call(self, self, command);
+                }
+            }
+            function show(result) {
+                if (typeof result !== 'undefined') {
+                    display_object(result);
                 }
+                after_exec();
+                self.resume();
             }
             try {
                 // this callback can disable commands
                 if ($.isFunction(settings.onBeforeCommand)) {
-                    if (settings.onBeforeCommand(self, command) === false) {
+                    if (settings.onBeforeCommand.call(self, self, command) === false) {
                         return;
                     }
                 }
@@ -3417,7 +4929,7 @@
                 } else if (settings.exit && command.match(/^\s*exit\s*$/) &&
                            !in_login) {
                     var level = self.level();
-                    if (level == 1 && self.get_token() || level > 1) {
+                    if (level === 1 && self.get_token() || level > 1) {
                         if (self.get_token(true)) {
                             self.set_token(undefined, true);
                         }
@@ -3429,22 +4941,18 @@
                     self.clear();
                     after_exec();
                 } else {
-                    var position = lines.length-1;
                     // Call user interpreter function
                     var result = interpreter.interpreter.call(self, command, self);
-                    if (result !== undefined) {
+                    if (result) {
                         // auto pause/resume when user return promises
-                        self.pause(true);
-                        return $.when(result).then(function(result) {
-                            // don't echo result if user echo something
-                            if (result && position === lines.length-1) {
-                                display_object(result);
-                            }
-                            after_exec();
-                            self.resume();
-                        });
+                        self.pause(settings.softPause);
+                        // when for native Promise object work only in jQuery 3.x
+                        if (result.then) {
+                            result.then(show);
+                        } else {
+                            return $.when(result).done(show);
+                        }
                     } else if (paused) {
-                        var old_command = command;
                         resume_callbacks.push(function() {
                             // exec with resume/pause in user code
                             after_exec();
@@ -3457,7 +4965,6 @@
             } catch (e) {
                 display_exception(e, 'USER');
                 self.resume();
-                throw e;
             }
         }
         // ---------------------------------------------------------------------
@@ -3468,7 +4975,7 @@
         function global_logout() {
             if ($.isFunction(settings.onBeforeLogout)) {
                 try {
-                    if (settings.onBeforeLogout(self) === false) {
+                    if (settings.onBeforeLogout.call(self, self) === false) {
                         return;
                     }
                 } catch (e) {
@@ -3478,12 +4985,12 @@
             clear_loging_storage();
             if ($.isFunction(settings.onAfterLogout)) {
                 try {
-                    settings.onAfterLogout(self);
+                    settings.onAfterLogout.call(self, self);
                 } catch (e) {
                     display_exception(e, 'onAfterlogout');
                 }
             }
-            self.login(settings.login, true, initialize);
+            self.login(global_login_fn, true, initialize);
         }
         // ---------------------------------------------------------------------
         function clear_loging_storage() {
@@ -3498,11 +5005,11 @@
             var storage_key = self.prefix_name() + '_interpreters';
             var names = storage.get(storage_key);
             if (names) {
-                names = $.parseJSON(names);
+                names = JSON.parse(names);
             } else {
                 names = [];
             }
-            if ($.inArray(interpreter_name, names) == -1) {
+            if ($.inArray(interpreter_name, names) === -1) {
                 names.push(interpreter_name);
                 storage.set(storage_key, JSON.stringify(names));
             }
@@ -3518,22 +5025,64 @@
             }
             command_line.name(name);
             if ($.isFunction(interpreter.prompt)) {
-                command_line.prompt(function(command) {
-                    interpreter.prompt(command, self);
+                command_line.prompt(function(callback) {
+                    var ret = interpreter.prompt.call(self, callback, self);
+                    if (ret && ret.then) {
+                        ret.then(function(string) {
+                            if (typeof string === 'string') {
+                                callback(string);
+                            }
+                        });
+                    }
                 });
             } else {
                 command_line.prompt(interpreter.prompt);
             }
+            if ($.isPlainObject(interpreter.keymap)) {
+                command_line.keymap($.omap(interpreter.keymap, function(name, fun) {
+                    return function() {
+                        var args = [].slice.call(arguments);
+                        try {
+                            return fun.apply(self, args);
+                        } catch (e) {
+                            display_exception(e, 'USER KEYMAP');
+                        }
+                    };
+                }));
+            }
             command_line.set('');
+            init_queue.resolve();
             if (!silent && $.isFunction(interpreter.onStart)) {
-                interpreter.onStart(self);
+                interpreter.onStart.call(self, self);
+            }
+        }
+        // ---------------------------------------------------------------------
+        function hashchange() {
+            if (fire_hash_change && settings.execHash) {
+                try {
+                    if (location.hash) {
+                        var hash = location.hash.replace(/^#/, '');
+                        hash_commands = JSON.parse(decodeURIComponent(hash));
+                    } else {
+                        hash_commands = [];
+                    }
+                    if (hash_commands.length) {
+                        restore_state(hash_commands[hash_commands.length - 1]);
+                    } else if (save_state[0]) {
+                        self.import_view(save_state[0]);
+                    }
+                } catch (e) {
+                    display_exception(e, 'TERMINAL');
+                }
             }
         }
         // ---------------------------------------------------------------------
-        var local_first_instance;
         function initialize() {
             prepare_top_interpreter();
             show_greetings();
+            if (lines.length) {
+                self.refresh(); // for case when showing long error before init
+            }
             // was_paused flag is workaround for case when user call exec before
             // login and pause in onInit, 3rd exec will have proper timing (will
             // execute after onInit resume)
@@ -3543,13 +5092,13 @@
                     was_paused = true;
                 };
                 try {
-                    settings.onInit(self);
+                    settings.onInit.call(self, self);
                 } catch (e) {
                     display_exception(e, 'OnInit');
                     // throw e; // it will be catched by terminal
                 } finally {
                     onPause = $.noop;
-                    if (!was_paused) {
+                    if (!was_paused && self.enabled()) {
                         // resume login if user didn't call pause in onInit
                         // if user pause in onInit wait with exec until it
                         // resume
@@ -3557,217 +5106,250 @@
                     }
                 }
             }
-            function hashchange() {
-                if (fire_hash_change && settings.execHash) {
-                    try {
-                        if (location.hash) {
-                            var hash = location.hash.replace(/^#/, '');
-                            hash_commands = $.parseJSON(decodeURIComponent(hash));
-                        } else {
-                            hash_commands = [];
-                        }
-                        if (hash_commands.length) {
-                            restore_state(hash_commands[hash_commands.length-1]);
-                        } else if (save_state[0]) {
-                            self.import_view(save_state[0]);
-                        }
-                    } catch(e) {
-                        display_exception(e, 'TERMINAL');
-                    }
-                }
-            }
             if (first_instance) {
                 first_instance = false;
-                if ($.fn.hashchange) {
-                    $(window).hashchange(hashchange);
-                } else {
-                    $(window).bind('hashchange', hashchange);
-                }
+                $(window).on('hashchange', hashchange);
             }
         }
         // ---------------------------------------------------------------------
-        // :: function complete the command
+        // :: If Ghost don't store anything in localstorage
         // ---------------------------------------------------------------------
-        function complete_helper(command, string, commands) {
-            if (settings.clear && $.inArray('clear', commands) == -1) {
-                commands.push('clear');
-            }
-            if (settings.exit && $.inArray('exit', commands) == -1) {
-                commands.push('exit');
-            }
-            var test = command_line.get().substring(0, command_line.position());
-            if (test !== command) {
-                // command line changed between TABS - ignore
-                return;
-            }
-            var regex = new RegExp('^' + $.terminal.escape_regex(string));
-            var matched = [];
-            for (var i=commands.length; i--;) {
-                if (regex.test(commands[i])) {
-                    matched.push(commands[i]);
-                }
+        function ghost() {
+            return in_login || command_line.mask() !== false;
+        }
+        // ---------------------------------------------------------------------
+        // :: return string that are common in all elements of the array
+        // ---------------------------------------------------------------------
+        function common_string(string, array, matchCase) {
+            if (!array.length) {
+                return '';
             }
-            if (matched.length === 1) {
-                self.insert(matched[0].replace(regex, ''));
-            } else if (matched.length > 1) {
-                if (tab_count >= 2) {
-                    echo_command(command);
-                    var text = matched.reverse().join('\t');
-                    self.echo($.terminal.escape_brackets(text), {keepWords: true});
-                    tab_count = 0;
-                } else {
-                    var found = false;
-                    var found_index;
-                    var j;
-                    loop:
-                    for (j=string.length; j<matched[0].length; ++j) {
-                        for (i=1; i<matched.length; ++i) {
-                            if (matched[0].charAt(j) !== matched[i].charAt(j)) {
-                                break loop;
+            var type = string_case(string);
+            var result = [];
+            for (var j = string.length; j < array[0].length; ++j) {
+                var push = false;
+                var candidate = array[0].charAt(j),
+                    candidateLower = candidate.toLowerCase();
+                for (var i = 1; i < array.length; ++i) {
+                    push = true;
+                    var current = array[i].charAt(j),
+                        currentLower = current.toLowerCase();
+                    if (candidate !== current) {
+                        if (matchCase || type === 'mixed') {
+                            push = false;
+                            break;
+                        } else if (candidateLower === currentLower) {
+                            if (type === 'lower') {
+                                candidate = candidate.toLowerCase();
+                            } else if (type === 'upper') {
+                                candidate = candidate.toUpperCase();
+                            } else {
+                                push = false;
+                                break;
                             }
+                        } else {
+                            push = false;
+                            break;
                         }
-                        found = true;
-                    }
-                    if (found) {
-                        self.insert(matched[0].slice(0, j).replace(regex, ''));
                     }
                 }
+                if (push) {
+                    result.push(candidate);
+                } else {
+                    break;
+                }
             }
+            return string + result.join('');
         }
         // ---------------------------------------------------------------------
-        // :: If Ghost don't store anything in localstorage
         // ---------------------------------------------------------------------
-        function ghost() {
-            return in_login || command_line.mask() !== false;
+        function trigger_terminal_change(next) {
+            terminals.forEach(function(term) {
+                term.settings().onTerminalChange.call(term, next);
+            });
         }
         // ---------------------------------------------------------------------
         // :: Keydown event handler
         // ---------------------------------------------------------------------
-        function key_down(e) {
-            // Prevent to be executed by cmd: CTRL+D, TAB, CTRL+TAB (if more
-            // then one terminal)
-            var result, i, top = interpreters.top(), completion;
-            if (!self.paused() && self.enabled()) {
-                if ($.isFunction(top.keydown)) {
-                    result = top.keydown(e, self);
-                    if (result !== undefined) {
-                        return result;
-                    }
-                } else if ($.isFunction(settings.keydown)) {
-                    result = settings.keydown(e, self);
-                    if (result !== undefined) {
-                        return result;
+        function user_key_down(e) {
+            var result, top = interpreters.top();
+            if ($.isFunction(top.keydown)) {
+                result = top.keydown.call(self, e, self);
+                if (result !== undefined) {
+                    return result;
+                }
+            } else if ($.isFunction(settings.keydown)) {
+                result = settings.keydown.call(self, e, self);
+                if (result !== undefined) {
+                    return result;
+                }
+            }
+        }
+        var keymap = {
+            'CTRL+D': function(e, original) {
+                if (!in_login) {
+                    if (command_line.get() === '') {
+                        if (interpreters.size() > 1 ||
+                            $.isFunction(global_login_fn)) {
+                            self.pop('');
+                        } else {
+                            self.resume();
+                            self.echo('');
+                        }
+                    } else {
+                        original();
                     }
                 }
+                return false;
+            },
+            'CTRL+C': function() {
+                if (get_selected_text() === '') {
+                    echo_command(self.get_command() + '^C');
+                    self.set_command('');
+                }
+            },
+            'CTRL+L': function() {
+                self.clear();
+            },
+            'TAB': function(e, orignal) {
+                // TODO: move this to cmd plugin
+                //       add completion = array | function
+                //       !!! Problem complete more then one key need terminal
+                var top = interpreters.top(), completion, caseSensitive;
+                if (typeof top.caseSensitiveAutocomplete !== 'undefined') {
+                    caseSensitive = top.caseSensitiveAutocomplete;
+                } else {
+                    caseSensitive = settings.caseSensitiveAutocomplete;
+                }
                 if (settings.completion &&
-                    $.type(settings.completion) != 'boolean' &&
+                    $.type(settings.completion) !== 'boolean' &&
                     top.completion === undefined) {
                     completion = settings.completion;
                 } else {
                     completion = top.completion;
                 }
-                if (completion == 'settings') {
+                if (completion === 'settings') {
                     completion = settings.completion;
                 }
-                // after text pasted into textarea in cmd plugin
-                self.oneTime(10, function() {
-                    on_scrollbar_show_resize();
-                });
-                if (e.which !== 9) { // not a TAB
-                    tab_count = 0;
-                }
-                if (e.which === 68 && e.ctrlKey) { // CTRL+D
-                    if (!in_login) {
-                        if (command_line.get() === '') {
-                            if (interpreters.size() > 1 ||
-                                settings.login !== undefined) {
-                                self.pop('');
-                            } else {
-                                self.resume();
-                                self.echo('');
-                            }
-                        } else {
-                            self.set_command('');
-                        }
-                    }
-                    return false;
-                } else if (e.which === 76 && e.ctrlKey) { // CTRL+L
-                    self.clear();
-                } else if (completion && e.which === 9) { // TAB
-                    // TODO: move this to cmd plugin
-                    //       add completion = array | function
-                    //       !!! Problem complete more then one key need terminal
-                    ++tab_count;
-                    // cursor can be in the middle of the command
-                    // so we need to get the text before the cursor
-                    var pos = command_line.position();
-                    var command = command_line.get().substring(0, pos);
-                    var cmd_strings = command.split(' ');
-                    var string; // string before cursor that will be completed
-                    if (strings.length == 1) {
-                        string = cmd_strings[0];
-                    } else {
-                        string = cmd_strings[cmd_strings.length-1];
-                        for (i=cmd_strings.length-1; i>0; i--) {
-                            // treat escape space as part of the string
-                            if (cmd_strings[i-1][cmd_strings[i-1].length-1] == '\\') {
-                                string = cmd_strings[i-1] + ' ' + string;
-                            } else {
-                                break;
-                            }
-                        }
-                    }
+                if (completion) {
                     switch ($.type(completion)) {
                         case 'function':
-                            completion(self, string, function(commands) {
-                                complete_helper(command, string, commands);
+                            var string = self.before_cursor(settings.wordAutocomplete);
+                            if (completion.length === 3) {
+                                var error = new Error(strings().comletionParameters);
+                                display_exception(error, 'USER');
+                                return false;
+                            }
+                            completion.call(self, string, function(commands) {
+                                self.complete(commands, {
+                                    echo: true,
+                                    word: settings.wordAutocomplete,
+                                    escape: settings.completionEscape,
+                                    caseSensitive: caseSensitive
+                                });
                             });
                             break;
                         case 'array':
-                            complete_helper(command, string, completion);
+                            self.complete(completion, {
+                                echo: true,
+                                word: settings.wordAutocomplete,
+                                escape: settings.completionEscape,
+                                caseSensitive: caseSensitive
+                            });
                             break;
                         default:
-                            // terminal will not catch this because it's an event
-                            throw new Error(strings.invalidCompletion);
+                            throw new Error(strings().invalidCompletion);
                     }
-                    return false;
-                } else if ((e.which === 118 || e.which === 86) &&
-                           (e.ctrlKey || e.metaKey)) { // CTRL+V
-                    self.oneTime(1, function() {
-                        scroll_to_bottom();
-                    });
-                    return;
-                } else if (e.which === 9 && e.ctrlKey) { // CTRL+TAB
-                    if (terminals.length() > 1) {
-                        self.focus(false);
-                        return false;
-                    }
-                } else if (e.which === 34) { // PAGE DOWN
-                    self.scroll(self.height());
-                } else if (e.which === 33) { // PAGE UP
-                    self.scroll(-self.height());
                 } else {
-                    self.attr({scrollTop: self.attr('scrollHeight')});
+                    orignal();
                 }
-            } else if (e.which === 68 && e.ctrlKey) { // CTRL+D (if paused)
-                if (requests.length) {
-                    for (i=requests.length; i--;) {
-                        var r = requests[i];
-                        if (4 !== r.readyState) {
-                            try {
-                                r.abort();
-                            } catch (error) {
-                                self.error(strings.ajaxAbortError);
+                return false;
+            },
+            'CTRL+V': function(e, original) {
+                original(e);
+                self.oneTime(200, function() {
+                    scroll_to_bottom();
+                });
+                return true;
+            },
+            'CTRL+TAB': function() {
+                if (terminals.length() > 1) {
+                    self.focus(false);
+                    return false;
+                }
+            },
+            'PAGEDOWN': function() {
+                self.scroll(self.height());
+            },
+            'PAGEUP': function() {
+                self.scroll(-self.height());
+            }
+        };
+        function key_down(e) {
+            // Prevent to be executed by cmd: CTRL+D, TAB, CTRL+TAB (if more
+            // then one terminal)
+            var result, i;
+            if (self.enabled()) {
+                if (!self.paused()) {
+                    result = user_key_down(e);
+                    if (result !== undefined) {
+                        return result;
+                    }
+                    if (e.which !== 9) { // not a TAB
+                        tab_count = 0;
+                    }
+                    self.attr({scrollTop: self.attr('scrollHeight')});
+                } else {
+                    if (!settings.pauseEvents) {
+                        result = user_key_down(e);
+                        if (result !== undefined) {
+                            return result;
+                        }
+                    }
+                    if (e.which === 68 && e.ctrlKey) { // CTRL+D (if paused)
+                        if (settings.pauseEvents) {
+                            result = user_key_down(e);
+                            if (result !== undefined) {
+                                return result;
+                            }
+                        }
+                        if (requests.length) {
+                            for (i = requests.length; i--;) {
+                                var r = requests[i];
+                                if (r.readyState !== 4) {
+                                    try {
+                                        r.abort();
+                                    } catch (error) {
+                                        if ($.isFunction(settings.exceptionHandler)) {
+                                            settings.exceptionHandler.call(self,
+                                                                           e,
+                                                                           'AJAX ABORT');
+                                        } else {
+                                            self.error(strings().ajaxAbortError);
+                                        }
+                                    }
+                                }
                             }
+                            requests = [];
                         }
+                        self.resume();
                     }
-                    requests = [];
-                    // only resume if there are ajax calls
-                    self.resume();
+                    return false;
                 }
-                return false;
             }
         }
+        function ready(queue) {
+            return function(fun) {
+                queue.add(fun);
+            };
+        }
+        function strings() {
+            return $.extend(
+                {},
+                $.terminal.defaults.strings,
+                settings && settings.strings || {}
+            );
+        }
         // ---------------------------------------------------------------------
         var self = this;
         if (this.length > 1) {
@@ -3782,12 +5364,11 @@
             return self.data('terminal');
         }
         if (self.length === 0) {
-            throw sprintf($.terminal.defaults.strings.invalidSelector, self.selector);
+            throw new Error(sprintf(strings().invalidSelector, self.selector));
         }
-        //var names = []; // stack if interpreter names
+        // var names = []; // stack if interpreter names
         var scroll_object;
         var prev_command; // used for name on the terminal if not defined
-        var loged_in = false;
         var tab_count = 0; // for tab completion
         // array of line objects:
         // - function (called whenever necessary, result is printed)
@@ -3798,14 +5379,16 @@
         var terminal_id = terminals.length();
         var num_chars; // numer of chars in line
         var num_rows; // number of lines that fit without scrollbar
-        var command_list = []; // for tab completion
-        var url;
-        var bottom; // indicate if terminal was scrolled to bottom before echo command
+        var command; // for tab completion
         var logins = new Stack(); // stack of logins
-        var init_deferr = $.Deferred();
-        var in_login = false;//some Methods should not be called when login
+        var command_queue = new DelayQueue();
+        var init_queue = new DelayQueue();
+        var when_ready = ready(init_queue);
+        var char_size = get_char_size(self);
+        var cmd_ready = ready(command_queue);
+        var in_login = false;// some Methods should not be called when login
         // TODO: Try to use mutex like counter for pause/resume
-        var onPause = $.noop;//used to indicate that user call pause onInit
+        var onPause = $.noop;// used to indicate that user call pause onInit
         var old_width, old_height;
         var delayed_commands = []; // used when exec commands while paused
         var settings = $.extend({},
@@ -3813,10 +5396,14 @@
                                 {name: self.selector},
                                 options || {});
         var storage = new StorageHelper(settings.memory);
-        var strings = $.terminal.defaults.strings;
         var enabled = settings.enabled, frozen = false;
         var paused = false;
-        var autologin = true; // set to false of onBeforeLogin return false
+        var autologin = true; // set to false if onBeforeLogin return false
+        var interpreters;
+        var command_line;
+        var old_enabled;
+        var visibility_observer;
+        var mutation_observer;
         // -----------------------------------------------------------------
         // TERMINAL METHODS
         // -----------------------------------------------------------------
@@ -3831,11 +5418,11 @@
                 output.html('');
                 lines = [];
                 try {
-                    settings.onClear(self);
+                    settings.onClear.call(self, self);
                 } catch (e) {
                     display_exception(e, 'onClear');
                 }
-                self.attr({ scrollTop: 0});
+                self.attr({scrollTop: 0});
                 return self;
             },
             // -------------------------------------------------------------
@@ -3846,8 +5433,8 @@
                 var user_export = {};
                 if ($.isFunction(settings.onExport)) {
                     try {
-                        user_export = settings.onExport();
-                    } catch(e) {
+                        user_export = settings.onExport.call(self);
+                    } catch (e) {
                         display_exception(e, 'onExport');
                     }
                 }
@@ -3858,7 +5445,8 @@
                     command: self.get_command(),
                     position: command_line.position(),
                     lines: clone(lines),
-                    interpreters: interpreters.clone()
+                    interpreters: interpreters.clone(),
+                    history: command_line.history().data
                 }, user_export);
             },
             // -------------------------------------------------------------
@@ -3866,16 +5454,17 @@
             // -------------------------------------------------------------
             import_view: function(view) {
                 if (in_login) {
-                    throw new Error(sprintf(strings.notWhileLogin, 'import_view'));
+                    throw new Error(sprintf(strings().notWhileLogin, 'import_view'));
                 }
                 if ($.isFunction(settings.onImport)) {
                     try {
-                        settings.onImport(view);
-                    } catch(e) {
+                        settings.onImport.call(self, view);
+                    } catch (e) {
+                        settings.onImport = $.noop;
                         display_exception(e, 'onImport');
                     }
                 }
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     self.set_prompt(view.prompt);
                     self.set_command(view.command);
                     command_line.position(view.position);
@@ -3885,6 +5474,9 @@
                     }
                     lines = clone(view.lines);
                     interpreters = view.interpreters;
+                    if (settings.importHistory) {
+                        command_line.history().set(view.history);
+                    }
                     redraw();
                 });
                 return self;
@@ -3893,8 +5485,8 @@
             // :: Store current terminal state
             // -------------------------------------------------------------
             save_state: function(command, ignore_hash, index) {
-                //save_state.push({view:self.export_view(), join:[]});
-                if (typeof index != 'undefined') {
+                // save_state.push({view:self.export_view(), join:[]});
+                if (typeof index !== 'undefined') {
                     save_state[index] = self.export_view();
                 } else {
                     save_state.push(self.export_view());
@@ -3905,7 +5497,7 @@
                 if (command !== undefined && !ignore_hash) {
                     var state = [
                         terminal_id,
-                        save_state.length-1,
+                        save_state.length - 1,
                         command
                     ];
                     hash_commands.push(state);
@@ -3919,12 +5511,12 @@
             // -------------------------------------------------------------
             exec: function(command, silent, deferred) {
                 var d = deferred || new $.Deferred();
-                function run() {
+                cmd_ready(function ready() {
                     if ($.isArray(command)) {
                         (function recur() {
                             var cmd = command.shift();
                             if (cmd) {
-                                self.exec(cmd, silent).then(recur);
+                                self.exec(cmd, silent).done(recur);
                             } else {
                                 d.resolve();
                             }
@@ -3937,18 +5529,13 @@
                         // commands may return promise from user code
                         // it will resolve exec promise when user promise
                         // is resolved
-                        commands(command, silent, true).then(function() {
+                        commands(command, silent, true).done(function() {
                             d.resolve(self);
                         });
                     }
-                }
+                });
                 // while testing it didn't executed last exec when using this
                 // for resolved deferred
-                if (init_deferr.state() != 'resolved') {
-                    init_deferr.then(run);
-                } else {
-                    run();
-                }
                 return d.promise();
             },
             // -------------------------------------------------------------
@@ -3968,35 +5555,32 @@
             login: function(auth, infinite, success, error) {
                 logins.push([].slice.call(arguments));
                 if (in_login) {
-                    throw new Error(sprintf(strings.notWhileLogin, 'login'));
+                    throw new Error(sprintf(strings().notWhileLogin, 'login'));
                 }
                 if (!$.isFunction(auth)) {
-                    throw new Error(strings.loginIsNotAFunction);
+                    throw new Error(strings().loginIsNotAFunction);
                 }
                 in_login = true;
-                if (self.token() && self.level() == 1 && !autologin) {
+                if (self.token() && self.level() === 1 && !autologin) {
                     in_login = false; // logout will call login
                     self.logout(true);
-                } else {
-                    if (self.token(true) && self.login_name(true)) {
-                        in_login = false;
-                        if ($.isFunction(success)) {
-                            success();
-                        }
-                        return self;
+                } else if (self.token(true) && self.login_name(true)) {
+                    in_login = false;
+                    if ($.isFunction(success)) {
+                        success();
                     }
+                    return self;
                 }
-                var user = null;
                 // don't store login data in history
                 if (settings.history) {
                     command_line.history().disable();
                 }
                 // so we know how many times call pop
                 var level = self.level();
-                function login_callback(user, token, silent, event) {
+                function login_callback(user, token, silent) {
                     if (token) {
                         while (self.level() > level) {
-                            self.pop();
+                            self.pop(undefined, true);
                         }
                         if (settings.history) {
                             command_line.history().enable();
@@ -4015,15 +5599,15 @@
                     } else {
                         if (infinite) {
                             if (!silent) {
-                                self.error(strings.wrongPasswordTryAgain);
+                                self.error(strings().wrongPasswordTryAgain);
                             }
-                            self.pop().set_mask(false);
+                            self.pop(undefined, true).set_mask(false);
                         } else {
                             in_login = false;
                             if (!silent) {
-                                self.error(strings.wrongPassword);
+                                self.error(strings().wrongPassword);
                             }
-                            self.pop().pop();
+                            self.pop(undefined, true).pop(undefined, true);
                         }
                         // used only to call pop in push
                         if ($.isFunction(error)) {
@@ -4041,15 +5625,15 @@
                             auth.call(self, user, pass, function(token, silent) {
                                 login_callback(user, token, silent);
                             });
-                        } catch(e) {
+                        } catch (e) {
                             display_exception(e, 'AUTH');
                         }
                     }, {
-                        prompt: strings.password + ': ',
+                        prompt: strings().password + ': ',
                         name: 'password'
                     });
                 }, {
-                    prompt: strings.login + ': ',
+                    prompt: strings().login + ': ',
                     name: 'login'
                 });
                 return self;
@@ -4061,6 +5645,164 @@
                 return settings;
             },
             // -------------------------------------------------------------
+            // :: Get string before cursor
+            // -------------------------------------------------------------
+            before_cursor: function(word) {
+                var pos = command_line.position();
+                var command = command_line.get().substring(0, pos);
+                var cmd_strings = command.split(' ');
+                var string; // string before cursor that will be completed
+                if (word) {
+                    if (cmd_strings.length === 1) {
+                        string = cmd_strings[0];
+                    } else {
+                        var m = command.match(/(\\?")/g);
+                        var double_quotes = m ? m.filter(function(chr) {
+                            return !chr.match(/^\\/);
+                        }).length : 0;
+                        m = command.match(/'/g);
+                        var single_quote = m ? m.length : 0;
+                        if (single_quote % 2 === 1) {
+                            string = command.match(/('[^']*)$/)[0];
+                        } else if (double_quotes % 2 === 1) {
+                            string = command.match(/("(?:[^"]|\\")*)$/)[0];
+                        } else {
+                            string = cmd_strings[cmd_strings.length - 1];
+                            for (i = cmd_strings.length - 1; i > 0; i--) {
+                                // treat escape space as part of the string
+                                var prev_string = cmd_strings[i - 1];
+                                if (prev_string[prev_string.length - 1] === '\\') {
+                                    string = cmd_strings[i - 1] + ' ' + string;
+                                } else {
+                                    break;
+                                }
+                            }
+                        }
+                    }
+                } else {
+                    string = command;
+                }
+                return string;
+            },
+            // -------------------------------------------------------------
+            // :: complete word or command based on array of words
+            // -------------------------------------------------------------
+            complete: function(commands, options) {
+                options = $.extend({
+                    word: true,
+                    echo: false,
+                    escape: true,
+                    caseSensitive: true
+                }, options || {});
+                var sensitive = options.caseSensitive;
+                // cursor can be in the middle of the command
+                // so we need to get the text before the cursor
+                var string = self.before_cursor(options.word).replace(/\\"/g, '"');
+                var quote = false;
+                if (options.word) {
+                    if (string.match(/^"/)) {
+                        quote = '"';
+                    } else if (string.match(/^'/)) {
+                        quote = "'";
+                    }
+                    if (quote) {
+                        string = string.replace(/^["']/, '');
+                    }
+                }
+                // local copy
+                commands = commands.slice();
+                if (settings.clear && $.inArray('clear', commands) === -1) {
+                    commands.push('clear');
+                }
+                if (settings.exit && $.inArray('exit', commands) === -1) {
+                    commands.push('exit');
+                }
+                if (tab_count % 2 === 0) {
+                    command = self.before_cursor(options.word);
+                } else {
+                    var test = self.before_cursor(options.word);
+                    if (test !== command) {
+                        // command line changed between TABS - ignore
+                        return;
+                    }
+                }
+                var safe = $.terminal.escape_regex(string);
+                if (options.escape) {
+                    safe = safe.replace(/(\\+)(["'() ])/g, function(_, slash, chr) {
+                        if (chr.match(/[()]/)) {
+                            return slash + '\\?\\' + chr;
+                        } else {
+                            return slash + '?' + chr;
+                        }
+                    });
+                }
+                function matched_strings() {
+                    var matched = [];
+                    for (var i = commands.length; i--;) {
+                        if (regex.test(commands[i])) {
+                            var match = commands[i];
+                            if (quote === '"') {
+                                match = match.replace(/"/g, '\\"');
+                            }
+                            if (!quote && options.escape) {
+                                match = match.replace(/(["'() ])/g, '\\$1');
+                            }
+                            if (!sensitive && same_case(match)) {
+                                if (string.toLowerCase() === string) {
+                                    match = match.toLowerCase();
+                                } else if (string.toUpperCase() === string) {
+                                    match = match.toUpperCase();
+                                }
+                            }
+                            matched.push(match);
+                        }
+                    }
+                    return matched;
+                }
+                var flags = sensitive ? '' : 'i';
+                var regex = new RegExp('^' + safe, flags);
+                var matched = matched_strings();
+                function replace(input, replacement) {
+                    var text = self.get_command();
+                    var pos = self.get_position();
+                    var re = new RegExp('^' + input, 'i');
+                    var pre = text.substring(0, pos);
+                    var post = text.substring(pos);
+                    var to_insert = replacement.replace(re, '') + (quote || '');
+                    self.set_command(pre + to_insert + post);
+                    self.set_position((pre + to_insert).length);
+                }
+                if (matched.length === 1) {
+                    if (options.escape) {
+                        replace(safe, matched[0]);
+                    } else {
+                        self.insert(matched[0].replace(regex, '') + (quote || ''));
+                    }
+                    command = self.before_cursor(options.word);
+                    return true;
+                } else if (matched.length > 1) {
+                    if (++tab_count >= 2) {
+                        tab_count = 0;
+                        if (options.echo) {
+                            echo_command();
+                            var text = matched.reverse().join('\t');
+                            self.echo($.terminal.escape_brackets(text), {
+                                keepWords: true,
+                                formatters: false
+                            });
+                            return true;
+                        }
+                    } else {
+                        var common = common_string(string, matched, sensitive);
+                        if (common) {
+                            replace(string, common);
+                            command = self.before_cursor(options.word);
+                            return true;
+                        }
+                    }
+                }
+            },
+            // -------------------------------------------------------------
             // :: Return commands function from top interpreter
             // -------------------------------------------------------------
             commands: function() {
@@ -4069,25 +5811,17 @@
             // -------------------------------------------------------------
             // :: Low Level method that overwrites interpreter
             // -------------------------------------------------------------
-            setInterpreter: function() {
-                if (window.console && console.warn) {
-                    console.warn('This function is deprecated, use set_inte'+
-                                 'rpreter insead!');
-                }
-                return self.set_interpreter.apply(self, arguments);
-            },
-            // -------------------------------------------------------------
             set_interpreter: function(user_intrp, login) {
                 function overwrite_interpreter() {
-                    self.pause();
-                    make_interpreter(user_intrp, !!login, function(result) {
+                    self.pause(settings.softPause);
+                    make_interpreter(user_intrp, login, function(result) {
                         self.resume();
                         var top = interpreters.top();
                         $.extend(top, result);
                         prepare_top_interpreter(true);
                     });
                 }
-                if ($.type(user_intrp) == 'string' && login) {
+                if ($.type(user_intrp) === 'string' && login) {
                     self.login(make_json_rpc_login(user_intrp, login),
                                true,
                                overwrite_interpreter);
@@ -4113,31 +5847,29 @@
             // :: Pause the terminal, it should be used for ajax calls
             // -------------------------------------------------------------
             pause: function(visible) {
-                onPause();
-                if (!paused && command_line) {
-                    init_deferr.then(function() {
-                        paused = true;
-                        command_line.disable();
-                        if (!visible) {
-                            command_line.hidden();
-                        }
-                        if ($.isFunction(settings.onPause)) {
-                            settings.onPause();
-                        }
-                    });
-                }
+                cmd_ready(function ready() {
+                    onPause();
+                    paused = true;
+                    command_line.disable(visible || is_android);
+                    if (!visible) {
+                        command_line.find('.prompt').hidden();
+                    }
+                    if ($.isFunction(settings.onPause)) {
+                        settings.onPause.call(self);
+                    }
+                });
                 return self;
             },
             // -------------------------------------------------------------
             // :: Resume the previously paused terminal
             // -------------------------------------------------------------
             resume: function() {
-                function run() {
+                cmd_ready(function ready() {
                     paused = false;
-                    if (terminals.front() == self) {
+                    if (enabled && terminals.front() === self) {
                         command_line.enable();
                     }
-                    command_line.visible();
+                    command_line.find('.prompt').visible();
                     var original = delayed_commands;
                     delayed_commands = [];
                     for (var i = 0; i < original.length; ++i) {
@@ -4150,16 +5882,9 @@
                     }
                     scroll_to_bottom();
                     if ($.isFunction(settings.onResume)) {
-                        settings.onResume();
-                    }
-                }
-                if (paused && command_line) {
-                    if (init_deferr.state() != 'resolved') {
-                        init_deferr.then(run);
-                    } else {
-                        run();
+                        settings.onResume.call(self);
                     }
-                }
+                });
                 return self;
             },
             // -------------------------------------------------------------
@@ -4167,14 +5892,26 @@
             // :: the terminal
             // -------------------------------------------------------------
             cols: function() {
-                return settings.numChars?settings.numChars:get_num_chars(self);
+                if (settings.numChars) {
+                    return settings.numChars;
+                }
+                if (typeof num_chars === 'undefined') {
+                    num_chars = get_num_chars(self, char_size);
+                }
+                return num_chars;
             },
             // -------------------------------------------------------------
             // :: Return the number of lines that fit into the height of the
             // :: terminal
             // -------------------------------------------------------------
             rows: function() {
-                return settings.numRows?settings.numRows:get_num_rows(self);
+                if (settings.numRows) {
+                    return settings.numRows;
+                }
+                if (typeof num_rows === 'undefined') {
+                    num_rows = get_num_rows(self, char_size);
+                }
+                return num_rows;
             },
             // -------------------------------------------------------------
             // :: Return the History object
@@ -4197,7 +5934,7 @@
                 if (toggle) {
                     // if set to true and if set from user command we need
                     // not to include the command
-                    if (typeof window.setImmediate == 'undefined') {
+                    if (typeof window.setImmediate === 'undefined') {
                         setTimeout(run, 0);
                     } else {
                         setImmediate(run);
@@ -4222,24 +5959,13 @@
                 if (terminals.length() === 1) {
                     return self;
                 } else {
-                    var offsetTop = self.offset().top;
-                    var height = self.height();
-                    var scrollTop = self.scrollTop();
-                    /*if (!is_scrolled_into_view(self)) {
-                        self.enable();
-                        $('html,body').animate({
-                            scrollTop: offsetTop-50
-                        }, 500);
-                        return self;
-                    } else {
-                    */
                     terminals.front().disable();
                     var next = terminals.rotate().enable();
-                    // 100 provides buffer in viewport
+                    // 50 provides buffer in viewport
                     var x = next.offset().top - 50;
                     $('html,body').animate({scrollTop: x}, 500);
                     try {
-                        settings.onTerminalChange(next);
+                        trigger_terminal_change(next);
                     } catch (e) {
                         display_exception(e, 'onTerminalChange');
                     }
@@ -4253,59 +5979,45 @@
             // :: the events will be not fired. Used on init
             // -------------------------------------------------------------
             focus: function(toggle, silent) {
-                init_deferr.then(function() {
+                cmd_ready(function ready() {
                     if (terminals.length() === 1) {
-                        if (toggle === false) {
-                            try {
-                                if (!silent && settings.onBlur(self) !== false ||
-                                    silent) {
-                                    self.disable();
-                                }
-                            } catch (e) {
-                                display_exception(e, 'onBlur');
-                            }
+                        if (toggle === false) {
+                            self.disable(silent);
                         } else {
-                            try {
-                                if (!silent && settings.onFocus(self) !== false ||
-                                    silent) {
-                                    self.enable();
-                                }
-                            } catch (e) {
-                                display_exception(e, 'onFocus');
-                            }
+                            self.enable(silent);
                         }
+                    } else if (toggle === false) {
+                        self.next();
                     } else {
-                        if (toggle === false) {
-                            self.next();
-                        } else {
-                            var front = terminals.front();
-                            if (front != self) {
-                                front.disable();
-                                if (!silent) {
-                                    try {
-                                        settings.onTerminalChange(self);
-                                    } catch (e) {
-                                        display_exception(e, 'onTerminalChange');
-                                    }
+                        var front = terminals.front();
+                        if (front !== self) {
+                            // there should be only from terminal enabled but tests
+                            // sometime fail because there where more them one
+                            // where cursor have blink class
+                            terminals.forEach(function(terminal) {
+                                if (terminal !== self && terminal.enabled()) {
+                                    terminal.disable(silent);
+                                }
+                            });
+                            if (!silent) {
+                                try {
+                                    trigger_terminal_change(self);
+                                } catch (e) {
+                                    display_exception(e, 'onTerminalChange');
                                 }
                             }
-                            terminals.set(self);
-                            self.enable();
                         }
+                        terminals.set(self);
+                        self.enable(silent);
                     }
                 });
-                // why this delay - it can't be use for mobile
-                /*
-                self.oneTime(1, function() {
-                });
-                */
                 return self;
             },
             // -------------------------------------------------------------
             // :: Disable/Enable terminal that can be enabled by click
             // -------------------------------------------------------------
             freeze: function(freeze) {
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     if (freeze) {
                         self.disable();
                         frozen = true;
@@ -4324,15 +6036,28 @@
             // -------------------------------------------------------------
             // :: Enable the terminal
             // -------------------------------------------------------------
-            enable: function() {
+            enable: function(silent) {
                 if (!enabled && !frozen) {
                     if (num_chars === undefined) {
-                        //enabling first time
+                        // enabling first time
                         self.resize();
                     }
-                    init_deferr.then(function() {
-                        command_line.enable();
-                        enabled = true;
+                    cmd_ready(function ready() {
+                        var ret;
+                        if (!silent && !enabled) {
+                            try {
+                                ret = settings.onFocus.call(self, self);
+                            } catch (e) {
+                                settings.onFocus = $.noop;
+                                display_exception(e, 'onFocus');
+                            }
+                        }
+                        if (!silent && ret === undefined || silent) {
+                            enabled = true;
+                            if (!self.paused()) {
+                                command_line.enable();
+                            }
+                        }
                     });
                 }
                 return self;
@@ -4340,13 +6065,22 @@
             // -------------------------------------------------------------
             // :: Disable the terminal
             // -------------------------------------------------------------
-            disable: function() {
-                if (enabled && !frozen) {
-                    init_deferr.then(function() {
+            disable: function(silent) {
+                cmd_ready(function ready() {
+                    var ret;
+                    if (!silent && enabled) {
+                        try {
+                            ret = settings.onBlur.call(self, self);
+                        } catch (e) {
+                            settings.onBlur = $.noop;
+                            display_exception(e, 'onBlur');
+                        }
+                    }
+                    if (!silent && ret === undefined || silent) {
                         enabled = false;
                         command_line.disable();
-                    });
-                }
+                    }
+                });
                 return self;
             },
             // -------------------------------------------------------------
@@ -4360,12 +6094,15 @@
             // -------------------------------------------------------------
             signature: function() {
                 var cols = self.cols();
-                var i = cols < 15 ? null : cols < 35 ? 0 : cols < 55 ? 1 : cols < 64 ? 2 : cols < 75 ? 3 : 4;
-                if (i !== null) {
-                    return signatures[i].join('\n') + '\n';
-                } else {
-                    return '';
+                for (var i = signatures.length; i--;) {
+                    var lenghts = signatures[i].map(function(line) {
+                        return line.length;
+                    });
+                    if (Math.max.apply(null, lenghts) <= cols) {
+                        return signatures[i].join('\n') + '\n';
+                    }
                 }
+                return '';
             },
             // -------------------------------------------------------------
             // :: Return the version number
@@ -4389,30 +6126,50 @@
             // -------------------------------------------------------------
             // :: Change the command line to the new one
             // -------------------------------------------------------------
-            set_command: function(command) {
-                init_deferr.then(function() {
-                    command_line.set(command);
+            set_command: function(command, silent) {
+                when_ready(function ready() {
+                    // TODO: refactor to use options - breaking change
+                    command_line.set(command, undefined, silent);
+                });
+                return self;
+            },
+            // -------------------------------------------------------------
+            // :: Change position of the command line
+            // -------------------------------------------------------------
+            set_position: function(position, relative) {
+                when_ready(function ready() {
+                    command_line.position(position, relative);
                 });
                 return self;
             },
             // -------------------------------------------------------------
+            // :: Return position of the command line
+            // -------------------------------------------------------------
+            get_position: function() {
+                return command_line.position();
+            },
+            // -------------------------------------------------------------
             // :: Insert text into the command line after the cursor
             // -------------------------------------------------------------
-            insert: function(string) {
+            insert: function(string, stay) {
                 if (typeof string === 'string') {
-                    init_deferr.then(function() {
-                        command_line.insert(string);
+                    when_ready(function ready() {
+                        var bottom = self.is_bottom();
+                        command_line.insert(string, stay);
+                        if (settings.scrollOnEcho || bottom) {
+                            scroll_to_bottom();
+                        }
                     });
                     return self;
                 } else {
-                    throw "insert function argument is not a string";
+                    throw new Error(sprintf(strings().notAString, 'insert'));
                 }
             },
             // -------------------------------------------------------------
             // :: Set the prompt of the command line
             // -------------------------------------------------------------
             set_prompt: function(prompt) {
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     if (validate('prompt', prompt)) {
                         if ($.isFunction(prompt)) {
                             command_line.prompt(function(callback) {
@@ -4432,7 +6189,7 @@
             get_prompt: function() {
                 return interpreters.top().prompt;
                 // command_line.prompt(); - can be a wrapper
-                //return command_line.prompt();
+                // return command_line.prompt();
             },
             // -------------------------------------------------------------
             // :: Enable or Disable mask depedning on the passed argument
@@ -4440,7 +6197,7 @@
             // :: strings longer then one)
             // -------------------------------------------------------------
             set_mask: function(mask) {
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     command_line.mask(mask === true ? settings.maskChar : mask);
                 });
                 return self;
@@ -4474,31 +6231,52 @@
                     }
                     width = self.width();
                     height = self.height();
-                    var new_num_chars = self.cols();
-                    var new_num_rows = self.rows();
+                    if (typeof settings.numChars !== 'undefined' ||
+                        typeof settings.numRows !== 'undefined') {
+                        command_line.resize(settings.numChars);
+                        self.refresh();
+                        return;
+                    }
+                    var new_num_chars = get_num_chars(self, char_size);
+                    var new_num_rows = get_num_rows(self, char_size);
                     // only if number of chars changed
                     if (new_num_chars !== num_chars ||
                         new_num_rows !== num_rows) {
                         num_chars = new_num_chars;
                         num_rows = new_num_rows;
-                        redraw();
+                        command_line.resize(num_chars);
+                        self.refresh();
                         var top = interpreters.top();
                         if ($.isFunction(top.resize)) {
-                            top.resize(self);
+                            top.resize.call(self, self);
                         } else if ($.isFunction(settings.onResize)) {
-                            settings.onResize(self);
+                            settings.onResize.call(self, self);
                         }
-                        old_height = height;
-                        old_width = width;
-                        scroll_to_bottom();
                     }
                 }
                 return self;
             },
             // -------------------------------------------------------------
+            // :: redraw the terminal
+            // -------------------------------------------------------------
+            refresh: function() {
+                if (char_size.width !== 0) {
+                    self[0].style.setProperty('--char-width', char_size.width);
+                }
+                redraw({
+                    scroll: false,
+                    update: true
+                });
+                return self;
+            },
+            // -------------------------------------------------------------
             // :: Flush the output to the terminal
             // -------------------------------------------------------------
-            flush: function() {
+            flush: function(options) {
+                options = $.extend({}, {
+                    update: false,
+                    scroll: true
+                }, options || {});
                 try {
                     var bottom = self.is_bottom();
                     var wrapper;
@@ -4506,88 +6284,87 @@
                     $.each(output_buffer, function(i, line) {
                         if (line === NEW_LINE) {
                             wrapper = $('<div></div>');
-                        } else if ($.isFunction(line)) {
+                        } else if ($.isPlainObject(line) && $.isFunction(line.finalize)) {
                             // this is finalize function from echo
-                            wrapper.appendTo(output);
-                            try {
-                                line(wrapper);
-                                /* this don't work with resize
-                                   line(wrapper, function(user_finalize) {
-                                   // TODO:
-                                   //user_finalize need to be save in line object
-                                   user_finalize(wrapper);
-                                   });*/
-                            } catch (e) {
-                                display_exception(e, 'USER:echo(finalize)');
+                            if (options.update) {
+                                var selector = '> div[data-index=' + line.index + ']';
+                                var node = output.find(selector);
+                                if (node.html() !== wrapper.html()) {
+                                    node.replaceWith(wrapper);
+                                }
+                            } else {
+                                wrapper.appendTo(output);
                             }
+                            line.finalize(wrapper.attr('data-index', line.index));
                         } else {
-                            $('<div/>').html(line).
-                                appendTo(wrapper).width('100%');
+                            $('<div/>').html(line)
+                                .appendTo(wrapper).width('100%');
                         }
                     });
-                    if (settings.outputLimit >= 0) {
-                        var limit = settings.outputLimit === 0 ?
-                            self.rows() :
-                            settings.outputLimit;
-                        var $lines = output.find('div div');
-                        if ($lines.length > limit) {
-                            var max = $lines.length-limit+1;
-                            var for_remove = $lines.slice(0, max);
-                            // you can't get parent if you remove the
-                            // element so we first get the parent
-                            var parents = for_remove.parent();
-                            for_remove.remove();
-                            parents.each(function() {
-                                var self = $(this);
-                                if (self.is(':empty')) {
-                                    // there can be divs inside parent that
-                                    // was not removed
-                                    self.remove();
-                                }
-                            });
-                        }
+                    limit_lines();
+                    try {
+                        settings.onFlush.call(self, self);
+                    } catch (e) {
+                        settings.onFlush = $.noop;
+                        display_exception(e, 'onFlush');
                     }
-                    num_rows = get_num_rows(self);
-                    on_scrollbar_show_resize();
-                    if (settings.scrollOnEcho || bottom) {
+                    //num_rows = get_num_rows(self, char_size);
+                    if ((settings.scrollOnEcho && options.scroll) || bottom) {
                         scroll_to_bottom();
                     }
                     output_buffer = [];
                 } catch (e) {
-                    alert('[Flush] ' + exception_message(e) + '\n' +
-                          e.stack);
+                    if ($.isFunction(settings.exceptionHandler)) {
+                        settings.exceptionHandler.call(self, e, 'TERMINAL (Flush)');
+                    } else {
+                        alert_exception('[Flush]', e);
+                    }
                 }
                 return self;
             },
             // -------------------------------------------------------------
             // :: Update the output line - line number can be negative
             // -------------------------------------------------------------
-            update: function(line, string) {
-                init_deferr.then(function() {
+            update: function(line, string, options) {
+                when_ready(function ready() {
                     if (line < 0) {
                         line = lines.length + line; // yes +
                     }
                     if (!lines[line]) {
                         self.error('Invalid line number ' + line);
+                    } else if (string === null) {
+                        lines.splice(line, 1);
+                        output.find('[data-index=' + line + ']').remove();
                     } else {
-                        if (string === null) {
-                            lines.splice(line, 1);
-                        } else {
-                            lines[line][0] = string;
+                        lines[line][0] = string;
+                        if (options) {
+                            lines[line][1] = options;
                         }
-                        // it would be hard to figure out which div need to be
-                        // updated so we update everything
-                        redraw();
+                        process_line({
+                            string: string,
+                            index: line,
+                            options: options
+                        });
+                        self.flush({
+                            scroll: false,
+                            update: true
+                        });
                     }
                 });
                 return self;
             },
             // -------------------------------------------------------------
+            // :: convenience method for removing selected line
+            // -------------------------------------------------------------
+            remove: function(line, options) {
+                return self.update(line, null, options);
+            },
+            // -------------------------------------------------------------
             // :: return index of last line in case when you need to update
             // :: after something is echo on the terminal
             // -------------------------------------------------------------
             last_index: function() {
-                return lines.length-1;
+                return lines.length - 1;
             },
             // -------------------------------------------------------------
             // :: Print data to the terminal output. It can have two options
@@ -4598,23 +6375,49 @@
             // :: redraw.
             // :: it use $.when so you can echo a promise
             // -------------------------------------------------------------
-            echo: function(string, options) {
-                string = string || '';
-                $.when(string).then(function(string) {
+            echo: function(arg, options) {
+                function echo(arg) {
                     try {
                         var locals = $.extend({
                             flush: true,
                             raw: settings.raw,
                             finalize: $.noop,
-                            keepWords: false
+                            keepWords: false,
+                            formatters: true
                         }, options || {});
+                        (function(finalize) {
+                            locals.finalize = function(div) {
+                                if (locals.raw) {
+                                    div.addClass('raw');
+                                }
+                                try {
+                                    if ($.isFunction(finalize)) {
+                                        finalize(div);
+                                    }
+                                } catch (e) {
+                                    display_exception(e, 'USER:echo(finalize)');
+                                    finalize = null;
+                                }
+                            };
+                        })(locals.finalize);
                         if (locals.flush) {
+                            // flush buffer if there was no flush after previous echo
+                            if (output_buffer.length) {
+                                self.flush();
+                            }
                             output_buffer = [];
                         }
-                        process_line(string, locals);
+                        if (typeof arg === 'function') {
+                            arg = arg.bind(self);
+                        }
+                        process_line({
+                            string: arg,
+                            options: locals,
+                            index: lines.length
+                        });
                         // extended commands should be processed only
                         // once in echo and not on redraw
-                        lines.push([string, $.extend(locals, {
+                        lines.push([arg, $.extend(locals, {
                             exec: false
                         })]);
                         if (locals.flush) {
@@ -4623,21 +6426,41 @@
                     } catch (e) {
                         // if echo throw exception we can't use error to
                         // display that exception
-                        alert('[Terminal.echo] ' + exception_message(e) +
-                              '\n' + e.stack);
+                        if ($.isFunction(settings.exceptionHandler)) {
+                            settings.exceptionHandler.call(self, e, 'TERMINAL (echo)');
+                        } else {
+                            alert_exception('[Terminal.echo]', e);
+                        }
                     }
-                });
+                }
+                if ($.isFunction(arg.then)) {
+                    $.when(arg).done(echo);
+                } else {
+                    echo(arg);
+                }
                 return self;
             },
             // -------------------------------------------------------------
             // :: echo red text
             // -------------------------------------------------------------
-            error: function(message, finalize) {
-                //quick hack to fix trailing backslash
-                var str = $.terminal.escape_brackets(message).
-                    replace(/\\$/, '&#92;').
-                    replace(url_re, ']$1[[;;;error]');
-                return self.echo('[[;;;error]' + str + ']', finalize);
+            error: function(message, options) {
+                options = $.extend({}, options, {raw: false, formatters: false});
+                function format(string) {
+                    if (typeof string !== 'string') {
+                        string = String(string);
+                    }
+                    // quick hack to fix trailing backslash
+                    var str = $.terminal.escape_brackets(string).
+                        replace(/\\$/, '&#92;').
+                        replace(url_re, ']$1[[;;;error]');
+                    return '[[;;;error]' + str + ']';
+                }
+                if (typeof message === 'function') {
+                    return self.echo(function() {
+                        return format(message.call(self));
+                    }, options);
+                }
+                return self.echo(format(message), options);
             },
             // -------------------------------------------------------------
             // :: Display Exception on terminal
@@ -4651,20 +6474,21 @@
                     self.error(message, {
                         finalize: function(div) {
                             div.addClass('exception message');
-                        }
+                        },
+                        keepWords: true
                     });
                 }
                 if (typeof e.fileName === 'string') {
-                    //display filename and line which throw exeption
-                    self.pause();
+                    // display filename and line which throw exeption
+                    self.pause(settings.softPause);
                     $.get(e.fileName, function(file) {
-                        self.resume();
                         var num = e.lineNumber - 1;
                         var line = file.split('\n')[num];
                         if (line) {
                             self.error('[' + e.lineNumber + ']: ' + line);
                         }
-                    });
+                        self.resume();
+                    }, 'text');
                 }
                 if (e.stack) {
                     var stack = $.terminal.escape_brackets(e.stack);
@@ -4675,7 +6499,8 @@
                     }).join('\n'), {
                         finalize: function(div) {
                             div.addClass('exception stack-trace');
-                        }
+                        },
+                        formatters: false
                     });
                 }
             },
@@ -4706,19 +6531,23 @@
             // -------------------------------------------------------------
             logout: function(local) {
                 if (in_login) {
-                    throw new Error(sprintf(strings.notWhileLogin, 'logout'));
+                    throw new Error(sprintf(strings().notWhileLogin, 'logout'));
                 }
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     if (local) {
                         var login = logins.pop();
                         self.set_token(undefined, true);
                         self.login.apply(self, login);
+                    } else if (interpreters.size() === 1 && self.token()) {
+                        self.logout(true);
                     } else {
-                        while (interpreters.size() > 0) {
+                        while (interpreters.size() > 1) {
                             // pop will call global_logout that will call login
                             // and size will be > 0; this is workaround the problem
-                            if (self.pop()) {
-                                break;
+                            if (self.token()) {
+                                self.logout(true).pop().pop();
+                            } else {
+                                self.pop();
                             }
                         }
                     }
@@ -4739,7 +6568,7 @@
             // -------------------------------------------------------------
             set_token: function(token, local) {
                 var name = self.prefix_name(local) + '_token';
-                if (typeof token == 'undefined') {
+                if (typeof token === 'undefined') {
                     storage.remove(name, token);
                 } else {
                     storage.set(name, token);
@@ -4751,7 +6580,7 @@
             // :: by the set_token method.
             // -------------------------------------------------------------
             get_token: function(local) {
-                return storage.get(self.prefix_name(local) + '_token');
+                return self.token(local);
             },
             // -------------------------------------------------------------
             // :: Function return Login name entered by the user
@@ -4769,11 +6598,11 @@
             // :: Function return prefix name for login/token
             // -------------------------------------------------------------
             prefix_name: function(local) {
-                var name = (settings.name ? settings.name + '_': '') +
+                var name = (settings.name ? settings.name + '_' : '') +
                     terminal_id;
                 if (local && interpreters.size() > 1) {
                     var local_name = interpreters.map(function(intrp) {
-                        return intrp.name;
+                        return intrp.name || '';
                     }).slice(1).join('_');
                     if (local_name) {
                         name += '_' + local_name;
@@ -4801,55 +6630,62 @@
             // :: Push a new interenter on the Stack
             // -------------------------------------------------------------
             push: function(interpreter, options) {
-                init_deferr.then(function() {
+                cmd_ready(function ready() {
                     options = options || {};
                     var defaults = {
                         infiniteLogin: false
                     };
-                    var settings = $.extend({}, defaults, options);
-                    if (!settings.name && prev_command) {
+                    var push_settings = $.extend({}, defaults, options);
+                    if (!push_settings.name && prev_command) {
                         // push is called in login
-                        settings.name = prev_command.name;
+                        push_settings.name = prev_command.name;
                     }
-                    if (settings.prompt === undefined) {
-                        settings.prompt = (settings.name || '>') + ' ';
+                    if (push_settings.prompt === undefined) {
+                        push_settings.prompt = (push_settings.name || '>') + ' ';
                     }
-                    //names.push(options.name);
+                    // names.push(options.name);
                     var top = interpreters.top();
                     if (top) {
                         top.mask = command_line.mask();
                     }
                     var was_paused = paused;
-                    //self.pause();
-                    make_interpreter(interpreter, !!options.login, function(ret) {
-                        // result is object with interpreter and completion
-                        // properties
-                        interpreters.push($.extend({}, ret, settings));
-                        if ($.isArray(ret.completion) && settings.completion === true) {
-                            interpreters.top().completion = ret.completion;
-                        } else if (!ret.completion && settings.completion === true) {
-                            interpreters.top().completion = false;
+                    function init() {
+                        settings.onPush.call(self, top, interpreters.top(), self);
+                        prepare_top_interpreter();
+                    }
+                    // self.pause();
+                    make_interpreter(interpreter, options.login, function(ret) {
+                        // result is object with interpreter and completion properties
+                        interpreters.push($.extend({}, ret, push_settings));
+                        if (push_settings.completion === true) {
+                            if ($.isArray(ret.completion)) {
+                                interpreters.top().completion = ret.completion;
+                            } else if (!ret.completion) {
+                                interpreters.top().completion = false;
+                            }
                         }
-                        if (settings.login) {
-                            var type = $.type(settings.login);
-                            if (type == 'function') {
-                                // self.pop on error
-                                self.login(settings.login,
-                                           settings.infiniteLogin,
-                                           prepare_top_interpreter,
-                                           settings.infiniteLogin ? $.noop : self.pop);
-                            } else if ($.type(interpreter) == 'string' &&
-                                       type == 'string' || type == 'boolean') {
+                        if (push_settings.login) {
+                            var error;
+                            var type = $.type(push_settings.login);
+                            if (type === 'function') {
+                                error = push_settings.infiniteLogin ? $.noop : self.pop;
+                                self.login(push_settings.login,
+                                           push_settings.infiniteLogin,
+                                           init,
+                                           error);
+                            } else if ($.type(interpreter) === 'string' &&
+                                       type === 'string' || type === 'boolean') {
+                                error = push_settings.infiniteLogin ? $.noop : self.pop;
                                 self.login(make_json_rpc_login(interpreter,
-                                                               settings.login),
-                                           settings.infiniteLogin,
-                                           prepare_top_interpreter,
-                                           settings.infiniteLogin ? $.noop : self.pop);
+                                                               push_settings.login),
+                                           push_settings.infiniteLogin,
+                                           init,
+                                           error);
                             }
                         } else {
-                            prepare_top_interpreter();
+                            init();
                         }
-                        if (!was_paused) {
+                        if (!was_paused && self.enabled()) {
                             self.resume();
                         }
                     });
@@ -4859,44 +6695,54 @@
             // -------------------------------------------------------------
             // :: Remove the last interpreter from the Stack
             // -------------------------------------------------------------
-            pop: function(string) {
+            pop: function(string, silent) {
                 if (string !== undefined) {
                     echo_command(string);
                 }
                 var token = self.token(true);
-                if (interpreters.size() == 1) {
+                var top;
+                if (interpreters.size() === 1) {
+                    top = interpreters.top();
                     if (settings.login) {
+                        if (!silent) {
+                            settings.onPop.call(self, top, null, self);
+                        }
                         global_logout();
                         if ($.isFunction(settings.onExit)) {
                             try {
-                                settings.onExit(self);
+                                settings.onExit.call(self, self);
                             } catch (e) {
+                                settings.onExit = $.noop;
                                 display_exception(e, 'onExit');
                             }
                         }
-                        return true;
                     } else {
-                        self.error(strings.canExitError);
+                        self.error(strings().canExitError);
                     }
                 } else {
-                    if (self.token(true)) {
+                    if (token) {
                         clear_loging_storage();
                     }
                     var current = interpreters.pop();
+                    top = interpreters.top();
                     prepare_top_interpreter();
+                    if (!silent) {
+                        settings.onPop.call(self, current, top);
+                    }
                     // we check in case if you don't pop from password interpreter
-                    if (in_login && self.get_prompt() != strings.login + ': ') {
+                    if (in_login && self.get_prompt() !== strings().login + ': ') {
                         in_login = false;
                     }
                     if ($.isFunction(current.onExit)) {
                         try {
-                            current.onExit(self);
+                            current.onExit.call(self, self);
                         } catch (e) {
+                            current.onExit = $.noop;
                             display_exception(e, 'onExit');
                         }
                     }
                     // restore mask
-                    self.set_mask(interpreters.top().mask);
+                    self.set_mask(top.mask);
                 }
                 return self;
             },
@@ -4904,16 +6750,19 @@
             // :: Change terminal option(s) at runtime
             // -------------------------------------------------------------
             option: function(object_or_name, value) {
-                if (typeof value == 'undefined') {
-                    if (typeof object_or_name == 'string') {
+                if (typeof value === 'undefined') {
+                    if (typeof object_or_name === 'string') {
                         return settings[object_or_name];
-                    } else if (typeof object_or_name == 'object') {
+                    } else if (typeof object_or_name === 'object') {
                         $.each(object_or_name, function(key, value) {
                             settings[key] = value;
                         });
                     }
                 } else {
                     settings[object_or_name] = value;
+                    if (object_or_name.match(/^num(Chars|Rows)$/)) {
+                        redraw();
+                    }
                 }
                 return self;
             },
@@ -4927,9 +6776,9 @@
             // :: Reinitialize the terminal
             // -------------------------------------------------------------
             reset: function() {
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     self.clear();
-                    while(interpreters.size() > 1) {
+                    while (interpreters.size() > 1) {
                         interpreters.pop();
                     }
                     initialize();
@@ -4941,14 +6790,16 @@
             // :: logout you until you refresh the browser
             // -------------------------------------------------------------
             purge: function() {
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     var prefix = self.prefix_name() + '_';
                     var names = storage.get(prefix + 'interpreters');
-                    $.each($.parseJSON(names), function(_, name) {
-                        storage.remove(name + '_commands');
-                        storage.remove(name + '_token');
-                        storage.remove(name + '_login');
-                    });
+                    if (names) {
+                        $.each(JSON.parse(names), function(_, name) {
+                            storage.remove(name + '_commands');
+                            storage.remove(name + '_token');
+                            storage.remove(name + '_login');
+                        });
+                    }
                     command_line.purge();
                     storage.remove(prefix + 'interpreters');
                 });
@@ -4960,13 +6811,15 @@
             // :: when you refresh the browser
             // -------------------------------------------------------------
             destroy: function() {
-                init_deferr.then(function() {
+                when_ready(function ready() {
                     command_line.destroy().remove();
                     output.remove();
-                    $(document).unbind('.terminal');
-                    $(window).unbind('.terminal');
-                    self.unbind('click mousewheel mousedown mouseup');
-                    self.removeData('terminal').removeClass('terminal');
+                    wrapper.remove();
+                    $(document).unbind('.terminal_' + self.id());
+                    $(window).unbind('.terminal_' + self.id());
+                    self.unbind('click wheel mousewheel mousedown mouseup');
+                    self.removeData('terminal').removeClass('terminal').
+                        unbind('.terminal');
                     if (settings.width) {
                         self.css('width', '');
                     }
@@ -4975,23 +6828,49 @@
                     }
                     $(window).off('blur', blur_terminal).
                         off('focus', focus_terminal);
+                    self.find('.terminal-fill').remove();
+                    self.stopTime();
                     terminals.remove(terminal_id);
+                    if (visibility_observer) {
+                        visibility_observer.unobserve(self[0]);
+                    }
+                    if (mutation_observer) {
+                        mutation_observer.disconnect();
+                    }
+                    self.resizer('unbind');
+                    font_resizer.resizer('unbind').remove();
+                    if (!terminals.length()) {
+                        $(window).off('hashchange');
+                    }
                 });
                 return self;
             },
-            scroll_to_bottom: scroll_to_bottom,
+            // -------------------------------------------------------------
+            scroll_to_bottom: function() {
+                scroll_to_bottom();
+                return self;
+            },
+            // -------------------------------------------------------------
+            // :: return true if terminal div or body is at the bottom
+            // :: is use scrollBottomOffset option as margin for the check
+            // -------------------------------------------------------------
             is_bottom: function() {
-                var scroll_height, scroll_top, height;
-                if (self.is('body')) {
-                    scroll_height = $(document).height();
-                    scroll_top = $(window).scrollTop();
-                    height = window.innerHeight;
+                if (settings.scrollBottomOffset === -1) {
+                    return false;
                 } else {
-                    scroll_height = scroll_object[0].scrollHeight;
-                    scroll_top = scroll_object.scrollTop();
-                    height = scroll_object.outerHeight();
+                    var scroll_height, scroll_top, height;
+                    if (self.is('body')) {
+                        scroll_height = $(document).height();
+                        scroll_top = $(window).scrollTop();
+                        height = window.innerHeight;
+                    } else {
+                        scroll_height = scroll_object[0].scrollHeight;
+                        scroll_top = scroll_object.scrollTop();
+                        height = scroll_object.outerHeight();
+                    }
+                    var limit = scroll_height - settings.scrollBottomOffset;
+                    return scroll_top + height > limit;
                 }
-				return scroll_top + height > scroll_height - settings.scrollBottomOffset;
             }
         }, function(name, fun) {
             // wrap all functions and display execptions
@@ -5001,103 +6880,71 @@
                 } catch (e) {
                     // exec catch by command (resume call exec)
                     if (name !== 'exec' && name !== 'resume') {
-                        display_exception(e, 'TERMINAL');
+                        display_exception(e, 'TERMINAL', true);
+                    }
+                    if (!settings.exceptionHandler) {
+                        throw e;
                     }
-                    throw e;
                 }
             };
         }));
 
-        // -----------------------------------------------------------------
-        var on_scrollbar_show_resize = (function() {
-            var scroll_bars = have_scrollbars(self);
-            return function() {
-                if (scroll_bars !== have_scrollbars(self)) {
-                    // if the scollbar appearance changes we will have a
-                    // different number of chars
-                    self.resize();
-                    scroll_bars = have_scrollbars(self);
-                }
-            };
-        })();
-
-
         // -----------------------------------------------------------------
         // INIT CODE
         // -----------------------------------------------------------------
+        // backward compatibility
+        if (settings.ignoreSystemDescribe === true) {
+            settings.describe = false;
+        }
         if (settings.width) {
             self.width(settings.width);
         }
         if (settings.height) {
             self.height(settings.height);
         }
-        var agent = navigator.userAgent.toLowerCase();
-        if (!agent.match(/(webkit)[ \/]([\w.]+)/) &&
-            self[0].tagName.toLowerCase() == 'body') {
-            scroll_object = $('html');
-        } else {
-            scroll_object = self;
-        }
+        scroll_object = self.scroll_element();
         // register ajaxSend for cancel requests on CTRL+D
-        $(document).bind('ajaxSend.terminal', function(e, xhr, opt) {
+        $(document).bind('ajaxSend.terminal_' + self.id(), function(e, xhr) {
             requests.push(xhr);
         });
-        output = $('<div>').addClass('terminal-output').appendTo(self);
+        var wrapper = $('<div class="terminal-wrapper"/>').appendTo(self);
+        var font_resizer = $('<div class="font"/>').appendTo(self);
+        var fill = $('<div class="terminal-fill"/>').appendTo(self);
+        output = $('<div>').addClass('terminal-output').attr('role', 'log')
+            .appendTo(wrapper);
         self.addClass('terminal');
-        // keep focus in clipboard textarea in mobile
-        /*
-          if (('ontouchstart' in window) || window.DocumentTouch &&
-          document instanceof DocumentTouch) {
-          self.click(function() {
-          self.find('textarea').focus();
-          });
-          self.find('textarea').focus();
-          }
-        */
-        /*
-          self.bind('touchstart.touchScroll', function() {
-
-          });
-          self.bind('touchmove.touchScroll', function() {
-
-          });
-        */
-        //$('<input type="text"/>').hide().focus().appendTo(self);
-
         // before login event
         if (settings.login && $.isFunction(settings.onBeforeLogin)) {
             try {
-                if (settings.onBeforeLogin(self) === false) {
+                if (settings.onBeforeLogin.call(self, self) === false) {
                     autologin = false;
                 }
             } catch (e) {
+                settings.onBeforeLogin = $.noop;
                 display_exception(e, 'onBeforeLogin');
-                throw e;
             }
         }
-        var auth = settings.login;
         // create json-rpc authentication function
         var base_interpreter;
-        if (typeof init_interpreter == 'string') {
+        if (typeof init_interpreter === 'string') {
             base_interpreter = init_interpreter;
         } else if (init_interpreter instanceof Array) {
             // first JSON-RPC
-            for (var i=0, len=init_interpreter.length; i<len; ++i) {
-                if (typeof init_interpreter[i] == 'string') {
+            for (var i = 0, len = init_interpreter.length; i < len; ++i) {
+                if (typeof init_interpreter[i] === 'string') {
                     base_interpreter = init_interpreter[i];
                     break;
                 }
             }
         }
-        if (base_interpreter &&
+        var global_login_fn;
+        if ($.isFunction(settings.login)) {
+            global_login_fn = settings.login;
+        } else if (base_interpreter &&
             (typeof settings.login === 'string' || settings.login === true)) {
-            settings.login = make_json_rpc_login(base_interpreter,
-                                                 settings.login);
+            global_login_fn = make_json_rpc_login(base_interpreter, settings.login);
         }
         terminals.append(self);
-        var interpreters;
-        var command_line;
-        var old_enabled;
         function focus_terminal() {
             if (old_enabled) {
                 self.focus();
@@ -5105,124 +6952,236 @@
         }
         function blur_terminal() {
             old_enabled = enabled;
-            self.disable();
+            self.disable().find('textarea').trigger('blur', [true]);
+        }
+        function paste_event(e) {
+            e = e.originalEvent;
+            // we don't care about browser that don't support clipboard data
+            // those browser simple will not have this feature normal paste
+            // is cross-browser and it's handled by cmd plugin
+            function is_type(item, type) {
+                return item.type.indexOf(type) !== -1;
+            }
+            if (e.clipboardData) {
+                if (self.enabled()) {
+                    var items = e.clipboardData.items;
+                    if (items) {
+                        for (var i = 0; i < items.length; i++) {
+                            if (is_type(items[i], 'image') && settings.pasteImage) {
+                                var blob = items[i].getAsFile();
+                                var URL = window.URL || window.webkitURL;
+                                var source = URL.createObjectURL(blob);
+                                self.echo('<img src="' + source + '"/>', {raw: true});
+                            } else if (is_type(items[i], 'text/plain')) {
+                                items[i].getAsString(self.insert);
+                            }
+                        }
+                    } else if (e.clipboardData.getData) {
+                        var text = e.clipboardData.getData('text/plain');
+                        self.insert(text);
+                    }
+                    return false;
+                }
+            }
         }
-        make_interpreter(init_interpreter, !!settings.login, function(itrp) {
-            if (settings.completion && typeof settings.completion != 'boolean' ||
+        $(document).on('paste.terminal_' + self.id(), paste_event);
+        make_interpreter(init_interpreter, settings.login, function(itrp) {
+            if (settings.completion && typeof settings.completion !== 'boolean' ||
                 !settings.completion) {
                 // overwrite interpreter completion by global setting #224
                 // we use string to indicate that it need to be taken from settings
                 // so we are able to change it using option API method
                 itrp.completion = 'settings';
             }
-            interpreters = new Stack($.extend({
+            var new_keymap = $.extend(
+                {},
+                keymap,
+                $.omap(settings.keymap || {}, function(key, fn) {
+                    if (!keymap[key]) {
+                        return fn.bind(self);
+                    }
+                    return function(e, original) {
+                        // new keymap function will get default as 2nd argument
+                        return fn.call(self, e, function() {
+                            return keymap[key](e, original);
+                        });
+                    };
+                })
+            );
+            interpreters = new Stack($.extend({}, settings.extra, {
                 name: settings.name,
                 prompt: settings.prompt,
                 keypress: settings.keypress,
                 keydown: settings.keydown,
                 resize: settings.onResize,
                 greetings: settings.greetings,
-                mousewheel: settings.mousewheel
+                mousewheel: settings.mousewheel,
+                keymap: new_keymap
             }, itrp));
             // CREATE COMMAND LINE
-            command_line = $('<div/>').appendTo(self).cmd({
+            command_line = $('<div/>').appendTo(wrapper).cmd({
                 prompt: settings.prompt,
                 history: settings.memory ? 'memory' : settings.history,
                 historyFilter: settings.historyFilter,
                 historySize: settings.historySize,
                 width: '100%',
-                enabled: enabled && !is_touch,
+                enabled: false,
                 keydown: key_down,
+                keymap: new_keymap,
+                clickTimeout: settings.clickTimeout,
                 keypress: function(e) {
-                    var result, i, top = interpreters.top();
-                    if ($.isFunction(top.keypress)) {
-                        return top.keypress(e, self);
-                    } else if ($.isFunction(settings.keypress)) {
-                        return settings.keypress(e, self);
+                    var top = interpreters.top();
+                    if (enabled && (!paused || !settings.pauseEvents)) {
+                        if ($.isFunction(top.keypress)) {
+                            return top.keypress.call(self, e, self);
+                        } else if ($.isFunction(settings.keypress)) {
+                            return settings.keypress.call(self, e, self);
+                        }
                     }
                 },
                 onCommandChange: function(command) {
                     if ($.isFunction(settings.onCommandChange)) {
                         try {
-                            settings.onCommandChange(command, self);
+                            settings.onCommandChange.call(self, command, self);
                         } catch (e) {
+                            settings.onCommandChange = $.noop;
                             display_exception(e, 'onCommandChange');
-                            throw e;
                         }
                     }
                     scroll_to_bottom();
                 },
                 commands: commands
             });
-            // touch devices need touch event to get virtual keyboard
-            if (enabled && self.is(':visible') && !is_touch) {
-                self.focus(undefined, true);
-            } else {
-                self.disable();
-            }
-            self.oneTime(100, function() {
-                function disable(e) {
-                    var sender = $(e.target);
-                    if (!sender.closest('.terminal').length &&
-                        self.enabled() &&
-                        settings.onBlur(self) !== false) {
+            function disable(e) {
+                e = e.originalEvent;
+                if (e) {
+                    // e.terget is body when click outside of context menu to close it
+                    // even if you click on terminal
+                    var node = document.elementFromPoint(e.clientX, e.clientY);
+                    if (!$(node).closest('.terminal').length && self.enabled()) {
+                        // we only need to disable when click outside of terminal
+                        // click on other terminal is handled by focus event
                         self.disable();
                     }
                 }
-                $(document).bind('click.terminal', disable).
-                    bind('contextmenu.terminal', disable);
+            }
+            self.oneTime(100, function() {
+                $(document).bind('click.terminal_' + self.id(), disable).
+                    bind('contextmenu.terminal_' + self.id(), disable);
             });
             var $win = $(window);
-            if (!is_touch) {
-                // work weird on mobile
-                $win.on('focus', focus_terminal).
-                    on('blur', blur_terminal);
-            } else {
-                /*
-                self.find('textarea').on('blur.terminal', function() {
-                    if (enabled) {
-                        self.focus(false);
-                    }
-                });*/
-            }
-            if (is_touch) {
+            // cordova application, if keyboard was open and we resume it will be
+            // closed so we need to disable terminal so you can enable it with tap
+            document.addEventListener("resume", function() {
+                self.disable();
+            });
+            if (is_mobile) {
                 self.click(function() {
-                    if (!self.enabled() && !frozen) {
-                        self.focus();
-                        command_line.enable();
-                    } else {
-                        self.focus(false);
+                    if (!frozen) {
+                        if (!self.enabled()) {
+                            self.focus();
+                            command_line.enable();
+                        } else {
+                            self.disable();
+                        }
                     }
                 });
             } else {
+                // work weird on mobile
+                $win.on('focus.terminal_' + self.id(), focus_terminal).
+                    on('blur.terminal_' + self.id(), blur_terminal);
                 // detect mouse drag
                 (function() {
                     var count = 0;
-                    var isDragging = false;
-                    self.mousedown(function() {
-                        self.oneTime(1, function() {
-                            $(window).mousemove(function() {
-                                isDragging = true;
-                                count = 0;
-                                $(window).unbind('mousemove');
-                            });
-                        });
+                    var $target;
+                    var name = 'click_' + self.id();
+                    function position() {
+                        if ($target.is('.terminal') ||
+                            $target.is('.terminal-wrapper')) {
+                            var len = self.get_command().length;
+                            self.set_position(len);
+                        } else if ($target.closest('.prompt').length) {
+                            self.set_position(0);
+                        }
+                        reset();
+                    }
+                    function reset() {
+                        count = 0;
+                        $target = null;
+                    }
+                    self.mousedown(function(e) {
+                        if (!scrollbar_event(e, fill)) {
+                            $target = $(e.target);
+                        }
                     }).mouseup(function() {
-                        var wasDragging = isDragging;
-                        isDragging = false;
-                        $(window).unbind('mousemove');
-                        if (!wasDragging && ++count == 1) {
-                            count = 0;
-                            if (!self.enabled() && !frozen) {
-                                self.focus();
-                                command_line.enable();
+                        if (get_selected_text() === '' && $target) {
+                            if (++count === 1) {
+                                if (!frozen) {
+                                    if (!enabled) {
+                                        self.focus();
+                                    } else {
+                                        var timeout = settings.clickTimeout;
+                                        self.oneTime(timeout, name, position);
+                                        return;
+                                    }
+                                }
+                            } else {
+                                self.stopTime(name);
+                            }
+                        }
+                        reset();
+                    }).dblclick(function() {
+                        reset();
+                        self.stopTime(name);
+                    });
+                })();
+                (function() {
+                    var clip = self.find('textarea');
+                    self.on('contextmenu.terminal', function(e) {
+                        if (get_selected_text() === '') {
+                            if (!$(e.target).is('img,value,audio,object,canvas,a')) {
+                                if (!self.enabled()) {
+                                    self.enable();
+                                }
+                                var offset = command_line.offset();
+                                clip.css({
+                                    left: e.pageX - offset.left - 20,
+                                    top: e.pageY - offset.top - 20,
+                                    width: '5em',
+                                    height: '4em'
+                                });
+                                if (!clip.is(':focus')) {
+                                    clip.focus();
+                                }
+                                self.stopTime('textarea');
+                                self.oneTime(100, 'textarea', function() {
+                                    clip.css({
+                                        left: '',
+                                        top: '',
+                                        width: '',
+                                        height: ''
+                                    });
+                                });
+                                self.stopTime('selection');
+                                self.everyTime(20, 'selection', function() {
+                                    if (clip[0].selection !== clip[0].value) {
+                                        if (get_textarea_selection(clip[0])) {
+                                            clear_textarea_selection(clip[0]);
+                                            select(
+                                                self.find('.terminal-output')[0],
+                                                self.find('.cmd div:last-of-type')[0]
+                                            );
+                                            self.stopTime('selection');
+                                        }
+                                    }
+                                });
                             }
                         }
                     });
                 })();
             }
             self.delegate('.exception a', 'click', function(e) {
-                //.on('click', '.exception a', function(e) {
+                // .on('click', '.exception a', function(e) {
                 // in new jquery .delegate just call .on
                 var href = $(this).attr('href');
                 if (href.match(/:[0-9]+$/)) { // display line if specified
@@ -5230,65 +7189,132 @@
                     print_line(href);
                 }
             });
-            if (!navigator.platform.match(/linux/i)) {
-                // on linux system paste work with middle mouse button
-                self.mousedown(function(e) {
-                    if (e.which == 2) {
-                        var selected = get_selected_text();
-                        self.insert(selected);
+            if (self.is(':visible')) {
+                num_chars = self.cols();
+                command_line.resize(num_chars);
+                if (!char_size) {
+                    char_size = get_char_size(self);
+                }
+                num_rows = get_num_rows(self, char_size);
+            }
+            function resize() {
+                if (self.is(':visible')) {
+                    var width = self.width();
+                    var height = self.height();
+                    // prevent too many calculations in IE
+                    if (old_height !== height || old_width !== width) {
+                        self.resize();
                     }
+                    old_height = height;
+                    old_width = width;
+                }
+            }
+            function create_resizers() {
+                self.resizer('unbind').resizer(resize);
+                font_resizer.resizer('unbind').resizer(function() {
+                    char_size = get_char_size(self);
+                    self.resize();
                 });
             }
             if (self.is(':visible')) {
-                num_chars = self.cols();
-                command_line.resize(num_chars);
-                num_rows = get_num_rows(self);
+                create_resizers();
+            }
+            function observe_visibility() {
+                if (visibility_observer) {
+                    visibility_observer.unobserve(self[0]);
+                }
+                var was_enabled = self.enabled();
+                var visible = self.is(':visible');
+                if (visible) {
+                    create_resizers();
+                }
+                visibility_observer = new IntersectionObserver(function() {
+                    if (self.is(':visible') && !visible) {
+                        visible = true;
+                        create_resizers();
+                        char_size = get_char_size(self);
+                        resize();
+                        if (was_enabled) {
+                            self.enable();
+                        }
+                    } else if (visible && !self.is(':visible')) {
+                        visible = false;
+                        was_enabled = $.terminal.active() === self && self.enabled();
+                        self.disable();
+                    }
+                }, {
+                    root: document.body
+                });
+                visibility_observer.observe(self[0]);
+            }
+            var in_dom = !!self.closest('body').length;
+            var MutationObsrv = window.MutationObserver || window.WebKitMutationObserver;
+            if (window.IntersectionObserver) {
+                if (MutationObsrv) {
+                    mutation_observer = new MutationObsrv(function() {
+                        if (self.closest('body').length) {
+                            if (!in_dom) {
+                                self.scroll_to_bottom();
+                                observe_visibility();
+                            }
+                            in_dom = true;
+                        } else if (in_dom) {
+                            in_dom = false;
+                        }
+                    });
+                    mutation_observer.observe(document.body, {childList: true});
+                }
+                // check if element is in the DOM if not running IntersectionObserver
+                // don't make sense
+                if (in_dom) {
+                    observe_visibility();
+                }
+            }
+            command_queue.resolve();
+            // touch devices need touch event to get virtual keyboard
+            if (enabled && self.is(':visible') && !is_mobile) {
+                self.focus(undefined, true);
+            } else {
+                self.disable();
             }
             // -------------------------------------------------------------
             // Run Login
-            if (settings.login) {
-                self.login(settings.login, true, initialize);
+            if ($.isFunction(global_login_fn)) {
+                self.login(global_login_fn, true, initialize);
             } else {
                 initialize();
             }
-            self.oneTime(100, function() {
-                $win.bind('resize.terminal', function() {
-                    if (self.is(':visible')) {
-                        var width = self.width();
-                        var height = self.height();
-                        // prevent too many calculations in IE
-                        if (old_height !== height || old_width !== width) {
-                            self.resize();
-                        }
-                    }
-                });
-            });
             // -------------------------------------------------------------
             // :: helper
             function exec_spec(spec) {
                 var terminal = terminals.get()[spec[0]];
                 // execute if belong to this terminal
-                if (terminal && terminal_id == terminal.id()) {
+                if (terminal && terminal_id === terminal.id()) {
                     if (spec[2]) {
                         try {
                             if (paused) {
                                 var defer = $.Deferred();
                                 resume_callbacks.push(function() {
-                                    return terminal.exec(spec[2]).then(function(term, i) {
+                                    return terminal.exec(spec[2]).done(function() {
                                         terminal.save_state(spec[2], true, spec[1]);
                                         defer.resolve();
                                     });
                                 });
                                 return defer.promise();
                             } else {
-                                return terminal.exec(spec[2]).then(function(term, i) {
+                                return terminal.exec(spec[2]).done(function() {
                                     terminal.save_state(spec[2], true, spec[1]);
                                 });
                             }
                         } catch (e) {
-                            var cmd = $.terminal.escape_brackets(command);
-                            var msg = "Error while exec with command " + cmd;
-                            terminal.error(msg).exception(e);
+                            var settings = terminal.settings();
+                            if ($.isFunction(settings.exceptionHandler)) {
+                                settings.exceptionHandler.call(self, e, 'EXEC HASH');
+                            } else {
+                                var cmd = $.terminal.escape_brackets(command);
+                                var msg = 'Error while exec with command ' + cmd;
+                                terminal.error(msg).exception(e);
+                            }
                         }
                     }
                 }
@@ -5301,18 +7327,18 @@
                         try {
                             var hash = location.hash.replace(/^#/, '');
                             // yes no var - local inside terminal
-                            hash_commands = $.parseJSON(decodeURIComponent(hash));
+                            hash_commands = JSON.parse(decodeURIComponent(hash));
                             var i = 0;
                             (function recur() {
                                 var spec = hash_commands[i++];
                                 if (spec) {
-                                    exec_spec(spec).then(recur);
+                                    exec_spec(spec).done(recur);
                                 } else {
                                     change_hash = true;
                                 }
-                            })();//*/
+                            })();// */
                         } catch (e) {
-                            //invalid json - ignore
+                            // invalid json - ignore
                         }
                     });
                 } else {
@@ -5321,43 +7347,73 @@
             } else {
                 change_hash = true; // if enabled later
             }
-            //change_hash = true; // exec can now change hash
+            // change_hash = true; // exec can now change hash
             // -------------------------------------------------------------
-            if ($.event.special.mousewheel) {
-                var shift = false;
-                $(document).bind('keydown.terminal', function(e) {
-                    if (e.shiftKey) {
-                        shift = true;
+            var shift = false;
+            $(document).bind('keydown.terminal_' + self.id(), function(e) {
+                if (e.shiftKey) {
+                    shift = true;
+                }
+            }).bind('keyup.terminal_' + self.id(), function(e) {
+                // in Google Chromium/Linux shiftKey is false
+                if (e.shiftKey || e.which === 16) {
+                    shift = false;
+                }
+            });
+            // this could work without calling scroll on wheel event but we
+            // need to for cases where you have mouse wheel work differently
+            // like with less command that scroll text
+            function mousewheel(event, delta) {
+                if (!shift) {
+                    var interpreter = interpreters.top();
+                    var ret;
+                    if ($.isFunction(interpreter.mousewheel)) {
+                        ret = interpreter.mousewheel(event, delta, self);
+                    } else if ($.isFunction(settings.mousewheel)) {
+                        ret = settings.mousewheel(event, delta, self);
+                    }
+                    if (have_scrollbar() || ret === false) {
+                        event.preventDefault();
+                    }
+                    if (ret === false) {
+                        return;
                     }
-                }).bind('keyup.terminal', function(e) {
-                    // in Google Chromium/Linux shiftKey is false
-                    if (e.shiftKey || e.which == 16) {
-                        shift = false;
+                    if (delta > 0) {
+                        self.scroll(-40);
+                    } else {
+                        self.scroll(40);
                     }
-                });
-                self.mousewheel(function(event, delta) {
-                    if (!shift) {
-                        var interpreter = interpreters.top();
-                        if ($.isFunction(interpreter.mousewheel)) {
-                            var ret = interpreter.mousewheel(event, delta, self);
-                            if (ret === false) {
-                                return;
-                            }
-                        } else if ($.isFunction(settings.mousewheel)) {
-                            settings.mousewheel(event, delta, self);
-                        }
-                        if (delta > 0) {
-                            self.scroll(-40);
-                        } else {
-                            self.scroll(40);
-                        }
-                        //event.preventDefault();
+                }
+            }
+            if ($.event.special.mousewheel) {
+                // we keep mousewheel plugin just in case
+                self.on('mousewheel', mousewheel);
+            } else {
+                // detection take from:
+                // https://developer.mozilla.org/en-US/docs/Web/Events/wheel
+                var event;
+                var div = document.createElement("div");
+                if ("onwheel" in div) {
+                    event = "wheel"; // Modern browsers support "wheel"
+                } else if (document.onmousewheel !== undefined) {
+                    event = "mousewheel"; // Webkit and IE support at least "mousewheel"
+                } else {
+                    // let's assume that remaining browsers are older Firefox
+                    event = "DOMMouseScroll";
+                }
+                div = null;
+                self.on(event, function(e) {
+                    var delta;
+                    if (event === 'mousewheel') {
+                        delta = - 1 / 40 * e.originalEvent.wheelDelta;
+                    } else {
+                        delta = e.originalEvent.deltaY || e.originalEvent.detail;
                     }
+                    mousewheel(e, -delta);
                 });
             }
-            init_deferr.resolve();
         }); // make_interpreter
         self.data('terminal', self);
         return self;
-    }; //terminal plugin
-})(jQuery);
+    }; // terminal plugin
+});
diff --git a/src/main/resources/static/js/jquery.terminal.min.js b/src/main/resources/static/js/jquery.terminal.min.js
index 486331f..5e3d15c 100644
--- a/src/main/resources/static/js/jquery.terminal.min.js
+++ b/src/main/resources/static/js/jquery.terminal.min.js
@@ -4,16 +4,17 @@
  *  __ / // // // // // _  // _// // / / // _  // _//     // //  \/ // _ \/ /
  * /  / // // // // // ___// / / // / / // ___// / / / / // // /\  // // / /__
  * \___//____ \\___//____//_/ _\_  / /_//____//_/ /_/ /_//_//_/ /_/ \__\_\___/
- *           \/              /____/                              version 0.11.23
+ *           \/              /____/                              version 1.11.4
  *
  * This file is part of jQuery Terminal. http://terminal.jcubic.pl
  *
- * Copyright (c) 2010-2016 Jakub Jankiewicz <http://jcubic.pl>
+ * Copyright (c) 2010-2018 Jakub Jankiewicz <http://jcubic.pl/me>
  * Released under the MIT license
  *
  * Contains:
  *
  * Storage plugin Distributed under the MIT License
+ * modified to work from Data URIs that block storage and cookies in Chrome
  * Copyright (c) 2010 Dave Schindler
  *
  * jQuery Timers licenced with the WTFPL
@@ -31,8 +32,6 @@
  * Copyright (c) 2007-2013 Alexandru Marasteanu <hello at alexei dot ro>
  * licensed under 3 clause BSD license
  *
- * Date: Sun, 08 Jan 2017 11:44:38 +0000
+ * Date: Sat, 27 Jan 2018 15:44:36 +0000
  */
-(function(e){var n=function(){if(!n.cache.hasOwnProperty(arguments[0])){n.cache[arguments[0]]=n.parse(arguments[0])}return n.format.call(null,n.cache[arguments[0]],arguments)};n.format=function(e,t){var o=1,a=e.length,s="",l,f=[],c,u,h,p,m,g;for(c=0;c<a;c++){s=r(e[c]);if(s==="string"){f.push(e[c])}else if(s==="array"){h=e[c];if(h[2]){l=t[o];for(u=0;u<h[2].length;u++){if(!l.hasOwnProperty(h[2][u])){throw n('[sprintf] property "%s" does not exist',h[2][u])}l=l[h[2][u]]}}else if(h[1]){l=t[h[1]]}else{l=t[o++]}if(/[^s]/.test(h[8])&&r(l)!="number"){throw n("[sprintf] expecting number but found %s",r(l))}switch(h[8]){case"b":l=l.toString(2);break;case"c":l=String.fromCharCode(l);break;case"d":l=parseInt(l,10);break;case"e":l=h[7]?l.toExponential(h[7]):l.toExponential();break;case"f":l=h[7]?parseFloat(l).toFixed(h[7]):parseFloat(l);break;case"o":l=l.toString(8);break;case"s":l=(l=String(l))&&h[7]?l.substring(0,h[7]):l;break;case"u":l=l>>>0;break;case"x":l=l.toString(16);break;case"X":l=l.toString(16).toUpperCase();break}l=/[def]/.test(h[8])&&h[3]&&l>=0?"+"+l:l;m=h[4]?h[4]=="0"?"0":h[4].charAt(1):" ";g=h[6]-String(l).length;p=h[6]?i(m,g):"";f.push(h[5]?l+p:p+l)}}return f.join("")};n.cache={};n.parse=function(e){var n=e,t=[],r=[],i=0;while(n){if((t=/^[^\x25]+/.exec(n))!==null){r.push(t[0])}else if((t=/^\x25{2}/.exec(n))!==null){r.push("%")}else if((t=/^\x25(?:([1-9]\d*)\$|\(([^\)]+)\))?(\+)?(0|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-fosuxX])/.exec(n))!==null){if(t[2]){i|=1;var o=[],a=t[2],s=[];if((s=/^([a-z_][a-z_\d]*)/i.exec(a))!==null){o.push(s[1]);while((a=a.substring(s[0].length))!==""){if((s=/^\.([a-z_][a-z_\d]*)/i.exec(a))!==null){o.push(s[1])}else if((s=/^\[(\d+)\]/.exec(a))!==null){o.push(s[1])}else{throw"[sprintf] huh?"}}}else{throw"[sprintf] huh?"}t[2]=o}else{i|=2}if(i===3){throw"[sprintf] mixing positional and named placeholders is not (yet) supported"}r.push(t)}else{throw"[sprintf] huh?"}n=n.substring(t[0].length)}return r};var t=function(e,t,r){r=t.slice(0);r.splice(0,0,e);return n.apply(null,r)};function r(e){return Object.prototype.toString.call(e).slice(8,-1).toLowerCase()}function i(e,n){for(var t=[];n>0;t[--n]=e){}return t.join("")}e.sprintf=n;e.vsprintf=t})(typeof global!="undefined"?global:window);(function(e,n){"use strict";e.omap=function(n,t){var r={};e.each(n,function(e,i){r[e]=t.call(n,e,i)});return r};var t={clone_object:function(n){var t={};if(typeof n=="object"){if(e.isArray(n)){return this.clone_array(n)}else if(n===null){return n}else{for(var r in n){if(e.isArray(n[r])){t[r]=this.clone_array(n[r])}else if(typeof n[r]=="object"){t[r]=this.clone_object(n[r])}else{t[r]=n[r]}}}}return t},clone_array:function(n){if(!e.isFunction(Array.prototype.map)){throw new Error("You'r browser don't support ES5 array map "+"use es5-shim")}return n.slice(0).map(function(e){if(typeof e=="object"){return this.clone_object(e)}else{return e}}.bind(this))}};var r=function(e){return t.clone_object(e)};var i=function(){var e="test",n=window.localStorage;try{n.setItem(e,"1");n.removeItem(e);return true}catch(t){return false}};var o=i();function a(e,n){var t;if(typeof e==="string"&&typeof n==="string"){localStorage[e]=n;return true}else if(typeof e==="object"&&typeof n==="undefined"){for(t in e){if(e.hasOwnProperty(t)){localStorage[t]=e[t]}}return true}return false}function s(e,n){var t,r,i;t=new Date;t.setTime(t.getTime()+31536e6);r="; expires="+t.toGMTString();if(typeof e==="string"&&typeof n==="string"){document.cookie=e+"="+n+r+"; path=/";return true}else if(typeof e==="object"&&typeof n==="undefined"){for(i in e){if(e.hasOwnProperty(i)){document.cookie=i+"="+e[i]+r+"; path=/"}}return true}return false}function l(e){return localStorage[e]}function f(e){var n,t,r,i;n=e+"=";t=document.cookie.split(";");for(r=0;r<t.length;r++){i=t[r];while(i.charAt(0)===" "){i=i.substring(1,i.length)}if(i.indexOf(n)===0){return i.substring(n.length,i.length)}}return null}function c(e){return delete localStorage[e]}function u(e){return s(e,"",-1)}e.extend({Storage:{set:o?a:s,get:o?l:f,remove:o?c:u}});var h=e;h.fn.extend({everyTime:function(e,n,t,r,i){return this.each(function(){h.timer.add(this,e,n,t,r,i)})},oneTime:function(e,n,t){return this.each(function(){h.timer.add(this,e,n,t,1)})},stopTime:function(e,n){return this.each(function(){h.timer.remove(this,e,n)})}});h.extend({timer:{guid:1,global:{},regex:/^([0-9]+)\s*(.*s)?$/,powers:{ms:1,cs:10,ds:100,s:1e3,das:1e4,hs:1e5,ks:1e6},timeParse:function(e){if(e===n||e===null){return null}var t=this.regex.exec(h.trim(e.toString()));if(t[2]){var r=parseInt(t[1],10);var i=this.powers[t[2]]||1;return r*i}else{return e}},add:function(e,n,t,r,i,o){var a=0;if(h.isFunction(t)){if(!i){i=r}r=t;t=n}n=h.timer.timeParse(n);if(typeof n!=="number"||isNaN(n)||n<=0){return}if(i&&i.constructor!==Number){o=!!i;i=0}i=i||0;o=o||false;if(!e.$timers){e.$timers={}}if(!e.$timers[t]){e.$timers[t]={}}r.$timerID=r.$timerID||this.guid++;var s=function(){if(o&&s.inProgress){return}s.inProgress=true;if(++a>i&&i!==0||r.call(e,a)===false){h.timer.remove(e,t,r)}s.inProgress=false};s.$timerID=r.$timerID;if(!e.$timers[t][r.$timerID]){e.$timers[t][r.$timerID]=window.setInterval(s,n)}if(!this.global[t]){this.global[t]=[]}this.global[t].push(e)},remove:function(e,n,t){var r=e.$timers,i;if(r){if(!n){for(var o in r){if(r.hasOwnProperty(o)){this.remove(e,o,t)}}}else if(r[n]){if(t){if(t.$timerID){window.clearInterval(r[n][t.$timerID]);delete r[n][t.$timerID]}}else{for(var a in r[n]){if(r[n].hasOwnProperty(a)){window.clearInterval(r[n][a]);delete r[n][a]}}}for(i in r[n]){if(r[n].hasOwnProperty(i)){break}}if(!i){i=null;delete r[n]}}for(i in r){if(r.hasOwnProperty(i)){break}}if(!i){e.$timers=null}}}}});if(/(msie) ([\w.]+)/.exec(navigator.userAgent.toLowerCase())){h(window).one("unload",function(){var e=h.timer.global;for(var n in e){if(e.hasOwnProperty(n)){var t=e[n],r=t.length;while(--r){h.timer.remove(t[r],n)}}}})}(function(e){if(!String.prototype.split.toString().match(/\[native/)){return}var n=String.prototype.split,t=/()??/.exec("")[1]===e,r;r=function(r,i,o){if(Object.prototype.toString.call(i)!=="[object RegExp]"){return n.call(r,i,o)}var a=[],s=(i.ignoreCase?"i":"")+(i.multiline?"m":"")+(i.extended?"x":"")+(i.sticky?"y":""),l=0,f,c,u,h;i=new RegExp(i.source,s+"g");r+="";if(!t){f=new RegExp("^"+i.source+"$(?!\\s)",s)}o=o===e?-1>>>0:o>>>0;while(c=i.exec(r)){u=c.index+c[0].length;if(u>l){a.push(r.slice(l,c.index));if(!t&&c.length>1){c[0].replace(f,function(){for(var n=1;n<arguments.length-2;n++){if(arguments[n]===e){c[n]=e}}})}if(c.length>1&&c.index<r.length){Array.prototype.push.apply(a,c.slice(1))}h=c[0].length;l=u;if(a.length>=o){break}}if(i.lastIndex===c.index){i.lastIndex++}}if(l===r.length){if(h||!i.test("")){a.push("")}}else{a.push(r.slice(l))}return a.length>o?a.slice(0,o):a};String.prototype.split=function(e,n){return r(this,e,n)};return r})();e.fn.caret=function(e){var n=this[0];var t=n.contentEditable==="true";if(arguments.length==0){if(window.getSelection){if(t){n.focus();var r=window.getSelection().getRangeAt(0),i=r.cloneRange();i.selectNodeContents(n);i.setEnd(r.endContainer,r.endOffset);return i.toString().length}return n.selectionStart}if(document.selection){n.focus();if(t){var r=document.selection.createRange(),i=document.body.createTextRange();i.moveToElementText(n);i.setEndPoint("EndToEnd",r);return i.text.length}var e=0,o=n.createTextRange(),i=document.selection.createRange().duplicate(),a=i.getBookmark();o.moveToBookmark(a);while(o.moveStart("character",-1)!==0)e++;return e}return 0}if(e==-1)e=this[t?"text":"val"]().length;if(window.getSelection){if(t){n.focus();window.getSelection().collapse(n.firstChild,e)}else n.setSelectionRange(e,e)}else if(document.body.createTextRange){var o=document.body.createTextRange();o.moveToElementText(n);o.moveStart("character",e);o.collapse(true);o.select()}if(!t)n.focus();return e};function p(e,n){var t=[];var r=e.length;if(r<n){return[e]}else if(n<0){throw new Error("str_parts: length can't be negative")}for(var i=0;i<r;i+=n){t.push(e.substring(i,i+n))}return t}function m(n){var t=n?[n]:[];var r=0;e.extend(this,{get:function(){return t},rotate:function(){if(!t.filter(Boolean).length){return}if(t.length===1){return t[0]}else{if(r===t.length-1){r=0}else{++r}if(t[r]){return t[r]}else{return this.rotate()}}},length:function(){return t.length},remove:function(e){delete t[e]},set:function(e){for(var n=t.length;n--;){if(t[n]===e){r=n;return}}this.append(e)},front:function(){if(t.length){var e=r;var n=false;while(!t[e]){e++;if(e>t.length){if(n){break}e=0;n=true}}return t[e]}},append:function(e){t.push(e)}})}function g(n){var t=n instanceof Array?n:n?[n]:[];e.extend(this,{data:function(){return t},map:function(n){return e.map(t,n)},size:function(){return t.length},pop:function(){if(t.length===0){return null}else{var e=t[t.length-1];t=t.slice(0,t.length-1);return e}},push:function(e){t=t.concat([e]);return e},top:function(){return t.length>0?t[t.length-1]:null},clone:function(){return new g(t.slice(0))}})}function d(n,t,r){var i=true;var o="";if(typeof n==="string"&&n!==""){o=n+"_"}o+="commands";var a;if(r){a=[]}else{a=e.Storage.get(o);a=a?e.parseJSON(a):[]}var s=a.length-1;e.extend(this,{append:function(n){if(i){if(a[a.length-1]!==n){a.push(n);if(t&&a.length>t){a=a.slice(-t)}s=a.length-1;if(!r){e.Storage.set(o,JSON.stringify(a))}}}},data:function(){return a},reset:function(){s=a.length-1},last:function(){return a[a.length-1]},end:function(){return s===a.length-1},position:function(){return s},current:function(){return a[s]},next:function(){if(s<a.length-1){++s}if(s!==-1){return a[s]}},previous:function(){var e=s;if(s>0){--s}if(e!==-1){return a[s]}},clear:function(){a=[];this.purge()},enabled:function(){return i},enable:function(){i=true},purge:function(){if(!r){e.Storage.remove(o)}},disable:function(){i=false}})}var v=function(){var e=document.createElement("div");e.setAttribute("onpaste","return;");return typeof e.onpaste=="function"}();var y=true;e.fn.cmd=function(t){var r=this;var i=r.data("cmd");if(i){return i}r.addClass("cmd");r.append('<span class="prompt"></span><span></span>'+'<span class="cursor">&nbsp;</span><span></span>');var o=e("<textarea>").attr({autocapitalize:"off",spellcheck:"false"}).addClass("clipboard").appendTo(r);if(t.width){r.width(t.width)}var a;var s;var l=r.find(".prompt");var f=false;var c="";var u=null;var h;var m=t.mask||false;var g="";var y;var w="";var _="";var C=0;var S;var T;var F=t.historySize||60;var E,A;var R=r.find(".cursor");var j;var $=0;function I(){var e=o.is(":focus");if(T){if(!e){o.focus();r.oneTime(10,function(){o.focus()})}}else{if(e){o.blur()}}}function O(){r.oneTime(10,function(){o.val(g);if(T){r.oneTime(10,function(){o.caret(C)})}})}if(b&&!k){j=function(e){if(e){R.addClass("blink")}else{R.removeClass("blink")}}}else{var z=false;j=function(e){if(e&&!z){z=true;R.addClass("inverted blink");r.everyTime(500,"blink",N)}else if(z&&!e){z=false;r.stopTime("blink",N);R.removeClass("inverted blink")}}}function N(e){R.toggleClass("inverted")}function K(){S="(reverse-i-search)`"+c+"': ";W()}function L(){S=h;f=false;u=null;c=""}function P(n){var t=A.data();var i,o;var a=t.length;if(n&&u>0){a-=u}if(c.length>0){for(var s=c.length;s>0;s--){o=e.terminal.escape_regex(c.substring(0,s));i=new RegExp(o);for(var l=a;l--;){if(i.test(t[l])){u=t.length-l;r.position(t[l].indexOf(o));r.set(t[l],true);H();if(c.length!==s){c=c.substring(0,s);K()}return}}}}c=""}function D(){var e=r.width();var n=R[0].getBoundingClientRect().width;a=Math.floor(e/n)}function B(e){var n=e.substring(0,a-s);var t=e.substring(a-s);return[n].concat(p(t,a))}var H=function(n){var t=R.prev();var r=R.next();function i(n,i){var o=n.length;if(i===o){t.html(e.terminal.encode(n));R.html("&nbsp;");r.html("")}else if(i===0){t.html("");R.html(e.terminal.encode(n.slice(0,1)));r.html(e.terminal.encode(n.slice(1)))}else{var a=n.slice(0,i);t.html(e.terminal.encode(a));var s=n.slice(i,i+1);R.html(e.terminal.encode(s));if(i===n.length-1){r.html("")}else{r.html(e.terminal.encode(n.slice(i+1)))}}}function o(n){return"<div>"+e.terminal.encode(n)+"</div>"}function l(n){var t=r;e.each(n,function(n,r){t=e(o(r)).insertAfter(t).addClass("clear")})}function f(n){e.each(n,function(e,n){t.before(o(n))})}var c=0;return function(){var c;var u;switch(typeof m){case"boolean":c=m?g.replace(/./g,"*"):g;break;case"string":c=g.replace(/./g,m);break}var h,d;n.find("div").remove();t.html("");if(c.length>a-s-1||c.match(/\n/)){var v;var y=c.match(/\t/g);var w=y?y.length*3:0;if(y){c=c.replace(/\t/g,"\x00\x00\x00\x00")}if(c.match(/\n/)){var _=c.split("\n");d=a-s-1;for(h=0;h<_.length-1;++h){_[h]+=" "}if(_[0].length>d){v=[_[0].substring(0,d)];u=_[0].substring(d);v=v.concat(p(u,a))}else{v=[_[0]]}for(h=1;h<_.length;++h){if(_[h].length>a){v=v.concat(p(_[h],a))}else{v.push(_[h])}}}else{v=B(c)}if(y){v=e.map(v,function(e){return e.replace(/\x00\x00\x00\x00/g,"	")})}d=v[0].length;if(d===0&&v.length===1){}else if(C<d){i(v[0],C);l(v.slice(1))}else if(C===d){t.before(o(v[0]));i(v[1],0);l(v.slice(2))}else{var b=v.length;var k=0;if(C<d){i(v[0],C);l(v.slice(1))}else if(C===d){t.before(o(v[0]));i(v[1],0);l(v.slice(2))}else{var x=v.slice(-1)[0];var S=c.length-C-w;var T=x.length;var F=0;if(S<=T){f(v.slice(0,-1));if(T===S){F=0}else{F=T-S}i(x,F)}else{if(b===3){u=e.terminal.encode(v[0]);t.before("<div>"+u+"</div>");i(v[1],C-d-1);u=e.terminal.encode(v[2]);r.after('<div class="clear">'+u+"</div>")}else{var E;var A;F=C;for(h=0;h<v.length;++h){var j=v[h].length;if(F>j){F-=j}else{break}}A=v[h];E=h;if(F===A.length){F=0;A=v[++E]}i(A,F);f(v.slice(0,E));l(v.slice(E+1))}}}}}else{if(c===""){t.html("");R.html("&nbsp;");r.html("")}else{i(c,C)}}}}(r);var W=function(){function n(n){l.html(e.terminal.format(e.terminal.encode(n)));s=l.text().length}return function(){switch(typeof S){case"string":n(S);break;case"function":S(n);break}}}();function q(e){if($++>0){return}if(e.originalEvent){e=e.originalEvent}if(r.isenabled()){var n=r.find("textarea");if(!n.is(":focus")){n.focus()}r.oneTime(100,function(){r.insert(n.val());n.val("");O()})}}var M=true;var U=false;var Y;function G(i){var a,s,l;if(T){if(e.isFunction(t.keydown)){a=t.keydown(i);if(a!==n){return a}}if(i.which!==38&&!(i.which===80&&i.ctrlKey)){M=true}if(f&&(i.which===35||i.which===36||i.which===37||i.which===38||i.which===39||i.which===40||i.which===13||i.which===27)){L();W();if(i.which===27){r.set("")}H();G.call(this,i)}else if(i.altKey){if(i.which===68){r.set(g.slice(0,C)+g.slice(C).replace(/ *[^ ]+ *(?= )|[^ ]+$/,""),true);return false}return true}else if(i.keyCode===13){if(i.shiftKey){r.insert("\n")}else{if(A&&g&&!m&&(e.isFunction(t.historyFilter)&&t.historyFilter(g))||t.historyFilter instanceof RegExp&&g.match(t.historyFilter)||!t.historyFilter){A.append(g)}var u=g;A.reset();r.set("");if(t.commands){t.commands(u)}if(e.isFunction(S)){W()}e(".clipboard").val("")}}else if(i.which===8){if(f){c=c.slice(0,-1);K()}else{if(g!==""&&C>0){r["delete"](-1)}}if(x){return true}}else if(i.which===67&&i.ctrlKey&&i.shiftKey){w=J()}else if(i.which===86&&i.ctrlKey&&i.shiftKey){if(w!==""){r.insert(w)}}else if(i.which===9&&!(i.ctrlKey||i.altKey)){r.insert("	")}else if(i.which===46){r["delete"](1);return}else if(A&&(i.which===38&&!i.ctrlKey)||i.which===80&&i.ctrlKey){if(M){y=g;r.set(A.current())}else{r.set(A.previous())}M=false}else if(A&&(i.which===40&&!i.ctrlKey)||i.which===78&&i.ctrlKey){r.set(A.end()?y:A.next())}else if(i.which===37||i.which===66&&i.ctrlKey){if(i.ctrlKey&&i.which!==66){l=C-1;s=0;if(g[l]===" "){--l}for(var p=l;p>0;--p){if(g[p]===" "&&g[p+1]!==" "){s=p+1;break}else if(g[p]==="\n"&&g[p+1]!=="\n"){s=p;break}}r.position(s)}else{if(C>0){r.position(-1,true);H()}}}else if(i.which===82&&i.ctrlKey){if(f){P(true)}else{h=S;K();y=g;r.set("");H();f=true}}else if(i.which==71&&i.ctrlKey){if(f){S=h;W();r.set(y);H();f=false;c=""}}else if(i.which===39||i.which===70&&i.ctrlKey){if(i.ctrlKey&&i.which!==70){if(g[C]===" "){++C}var d=/\S[\n\s]{2,}|[\n\s]+\S?/;var b=g.slice(C).match(d);if(!b||b[0].match(/^\s+$/)){r.position(g.length)}else{if(b[0][0]!==" "){C+=b.index+1}else{C+=b.index+b[0].length-1;if(b[0][b[0].length-1]!==" "){--C}}}H()}else{if(C<g.length){r.position(1,true)}}}else if(i.which===123){return}else if(i.which===36){r.position(0)}else if(i.which===35){r.position(g.length)}else if(i.shiftKey&&i.which==45){o.val("");$=0;if(!v){q(i)}else{o.focus()}return}else if(i.ctrlKey||i.metaKey){if(i.which===192){return}if(i.metaKey){if(i.which===82){return}else if(i.which===76){return}}if(i.shiftKey){if(i.which===84){return}}else{if(i.which===81){if(g!==""&&C!==0){var k=g.slice(0,C).match(/([^ ]+ *$)/);_=r["delete"](-k[0].length)}return false}else if(i.which===72){if(g!==""&&C>0){r["delete"](-1)}return false}else if(i.which===65){r.position(0)}else if(i.which===69){r.position(g.length)}else if(i.which===88||i.which===67||i.which===84){return}else if(i.which===89){if(_!==""){r.insert(_)}}else if(i.which===86||i.which===118){o.val("");$=0;if(!v){q(i)}else{o.focus();o.on("input",function F(e){q(e);o.off("input",F)})}return}else if(i.which===75){_=r["delete"](g.length-C)}else if(i.which===85){if(g!==""&&C!==0){_=r["delete"](-C)}}else if(i.which===17){return false}}}else{U=false;Y=true;return}i.preventDefault()}}function Q(){if(e.isFunction(t.onCommandChange)){t.onCommandChange(g)}}e.extend(r,{name:function(e){if(e!==n){E=e;var i=A&&A.enabled()||!A;A=new d(e,F,t.history=="memory");if(!i){A.disable()}return r}else{return E}},purge:function(){A.clear();return r},history:function(){return A},"delete":function(e,n){var t;if(e===0){return r}else if(e<0){if(C>0){t=g.slice(0,C).slice(e);g=g.slice(0,C+e)+g.slice(C,g.length);if(!n){r.position(C+e)}else{Q()}}}else{if(g!==""&&C<g.length){t=g.slice(C).slice(0,e);g=g.slice(0,C)+g.slice(C+e,g.length);Q()}}H();O();return t},set:function(e,t){if(e!==n){g=e;if(!t){r.position(g.length)}H();O();Q()}return r},insert:function(e,n){if(C===g.length){g+=e}else if(C===0){g=e+g}else{g=g.slice(0,C)+e+g.slice(C)}if(!n){r.position(e.length,true)}else{O()}H();Q();return r},get:function(){return g},commands:function(e){if(e){t.commands=e;return r}else{return e}},destroy:function(){Z.unbind("keypress.cmd",V);Z.unbind("keydown.cmd",G);Z.unbind("paste.cmd",q);Z.unbind("input.cmd",ee);r.stopTime("blink",N);r.find(".cursor").next().remove().end().prev().remove().end().remove();r.find(".prompt, .clipboard").remove();r.removeClass("cmd").removeData("cmd");return r},prompt:function(e){if(e===n){return S}else{if(typeof e==="string"||typeof e==="function"){S=e}else{throw new Error("prompt must be a function or string")}W();H();return r}},kill_text:function(){return _},position:function(n,i){if(typeof n==="number"){if(i){C+=n}else{if(n<0){C=0}else if(n>g.length){C=g.length}else{C=n}}if(e.isFunction(t.onPositionChange)){t.onPositionChange(C)}H();O();return r}else{return C}},visible:function(){var e=r.visible;return function(){e.apply(r,[]);H();W()}}(),show:function(){var e=r.show;return function(){e.apply(r,[]);H();W()}}(),resize:function(e){if(e){a=e}else{D()}H();return r},enable:function(){T=true;r.addClass("enabled");o.caret(C);j(true);I();return r},isenabled:function(){return T},disable:function(){T=false;r.removeClass("enabled");j(false);I();return r},mask:function(e){if(typeof e==="undefined"){return m}else{m=e;H();return r}}});r.name(t.name||t.prompt||"");if(typeof t.prompt=="string"){S=t.prompt}else{S="> "}W();if(t.enabled===n||t.enabled===true){r.enable()}var X;var Z=e(document.documentElement||window);function V(i){var o;Y=false;if((i.ctrlKey||i.metaKey)&&[99,118,86].indexOf(i.which)!==-1){return}if(U){return}if(!f&&e.isFunction(t.keypress)){o=t.keypress(i)}if(o===n||o){if(T){if(e.inArray(i.which,[38,13,0,8])>-1&&!(i.which===38&&i.shiftKey)){if(i.keyCode==123){return}return false}else if(!i.ctrlKey&&!(i.altKey&&i.which===100)||i.altKey){if(f){c+=String.fromCharCode(i.which);P();K()}else{r.insert(String.fromCharCode(i.which))}return false}}}else{return o}}function ee(e){if(Y){var n=o.val();if(n||e.which==8){r.set(n)}}}Z.bind("keypress.cmd",V).bind("keydown.cmd",G).bind("input.cmd",ee);r.data("cmd",r);return r};function w(n){return e("<div>"+e.terminal.strip(n)+"</div>").text().length}function _(e){return e.length-w(e)}var b=function(){var e=false,t="animation",r="",i="Webkit Moz O ms Khtml".split(" "),o="",a=document.createElement("div");if(a.style.animationName){e=true}if(e===false){for(var s=0;s<i.length;s++){var l=i[s]+"AnimationName";if(a.style[l]!==n){o=i[s];t=o+"Animation";r="-"+o.toLowerCase()+"-";e=true;break}}}return e}();var k=navigator.userAgent.toLowerCase().indexOf("android")!=-1;var x=function(){return"ontouchstart"in window||window.DocumentTouch&&document instanceof DocumentTouch}();function C(n,t){var r=t(n);if(r.length){var i=r.shift();var o=new RegExp("^"+e.terminal.escape_regex(i));var a=n.replace(o,"").trim();return{command:n,name:i,args:r,rest:a}}else{return{command:n,name:"",args:[],rest:""}}}var S=/(\[\[[!gbiuso]*;[^;]*;[^\]]*\](?:[^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]?)/i;var T=/\[\[([!gbiuso]*);([^;]*);([^;\]]*);?([^;\]]*);?([^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]?/gi;var F=/\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]?/gi;var E=/\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]/gi;var A=/^\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^\[]*\[[^\]]*)\]$/gi;var R=/^#([0-9a-f]{3}|[0-9a-f]{6})$/i;var j=/(\bhttps?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\]\[)])+\b)/gi;var $=/\b(https?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\][)])+)\b(?![^[\]]*])/gi;var I=/((([^<>('")[\]\\.,;:\s@\"]+(\.[^<>()[\]\\.,;:\s@\"]+)*)|(\".+\"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,})))/g;var O=/('[^']*'|"(\\"|[^"])*"|(?:\/(\\\/|[^\/])+\/[gimy]*)(?=:? |$)|(\\ |[^ ])+|[\w-]+)/gi;var z=/(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;var N=/^(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;var K=/\[\[[!gbiuso]*;[^;]*;[^\]]*\]?$/i;var L=/(\[\[(?:[^\]]|\\\])*\]\])/;e.terminal={version:"0.11.23",color_names:["black","silver","gray","white","maroon","red","purple","fuchsia","green","lime","olive","yellow","navy","blue","teal","aqua","aliceblue","antiquewhite","aqua","aquamarine","azure","beige","bisque","black","blanchedalmond","blue","blueviolet","brown","burlywood","cadetblue","chartreuse","chocolate","coral","cornflowerblue","cornsilk","crimson","cyan","darkblue","darkcyan","darkgoldenrod","darkgray","darkgreen","darkgrey","darkkhaki","darkmagenta","darkolivegreen","darkorange","darkorchid","darkred","darksalmon","darkseagreen","darkslateblue","darkslategray","darkslategrey","darkturquoise","darkviolet","deeppink","deepskyblue","dimgray","dimgrey","dodgerblue","firebrick","floralwhite","forestgreen","fuchsia","gainsboro","ghostwhite","gold","goldenrod","gray","green","greenyellow","grey","honeydew","hotpink","indianred","indigo","ivory","khaki","lavender","lavenderblush","lawngreen","lemonchiffon","lightblue","lightcoral","lightcyan","lightgoldenrodyellow","lightgray","lightgreen","lightgrey","lightpink","lightsalmon","lightseagreen","lightskyblue","lightslategray","lightslategrey","lightsteelblue","lightyellow","lime","limegreen","linen","magenta","maroon","mediumaquamarine","mediumblue","mediumorchid","mediumpurple","mediumseagreen","mediumslateblue","mediumspringgreen","mediumturquoise","mediumvioletred","midnightblue","mintcream","mistyrose","moccasin","navajowhite","navy","oldlace","olive","olivedrab","orange","orangered","orchid","palegoldenrod","palegreen","paleturquoise","palevioletred","papayawhip","peachpuff","peru","pink","plum","powderblue","purple","red","rosybrown","royalblue","saddlebrown","salmon","sandybrown","seagreen","seashell","sienna","silver","skyblue","slateblue","slategray","slategrey","snow","springgreen","steelblue","tan","teal","thistle","tomato","turquoise","violet","wheat","white","whitesmoke","yellow","yellowgreen"],valid_color:function(n){if(n.match(R)){return true}else{return e.inArray(n.toLowerCase(),e.terminal.color_names)!==-1}},escape_regex:function(e){if(typeof e=="string"){var n=/([-\\\^$\[\]()+{}?*.|])/g;return e.replace(n,"\\$1")}},have_formatting:function(e){return typeof e=="string"&&!!e.match(E)},is_formatting:function(e){return typeof e=="string"&&!!e.match(A)},format_split:function(e){return e.split(S)},split_equal:function(n,t,r){var i=false;var o=false;var a="";var s=[];var l=n.replace(F,function(e,n,t){var r=n.match(/;/g).length;if(r>=4){return e}else if(r==2){r=";;"}else if(r==3){r=";"}else{r=""}var i=t.replace(/\\\]/g,"&#93;").replace(/\n/g,"\\n").replace(/&nbsp;/g," ");return"[["+n+r+i+"]"+t+"]"}).split(/\n/g);function f(){return h.substring(v-6,v)=="&nbsp;"||h.substring(v-1,v)==" "}for(var c=0,u=l.length;c<u;++c){if(l[c]===""){s.push("");continue}var h=l[c];var p=0;var m=0;var g;var d=-1;for(var v=0,y=h.length;v<y;++v){if(h.substring(v).match(N)){i=true;o=false}else if(i&&h[v]==="]"){if(o){i=false;o=false}else{o=true}}else if(i&&o||!i){if(h[v]==="&"){var w=h.substring(v).match(/^(&[^;]+;)/);if(!w){throw new Error("Unclosed html entity in line "+(c+1)+" at char "+(v+1))}v+=w[1].length-2;if(v===y-1){s.push(g+w[1])}continue}else if(h[v]==="]"&&h[v-1]==="\\"){--m}else{++m}}if(f()&&(i&&o||!i||h[v]==="["&&h[v+1]==="[")){d=v}if((m===t||v===y-1)&&(i&&o||!i)){var _=e.terminal.strip(h.substring(d));_=e("<span>"+_+"</span>").text();var b=_.length;_=_.substring(0,v+t+1);var k=!!_.match(/\s/)||v+t+1>b;if(r&&d!=-1&&v!==y-1&&k){g=h.substring(p,d);v=d-1}else{g=h.substring(p,v+1)}if(r){g=g.replace(/(&nbsp;|\s)+$/g,"")}d=-1;p=v+1;m=0;if(a){g=a+g;if(g.match("]")){a=""}}var x=g.match(F);if(x){var C=x[x.length-1];if(C[C.length-1]!=="]"){a=C.match(z)[1];g+="]"}else if(g.match(K)){var S=g.length;g=g.replace(K,"");a=C.match(z)[1]}}s.push(g)}}}return s},encode:function(e){e=e.replace(/&(?!#[0-9]+;|[a-zA-Z]+;)/g,"&amp;");return e.replace(/</g,"&lt;").replace(/>/g,"&gt;").replace(/ /g,"&nbsp;").replace(/\t/g,"&nbsp;&nbsp;&nbsp;&nbsp;")},escape_formatting:function(n){return e.terminal.escape_brackets(e.terminal.encode(n))},format:function(n,t){var r=e.extend({},{linksNoReferrer:false},t||{});if(typeof n==="string"){var i=e.terminal.format_split(n);n=e.map(i,function(n){if(n===""){return n}else if(e.terminal.is_formatting(n)){n=n.replace(/\[\[[^\]]+\]/,function(e){return e.replace(/&nbsp;/g," ")});return n.replace(T,function(n,t,i,o,a,s,l){if(l===""){return""}l=l.replace(/\\]/g,"]");var f="";if(t.indexOf("b")!==-1){f+="font-weight:bold;"}var c=[];if(t.indexOf("u")!==-1){c.push("underline")}if(t.indexOf("s")!==-1){c.push("line-through")}if(t.indexOf("o")!==-1){c.push("overline")}if(c.length){f+="text-decoration:"+c.join(" ")+";"}if(t.indexOf("i")!==-1){f+="font-style:italic;"}if(e.terminal.valid_color(i)){f+="color:"+i+";";if(t.indexOf("g")!==-1){f+="text-shadow:0 0 5px "+i+";"}}if(e.terminal.valid_color(o)){f+="background-color:"+o}var u;if(s===""){u=l}else{u=s.replace(/&#93;/g,"]")}var h;if(t.indexOf("!")!==-1){if(u.match(I)){h='<a href="mailto:'+u+'" '}else{h='<a target="_blank" href="'+u+'" ';if(r.linksNoReferrer){h+='rel="noreferrer" '}}}else{h="<span"}if(f!==""){h+=' style="'+f+'"'}if(a!==""){h+=' class="'+a+'"'}if(t.indexOf("!")!==-1){h+=">"+l+"</a>"}else{h+=' data-text="'+u.replace('"',"&quote;")+'">'+l+"</span>"}return h})}else{return"<span>"+n.replace(/\\\]/g,"]")+"</span>"}}).join("");return n.replace(/<span><br\s*\/?><\/span>/gi,"<br/>")}else{return""}},escape_brackets:function(e){return e.replace(/\[/g,"&#91;").replace(/\]/g,"&#93;")},strip:function(e){return e.replace(T,"$6")},active:function(){return Z.front()},last_id:function(){var e=Z.length();if(e){return e-1}},parseArguments:function(n){return e.terminal.parse_arguments(n)},splitArguments:function(n){return e.terminal.split_arguments(n)},parseCommand:function(n){return e.terminal.parse_command(n)},splitCommand:function(n){return e.terminal.split_command(n)},parse_arguments:function(n){var t=/^[-+]?[0-9]*\.?[0-9]+([eE][-+]?[0-9]+)?$/;return e.map(n.match(O)||[],function(e){if(e[0]==="'"&&e[e.length-1]==="'"){return e.replace(/^'|'$/g,"")}else if(e[0]==='"'&&e[e.length-1]==='"'){e=e.replace(/^"|"$/g,"").replace(/\\([" ])/g,"$1");return e.replace(/\\\\|\\t|\\n/g,function(e){if(e[1]==="t"){return"	"}else if(e[1]==="n"){return"\n"}else{return"\\"}}).replace(/\\x([0-9a-f]+)/gi,function(e,n){return String.fromCharCode(parseInt(n,16))}).replace(/\\0([0-7]+)/g,function(e,n){return String.fromCharCode(parseInt(n,8))})}else if(e.match(/^\/(\\\/|[^\/])+\/[gimy]*$/)){var n=e.match(/^\/([^\/]+)\/([^\/]*)$/);return new RegExp(n[1],n[2])}else if(e.match(/^-?[0-9]+$/)){return parseInt(e,10)}else if(e.match(t)){return parseFloat(e)}else{return e.replace(/\\ /g," ")}})},split_arguments:function(n){return e.map(n.match(O)||[],function(e){if(e[0]==="'"&&e[e.length-1]==="'"){return e.replace(/^'|'$/g,"")}else if(e[0]==='"'&&e[e.length-1]==='"'){return e.replace(/^"|"$/g,"").replace(/\\([" ])/g,"$1")}else if(e.match(/\/.*\/[gimy]*$/)){return e}else{return e.replace(/\\ /g," ")}})},parse_command:function(n){return C(n,e.terminal.parse_arguments)},split_command:function(n){return C(n,e.terminal.split_arguments)},extended_command:function(e,n){try{ne=false;e.exec(n,true).then(function(){ne=true})}catch(t){}}};e.fn.visible=function(){return this.css("visibility","visible")};e.fn.hidden=function(){return this.css("visibility","hidden")};var P={};e.jrpc=function(n,t,r,i,o){P[n]=P[n]||0;var a=JSON.stringify({jsonrpc:"2.0",method:t,params:r,id:++P[n]});return e.ajax({url:n,data:a,success:function(n,t,r){var a=r.getResponseHeader("Content-Type");if(!a.match(/(application|text)\/json/)){var s="Response Content-Type is neither application/json nor text/json";if(console&&console.warn){console.warn(s)}else{throw new Error("WARN: "+s)}}var l;try{l=e.parseJSON(n)}catch(f){if(o){o(r,"Invalid JSON",f)}else{throw new Error("Invalid JSON")}return}i(l,t,r)},error:o,contentType:"application/json",dataType:"text",async:true,cache:false,type:"POST"})};function D(){var n=e('<div class="terminal temp"><div class="cmd"><span cla'+'ss="cursor">&nbsp;</span></div></div>').appendTo("body");var t=n.find("span");var r={width:t.width(),height:t.outerHeight()};n.remove();return r}function B(n){var t=e('<div class="terminal wrap"><span class="cursor">'+"&nbsp;</span></div>").appendTo("body").css("padding",0);var r=t.find("span");var i=r[0].getBoundingClientRect().width;var o=Math.floor(n.width()/i);t.remove();if(W(n)){var a=20;var s=n.innerWidth()-n.width();o-=Math.ceil((a-s/2)/(i-1))}return o}function H(e){return Math.floor(e.height()/D().height)}function J(){if(window.getSelection||document.getSelection){var e=(window.getSelection||document.getSelection)();if(e.text){return e.text}else{return e.toString()}}else if(document.selection){return document.selection.createRange().text}}function W(n){if(n.css("overflow")=="scroll"||n.css("overflow-y")=="scroll"){return true}else if(n.is("body")){return e("body").height()>e(window).height()}else{return n.get(0).scrollHeight>n.innerHeight()}}var q=!e.terminal.version.match(/^\{\{/);var M="Copyright (c) 2011-2016 Jakub Jankiewicz <http://jcubic"+".pl>";var U=q?" v. "+e.terminal.version:" ";var Y=new RegExp(" {"+U.length+"}$");var G="jQuery Terminal Emulator"+(q?U:"");var Q=[["jQuery Terminal","(c) 2011-2016 jcubic"],[G,M.replace(/^Copyright | *<.*>/g,"")],[G,M.replace(/^Copyright /,"")],["      _______                 ________                        __","     / / _  /_ ____________ _/__  ___/______________  _____  / /"," __ / / // / // / _  / _/ // / / / _  / _/     / /  \\/ / _ \\/ /","/  / / // / // / ___/ // // / / / ___/ // / / / / /\\  / // / /__","\\___/____ \\\\__/____/_/ \\__ / /_/____/_//_/_/_/ /_/  \\/\\__\\_\\___/","         \\/          /____/                                   ".replace(Y," ")+U,M],["      __ _____                     ________                              __","     / // _  /__ __ _____ ___ __ _/__  ___/__ ___ ______ __ __  __ ___  / /"," __ / // // // // // _  // _// // / / // _  // _//     // //  \\/ // _ \\/ /","/  / // // // // // ___// / / // / / // ___// / / / / // // /\\  // // / /__","\\___//____ \\\\___//____//_/ _\\_  / /_//____//_/ /_/ /_//_//_/ /_/ \\__\\_\\___/","          \\/              /____/                                          ".replace(Y,"")+U,M]];
-
-e.terminal.defaults={prompt:"> ",history:true,exit:true,clear:true,enabled:true,historySize:60,maskChar:"*",wrap:true,checkArity:true,raw:false,exceptionHandler:null,memory:false,cancelableAjax:true,processArguments:true,linksNoReferrer:false,processRPCResponse:null,Token:true,convertLinks:true,historyState:false,echoCommand:true,scrollOnEcho:true,login:null,outputLimit:-1,formatters:[],onAjaxError:null,scrollBottomOffset:20,onRPCError:null,completion:false,historyFilter:null,onInit:e.noop,onClear:e.noop,onBlur:e.noop,onFocus:e.noop,onTerminalChange:e.noop,onExit:e.noop,keypress:e.noop,keydown:e.noop,strings:{wrongPasswordTryAgain:"Wrong password try again!",wrongPassword:"Wrong password!",ajaxAbortError:"Error while aborting ajax call!",wrongArity:"Wrong number of arguments. Function '%s' expects %s got"+" %s!",commandNotFound:"Command '%s' Not Found!",oneRPCWithIgnore:"You can use only one rpc with ignoreSystemDescr"+"ibe",oneInterpreterFunction:"You can't use more than one function (rpc"+"with ignoreSystemDescribe counts as one)",loginFunctionMissing:"You didn't specify a login function",noTokenError:"Access denied (no token)",serverResponse:"Server responded",wrongGreetings:"Wrong value of greetings parameter",notWhileLogin:"You can't call `%s' function while in login",loginIsNotAFunction:"Authenticate must be a function",canExitError:"You can't exit from main interpreter",invalidCompletion:"Invalid completion",invalidSelector:'Sorry, but terminal said that "%s" is not valid '+"selector!",invalidTerminalId:"Invalid Terminal ID",login:"login",password:"password",recursiveCall:"Recursive call detected, skip"}};var X=[];var Z=new m;var V=[];var ee;var ne=false;var te=true;var re=true;var ie;e.fn.terminal=function(t,i){function o(n){if(n){this.storage={}}this.set=function(t,r){if(n){this.storage[t]=r}else{e.Storage.set(t,r)}};this.get=function(t){if(n){return this.storage[t]}else{return e.Storage.get(t)}};this.remove=function(t){if(n){delete this.storage[t]}else{e.Storage.remove(t)}}}function a(n){if(e.isFunction(Ee.processArguments)){return C(n,Ee.processArguments)}else if(Ee.processArguments){return e.terminal.parse_command(n)}else{return e.terminal.split_command(n)}}function s(n){if(typeof n==="string"){le.echo(n)}else if(n instanceof Array){le.echo(e.map(n,function(e){return JSON.stringify(e)}).join(" "))}else if(typeof n==="object"){le.echo(JSON.stringify(n))}else{le.echo(n)}}function l(n){var t=/(.*):([0-9]+):([0-9]+)$/;var r=n.match(t);if(r){le.pause();e.get(r[1],function(n){var t=location.href.replace(/[^\/]+$/,"");var i=r[1].replace(t,"");le.echo("[[b;white;]"+i+"]");var o=n.split("\n");var a=+r[2]-1;le.echo(o.slice(a-2,a+3).map(function(n,t){if(t==2){n="[[;#f00;]"+e.terminal.escape_brackets(n)+"]"}return"["+(a+t)+"]: "+n}).join("\n")).resume()},"text")}}function f(n){if(e.isFunction(Ee.onRPCError)){Ee.onRPCError.call(le,n)}else{le.error("&#91;RPC&#93; "+n.message);if(n.error&&n.error.message){n=n.error;var t="	"+n.message;if(n.file){t+=' in file "'+n.file.replace(/.*\//,"")+'"'}if(n.at){t+=" at line "+n.at}le.error(t)}}}function c(n,t){var r=function(t,r){le.pause();e.jrpc(n,t,r,function(n){if(n.error){f(n.error)}else{if(e.isFunction(Ee.processRPCResponse)){Ee.processRPCResponse.call(le,n.result,le)}else{s(n.result)}}le.resume()},h)};return function(e,n){if(e===""){return}try{e=a(e)}catch(i){n.error(i.toString());return}if(!t||e.name==="help"){r(e.name,e.args)}else{var o=n.token();if(o){r(e.name,[o].concat(e.args))}else{n.error("&#91;AUTH&#93; "+Re.noTokenError)}}}}function u(t,r,i,o){return function(s,l){if(s===""){return}var f;try{f=a(s)}catch(c){le.error(c.toString());return}var h=t[f.name];var p=e.type(h);if(p==="function"){if(r&&h.length!==f.args.length){le.error("&#91;Arity&#93; "+sprintf(Re.wrongArity,f.name,h.length,f.args.length))}else{return h.apply(le,f.args)}}else if(p==="object"||p==="string"){var m=[];if(p==="object"){m=Object.keys(h);h=u(h,r,i)}l.push(h,{prompt:f.name+"> ",name:f.name,completion:p==="object"?m:n})}else{if(e.isFunction(o)){o(s,le)}else if(e.isFunction(Ee.onCommandNotFound)){Ee.onCommandNotFound(s,le)}else{l.error(sprintf(Re.commandNotFound,f.name))}}}}function h(n,t,r){le.resume();if(e.isFunction(Ee.onAjaxError)){Ee.onAjaxError.call(le,n,t,r)}else if(t!=="abort"){le.error("&#91;AJAX&#93; "+t+" - "+Re.serverResponse+": \n"+e.terminal.escape_brackets(n.responseText))}}function p(n,t,r){e.jrpc(n,"system.describe",[],function(i){var o=[];if(i.procs){var a={};e.each(i.procs,function(r,i){a[i.name]=function(){var r=t&&i.name!="help";var o=Array.prototype.slice.call(arguments);var a=o.length+(r?1:0);if(Ee.checkArity&&i.params&&i.params.length!==a){le.error("&#91;Arity&#93; "+sprintf(Re.wrongArity,i.name,i.params.length,a))}else{le.pause();if(r){var l=le.token(true);if(l){o=[l].concat(o)}else{le.error("&#91;AUTH&#93; "+Re.noTokenError)}}e.jrpc(n,i.name,o,function(n){if(n.error){f(n.error)}else{if(e.isFunction(Ee.processRPCResponse)){Ee.processRPCResponse.call(le,n.result,le)}else{s(n.result)}}le.resume()},h)}}});a.help=a.help||function(n){if(typeof n=="undefined"){le.echo("Available commands: "+i.procs.map(function(e){return e.name}).join(", ")+", help")}else{var t=false;e.each(i.procs,function(e,r){if(r.name==n){t=true;var i="";i+="[[bu;#fff;]"+r.name+"]";if(r.params){i+=" "+r.params.join(" ")}if(r.help){i+="\n"+r.help}le.echo(i);return false}});if(!t){if(n=="help"){le.echo("[[bu;#fff;]help] [method]\ndisplay help "+"for the method or list of methods if not"+" specified")}else{var r="Method `"+n.toString()+"' not found ";le.error(r)}}}};r(a)}else{r(null)}},function(){r(null)})}function m(n,t,r){r=r||e.noop;var i=e.type(n);var o;var a={};var s=0;var l;if(i==="array"){o={};(function f(n,r){if(n.length){var i=n[0];var a=n.slice(1);var u=e.type(i);if(u==="string"){s++;le.pause();if(Ee.ignoreSystemDescribe){if(s===1){l=c(i,t)}else{le.error(Re.oneRPCWithIgnore)}f(a,r)}else{p(i,t,function(n){if(n){e.extend(o,n)}le.resume();f(a,r)})}}else if(u==="function"){if(l){le.error(Re.oneInterpreterFunction)}else{l=i}f(a,r)}else if(u==="object"){e.extend(o,i);f(a,r)}}else{r()}})(n,function(){r({interpreter:u(o,false,t,l),completion:Object.keys(o)})})}else if(i==="string"){if(Ee.ignoreSystemDescribe){o={interpreter:c(n,t)};if(e.isArray(Ee.completion)){o.completion=Ee.completion}r(o)}else{le.pause();p(n,t,function(e){if(e){a.interpreter=u(e,false,t);a.completion=Object.keys(e)}else{a.interpreter=c(n,t)}r(a);le.resume()})}}else if(i==="object"){r({interpreter:u(n,Ee.checkArity),completion:Object.keys(n)})}else{if(i==="undefined"){n=e.noop}else if(i!=="function"){throw i+" is invalid interpreter value"}r({interpreter:n,completion:Ee.completion})}}function d(n,t){var r=e.type(t)==="boolean"?"login":t;return function(t,i,o,a){le.pause();e.jrpc(n,r,[t,i],function(e){if(!e.error&&e.result){o(e.result)}else{o(null)}le.resume()},h)}}function v(e){if(typeof e==="string"){return e}else if(typeof e.fileName==="string"){return e.fileName+": "+e.message}else{return e.message}}function y(n,t){if(e.isFunction(Ee.exceptionHandler)){Ee.exceptionHandler.call(le,n)}else{le.exception(n,t)}}function w(){var e;if(fe.prop){e=fe.prop("scrollHeight")}else{e=fe.attr("scrollHeight")}fe.scrollTop(e)}function _(n,t){try{if(e.isFunction(t)){t(function(){})}else if(typeof t!=="string"){var r=n+" must be string or function";throw r}}catch(i){y(i,n.toUpperCase());return false}return true}var b=[];var k=1;function S(t,r){if(Ee.convertLinks&&!r.raw){t=t.replace(I,"[[!;;]$1]").replace($,"[[!;;]$1]")}var i=e.terminal.defaults.formatters;var o,a;if(!r.raw){for(o=0;o<i.length;++o){try{if(typeof i[o]=="function"){var s=i[o](t);if(typeof s=="string"){t=s}}}catch(l){alert("formatting error at formatters["+o+"]\n"+(l.stack?l.stack:l))}}t=e.terminal.encode(t)}b.push(k);if(!r.raw&&(t.length>de||t.match(/\n/))&&(Ee.wrap===true&&r.wrap===n||Ee.wrap===false&&r.wrap===true)){var f=r.keepWords;var c=e.terminal.split_equal(t,de,f);for(o=0,a=c.length;o<a;++o){if(c[o]===""||c[o]==="\r"){b.push("<span></span>")}else{if(r.raw){b.push(c[o])}else{b.push(e.terminal.format(c[o],{linksNoReferrer:Ee.linksNoReferrer}))}}}}else if(!r.raw){t=e.terminal.format(t,{linksNoReferrer:Ee.linksNoReferrer});t.split(/\n/).forEach(function(e){b.push(e)})}else{b.push(t)}b.push(r.finalize)}function T(n,t){try{var r=e.extend({exec:true,raw:false,finalize:e.noop},t||{});var i=e.type(n)==="function"?n():n;i=e.type(i)==="string"?i:String(i);if(i!==""){if(r.exec){i=e.map(i.split(L),function(n){if(n.match(L)&&!e.terminal.is_formatting(n)){n=n.replace(/^\[\[|\]\]$/g,"");if(ce&&ce.command==n){le.error(Re.recursiveCall)}else{e.terminal.extended_command(le,n)}return""}else{return n}}).join("");if(i!==""){S(i,r)}}else{S(i,r)}}}catch(o){b=[];alert("[Internal Exception(process_line)]:"+v(o)+"\n"+o.stack)}}function F(){Je.resize(de);var n=me.empty().detach();var t;if(Ee.outputLimit>=0){var r=Ee.outputLimit===0?le.rows():Ee.outputLimit;t=pe.slice(pe.length-r-1)}else{t=pe}try{b=[];e.each(t,function(e,n){T.apply(null,n)});Je.before(n);le.flush()}catch(i){alert("Exception in redraw\n"+i.stack)}}function E(){if(Ee.greetings===n){le.echo(le.signature)}else if(Ee.greetings){var e=typeof Ee.greetings;if(e==="string"){le.echo(Ee.greetings)}else if(e==="function"){Ee.greetings.call(le,le.echo)}else{le.error(Re.wrongGreetings)}}}function A(n){var t=Je.prompt();var r=Je.mask();switch(typeof r){case"string":n=n.replace(/./g,r);break;case"boolean":if(r){n=n.replace(/./g,Ee.maskChar)}else{n=e.terminal.escape_formatting(n)}break}var i={finalize:function(e){e.addClass("command")}};if(e.isFunction(t)){t(function(e){le.echo(e+n,i)})}else{le.echo(t+n,i)}}function R(e){var n=Z.get()[e[0]];if(!n){throw new Error(Re.invalidTerminalId)}var t=e[1];if(V[t]){n.import_view(V[t])}else{ne=false;var r=e[2];if(r){n.exec(r).then(function(){ne=true;V[t]=n.export_view()})}}}function O(){if(ne){te=false;location.hash="#"+JSON.stringify(ee);setTimeout(function(){te=true},100)}}var z=true;var N;var K=[];var P=false;function D(t,r,i){N=t;if(z){z=false;if(Ee.historyState||Ee.execHash&&i){if(!V.length){le.save_state()}else{le.save_state(null)}}}function o(){if(!i){ne=true;if(Ee.historyState){le.save_state(t,false)}ne=f}l.resolve();if(e.isFunction(Ee.onAfterCommand)){Ee.onAfterCommand(le,t)}}try{if(e.isFunction(Ee.onBeforeCommand)){if(Ee.onBeforeCommand(le,t)===false){return}}if(!i){ce=e.terminal.split_command(t)}if(!ae()){if(i&&(e.isFunction(Ee.historyFilter)&&Ee.historyFilter(t)||t.match(Ee.historyFilter))){Je.history().append(t)}}var a=He.top();if(!r&&Ee.echoCommand){A(t)}var l=new e.Deferred;var f=ne;if(t.match(/^\s*login\s*$/)&&le.token(true)){if(le.level()>1){le.logout(true)}else{le.logout()}o()}else if(Ee.exit&&t.match(/^\s*exit\s*$/)&&!xe){var c=le.level();if(c==1&&le.get_token()||c>1){if(le.get_token(true)){le.set_token(n,true)}le.pop()}o()}else if(Ee.clear&&t.match(/^\s*clear\s*$/)&&!xe){le.clear();o()}else{var u=pe.length-1;var h=a.interpreter.call(le,t,le);if(h!==n){le.pause(true);return e.when(h).then(function(e){if(e&&u===pe.length-1){s(e)}o();le.resume()})}else if(Ie){var p=t;K.push(function(){o()})}else{o()}}return l.promise()}catch(m){y(m,"USER");le.resume();throw m}}function q(){if(e.isFunction(Ee.onBeforeLogout)){try{if(Ee.onBeforeLogout(le)===false){return}}catch(n){y(n,"onBeforeLogout")}}M();if(e.isFunction(Ee.onAfterLogout)){try{Ee.onAfterLogout(le)}catch(n){y(n,"onAfterlogout")}}le.login(Ee.login,true,ie)}function M(){var e=le.prefix_name(true)+"_";Ae.remove(e+"token");Ae.remove(e+"login")}function U(n){var t=le.prefix_name()+"_interpreters";var r=Ae.get(t);if(r){r=e.parseJSON(r)}else{r=[]}if(e.inArray(n,r)==-1){r.push(n);Ae.set(t,JSON.stringify(r))}}function Y(n){var t=He.top();var r=le.prefix_name(true);if(!ae()){U(r)}Je.name(r);if(e.isFunction(t.prompt)){Je.prompt(function(e){t.prompt(e,le)})}else{Je.prompt(t.prompt)}Je.set("");if(!n&&e.isFunction(t.onStart)){t.onStart(le)}}var G;function ie(){Y();E();var n=false;if(e.isFunction(Ee.onInit)){Ce=function(){n=true};try{Ee.onInit(le)}catch(t){y(t,"OnInit")}finally{Ce=e.noop;if(!n){le.resume()}}}function r(){if(te&&Ee.execHash){try{if(location.hash){var n=location.hash.replace(/^#/,"");ee=e.parseJSON(decodeURIComponent(n))}else{ee=[]}if(ee.length){R(ee[ee.length-1])}else if(V[0]){le.import_view(V[0])}}catch(t){y(t,"TERMINAL")}}}if(re){re=false;if(e.fn.hashchange){e(window).hashchange(r)}else{e(window).bind("hashchange",r)}}}function oe(n,t,r){if(Ee.clear&&e.inArray("clear",r)==-1){r.push("clear")}if(Ee.exit&&e.inArray("exit",r)==-1){r.push("exit")}var i=Je.get().substring(0,Je.position());if(i!==n){return}var o=new RegExp("^"+e.terminal.escape_regex(t));var a=[];for(var s=r.length;s--;){if(o.test(r[s])){a.push(r[s])}}if(a.length===1){le.insert(a[0].replace(o,""))}else if(a.length>1){if(he>=2){A(n);var l=a.reverse().join("	");le.echo(e.terminal.escape_brackets(l),{keepWords:true});he=0}else{var f=false;var c;var u;e:for(u=t.length;u<a[0].length;++u){for(s=1;s<a.length;++s){if(a[0].charAt(u)!==a[s].charAt(u)){break e}}f=true}if(f){le.insert(a[0].slice(0,u).replace(o,""))}}}}function ae(){return xe||Je.mask()!==false}function se(t){var r,i,o=He.top(),a;if(!le.paused()&&le.enabled()){if(e.isFunction(o.keydown)){r=o.keydown(t,le);if(r!==n){return r}}else if(e.isFunction(Ee.keydown)){r=Ee.keydown(t,le);if(r!==n){return r}}if(Ee.completion&&e.type(Ee.completion)!="boolean"&&o.completion===n){a=Ee.completion}else{a=o.completion}if(a=="settings"){a=Ee.completion}le.oneTime(10,function(){ze()});if(t.which!==9){he=0}if(t.which===68&&t.ctrlKey){if(!xe){if(Je.get()===""){if(He.size()>1||Ee.login!==n){le.pop("")}else{le.resume();le.echo("")}}else{le.set_command("")}}return false}else if(t.which===76&&t.ctrlKey){le.clear()}else if(a&&t.which===9){++he;var s=Je.position();var l=Je.get().substring(0,s);var f=l.split(" ");var c;if(Re.length==1){c=f[0]}else{c=f[f.length-1];for(i=f.length-1;i>0;i--){if(f[i-1][f[i-1].length-1]=="\\"){c=f[i-1]+" "+c}else{break}}}switch(e.type(a)){case"function":a(le,c,function(e){oe(l,c,e)});break;case"array":oe(l,c,a);break;default:throw new Error(Re.invalidCompletion)}return false}else if((t.which===118||t.which===86)&&(t.ctrlKey||t.metaKey)){le.oneTime(1,function(){w()});return}else if(t.which===9&&t.ctrlKey){if(Z.length()>1){le.focus(false);return false}}else if(t.which===34){le.scroll(le.height())}else if(t.which===33){le.scroll(-le.height())}else{le.attr({scrollTop:le.attr("scrollHeight")})}}else if(t.which===68&&t.ctrlKey){if(X.length){for(i=X.length;i--;){var u=X[i];if(4!==u.readyState){try{u.abort()}catch(h){le.error(Re.ajaxAbortError)}}}X=[];le.resume()}return false}}var le=this;if(this.length>1){return this.each(function(){e.fn.terminal.call(e(this),t,e.extend({name:le.selector},i))})}if(le.data("terminal")){return le.data("terminal")}if(le.length===0){throw sprintf(e.terminal.defaults.strings.invalidSelector,le.selector)}var fe;var ce;var ue=false;var he=0;var pe=[];var me;var ge=Z.length();var de;var ve;var ye=[];var we;var _e;var be=new g;var ke=e.Deferred();var xe=false;var Ce=e.noop;var Se,Te;var Fe=[];var Ee=e.extend({},e.terminal.defaults,{name:le.selector},i||{});var Ae=new o(Ee.memory);var Re=e.terminal.defaults.strings;var je=Ee.enabled,$e=false;var Ie=false;var Oe=true;e.extend(le,e.omap({id:function(){return ge},clear:function(){me.html("");pe=[];try{Ee.onClear(le)}catch(e){y(e,"onClear")}le.attr({scrollTop:0});return le},export_view:function(){var n={};if(e.isFunction(Ee.onExport)){try{n=Ee.onExport()}catch(t){y(t,"onExport")}}return e.extend({},{focus:je,mask:Je.mask(),prompt:le.get_prompt(),command:le.get_command(),position:Je.position(),lines:r(pe),interpreters:He.clone()},n)},import_view:function(n){if(xe){throw new Error(sprintf(Re.notWhileLogin,"import_view"))}if(e.isFunction(Ee.onImport)){try{Ee.onImport(n)}catch(t){y(t,"onImport")}}ke.then(function(){le.set_prompt(n.prompt);le.set_command(n.command);Je.position(n.position);Je.mask(n.mask);if(n.focus){le.focus()}pe=r(n.lines);He=n.interpreters;F()});return le},save_state:function(t,r,i){if(typeof i!="undefined"){V[i]=le.export_view()}else{V.push(le.export_view())}if(!e.isArray(ee)){ee=[]}if(t!==n&&!r){var o=[ge,V.length-1,t];ee.push(o);O()}},exec:function(n,t,r){var i=r||new e.Deferred;function o(){if(e.isArray(n)){(function r(){var e=n.shift();if(e){le.exec(e,t).then(r)}else{i.resolve()}})()}else if(Ie){Fe.push([n,t,i])}else{D(n,t,true).then(function(){i.resolve(le)})}}if(ke.state()!="resolved"){ke.then(o)}else{o()}return i.promise()},autologin:function(e,n,t){le.trigger("terminal.autologin",[e,n,t]);return le},login:function(n,t,r,i){be.push([].slice.call(arguments));if(xe){throw new Error(sprintf(Re.notWhileLogin,"login"))}if(!e.isFunction(n)){throw new Error(Re.loginIsNotAFunction)}xe=true;if(le.token()&&le.level()==1&&!Oe){xe=false;le.logout(true)}else{if(le.token(true)&&le.login_name(true)){xe=false;if(e.isFunction(r)){r()}return le}}var o=null;if(Ee.history){Je.history().disable()}var a=le.level();function s(n,o,s,l){if(o){while(le.level()>a){le.pop()}if(Ee.history){Je.history().enable()}var f=le.prefix_name(true)+"_";Ae.set(f+"token",o);Ae.set(f+"login",n);xe=false;if(e.isFunction(r)){r()}}else{if(t){if(!s){le.error(Re.wrongPasswordTryAgain)}le.pop().set_mask(false)}else{xe=false;if(!s){le.error(Re.wrongPassword)}le.pop().pop()}if(e.isFunction(i)){i()}}le.off("terminal.autologin")}le.on("terminal.autologin",function(e,n,t,r){s(n,t,r)});le.push(function(e){le.set_mask(Ee.maskChar).push(function(t){try{n.call(le,e,t,function(n,t){s(e,n,t)})}catch(r){y(r,"AUTH")}},{prompt:Re.password+": ",name:"password"})},{prompt:Re.login+": ",name:"login"});return le},settings:function(){return Ee},commands:function(){return He.top().interpreter},setInterpreter:function(){if(window.console&&console.warn){console.warn("This function is deprecated, use set_inte"+"rpreter insead!")}return le.set_interpreter.apply(le,arguments)},set_interpreter:function(n,t){function r(){le.pause();m(n,!!t,function(n){le.resume();var t=He.top();e.extend(t,n);Y(true)})}if(e.type(n)=="string"&&t){le.login(d(n,t),true,r)}else{r()}return le},greetings:function(){E();return le},paused:function(){return Ie},pause:function(n){Ce();if(!Ie&&Je){ke.then(function(){Ie=true;Je.disable();if(!n){Je.hidden()}if(e.isFunction(Ee.onPause)){Ee.onPause()}})}return le},resume:function(){function n(){Ie=false;if(Z.front()==le){Je.enable()}Je.visible();var n=Fe;Fe=[];for(var t=0;t<n.length;++t){le.exec.apply(le,n[t])}le.trigger("resume");var r=K.shift();if(r){r()}w();if(e.isFunction(Ee.onResume)){Ee.onResume()}}if(Ie&&Je){if(ke.state()!="resolved"){ke.then(n)}else{n()}}return le},cols:function(){return Ee.numChars?Ee.numChars:B(le)},rows:function(){return Ee.numRows?Ee.numRows:H(le)},history:function(){return Je.history()},history_state:function(e){function n(){Ee.historyState=true;if(!V.length){le.save_state()}else if(Z.length()>1){le.save_state(null)}}if(e){if(typeof window.setImmediate=="undefined"){setTimeout(n,0)}else{setImmediate(n)}}else{Ee.historyState=false}return le},clear_history_state:function(){ee=[];V=[];return le},next:function(){if(Z.length()===1){return le}else{var n=le.offset().top;var t=le.height();var r=le.scrollTop();Z.front().disable();var i=Z.rotate().enable();var o=i.offset().top-50;e("html,body").animate({scrollTop:o},500);try{Ee.onTerminalChange(i)}catch(a){y(a,"onTerminalChange")}return i}},focus:function(e,n){ke.then(function(){if(Z.length()===1){if(e===false){try{if(!n&&Ee.onBlur(le)!==false||n){le.disable()}}catch(t){y(t,"onBlur")}}else{try{if(!n&&Ee.onFocus(le)!==false||n){le.enable()}}catch(t){y(t,"onFocus")}}}else{if(e===false){le.next()}else{var r=Z.front();if(r!=le){r.disable();if(!n){try{Ee.onTerminalChange(le)}catch(t){y(t,"onTerminalChange")}}}Z.set(le);le.enable()}}});return le},freeze:function(e){ke.then(function(){if(e){le.disable();$e=true}else{$e=false;le.enable()}})},frozen:function(){return $e},enable:function(){if(!je&&!$e){if(de===n){le.resize()}ke.then(function(){Je.enable();je=true})}return le},disable:function(){if(je&&!$e){ke.then(function(){je=false;Je.disable()})}return le},enabled:function(){return je},signature:function(){var e=le.cols();var n=e<15?null:e<35?0:e<55?1:e<64?2:e<75?3:4;if(n!==null){return Q[n].join("\n")+"\n"}else{return""}},version:function(){return e.terminal.version},cmd:function(){return Je},get_command:function(){return Je.get()},set_command:function(e){ke.then(function(){Je.set(e)});return le},insert:function(e){if(typeof e==="string"){ke.then(function(){Je.insert(e)});return le}else{throw"insert function argument is not a string"}},set_prompt:function(n){ke.then(function(){if(_("prompt",n)){if(e.isFunction(n)){Je.prompt(function(e){n(e,le)})}else{Je.prompt(n)}He.top().prompt=n}});return le},get_prompt:function(){return He.top().prompt},set_mask:function(e){ke.then(function(){Je.mask(e===true?Ee.maskChar:e)});return le},get_output:function(n){if(n){return pe}else{return e.map(pe,function(n){return e.isFunction(n[0])?n[0]():n[0]}).join("\n")}},resize:function(n,t){if(!le.is(":visible")){le.stopTime("resize");le.oneTime(500,"resize",function(){le.resize(n,t)})}else{if(n&&t){le.width(n);le.height(t)}n=le.width();t=le.height();var r=le.cols();var i=le.rows();if(r!==de||i!==ve){de=r;ve=i;F();var o=He.top();if(e.isFunction(o.resize)){o.resize(le)}else if(e.isFunction(Ee.onResize)){Ee.onResize(le)}Te=t;Se=n;w()}}return le},flush:function(){try{var n=le.is_bottom();var t;e.each(b,function(n,r){if(r===k){t=e("<div></div>")}else if(e.isFunction(r)){t.appendTo(me);try{r(t)}catch(i){y(i,"USER:echo(finalize)")}}else{e("<div/>").html(r).appendTo(t).width("100%")}});if(Ee.outputLimit>=0){var r=Ee.outputLimit===0?le.rows():Ee.outputLimit;var i=me.find("div div");if(i.length>r){var o=i.length-r+1;var a=i.slice(0,o);var s=a.parent();a.remove();s.each(function(){var n=e(this);if(n.is(":empty")){n.remove()}})}}ve=H(le);ze();if(Ee.scrollOnEcho||n){w()}b=[]}catch(l){alert("[Flush] "+v(l)+"\n"+l.stack)}return le},update:function(e,n){ke.then(function(){if(e<0){e=pe.length+e}if(!pe[e]){le.error("Invalid line number "+e)}else{if(n===null){pe.splice(e,1)}else{pe[e][0]=n}F()}});return le},last_index:function(){return pe.length-1},echo:function(n,t){n=n||"";e.when(n).then(function(n){try{var r=e.extend({flush:true,raw:Ee.raw,finalize:e.noop,keepWords:false},t||{});if(r.flush){b=[]}T(n,r);pe.push([n,e.extend(r,{exec:false})]);if(r.flush){le.flush()}}catch(i){alert("[Terminal.echo] "+v(i)+"\n"+i.stack)}});return le},error:function(n,t){var r=e.terminal.escape_brackets(n).replace(/\\$/,"&#92;").replace(j,"]$1[[;;;error]");return le.echo("[[;;;error]"+r+"]",t)},exception:function(n,t){var r=v(n);if(t){r="&#91;"+t+"&#93;: "+r}if(r){le.error(r,{finalize:function(e){e.addClass("exception message")}})}if(typeof n.fileName==="string"){le.pause();e.get(n.fileName,function(e){le.resume();var t=n.lineNumber-1;var r=e.split("\n")[t];if(r){le.error("["+n.lineNumber+"]: "+r)}})}if(n.stack){var i=e.terminal.escape_brackets(n.stack);le.echo(i.split(/\n/g).map(function(e){return"[[;;;error]"+e.replace(j,function(e){return"]"+e+"[[;;;error]"})+"]"}).join("\n"),{finalize:function(e){e.addClass("exception stack-trace")}})}},scroll:function(e){var n;e=Math.round(e);if(fe.prop){if(e>fe.prop("scrollTop")&&e>0){fe.prop("scrollTop",0)}n=fe.prop("scrollTop");fe.scrollTop(n+e)}else{if(e>fe.attr("scrollTop")&&e>0){fe.attr("scrollTop",0)}n=fe.attr("scrollTop");fe.scrollTop(n+e)}return le},logout:function(e){if(xe){throw new Error(sprintf(Re.notWhileLogin,"logout"))}ke.then(function(){if(e){var t=be.pop();le.set_token(n,true);le.login.apply(le,t)}else{while(He.size()>0){if(le.pop()){break}}}});return le},token:function(e){return Ae.get(le.prefix_name(e)+"_token")},set_token:function(e,n){var t=le.prefix_name(n)+"_token";if(typeof e=="undefined"){Ae.remove(t,e)}else{Ae.set(t,e)}return le},get_token:function(e){return Ae.get(le.prefix_name(e)+"_token")},login_name:function(e){return Ae.get(le.prefix_name(e)+"_login")},name:function(){return He.top().name},prefix_name:function(e){var n=(Ee.name?Ee.name+"_":"")+ge;if(e&&He.size()>1){var t=He.map(function(e){return e.name}).slice(1).join("_");if(t){n+="_"+t}}return n},read:function(n,t){var r=new e.Deferred;le.push(function(n){le.pop();if(e.isFunction(t)){t(n)}r.resolve(n)},{prompt:n});return r.promise()},push:function(t,r){ke.then(function(){r=r||{};var i={infiniteLogin:false};var o=e.extend({},i,r);if(!o.name&&ce){o.name=ce.name}if(o.prompt===n){o.prompt=(o.name||">")+" "}var a=He.top();if(a){a.mask=Je.mask()}var s=Ie;m(t,!!r.login,function(n){He.push(e.extend({},n,o));if(e.isArray(n.completion)&&o.completion===true){He.top().completion=n.completion}else if(!n.completion&&o.completion===true){He.top().completion=false}if(o.login){var r=e.type(o.login);if(r=="function"){le.login(o.login,o.infiniteLogin,Y,o.infiniteLogin?e.noop:le.pop)}else if(e.type(t)=="string"&&r=="string"||r=="boolean"){le.login(d(t,o.login),o.infiniteLogin,Y,o.infiniteLogin?e.noop:le.pop)}}else{Y()}if(!s){le.resume()}})});return le},pop:function(t){if(t!==n){A(t)}var r=le.token(true);if(He.size()==1){if(Ee.login){q();if(e.isFunction(Ee.onExit)){try{Ee.onExit(le)}catch(i){y(i,"onExit")}}return true}else{le.error(Re.canExitError)}}else{if(le.token(true)){M()}var o=He.pop();Y();if(xe&&le.get_prompt()!=Re.login+": "){xe=false}if(e.isFunction(o.onExit)){try{o.onExit(le)}catch(i){y(i,"onExit")}}le.set_mask(He.top().mask)}return le},option:function(n,t){if(typeof t=="undefined"){if(typeof n=="string"){return Ee[n]}else if(typeof n=="object"){e.each(n,function(e,n){Ee[e]=n})}}else{Ee[n]=t}return le},level:function(){return He.size()},reset:function(){ke.then(function(){le.clear();while(He.size()>1){He.pop()}ie()});return le},purge:function(){ke.then(function(){var n=le.prefix_name()+"_";var t=Ae.get(n+"interpreters");e.each(e.parseJSON(t),function(e,n){Ae.remove(n+"_commands");Ae.remove(n+"_token");Ae.remove(n+"_login")});Je.purge();Ae.remove(n+"interpreters")});return le},destroy:function(){ke.then(function(){Je.destroy().remove();me.remove();e(document).unbind(".terminal");e(window).unbind(".terminal");le.unbind("click mousewheel mousedown mouseup");le.removeData("terminal").removeClass("terminal");if(Ee.width){le.css("width","")}if(Ee.height){le.css("height","")}e(window).off("blur",Me).off("focus",qe);Z.remove(ge)});return le},scroll_to_bottom:w,is_bottom:function(){var n,t,r;if(le.is("body")){n=e(document).height();t=e(window).scrollTop();r=window.innerHeight}else{n=fe[0].scrollHeight;t=fe.scrollTop();r=fe.outerHeight()}return t+r>n-Ee.scrollBottomOffset}},function(e,n){return function(){try{return n.apply(le,[].slice.apply(arguments))}catch(t){if(e!=="exec"&&e!=="resume"){y(t,"TERMINAL")}throw t}}}));var ze=function(){var e=W(le);return function(){if(e!==W(le)){le.resize();e=W(le)}}}();if(Ee.width){le.width(Ee.width)}if(Ee.height){le.height(Ee.height)}var Ne=navigator.userAgent.toLowerCase();if(!Ne.match(/(webkit)[ \/]([\w.]+)/)&&le[0].tagName.toLowerCase()=="body"){fe=e("html")}else{fe=le}e(document).bind("ajaxSend.terminal",function(e,n,t){X.push(n)});me=e("<div>").addClass("terminal-output").appendTo(le);le.addClass("terminal");if(Ee.login&&e.isFunction(Ee.onBeforeLogin)){try{if(Ee.onBeforeLogin(le)===false){Oe=false}}catch(Ke){y(Ke,"onBeforeLogin");throw Ke}}var Le=Ee.login;var Pe;if(typeof t=="string"){Pe=t}else if(t instanceof Array){for(var De=0,Be=t.length;De<Be;++De){if(typeof t[De]=="string"){Pe=t[De];break}}}if(Pe&&(typeof Ee.login==="string"||Ee.login===true)){Ee.login=d(Pe,Ee.login)}Z.append(le);var He;var Je;var We;function qe(){if(We){le.focus()}}function Me(){We=je;le.disable()}m(t,!!Ee.login,function(t){if(Ee.completion&&typeof Ee.completion!="boolean"||!Ee.completion){t.completion="settings"}He=new g(e.extend({name:Ee.name,prompt:Ee.prompt,keypress:Ee.keypress,keydown:Ee.keydown,resize:Ee.onResize,greetings:Ee.greetings,mousewheel:Ee.mousewheel},t));Je=e("<div/>").appendTo(le).cmd({prompt:Ee.prompt,history:Ee.memory?"memory":Ee.history,historyFilter:Ee.historyFilter,historySize:Ee.historySize,width:"100%",enabled:je&&!x,keydown:se,keypress:function(n){var t,r,i=He.top();if(e.isFunction(i.keypress)){return i.keypress(n,le)}else if(e.isFunction(Ee.keypress)){return Ee.keypress(n,le)}},onCommandChange:function(n){if(e.isFunction(Ee.onCommandChange)){try{Ee.onCommandChange(n,le)}catch(t){y(t,"onCommandChange");throw t}}w()},commands:D});if(je&&le.is(":visible")&&!x){le.focus(n,true)}else{le.disable()}le.oneTime(100,function(){function n(n){var t=e(n.target);if(!t.closest(".terminal").length&&le.enabled()&&Ee.onBlur(le)!==false){le.disable()}}e(document).bind("click.terminal",n).bind("contextmenu.terminal",n)});var r=e(window);if(!x){r.on("focus",qe).on("blur",Me)}else{}if(x){le.click(function(){if(!le.enabled()&&!$e){le.focus();Je.enable()}else{le.focus(false)}})}else{(function(){var n=0;var t=false;le.mousedown(function(){le.oneTime(1,function(){e(window).mousemove(function(){t=true;n=0;e(window).unbind("mousemove")})})}).mouseup(function(){var r=t;t=false;e(window).unbind("mousemove");if(!r&&++n==1){n=0;if(!le.enabled()&&!$e){le.focus();Je.enable()}}})})()}le.delegate(".exception a","click",function(n){var t=e(this).attr("href");if(t.match(/:[0-9]+$/)){n.preventDefault();l(t)}});if(!navigator.platform.match(/linux/i)){le.mousedown(function(e){if(e.which==2){var n=J();le.insert(n)}})}if(le.is(":visible")){de=le.cols();Je.resize(de);ve=H(le)}if(Ee.login){le.login(Ee.login,true,ie)}else{ie()}le.oneTime(100,function(){r.bind("resize.terminal",function(){if(le.is(":visible")){var e=le.width();var n=le.height();if(Te!==n||Se!==e){le.resize()}}})});function i(n){var t=Z.get()[n[0]];if(t&&ge==t.id()){if(n[2]){try{if(Ie){var r=e.Deferred();K.push(function(){return t.exec(n[2]).then(function(e,i){t.save_state(n[2],true,n[1]);r.resolve()})});return r.promise()}else{return t.exec(n[2]).then(function(e,r){t.save_state(n[2],true,n[1])})}}catch(i){var o=e.terminal.escape_brackets(command);var a="Error while exec with command "+o;t.error(a).exception(i)}}}}if(Ee.execHash){if(location.hash){setTimeout(function(){try{var n=location.hash.replace(/^#/,"");ee=e.parseJSON(decodeURIComponent(n));var t=0;(function o(){var e=ee[t++];if(e){i(e).then(o)}else{ne=true}})()}catch(r){}})}else{ne=true}}else{ne=true}if(e.event.special.mousewheel){var o=false;e(document).bind("keydown.terminal",function(e){if(e.shiftKey){o=true}}).bind("keyup.terminal",function(e){if(e.shiftKey||e.which==16){o=false}});le.mousewheel(function(n,t){if(!o){var r=He.top();if(e.isFunction(r.mousewheel)){var i=r.mousewheel(n,t,le);if(i===false){return}}else if(e.isFunction(Ee.mousewheel)){Ee.mousewheel(n,t,le)}if(t>0){le.scroll(-40)}else{le.scroll(40)}}})}ke.resolve()});le.data("terminal",le);return le}})(jQuery);
\ No newline at end of file
+(function(e){var n=function(){if(!n.cache.hasOwnProperty(arguments[0])){n.cache[arguments[0]]=n.parse(arguments[0])}return n.format.call(null,n.cache[arguments[0]],arguments)};n.format=function(e,t){var o=1,a=e.length,s="",l,f=[],c,u,p,m,d,h;for(c=0;c<a;c++){s=r(e[c]);if(s==="string"){f.push(e[c])}else if(s==="array"){p=e[c];if(p[2]){l=t[o];for(u=0;u<p[2].length;u++){if(!l.hasOwnProperty(p[2][u])){throw n('[sprintf] property "%s" does not exist',p[2][u])}l=l[p[2][u]]}}else if(p[1]){l=t[p[1]]}else{l=t[o++]}if(/[^s]/.test(p[8])&&r(l)!=="number"){throw n("[sprintf] expecting number but found %s",r(l))}switch(p[8]){case"b":l=l.toString(2);break;case"c":l=String.fromCharCode(l);break;case"d":l=parseInt(l,10);break;case"e":l=p[7]?l.toExponential(p[7]):l.toExponential();break;case"f":l=p[7]?parseFloat(l).toFixed(p[7]):parseFloat(l);break;case"o":l=l.toString(8);break;case"s":l=(l=String(l))&&p[7]?l.substring(0,p[7]):l;break;case"u":l=l>>>0;break;case"x":l=l.toString(16);break;case"X":l=l.toString(16).toUpperCase();break}l=/[def]/.test(p[8])&&p[3]&&l>=0?" +"+l:l;d=p[4]?p[4]==="0"?"0":p[4].charAt(1):" ";h=p[6]-String(l).length;m=p[6]?i(d,h):"";f.push(p[5]?l+m:m+l)}}return f.join("")};n.cache={};n.parse=function(e){var n=e,t=[],r=[],i=0;while(n){if((t=/^[^\x25]+/.exec(n))!==null){r.push(t[0])}else if((t=/^\x25{2}/.exec(n))!==null){r.push("%")}else if((t=/^\x25(?:([1-9]\d*)\$|\(([^\)]+)\))?(\+)?(0|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-fosuxX])/.exec(n))!==null){if(t[2]){i|=1;var o=[],a=t[2],s=[];if((s=/^([a-z_][a-z_\d]*)/i.exec(a))!==null){o.push(s[1]);while((a=a.substring(s[0].length))!==""){if((s=/^\.([a-z_][a-z_\d]*)/i.exec(a))!==null){o.push(s[1])}else if((s=/^\[(\d+)\]/.exec(a))!==null){o.push(s[1])}else{throw"[sprintf] huh?"}}}else{throw"[sprintf] huh?"}t[2]=o}else{i|=2}if(i===3){throw"[sprintf] mixing positional and named placeholders is not (yet) supported"}r.push(t)}else{throw"[sprintf] huh?"}n=n.substring(t[0].length)}return r};var t=function(e,t,r){r=t.slice(0);r.splice(0,0,e);return n.apply(null,r)};function r(e){return Object.prototype.toString.call(e).slice(8,-1).toLowerCase()}function i(e,n){for(var t=[];n>0;t[--n]=e){}return t.join("")}e.sprintf=n;e.vsprintf=t})(typeof global!=="undefined"?global:window);(function(e){if(typeof define==="function"&&define.amd){define(["jquery"],e)}else if(typeof module==="object"&&module.exports){module.exports=function(n,t){if(t===undefined){if(typeof window!=="undefined"){t=require("jquery")}else{t=require("jquery")(n)}}e(t);return t}}else{e(jQuery)}})(function(e,n){"use strict";function t(){var n=e.Callbacks();var t=false;this.resolve=function(){n.fire();t=true};this.add=function(e){if(t){e()}else{n.add(e)}}}e.omap=function(n,t){var r={};e.each(n,function(e,i){r[e]=t.call(n,e,i)});return r};e.fn.text_length=function(){return this.map(function(){return e(this).text().length}).get().reduce(function(e,n){return e+n},0)};var r={clone_object:function(n){var t={};if(typeof n==="object"){if(e.isArray(n)){return this.clone_array(n)}else if(n===null){return n}else{for(var r in n){if(e.isArray(n[r])){t[r]=this.clone_array(n[r])}else if(typeof n[r]==="object"){t[r]=this.clone_object(n[r])}else{t[r]=n[r]}}}}return t},clone_array:function(n){if(!e.isFunction(Array.prototype.map)){throw new Error("Your browser don't support ES5 array map "+"use es5-shim")}return n.slice(0).map(function(e){if(typeof e==="object"){return this.clone_object(e)}else{return e}}.bind(this))}};var i=function(e){return r.clone_object(e)};var o=function(){try{var e="test",n=window.localStorage;n.setItem(e,"1");n.removeItem(e);return true}catch(e){return false}};var a=function(){try{document.cookie.split(";");return true}catch(e){return false}};var s=o();function l(e,n){var t;if(typeof e==="string"&&typeof n==="string"){d[e]=n;return true}else if(typeof e==="object"&&typeof n==="undefined"){for(t in e){if(e.hasOwnProperty(t)){d[t]=e[t]}}return true}return false}function f(e,n){var t,r,i;t=new Date;t.setTime(t.getTime()+31536e6);r="; expires="+t.toGMTString();if(typeof e==="string"&&typeof n==="string"){document.cookie=e+"="+n+r+"; path=/";return true}else if(typeof e==="object"&&typeof n==="undefined"){for(i in e){if(e.hasOwnProperty(i)){document.cookie=i+"="+e[i]+r+"; path=/"}}return true}return false}function c(e){return d[e]}function u(e){var n,t,r,i;n=e+"=";t=document.cookie.split(";");for(r=0;r<t.length;r++){i=t[r];while(i.charAt(0)===" "){i=i.substring(1,i.length)}if(i.indexOf(n)===0){return i.substring(n.length,i.length)}}return null}function p(e){return delete d[e]}function m(e){return f(e,"",-1)}var d;if(!a()&&!s){d={};e.extend({Storage:{set:l,get:c,remove:p}})}else{if(s){d=window.localStorage}e.extend({Storage:{set:s?l:f,get:s?c:u,remove:s?p:m}})}var h=e;h.fn.extend({everyTime:function(e,n,t,r,i){return this.each(function(){h.timer.add(this,e,n,t,r,i)})},oneTime:function(e,n,t){return this.each(function(){h.timer.add(this,e,n,t,1)})},stopTime:function(e,n){return this.each(function(){h.timer.remove(this,e,n)})}});h.extend({timer:{guid:1,global:{},regex:/^([0-9]+)\s*(.*s)?$/,powers:{ms:1,cs:10,ds:100,s:1e3,das:1e4,hs:1e5,ks:1e6},timeParse:function(e){if(e===n||e===null){return null}var t=this.regex.exec(h.trim(e.toString()));if(t[2]){var r=parseInt(t[1],10);var i=this.powers[t[2]]||1;return r*i}else{return e}},add:function(e,n,t,r,i,o){var a=0;if(h.isFunction(t)){if(!i){i=r}r=t;t=n}n=h.timer.timeParse(n);if(typeof n!=="number"||isNaN(n)||n<=0){return}if(i&&i.constructor!==Number){o=!!i;i=0}i=i||0;o=o||false;if(!e.$timers){e.$timers={}}if(!e.$timers[t]){e.$timers[t]={}}r.$timerID=r.$timerID||this.guid++;var s=function(){if(o&&s.inProgress){return}s.inProgress=true;if(++a>i&&i!==0||r.call(e,a)===false){h.timer.remove(e,t,r)}s.inProgress=false};s.$timerID=r.$timerID;if(!e.$timers[t][r.$timerID]){e.$timers[t][r.$timerID]=window.setInterval(s,n)}if(!this.global[t]){this.global[t]=[]}this.global[t].push(e)},remove:function(e,n,t){var r=e.$timers,i;if(r){if(!n){for(var o in r){if(r.hasOwnProperty(o)){this.remove(e,o,t)}}}else if(r[n]){if(t){if(t.$timerID){window.clearInterval(r[n][t.$timerID]);delete r[n][t.$timerID]}}else{for(var a in r[n]){if(r[n].hasOwnProperty(a)){window.clearInterval(r[n][a]);delete r[n][a]}}}for(i in r[n]){if(r[n].hasOwnProperty(i)){break}}if(!i){i=null;delete r[n]}}for(i in r){if(r.hasOwnProperty(i)){break}}if(!i){e.$timers=null}}}}});if(/(msie) ([\w.]+)/.exec(navigator.userAgent.toLowerCase())){e(window).one("unload",function(){var e=h.timer.global;for(var n in e){if(e.hasOwnProperty(n)){var t=e[n],r=t.length;while(--r){h.timer.remove(t[r],n)}}}})}(function(e){if(!String.prototype.split.toString().match(/\[native/)){return}var n=String.prototype.split,t=/()??/.exec("")[1]===e,r;r=function(r,i,o){if(Object.prototype.toString.call(i)!=="[object RegExp]"){return n.call(r,i,o)}var a=[],s=(i.ignoreCase?"i":"")+(i.multiline?"m":"")+(i.extended?"x":"")+(i.sticky?"y":""),l=0,f,c,u,p;i=new RegExp(i.source,s+"g");r+="";if(!t){f=new RegExp("^"+i.source+"$(?!\\s)",s)}o=o===e?-1>>>0:o>>>0;while(c=i.exec(r)){u=c.index+c[0].length;if(u>l){a.push(r.slice(l,c.index));if(!t&&c.length>1){c[0].replace(f,function(){for(var n=1;n<arguments.length-2;n++){if(arguments[n]===e){c[n]=e}}})}if(c.length>1&&c.index<r.length){Array.prototype.push.apply(a,c.slice(1))}p=c[0].length;l=u;if(a.length>=o){break}}if(i.lastIndex===c.index){i.lastIndex++}}if(l===r.length){if(p||!i.test("")){a.push("")}}else{a.push(r.slice(l))}return a.length>o?a.slice(0,o):a};String.prototype.split=function(e,n){return r(this,e,n)};return r})();e.fn.caret=function(e){var n=this[0];var t=n.contentEditable==="true";if(arguments.length===0){if(window.getSelection){if(t){n.focus();var r=window.getSelection().getRangeAt(0),i=r.cloneRange();i.selectNodeContents(n);i.setEnd(r.endContainer,r.endOffset);return i.toString().length}return n.selectionStart}if(document.selection){n.focus();if(t){var r=document.selection.createRange(),i=document.body.createTextRange();i.moveToElementText(n);i.setEndPoint("EndToEnd",r);return i.text.length}var e=0,o=n.createTextRange(),i=document.selection.createRange().duplicate(),a=i.getBookmark();o.moveToBookmark(a);while(o.moveStart("character",-1)!==0)e++;return e}return 0}if(e===-1)e=this[t?"text":"val"]().length;if(window.getSelection){if(t){n.focus();window.getSelection().collapse(n.firstChild,e)}else n.setSelectionRange(e,e)}else if(document.body.createTextRange){var o=document.body.createTextRange();o.moveToElementText(n);o.moveStart("character",e);o.collapse(true);o.select()}if(!t&&!this.is(":focus")){n.focus()}return e};var v=window.requestAnimationFrame||window.mozRequestAnimationFrame||window.webkitRequestAnimationFrame||function(e){return setTimeout(e,20)};e.fn.resizer=function(n){var t=arguments[0]==="unbind";if(!t&&!e.isFunction(n)){throw new Error('Invalid argument, it need to a function or string "unbind".')}if(t){n=e.isFunction(arguments[1])?arguments[1]:null}return this.each(function(){var r=e(this);var i;if(t){i=r.data("callbacks");if(n&&i){i.remove(n);if(!i.has()){i=null}}else{i=null}if(!i){r.removeData("callbacks");if(window.ResizeObserver){var o=r.data("observer");if(o){o.unobserve(this);r.removeData("observer")}}else{r.find(".resizer").remove()}}}else if(r.data("callbacks")){e(this).data("callbacks").add(n)}else{i=e.Callbacks();i.add(n);r.data("callbacks",i);var a;var s=true;if(window.ResizeObserver){a=new ResizeObserver(function(){if(!s){var e=r.data("callbacks");e.fire()}s=false});a.observe(this);r.data("observer",a);return}var l=this;a=e("<div/>").addClass("resizer").appendTo(this)[0];var f="position: absolute; left: 0; top: 0; right: 0; bottom: 0; "+"overflow: hidden; z-index: -1; visibility: hidden;";var c="position: absolute; left: 0; top: 0; transition: 0s;";a.style.cssText=f;a.innerHTML='<div class="resize-sensor-expand" style="'+f+'">'+'<div style="'+c+'"></div>'+"</div>"+'<div class="resize-sensor-shrink" style="'+f+'">'+'<div style="'+c+' width: 200%; height: 200%"></div>'+"</div>";var u=a.childNodes[0];var p=u.childNodes[0];var m=a.childNodes[1];var d,h,g,y;var b=l.offsetWidth;var w=l.offsetHeight;var _=function(){p.style.width="100000px";p.style.height="100000px";u.scrollLeft=1e5;u.scrollTop=1e5;m.scrollLeft=1e5;m.scrollTop=1e5};_();var x=function(){h=0;if(!d){return}b=g;w=y;i.fire()};var k=function(){g=l.offsetWidth;y=l.offsetHeight;d=g!==b||y!==w;if(d&&!h){h=v(x)}_()};e(u).on("scroll",k);e(m).on("scroll",k)}})};function g(e){e.attr({role:"presentation","aria-hidden":"true"})}var y=[];function b(e,n){var t=(e?e+": ":"")+_(n);if(y.indexOf(t)===-1){y.push(t);alert(t+(n.stack?"\n"+n.stack:""))}}function w(e,n){var t=n.offset().left;return n.outerWidth()<=e.clientX-t}function _(e){if(typeof e==="string"){return e}else if(typeof e.fileName==="string"){return e.fileName+": "+e.message}else{return e.message}}function x(){var n=[].slice.call(arguments);var t=0;e.extend(this,{get:function(){return n},index:function(){return t},rotate:function(e){if(!e){var r=n.filter(function(e){return typeof e!=="undefined"});if(!r.length){return}}if(n.length===1){return n[0]}else{if(t===n.length-1){t=0}else{++t}if(typeof n[t]!=="undefined"){return n[t]}else{return this.rotate(true)}}},length:function(){return n.length},remove:function(e){delete n[e]},set:function(e){for(var r=n.length;r--;){if(n[r]===e){t=r;return}}this.append(e);t=n.length-1},front:function(){if(n.length){var e=t;var r=false;while(!n[e]){e++;if(e>n.length){if(r){break}e=0;r=true}}return n[e]}},map:function(e){return n.filter(Boolean).map(e)},forEach:function(e){n.filter(Boolean).forEach(e)},append:function(e){n.push(e)}})}function k(n){var t=n instanceof Array?n:n?[n]:[];e.extend(this,{data:function(){return t},map:function(n){return e.map(t,n)},size:function(){return t.length},pop:function(){if(t.length===0){return null}else{var e=t[t.length-1];t=t.slice(0,t.length-1);return e}},push:function(e){t=t.concat([e]);return e},top:function(){return t.length>0?t[t.length-1]:null},clone:function(){return new k(t.slice(0))}})}function T(n,t,r){var i=true;var o="";if(typeof n==="string"&&n!==""){o=n+"_"}o+="commands";var a;if(r){a=[]}else{a=e.Storage.get(o);a=a?JSON.parse(a):[]}var s=a.length-1;e.extend(this,{append:function(n){if(i){if(a[a.length-1]!==n){a.push(n);if(t&&a.length>t){a=a.slice(-t)}s=a.length-1;if(!r){e.Storage.set(o,JSON.stringify(a))}}}},set:function(n){if(n instanceof Array){a=n;if(!r){e.Storage.set(o,JSON.stringify(a))}}},data:function(){return a},reset:function(){s=a.length-1},last:function(){return a[a.length-1]},end:function(){return s===a.length-1},position:function(){return s},current:function(){return a[s]},next:function(){var e=s;if(s<a.length-1){++s}if(e!==s){return a[s]}},previous:function(){var e=s;if(s>0){--s}if(e!==s){return a[s]}},clear:function(){a=[];this.purge()},enabled:function(){return i},enable:function(){i=true},purge:function(){if(!r){e.Storage.remove(o)}},disable:function(){i=false}})}var E=0;e.fn.cmd=function(t){var r=this;var i=r.data("cmd");if(i){return i}var o=E++;r.addClass("cmd");r.append('<span class="prompt"></span>');r.append('<div class="cursor-line">'+"<span></span>"+'<span class="cursor">&nbsp;</span>'+"<span></span>"+"</div>");g(r.find(".cursor-line"));var a=e("<textarea>").attr({autocapitalize:"off",spellcheck:"false",tabindex:1}).addClass("clipboard").appendTo(r).val(" ");if(t.width){r.width(t.width)}var s;var l;var f=r.find(".prompt");var c=false;var u="";var p=null;var m;var d=t.mask||false;var h="";var v;var y="";var w=0;var _;var x;var k=0;var C=t.historySize||60;var R,A;var S=r.find(".cursor");var F;var L;var j=0;function O(n){var t=e(n.target);if(t.is("span")){return t.index()+t.parents("span").prevAll().text_length()+t.closest('[role="presentation"]').prevUntil(".prompt").text_length()}else if(t.is('div[role="presentation"]')){var r=t.index();var i=h.split(/\n/).slice(0,r);return i.reduce(function(e,n){return e+me(n)},0)+(i.length-1)}}var z={SPACEBAR:" ",UP:"ARROWUP",DOWN:"ARROWDOWN",LEFT:"ARROWLEFT",RIGHT:"ARROWRIGHT",DEL:"DELETE",MULTIPLY:"*",DIVIDE:"/",SUBTRACT:"-",ADD:"+"};function I(e){if(e.key){var n=e.key.toUpperCase();if(z[n]){n=z[n]}if(n==="CONTROL"){return"CTRL"}else{var t=[];if(e.ctrlKey){t.push("CTRL")}if(e.metaKey&&n!=="META"){t.push("META")}if(e.shiftKey&&n!=="SHIFT"){t.push("SHIFT")}if(e.altKey&&n!=="ALT"){t.push("ALT")}if(t.length&&n===" "){n="SPACEBAR"}if(e.key){t.push(n)}return t.join("+")}}}var P;var N={"ALT+D":function(){r.set(h.slice(0,w)+h.slice(w).replace(/ *[^ ]+ *(?= )|[^ ]+$/,""),true);return false},ENTER:function(){if(A&&h&&!d&&(e.isFunction(t.historyFilter)&&t.historyFilter(h))||t.historyFilter instanceof RegExp&&h.match(t.historyFilter)||!t.historyFilter){A.append(h)}var n=h;A.reset();je="";Ae=true;r.set("");if(t.commands){t.commands(n)}if(e.isFunction(_)){ye()}a.val("");return false},"SHIFT+ENTER":function(){r.insert("\n");return true},BACKSPACE:function(){if(c){u=u.slice(0,-1);ie()}else if(h!==""&&w>0){r["delete"](-1)}r.oneTime(1,function(){Ae=true})},TAB:function(){r.insert("\t")},"CTRL+D":function(){r["delete"](1);return false},DELETE:function(){r["delete"](1);return true},ARROWUP:D,"CTRL+P":D,ARROWDOWN:B,"CTRL+N":B,ARROWLEFT:q,"CTRL+B":q,"CTRL+ARROWLEFT":function(){var e=w-1;var n=0;if(h[e]===" "){--e}for(var t=e;t>0;--t){if(h[t]===" "&&h[t+1]!==" "){n=t+1;break}else if(h[t]==="\n"&&h[t+1]!=="\n"){n=t;break}}r.position(n)},"CTRL+R":function(){if(c){se(true)}else{m=_;ie();v=h;r.set("");ge();c=true}return false},"CTRL+G":function(){if(c){_=m;ye();r.set(v);ge();c=false;u="";return false}},ARROWRIGHT:W,"CTRL+F":W,"CTRL+ARROWRIGHT":function(){if(h[w]===" "){++w}var e=/\S[\n\s]{2,}|[\n\s]+\S?/;var n=h.slice(w).match(e);if(!n||n[0].match(/^\s+$/)){r.position(h.length)}else if(n[0][0]!==" "){w+=n.index+1}else{w+=n.index+n[0].length-1;if(n[0][n[0].length-1]!==" "){--w}}ge()},F12:$,END:Y,"CTRL+E":Y,HOME:U,"CTRL+A":U,"SHIFT+INSERT":H,"CTRL+SHIFT+T":$,"CTRL+W":function(){if(h!==""&&w!==0){var e=h.slice(0,w).match(/([^ ]+ *$)/);if(e[0].length){y=r["delete"](-e[0].length);Z(r,y)}}return false},"CTRL+H":function(){if(h!==""&&w>0){r["delete"](-1)}return false},"CTRL+X":$,"CTRL+C":$,"CTRL+T":$,"CTRL+Y":function(){if(y!==""){r.insert(y)}},"CTRL+V":H,"META+V":H,"CTRL+K":function(){if(h.length-w){y=r["delete"](h.length-w);Z(r,y)}return false},"CTRL+U":function(){if(h!==""&&w!==0){y=r["delete"](-w);Z(r,y)}return false},"CTRL+TAB":function(){return false},"META+`":$,"META+R":$,"META+L":$};function $(){return true}function H(){a.val("");j=0;if(r.isenabled()&&!a.is(":focus")){a.trigger("focus",[true])}a.one("input",be);return true}function D(){if(xe){v=h;r.set(A.current())}else{r.set(A.previous())}xe=false;return false}function B(){r.set(A.end()?v:A.next());return false}function q(){if(w>0){r.position(-1,true);ge()}}function W(){if(w<h.length){r.position(1,true)}return false}function U(){r.position(0)}function Y(){r.position(h.length)}function ee(){var e=a.is(":focus");if(x){if(!e){}r.oneTime(10,function(){if(!a.is(":focus")&&x){a.trigger("focus",[true])}})}else if(e&&(V||!x)){a.trigger("blur",[true])}}function ne(e){if(!r.isenabled()){return}r.oneTime(10,function(){if(a.val()!==h&&!e){a.val(" "+h)}if(x){r.oneTime(10,function(){try{if(a.caret()!==w+1){a.caret(w+1)}}catch(e){}})}})}if(M&&!K){F=function(e){if(e){S.addClass("blink")}else{S.removeClass("blink")}};L=function(){var e=S.clone();e.insertBefore(S);S.remove();S=e}}else{var te=false;F=function(e){if(e&&!te){te=true;S.addClass("inverted blink");r.everyTime(500,"blink",re)}else if(te&&!e){te=false;r.stopTime("blink",re);S.removeClass("inverted blink")}};L=function(){F(false);F(true)}}function re(){S.toggleClass("inverted")}function ie(){_="(reverse-i-search)`"+u+"': ";ye()}function ae(){_=m;c=false;p=null;u=""}function se(n){var t=A.data();var i,o;var a=t.length;if(n&&p>0){a-=p}if(u.length>0){for(var s=u.length;s>0;s--){o=e.terminal.escape_regex(u.substring(0,s));i=new RegExp(o);for(var l=a;l--;){if(i.test(t[l])){p=t.length-l;r.position(t[l].indexOf(o));r.set(t[l],true);ge();if(u.length!==s){u=u.substring(0,s);ie()}return}}}}u=""}function le(){var e=r.find(".prompt").text("&nbsp;");var n=r.width();var t=e[0].getBoundingClientRect().width;s=Math.floor(n/t);ye()}function fe(n){function t(n){return e.terminal.split_equal(n,s)}function r(n){return n.filter(function(n){return!e.terminal.strip(n).match(/^ $/)})}var i=f.text();var o=new RegExp("^"+e.terminal.escape_regex(i));var a;if(n.match(/\n/)){var c=n.split("\n");var u=s-l-1;for(var p=0;p<c.length-1;++p){c[p]+=" "}if(J(c[0])>u){a=t(i+c[0]);a[0]=a[0].replace(o,"");a=r(a)}else{a=[c[0]]}for(p=1;p<c.length;++p){if(J(c[p])>s){var m=t(c[p]);if(p<c.length-1){m=r(m)}a=a.concat(m)}else{a.push(c[p])}}}else{a=t(i+n,s);a[0]=a[0].replace(o,"")}return a}window.get_splitted_command_line=fe;function ce(n){n=e.terminal.escape_formatting(n);try{return e.terminal.apply_formatters(n)}catch(e){b("[Formatting]",e)}}function ue(n){return e.terminal.format(e.terminal.encode(pe(n)))}function pe(n){function t(n){if(e.terminal.is_formatting(n)){if(n.match(/\]\\\]/)){n=n.replace(/\]\\\]/g,"]\\\\]")}}else{if(n.match(/\\$/)){n+="\\"}n="[[;;]"+n+"]"}return n}var r=me(n);if(r===1){return t(n)}var i=[];for(var o=0;o<r;++o){var a=e.terminal.substring(n,o,o+1);i.push(t(a))}return i.join("")}function me(n){return e.terminal.length(n)}function de(n,t,r){return e.terminal.substring(n,t,r)}function he(n){var t=e.terminal.defaults.formatters.filter(function(e){return e instanceof Array});if(n===0){return n}if(t.length){return t.reduce(function(e,n){var t=e[0];var r=e[1];return ve(t,n[0],n[1],r)},[h,n])[1]}return n}function ve(e,n,t,r){var i="";var o;var a=0;var s;var l=r;var f;n.lastIndex=0;while(o=n.exec(e)){var c=me(de(e,0,n.lastIndex));f=c-me(o[0]);if(a<f){i+=de(e,a,f)}a=c;s=t.replace(/\$(\$|\d)/g,function(e,n){if(n==="$"){return"$"}return o[n]});i+=s;if(f<r){if(c<r){l=Math.max(0,l+me(s)-me(o[0]))}else{l+=me(s)-(r-f)}}}if(a<me(e)){i+=de(e,a)}return[i,l]}var ge=function(){var t=S.prev();var i=S.next();var o=S.parent();function a(n,r){var o=me(n);if(r===o){t.html(ue(n));S.html("&nbsp;");i.html("")}else if(r===0){t.html("");S.html(ue(de(n,0,1)));i.html(ue(de(n,1)))}else{var a=e.terminal.substring(n,0,r);t.html(ue(a));var s=de(n,r,r+1);S.html(ue(s));if(r===o-1){i.html("")}else{i.html(ue(de(n,r+1)))}}}function f(e){return'<div role="presentation" aria-hidden="true">'+ue(e)+"</div>"}function c(n){var t=o;e.each(n,function(n,r){t=e(f(r)).insertAfter(t)})}function u(n){e.each(n,function(e,n){o.before(f(n))})}return function(){var p;switch(typeof d){case"boolean":p=d?h.replace(/./g,"*"):h;break;case"string":p=h.replace(/./g,d);break}var m=k;p=ce(X(p.replace(/&/g,"&amp;")));var v;r.find("div:not(.cursor-line,.clipboard-wrapper)").remove();t.html("");if(J(G(p))>s-l-1||p.match(/\n/)){var g=p.match(/\t/g);var y=g?g.length*3:0;if(g){p=p.replace(/\t/g,"\0\0\0\0")}var b=fe(p);if(g){b=e.map(b,function(e){return e.replace(/\x00\x00\x00\x00/g,"\t")})}var w=me(b[0]);if(w===0&&b.length===1){}else if(m<w){a(b[0],m);c(b.slice(1))}else if(m===w){o.before(f(b[0]));a(b[1]||"",0);if(b.length>1){c(b.slice(2))}}else if(m<w){a(b[0],m);c(b.slice(1))}else if(m===w){o.before(f(b[0]));a(b[1],0);c(b.slice(2))}else{var _=b.slice(-1)[0];var x=me(p);var T=x-m-y;var E=me(_);var C=0;if(T===-1){T=0}if(T<=E){u(b.slice(0,-1));if(E===T){C=0}else{C=E-T}a(_,C)}else{var R;var A;C=m;for(v=0;v<b.length;++v){var F=e.terminal.length(b[v]);if(C>F){C-=F}else{break}}A=b[v];R=v;if(C===me(A)){C=0;A=b[++R];if(A===n){var L=e.terminal.defaults.strings.redrawError;throw new Error(L)}}a(A,C);u(b.slice(0,R));c(b.slice(R+1))}}}else if(p===""){t.html("");S.html("&nbsp;");i.html("")}else{a(p,m)}}}();var ye=function(){function n(n){var t=e.terminal.split_equal(e.terminal.encode(n),s);var r=e.terminal.format(t[t.length-1]);var i=t.slice(0,-1).map(function(n){return'<span class="line">'+e.terminal.format(n)+"</span>"}).concat([r]).join("\n");if(f.html()!==i){f.html(i);l=J(e("<span>"+r+"</span>").text())}}return function(){switch(typeof _){case"string":n(_);break;case"function":_(n);break}}}();function be(){if(j++>0){return}if(r.isenabled()){r.oneTime(100,function(){r.insert(a.val());a.val(h);ne()})}}function we(){if(e.isFunction(t.onCommandChange)){t.onCommandChange(h)}}function _e(e){return e.replace(/[\r\n]{2}/g,"\n")}e.extend(r,{name:function(e){if(e!==n){R=e;var i=A&&A.enabled()||!A;A=new T(e,C,t.history==="memory");if(!i){A.disable()}return r}else{return R}},purge:function(){A.clear();return r},history:function(){return A},delete:function(e,n){var t;if(e===0){return r}else if(e<0){if(w>0){t=h.slice(0,w).slice(e);h=h.slice(0,w+e)+h.slice(w,h.length);if(!n){r.position(w+e)}we()}}else if(h!==""&&w<h.length){t=h.slice(w).slice(0,e);h=h.slice(0,w)+h.slice(w+e,h.length);we()}ge();ne();return t},set:function(e,t,i){if(e!==n){h=_e(e);if(!t){r.position(h.length)}ge();ne();if(!i){we()}}return r},keymap:function(n,t){function i(e,n){return function(t){return n(t,N[e])}}if(typeof n==="undefined"){return P}else if(typeof n==="string"){if(typeof t==="undefined"){if(P[n]){return P[n]}else if(N[n]){return N[n]}}else{P[n]=i(n,t)}}else{P=e.extend({},N,e.omap(n||{},i));return r}},insert:function(e,n){e=_e(e);if(w===h.length){h+=e}else if(w===0){h=e+h}else{h=h.slice(0,w)+e+h.slice(w)}if(!n){r.position(e.length,true)}else{ne()}ge();we();ne();return r},get:function(){return h},commands:function(e){if(e){t.commands=e;return r}else{return e}},destroy:function(){ze.unbind("keypress.cmd",Ie);ze.unbind("keydown.cmd",Oe);ze.unbind("input.cmd",$e);r.stopTime("blink",re);r.find(".cursor").next().remove().end().prev().remove().end().remove();r.find(".prompt, .clipboard").remove();r.removeClass("cmd").removeData("cmd").off(".cmd");return r},prompt:function(e){if(e===n){return _}else{if(typeof e==="string"||typeof e==="function"){_=e}else{throw new Error("prompt must be a function or string")}ye();ge();return r}},kill_text:function(){return y},position:function(n,i){if(typeof n==="number"){if(i){w+=n}else if(n<0){w=0}else if(n>h.length){w=h.length}else{w=n}k=he(w);if(e.isFunction(t.onPositionChange)){t.onPositionChange(w)}ge();ne(true);return r}else{return w}},display_position:function(t,i){if(t===n){return k}else{var o=ce(h);var a=e.terminal.length(o);var s=e.terminal.length(h);if(a===s){return r.position(t)}else{var l;if(i){l=k+t}else if(t>a){l=a}else{l=t}if(l===a){r.position(e.terminal.length(h))}else{for(var f=0;f<s;++f){if(l===he(f)){r.position(f)}}}}return r}},visible:function(){var e=r.visible;return function(){e.apply(r,[]);ge();ye()}}(),show:function(){var e=r.show;return function(){e.apply(r,[]);ge();ye()}}(),resize:function(e){if(e){s=e}else{le()}ge();ye();return r},enable:function(){if(!x){x=true;r.addClass("enabled");try{a.caret(w)}catch(e){}F(true);ye()}ee();return r},isenabled:function(){return x},disable:function(e){x=false;r.removeClass("enabled");F(false);if(!e){ee()}return r},mask:function(e){if(typeof e==="undefined"){return d}else{d=e;ge();return r}}});r.name(t.name||t.prompt||"");if(typeof t.prompt==="string"){_=t.prompt}else{_="> "}ye();if(t.enabled===n||t.enabled===true){r.enable()}if(!t.history){A.disable()}var xe=true;var ke=false;var Te=false;var Ee=false;var Ce=false;var Re=false;var Ae=true;var Se=false;var Fe=false;var Le;var je="";function Oe(i){Ne('keydown "'+i.key+'" '+i.fake+" "+i.which);Fe=(i.key||"").toLowerCase()==="process"||i.which===0;var o;Te=Ce&&Ee;try{if(!i.fake){Ee=i.key&&i.key.length===1&&!i.ctrlKey;Re=String(i.key).toLowerCase()==="unidentified";Se=i.key.toUpperCase()==="BACKSPACE"||i.which===8}}catch(e){}if(i.key==="Unidentified"){Ae=true;return}if(!i.fake){Ce=true;Ae=false}a.off("input",be);var s=I(i);if(e.isFunction(t.keydown)){o=t.keydown(i);if(o!==n){if(!o){Le=true}return o}}if(x){L();Le=["CTRL+V","META+V"].indexOf(s)!==-1;if(i.which!==38&&!(i.which===80&&i.ctrlKey)){xe=true}if(c&&(i.which===35||i.which===36||i.which===37||i.which===38||i.which===39||i.which===40||i.which===13||i.which===27)){ae();ye();if(i.which===27){r.set("")}ge();Oe.call(this,i)}else if(e.isFunction(P[s])){o=P[s]();if(o===true){return}if(o!==n){return o}}else if(i.altKey){return}else{ke=false;return}}}var ze=e(document.documentElement||window);r.keymap(t.keymap||{});function Ie(i){Ne('keypress "'+i.key+'" '+i.fake);var o;if(!i.fake){Ce=false}if((i.ctrlKey||i.metaKey)&&!i.altKey){return}if(ke){return}if(e.isFunction(t.keypress)){o=t.keypress(i);if(o!==n){if(!o){Le=true}return o}}if(x){if(i.fake){return}var a;if(oe()||i.fake){a=i.key;var s=a.toUpperCase();if(z[s]){a=z[s]}}if(!a||Re){a=String.fromCharCode(i.which)}if(e.inArray(i.which,[13,0,8])>-1){if(i.keyCode===123){return}return false}else if(a&&(!i.ctrlKey||i.ctrlKey&&i.ctrlKey)&&(!(i.altKey&&i.which===100)||i.altKey)&&!Te){if(c){u+=a;se();ie()}else if(a.length===1){r.insert(a)}}}}function Pe(n,t,r){var i=e.Event(n);i.which=r;i.key=t;i.fake=true;ze.trigger(i)}function Ne(e){if(false){console.log(e)}}function $e(e){Ne("input "+Ae+" || "+Fe+" (("+Ce+" || "+Te+") && !"+Le+" && ("+Ee+" || "+Re+") && !"+Se+")");Ne(JSON.stringify({data:e.originalEvent.data,inputType:e.originalEvent.data}));var n=a.val();if((Ae||Fe||(Ce||Te)&&!Le&&(Ee||Re)&&!Se)&&n!==h){var t=w;if(Ae){var i=je;Se=i.substring(0,i.length-1).length===n.length}if(c){u=n;se();ie()}else{var o=n.substring(w);if(o.length===1||Se){if(Ae){var s;if(Se){s=8}else{s=o.toUpperCase().charCodeAt(0)}Pe("keydown",Se?"Backspace":o,s)}if(Ce&&!Se){Pe("keypress",o,o.charCodeAt(0))}}if(Se){je=h;return}if(Le){Le=false;return}r.set(n)}if(Se){r.position(t-1)}else{r.position(t+Math.abs(n.length-je.length))}}je=h;Le=false;Ae=true}ze.bind("keypress.cmd",Ie).bind("keydown.cmd",Oe).bind("input.cmd",$e);(function(){var n=false;var i=0;r.on("mousedown.cmd",function(){n=true}).on("mouseup.cmd",function(a){if(a.originalEvent.button===0&&Q()===""){var s="click_"+o;if(++i===1){var l=n;if(x){r.oneTime(t.clickTimeout,s,function(){var n=e(a.target);if(!n.is(".prompt")&&l){if(x){if(n.is(".cmd")){r.position(h.length)}else{r.display_position(O(a))}}}i=0})}else{i=0}}else{r.stopTime(s);i=0}}n=false})})();r.data("cmd",r);if(!("KeyboardEvent"in window&&"key"in window.KeyboardEvent.prototype)){setTimeout(function(){throw new Error("key event property not supported try "+"https://github.com/cvan/keyboardevent-key-polyfill")},0)}return r};var C=/(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino|android|ipad|playbook|silk/i;var R=/1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i;var A=/(\[\[[!gbiuso]*;[^;]*;[^\]]*\](?:[^\]]*[^\\](\\\\)*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?)/i;var S=/\[\[([!gbiuso]*);([^;]*);([^;\]]*);?([^;\]]*);?([^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?/gi;var F=/\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?/gi;var L=/\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]/gi;var j=/^\[\[([!gbiuso]*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]$/gi;var O=/^#([0-9a-f]{3}|[0-9a-f]{6})$/i;var z=/(\bhttps?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\][)])+\b)/gi;var I=/\b(https?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\][)])+)\b(?![^[\]]*])/gi;var P=/((([^<>('")[\]\\.,;:\s@"]+(\.[^<>()[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,})))/g;var N=/((?:"[^"\\]*(?:\\[\S\s][^"\\]*)*"|'[^'\\]*(?:\\[\S\s][^'\\]*)*'|\/[^\/\\]*(?:\\[\S\s][^\/\\]*)*\/[gimy]*(?=\s|$)|(?:\\\s|\S))+)(?=\s|$)/gi;var $=/(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;var H=/^(\[\[[!gbiuso]*;[^;]*;[^\]]*\])/i;var D=/\[\[[!gbiuso]*;[^;]*;[^\]]*\]?$/i;var B=/(\[\[(?:[^\]]|\\\])+\]\])/;var q=/^[-+]?[0-9]*\.?[0-9]+([eE][-+]?[0-9]+)?$/;var W=/^\/((?:\\\/|[^/]|\[[^\]]*\/[^\]]*\])+)\/([gimy]*)$/;var U=/^(?=((?:[^"']+|"[^"\\]*(?:\\[^][^"\\]*)*"|'[^'\\]*(?:\\[^][^'\\]*)*')*))\1./;var M=function(){var e=false,t="Webkit Moz O ms Khtml".split(" "),r=document.createElement("div");if(r.style.animationName){e=true}if(e===false){for(var i=0;i<t.length;i++){var o=t[i]+"AnimationName";if(r.style[o]!==n){e=true;break}}}r=null;return e}();var K=navigator.userAgent.toLowerCase().indexOf("android")!==-1;var J=function(){if(typeof wcwidth==="undefined"){return function(e){return e.length}}else{return wcwidth}}();function Y(n){if(!n.match(/&/)){return n}return e("<span>"+X(n)+"</span>").text()}function G(n){return Y(e.terminal.strip(n))}function X(e){if(!e.match(/[<>]/)){return e}return e.replace(/>/g,"&gt;").replace(/</g,"&lt;")}var V=function(e){var n=false;if(C.test(e)||R.test(e.substr(0,4))){n=true}return n}(navigator.userAgent||navigator.vendor||window.opera);var Q=function(){if(window.getSelection||document.getSelection){return function(){var e=(window.getSelection||document.getSelection)();if(e.text){return e.text}else{return e.toString()}}}else if(document.selection&&document.selection.type!=="Control"){return function(){return document.selection.createRange().text}}return function(){return""}}();function Z(n,t){var r=e("<div>"+t.replace(/\n/,"<br/>")+"<div>");r.appendTo("body");re(r[0]);try{document.execCommand("copy")}catch(e){}r.remove()}var ee=function(){var e=document.createElement("textarea");var n="selectionStart"in e;e=null;if(n){return function(e){var n=e.selectionEnd-e.selectionStart;return e.value.substr(e.selectionStart,n)}}else if(document.selection){return function(){var e=document.selection.createRange();return e.text()}}else{return function(){return""}}}();function ne(e){e.selectionStart=e.selectionEnd=0}var te=function(){if(window.getSelection){var n=window.getSelection();if(n.setBaseAndExtent){return function(e,n){var t=window.getSelection();t.setBaseAndExtent(e,0,n,1)}}else{return function(e,n){var t=window.getSelection();var r=document.createRange();r.setStart(e,0);r.setEnd(n,n.childNodes.length);t.removeAllRanges();t.addRange(r)}}}else{return e.noop}}();function re(e){if(window.getSelection){var n=window.getSelection();if(n.setBaseAndExtent){n.setBaseAndExtent(e,0,e,1)}else if(document.createRange){var t=document.createRange();t.selectNodeContents(e);n.removeAllRanges();n.addRange(t)}}}function ie(n,t){var r=n.match(N)||[];if(r.length){var i=r.shift();var o=e.map(r,function(e){if(e.match(/^["']/)){e=e.replace(/\n/g,"\\u0000\\u0000\\u0000\\u0000");e=t(e);return e.replace(/\x00\x00\x00\x00/g,"\n")}return t(e)});var a=e.map(r,function(e){var n=e.match(/^(['"]).*\1$/);return n&&n[1]||""});var s=n.substring(i.length).trim();return{command:n,name:i,args:o,args_quotes:a,rest:s}}else{return{command:n,name:"",args:[],args_quotes:a,rest:""}}}e.terminal={version:"1.11.4",date:"Sat, 27 Jan 2018 15:44:36 +0000",color_names:["transparent","currentcolor","black","silver","gray","white","maroon","red","purple","fuchsia","green","lime","olive","yellow","navy","blue","teal","aqua","aliceblue","antiquewhite","aqua","aquamarine","azure","beige","bisque","black","blanchedalmond","blue","blueviolet","brown","burlywood","cadetblue","chartreuse","chocolate","coral","cornflowerblue","cornsilk","crimson","cyan","darkblue","darkcyan","darkgoldenrod","darkgray","darkgreen","darkgrey","darkkhaki","darkmagenta","darkolivegreen","darkorange","darkorchid","darkred","darksalmon","darkseagreen","darkslateblue","darkslategray","darkslategrey","darkturquoise","darkviolet","deeppink","deepskyblue","dimgray","dimgrey","dodgerblue","firebrick","floralwhite","forestgreen","fuchsia","gainsboro","ghostwhite","gold","goldenrod","gray","green","greenyellow","grey","honeydew","hotpink","indianred","indigo","ivory","khaki","lavender","lavenderblush","lawngreen","lemonchiffon","lightblue","lightcoral","lightcyan","lightgoldenrodyellow","lightgray","lightgreen","lightgrey","lightpink","lightsalmon","lightseagreen","lightskyblue","lightslategray","lightslategrey","lightsteelblue","lightyellow","lime","limegreen","linen","magenta","maroon","mediumaquamarine","mediumblue","mediumorchid","mediumpurple","mediumseagreen","mediumslateblue","mediumspringgreen","mediumturquoise","mediumvioletred","midnightblue","mintcream","mistyrose","moccasin","navajowhite","navy","oldlace","olive","olivedrab","orange","orangered","orchid","palegoldenrod","palegreen","paleturquoise","palevioletred","papayawhip","peachpuff","peru","pink","plum","powderblue","purple","red","rosybrown","royalblue","saddlebrown","salmon","sandybrown","seagreen","seashell","sienna","silver","skyblue","slateblue","slategray","slategrey","snow","springgreen","steelblue","tan","teal","thistle","tomato","turquoise","violet","wheat","white","whitesmoke","yellow","yellowgreen"],Cycle:x,History:T,Stack:k,valid_color:function n(t){if(t.match(O)){return true}else{return e.inArray(t.toLowerCase(),e.terminal.color_names)!==-1}},unclosed_strings:function e(n){return!!n.match(U)},escape_regex:function e(n){if(typeof n==="string"){var t=/([-\\^$[\]()+{}?*.|])/g;return n.replace(t,"\\$1")}},have_formatting:function e(n){return typeof n==="string"&&!!n.match(L)},is_formatting:function e(n){return typeof n==="string"&&!!n.match(j)},format_split:function e(n){return n.split(A).filter(Boolean)},iterate_formatting:function e(t,r){function i(e){return t.substring(e-6,e)==="&nbsp;"||t.substring(e-1,e).match(/\s/)}function o(e){return t.substring(e).match(/^(&[^;]+;)/)}var a=false;var s=false;var l=0;var f;var c=-1;var u;var p=0;for(var m=0;m<t.length;m++){f=t.substring(m).match(H);if(f){a=f[1];s=false}else if(a){if(t[m]==="]"){if(s){a="";s=false}else{s=true}}}else{s=true}var d=a&&s||!a;var h=t[m]==="["&&t[m+1]==="[";if(i(m)&&(d||h)){if(c===-1&&u!==m||c!==-1){c=m}}var v=t[m].match(/[[\]]/);if(d){if(t[m]==="&"){f=o(m);if(f){m+=f[1].length-2;continue}++l;++p}else if(t[m]==="]"&&t[m-1]==="\\"){--l;--p}else if(!v){++l;++p}}if(d&&t[m]!=="]"&&!h){if(J(t[m])===2){p++}var g={count:l,index:m,formatting:a,length:p,text:s,space:c};var y=r(g);if(y===false){break}else if(y){if(y.count!==n){l=y.count}if(y.length!==n){p=y.length}if(y.space!==n){u=c;c=y.space}if(y.index!==n){m=y.index}}}}},substring:function n(t,r,i){if(G(t).substring(r,i)===""){return""}var o;var a=t.length;var s="";var l="";var f;var c=/(&[^;]+);$/;e.terminal.iterate_formatting(t,function(e){var n;if(r&&e.count===r+1){o=e.index;n=t.substring(0,o+1).match(c);if(n){o-=n[1].length}if(e.formatting){s=e.formatting}}if(i&&e.count===i+1){a=e.index;n=t.substring(0,a+1).match(c);if(n){a-=n[1].length}if(e.formatting){a=f+1}}if(i&&e.count===i){l=e.formatting;f=e.index}});if(r&&!o){return""}t=s+t.substring(o,a);if(l){t=t.replace(/(\[\[^\]]+)?\]$/,"");t+="]"}return t},normalize:function e(n){return n.replace(F,function(e,n,t){if(t===""){return""}var r=n.match(/;/g).length;if(r>=4){var i=n.split(/;/);var o=i.slice(0,4).join(";");var a=i.slice(4).join(";");return"[["+o+";"+(a||t)+"]"+t+"]"}else if(r===2){r=";;"}else if(r===3){r=";"}else{r=""}var s=t.replace(/\\\]/g,"&#93;").replace(/\n/g,"\\n").replace(/&nbsp;/g," ");return"[["+n+r+s+"]"+t+"]"})},split_equal:function n(t,r,i){var o="";var a=[];var s=e.terminal.normalize(t).split(/\n/g);for(var l=0,f=s.length;l<f;++l){if(s[l]===""){a.push("");continue}var c=s[l];var u=0;var p;var m=c.length;e.terminal.iterate_formatting(c,function(n){var t=n.index===m-2&&c[n.index+1]==="]";var s=n.index===m-1||t;if(n.length>=r||s||n.length===r-1&&J(c[n.index+1])===2){var l=false;if(i&&n.space!==-1){var f=e.terminal.strip(c.substring(n.space));f=e("<span>"+f+"</span>").text();var d=f.length;var h=n.index+r+1;f=f.substring(0,h);if(f.match(/\s|&nbsp;/)||h>d){l=true}}if(i&&!t&&n.space!==-1&&n.index!==m-1&&l){p=c.substring(u,n.space);var v=n.space-1}else{p=c.substring(u,n.index+1)}if(i){p=p.replace(/^(&nbsp;|\s)+|(&nbsp;|\s)+$/g,"")}u=(v||n.index)+1;if(o){var g=p.match(/^[^\]]*\]/);p=o+p;if(g){o=""}}if(t){p+="]";o=""}var y=p.match(F);if(y){var b=y[y.length-1];if(b[b.length-1]!=="]"){o=b.match($)[1];p+="]"}else if(p.match(D)){p=p.replace(D,"");o=b.match($)[1]}}p=p.replace(/^(\[\[[^\]]+\])?\]/,"");a.push(p);return{index:v,length:0,space:-1}}})}return a},amp:function(e){return e.replace(/&(?!#[0-9]+;|[a-zA-Z]+;)/g,"&amp;")},encode:function n(t){return e.terminal.amp(t).replace(/</g,"&lt;").replace(/>/g,"&gt;").replace(/ /g,"&nbsp;").replace(/\t/g,"&nbsp;&nbsp;&nbsp;&nbsp;")},nested_formatting:function n(t){if(!e.terminal.have_formatting(t)){return t}var r=[];var i=/((?:\[\[(?:[^\]]|\\\])+\])?(?:[^\][]|\\\])*\]?)/;var o=/(\[\[(?:[^\]]|\\\])+\])[\s\S]*/;return t.split(i).filter(Boolean).map(function(n){if(n.match(/^\[\[/)){if(!e.terminal.is_formatting(n)){n+="]";r.push(n.replace(o,"$1"))}}else{var t=false;if(n.match(/\]/)){t=true}if(r.length){n=r[r.length-1]+n}if(t){r.pop()}else if(r.length){n+="]"}}return n}).join("")},escape_formatting:function n(t){return e.terminal.escape_brackets(t)},apply_formatters:function(n){var t=e.terminal.defaults.formatters;var r=0;try{return t.reduce(function(n,t){r++;if(typeof t==="function"&&t.__meta__){var i=t(n);if(typeof i==="string"){return i}}else{return e.terminal.format_split(n).map(function(n){if(e.terminal.is_formatting(n)){return n}else{if(t instanceof Array){return n.replace(t[0],t[1])}else if(typeof t==="function"){var r=t(n);if(typeof r==="string"){return r}}return n}}).join("")}return n},n)}catch(e){throw new Error("Error in formatter ["+(r-1)+"]")}},format:function n(t,r){function i(e){if(e.match(/\\]/)){e=e.replace(/(\\+)]/g,function(e,n){if(n.length%2===1){return"]"}else{return n.replace(/../,"\\")}})}return X(e)}var o=e.extend({},{linksNoReferrer:false},r||{});if(typeof t==="string"){var a=e.terminal.format_split(t);t=e.map(a,function(n){if(n===""){return n}else if(e.terminal.is_formatting(n)){n=n.replace(/\[\[[^\]]+\]/,function(e){return e.replace(/&nbsp;/g," ")});return n.replace(S,function(n,t,r,a,s,l,f){if(f===""){return""}f=i(f);var c="";if(t.indexOf("b")!==-1){c+="font-weight:bold;"}var u=[];if(t.indexOf("u")!==-1){u.push("underline")}if(t.indexOf("s")!==-1){u.push("line-through")}if(t.indexOf("o")!==-1){u.push("overline")}if(u.length){c+="text-decoration:"+u.join(" ")+";"}if(t.indexOf("i")!==-1){c+="font-style:italic;"}if(typeof wcwidth!=="undefined"){var p=Y(f);var m=J(p);if(m!==p.length){c+="--length: "+m+";"}}if(e.terminal.valid_color(r)){c+="color:"+r+";";if(t.indexOf("g")!==-1){c+="text-shadow:0 0 5px "+r+";"}}if(e.terminal.valid_color(a)){c+="background-color:"+a}var d;if(l===""){d=f}else{d=l.replace(/&#93;/g,"]").replace(/>/g,"&gt;").replace(/</g,"&lt;")}var h;if(t.indexOf("!")!==-1){if(d.match(P)){h='<a href="mailto:'+d+'"'}else{h='<a target="_blank" href="'+d+'"';if(o.linksNoReferrer){h+=' rel="noreferrer noopener"'}else{h+=' rel="noopener"'}}h+=' tabindex="1000"'}else{h="<span"}if(c!==""){h+=' style="'+c+'"'}if(s!==""){h+=' class="'+s+'"'}if(t.indexOf("!")!==-1){h+=">"+f+"</a>"}else{h+=' data-text="'+d.replace(/"/g,"&quote;")+'">'+f+"</span>"}return h})}else{n=i(n);var t="";if(typeof wcwidth!=="undefined"){var r=Y(n);var a=J(r);if(r.length!==a){t=' style="--length: '+a+'"'}}return"<span"+t+">"+n+"</span>"}}).join("");return t.replace(/<span><br\s*\/?><\/span>/gi,"<br/>")}else{return""}},escape_brackets:function e(n){return n.replace(/\[/g,"&#91;").replace(/\]/g,"&#93;")},length:function(e){return G(e).length},columns:function(e,n,t){var r=e.map(function(e){return e.length});var i=Math.max.apply(null,r)+t;if(typeof t==="undefined"){t=4}var o=Math.floor(n/i);var a=[];var s;function l(n){var t=new Array(i-e[n].length).join(" ");s.push(e[n]+(n%o===0?"":t))}if(o<2){return e.join("\n")}for(var f=0;f<e.length;++f){if(f%o===0){if(s){l(f);a.push(s.join(""))}s=[]}else{l(f)}}return a.join("\n")},strip:function e(n){n=n.replace(S,"$6");return n.replace(/(\\?)([[\]])/g,function(e,n){if(n){return e}else{return""}})},active:function e(){return _e.front()},last_id:function e(){var n=_e.length();if(n){return n-1}},parse_argument:function e(n,t){function r(e){if(e.match(/^['"]/)){var n=e[0];var t=new RegExp("((^|[^\\\\])(?:\\\\\\\\)*)"+n,"g");e=e.replace(t,"$1")}return JSON.parse('"'+e+'"')}if(t===false){if(n[0]==="'"&&n[n.length-1]==="'"){return n.replace(/^'|'$/g,"")}else if(n[0]==='"'&&n[n.length-1]==='"'){return n.replace(/^"|"$/g,"").replace(/\\([" ])/g,"$1")}else if(n.match(/\/.*\/[gimy]*$/)){return n}else if(n.match(/['"]]/)){return r(n)}else{return n.replace(/\\ /g," ")}}var i=n.match(W);if(i){return new RegExp(i[1],i[2])}else if(n.match(/['"]/)){return r(n)}else if(n.match(/^-?[0-9]+$/)){return parseInt(n,10)}else if(n.match(q)){return parseFloat(n)}else{return n.replace(/\\(['"() ])/g,"$1")}},parse_arguments:function n(t){return e.map(t.match(N)||[],e.terminal.parse_argument)},split_arguments:function(n){return e.map(n.match(N)||[],function(n){return e.terminal.parse_argument(n,false)})},parse_command:function n(t){return ie(t,e.terminal.parse_argument)},split_command:function(n){return ie(n,function(n){return e.terminal.parse_argument(n,false)})},extended_command:function e(n,t){try{Te=false;n.exec(t,true).done(function(){Te=true})}catch(e){}},formatter:new function(){try{this[Symbol.split]=function(n){return e.terminal.format_split(n)};this[Symbol.match]=function(e){return e.match(F)};this[Symbol.replace]=function(e,n){return e.replace(S,n)};this[Symbol.search]=function(e){return e.search(F)}}catch(e){}}};e.fn.visible=function(){return this.css("visibility","visible")};e.fn.hidden=function(){return this.css("visibility","hidden")};e.fn.scroll_element=function(){var n=e.fn.scroll_element.defaults;return this.map(function(){var t=e(this);if(t.is("body")){if("scrollingElement"in document){return document.scrollingElement}if(e.fn.scroll_element.cache){return e.fn.scroll_element.cache}var r=e("html");var i=e("body");var o=i.scrollTop()||r.scrollTop();var a=e("<pre/>").css(n.pre).appendTo("body");e("body,html").scrollTop(10);var s;if(i.scrollTop()===10){i.scrollTop(o);s=i[0]}else if(r.scrollTop()===10){r.scrollTop(o);s=r[0]}a.remove();e.fn.scroll_element.cache=s;return s}else{return this}})};e.fn.scroll_element.defaults={lines:2e3,pre:{height:"99999em"}};e.fn.scroll_element.cache;function oe(){if(!("KeyboardEvent"in window&&"key"in window.KeyboardEvent.prototype)){return false}var e=window.KeyboardEvent.prototype;var n=Object.getOwnPropertyDescriptor(e,"key").get;return n.toString().match(/\[native code\]/)}function ae(e){e="[jQuery Terminal] "+e;if(console&&console.warn){console.warn(e)}else{setTimeout(function(){throw new Error("WARN: "+e)},0)}}var se={};e.jrpc=function(n,t,r,i,o){var a;if(e.isPlainObject(n)){a=n}else{a={url:n,method:t,params:r,success:i,error:o}}function s(n){return e.isNumeric(n.id)&&(typeof n.result!=="undefined"||typeof n.error!=="undefined")}se[a.url]=se[a.url]||0;var l={jsonrpc:"2.0",method:a.method,params:a.params,id:++se[a.url]};return e.ajax({url:a.url,beforeSend:function n(t,r){if(e.isFunction(a.request)){a.request(t,l)}r.data=JSON.stringify(l)},success:function n(t,r,i){var o=i.getResponseHeader("Content-Type");if(!o.match(/(application|text)\/json/)){ae("Response Content-Type is neither application/json"+" nor text/json")}var l;try{l=JSON.parse(t)}catch(e){if(a.error){a.error(i,"Invalid JSON",e)}else{throw new Error("Invalid JSON")}return}if(e.isFunction(a.response)){a.response(i,l)}if(s(l)||a.method==="system.describe"){a.success(l,r,i)}else if(a.error){a.error(i,"Invalid JSON-RPC")}else{throw new Error("Invalid JSON-RPC")}},error:a.error,contentType:"application/json",dataType:"text",async:true,cache:false,type:"POST"})};function le(n){var t=e('<div class="terminal temp"><div class="cmd"><span cla'+'ss="prompt">&nbsp;</span></div></div>').appendTo("body");t.addClass(n.attr("class"));if(n){var r=n.attr("style");if(r){r=r.split(/\s*;\s*/).filter(function(e){return!e.match(/display\s*:\s*none/i)}).join(";");t.attr("style",r)}}var i=t.find("span")[0].getBoundingClientRect();var o={width:i.width,height:i.height};t.remove();return o}function fe(e,n){var t=e.find(".terminal-fill").width();var r=Math.floor(t/n.width);return r||1e3}function ce(e,n){return Math.floor(e.find(".terminal-fill").height()/n.height)}function ue(e,n){var t=e.filter(function(e){return e[n]()===e});return t.length===e.length}function pe(e){var n=e.split("");if(ue(n,"toLowerCase")){return"lower"}else if(ue(n,"toUpperCase")){return"upper"}else{return"mixed"}}function me(e){return pe(e)!=="mixed"}var de=!e.terminal.version.match(/^\{\{/);var he="Copyright (c) 2011-2018 Jakub Jankiewicz <http://jcubic"+".pl/me>";var ve=de?" v. "+e.terminal.version:" ";var ge=new RegExp(" {"+ve.length+"}$");var ye="jQuery Terminal Emulator"+(de?ve:"");var be=[["jQuery Terminal","(c) 2011-2018 jcubic"],[ye,he.replace(/^Copyright | *<.*>/g,"")],[ye,he.replace(/^Copyright /,"")],["      _______                 ________                        __","     / / _  /_ ____________ _/__  ___/______________  _____  / /"," __ / / // / // / _  / _/ // / / / _  / _/     / /  \\/ / _ \\/ /","/  / / // / // / ___/ // // / / / ___/ // / / / / /\\  / // / /__","\\___/____ \\\\__/____/_/ \\__ / /_/____/_//_/_/_/ /_/  \\/\\__\\_\\___/","         \\/          /____/                                   ".replace(ge," ")+ve,he],["      __ _____                     ________                            "+"  __","     / // _  /__ __ _____ ___ __ _/__  ___/__ ___ ______ __ __  __ ___ "+" / /"," __ / // // // // // _  // _// // / / // _  // _//     // //  \\/ // _ "+"\\/ /","/  / // // // // // ___// / / // / / // ___// / / / / // // /\\  // // "+"/ /__","\\___//____ \\\\___//____//_/ _\\_  / /_//____//_/ /_/ /_//_//_/ /_/ \\"+"__\\_\\___/",("          \\/              /____/                                     "+"     ").replace(ge,"")+ve,he]];e.terminal.nested_formatting.__meta__=true;e.terminal.defaults={prompt:"> ",history:true,exit:true,clear:true,enabled:true,maskChar:"*",wrap:true,checkArity:true,raw:false,exceptionHandler:null,pauseEvents:true,softPause:false,memory:false,cancelableAjax:true,processArguments:true,linksNoReferrer:false,processRPCResponse:null,completionEscape:true,convertLinks:true,extra:{},tabs:4,historySize:60,historyState:false,importHistory:false,historyFilter:null,echoCommand:true,scrollOnEcho:true,login:null,outputLimit:-1,formatters:[e.terminal.nested_formatting],onAjaxError:null,pasteImage:true,scrollBottomOffset:20,wordAutocomplete:true,caseSensitiveAutocomplete:true,clickTimeout:200,request:e.noop,response:e.noop,describe:"procs",onRPCError:null,completion:false,onInit:e.noop,onClear:e.noop,onBlur:e.noop,onFocus:e.noop,onTerminalChange:e.noop,onExit:e.noop,onPush:e.noop,onPop:e.noop,keypress:e.noop,keydown:e.noop,onAfterRedraw:e.noop,onEchoCommand:e.noop,onFlush:e.noop,strings:{comletionParameters:"From version 1.0.0 completion function need to"+" have two arguments",wrongPasswordTryAgain:"Wrong password try again!",wrongPassword:"Wrong password!",ajaxAbortError:"Error while aborting ajax call!",wrongArity:"Wrong number of arguments. Function '%s' expects %s got"+" %s!",commandNotFound:"Command '%s' Not Found!",oneRPCWithIgnore:"You can use only one rpc with describe == false "+"or rpc without system.describe",oneInterpreterFunction:"You can't use more than one function (rpc "+"without system.describe or with option describe == false count"+"s as one)",loginFunctionMissing:"You didn't specify a login function",noTokenError:"Access denied (no token)",serverResponse:"Server responded",wrongGreetings:"Wrong value of greetings parameter",notWhileLogin:"You can't call `%s' function while in login",loginIsNotAFunction:"Authenticate must be a function",canExitError:"You can't exit from main interpreter",invalidCompletion:"Invalid completion",invalidSelector:'Sorry, but terminal said that "%s" is not valid '+"selector!",invalidTerminalId:"Invalid Terminal ID",login:"login",password:"password",recursiveCall:"Recursive call detected, skip",notAString:"%s function: argument is not a string",redrawError:"Internal error, wrong position in cmd redraw",invalidStrings:"Command %s have unclosed strings"}};var we=[];var _e=new x;var xe=[];var ke;var Te=false;var Ee=true;var Ce=true;e.fn.terminal=function(r,o){function a(n){if(n){this.storage={}}this.set=function(t,r){if(n){this.storage[t]=r}else{e.Storage.set(t,r)}};this.get=function(t){if(n){return this.storage[t]}else{return e.Storage.get(t)}};this.remove=function(t){if(n){delete this.storage[t]}else{e.Storage.remove(t)}}}function s(n){if(e.terminal.unclosed_strings(n)){var t=e.terminal.escape_brackets(n);throw new Error(sprintf(he().invalidStrings,"`"+t+"`"))}else if(e.isFunction(Me.processArguments)){return ie(n,Me.processArguments)}else if(Me.processArguments){return e.terminal.parse_command(n)}else{return e.terminal.split_command(n)}}function l(n){if(typeof n==="string"){ve.echo(n)}else if(n instanceof Array){ve.echo(e.map(n,function(e){return JSON.stringify(e)}).join(" "))}else if(typeof n==="object"){ve.echo(JSON.stringify(n))}else{ve.echo(n)}}function f(n){var t=/(.*):([0-9]+):([0-9]+)$/;var r=n.match(t);if(r){ve.pause(Me.softPause);e.get(r[1],function(n){var t=location.href.replace(/[^/]+$/,"");var i=r[1].replace(t,"");ve.echo("[[b;white;]"+i+"]");var o=n.split("\n");var a=+r[2]-1;ve.echo(o.slice(a-2,a+3).map(function(n,t){if(t===2){n="[[;#f00;]"+e.terminal.escape_brackets(n)+"]"}return"["+(a+t)+"]: "+n}).join("\n")).resume()},"text")}}function c(n){if(e.isFunction(Me.onRPCError)){Me.onRPCError.call(ve,n)}else{ve.error("&#91;RPC&#93; "+n.message);if(n.error&&n.error.message){n=n.error;var t="\t"+n.message;if(n.file){t+=' in file "'+n.file.replace(/.*\//,"")+'"'}if(n.at){t+=" at line "+n.at}ve.error(t)}}}function u(n,t){var r=function(t,r){ve.pause(Me.softPause);e.jrpc({url:n,method:t,params:r,request:function(e,n){try{Me.request.call(ve,e,n,ve)}catch(e){y(e,"USER")}},response:function(e,n){try{Me.response.call(ve,e,n,ve)}catch(e){y(e,"USER")}},success:function n(t){if(t.error){c(t.error)}else if(e.isFunction(Me.processRPCResponse)){Me.processRPCResponse.call(ve,t.result,ve)}else{l(t.result)}ve.resume()},error:m})};return function(e,n){if(e===""){return}try{e=s(e)}catch(e){y(e,"TERMINAL (get_processed_command)");return}if(!t||e.name==="help"){r(e.name,e.args)}else{var i=n.token();if(i){r(e.name,[i].concat(e.args))}else{n.error("&#91;AUTH&#93; "+he().noTokenError)}}}}function p(t,r,i,o){return function(a,l){if(a===""){return}var f;try{f=s(a)}catch(n){if(e.isFunction(Me.exception)){Me.exception(n,ve)}else{ve.error(n.toString())}return}var c=t[f.name];var u=e.type(c);if(u==="function"){if(r&&c.length!==f.args.length){ve.error("&#91;Arity&#93; "+sprintf(he().wrongArity,f.name,c.length,f.args.length))}else{return c.apply(ve,f.args)}}else if(u==="object"||u==="string"){var m=[];if(u==="object"){m=Object.keys(c);c=p(c,r,i)}l.push(c,{prompt:f.name+"> ",name:f.name,completion:u==="object"?m:n})}else if(e.isFunction(o)){o(a,ve)}else if(e.isFunction(Me.onCommandNotFound)){Me.onCommandNotFound.call(ve,a,ve)}else{l.error(sprintf(he().commandNotFound,f.name))}}}function m(n,t,r){ve.resume();if(e.isFunction(Me.onAjaxError)){Me.onAjaxError.call(ve,n,t,r)}else if(t!=="abort"){ve.error("&#91;AJAX&#93; "+t+" - "+he().serverResponse+":\n"+e.terminal.escape_brackets(n.responseText))}}function d(n,t,r){function i(n){if(n.error){c(n.error)}else if(e.isFunction(Me.processRPCResponse)){Me.processRPCResponse.call(ve,n.result,ve)}else{l(n.result)}ve.resume()}function o(e,n){try{Me.request.call(ve,e,n,ve)}catch(e){y(e,"USER")}}function a(e,n){try{Me.response.call(ve,e,n,ve)}catch(e){y(e,"USER")}}function s(s){var l=s;if(Me.describe!==""){Me.describe.split(".").forEach(function(e){l=l[e]})}if(l&&l.length){var f={};e.each(l,function(r,s){if(e.isPlainObject(s)&&typeof s.name==="string"){f[s.name]=function(){var r=t&&s.name!=="help";var l=Array.prototype.slice.call(arguments);var f=l.length+(r?1:0);if(Me.checkArity&&s.params&&s.params.length!==f){ve.error("&#91;Arity&#93; "+sprintf(he().wrongArity,s.name,s.params.length,f))}else{ve.pause(Me.softPause);if(r){var c=ve.token(true);if(c){l=[c].concat(l)}else{ve.error("&#91;AUTH&#93; "+he().noTokenError)}}e.jrpc({url:n,method:s.name,params:l,request:o,response:a,success:i,error:m})}}}});var c=typeof t==="string"?t:"login";f.help=f.help||function(n){if(typeof n==="undefined"){var r=s.procs.map(function(e){return e.name}).join(", ")+", help";ve.echo("Available commands: "+r)}else{var i=false;e.each(l,function(e,r){if(r.name===n){i=true;var o="";o+="[[bu;;]"+r.name+"]";if(r.params){var a=r.params;if(t&&r.name!==c){a=a.slice(1)}o+=" "+a.join(" ")}if(r.help){o+="\n"+r.help}ve.echo(o);return false}});if(!i){if(n==="help"){ve.echo("[[bu;;]help] [method]\ndisplay help "+"for the method or list of methods if not"+" specified")}else{var o="Method `"+n+"' not found ";ve.error(o)}}}};r(f)}else{r(null)}}return e.jrpc({url:n,method:"system.describe",params:[],success:s,request:o,response:a,error:function e(){r(null)}})}function h(n,t,r){r=r||e.noop;var i=e.type(n);var o;var a={};var s=0;var l;if(i==="array"){o={};(function n(r,i){if(r.length){var a=r[0];var f=r.slice(1);var c=e.type(a);if(c==="string"){ve.pause(Me.softPause);if(Me.describe===false){if(++s===1){l=u(a,t)}else{ve.error(he().oneRPCWithIgnore)}n(f,i)}else{d(a,t,function(r){if(r){e.extend(o,r)}else if(++s===1){l=u(a,t)}else{ve.error(he().oneRPCWithIgnore)}ve.resume();n(f,i)})}}else if(c==="function"){if(l){ve.error(he().oneInterpreterFunction)}else{l=a}n(f,i)}else if(c==="object"){e.extend(o,a);n(f,i)}}else{i()}})(n,function(){r({interpreter:p(o,false,t,l.bind(ve)),completion:Object.keys(o)})})}else if(i==="string"){if(Me.ignoreSystemDescribe){o={interpreter:u(n,t)};if(e.isArray(Me.completion)){o.completion=Me.completion}r(o)}else{ve.pause(Me.softPause);d(n,t,function(e){if(e){a.interpreter=p(e,false,t);a.completion=Object.keys(e)}else{a.interpreter=u(n,t)}r(a);ve.resume()})}}else if(i==="object"){r({interpreter:p(n,Me.checkArity),completion:Object.keys(n)})}else{if(i==="undefined"){n=e.noop}else if(i!=="function"){throw new Error(i+" is invalid interpreter value")}r({interpreter:n,completion:Me.completion})}}function v(n,t){var r=e.type(t)==="boolean"?"login":t;return function(t,i,o){ve.pause(Me.softPause);e.jrpc({url:n,method:r,params:[t,i],request:function(e,n){try{Me.request.call(ve,e,n,ve)}catch(e){y(e,"USER")}},response:function(e,n){try{Me.response.call(ve,e,n,ve)}catch(e){y(e,"USER")}},success:function e(n){if(!n.error&&n.result){o(n.result)}else{o(null)}ve.resume()},error:m})}}function y(n,t,r){if(e.isFunction(Me.exceptionHandler)){Me.exceptionHandler.call(ve,n,t)}else{ve.exception(n,t);if(!r){setTimeout(function(){throw n},0)}}}function x(){var e;if(ge.prop){e=ge.prop("scrollHeight")}else{e=ge.attr("scrollHeight")}ge.scrollTop(e)}function T(n,t){try{if(e.isFunction(t)){t.call(ve,e.noop,ve)}else if(typeof t!=="string"){var r=n+" must be string or function";throw r}}catch(e){y(e,n.toUpperCase());return false}return true}var E=[];var C=1;function R(t,r,i){var o,a;E.push(C);if(t===""){}else if(!i.raw){if((J(t)>Le||t.match(/\n/))&&(Me.wrap===true&&i.wrap===n||Me.wrap===false&&i.wrap===true)){var s=i.keepWords;var l=e.terminal.split_equal(t,Le,s);for(o=0,a=l.length;o<a;++o){if(l[o]===""||l[o]==="\r"){E.push("<span></span>")}else{E.push(e.terminal.format(l[o],{linksNoReferrer:Me.linksNoReferrer}))}}}else{t=e.terminal.normalize(t);t=e.terminal.format(t,{linksNoReferrer:Me.linksNoReferrer});t.split(/\n/).forEach(function(e){E.push(e)})}}else{E.push(t)}E.push({finalize:i.finalize,index:r})}function A(n){try{var t=e.extend({exec:true,raw:false,finalize:e.noop},n.options||{});var r;var i=n.string;var o=e.type(i)==="function";if(o){i=i()}if(e.type(i)!=="string"){if(e.isFunction(Me.parseObject)){var a=Me.parseObject(i);if(e.type(a)==="string"){r=a}}else if(i instanceof Array){r=e.terminal.columns(i,ve.cols(),Me.tabs)}else{r=String(i)}}else{r=i}if(r!==""){r=e.map(r.split(B),function(n){if(n&&n.match(B)&&!e.terminal.is_formatting(n)){n=n.replace(/^\[\[|\]\]$/g,"");if(t.exec){if(ye&&ye.command===n){ve.error(he().recursiveCall)}else{e.terminal.extended_command(ve,n)}}return""}else{return n}}).join("");if(r!==""){if(!t.raw){if(Me.convertLinks){r=r.replace(P,"[[!;;]$1]").replace(I,"[[!;;]$1]")}if(t.formatters){try{r=e.terminal.apply_formatters(r)}catch(e){y(e,"FORMATTING")}}r=e.terminal.encode(r)}R(r,n.index,t)}}if(r===""&&o){R(r,n.index,t)}}catch(n){E=[];if(e.isFunction(Me.exceptionHandler)){Me.exceptionHandler.call(ve,n,"TERMINAL")}else{b("[Internal Exception(process_line)]",n)}}}function S(n){n=e.extend({},{update:false,scroll:true},n||{});if(!n.update){Qe.resize(Le);var t=Se.empty().detach()}var r=[];if(Me.outputLimit>=0){var i;if(Me.outputLimit===0){i=ve.rows()}else{i=Me.outputLimit}Ae.forEach(function(n,t){var i=n[0];var o=n[1];if(e.type(i)==="function"){i=i()}if(e.type(i)!=="string"){i=String(i)}r.push({string:i,index:t,options:o})});r=r.slice(r.length-i-1)}else{r=Ae.map(function(e,n){return{string:e[0],index:n,options:e[1]}})}try{E=[];e.each(r,function(e,n){A(n)});if(!n.update){Qe.before(t)}ve.flush(n);try{Me.onAfterRedraw.call(ve)}catch(n){Me.onAfterRedraw=e.noop;y(n,"onAfterRedraw")}}catch(n){if(e.isFunction(Me.exceptionHandler)){Me.exceptionHandler.call(ve,n,"TERMINAL (redraw)")}else{b("[redraw]",n)}}}function F(){if(Me.outputLimit>=0){var n;if(Me.outputLimit===0){n=ve.rows()}else{n=Me.outputLimit}var t=Se.find("> div > div");if(t.length+1>n){var r=t.length-n+1;var i=t.slice(0,r);var o=i.parent();i.remove();o.each(function(){var n=e(this);if(n.is(":empty")){n.remove()}})}}}function L(){if(Me.greetings===n){ve.echo(ve.signature,{finalize:g,formatters:false})}else if(Me.greetings){var e=typeof Me.greetings;if(e==="string"){ve.echo(Me.greetings)}else if(e==="function"){try{Me.greetings.call(ve,ve.echo)}catch(e){Me.greetings=null;y(e,"greetings")}}else{ve.error(he().wrongGreetings)}}}function j(n){if(typeof n==="undefined"){n=ve.get_command()}var t=Qe.prompt();var r=Qe.mask();switch(typeof r){case"string":n=n.replace(/./g,r);break;case"boolean":if(r){n=n.replace(/./g,Me.maskChar)}else{n=e.terminal.escape_formatting(n)}break}var i={finalize:function t(r){g(r.addClass("command"));try{Me.onEchoCommand.call(ve,r,n)}catch(n){Me.onEchoCommand=e.noop;ve.exception(n)}}};if(e.isFunction(t)){var o=t(function(e){ve.echo(e+n,i)});if(o&&o.then){o.then(function(e){if(typeof e==="string"){ve.echo(e+n,i)}})}}else{ve.echo(t+n,i)}}function O(){return on.outerWidth()!==ve.outerWidth()}function N(e){var n=_e.get()[e[0]];if(!n){throw new Error(he().invalidTerminalId)}var t=e[1];if(xe[t]){n.import_view(xe[t])}else{Te=false;var r=e[2];if(r){n.exec(r).done(function(){Te=true;xe[t]=n.export_view()})}}}function $(){if(Te){Ee=false;location.hash="#"+JSON.stringify(ke);setTimeout(function(){Ee=true},100)}}var H=true;var D=[];function q(t,r,i){if(H){H=false;if(Me.historyState||Me.execHash&&i){if(!xe.length){ve.save_state()}else{ve.save_state(null)}}}function o(){if(!i){Te=true;if(Me.historyState){ve.save_state(t,false)}Te=c}f.resolve();if(e.isFunction(Me.onAfterCommand)){Me.onAfterCommand.call(ve,ve,t)}}function a(e){if(typeof e!=="undefined"){l(e)}o();ve.resume()}try{if(e.isFunction(Me.onBeforeCommand)){if(Me.onBeforeCommand.call(ve,ve,t)===false){return}}if(!i){ye=e.terminal.split_command(t)}if(!Z()){if(i&&(e.isFunction(Me.historyFilter)&&Me.historyFilter(t)||t.match(Me.historyFilter))){Qe.history().append(t)}}var s=Ve.top();if(!r&&Me.echoCommand){j(t)}var f=new e.Deferred;var c=Te;if(t.match(/^\s*login\s*$/)&&ve.token(true)){if(ve.level()>1){ve.logout(true)}else{ve.logout()}o()}else if(Me.exit&&t.match(/^\s*exit\s*$/)&&!De){var u=ve.level();if(u===1&&ve.get_token()||u>1){if(ve.get_token(true)){ve.set_token(n,true)}ve.pop()}o()}else if(Me.clear&&t.match(/^\s*clear\s*$/)&&!De){ve.clear();o()}else{var p=s.interpreter.call(ve,t,ve);if(p){ve.pause(Me.softPause);if(p.then){p.then(a)}else{return e.when(p).done(a)}}else if(Ge){D.push(function(){o()})}else{o()}}return f.promise()}catch(e){y(e,"USER");ve.resume()}}function W(){if(e.isFunction(Me.onBeforeLogout)){try{if(Me.onBeforeLogout.call(ve,ve)===false){return}}catch(e){y(e,"onBeforeLogout")}}U();if(e.isFunction(Me.onAfterLogout)){try{Me.onAfterLogout.call(ve,ve)}catch(e){y(e,"onAfterlogout")}}ve.login(fn,true,X)}function U(){var e=ve.prefix_name(true)+"_";Ke.remove(e+"token");Ke.remove(e+"login")}function M(n){var t=ve.prefix_name()+"_interpreters";var r=Ke.get(t);if(r){r=JSON.parse(r)}else{r=[]}if(e.inArray(n,r)===-1){r.push(n);Ke.set(t,JSON.stringify(r))}}function Y(n){var t=Ve.top();var r=ve.prefix_name(true);if(!Z()){M(r)}Qe.name(r);if(e.isFunction(t.prompt)){Qe.prompt(function(e){var n=t.prompt.call(ve,e,ve);if(n&&n.then){n.then(function(n){if(typeof n==="string"){e(n)}})}})}else{Qe.prompt(t.prompt)}if(e.isPlainObject(t.keymap)){Qe.keymap(e.omap(t.keymap,function(e,n){return function(){var e=[].slice.call(arguments);try{return n.apply(ve,e)}catch(e){y(e,"USER KEYMAP")}}}))}Qe.set("");Pe.resolve();if(!n&&e.isFunction(t.onStart)){t.onStart.call(ve,ve)}}function G(){if(Ee&&Me.execHash){try{if(location.hash){var e=location.hash.replace(/^#/,"");ke=JSON.parse(decodeURIComponent(e))}else{ke=[]}if(ke.length){N(ke[ke.length-1])}else if(xe[0]){ve.import_view(xe[0])}}catch(e){y(e,"TERMINAL")}}}function X(){Y();L();if(Ae.length){ve.refresh()}var n=false;if(e.isFunction(Me.onInit)){Be=function(){n=true};try{Me.onInit.call(ve,ve)}catch(e){y(e,"OnInit")}finally{Be=e.noop;if(!n&&ve.enabled()){ve.resume()}}}if(Ce){Ce=false;e(window).on("hashchange",G)}}function Z(){return De||Qe.mask()!==false}function re(e,n,t){if(!n.length){return""}var r=pe(e);var i=[];for(var o=e.length;o<n[0].length;++o){var a=false;var s=n[0].charAt(o),l=s.toLowerCase();for(var f=1;f<n.length;++f){a=true;var c=n[f].charAt(o),u=c.toLowerCase();if(s!==c){if(t||r==="mixed"){a=false;break}else if(l===u){if(r==="lower"){s=s.toLowerCase()}else if(r==="upper"){s=s.toUpperCase()}else{a=false;break}}else{a=false;break}}}if(a){i.push(s)}else{break}}return e+i.join("")}function oe(e){_e.forEach(function(n){n.settings().onTerminalChange.call(n,e)})}function ae(t){var r,i=Ve.top();if(e.isFunction(i.keydown)){r=i.keydown.call(ve,t,ve);if(r!==n){return r}}else if(e.isFunction(Me.keydown)){r=Me.keydown.call(ve,t,ve);if(r!==n){return r}}}var se={"CTRL+D":function(n,t){if(!De){if(Qe.get()===""){if(Ve.size()>1||e.isFunction(fn)){ve.pop("")}else{ve.resume();ve.echo("")}}else{t()}}return false},"CTRL+C":function(){if(Q()===""){j(ve.get_command()+"^C");ve.set_command("")}},"CTRL+L":function(){ve.clear()},TAB:function(t,r){var i=Ve.top(),o,a;if(typeof i.caseSensitiveAutocomplete!=="undefined"){a=i.caseSensitiveAutocomplete}else{a=Me.caseSensitiveAutocomplete}if(Me.completion&&e.type(Me.completion)!=="boolean"&&i.completion===n){o=Me.completion}else{o=i.completion}if(o==="settings"){o=Me.completion}if(o){switch(e.type(o)){case"function":var s=ve.before_cursor(Me.wordAutocomplete);if(o.length===3){var l=new Error(he().comletionParameters);y(l,"USER");return false}o.call(ve,s,function(e){ve.complete(e,{echo:true,word:Me.wordAutocomplete,escape:Me.completionEscape,caseSensitive:a})});break;case"array":ve.complete(o,{echo:true,word:Me.wordAutocomplete,escape:Me.completionEscape,caseSensitive:a});break;default:throw new Error(he().invalidCompletion)}}else{r()}return false},"CTRL+V":function(e,n){n(e);ve.oneTime(200,function(){x()});return true},"CTRL+TAB":function(){if(_e.length()>1){ve.focus(false);return false}},PAGEDOWN:function(){ve.scroll(ve.height())},PAGEUP:function(){ve.scroll(-ve.height())}};function ue(t){var r,i;if(ve.enabled()){if(!ve.paused()){r=ae(t);if(r!==n){return r}if(t.which!==9){Re=0}ve.attr({scrollTop:ve.attr("scrollHeight")})}else{if(!Me.pauseEvents){r=ae(t);if(r!==n){return r}}if(t.which===68&&t.ctrlKey){if(Me.pauseEvents){r=ae(t);if(r!==n){return r}}if(we.length){for(i=we.length;i--;){var o=we[i];if(o.readyState!==4){try{o.abort()}catch(n){if(e.isFunction(Me.exceptionHandler)){Me.exceptionHandler.call(ve,t,"AJAX ABORT")}else{ve.error(he().ajaxAbortError)}}}}we=[]}ve.resume()}return false}}}function de(e){return function(n){e.add(n)}}function he(){return e.extend({},e.terminal.defaults.strings,Me&&Me.strings||{})}var ve=this;if(this.length>1){return this.each(function(){e.fn.terminal.call(e(this),r,e.extend({name:ve.selector},o))})}if(ve.data("terminal")){return ve.data("terminal")}if(ve.length===0){throw new Error(sprintf(he().invalidSelector,ve.selector))}var ge;var ye;var Re=0;var Ae=[];var Se;var Fe=_e.length();var Le;var je;var Oe;var ze=new k;var Ie=new t;var Pe=new t;var Ne=de(Pe);var $e=le(ve);var He=de(Ie);var De=false;var Be=e.noop;var qe,We;var Ue=[];var Me=e.extend({},e.terminal.defaults,{name:ve.selector},o||{});var Ke=new a(Me.memory);var Je=Me.enabled,Ye=false;var Ge=false;var Xe=true;var Ve;var Qe;var Ze;var en;var nn;e.extend(ve,e.omap({id:function(){return Fe},clear:function(){Se.html("");Ae=[];try{Me.onClear.call(ve,ve)}catch(e){y(e,"onClear")}ve.attr({scrollTop:0});return ve},export_view:function(){var n={};if(e.isFunction(Me.onExport)){try{n=Me.onExport.call(ve)}catch(e){y(e,"onExport")}}return e.extend({},{focus:Je,mask:Qe.mask(),prompt:ve.get_prompt(),command:ve.get_command(),position:Qe.position(),lines:i(Ae),interpreters:Ve.clone(),history:Qe.history().data},n)},import_view:function(n){if(De){throw new Error(sprintf(he().notWhileLogin,"import_view"))}if(e.isFunction(Me.onImport)){try{Me.onImport.call(ve,n)}catch(n){Me.onImport=e.noop;y(n,"onImport")}}Ne(function e(){ve.set_prompt(n.prompt);ve.set_command(n.command);Qe.position(n.position);Qe.mask(n.mask);if(n.focus){ve.focus()}Ae=i(n.lines);Ve=n.interpreters;if(Me.importHistory){Qe.history().set(n.history)}S()});return ve},save_state:function(t,r,i){if(typeof i!=="undefined"){xe[i]=ve.export_view()}else{xe.push(ve.export_view())}if(!e.isArray(ke)){ke=[]}if(t!==n&&!r){var o=[Fe,xe.length-1,t];ke.push(o);$()}},exec:function(n,t,r){var i=r||new e.Deferred;He(function r(){if(e.isArray(n)){(function e(){var r=n.shift();if(r){ve.exec(r,t).done(e)}else{i.resolve()}})()}else if(Ge){Ue.push([n,t,i])}else{q(n,t,true).done(function(){i.resolve(ve)})}});return i.promise()},autologin:function(e,n,t){ve.trigger("terminal.autologin",[e,n,t]);return ve},login:function(t,r,i,o){ze.push([].slice.call(arguments));if(De){throw new Error(sprintf(he().notWhileLogin,"login"))}if(!e.isFunction(t)){throw new Error(he().loginIsNotAFunction)}De=true;if(ve.token()&&ve.level()===1&&!Xe){De=false;ve.logout(true)}else if(ve.token(true)&&ve.login_name(true)){De=false;if(e.isFunction(i)){i()}return ve}if(Me.history){Qe.history().disable()}var a=ve.level();function s(t,s,l){if(s){while(ve.level()>a){ve.pop(n,true)}if(Me.history){Qe.history().enable()}var f=ve.prefix_name(true)+"_";Ke.set(f+"token",s);Ke.set(f+"login",t);De=false;if(e.isFunction(i)){i()}}else{if(r){if(!l){ve.error(he().wrongPasswordTryAgain)}ve.pop(n,true).set_mask(false)}else{De=false;if(!l){ve.error(he().wrongPassword)}ve.pop(n,true).pop(n,true)}if(e.isFunction(o)){o()}}ve.off("terminal.autologin")}ve.on("terminal.autologin",function(e,n,t,r){s(n,t,r)});ve.push(function(e){ve.set_mask(Me.maskChar).push(function(n){try{t.call(ve,e,n,function(n,t){s(e,n,t)})}catch(e){y(e,"AUTH")}},{prompt:he().password+": ",name:"password"})},{prompt:he().login+": ",name:"login"});return ve},settings:function(){return Me},before_cursor:function(e){var n=Qe.position();var t=Qe.get().substring(0,n);var r=t.split(" ");var i;if(e){if(r.length===1){i=r[0]}else{var o=t.match(/(\\?")/g);var a=o?o.filter(function(e){return!e.match(/^\\/)}).length:0;o=t.match(/'/g);var s=o?o.length:0;if(s%2===1){i=t.match(/('[^']*)$/)[0]}else if(a%2===1){i=t.match(/("(?:[^"]|\\")*)$/)[0]}else{i=r[r.length-1];for(sn=r.length-1;sn>0;sn--){var l=r[sn-1];if(l[l.length-1]==="\\"){i=r[sn-1]+" "+i}else{break}}}}}else{i=t}return i},complete:function(n,t){t=e.extend({word:true,echo:false,escape:true,caseSensitive:true},t||{});var r=t.caseSensitive;var i=ve.before_cursor(t.word).replace(/\\"/g,'"');var o=false;if(t.word){if(i.match(/^"/)){o='"'}else if(i.match(/^'/)){o="'"}if(o){i=i.replace(/^["']/,"")}}n=n.slice();if(Me.clear&&e.inArray("clear",n)===-1){n.push("clear")}if(Me.exit&&e.inArray("exit",n)===-1){n.push("exit")}if(Re%2===0){Oe=ve.before_cursor(t.word)}else{var a=ve.before_cursor(t.word);if(a!==Oe){return}}var s=e.terminal.escape_regex(i);if(t.escape){s=s.replace(/(\\+)(["'() ])/g,function(e,n,t){if(t.match(/[()]/)){return n+"\\?\\"+t}else{return n+"?"+t}})}function l(){var e=[];for(var a=n.length;a--;){if(c.test(n[a])){var s=n[a];if(o==='"'){s=s.replace(/"/g,'\\"')}if(!o&&t.escape){s=s.replace(/(["'() ])/g,"\\$1")}if(!r&&me(s)){if(i.toLowerCase()===i){s=s.toLowerCase()}else if(i.toUpperCase()===i){s=s.toUpperCase()}}e.push(s)}}return e}var f=r?"":"i";var c=new RegExp("^"+s,f);var u=l();function p(e,n){var t=ve.get_command();var r=ve.get_position();var i=new RegExp("^"+e,"i");var a=t.substring(0,r);var s=t.substring(r);var l=n.replace(i,"")+(o||"");ve.set_command(a+l+s);ve.set_position((a+l).length)}if(u.length===1){if(t.escape){p(s,u[0])}else{ve.insert(u[0].replace(c,"")+(o||""))}Oe=ve.before_cursor(t.word);return true}else if(u.length>1){if(++Re>=2){Re=0;if(t.echo){j();var m=u.reverse().join("\t");ve.echo(e.terminal.escape_brackets(m),{keepWords:true,formatters:false});return true}}else{var d=re(i,u,r);if(d){p(i,d);Oe=ve.before_cursor(t.word);return true}}}},commands:function(){return Ve.top().interpreter},set_interpreter:function(n,t){function r(){ve.pause(Me.softPause);h(n,t,function(n){ve.resume();var t=Ve.top();e.extend(t,n);Y(true)})}if(e.type(n)==="string"&&t){ve.login(v(n,t),true,r)}else{r()}return ve},greetings:function(){L();return ve},paused:function(){return Ge},pause:function(n){He(function t(){Be();Ge=true;Qe.disable(n||K);if(!n){Qe.find(".prompt").hidden()}if(e.isFunction(Me.onPause)){Me.onPause.call(ve)}});return ve},resume:function(){He(function n(){Ge=false;if(Je&&_e.front()===ve){Qe.enable()}Qe.find(".prompt").visible();var t=Ue;Ue=[];for(var r=0;r<t.length;++r){ve.exec.apply(ve,t[r])}ve.trigger("resume");var i=D.shift();if(i){i()}x();if(e.isFunction(Me.onResume)){Me.onResume.call(ve)}});return ve},cols:function(){if(Me.numChars){return Me.numChars}if(typeof Le==="undefined"){Le=fe(ve,$e)}return Le},rows:function(){if(Me.numRows){return Me.numRows}if(typeof je==="undefined"){je=ce(ve,$e)}return je},history:function(){return Qe.history()},history_state:function(e){function n(){Me.historyState=true;if(!xe.length){ve.save_state()}else if(_e.length()>1){ve.save_state(null)}}if(e){if(typeof window.setImmediate==="undefined"){setTimeout(n,0)}else{setImmediate(n)}}else{Me.historyState=false}return ve},clear_history_state:function(){ke=[];xe=[];return ve},next:function(){if(_e.length()===1){return ve}else{_e.front().disable();var n=_e.rotate().enable();var t=n.offset().top-50;e("html,body").animate({scrollTop:t},500);try{oe(n)}catch(e){y(e,"onTerminalChange")}return n}},focus:function(e,n){He(function t(){if(_e.length()===1){if(e===false){ve.disable(n)}else{ve.enable(n)}}else if(e===false){ve.next()}else{var r=_e.front();if(r!==ve){_e.forEach(function(e){if(e!==ve&&e.enabled()){e.disable(n)}});if(!n){try{oe(ve)}catch(e){y(e,"onTerminalChange")}}}_e.set(ve);ve.enable(n)}});return ve},freeze:function(e){Ne(function n(){if(e){ve.disable();Ye=true}else{Ye=false;ve.enable()}})},frozen:function(){return Ye},enable:function(t){if(!Je&&!Ye){if(Le===n){ve.resize()}He(function r(){var i;if(!t&&!Je){try{i=Me.onFocus.call(ve,ve)}catch(n){Me.onFocus=e.noop;y(n,"onFocus")}}if(!t&&i===n||t){Je=true;if(!ve.paused()){Qe.enable()}}})}return ve},disable:function(t){He(function r(){var i;if(!t&&Je){try{i=Me.onBlur.call(ve,ve)}catch(n){Me.onBlur=e.noop;y(n,"onBlur")}}if(!t&&i===n||t){Je=false;Qe.disable()}});return ve},enabled:function(){return Je},signature:function(){var e=ve.cols();for(var n=be.length;n--;){var t=be[n].map(function(e){return e.length});if(Math.max.apply(null,t)<=e){return be[n].join("\n")+"\n"}}return""},version:function(){return e.terminal.version},cmd:function(){return Qe},get_command:function(){return Qe.get()},set_command:function(e,t){Ne(function r(){Qe.set(e,n,t)});return ve},set_position:function(e,n){Ne(function t(){Qe.position(e,n)});return ve},get_position:function(){return Qe.position()},insert:function(e,n){if(typeof e==="string"){Ne(function t(){var r=ve.is_bottom();Qe.insert(e,n);if(Me.scrollOnEcho||r){x()}});return ve}else{throw new Error(sprintf(he().notAString,"insert"))}},set_prompt:function(n){Ne(function t(){if(T("prompt",n)){if(e.isFunction(n)){Qe.prompt(function(e){n(e,ve)})}else{Qe.prompt(n)}Ve.top().prompt=n}});return ve},get_prompt:function(){return Ve.top().prompt},set_mask:function(e){Ne(function n(){Qe.mask(e===true?Me.maskChar:e)});return ve},get_output:function(n){if(n){return Ae}else{return e.map(Ae,function(n){return e.isFunction(n[0])?n[0]():n[0]}).join("\n")}},resize:function(n,t){if(!ve.is(":visible")){ve.stopTime("resize");ve.oneTime(500,"resize",function(){ve.resize(n,t)})}else{if(n&&t){ve.width(n);ve.height(t)}n=ve.width();t=ve.height();if(typeof Me.numChars!=="undefined"||typeof Me.numRows!=="undefined"){Qe.resize(Me.numChars);ve.refresh();return}var r=fe(ve,$e);var i=ce(ve,$e);if(r!==Le||i!==je){Le=r;je=i;Qe.resize(Le);ve.refresh();var o=Ve.top();if(e.isFunction(o.resize)){o.resize.call(ve,ve)}else if(e.isFunction(Me.onResize)){Me.onResize.call(ve,ve)}}}return ve},refresh:function(){if($e.width!==0){ve[0].style.setProperty("--char-width",$e.width)}S({scroll:false,update:true});return ve},flush:function(n){n=e.extend({},{update:false,scroll:true},n||{});try{var t=ve.is_bottom();var r;e.each(E,function(t,i){if(i===C){r=e("<div></div>")}else if(e.isPlainObject(i)&&e.isFunction(i.finalize)){if(n.update){var o="> div[data-index="+i.index+"]";var a=Se.find(o);if(a.html()!==r.html()){a.replaceWith(r)}}else{r.appendTo(Se)}i.finalize(r.attr("data-index",i.index))}else{e("<div/>").html(i).appendTo(r).width("100%")}});F();try{Me.onFlush.call(ve,ve)}catch(n){Me.onFlush=e.noop;y(n,"onFlush")}if(Me.scrollOnEcho&&n.scroll||t){x()}E=[]}catch(n){if(e.isFunction(Me.exceptionHandler)){Me.exceptionHandler.call(ve,n,"TERMINAL (Flush)")}else{b("[Flush]",n)}}return ve},update:function(e,n,t){Ne(function r(){if(e<0){e=Ae.length+e}if(!Ae[e]){ve.error("Invalid line number "+e)}else if(n===null){Ae.splice(e,1);Se.find("[data-index="+e+"]").remove()}else{Ae[e][0]=n;if(t){Ae[e][1]=t}A({string:n,index:e,options:t});ve.flush({scroll:false,update:true})}});return ve},remove:function(e,n){return ve.update(e,null,n)},last_index:function(){return Ae.length-1},echo:function(n,t){function r(n){try{var r=e.extend({flush:true,raw:Me.raw,finalize:e.noop,keepWords:false,formatters:true},t||{});(function(n){r.finalize=function(t){if(r.raw){t.addClass("raw")}try{if(e.isFunction(n)){n(t)}}catch(e){y(e,"USER:echo(finalize)");n=null}}})(r.finalize);if(r.flush){if(E.length){ve.flush()}E=[]}if(typeof n==="function"){n=n.bind(ve)}A({string:n,options:r,index:Ae.length});Ae.push([n,e.extend(r,{exec:false})]);if(r.flush){ve.flush()}}catch(n){if(e.isFunction(Me.exceptionHandler)){Me.exceptionHandler.call(ve,n,"TERMINAL (echo)")}else{b("[Terminal.echo]",n)}}}if(e.isFunction(n.then)){e.when(n).done(r)}else{r(n)}return ve},error:function(n,t){t=e.extend({},t,{raw:false,formatters:false});function r(n){if(typeof n!=="string"){n=String(n)}var t=e.terminal.escape_brackets(n).replace(/\\$/,"&#92;").replace(z,"]$1[[;;;error]");return"[[;;;error]"+t+"]"}if(typeof n==="function"){return ve.echo(function(){return r(n.call(ve))},t)}return ve.echo(r(n),t)},exception:function(n,t){var r=_(n);if(t){r="&#91;"+t+"&#93;: "+r}if(r){ve.error(r,{finalize:function(e){e.addClass("exception message")},keepWords:true})}if(typeof n.fileName==="string"){ve.pause(Me.softPause);e.get(n.fileName,function(e){var t=n.lineNumber-1;var r=e.split("\n")[t];if(r){ve.error("["+n.lineNumber+"]: "+r)}ve.resume()},"text")}if(n.stack){var i=e.terminal.escape_brackets(n.stack);ve.echo(i.split(/\n/g).map(function(e){return"[[;;;error]"+e.replace(z,function(e){return"]"+e+"[[;;;error]"})+"]"}).join("\n"),{finalize:function(e){e.addClass("exception stack-trace")},formatters:false})}},scroll:function(e){var n;e=Math.round(e);if(ge.prop){if(e>ge.prop("scrollTop")&&e>0){ge.prop("scrollTop",0)}n=ge.prop("scrollTop");ge.scrollTop(n+e)}else{if(e>ge.attr("scrollTop")&&e>0){ge.attr("scrollTop",0)}n=ge.attr("scrollTop");ge.scrollTop(n+e)}return ve},logout:function(e){if(De){throw new Error(sprintf(he().notWhileLogin,"logout"))}Ne(function t(){if(e){var r=ze.pop();ve.set_token(n,true);ve.login.apply(ve,r)}else if(Ve.size()===1&&ve.token()){ve.logout(true)}else{while(Ve.size()>1){if(ve.token()){ve.logout(true).pop().pop()}else{ve.pop()}}}});return ve},token:function(e){return Ke.get(ve.prefix_name(e)+"_token")},set_token:function(e,n){var t=ve.prefix_name(n)+"_token";if(typeof e==="undefined"){Ke.remove(t,e)}else{Ke.set(t,e)}return ve},get_token:function(e){return ve.token(e)},login_name:function(e){return Ke.get(ve.prefix_name(e)+"_login")},name:function(){return Ve.top().name},prefix_name:function(e){var n=(Me.name?Me.name+"_":"")+Fe;if(e&&Ve.size()>1){var t=Ve.map(function(e){return e.name||""}).slice(1).join("_");if(t){n+="_"+t}}return n},read:function(n,t){var r=new e.Deferred;ve.push(function(n){ve.pop();if(e.isFunction(t)){t(n)}r.resolve(n)},{prompt:n});return r.promise()},push:function(t,r){He(function i(){r=r||{};var o={infiniteLogin:false};var a=e.extend({},o,r);if(!a.name&&ye){a.name=ye.name}if(a.prompt===n){a.prompt=(a.name||">")+" "}var s=Ve.top();if(s){s.mask=Qe.mask()}var l=Ge;function f(){Me.onPush.call(ve,s,Ve.top(),ve);Y()}h(t,r.login,function(n){Ve.push(e.extend({},n,a));if(a.completion===true){if(e.isArray(n.completion)){Ve.top().completion=n.completion}else if(!n.completion){Ve.top().completion=false}}if(a.login){var r;var i=e.type(a.login);if(i==="function"){r=a.infiniteLogin?e.noop:ve.pop;ve.login(a.login,a.infiniteLogin,f,r)}else if(e.type(t)==="string"&&i==="string"||i==="boolean"){r=a.infiniteLogin?e.noop:ve.pop;ve.login(v(t,a.login),a.infiniteLogin,f,r)}}else{f()}if(!l&&ve.enabled()){ve.resume()}})});return ve},pop:function(t,r){if(t!==n){j(t)}var i=ve.token(true);var o;if(Ve.size()===1){o=Ve.top();if(Me.login){if(!r){Me.onPop.call(ve,o,null,ve)}W();if(e.isFunction(Me.onExit)){try{Me.onExit.call(ve,ve)}catch(n){Me.onExit=e.noop;y(n,"onExit")}}}else{ve.error(he().canExitError)}}else{if(i){U()}var a=Ve.pop();o=Ve.top();Y();if(!r){Me.onPop.call(ve,a,o)}if(De&&ve.get_prompt()!==he().login+": "){De=false}if(e.isFunction(a.onExit)){try{a.onExit.call(ve,ve)}catch(n){a.onExit=e.noop;y(n,"onExit")}}ve.set_mask(o.mask)}return ve},option:function(n,t){if(typeof t==="undefined"){if(typeof n==="string"){return Me[n]}else if(typeof n==="object"){e.each(n,function(e,n){Me[e]=n})}}else{Me[n]=t;if(n.match(/^num(Chars|Rows)$/)){S()}}return ve},level:function(){return Ve.size()},reset:function(){Ne(function e(){ve.clear();while(Ve.size()>1){Ve.pop()}X()});return ve},purge:function(){Ne(function n(){var t=ve.prefix_name()+"_";var r=Ke.get(t+"interpreters");if(r){e.each(JSON.parse(r),function(e,n){Ke.remove(n+"_commands");Ke.remove(n+"_token");Ke.remove(n+"_login")})}Qe.purge();Ke.remove(t+"interpreters")});return ve},destroy:function(){Ne(function n(){Qe.destroy().remove();Se.remove();tn.remove();e(document).unbind(".terminal_"+ve.id());e(window).unbind(".terminal_"+ve.id());ve.unbind("click wheel mousewheel mousedown mouseup");ve.removeData("terminal").removeClass("terminal").unbind(".terminal");if(Me.width){ve.css("width","")}if(Me.height){ve.css("height","")}e(window).off("blur",un).off("focus",cn);ve.find(".terminal-fill").remove();ve.stopTime();_e.remove(Fe);if(en){en.unobserve(ve[0])}if(nn){nn.disconnect()}ve.resizer("unbind");rn.resizer("unbind").remove();if(!_e.length()){e(window).off("hashchange")}});return ve},scroll_to_bottom:function(){x();return ve},is_bottom:function(){if(Me.scrollBottomOffset===-1){return false}else{var n,t,r;if(ve.is("body")){n=e(document).height();t=e(window).scrollTop();r=window.innerHeight}else{n=ge[0].scrollHeight;t=ge.scrollTop();r=ge.outerHeight()}var i=n-Me.scrollBottomOffset;return t+r>i}}},function(e,n){return function(){try{return n.apply(ve,[].slice.apply(arguments))}catch(n){if(e!=="exec"&&e!=="resume"){y(n,"TERMINAL",true)}if(!Me.exceptionHandler){throw n}}}}));if(Me.ignoreSystemDescribe===true){Me.describe=false}if(Me.width){ve.width(Me.width)}if(Me.height){ve.height(Me.height)}ge=ve.scroll_element();e(document).bind("ajaxSend.terminal_"+ve.id(),function(e,n){we.push(n)});var tn=e('<div class="terminal-wrapper"/>').appendTo(ve);var rn=e('<div class="font"/>').appendTo(ve);var on=e('<div class="terminal-fill"/>').appendTo(ve);Se=e("<div>").addClass("terminal-output").attr("role","log").appendTo(tn);ve.addClass("terminal");if(Me.login&&e.isFunction(Me.onBeforeLogin)){try{if(Me.onBeforeLogin.call(ve,ve)===false){Xe=false}}catch(n){Me.onBeforeLogin=e.noop;y(n,"onBeforeLogin")}}var an;if(typeof r==="string"){an=r}else if(r instanceof Array){for(var sn=0,ln=r.length;sn<ln;++sn){if(typeof r[sn]==="string"){an=r[sn];break}}}var fn;if(e.isFunction(Me.login)){fn=Me.login}else if(an&&(typeof Me.login==="string"||Me.login===true)){fn=v(an,Me.login)}_e.append(ve);function cn(){if(Ze){ve.focus()}}function un(){Ze=Je;ve.disable().find("textarea").trigger("blur",[true])}function pn(e){e=e.originalEvent;function n(e,n){return e.type.indexOf(n)!==-1}if(e.clipboardData){if(ve.enabled()){var t=e.clipboardData.items;if(t){for(var r=0;r<t.length;r++){if(n(t[r],"image")&&Me.pasteImage){var i=t[r].getAsFile();var o=window.URL||window.webkitURL;var a=o.createObjectURL(i);ve.echo('<img src="'+a+'"/>',{raw:true})}else if(n(t[r],"text/plain")){t[r].getAsString(ve.insert)}}}else if(e.clipboardData.getData){var s=e.clipboardData.getData("text/plain");ve.insert(s)}return false}}}e(document).on("paste.terminal_"+ve.id(),pn);h(r,Me.login,function(t){if(Me.completion&&typeof Me.completion!=="boolean"||!Me.completion){t.completion="settings"}var r=e.extend({},se,e.omap(Me.keymap||{},function(e,n){if(!se[e]){return n.bind(ve)}return function(t,r){return n.call(ve,t,function(){return se[e](t,r)})}}));Ve=new k(e.extend({},Me.extra,{name:Me.name,prompt:Me.prompt,keypress:Me.keypress,keydown:Me.keydown,resize:Me.onResize,greetings:Me.greetings,mousewheel:Me.mousewheel,keymap:r},t));Qe=e("<div/>").appendTo(tn).cmd({prompt:Me.prompt,history:Me.memory?"memory":Me.history,historyFilter:Me.historyFilter,historySize:Me.historySize,width:"100%",enabled:false,keydown:ue,keymap:r,clickTimeout:Me.clickTimeout,keypress:function(n){var t=Ve.top();if(Je&&(!Ge||!Me.pauseEvents)){if(e.isFunction(t.keypress)){return t.keypress.call(ve,n,ve)}else if(e.isFunction(Me.keypress)){return Me.keypress.call(ve,n,ve)}}},onCommandChange:function(n){if(e.isFunction(Me.onCommandChange)){try{Me.onCommandChange.call(ve,n,ve)}catch(n){Me.onCommandChange=e.noop;y(n,"onCommandChange")}}x()},commands:q});function i(n){n=n.originalEvent;if(n){var t=document.elementFromPoint(n.clientX,n.clientY);if(!e(t).closest(".terminal").length&&ve.enabled()){ve.disable()}}}ve.oneTime(100,function(){e(document).bind("click.terminal_"+ve.id(),i).bind("contextmenu.terminal_"+ve.id(),i)});var o=e(window);document.addEventListener("resume",function(){ve.disable()});if(V){ve.click(function(){if(!Ye){if(!ve.enabled()){ve.focus();Qe.enable()}else{ve.disable()}}})}else{o.on("focus.terminal_"+ve.id(),cn).on("blur.terminal_"+ve.id(),un);(function(){var n=0;var t;var r="click_"+ve.id();function i(){if(t.is(".terminal")||t.is(".terminal-wrapper")){var e=ve.get_command().length;ve.set_position(e)}else if(t.closest(".prompt").length){ve.set_position(0)}o()}function o(){n=0;t=null}ve.mousedown(function(n){if(!w(n,on)){t=e(n.target)}}).mouseup(function(){if(Q()===""&&t){if(++n===1){if(!Ye){if(!Je){ve.focus()}else{var e=Me.clickTimeout;ve.oneTime(e,r,i);return}}}else{ve.stopTime(r)}}o()}).dblclick(function(){o();ve.stopTime(r)})})();(function(){var n=ve.find("textarea");ve.on("contextmenu.terminal",function(t){if(Q()===""){if(!e(t.target).is("img,value,audio,object,canvas,a")){if(!ve.enabled()){ve.enable()}var r=Qe.offset();n.css({left:t.pageX-r.left-20,top:t.pageY-r.top-20,width:"5em",height:"4em"});if(!n.is(":focus")){n.focus()}ve.stopTime("textarea");ve.oneTime(100,"textarea",function(){n.css({left:"",top:"",width:"",height:""})});ve.stopTime("selection");ve.everyTime(20,"selection",function(){if(n[0].selection!==n[0].value){if(ee(n[0])){ne(n[0]);te(ve.find(".terminal-output")[0],ve.find(".cmd div:last-of-type")[0]);ve.stopTime("selection")}}})}}})})()}ve.delegate(".exception a","click",function(n){var t=e(this).attr("href");if(t.match(/:[0-9]+$/)){n.preventDefault();f(t)}});if(ve.is(":visible")){Le=ve.cols();Qe.resize(Le);if(!$e){$e=le(ve)}je=ce(ve,$e)}function a(){if(ve.is(":visible")){var e=ve.width();var n=ve.height();if(We!==n||qe!==e){ve.resize()}We=n;qe=e}}function s(){ve.resizer("unbind").resizer(a);rn.resizer("unbind").resizer(function(){$e=le(ve);ve.resize()})}if(ve.is(":visible")){s()}function l(){if(en){en.unobserve(ve[0])}var n=ve.enabled();var t=ve.is(":visible");if(t){s()}en=new IntersectionObserver(function(){if(ve.is(":visible")&&!t){t=true;s();$e=le(ve);a();if(n){ve.enable()}}else if(t&&!ve.is(":visible")){t=false;n=e.terminal.active()===ve&&ve.enabled();ve.disable()}},{root:document.body});en.observe(ve[0])}var c=!!ve.closest("body").length;var u=window.MutationObserver||window.WebKitMutationObserver;if(window.IntersectionObserver){if(u){nn=new u(function(){if(ve.closest("body").length){if(!c){ve.scroll_to_bottom();l()}c=true}else if(c){c=false}});nn.observe(document.body,{childList:true})}if(c){l()}}Ie.resolve();if(Je&&ve.is(":visible")&&!V){ve.focus(n,true)}else{ve.disable()}if(e.isFunction(fn)){ve.login(fn,true,X)}else{X()}function p(n){var t=_e.get()[n[0]];if(t&&Fe===t.id()){if(n[2]){try{if(Ge){var r=e.Deferred();D.push(function(){return t.exec(n[2]).done(function(){t.save_state(n[2],true,n[1]);r.resolve()})});return r.promise()}else{return t.exec(n[2]).done(function(){t.save_state(n[2],true,n[1])})}}catch(n){var i=t.settings();if(e.isFunction(i.exceptionHandler)){i.exceptionHandler.call(ve,n,"EXEC HASH")}else{var o=e.terminal.escape_brackets(Oe);var a="Error while exec with command "+o;t.error(a).exception(n)}}}}}if(Me.execHash){if(location.hash){setTimeout(function(){try{var e=location.hash.replace(/^#/,"");ke=JSON.parse(decodeURIComponent(e));var n=0;(function e(){var t=ke[n++];if(t){p(t).done(e)}else{Te=true}})()}catch(e){}})}else{Te=true}}else{Te=true}var m=false;e(document).bind("keydown.terminal_"+ve.id(),function(e){if(e.shiftKey){m=true}}).bind("keyup.terminal_"+ve.id(),function(e){if(e.shiftKey||e.which===16){m=false}});function d(n,t){if(!m){var r=Ve.top();var i;if(e.isFunction(r.mousewheel)){i=r.mousewheel(n,t,ve)}else if(e.isFunction(Me.mousewheel)){i=Me.mousewheel(n,t,ve)}if(O()||i===false){n.preventDefault()}if(i===false){return}if(t>0){ve.scroll(-40)}else{ve.scroll(40)}}}if(e.event.special.mousewheel){ve.on("mousewheel",d)}else{var h;var v=document.createElement("div");if("onwheel"in v){h="wheel"}else if(document.onmousewheel!==n){h="mousewheel"}else{h="DOMMouseScroll"}v=null;ve.on(h,function(e){var n;if(h==="mousewheel"){n=-1/40*e.originalEvent.wheelDelta}else{n=e.originalEvent.deltaY||e.originalEvent.detail}d(e,-n)})}});ve.data("terminal",ve);return ve}});
\ No newline at end of file
diff --git a/src/main/resources/static/js/unix_formatting.js b/src/main/resources/static/js/unix_formatting.js
index 0f6bbfa..da0ead3 100644
--- a/src/main/resources/static/js/unix_formatting.js
+++ b/src/main/resources/static/js/unix_formatting.js
@@ -9,10 +9,11 @@
  *
  * This is example of how to create custom formatter for jQuery Terminal
  *
- * Copyright (c) 2014-2016 Jakub Jankiewicz <http://jcubic.pl>
+ * Copyright (c) 2014-2018 Jakub Jankiewicz <http://jcubic.pl/me>
  * Released under the MIT license
  *
  */
+/* global jQuery */
 (function($) {
     if (!$.terminal) {
         throw new Error('$.terminal is not defined');
@@ -20,11 +21,11 @@
     // ---------------------------------------------------------------------
     // :: Replace overtyping (from man) formatting with terminal formatting
     // ---------------------------------------------------------------------
-    $.terminal.overtyping = function(string) {
-        return string.replace(/((?:_\x08.|.\x08_)+)/g, function(full, g) {
+    $.terminal.overtyping = function overtyping(string) {
+        return string.replace(/((?:_\x08.|.\x08_)+)/g, function(full) {
             var striped = full.replace(/_x08|\x08_|_\u0008|\u0008_/g, '');
             return '[[u;;]' + striped + ']';
-        }).replace(/((?:.\x08.)+)/g, function(full, g) {
+        }).replace(/((?:.\x08.)+)/g, function(full) {
             return '[[b;#fff;]' + full.replace(/(.)(?:\x08|\u0008)\1/g,
                                                function(full, g) {
                                                    return g;
@@ -153,7 +154,47 @@
             var _8bit_background = false;
             var process_8bit = false;
             var palette = $.terminal.ansi_colors.palette;
-            for(var i in controls) {
+            function set_styles(num) {
+                switch (num) {
+                    case 1:
+                        styles.push('b');
+                        bold = true;
+                        faited = false;
+                        break;
+                    case 4:
+                        styles.push('u');
+                        break;
+                    case 3:
+                        styles.push('i');
+                        break;
+                    case 5:
+                        process_8bit = true;
+                        break;
+                    case 38:
+                        _8bit_color = true;
+                        break;
+                    case 48:
+                        _8bit_background = true;
+                        break;
+                    case 2:
+                        faited = true;
+                        bold = false;
+                        break;
+                    case 7:
+                        reverse = true;
+                        break;
+                    default:
+                        if (controls.indexOf('5') === -1) {
+                            if (color_list[num]) {
+                                output_color = color_list[num];
+                            }
+                            if (background_list[num]) {
+                                output_background = background_list[num];
+                            }
+                        }
+                }
+            }
+            for (var i in controls) {
                 if (controls.hasOwnProperty(i)) {
                     num = parseInt(controls[i], 10);
                     if (process_8bit && (_8bit_background || _8bit_color)) {
@@ -164,44 +205,7 @@
                             output_background = palette[num];
                         }
                     } else {
-                        switch(num) {
-                        case 1:
-                            styles.push('b');
-                            bold = true;
-                            faited = false;
-                            break;
-                        case 4:
-                            styles.push('u');
-                            break;
-                        case 3:
-                            styles.push('i');
-                            break;
-                        case 5:
-                            process_8bit = true;
-                            break;
-                        case 38:
-                            _8bit_color = true;
-                            break;
-                        case 48:
-                            _8bit_background = true;
-                            break;
-                        case 2:
-                            faited = true;
-                            bold = false;
-                            break;
-                        case 7:
-                            reverse = true;
-                            break;
-                        default:
-                            if (controls.indexOf('5') == -1) {
-                                if (color_list[num]) {
-                                    output_color = color_list[num];
-                                }
-                                if (background_list[num]) {
-                                    output_background = background_list[num];
-                                }
-                            }
-                        }
+                        set_styles(num);
                     }
                 }
             }
@@ -225,68 +229,67 @@
             }
             if (_8bit_color) {
                 color = output_color;
-            } else if (output_color == 'inherit') {
+            } else if (output_color === 'inherit') {
                 color = output_color;
             } else {
                 color = colors[output_color];
             }
             if (_8bit_background) {
                 background = output_background;
-            } else if (output_background == 'transparent') {
+            } else if (output_background === 'transparent') {
                 background = output_background;
             } else {
                 background = backgrounds[output_background];
             }
             return [styles.join(''), color, background];
         }
-        return function(input) {
+        return function from_ansi(input) {
             //merge multiple codes
             /*input = input.replace(/((?:\x1B\[[0-9;]*[A-Za-z])*)/g, function(group) {
-                return group.replace(/m\x1B\[/g, ';');
-            });*/
+              return group.replace(/m\x1B\[/g, ';');
+              });*/
             var splitted = input.split(/(\x1B\[[0-9;]*[A-Za-z])/g);
-            if (splitted.length == 1) {
+            if (splitted.length === 1) {
                 return input;
             }
             var output = [];
             //skip closing at the begining
             if (splitted.length > 3) {
-                var str = splitted.slice(0,3).join('');
+                var str = splitted.slice(0, 3).join('');
                 if (str.match(/^\[0*m$/)) {
                     splitted = splitted.slice(3);
                 }
             }
-            var next, prev_color, prev_background, code, match;
+            var prev_color, prev_background, code, match;
             var inside = false;
-            for (var i=0; i<splitted.length; ++i) {
+            for (var i = 0; i < splitted.length; ++i) {
                 match = splitted[i].match(/^\x1B\[([0-9;]*)([A-Za-z])$/);
                 if (match) {
                     switch (match[2]) {
-                    case 'm':
-                        if (+match[1] !== 0) {
-                            code = format_ansi(match[1]);
-                        }
-                        if (inside) {
-                            output.push(']');
-                            if (+match[1] === 0) {
-                                //just closing
-                                inside = false;
-                                prev_color = prev_background = '';
-                            } else {
-                                // someone forget to close - move to next
-                                code[1] = code[1] || prev_color;
-                                code[2] = code[2] || prev_background;
-                                output.push('[[' + code.join(';') + ']');
-                                // store colors to next use
-                                if (code[1]) {
-                                    prev_color = code[1];
-                                }
-                                if (code[2]) {
-                                    prev_background = code[2];
-                                }
-                            }
-                        } else {
+                        case 'm':
                             if (+match[1] !== 0) {
+                                code = format_ansi(match[1]);
+                            }
+                            if (inside) {
+                                output.push(']');
+                                if (+match[1] === 0) {
+                                    //just closing
+                                    inside = false;
+                                    prev_color = prev_background = '';
+                                } else {
+                                    // someone forget to close - move to next
+                                    code[1] = code[1] || prev_color;
+                                    code[2] = code[2] || prev_background;
+                                    output.push('[[' + code.join(';') + ']');
+                                    // store colors to next use
+                                    if (code[1]) {
+                                        prev_color = code[1];
+                                    }
+                                    if (code[2]) {
+                                        prev_background = code[2];
+                                    }
+                                }
+                            } else if (+match[1] !== 0) {
                                 inside = true;
                                 code[1] = code[1] || prev_color;
                                 code[2] = code[2] || prev_background;
@@ -299,8 +302,7 @@
                                     prev_background = code[2];
                                 }
                             }
-                        }
-                        break;
+                            break;
                     }
                 } else {
                     output.push(splitted[i]);
@@ -312,6 +314,6 @@
             return output.join(''); //.replace(/\[\[[^\]]+\]\]/g, '');
         };
     })();
-    $.terminal.defaults.formatters.push($.terminal.overtyping);
-    $.terminal.defaults.formatters.push($.terminal.from_ansi);
+    $.terminal.defaults.formatters.unshift($.terminal.overtyping);
+    $.terminal.defaults.formatters.unshift($.terminal.from_ansi);
 })(jQuery);
diff --git a/src/main/resources/templates/serverconsole.ftl b/src/main/resources/templates/serverconsole.ftl
index 1311e31..6b1f68b 100644
--- a/src/main/resources/templates/serverconsole.ftl
+++ b/src/main/resources/templates/serverconsole.ftl
@@ -44,7 +44,12 @@
             }, {
                 clear: false,
                 exit: false,
-                history: false,
+                history: true,
+                convertLinks: true,
+                echoCommand: false,
+                outputLimit: 10000,
+                scrollOnEcho: true,
+                wrap: false,
                 name: 'console_${server.ID?js_string}',
                 greetings: 'Server console for ${server.ID?js_string}.'
             });
@@ -68,7 +73,7 @@
                 }
                 else
                 {
-                    term.echo(temp.data);
+                    term.echo(temp.data).resume();
                 }
             };
         });