diff --git a/.yarn/releases/yarn-1.22.10.js b/.yarn/releases/yarn-1.22.10.js
new file mode 100755
index 0000000..6418ae5
--- /dev/null
+++ b/.yarn/releases/yarn-1.22.10.js
@@ -0,0 +1,147392 @@
+#!/usr/bin/env node
+module.exports =
+/******/ (function(modules) { // webpackBootstrap
+/******/ // The module cache
+/******/ var installedModules = {};
+/******/
+/******/ // The require function
+/******/ function __webpack_require__(moduleId) {
+/******/
+/******/ // Check if module is in cache
+/******/ if(installedModules[moduleId]) {
+/******/ return installedModules[moduleId].exports;
+/******/ }
+/******/ // Create a new module (and put it into the cache)
+/******/ var module = installedModules[moduleId] = {
+/******/ i: moduleId,
+/******/ l: false,
+/******/ exports: {}
+/******/ };
+/******/
+/******/ // Execute the module function
+/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+/******/
+/******/ // Flag the module as loaded
+/******/ module.l = true;
+/******/
+/******/ // Return the exports of the module
+/******/ return module.exports;
+/******/ }
+/******/
+/******/
+/******/ // expose the modules object (__webpack_modules__)
+/******/ __webpack_require__.m = modules;
+/******/
+/******/ // expose the module cache
+/******/ __webpack_require__.c = installedModules;
+/******/
+/******/ // identity function for calling harmony imports with the correct context
+/******/ __webpack_require__.i = function(value) { return value; };
+/******/
+/******/ // define getter function for harmony exports
+/******/ __webpack_require__.d = function(exports, name, getter) {
+/******/ if(!__webpack_require__.o(exports, name)) {
+/******/ Object.defineProperty(exports, name, {
+/******/ configurable: false,
+/******/ enumerable: true,
+/******/ get: getter
+/******/ });
+/******/ }
+/******/ };
+/******/
+/******/ // getDefaultExport function for compatibility with non-harmony modules
+/******/ __webpack_require__.n = function(module) {
+/******/ var getter = module && module.__esModule ?
+/******/ function getDefault() { return module['default']; } :
+/******/ function getModuleExports() { return module; };
+/******/ __webpack_require__.d(getter, 'a', getter);
+/******/ return getter;
+/******/ };
+/******/
+/******/ // Object.prototype.hasOwnProperty.call
+/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
+/******/
+/******/ // __webpack_public_path__
+/******/ __webpack_require__.p = "";
+/******/
+/******/ // Load entry module and return exports
+/******/ return __webpack_require__(__webpack_require__.s = 549);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports) {
+
+module.exports = require("path");
+
+/***/ }),
+/* 1 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (immutable) */ __webpack_exports__["a"] = __extends;
+/* unused harmony export __assign */
+/* unused harmony export __rest */
+/* unused harmony export __decorate */
+/* unused harmony export __param */
+/* unused harmony export __metadata */
+/* unused harmony export __awaiter */
+/* unused harmony export __generator */
+/* unused harmony export __exportStar */
+/* unused harmony export __values */
+/* unused harmony export __read */
+/* unused harmony export __spread */
+/* unused harmony export __await */
+/* unused harmony export __asyncGenerator */
+/* unused harmony export __asyncDelegator */
+/* unused harmony export __asyncValues */
+/* unused harmony export __makeTemplateObject */
+/* unused harmony export __importStar */
+/* unused harmony export __importDefault */
+/*! *****************************************************************************
+Copyright (c) Microsoft Corporation. All rights reserved.
+Licensed under the Apache License, Version 2.0 (the "License"); you may not use
+this file except in compliance with the License. You may obtain a copy of the
+License at http://www.apache.org/licenses/LICENSE-2.0
+
+THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED
+WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE,
+MERCHANTABLITY OR NON-INFRINGEMENT.
+
+See the Apache Version 2.0 License for specific language governing permissions
+and limitations under the License.
+***************************************************************************** */
+/* global Reflect, Promise */
+
+var extendStatics = function(d, b) {
+ extendStatics = Object.setPrototypeOf ||
+ ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
+ function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
+ return extendStatics(d, b);
+};
+
+function __extends(d, b) {
+ extendStatics(d, b);
+ function __() { this.constructor = d; }
+ d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
+}
+
+var __assign = function() {
+ __assign = Object.assign || function __assign(t) {
+ for (var s, i = 1, n = arguments.length; i < n; i++) {
+ s = arguments[i];
+ for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
+ }
+ return t;
+ }
+ return __assign.apply(this, arguments);
+}
+
+function __rest(s, e) {
+ var t = {};
+ for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
+ t[p] = s[p];
+ if (s != null && typeof Object.getOwnPropertySymbols === "function")
+ for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0)
+ t[p[i]] = s[p[i]];
+ return t;
+}
+
+function __decorate(decorators, target, key, desc) {
+ var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
+ if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
+ else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
+ return c > 3 && r && Object.defineProperty(target, key, r), r;
+}
+
+function __param(paramIndex, decorator) {
+ return function (target, key) { decorator(target, key, paramIndex); }
+}
+
+function __metadata(metadataKey, metadataValue) {
+ if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
+}
+
+function __awaiter(thisArg, _arguments, P, generator) {
+ return new (P || (P = Promise))(function (resolve, reject) {
+ function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
+ function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
+ function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); }
+ step((generator = generator.apply(thisArg, _arguments || [])).next());
+ });
+}
+
+function __generator(thisArg, body) {
+ var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
+ return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
+ function verb(n) { return function (v) { return step([n, v]); }; }
+ function step(op) {
+ if (f) throw new TypeError("Generator is already executing.");
+ while (_) try {
+ if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
+ if (y = 0, t) op = [op[0] & 2, t.value];
+ switch (op[0]) {
+ case 0: case 1: t = op; break;
+ case 4: _.label++; return { value: op[1], done: false };
+ case 5: _.label++; y = op[1]; op = [0]; continue;
+ case 7: op = _.ops.pop(); _.trys.pop(); continue;
+ default:
+ if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
+ if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
+ if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
+ if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
+ if (t[2]) _.ops.pop();
+ _.trys.pop(); continue;
+ }
+ op = body.call(thisArg, _);
+ } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
+ if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
+ }
+}
+
+function __exportStar(m, exports) {
+ for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p];
+}
+
+function __values(o) {
+ var m = typeof Symbol === "function" && o[Symbol.iterator], i = 0;
+ if (m) return m.call(o);
+ return {
+ next: function () {
+ if (o && i >= o.length) o = void 0;
+ return { value: o && o[i++], done: !o };
+ }
+ };
+}
+
+function __read(o, n) {
+ var m = typeof Symbol === "function" && o[Symbol.iterator];
+ if (!m) return o;
+ var i = m.call(o), r, ar = [], e;
+ try {
+ while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
+ }
+ catch (error) { e = { error: error }; }
+ finally {
+ try {
+ if (r && !r.done && (m = i["return"])) m.call(i);
+ }
+ finally { if (e) throw e.error; }
+ }
+ return ar;
+}
+
+function __spread() {
+ for (var ar = [], i = 0; i < arguments.length; i++)
+ ar = ar.concat(__read(arguments[i]));
+ return ar;
+}
+
+function __await(v) {
+ return this instanceof __await ? (this.v = v, this) : new __await(v);
+}
+
+function __asyncGenerator(thisArg, _arguments, generator) {
+ if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+ var g = generator.apply(thisArg, _arguments || []), i, q = [];
+ return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
+ function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
+ function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
+ function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
+ function fulfill(value) { resume("next", value); }
+ function reject(value) { resume("throw", value); }
+ function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
+}
+
+function __asyncDelegator(o) {
+ var i, p;
+ return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
+ function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
+}
+
+function __asyncValues(o) {
+ if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+ var m = o[Symbol.asyncIterator], i;
+ return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
+ function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
+ function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
+}
+
+function __makeTemplateObject(cooked, raw) {
+ if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
+ return cooked;
+};
+
+function __importStar(mod) {
+ if (mod && mod.__esModule) return mod;
+ var result = {};
+ if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];
+ result.default = mod;
+ return result;
+}
+
+function __importDefault(mod) {
+ return (mod && mod.__esModule) ? mod : { default: mod };
+}
+
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+exports.__esModule = true;
+
+var _promise = __webpack_require__(227);
+
+var _promise2 = _interopRequireDefault(_promise);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+exports.default = function (fn) {
+ return function () {
+ var gen = fn.apply(this, arguments);
+ return new _promise2.default(function (resolve, reject) {
+ function step(key, arg) {
+ try {
+ var info = gen[key](arg);
+ var value = info.value;
+ } catch (error) {
+ reject(error);
+ return;
+ }
+
+ if (info.done) {
+ resolve(value);
+ } else {
+ return _promise2.default.resolve(value).then(function (value) {
+ step("next", value);
+ }, function (err) {
+ step("throw", err);
+ });
+ }
+ }
+
+ return step("next");
+ });
+ };
+};
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports) {
+
+module.exports = require("util");
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.unlink = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.open = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined;
+
+var _asyncToGenerator2;
+
+function _load_asyncToGenerator() {
+ return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2));
+}
+
+let buildActionsForCopy = (() => {
+ var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) {
+
+ //
+ let build = (() => {
+ var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
+ const src = data.src,
+ dest = data.dest,
+ type = data.type;
+
+ const onFresh = data.onFresh || noop;
+ const onDone = data.onDone || noop;
+
+ // TODO https://github.com/yarnpkg/yarn/issues/3751
+ // related to bundled dependencies handling
+ if (files.has(dest.toLowerCase())) {
+ reporter.verbose(`The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`);
+ } else {
+ files.add(dest.toLowerCase());
+ }
+
+ if (type === 'symlink') {
+ yield mkdirp((_path || _load_path()).default.dirname(dest));
+ onFresh();
+ actions.symlink.push({
+ dest,
+ linkname: src
+ });
+ onDone();
+ return;
+ }
+
+ if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) {
+ // ignored file
+ return;
+ }
+
+ const srcStat = yield lstat(src);
+ let srcFiles;
+
+ if (srcStat.isDirectory()) {
+ srcFiles = yield readdir(src);
+ }
+
+ let destStat;
+ try {
+ // try accessing the destination
+ destStat = yield lstat(dest);
+ } catch (e) {
+ // proceed if destination doesn't exist, otherwise error
+ if (e.code !== 'ENOENT') {
+ throw e;
+ }
+ }
+
+ // if destination exists
+ if (destStat) {
+ const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink();
+ const bothFolders = srcStat.isDirectory() && destStat.isDirectory();
+ const bothFiles = srcStat.isFile() && destStat.isFile();
+
+ // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving
+ // us modes that aren't valid. investigate this, it's generally safe to proceed.
+
+ /* if (srcStat.mode !== destStat.mode) {
+ try {
+ await access(dest, srcStat.mode);
+ } catch (err) {}
+ } */
+
+ if (bothFiles && artifactFiles.has(dest)) {
+ // this file gets changed during build, likely by a custom install script. Don't bother checking it.
+ onDone();
+ reporter.verbose(reporter.lang('verboseFileSkipArtifact', src));
+ return;
+ }
+
+ if (bothFiles && srcStat.size === destStat.size && (0, (_fsNormalized || _load_fsNormalized()).fileDatesEqual)(srcStat.mtime, destStat.mtime)) {
+ // we can safely assume this is the same file
+ onDone();
+ reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.size, +srcStat.mtime));
+ return;
+ }
+
+ if (bothSymlinks) {
+ const srcReallink = yield readlink(src);
+ if (srcReallink === (yield readlink(dest))) {
+ // if both symlinks are the same then we can continue on
+ onDone();
+ reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink));
+ return;
+ }
+ }
+
+ if (bothFolders) {
+ // mark files that aren't in this folder as possibly extraneous
+ const destFiles = yield readdir(dest);
+ invariant(srcFiles, 'src files not initialised');
+
+ for (var _iterator4 = destFiles, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) {
+ var _ref6;
+
+ if (_isArray4) {
+ if (_i4 >= _iterator4.length) break;
+ _ref6 = _iterator4[_i4++];
+ } else {
+ _i4 = _iterator4.next();
+ if (_i4.done) break;
+ _ref6 = _i4.value;
+ }
+
+ const file = _ref6;
+
+ if (srcFiles.indexOf(file) < 0) {
+ const loc = (_path || _load_path()).default.join(dest, file);
+ possibleExtraneous.add(loc);
+
+ if ((yield lstat(loc)).isDirectory()) {
+ for (var _iterator5 = yield readdir(loc), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) {
+ var _ref7;
+
+ if (_isArray5) {
+ if (_i5 >= _iterator5.length) break;
+ _ref7 = _iterator5[_i5++];
+ } else {
+ _i5 = _iterator5.next();
+ if (_i5.done) break;
+ _ref7 = _i5.value;
+ }
+
+ const file = _ref7;
+
+ possibleExtraneous.add((_path || _load_path()).default.join(loc, file));
+ }
+ }
+ }
+ }
+ }
+ }
+
+ if (destStat && destStat.isSymbolicLink()) {
+ yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest);
+ destStat = null;
+ }
+
+ if (srcStat.isSymbolicLink()) {
+ onFresh();
+ const linkname = yield readlink(src);
+ actions.symlink.push({
+ dest,
+ linkname
+ });
+ onDone();
+ } else if (srcStat.isDirectory()) {
+ if (!destStat) {
+ reporter.verbose(reporter.lang('verboseFileFolder', dest));
+ yield mkdirp(dest);
+ }
+
+ const destParts = dest.split((_path || _load_path()).default.sep);
+ while (destParts.length) {
+ files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase());
+ destParts.pop();
+ }
+
+ // push all files to queue
+ invariant(srcFiles, 'src files not initialised');
+ let remaining = srcFiles.length;
+ if (!remaining) {
+ onDone();
+ }
+ for (var _iterator6 = srcFiles, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) {
+ var _ref8;
+
+ if (_isArray6) {
+ if (_i6 >= _iterator6.length) break;
+ _ref8 = _iterator6[_i6++];
+ } else {
+ _i6 = _iterator6.next();
+ if (_i6.done) break;
+ _ref8 = _i6.value;
+ }
+
+ const file = _ref8;
+
+ queue.push({
+ dest: (_path || _load_path()).default.join(dest, file),
+ onFresh,
+ onDone: function (_onDone) {
+ function onDone() {
+ return _onDone.apply(this, arguments);
+ }
+
+ onDone.toString = function () {
+ return _onDone.toString();
+ };
+
+ return onDone;
+ }(function () {
+ if (--remaining === 0) {
+ onDone();
+ }
+ }),
+ src: (_path || _load_path()).default.join(src, file)
+ });
+ }
+ } else if (srcStat.isFile()) {
+ onFresh();
+ actions.file.push({
+ src,
+ dest,
+ atime: srcStat.atime,
+ mtime: srcStat.mtime,
+ mode: srcStat.mode
+ });
+ onDone();
+ } else {
+ throw new Error(`unsure how to copy this: ${src}`);
+ }
+ });
+
+ return function build(_x5) {
+ return _ref5.apply(this, arguments);
+ };
+ })();
+
+ const artifactFiles = new Set(events.artifactFiles || []);
+ const files = new Set();
+
+ // initialise events
+ for (var _iterator = queue, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+ var _ref2;
+
+ if (_isArray) {
+ if (_i >= _iterator.length) break;
+ _ref2 = _iterator[_i++];
+ } else {
+ _i = _iterator.next();
+ if (_i.done) break;
+ _ref2 = _i.value;
+ }
+
+ const item = _ref2;
+
+ const onDone = item.onDone;
+ item.onDone = function () {
+ events.onProgress(item.dest);
+ if (onDone) {
+ onDone();
+ }
+ };
+ }
+ events.onStart(queue.length);
+
+ // start building actions
+ const actions = {
+ file: [],
+ symlink: [],
+ link: []
+ };
+
+ // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items
+ // at a time due to the requirement to push items onto the queue
+ while (queue.length) {
+ const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS);
+ yield Promise.all(items.map(build));
+ }
+
+ // simulate the existence of some files to prevent considering them extraneous
+ for (var _iterator2 = artifactFiles, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+ var _ref3;
+
+ if (_isArray2) {
+ if (_i2 >= _iterator2.length) break;
+ _ref3 = _iterator2[_i2++];
+ } else {
+ _i2 = _iterator2.next();
+ if (_i2.done) break;
+ _ref3 = _i2.value;
+ }
+
+ const file = _ref3;
+
+ if (possibleExtraneous.has(file)) {
+ reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file));
+ possibleExtraneous.delete(file);
+ }
+ }
+
+ for (var _iterator3 = possibleExtraneous, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) {
+ var _ref4;
+
+ if (_isArray3) {
+ if (_i3 >= _iterator3.length) break;
+ _ref4 = _iterator3[_i3++];
+ } else {
+ _i3 = _iterator3.next();
+ if (_i3.done) break;
+ _ref4 = _i3.value;
+ }
+
+ const loc = _ref4;
+
+ if (files.has(loc.toLowerCase())) {
+ possibleExtraneous.delete(loc);
+ }
+ }
+
+ return actions;
+ });
+
+ return function buildActionsForCopy(_x, _x2, _x3, _x4) {
+ return _ref.apply(this, arguments);
+ };
+})();
+
+let buildActionsForHardlink = (() => {
+ var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) {
+
+ //
+ let build = (() => {
+ var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
+ const src = data.src,
+ dest = data.dest;
+
+ const onFresh = data.onFresh || noop;
+ const onDone = data.onDone || noop;
+ if (files.has(dest.toLowerCase())) {
+ // Fixes issue https://github.com/yarnpkg/yarn/issues/2734
+ // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1,
+ // package-linker passes that modules A1 and B1 need to be hardlinked,
+ // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case
+ // an exception.
+ onDone();
+ return;
+ }
+ files.add(dest.toLowerCase());
+
+ if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) {
+ // ignored file
+ return;
+ }
+
+ const srcStat = yield lstat(src);
+ let srcFiles;
+
+ if (srcStat.isDirectory()) {
+ srcFiles = yield readdir(src);
+ }
+
+ const destExists = yield exists(dest);
+ if (destExists) {
+ const destStat = yield lstat(dest);
+
+ const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink();
+ const bothFolders = srcStat.isDirectory() && destStat.isDirectory();
+ const bothFiles = srcStat.isFile() && destStat.isFile();
+
+ if (srcStat.mode !== destStat.mode) {
+ try {
+ yield access(dest, srcStat.mode);
+ } catch (err) {
+ // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving
+ // us modes that aren't valid. investigate this, it's generally safe to proceed.
+ reporter.verbose(err);
+ }
+ }
+
+ if (bothFiles && artifactFiles.has(dest)) {
+ // this file gets changed during build, likely by a custom install script. Don't bother checking it.
+ onDone();
+ reporter.verbose(reporter.lang('verboseFileSkipArtifact', src));
+ return;
+ }
+
+ // correct hardlink
+ if (bothFiles && srcStat.ino !== null && srcStat.ino === destStat.ino) {
+ onDone();
+ reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.ino));
+ return;
+ }
+
+ if (bothSymlinks) {
+ const srcReallink = yield readlink(src);
+ if (srcReallink === (yield readlink(dest))) {
+ // if both symlinks are the same then we can continue on
+ onDone();
+ reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink));
+ return;
+ }
+ }
+
+ if (bothFolders) {
+ // mark files that aren't in this folder as possibly extraneous
+ const destFiles = yield readdir(dest);
+ invariant(srcFiles, 'src files not initialised');
+
+ for (var _iterator10 = destFiles, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) {
+ var _ref14;
+
+ if (_isArray10) {
+ if (_i10 >= _iterator10.length) break;
+ _ref14 = _iterator10[_i10++];
+ } else {
+ _i10 = _iterator10.next();
+ if (_i10.done) break;
+ _ref14 = _i10.value;
+ }
+
+ const file = _ref14;
+
+ if (srcFiles.indexOf(file) < 0) {
+ const loc = (_path || _load_path()).default.join(dest, file);
+ possibleExtraneous.add(loc);
+
+ if ((yield lstat(loc)).isDirectory()) {
+ for (var _iterator11 = yield readdir(loc), _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) {
+ var _ref15;
+
+ if (_isArray11) {
+ if (_i11 >= _iterator11.length) break;
+ _ref15 = _iterator11[_i11++];
+ } else {
+ _i11 = _iterator11.next();
+ if (_i11.done) break;
+ _ref15 = _i11.value;
+ }
+
+ const file = _ref15;
+
+ possibleExtraneous.add((_path || _load_path()).default.join(loc, file));
+ }
+ }
+ }
+ }
+ }
+ }
+
+ if (srcStat.isSymbolicLink()) {
+ onFresh();
+ const linkname = yield readlink(src);
+ actions.symlink.push({
+ dest,
+ linkname
+ });
+ onDone();
+ } else if (srcStat.isDirectory()) {
+ reporter.verbose(reporter.lang('verboseFileFolder', dest));
+ yield mkdirp(dest);
+
+ const destParts = dest.split((_path || _load_path()).default.sep);
+ while (destParts.length) {
+ files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase());
+ destParts.pop();
+ }
+
+ // push all files to queue
+ invariant(srcFiles, 'src files not initialised');
+ let remaining = srcFiles.length;
+ if (!remaining) {
+ onDone();
+ }
+ for (var _iterator12 = srcFiles, _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) {
+ var _ref16;
+
+ if (_isArray12) {
+ if (_i12 >= _iterator12.length) break;
+ _ref16 = _iterator12[_i12++];
+ } else {
+ _i12 = _iterator12.next();
+ if (_i12.done) break;
+ _ref16 = _i12.value;
+ }
+
+ const file = _ref16;
+
+ queue.push({
+ onFresh,
+ src: (_path || _load_path()).default.join(src, file),
+ dest: (_path || _load_path()).default.join(dest, file),
+ onDone: function (_onDone2) {
+ function onDone() {
+ return _onDone2.apply(this, arguments);
+ }
+
+ onDone.toString = function () {
+ return _onDone2.toString();
+ };
+
+ return onDone;
+ }(function () {
+ if (--remaining === 0) {
+ onDone();
+ }
+ })
+ });
+ }
+ } else if (srcStat.isFile()) {
+ onFresh();
+ actions.link.push({
+ src,
+ dest,
+ removeDest: destExists
+ });
+ onDone();
+ } else {
+ throw new Error(`unsure how to copy this: ${src}`);
+ }
+ });
+
+ return function build(_x10) {
+ return _ref13.apply(this, arguments);
+ };
+ })();
+
+ const artifactFiles = new Set(events.artifactFiles || []);
+ const files = new Set();
+
+ // initialise events
+ for (var _iterator7 = queue, _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) {
+ var _ref10;
+
+ if (_isArray7) {
+ if (_i7 >= _iterator7.length) break;
+ _ref10 = _iterator7[_i7++];
+ } else {
+ _i7 = _iterator7.next();
+ if (_i7.done) break;
+ _ref10 = _i7.value;
+ }
+
+ const item = _ref10;
+
+ const onDone = item.onDone || noop;
+ item.onDone = function () {
+ events.onProgress(item.dest);
+ onDone();
+ };
+ }
+ events.onStart(queue.length);
+
+ // start building actions
+ const actions = {
+ file: [],
+ symlink: [],
+ link: []
+ };
+
+ // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items
+ // at a time due to the requirement to push items onto the queue
+ while (queue.length) {
+ const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS);
+ yield Promise.all(items.map(build));
+ }
+
+ // simulate the existence of some files to prevent considering them extraneous
+ for (var _iterator8 = artifactFiles, _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) {
+ var _ref11;
+
+ if (_isArray8) {
+ if (_i8 >= _iterator8.length) break;
+ _ref11 = _iterator8[_i8++];
+ } else {
+ _i8 = _iterator8.next();
+ if (_i8.done) break;
+ _ref11 = _i8.value;
+ }
+
+ const file = _ref11;
+
+ if (possibleExtraneous.has(file)) {
+ reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file));
+ possibleExtraneous.delete(file);
+ }
+ }
+
+ for (var _iterator9 = possibleExtraneous, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) {
+ var _ref12;
+
+ if (_isArray9) {
+ if (_i9 >= _iterator9.length) break;
+ _ref12 = _iterator9[_i9++];
+ } else {
+ _i9 = _iterator9.next();
+ if (_i9.done) break;
+ _ref12 = _i9.value;
+ }
+
+ const loc = _ref12;
+
+ if (files.has(loc.toLowerCase())) {
+ possibleExtraneous.delete(loc);
+ }
+ }
+
+ return actions;
+ });
+
+ return function buildActionsForHardlink(_x6, _x7, _x8, _x9) {
+ return _ref9.apply(this, arguments);
+ };
+})();
+
+let copyBulk = exports.copyBulk = (() => {
+ var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) {
+ const events = {
+ onStart: _events && _events.onStart || noop,
+ onProgress: _events && _events.onProgress || noop,
+ possibleExtraneous: _events ? _events.possibleExtraneous : new Set(),
+ ignoreBasenames: _events && _events.ignoreBasenames || [],
+ artifactFiles: _events && _events.artifactFiles || []
+ };
+
+ const actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter);
+ events.onStart(actions.file.length + actions.symlink.length + actions.link.length);
+
+ const fileActions = actions.file;
+
+ const currentlyWriting = new Map();
+
+ yield (_promise || _load_promise()).queue(fileActions, (() => {
+ var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
+ let writePromise;
+ while (writePromise = currentlyWriting.get(data.dest)) {
+ yield writePromise;
+ }
+
+ reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest));
+ const copier = (0, (_fsNormalized || _load_fsNormalized()).copyFile)(data, function () {
+ return currentlyWriting.delete(data.dest);
+ });
+ currentlyWriting.set(data.dest, copier);
+ events.onProgress(data.dest);
+ return copier;
+ });
+
+ return function (_x14) {
+ return _ref18.apply(this, arguments);
+ };
+ })(), CONCURRENT_QUEUE_ITEMS);
+
+ // we need to copy symlinks last as they could reference files we were copying
+ const symlinkActions = actions.symlink;
+ yield (_promise || _load_promise()).queue(symlinkActions, function (data) {
+ const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname);
+ reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname));
+ return symlink(linkname, data.dest);
+ });
+ });
+
+ return function copyBulk(_x11, _x12, _x13) {
+ return _ref17.apply(this, arguments);
+ };
+})();
+
+let hardlinkBulk = exports.hardlinkBulk = (() => {
+ var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) {
+ const events = {
+ onStart: _events && _events.onStart || noop,
+ onProgress: _events && _events.onProgress || noop,
+ possibleExtraneous: _events ? _events.possibleExtraneous : new Set(),
+ artifactFiles: _events && _events.artifactFiles || [],
+ ignoreBasenames: []
+ };
+
+ const actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter);
+ events.onStart(actions.file.length + actions.symlink.length + actions.link.length);
+
+ const fileActions = actions.link;
+
+ yield (_promise || _load_promise()).queue(fileActions, (() => {
+ var _ref20 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
+ reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest));
+ if (data.removeDest) {
+ yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(data.dest);
+ }
+ yield link(data.src, data.dest);
+ });
+
+ return function (_x18) {
+ return _ref20.apply(this, arguments);
+ };
+ })(), CONCURRENT_QUEUE_ITEMS);
+
+ // we need to copy symlinks last as they could reference files we were copying
+ const symlinkActions = actions.symlink;
+ yield (_promise || _load_promise()).queue(symlinkActions, function (data) {
+ const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname);
+ reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname));
+ return symlink(linkname, data.dest);
+ });
+ });
+
+ return function hardlinkBulk(_x15, _x16, _x17) {
+ return _ref19.apply(this, arguments);
+ };
+})();
+
+let readFileAny = exports.readFileAny = (() => {
+ var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) {
+ for (var _iterator13 = files, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) {
+ var _ref22;
+
+ if (_isArray13) {
+ if (_i13 >= _iterator13.length) break;
+ _ref22 = _iterator13[_i13++];
+ } else {
+ _i13 = _iterator13.next();
+ if (_i13.done) break;
+ _ref22 = _i13.value;
+ }
+
+ const file = _ref22;
+
+ if (yield exists(file)) {
+ return readFile(file);
+ }
+ }
+ return null;
+ });
+
+ return function readFileAny(_x19) {
+ return _ref21.apply(this, arguments);
+ };
+})();
+
+let readJson = exports.readJson = (() => {
+ var _ref23 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) {
+ return (yield readJsonAndFile(loc)).object;
+ });
+
+ return function readJson(_x20) {
+ return _ref23.apply(this, arguments);
+ };
+})();
+
+let readJsonAndFile = exports.readJsonAndFile = (() => {
+ var _ref24 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) {
+ const file = yield readFile(loc);
+ try {
+ return {
+ object: (0, (_map || _load_map()).default)(JSON.parse(stripBOM(file))),
+ content: file
+ };
+ } catch (err) {
+ err.message = `${loc}: ${err.message}`;
+ throw err;
+ }
+ });
+
+ return function readJsonAndFile(_x21) {
+ return _ref24.apply(this, arguments);
+ };
+})();
+
+let find = exports.find = (() => {
+ var _ref25 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) {
+ const parts = dir.split((_path || _load_path()).default.sep);
+
+ while (parts.length) {
+ const loc = parts.concat(filename).join((_path || _load_path()).default.sep);
+
+ if (yield exists(loc)) {
+ return loc;
+ } else {
+ parts.pop();
+ }
+ }
+
+ return false;
+ });
+
+ return function find(_x22, _x23) {
+ return _ref25.apply(this, arguments);
+ };
+})();
+
+let symlink = exports.symlink = (() => {
+ var _ref26 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) {
+ if (process.platform !== 'win32') {
+ // use relative paths otherwise which will be retained if the directory is moved
+ src = (_path || _load_path()).default.relative((_path || _load_path()).default.dirname(dest), src);
+ // When path.relative returns an empty string for the current directory, we should instead use
+ // '.', which is a valid fs.symlink target.
+ src = src || '.';
+ }
+
+ try {
+ const stats = yield lstat(dest);
+ if (stats.isSymbolicLink()) {
+ const resolved = dest;
+ if (resolved === src) {
+ return;
+ }
+ }
+ } catch (err) {
+ if (err.code !== 'ENOENT') {
+ throw err;
+ }
+ }
+
+ // We use rimraf for unlink which never throws an ENOENT on missing target
+ yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest);
+
+ if (process.platform === 'win32') {
+ // use directory junctions if possible on win32, this requires absolute paths
+ yield fsSymlink(src, dest, 'junction');
+ } else {
+ yield fsSymlink(src, dest);
+ }
+ });
+
+ return function symlink(_x24, _x25) {
+ return _ref26.apply(this, arguments);
+ };
+})();
+
+let walk = exports.walk = (() => {
+ var _ref27 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir, ignoreBasenames = new Set()) {
+ let files = [];
+
+ let filenames = yield readdir(dir);
+ if (ignoreBasenames.size) {
+ filenames = filenames.filter(function (name) {
+ return !ignoreBasenames.has(name);
+ });
+ }
+
+ for (var _iterator14 = filenames, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) {
+ var _ref28;
+
+ if (_isArray14) {
+ if (_i14 >= _iterator14.length) break;
+ _ref28 = _iterator14[_i14++];
+ } else {
+ _i14 = _iterator14.next();
+ if (_i14.done) break;
+ _ref28 = _i14.value;
+ }
+
+ const name = _ref28;
+
+ const relative = relativeDir ? (_path || _load_path()).default.join(relativeDir, name) : name;
+ const loc = (_path || _load_path()).default.join(dir, name);
+ const stat = yield lstat(loc);
+
+ files.push({
+ relative,
+ basename: name,
+ absolute: loc,
+ mtime: +stat.mtime
+ });
+
+ if (stat.isDirectory()) {
+ files = files.concat((yield walk(loc, relative, ignoreBasenames)));
+ }
+ }
+
+ return files;
+ });
+
+ return function walk(_x26, _x27) {
+ return _ref27.apply(this, arguments);
+ };
+})();
+
+let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => {
+ var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) {
+ const stat = yield lstat(loc);
+ const size = stat.size,
+ blockSize = stat.blksize;
+
+
+ return Math.ceil(size / blockSize) * blockSize;
+ });
+
+ return function getFileSizeOnDisk(_x28) {
+ return _ref29.apply(this, arguments);
+ };
+})();
+
+let getEolFromFile = (() => {
+ var _ref30 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) {
+ if (!(yield exists(path))) {
+ return undefined;
+ }
+
+ const buffer = yield readFileBuffer(path);
+
+ for (let i = 0; i < buffer.length; ++i) {
+ if (buffer[i] === cr) {
+ return '\r\n';
+ }
+ if (buffer[i] === lf) {
+ return '\n';
+ }
+ }
+ return undefined;
+ });
+
+ return function getEolFromFile(_x29) {
+ return _ref30.apply(this, arguments);
+ };
+})();
+
+let writeFilePreservingEol = exports.writeFilePreservingEol = (() => {
+ var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) {
+ const eol = (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL;
+ if (eol !== '\n') {
+ data = data.replace(/\n/g, eol);
+ }
+ yield writeFile(path, data);
+ });
+
+ return function writeFilePreservingEol(_x30, _x31) {
+ return _ref31.apply(this, arguments);
+ };
+})();
+
+let hardlinksWork = exports.hardlinksWork = (() => {
+ var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) {
+ const filename = 'test-file' + Math.random();
+ const file = (_path || _load_path()).default.join(dir, filename);
+ const fileLink = (_path || _load_path()).default.join(dir, filename + '-link');
+ try {
+ yield writeFile(file, 'test');
+ yield link(file, fileLink);
+ } catch (err) {
+ return false;
+ } finally {
+ yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(file);
+ yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(fileLink);
+ }
+ return true;
+ });
+
+ return function hardlinksWork(_x32) {
+ return _ref32.apply(this, arguments);
+ };
+})();
+
+// not a strict polyfill for Node's fs.mkdtemp
+
+
+let makeTempDir = exports.makeTempDir = (() => {
+ var _ref33 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) {
+ const dir = (_path || _load_path()).default.join((_os || _load_os()).default.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`);
+ yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dir);
+ yield mkdirp(dir);
+ return dir;
+ });
+
+ return function makeTempDir(_x33) {
+ return _ref33.apply(this, arguments);
+ };
+})();
+
+let readFirstAvailableStream = exports.readFirstAvailableStream = (() => {
+ var _ref34 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) {
+ for (var _iterator15 = paths, _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) {
+ var _ref35;
+
+ if (_isArray15) {
+ if (_i15 >= _iterator15.length) break;
+ _ref35 = _iterator15[_i15++];
+ } else {
+ _i15 = _iterator15.next();
+ if (_i15.done) break;
+ _ref35 = _i15.value;
+ }
+
+ const path = _ref35;
+
+ try {
+ const fd = yield open(path, 'r');
+ return (_fs || _load_fs()).default.createReadStream(path, { fd });
+ } catch (err) {
+ // Try the next one
+ }
+ }
+ return null;
+ });
+
+ return function readFirstAvailableStream(_x34) {
+ return _ref34.apply(this, arguments);
+ };
+})();
+
+let getFirstSuitableFolder = exports.getFirstSuitableFolder = (() => {
+ var _ref36 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths, mode = constants.W_OK | constants.X_OK) {
+ const result = {
+ skipped: [],
+ folder: null
+ };
+
+ for (var _iterator16 = paths, _isArray16 = Array.isArray(_iterator16), _i16 = 0, _iterator16 = _isArray16 ? _iterator16 : _iterator16[Symbol.iterator]();;) {
+ var _ref37;
+
+ if (_isArray16) {
+ if (_i16 >= _iterator16.length) break;
+ _ref37 = _iterator16[_i16++];
+ } else {
+ _i16 = _iterator16.next();
+ if (_i16.done) break;
+ _ref37 = _i16.value;
+ }
+
+ const folder = _ref37;
+
+ try {
+ yield mkdirp(folder);
+ yield access(folder, mode);
+
+ result.folder = folder;
+
+ return result;
+ } catch (error) {
+ result.skipped.push({
+ error,
+ folder
+ });
+ }
+ }
+ return result;
+ });
+
+ return function getFirstSuitableFolder(_x35) {
+ return _ref36.apply(this, arguments);
+ };
+})();
+
+exports.copy = copy;
+exports.readFile = readFile;
+exports.readFileRaw = readFileRaw;
+exports.normalizeOS = normalizeOS;
+
+var _fs;
+
+function _load_fs() {
+ return _fs = _interopRequireDefault(__webpack_require__(5));
+}
+
+var _glob;
+
+function _load_glob() {
+ return _glob = _interopRequireDefault(__webpack_require__(99));
+}
+
+var _os;
+
+function _load_os() {
+ return _os = _interopRequireDefault(__webpack_require__(46));
+}
+
+var _path;
+
+function _load_path() {
+ return _path = _interopRequireDefault(__webpack_require__(0));
+}
+
+var _blockingQueue;
+
+function _load_blockingQueue() {
+ return _blockingQueue = _interopRequireDefault(__webpack_require__(110));
+}
+
+var _promise;
+
+function _load_promise() {
+ return _promise = _interopRequireWildcard(__webpack_require__(50));
+}
+
+var _promise2;
+
+function _load_promise2() {
+ return _promise2 = __webpack_require__(50);
+}
+
+var _map;
+
+function _load_map() {
+ return _map = _interopRequireDefault(__webpack_require__(29));
+}
+
+var _fsNormalized;
+
+function _load_fsNormalized() {
+ return _fsNormalized = __webpack_require__(218);
+}
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const constants = exports.constants = typeof (_fs || _load_fs()).default.constants !== 'undefined' ? (_fs || _load_fs()).default.constants : {
+ R_OK: (_fs || _load_fs()).default.R_OK,
+ W_OK: (_fs || _load_fs()).default.W_OK,
+ X_OK: (_fs || _load_fs()).default.X_OK
+};
+
+const lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock');
+
+const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readFile);
+const open = exports.open = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.open);
+const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.writeFile);
+const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readlink);
+const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.realpath);
+const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readdir);
+const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.rename);
+const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.access);
+const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.stat);
+const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(145));
+const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.exists, true);
+const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.lstat);
+const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.chmod);
+const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.link);
+const glob = exports.glob = (0, (_promise2 || _load_promise2()).promisify)((_glob || _load_glob()).default);
+exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink;
+
+// fs.copyFile uses the native file copying instructions on the system, performing much better
+// than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the
+// concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD.
+
+const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4;
+
+const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.symlink);
+const invariant = __webpack_require__(9);
+const stripBOM = __webpack_require__(160);
+
+const noop = () => {};
+
+function copy(src, dest, reporter) {
+ return copyBulk([{ src, dest }], reporter);
+}
+
+function _readFile(loc, encoding) {
+ return new Promise((resolve, reject) => {
+ (_fs || _load_fs()).default.readFile(loc, encoding, function (err, content) {
+ if (err) {
+ reject(err);
+ } else {
+ resolve(content);
+ }
+ });
+ });
+}
+
+function readFile(loc) {
+ return _readFile(loc, 'utf8').then(normalizeOS);
+}
+
+function readFileRaw(loc) {
+ return _readFile(loc, 'binary');
+}
+
+function normalizeOS(body) {
+ return body.replace(/\r\n/g, '\n');
+}
+
+const cr = '\r'.charCodeAt(0);
+const lf = '\n'.charCodeAt(0);
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports) {
+
+module.exports = require("fs");
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+class MessageError extends Error {
+ constructor(msg, code) {
+ super(msg);
+ this.code = code;
+ }
+
+}
+
+exports.MessageError = MessageError;
+class ProcessSpawnError extends MessageError {
+ constructor(msg, code, process) {
+ super(msg, code);
+ this.process = process;
+ }
+
+}
+
+exports.ProcessSpawnError = ProcessSpawnError;
+class SecurityError extends MessageError {}
+
+exports.SecurityError = SecurityError;
+class ProcessTermError extends MessageError {}
+
+exports.ProcessTermError = ProcessTermError;
+class ResponseError extends Error {
+ constructor(msg, responseCode) {
+ super(msg);
+ this.responseCode = responseCode;
+ }
+
+}
+
+exports.ResponseError = ResponseError;
+class OneTimePasswordError extends Error {}
+exports.OneTimePasswordError = OneTimePasswordError;
+
+/***/ }),
+/* 7 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscriber; });
+/* unused harmony export SafeSubscriber */
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(154);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(420);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(321);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(185);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(323);
+/** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */
+
+
+
+
+
+
+
+var Subscriber = /*@__PURE__*/ (function (_super) {
+ __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subscriber, _super);
+ function Subscriber(destinationOrNext, error, complete) {
+ var _this = _super.call(this) || this;
+ _this.syncErrorValue = null;
+ _this.syncErrorThrown = false;
+ _this.syncErrorThrowable = false;
+ _this.isStopped = false;
+ _this._parentSubscription = null;
+ switch (arguments.length) {
+ case 0:
+ _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */];
+ break;
+ case 1:
+ if (!destinationOrNext) {
+ _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */];
+ break;
+ }
+ if (typeof destinationOrNext === 'object') {
+ if (destinationOrNext instanceof Subscriber) {
+ _this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;
+ _this.destination = destinationOrNext;
+ destinationOrNext.add(_this);
+ }
+ else {
+ _this.syncErrorThrowable = true;
+ _this.destination = new SafeSubscriber(_this, destinationOrNext);
+ }
+ break;
+ }
+ default:
+ _this.syncErrorThrowable = true;
+ _this.destination = new SafeSubscriber(_this, destinationOrNext, error, complete);
+ break;
+ }
+ return _this;
+ }
+ Subscriber.prototype[__WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { return this; };
+ Subscriber.create = function (next, error, complete) {
+ var subscriber = new Subscriber(next, error, complete);
+ subscriber.syncErrorThrowable = false;
+ return subscriber;
+ };
+ Subscriber.prototype.next = function (value) {
+ if (!this.isStopped) {
+ this._next(value);
+ }
+ };
+ Subscriber.prototype.error = function (err) {
+ if (!this.isStopped) {
+ this.isStopped = true;
+ this._error(err);
+ }
+ };
+ Subscriber.prototype.complete = function () {
+ if (!this.isStopped) {
+ this.isStopped = true;
+ this._complete();
+ }
+ };
+ Subscriber.prototype.unsubscribe = function () {
+ if (this.closed) {
+ return;
+ }
+ this.isStopped = true;
+ _super.prototype.unsubscribe.call(this);
+ };
+ Subscriber.prototype._next = function (value) {
+ this.destination.next(value);
+ };
+ Subscriber.prototype._error = function (err) {
+ this.destination.error(err);
+ this.unsubscribe();
+ };
+ Subscriber.prototype._complete = function () {
+ this.destination.complete();
+ this.unsubscribe();
+ };
+ Subscriber.prototype._unsubscribeAndRecycle = function () {
+ var _a = this, _parent = _a._parent, _parents = _a._parents;
+ this._parent = null;
+ this._parents = null;
+ this.unsubscribe();
+ this.closed = false;
+ this.isStopped = false;
+ this._parent = _parent;
+ this._parents = _parents;
+ this._parentSubscription = null;
+ return this;
+ };
+ return Subscriber;
+}(__WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */]));
+
+var SafeSubscriber = /*@__PURE__*/ (function (_super) {
+ __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SafeSubscriber, _super);
+ function SafeSubscriber(_parentSubscriber, observerOrNext, error, complete) {
+ var _this = _super.call(this) || this;
+ _this._parentSubscriber = _parentSubscriber;
+ var next;
+ var context = _this;
+ if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(observerOrNext)) {
+ next = observerOrNext;
+ }
+ else if (observerOrNext) {
+ next = observerOrNext.next;
+ error = observerOrNext.error;
+ complete = observerOrNext.complete;
+ if (observerOrNext !== __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]) {
+ context = Object.create(observerOrNext);
+ if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(context.unsubscribe)) {
+ _this.add(context.unsubscribe.bind(context));
+ }
+ context.unsubscribe = _this.unsubscribe.bind(_this);
+ }
+ }
+ _this._context = context;
+ _this._next = next;
+ _this._error = error;
+ _this._complete = complete;
+ return _this;
+ }
+ SafeSubscriber.prototype.next = function (value) {
+ if (!this.isStopped && this._next) {
+ var _parentSubscriber = this._parentSubscriber;
+ if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {
+ this.__tryOrUnsub(this._next, value);
+ }
+ else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {
+ this.unsubscribe();
+ }
+ }
+ };
+ SafeSubscriber.prototype.error = function (err) {
+ if (!this.isStopped) {
+ var _parentSubscriber = this._parentSubscriber;
+ var useDeprecatedSynchronousErrorHandling = __WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling;
+ if (this._error) {
+ if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {
+ this.__tryOrUnsub(this._error, err);
+ this.unsubscribe();
+ }
+ else {
+ this.__tryOrSetError(_parentSubscriber, this._error, err);
+ this.unsubscribe();
+ }
+ }
+ else if (!_parentSubscriber.syncErrorThrowable) {
+ this.unsubscribe();
+ if (useDeprecatedSynchronousErrorHandling) {
+ throw err;
+ }
+ __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
+ }
+ else {
+ if (useDeprecatedSynchronousErrorHandling) {
+ _parentSubscriber.syncErrorValue = err;
+ _parentSubscriber.syncErrorThrown = true;
+ }
+ else {
+ __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
+ }
+ this.unsubscribe();
+ }
+ }
+ };
+ SafeSubscriber.prototype.complete = function () {
+ var _this = this;
+ if (!this.isStopped) {
+ var _parentSubscriber = this._parentSubscriber;
+ if (this._complete) {
+ var wrappedComplete = function () { return _this._complete.call(_this._context); };
+ if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {
+ this.__tryOrUnsub(wrappedComplete);
+ this.unsubscribe();
+ }
+ else {
+ this.__tryOrSetError(_parentSubscriber, wrappedComplete);
+ this.unsubscribe();
+ }
+ }
+ else {
+ this.unsubscribe();
+ }
+ }
+ };
+ SafeSubscriber.prototype.__tryOrUnsub = function (fn, value) {
+ try {
+ fn.call(this._context, value);
+ }
+ catch (err) {
+ this.unsubscribe();
+ if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
+ throw err;
+ }
+ else {
+ __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
+ }
+ }
+ };
+ SafeSubscriber.prototype.__tryOrSetError = function (parent, fn, value) {
+ if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
+ throw new Error('bad call');
+ }
+ try {
+ fn.call(this._context, value);
+ }
+ catch (err) {
+ if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
+ parent.syncErrorValue = err;
+ parent.syncErrorThrown = true;
+ return true;
+ }
+ else {
+ __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
+ return true;
+ }
+ }
+ return false;
+ };
+ SafeSubscriber.prototype._unsubscribe = function () {
+ var _parentSubscriber = this._parentSubscriber;
+ this._context = null;
+ this._parentSubscriber = null;
+ _parentSubscriber.unsubscribe();
+ };
+ return SafeSubscriber;
+}(Subscriber));
+
+//# sourceMappingURL=Subscriber.js.map
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.getPathKey = getPathKey;
+const os = __webpack_require__(46);
+const path = __webpack_require__(0);
+const userHome = __webpack_require__(67).default;
+
+var _require = __webpack_require__(225);
+
+const getCacheDir = _require.getCacheDir,
+ getConfigDir = _require.getConfigDir,
+ getDataDir = _require.getDataDir;
+
+const isWebpackBundle = __webpack_require__(278);
+
+const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies'];
+const OWNED_DEPENDENCY_TYPES = exports.OWNED_DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies'];
+
+const RESOLUTIONS = exports.RESOLUTIONS = 'resolutions';
+const MANIFEST_FIELDS = exports.MANIFEST_FIELDS = [RESOLUTIONS, ...DEPENDENCY_TYPES];
+
+const SUPPORTED_NODE_VERSIONS = exports.SUPPORTED_NODE_VERSIONS = '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0';
+
+const YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com';
+const NPM_REGISTRY_RE = exports.NPM_REGISTRY_RE = /https?:\/\/registry\.npmjs\.org/g;
+
+const YARN_DOCS = exports.YARN_DOCS = 'https://yarnpkg.com/en/docs/cli/';
+const YARN_INSTALLER_SH = exports.YARN_INSTALLER_SH = 'https://yarnpkg.com/install.sh';
+const YARN_INSTALLER_MSI = exports.YARN_INSTALLER_MSI = 'https://yarnpkg.com/latest.msi';
+
+const SELF_UPDATE_VERSION_URL = exports.SELF_UPDATE_VERSION_URL = 'https://yarnpkg.com/latest-version';
+
+// cache version, bump whenever we make backwards incompatible changes
+const CACHE_VERSION = exports.CACHE_VERSION = 6;
+
+// lockfile version, bump whenever we make backwards incompatible changes
+const LOCKFILE_VERSION = exports.LOCKFILE_VERSION = 1;
+
+// max amount of network requests to perform concurrently
+const NETWORK_CONCURRENCY = exports.NETWORK_CONCURRENCY = 8;
+
+// HTTP timeout used when downloading packages
+const NETWORK_TIMEOUT = exports.NETWORK_TIMEOUT = 30 * 1000; // in milliseconds
+
+// max amount of child processes to execute concurrently
+const CHILD_CONCURRENCY = exports.CHILD_CONCURRENCY = 5;
+
+const REQUIRED_PACKAGE_KEYS = exports.REQUIRED_PACKAGE_KEYS = ['name', 'version', '_uid'];
+
+function getPreferredCacheDirectories() {
+ const preferredCacheDirectories = [getCacheDir()];
+
+ if (process.getuid) {
+ // $FlowFixMe: process.getuid exists, dammit
+ preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`));
+ }
+
+ preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`));
+
+ return preferredCacheDirectories;
+}
+
+const PREFERRED_MODULE_CACHE_DIRECTORIES = exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories();
+const CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getConfigDir();
+const DATA_DIRECTORY = exports.DATA_DIRECTORY = getDataDir();
+const LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(DATA_DIRECTORY, 'link');
+const GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(DATA_DIRECTORY, 'global');
+
+const NODE_BIN_PATH = exports.NODE_BIN_PATH = process.execPath;
+const YARN_BIN_PATH = exports.YARN_BIN_PATH = getYarnBinPath();
+
+// Webpack needs to be configured with node.__dirname/__filename = false
+function getYarnBinPath() {
+ if (isWebpackBundle) {
+ return __filename;
+ } else {
+ return path.join(__dirname, '..', 'bin', 'yarn.js');
+ }
+}
+
+const NODE_MODULES_FOLDER = exports.NODE_MODULES_FOLDER = 'node_modules';
+const NODE_PACKAGE_JSON = exports.NODE_PACKAGE_JSON = 'package.json';
+
+const PNP_FILENAME = exports.PNP_FILENAME = '.pnp.js';
+
+const POSIX_GLOBAL_PREFIX = exports.POSIX_GLOBAL_PREFIX = `${process.env.DESTDIR || ''}/usr/local`;
+const FALLBACK_GLOBAL_PREFIX = exports.FALLBACK_GLOBAL_PREFIX = path.join(userHome, '.yarn');
+
+const META_FOLDER = exports.META_FOLDER = '.yarn-meta';
+const INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity';
+const LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock';
+const METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json';
+const TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz';
+const CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean';
+
+const NPM_LOCK_FILENAME = exports.NPM_LOCK_FILENAME = 'package-lock.json';
+const NPM_SHRINKWRAP_FILENAME = exports.NPM_SHRINKWRAP_FILENAME = 'npm-shrinkwrap.json';
+
+const DEFAULT_INDENT = exports.DEFAULT_INDENT = ' ';
+const SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997;
+const SINGLE_INSTANCE_FILENAME = exports.SINGLE_INSTANCE_FILENAME = '.yarn-single-instance';
+
+const ENV_PATH_KEY = exports.ENV_PATH_KEY = getPathKey(process.platform, process.env);
+
+function getPathKey(platform, env) {
+ let pathKey = 'PATH';
+
+ // windows calls its path "Path" usually, but this is not guaranteed.
+ if (platform === 'win32') {
+ pathKey = 'Path';
+
+ for (const key in env) {
+ if (key.toLowerCase() === 'path') {
+ pathKey = key;
+ }
+ }
+ }
+
+ return pathKey;
+}
+
+const VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = {
+ major: 'red',
+ premajor: 'red',
+ minor: 'yellow',
+ preminor: 'yellow',
+ patch: 'green',
+ prepatch: 'green',
+ prerelease: 'red',
+ unchanged: 'white',
+ unknown: 'red'
+};
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+/**
+ * Copyright (c) 2013-present, Facebook, Inc.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+
+
+
+/**
+ * Use invariant() to assert state which your program assumes to be true.
+ *
+ * Provide sprintf-style format (only %s is supported) and arguments
+ * to provide information about what broke and what you were
+ * expecting.
+ *
+ * The invariant message will be stripped in production, but the invariant
+ * will remain to ensure logic does not differ in production.
+ */
+
+var NODE_ENV = process.env.NODE_ENV;
+
+var invariant = function(condition, format, a, b, c, d, e, f) {
+ if (NODE_ENV !== 'production') {
+ if (format === undefined) {
+ throw new Error('invariant requires an error message argument');
+ }
+ }
+
+ if (!condition) {
+ var error;
+ if (format === undefined) {
+ error = new Error(
+ 'Minified exception occurred; use the non-minified dev environment ' +
+ 'for the full error message and additional helpful warnings.'
+ );
+ } else {
+ var args = [a, b, c, d, e, f];
+ var argIndex = 0;
+ error = new Error(
+ format.replace(/%s/g, function() { return args[argIndex++]; })
+ );
+ error.name = 'Invariant Violation';
+ }
+
+ error.framesToPop = 1; // we don't care about invariant's own frame
+ throw error;
+ }
+};
+
+module.exports = invariant;
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var YAMLException = __webpack_require__(54);
+
+var TYPE_CONSTRUCTOR_OPTIONS = [
+ 'kind',
+ 'resolve',
+ 'construct',
+ 'instanceOf',
+ 'predicate',
+ 'represent',
+ 'defaultStyle',
+ 'styleAliases'
+];
+
+var YAML_NODE_KINDS = [
+ 'scalar',
+ 'sequence',
+ 'mapping'
+];
+
+function compileStyleAliases(map) {
+ var result = {};
+
+ if (map !== null) {
+ Object.keys(map).forEach(function (style) {
+ map[style].forEach(function (alias) {
+ result[String(alias)] = style;
+ });
+ });
+ }
+
+ return result;
+}
+
+function Type(tag, options) {
+ options = options || {};
+
+ Object.keys(options).forEach(function (name) {
+ if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) {
+ throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.');
+ }
+ });
+
+ // TODO: Add tag format check.
+ this.tag = tag;
+ this.kind = options['kind'] || null;
+ this.resolve = options['resolve'] || function () { return true; };
+ this.construct = options['construct'] || function (data) { return data; };
+ this.instanceOf = options['instanceOf'] || null;
+ this.predicate = options['predicate'] || null;
+ this.represent = options['represent'] || null;
+ this.defaultStyle = options['defaultStyle'] || null;
+ this.styleAliases = compileStyleAliases(options['styleAliases'] || null);
+
+ if (YAML_NODE_KINDS.indexOf(this.kind) === -1) {
+ throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.');
+ }
+}
+
+module.exports = Type;
+
+
+/***/ }),
+/* 11 */
+/***/ (function(module, exports) {
+
+module.exports = require("crypto");
+
+/***/ }),
+/* 12 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Observable; });
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(322);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(932);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(117);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(324);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(185);
+/** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */
+
+
+
+
+
+var Observable = /*@__PURE__*/ (function () {
+ function Observable(subscribe) {
+ this._isScalar = false;
+ if (subscribe) {
+ this._subscribe = subscribe;
+ }
+ }
+ Observable.prototype.lift = function (operator) {
+ var observable = new Observable();
+ observable.source = this;
+ observable.operator = operator;
+ return observable;
+ };
+ Observable.prototype.subscribe = function (observerOrNext, error, complete) {
+ var operator = this.operator;
+ var sink = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__["a" /* toSubscriber */])(observerOrNext, error, complete);
+ if (operator) {
+ operator.call(sink, this.source);
+ }
+ else {
+ sink.add(this.source || (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?
+ this._subscribe(sink) :
+ this._trySubscribe(sink));
+ }
+ if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
+ if (sink.syncErrorThrowable) {
+ sink.syncErrorThrowable = false;
+ if (sink.syncErrorThrown) {
+ throw sink.syncErrorValue;
+ }
+ }
+ }
+ return sink;
+ };
+ Observable.prototype._trySubscribe = function (sink) {
+ try {
+ return this._subscribe(sink);
+ }
+ catch (err) {
+ if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
+ sink.syncErrorThrown = true;
+ sink.syncErrorValue = err;
+ }
+ if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_canReportError__["a" /* canReportError */])(sink)) {
+ sink.error(err);
+ }
+ else {
+ console.warn(err);
+ }
+ }
+ };
+ Observable.prototype.forEach = function (next, promiseCtor) {
+ var _this = this;
+ promiseCtor = getPromiseCtor(promiseCtor);
+ return new promiseCtor(function (resolve, reject) {
+ var subscription;
+ subscription = _this.subscribe(function (value) {
+ try {
+ next(value);
+ }
+ catch (err) {
+ reject(err);
+ if (subscription) {
+ subscription.unsubscribe();
+ }
+ }
+ }, reject, resolve);
+ });
+ };
+ Observable.prototype._subscribe = function (subscriber) {
+ var source = this.source;
+ return source && source.subscribe(subscriber);
+ };
+ Observable.prototype[__WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__["a" /* observable */]] = function () {
+ return this;
+ };
+ Observable.prototype.pipe = function () {
+ var operations = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ operations[_i] = arguments[_i];
+ }
+ if (operations.length === 0) {
+ return this;
+ }
+ return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_pipe__["b" /* pipeFromArray */])(operations)(this);
+ };
+ Observable.prototype.toPromise = function (promiseCtor) {
+ var _this = this;
+ promiseCtor = getPromiseCtor(promiseCtor);
+ return new promiseCtor(function (resolve, reject) {
+ var value;
+ _this.subscribe(function (x) { return value = x; }, function (err) { return reject(err); }, function () { return resolve(value); });
+ });
+ };
+ Observable.create = function (subscribe) {
+ return new Observable(subscribe);
+ };
+ return Observable;
+}());
+
+function getPromiseCtor(promiseCtor) {
+ if (!promiseCtor) {
+ promiseCtor = __WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].Promise || Promise;
+ }
+ if (!promiseCtor) {
+ throw new Error('no Promise impl found');
+ }
+ return promiseCtor;
+}
+//# sourceMappingURL=Observable.js.map
+
+
+/***/ }),
+/* 13 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return OuterSubscriber; });
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscriber__ = __webpack_require__(7);
+/** PURE_IMPORTS_START tslib,_Subscriber PURE_IMPORTS_END */
+
+
+var OuterSubscriber = /*@__PURE__*/ (function (_super) {
+ __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](OuterSubscriber, _super);
+ function OuterSubscriber() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ OuterSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) {
+ this.destination.next(innerValue);
+ };
+ OuterSubscriber.prototype.notifyError = function (error, innerSub) {
+ this.destination.error(error);
+ };
+ OuterSubscriber.prototype.notifyComplete = function (innerSub) {
+ this.destination.complete();
+ };
+ return OuterSubscriber;
+}(__WEBPACK_IMPORTED_MODULE_1__Subscriber__["a" /* Subscriber */]));
+
+//# sourceMappingURL=OuterSubscriber.js.map
+
+
+/***/ }),
+/* 14 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (immutable) */ __webpack_exports__["a"] = subscribeToResult;
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(84);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(446);
+/** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */
+
+
+function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, destination) {
+ if (destination === void 0) {
+ destination = new __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__["a" /* InnerSubscriber */](outerSubscriber, outerValue, outerIndex);
+ }
+ if (destination.closed) {
+ return;
+ }
+ return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__subscribeTo__["a" /* subscribeTo */])(result)(destination);
+}
+//# sourceMappingURL=subscribeToResult.js.map
+
+
+/***/ }),
+/* 15 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+/* eslint-disable node/no-deprecated-api */
+
+
+
+var buffer = __webpack_require__(64)
+var Buffer = buffer.Buffer
+
+var safer = {}
+
+var key
+
+for (key in buffer) {
+ if (!buffer.hasOwnProperty(key)) continue
+ if (key === 'SlowBuffer' || key === 'Buffer') continue
+ safer[key] = buffer[key]
+}
+
+var Safer = safer.Buffer = {}
+for (key in Buffer) {
+ if (!Buffer.hasOwnProperty(key)) continue
+ if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue
+ Safer[key] = Buffer[key]
+}
+
+safer.Buffer.prototype = Buffer.prototype
+
+if (!Safer.from || Safer.from === Uint8Array.from) {
+ Safer.from = function (value, encodingOrOffset, length) {
+ if (typeof value === 'number') {
+ throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value)
+ }
+ if (value && typeof value.length === 'undefined') {
+ throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value)
+ }
+ return Buffer(value, encodingOrOffset, length)
+ }
+}
+
+if (!Safer.alloc) {
+ Safer.alloc = function (size, fill, encoding) {
+ if (typeof size !== 'number') {
+ throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size)
+ }
+ if (size < 0 || size >= 2 * (1 << 30)) {
+ throw new RangeError('The value "' + size + '" is invalid for option "size"')
+ }
+ var buf = Buffer(size)
+ if (!fill || fill.length === 0) {
+ buf.fill(0)
+ } else if (typeof encoding === 'string') {
+ buf.fill(fill, encoding)
+ } else {
+ buf.fill(fill)
+ }
+ return buf
+ }
+}
+
+if (!safer.kStringMaxLength) {
+ try {
+ safer.kStringMaxLength = process.binding('buffer').kStringMaxLength
+ } catch (e) {
+ // we can't determine kStringMaxLength in environments where process.binding
+ // is unsupported, so let's not set it
+ }
+}
+
+if (!safer.constants) {
+ safer.constants = {
+ MAX_LENGTH: safer.kMaxLength
+ }
+ if (safer.kStringMaxLength) {
+ safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength
+ }
+}
+
+module.exports = safer
+
+
+/***/ }),
+/* 16 */
+/***/ (function(module, exports, __webpack_require__) {
+
+// Copyright (c) 2012, Mark Cavage. All rights reserved.
+// Copyright 2015 Joyent, Inc.
+
+var assert = __webpack_require__(28);
+var Stream = __webpack_require__(23).Stream;
+var util = __webpack_require__(3);
+
+
+///--- Globals
+
+/* JSSTYLED */
+var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/;
+
+
+///--- Internal
+
+function _capitalize(str) {
+ return (str.charAt(0).toUpperCase() + str.slice(1));
+}
+
+function _toss(name, expected, oper, arg, actual) {
+ throw new assert.AssertionError({
+ message: util.format('%s (%s) is required', name, expected),
+ actual: (actual === undefined) ? typeof (arg) : actual(arg),
+ expected: expected,
+ operator: oper || '===',
+ stackStartFunction: _toss.caller
+ });
+}
+
+function _getClass(arg) {
+ return (Object.prototype.toString.call(arg).slice(8, -1));
+}
+
+function noop() {
+ // Why even bother with asserts?
+}
+
+
+///--- Exports
+
+var types = {
+ bool: {
+ check: function (arg) { return typeof (arg) === 'boolean'; }
+ },
+ func: {
+ check: function (arg) { return typeof (arg) === 'function'; }
+ },
+ string: {
+ check: function (arg) { return typeof (arg) === 'string'; }
+ },
+ object: {
+ check: function (arg) {
+ return typeof (arg) === 'object' && arg !== null;
+ }
+ },
+ number: {
+ check: function (arg) {
+ return typeof (arg) === 'number' && !isNaN(arg);
+ }
+ },
+ finite: {
+ check: function (arg) {
+ return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg);
+ }
+ },
+ buffer: {
+ check: function (arg) { return Buffer.isBuffer(arg); },
+ operator: 'Buffer.isBuffer'
+ },
+ array: {
+ check: function (arg) { return Array.isArray(arg); },
+ operator: 'Array.isArray'
+ },
+ stream: {
+ check: function (arg) { return arg instanceof Stream; },
+ operator: 'instanceof',
+ actual: _getClass
+ },
+ date: {
+ check: function (arg) { return arg instanceof Date; },
+ operator: 'instanceof',
+ actual: _getClass
+ },
+ regexp: {
+ check: function (arg) { return arg instanceof RegExp; },
+ operator: 'instanceof',
+ actual: _getClass
+ },
+ uuid: {
+ check: function (arg) {
+ return typeof (arg) === 'string' && UUID_REGEXP.test(arg);
+ },
+ operator: 'isUUID'
+ }
+};
+
+function _setExports(ndebug) {
+ var keys = Object.keys(types);
+ var out;
+
+ /* re-export standard assert */
+ if (process.env.NODE_NDEBUG) {
+ out = noop;
+ } else {
+ out = function (arg, msg) {
+ if (!arg) {
+ _toss(msg, 'true', arg);
+ }
+ };
+ }
+
+ /* standard checks */
+ keys.forEach(function (k) {
+ if (ndebug) {
+ out[k] = noop;
+ return;
+ }
+ var type = types[k];
+ out[k] = function (arg, msg) {
+ if (!type.check(arg)) {
+ _toss(msg, k, type.operator, arg, type.actual);
+ }
+ };
+ });
+
+ /* optional checks */
+ keys.forEach(function (k) {
+ var name = 'optional' + _capitalize(k);
+ if (ndebug) {
+ out[name] = noop;
+ return;
+ }
+ var type = types[k];
+ out[name] = function (arg, msg) {
+ if (arg === undefined || arg === null) {
+ return;
+ }
+ if (!type.check(arg)) {
+ _toss(msg, k, type.operator, arg, type.actual);
+ }
+ };
+ });
+
+ /* arrayOf checks */
+ keys.forEach(function (k) {
+ var name = 'arrayOf' + _capitalize(k);
+ if (ndebug) {
+ out[name] = noop;
+ return;
+ }
+ var type = types[k];
+ var expected = '[' + k + ']';
+ out[name] = function (arg, msg) {
+ if (!Array.isArray(arg)) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ var i;
+ for (i = 0; i < arg.length; i++) {
+ if (!type.check(arg[i])) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ }
+ };
+ });
+
+ /* optionalArrayOf checks */
+ keys.forEach(function (k) {
+ var name = 'optionalArrayOf' + _capitalize(k);
+ if (ndebug) {
+ out[name] = noop;
+ return;
+ }
+ var type = types[k];
+ var expected = '[' + k + ']';
+ out[name] = function (arg, msg) {
+ if (arg === undefined || arg === null) {
+ return;
+ }
+ if (!Array.isArray(arg)) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ var i;
+ for (i = 0; i < arg.length; i++) {
+ if (!type.check(arg[i])) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ }
+ };
+ });
+
+ /* re-export built-in assertions */
+ Object.keys(assert).forEach(function (k) {
+ if (k === 'AssertionError') {
+ out[k] = assert[k];
+ return;
+ }
+ if (ndebug) {
+ out[k] = noop;
+ return;
+ }
+ out[k] = assert[k];
+ });
+
+ /* export ourselves (for unit tests _only_) */
+ out._setExports = _setExports;
+
+ return out;
+}
+
+module.exports = _setExports(process.env.NODE_NDEBUG);
+
+
+/***/ }),
+/* 17 */
+/***/ (function(module, exports) {
+
+// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
+var global = module.exports = typeof window != 'undefined' && window.Math == Math
+ ? window : typeof self != 'undefined' && self.Math == Math ? self
+ // eslint-disable-next-line no-new-func
+ : Function('return this')();
+if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef
+
+
+/***/ }),
+/* 18 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.sortAlpha = sortAlpha;
+exports.sortOptionsByFlags = sortOptionsByFlags;
+exports.entries = entries;
+exports.removePrefix = removePrefix;
+exports.removeSuffix = removeSuffix;
+exports.addSuffix = addSuffix;
+exports.hyphenate = hyphenate;
+exports.camelCase = camelCase;
+exports.compareSortedArrays = compareSortedArrays;
+exports.sleep = sleep;
+const _camelCase = __webpack_require__(230);
+
+function sortAlpha(a, b) {
+ // sort alphabetically in a deterministic way
+ const shortLen = Math.min(a.length, b.length);
+ for (let i = 0; i < shortLen; i++) {
+ const aChar = a.charCodeAt(i);
+ const bChar = b.charCodeAt(i);
+ if (aChar !== bChar) {
+ return aChar - bChar;
+ }
+ }
+ return a.length - b.length;
+}
+
+function sortOptionsByFlags(a, b) {
+ const aOpt = a.flags.replace(/-/g, '');
+ const bOpt = b.flags.replace(/-/g, '');
+ return sortAlpha(aOpt, bOpt);
+}
+
+function entries(obj) {
+ const entries = [];
+ if (obj) {
+ for (const key in obj) {
+ entries.push([key, obj[key]]);
+ }
+ }
+ return entries;
+}
+
+function removePrefix(pattern, prefix) {
+ if (pattern.startsWith(prefix)) {
+ pattern = pattern.slice(prefix.length);
+ }
+
+ return pattern;
+}
+
+function removeSuffix(pattern, suffix) {
+ if (pattern.endsWith(suffix)) {
+ return pattern.slice(0, -suffix.length);
+ }
+
+ return pattern;
+}
+
+function addSuffix(pattern, suffix) {
+ if (!pattern.endsWith(suffix)) {
+ return pattern + suffix;
+ }
+
+ return pattern;
+}
+
+function hyphenate(str) {
+ return str.replace(/[A-Z]/g, match => {
+ return '-' + match.charAt(0).toLowerCase();
+ });
+}
+
+function camelCase(str) {
+ if (/[A-Z]/.test(str)) {
+ return null;
+ } else {
+ return _camelCase(str);
+ }
+}
+
+function compareSortedArrays(array1, array2) {
+ if (array1.length !== array2.length) {
+ return false;
+ }
+ for (let i = 0, len = array1.length; i < len; i++) {
+ if (array1[i] !== array2[i]) {
+ return false;
+ }
+ }
+ return true;
+}
+
+function sleep(ms) {
+ return new Promise(resolve => {
+ setTimeout(resolve, ms);
+ });
+}
+
+/***/ }),
+/* 19 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.stringify = exports.parse = undefined;
+
+var _asyncToGenerator2;
+
+function _load_asyncToGenerator() {
+ return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2));
+}
+
+var _parse;
+
+function _load_parse() {
+ return _parse = __webpack_require__(105);
+}
+
+Object.defineProperty(exports, 'parse', {
+ enumerable: true,
+ get: function get() {
+ return _interopRequireDefault(_parse || _load_parse()).default;
+ }
+});
+
+var _stringify;
+
+function _load_stringify() {
+ return _stringify = __webpack_require__(199);
+}
+
+Object.defineProperty(exports, 'stringify', {
+ enumerable: true,
+ get: function get() {
+ return _interopRequireDefault(_stringify || _load_stringify()).default;
+ }
+});
+exports.implodeEntry = implodeEntry;
+exports.explodeEntry = explodeEntry;
+
+var _misc;
+
+function _load_misc() {
+ return _misc = __webpack_require__(18);
+}
+
+var _normalizePattern;
+
+function _load_normalizePattern() {
+ return _normalizePattern = __webpack_require__(37);
+}
+
+var _parse2;
+
+function _load_parse2() {
+ return _parse2 = _interopRequireDefault(__webpack_require__(105));
+}
+
+var _constants;
+
+function _load_constants() {
+ return _constants = __webpack_require__(8);
+}
+
+var _fs;
+
+function _load_fs() {
+ return _fs = _interopRequireWildcard(__webpack_require__(4));
+}
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const invariant = __webpack_require__(9);
+
+const path = __webpack_require__(0);
+const ssri = __webpack_require__(65);
+
+function getName(pattern) {
+ return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name;
+}
+
+function blankObjectUndefined(obj) {
+ return obj && Object.keys(obj).length ? obj : undefined;
+}
+
+function keyForRemote(remote) {
+ return remote.resolved || (remote.reference && remote.hash ? `${remote.reference}#${remote.hash}` : null);
+}
+
+function serializeIntegrity(integrity) {
+ // We need this because `Integrity.toString()` does not use sorting to ensure a stable string output
+ // See https://git.io/vx2Hy
+ return integrity.toString().split(' ').sort().join(' ');
+}
+
+function implodeEntry(pattern, obj) {
+ const inferredName = getName(pattern);
+ const integrity = obj.integrity ? serializeIntegrity(obj.integrity) : '';
+ const imploded = {
+ name: inferredName === obj.name ? undefined : obj.name,
+ version: obj.version,
+ uid: obj.uid === obj.version ? undefined : obj.uid,
+ resolved: obj.resolved,
+ registry: obj.registry === 'npm' ? undefined : obj.registry,
+ dependencies: blankObjectUndefined(obj.dependencies),
+ optionalDependencies: blankObjectUndefined(obj.optionalDependencies),
+ permissions: blankObjectUndefined(obj.permissions),
+ prebuiltVariants: blankObjectUndefined(obj.prebuiltVariants)
+ };
+ if (integrity) {
+ imploded.integrity = integrity;
+ }
+ return imploded;
+}
+
+function explodeEntry(pattern, obj) {
+ obj.optionalDependencies = obj.optionalDependencies || {};
+ obj.dependencies = obj.dependencies || {};
+ obj.uid = obj.uid || obj.version;
+ obj.permissions = obj.permissions || {};
+ obj.registry = obj.registry || 'npm';
+ obj.name = obj.name || getName(pattern);
+ const integrity = obj.integrity;
+ if (integrity && integrity.isIntegrity) {
+ obj.integrity = ssri.parse(integrity);
+ }
+ return obj;
+}
+
+class Lockfile {
+ constructor({ cache, source, parseResultType } = {}) {
+ this.source = source || '';
+ this.cache = cache;
+ this.parseResultType = parseResultType;
+ }
+
+ // source string if the `cache` was parsed
+
+
+ // if true, we're parsing an old yarn file and need to update integrity fields
+ hasEntriesExistWithoutIntegrity() {
+ if (!this.cache) {
+ return false;
+ }
+
+ for (const key in this.cache) {
+ // $FlowFixMe - `this.cache` is clearly defined at this point
+ if (!/^.*@(file:|http)/.test(key) && this.cache[key] && !this.cache[key].integrity) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ static fromDirectory(dir, reporter) {
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ // read the manifest in this directory
+ const lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME);
+
+ let lockfile;
+ let rawLockfile = '';
+ let parseResult;
+
+ if (yield (_fs || _load_fs()).exists(lockfileLoc)) {
+ rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc);
+ parseResult = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc);
+
+ if (reporter) {
+ if (parseResult.type === 'merge') {
+ reporter.info(reporter.lang('lockfileMerged'));
+ } else if (parseResult.type === 'conflict') {
+ reporter.warn(reporter.lang('lockfileConflict'));
+ }
+ }
+
+ lockfile = parseResult.object;
+ } else if (reporter) {
+ reporter.info(reporter.lang('noLockfileFound'));
+ }
+
+ if (lockfile && lockfile.__metadata) {
+ const lockfilev2 = lockfile;
+ lockfile = {};
+ }
+
+ return new Lockfile({ cache: lockfile, source: rawLockfile, parseResultType: parseResult && parseResult.type });
+ })();
+ }
+
+ getLocked(pattern) {
+ const cache = this.cache;
+ if (!cache) {
+ return undefined;
+ }
+
+ const shrunk = pattern in cache && cache[pattern];
+
+ if (typeof shrunk === 'string') {
+ return this.getLocked(shrunk);
+ } else if (shrunk) {
+ explodeEntry(pattern, shrunk);
+ return shrunk;
+ }
+
+ return undefined;
+ }
+
+ removePattern(pattern) {
+ const cache = this.cache;
+ if (!cache) {
+ return;
+ }
+ delete cache[pattern];
+ }
+
+ getLockfile(patterns) {
+ const lockfile = {};
+ const seen = new Map();
+
+ // order by name so that lockfile manifest is assigned to the first dependency with this manifest
+ // the others that have the same remoteKey will just refer to the first
+ // ordering allows for consistency in lockfile when it is serialized
+ const sortedPatternsKeys = Object.keys(patterns).sort((_misc || _load_misc()).sortAlpha);
+
+ for (var _iterator = sortedPatternsKeys, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+ var _ref;
+
+ if (_isArray) {
+ if (_i >= _iterator.length) break;
+ _ref = _iterator[_i++];
+ } else {
+ _i = _iterator.next();
+ if (_i.done) break;
+ _ref = _i.value;
+ }
+
+ const pattern = _ref;
+
+ const pkg = patterns[pattern];
+ const remote = pkg._remote,
+ ref = pkg._reference;
+
+ invariant(ref, 'Package is missing a reference');
+ invariant(remote, 'Package is missing a remote');
+
+ const remoteKey = keyForRemote(remote);
+ const seenPattern = remoteKey && seen.get(remoteKey);
+ if (seenPattern) {
+ // no point in duplicating it
+ lockfile[pattern] = seenPattern;
+
+ // if we're relying on our name being inferred and two of the patterns have
+ // different inferred names then we need to set it
+ if (!seenPattern.name && getName(pattern) !== pkg.name) {
+ seenPattern.name = pkg.name;
+ }
+ continue;
+ }
+ const obj = implodeEntry(pattern, {
+ name: pkg.name,
+ version: pkg.version,
+ uid: pkg._uid,
+ resolved: remote.resolved,
+ integrity: remote.integrity,
+ registry: remote.registry,
+ dependencies: pkg.dependencies,
+ peerDependencies: pkg.peerDependencies,
+ optionalDependencies: pkg.optionalDependencies,
+ permissions: ref.permissions,
+ prebuiltVariants: pkg.prebuiltVariants
+ });
+
+ lockfile[pattern] = obj;
+
+ if (remoteKey) {
+ seen.set(remoteKey, obj);
+ }
+ }
+
+ return lockfile;
+ }
+}
+exports.default = Lockfile;
+
+/***/ }),
+/* 20 */
+/***/ (function(module, exports, __webpack_require__) {
+
+var store = __webpack_require__(133)('wks');
+var uid = __webpack_require__(137);
+var Symbol = __webpack_require__(17).Symbol;
+var USE_SYMBOL = typeof Symbol == 'function';
+
+var $exports = module.exports = function (name) {
+ return store[name] || (store[name] =
+ USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name));
+};
+
+$exports.store = store;
+
+
+/***/ }),
+/* 21 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+exports.__esModule = true;
+
+var _assign = __webpack_require__(591);
+
+var _assign2 = _interopRequireDefault(_assign);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+exports.default = _assign2.default || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+};
+
+/***/ }),
+/* 22 */
+/***/ (function(module, exports) {
+
+exports = module.exports = SemVer;
+
+// The debug function is excluded entirely from the minified version.
+/* nomin */ var debug;
+/* nomin */ if (typeof process === 'object' &&
+ /* nomin */ process.env &&
+ /* nomin */ process.env.NODE_DEBUG &&
+ /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG))
+ /* nomin */ debug = function() {
+ /* nomin */ var args = Array.prototype.slice.call(arguments, 0);
+ /* nomin */ args.unshift('SEMVER');
+ /* nomin */ console.log.apply(console, args);
+ /* nomin */ };
+/* nomin */ else
+ /* nomin */ debug = function() {};
+
+// Note: this is the semver.org version of the spec that it implements
+// Not necessarily the package version of this code.
+exports.SEMVER_SPEC_VERSION = '2.0.0';
+
+var MAX_LENGTH = 256;
+var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991;
+
+// Max safe segment length for coercion.
+var MAX_SAFE_COMPONENT_LENGTH = 16;
+
+// The actual regexps go on exports.re
+var re = exports.re = [];
+var src = exports.src = [];
+var R = 0;
+
+// The following Regular Expressions can be used for tokenizing,
+// validating, and parsing SemVer version strings.
+
+// ## Numeric Identifier
+// A single `0`, or a non-zero digit followed by zero or more digits.
+
+var NUMERICIDENTIFIER = R++;
+src[NUMERICIDENTIFIER] = '0|[1-9]\\d*';
+var NUMERICIDENTIFIERLOOSE = R++;
+src[NUMERICIDENTIFIERLOOSE] = '[0-9]+';
+
+
+// ## Non-numeric Identifier
+// Zero or more digits, followed by a letter or hyphen, and then zero or
+// more letters, digits, or hyphens.
+
+var NONNUMERICIDENTIFIER = R++;
+src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*';
+
+
+// ## Main Version
+// Three dot-separated numeric identifiers.
+
+var MAINVERSION = R++;
+src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' +
+ '(' + src[NUMERICIDENTIFIER] + ')\\.' +
+ '(' + src[NUMERICIDENTIFIER] + ')';
+
+var MAINVERSIONLOOSE = R++;
+src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' +
+ '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' +
+ '(' + src[NUMERICIDENTIFIERLOOSE] + ')';
+
+// ## Pre-release Version Identifier
+// A numeric identifier, or a non-numeric identifier.
+
+var PRERELEASEIDENTIFIER = R++;
+src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] +
+ '|' + src[NONNUMERICIDENTIFIER] + ')';
+
+var PRERELEASEIDENTIFIERLOOSE = R++;
+src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] +
+ '|' + src[NONNUMERICIDENTIFIER] + ')';
+
+
+// ## Pre-release Version
+// Hyphen, followed by one or more dot-separated pre-release version
+// identifiers.
+
+var PRERELEASE = R++;
+src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] +
+ '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))';
+
+var PRERELEASELOOSE = R++;
+src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] +
+ '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))';
+
+// ## Build Metadata Identifier
+// Any combination of digits, letters, or hyphens.
+
+var BUILDIDENTIFIER = R++;
+src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+';
+
+// ## Build Metadata
+// Plus sign, followed by one or more period-separated build metadata
+// identifiers.
+
+var BUILD = R++;
+src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] +
+ '(?:\\.' + src[BUILDIDENTIFIER] + ')*))';
+
+
+// ## Full Version String
+// A main version, followed optionally by a pre-release version and
+// build metadata.
+
+// Note that the only major, minor, patch, and pre-release sections of
+// the version string are capturing groups. The build metadata is not a
+// capturing group, because it should not ever be used in version
+// comparison.
+
+var FULL = R++;
+var FULLPLAIN = 'v?' + src[MAINVERSION] +
+ src[PRERELEASE] + '?' +
+ src[BUILD] + '?';
+
+src[FULL] = '^' + FULLPLAIN + '$';
+
+// like full, but allows v1.2.3 and =1.2.3, which people do sometimes.
+// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty
+// common in the npm registry.
+var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] +
+ src[PRERELEASELOOSE] + '?' +
+ src[BUILD] + '?';
+
+var LOOSE = R++;
+src[LOOSE] = '^' + LOOSEPLAIN + '$';
+
+var GTLT = R++;
+src[GTLT] = '((?:<|>)?=?)';
+
+// Something like "2.*" or "1.2.x".
+// Note that "x.x" is a valid xRange identifer, meaning "any version"
+// Only the first item is strictly required.
+var XRANGEIDENTIFIERLOOSE = R++;
+src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*';
+var XRANGEIDENTIFIER = R++;
+src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*';
+
+var XRANGEPLAIN = R++;
+src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' +
+ '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' +
+ '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' +
+ '(?:' + src[PRERELEASE] + ')?' +
+ src[BUILD] + '?' +
+ ')?)?';
+
+var XRANGEPLAINLOOSE = R++;
+src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' +
+ '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' +
+ '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' +
+ '(?:' + src[PRERELEASELOOSE] + ')?' +
+ src[BUILD] + '?' +
+ ')?)?';
+
+var XRANGE = R++;
+src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$';
+var XRANGELOOSE = R++;
+src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$';
+
+// Coercion.
+// Extract anything that could conceivably be a part of a valid semver
+var COERCE = R++;
+src[COERCE] = '(?:^|[^\\d])' +
+ '(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '})' +
+ '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' +
+ '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' +
+ '(?:$|[^\\d])';
+
+// Tilde ranges.
+// Meaning is "reasonably at or greater than"
+var LONETILDE = R++;
+src[LONETILDE] = '(?:~>?)';
+
+var TILDETRIM = R++;
+src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+';
+re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g');
+var tildeTrimReplace = '$1~';
+
+var TILDE = R++;
+src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$';
+var TILDELOOSE = R++;
+src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$';
+
+// Caret ranges.
+// Meaning is "at least and backwards compatible with"
+var LONECARET = R++;
+src[LONECARET] = '(?:\\^)';
+
+var CARETTRIM = R++;
+src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+';
+re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g');
+var caretTrimReplace = '$1^';
+
+var CARET = R++;
+src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$';
+var CARETLOOSE = R++;
+src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$';
+
+// A simple gt/lt/eq thing, or just "" to indicate "any version"
+var COMPARATORLOOSE = R++;
+src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$';
+var COMPARATOR = R++;
+src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$';
+
+
+// An expression to strip any whitespace between the gtlt and the thing
+// it modifies, so that `> 1.2.3` ==> `>1.2.3`
+var COMPARATORTRIM = R++;
+src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] +
+ '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')';
+
+// this one has to use the /g flag
+re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g');
+var comparatorTrimReplace = '$1$2$3';
+
+
+// Something like `1.2.3 - 1.2.4`
+// Note that these all use the loose form, because they'll be
+// checked against either the strict or loose comparator form
+// later.
+var HYPHENRANGE = R++;
+src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' +
+ '\\s+-\\s+' +
+ '(' + src[XRANGEPLAIN] + ')' +
+ '\\s*$';
+
+var HYPHENRANGELOOSE = R++;
+src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' +
+ '\\s+-\\s+' +
+ '(' + src[XRANGEPLAINLOOSE] + ')' +
+ '\\s*$';
+
+// Star ranges basically just allow anything at all.
+var STAR = R++;
+src[STAR] = '(<|>)?=?\\s*\\*';
+
+// Compile to actual regexp objects.
+// All are flag-free, unless they were created above with a flag.
+for (var i = 0; i < R; i++) {
+ debug(i, src[i]);
+ if (!re[i])
+ re[i] = new RegExp(src[i]);
+}
+
+exports.parse = parse;
+function parse(version, loose) {
+ if (version instanceof SemVer)
+ return version;
+
+ if (typeof version !== 'string')
+ return null;
+
+ if (version.length > MAX_LENGTH)
+ return null;
+
+ var r = loose ? re[LOOSE] : re[FULL];
+ if (!r.test(version))
+ return null;
+
+ try {
+ return new SemVer(version, loose);
+ } catch (er) {
+ return null;
+ }
+}
+
+exports.valid = valid;
+function valid(version, loose) {
+ var v = parse(version, loose);
+ return v ? v.version : null;
+}
+
+
+exports.clean = clean;
+function clean(version, loose) {
+ var s = parse(version.trim().replace(/^[=v]+/, ''), loose);
+ return s ? s.version : null;
+}
+
+exports.SemVer = SemVer;
+
+function SemVer(version, loose) {
+ if (version instanceof SemVer) {
+ if (version.loose === loose)
+ return version;
+ else
+ version = version.version;
+ } else if (typeof version !== 'string') {
+ throw new TypeError('Invalid Version: ' + version);
+ }
+
+ if (version.length > MAX_LENGTH)
+ throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters')
+
+ if (!(this instanceof SemVer))
+ return new SemVer(version, loose);
+
+ debug('SemVer', version, loose);
+ this.loose = loose;
+ var m = version.trim().match(loose ? re[LOOSE] : re[FULL]);
+
+ if (!m)
+ throw new TypeError('Invalid Version: ' + version);
+
+ this.raw = version;
+
+ // these are actually numbers
+ this.major = +m[1];
+ this.minor = +m[2];
+ this.patch = +m[3];
+
+ if (this.major > MAX_SAFE_INTEGER || this.major < 0)
+ throw new TypeError('Invalid major version')
+
+ if (this.minor > MAX_SAFE_INTEGER || this.minor < 0)
+ throw new TypeError('Invalid minor version')
+
+ if (this.patch > MAX_SAFE_INTEGER || this.patch < 0)
+ throw new TypeError('Invalid patch version')
+
+ // numberify any prerelease numeric ids
+ if (!m[4])
+ this.prerelease = [];
+ else
+ this.prerelease = m[4].split('.').map(function(id) {
+ if (/^[0-9]+$/.test(id)) {
+ var num = +id;
+ if (num >= 0 && num < MAX_SAFE_INTEGER)
+ return num;
+ }
+ return id;
+ });
+
+ this.build = m[5] ? m[5].split('.') : [];
+ this.format();
+}
+
+SemVer.prototype.format = function() {
+ this.version = this.major + '.' + this.minor + '.' + this.patch;
+ if (this.prerelease.length)
+ this.version += '-' + this.prerelease.join('.');
+ return this.version;
+};
+
+SemVer.prototype.toString = function() {
+ return this.version;
+};
+
+SemVer.prototype.compare = function(other) {
+ debug('SemVer.compare', this.version, this.loose, other);
+ if (!(other instanceof SemVer))
+ other = new SemVer(other, this.loose);
+
+ return this.compareMain(other) || this.comparePre(other);
+};
+
+SemVer.prototype.compareMain = function(other) {
+ if (!(other instanceof SemVer))
+ other = new SemVer(other, this.loose);
+
+ return compareIdentifiers(this.major, other.major) ||
+ compareIdentifiers(this.minor, other.minor) ||
+ compareIdentifiers(this.patch, other.patch);
+};
+
+SemVer.prototype.comparePre = function(other) {
+ if (!(other instanceof SemVer))
+ other = new SemVer(other, this.loose);
+
+ // NOT having a prerelease is > having one
+ if (this.prerelease.length && !other.prerelease.length)
+ return -1;
+ else if (!this.prerelease.length && other.prerelease.length)
+ return 1;
+ else if (!this.prerelease.length && !other.prerelease.length)
+ return 0;
+
+ var i = 0;
+ do {
+ var a = this.prerelease[i];
+ var b = other.prerelease[i];
+ debug('prerelease compare', i, a, b);
+ if (a === undefined && b === undefined)
+ return 0;
+ else if (b === undefined)
+ return 1;
+ else if (a === undefined)
+ return -1;
+ else if (a === b)
+ continue;
+ else
+ return compareIdentifiers(a, b);
+ } while (++i);
+};
+
+// preminor will bump the version up to the next minor release, and immediately
+// down to pre-release. premajor and prepatch work the same way.
+SemVer.prototype.inc = function(release, identifier) {
+ switch (release) {
+ case 'premajor':
+ this.prerelease.length = 0;
+ this.patch = 0;
+ this.minor = 0;
+ this.major++;
+ this.inc('pre', identifier);
+ break;
+ case 'preminor':
+ this.prerelease.length = 0;
+ this.patch = 0;
+ this.minor++;
+ this.inc('pre', identifier);
+ break;
+ case 'prepatch':
+ // If this is already a prerelease, it will bump to the next version
+ // drop any prereleases that might already exist, since they are not
+ // relevant at this point.
+ this.prerelease.length = 0;
+ this.inc('patch', identifier);
+ this.inc('pre', identifier);
+ break;
+ // If the input is a non-prerelease version, this acts the same as
+ // prepatch.
+ case 'prerelease':
+ if (this.prerelease.length === 0)
+ this.inc('patch', identifier);
+ this.inc('pre', identifier);
+ break;
+
+ case 'major':
+ // If this is a pre-major version, bump up to the same major version.
+ // Otherwise increment major.
+ // 1.0.0-5 bumps to 1.0.0
+ // 1.1.0 bumps to 2.0.0
+ if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0)
+ this.major++;
+ this.minor = 0;
+ this.patch = 0;
+ this.prerelease = [];
+ break;
+ case 'minor':
+ // If this is a pre-minor version, bump up to the same minor version.
+ // Otherwise increment minor.
+ // 1.2.0-5 bumps to 1.2.0
+ // 1.2.1 bumps to 1.3.0
+ if (this.patch !== 0 || this.prerelease.length === 0)
+ this.minor++;
+ this.patch = 0;
+ this.prerelease = [];
+ break;
+ case 'patch':
+ // If this is not a pre-release version, it will increment the patch.
+ // If it is a pre-release it will bump up to the same patch version.
+ // 1.2.0-5 patches to 1.2.0
+ // 1.2.0 patches to 1.2.1
+ if (this.prerelease.length === 0)
+ this.patch++;
+ this.prerelease = [];
+ break;
+ // This probably shouldn't be used publicly.
+ // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction.
+ case 'pre':
+ if (this.prerelease.length === 0)
+ this.prerelease = [0];
+ else {
+ var i = this.prerelease.length;
+ while (--i >= 0) {
+ if (typeof this.prerelease[i] === 'number') {
+ this.prerelease[i]++;
+ i = -2;
+ }
+ }
+ if (i === -1) // didn't increment anything
+ this.prerelease.push(0);
+ }
+ if (identifier) {
+ // 1.2.0-beta.1 bumps to 1.2.0-beta.2,
+ // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0
+ if (this.prerelease[0] === identifier) {
+ if (isNaN(this.prerelease[1]))
+ this.prerelease = [identifier, 0];
+ } else
+ this.prerelease = [identifier, 0];
+ }
+ break;
+
+ default:
+ throw new Error('invalid increment argument: ' + release);
+ }
+ this.format();
+ this.raw = this.version;
+ return this;
+};
+
+exports.inc = inc;
+function inc(version, release, loose, identifier) {
+ if (typeof(loose) === 'string') {
+ identifier = loose;
+ loose = undefined;
+ }
+
+ try {
+ return new SemVer(version, loose).inc(release, identifier).version;
+ } catch (er) {
+ return null;
+ }
+}
+
+exports.diff = diff;
+function diff(version1, version2) {
+ if (eq(version1, version2)) {
+ return null;
+ } else {
+ var v1 = parse(version1);
+ var v2 = parse(version2);
+ if (v1.prerelease.length || v2.prerelease.length) {
+ for (var key in v1) {
+ if (key === 'major' || key === 'minor' || key === 'patch') {
+ if (v1[key] !== v2[key]) {
+ return 'pre'+key;
+ }
+ }
+ }
+ return 'prerelease';
+ }
+ for (var key in v1) {
+ if (key === 'major' || key === 'minor' || key === 'patch') {
+ if (v1[key] !== v2[key]) {
+ return key;
+ }
+ }
+ }
+ }
+}
+
+exports.compareIdentifiers = compareIdentifiers;
+
+var numeric = /^[0-9]+$/;
+function compareIdentifiers(a, b) {
+ var anum = numeric.test(a);
+ var bnum = numeric.test(b);
+
+ if (anum && bnum) {
+ a = +a;
+ b = +b;
+ }
+
+ return (anum && !bnum) ? -1 :
+ (bnum && !anum) ? 1 :
+ a < b ? -1 :
+ a > b ? 1 :
+ 0;
+}
+
+exports.rcompareIdentifiers = rcompareIdentifiers;
+function rcompareIdentifiers(a, b) {
+ return compareIdentifiers(b, a);
+}
+
+exports.major = major;
+function major(a, loose) {
+ return new SemVer(a, loose).major;
+}
+
+exports.minor = minor;
+function minor(a, loose) {
+ return new SemVer(a, loose).minor;
+}
+
+exports.patch = patch;
+function patch(a, loose) {
+ return new SemVer(a, loose).patch;
+}
+
+exports.compare = compare;
+function compare(a, b, loose) {
+ return new SemVer(a, loose).compare(new SemVer(b, loose));
+}
+
+exports.compareLoose = compareLoose;
+function compareLoose(a, b) {
+ return compare(a, b, true);
+}
+
+exports.rcompare = rcompare;
+function rcompare(a, b, loose) {
+ return compare(b, a, loose);
+}
+
+exports.sort = sort;
+function sort(list, loose) {
+ return list.sort(function(a, b) {
+ return exports.compare(a, b, loose);
+ });
+}
+
+exports.rsort = rsort;
+function rsort(list, loose) {
+ return list.sort(function(a, b) {
+ return exports.rcompare(a, b, loose);
+ });
+}
+
+exports.gt = gt;
+function gt(a, b, loose) {
+ return compare(a, b, loose) > 0;
+}
+
+exports.lt = lt;
+function lt(a, b, loose) {
+ return compare(a, b, loose) < 0;
+}
+
+exports.eq = eq;
+function eq(a, b, loose) {
+ return compare(a, b, loose) === 0;
+}
+
+exports.neq = neq;
+function neq(a, b, loose) {
+ return compare(a, b, loose) !== 0;
+}
+
+exports.gte = gte;
+function gte(a, b, loose) {
+ return compare(a, b, loose) >= 0;
+}
+
+exports.lte = lte;
+function lte(a, b, loose) {
+ return compare(a, b, loose) <= 0;
+}
+
+exports.cmp = cmp;
+function cmp(a, op, b, loose) {
+ var ret;
+ switch (op) {
+ case '===':
+ if (typeof a === 'object') a = a.version;
+ if (typeof b === 'object') b = b.version;
+ ret = a === b;
+ break;
+ case '!==':
+ if (typeof a === 'object') a = a.version;
+ if (typeof b === 'object') b = b.version;
+ ret = a !== b;
+ break;
+ case '': case '=': case '==': ret = eq(a, b, loose); break;
+ case '!=': ret = neq(a, b, loose); break;
+ case '>': ret = gt(a, b, loose); break;
+ case '>=': ret = gte(a, b, loose); break;
+ case '<': ret = lt(a, b, loose); break;
+ case '<=': ret = lte(a, b, loose); break;
+ default: throw new TypeError('Invalid operator: ' + op);
+ }
+ return ret;
+}
+
+exports.Comparator = Comparator;
+function Comparator(comp, loose) {
+ if (comp instanceof Comparator) {
+ if (comp.loose === loose)
+ return comp;
+ else
+ comp = comp.value;
+ }
+
+ if (!(this instanceof Comparator))
+ return new Comparator(comp, loose);
+
+ debug('comparator', comp, loose);
+ this.loose = loose;
+ this.parse(comp);
+
+ if (this.semver === ANY)
+ this.value = '';
+ else
+ this.value = this.operator + this.semver.version;
+
+ debug('comp', this);
+}
+
+var ANY = {};
+Comparator.prototype.parse = function(comp) {
+ var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR];
+ var m = comp.match(r);
+
+ if (!m)
+ throw new TypeError('Invalid comparator: ' + comp);
+
+ this.operator = m[1];
+ if (this.operator === '=')
+ this.operator = '';
+
+ // if it literally is just '>' or '' then allow anything.
+ if (!m[2])
+ this.semver = ANY;
+ else
+ this.semver = new SemVer(m[2], this.loose);
+};
+
+Comparator.prototype.toString = function() {
+ return this.value;
+};
+
+Comparator.prototype.test = function(version) {
+ debug('Comparator.test', version, this.loose);
+
+ if (this.semver === ANY)
+ return true;
+
+ if (typeof version === 'string')
+ version = new SemVer(version, this.loose);
+
+ return cmp(version, this.operator, this.semver, this.loose);
+};
+
+Comparator.prototype.intersects = function(comp, loose) {
+ if (!(comp instanceof Comparator)) {
+ throw new TypeError('a Comparator is required');
+ }
+
+ var rangeTmp;
+
+ if (this.operator === '') {
+ rangeTmp = new Range(comp.value, loose);
+ return satisfies(this.value, rangeTmp, loose);
+ } else if (comp.operator === '') {
+ rangeTmp = new Range(this.value, loose);
+ return satisfies(comp.semver, rangeTmp, loose);
+ }
+
+ var sameDirectionIncreasing =
+ (this.operator === '>=' || this.operator === '>') &&
+ (comp.operator === '>=' || comp.operator === '>');
+ var sameDirectionDecreasing =
+ (this.operator === '<=' || this.operator === '<') &&
+ (comp.operator === '<=' || comp.operator === '<');
+ var sameSemVer = this.semver.version === comp.semver.version;
+ var differentDirectionsInclusive =
+ (this.operator === '>=' || this.operator === '<=') &&
+ (comp.operator === '>=' || comp.operator === '<=');
+ var oppositeDirectionsLessThan =
+ cmp(this.semver, '<', comp.semver, loose) &&
+ ((this.operator === '>=' || this.operator === '>') &&
+ (comp.operator === '<=' || comp.operator === '<'));
+ var oppositeDirectionsGreaterThan =
+ cmp(this.semver, '>', comp.semver, loose) &&
+ ((this.operator === '<=' || this.operator === '<') &&
+ (comp.operator === '>=' || comp.operator === '>'));
+
+ return sameDirectionIncreasing || sameDirectionDecreasing ||
+ (sameSemVer && differentDirectionsInclusive) ||
+ oppositeDirectionsLessThan || oppositeDirectionsGreaterThan;
+};
+
+
+exports.Range = Range;
+function Range(range, loose) {
+ if (range instanceof Range) {
+ if (range.loose === loose) {
+ return range;
+ } else {
+ return new Range(range.raw, loose);
+ }
+ }
+
+ if (range instanceof Comparator) {
+ return new Range(range.value, loose);
+ }
+
+ if (!(this instanceof Range))
+ return new Range(range, loose);
+
+ this.loose = loose;
+
+ // First, split based on boolean or ||
+ this.raw = range;
+ this.set = range.split(/\s*\|\|\s*/).map(function(range) {
+ return this.parseRange(range.trim());
+ }, this).filter(function(c) {
+ // throw out any that are not relevant for whatever reason
+ return c.length;
+ });
+
+ if (!this.set.length) {
+ throw new TypeError('Invalid SemVer Range: ' + range);
+ }
+
+ this.format();
+}
+
+Range.prototype.format = function() {
+ this.range = this.set.map(function(comps) {
+ return comps.join(' ').trim();
+ }).join('||').trim();
+ return this.range;
+};
+
+Range.prototype.toString = function() {
+ return this.range;
+};
+
+Range.prototype.parseRange = function(range) {
+ var loose = this.loose;
+ range = range.trim();
+ debug('range', range, loose);
+ // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4`
+ var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE];
+ range = range.replace(hr, hyphenReplace);
+ debug('hyphen replace', range);
+ // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5`
+ range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace);
+ debug('comparator trim', range, re[COMPARATORTRIM]);
+
+ // `~ 1.2.3` => `~1.2.3`
+ range = range.replace(re[TILDETRIM], tildeTrimReplace);
+
+ // `^ 1.2.3` => `^1.2.3`
+ range = range.replace(re[CARETTRIM], caretTrimReplace);
+
+ // normalize spaces
+ range = range.split(/\s+/).join(' ');
+
+ // At this point, the range is completely trimmed and
+ // ready to be split into comparators.
+
+ var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR];
+ var set = range.split(' ').map(function(comp) {
+ return parseComparator(comp, loose);
+ }).join(' ').split(/\s+/);
+ if (this.loose) {
+ // in loose mode, throw out any that are not valid comparators
+ set = set.filter(function(comp) {
+ return !!comp.match(compRe);
+ });
+ }
+ set = set.map(function(comp) {
+ return new Comparator(comp, loose);
+ });
+
+ return set;
+};
+
+Range.prototype.intersects = function(range, loose) {
+ if (!(range instanceof Range)) {
+ throw new TypeError('a Range is required');
+ }
+
+ return this.set.some(function(thisComparators) {
+ return thisComparators.every(function(thisComparator) {
+ return range.set.some(function(rangeComparators) {
+ return rangeComparators.every(function(rangeComparator) {
+ return thisComparator.intersects(rangeComparator, loose);
+ });
+ });
+ });
+ });
+};
+
+// Mostly just for testing and legacy API reasons
+exports.toComparators = toComparators;
+function toComparators(range, loose) {
+ return new Range(range, loose).set.map(function(comp) {
+ return comp.map(function(c) {
+ return c.value;
+ }).join(' ').trim().split(' ');
+ });
+}
+
+// comprised of xranges, tildes, stars, and gtlt's at this point.
+// already replaced the hyphen ranges
+// turn into a set of JUST comparators.
+function parseComparator(comp, loose) {
+ debug('comp', comp);
+ comp = replaceCarets(comp, loose);
+ debug('caret', comp);
+ comp = replaceTildes(comp, loose);
+ debug('tildes', comp);
+ comp = replaceXRanges(comp, loose);
+ debug('xrange', comp);
+ comp = replaceStars(comp, loose);
+ debug('stars', comp);
+ return comp;
+}
+
+function isX(id) {
+ return !id || id.toLowerCase() === 'x' || id === '*';
+}
+
+// ~, ~> --> * (any, kinda silly)
+// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0
+// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0
+// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0
+// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0
+// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0
+function replaceTildes(comp, loose) {
+ return comp.trim().split(/\s+/).map(function(comp) {
+ return replaceTilde(comp, loose);
+ }).join(' ');
+}
+
+function replaceTilde(comp, loose) {
+ var r = loose ? re[TILDELOOSE] : re[TILDE];
+ return comp.replace(r, function(_, M, m, p, pr) {
+ debug('tilde', comp, _, M, m, p, pr);
+ var ret;
+
+ if (isX(M))
+ ret = '';
+ else if (isX(m))
+ ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0';
+ else if (isX(p))
+ // ~1.2 == >=1.2.0 <1.3.0
+ ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0';
+ else if (pr) {
+ debug('replaceTilde pr', pr);
+ if (pr.charAt(0) !== '-')
+ pr = '-' + pr;
+ ret = '>=' + M + '.' + m + '.' + p + pr +
+ ' <' + M + '.' + (+m + 1) + '.0';
+ } else
+ // ~1.2.3 == >=1.2.3 <1.3.0
+ ret = '>=' + M + '.' + m + '.' + p +
+ ' <' + M + '.' + (+m + 1) + '.0';
+
+ debug('tilde return', ret);
+ return ret;
+ });
+}
+
+// ^ --> * (any, kinda silly)
+// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0
+// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0
+// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0
+// ^1.2.3 --> >=1.2.3 <2.0.0
+// ^1.2.0 --> >=1.2.0 <2.0.0
+function replaceCarets(comp, loose) {
+ return comp.trim().split(/\s+/).map(function(comp) {
+ return replaceCaret(comp, loose);
+ }).join(' ');
+}
+
+function replaceCaret(comp, loose) {
+ debug('caret', comp, loose);
+ var r = loose ? re[CARETLOOSE] : re[CARET];
+ return comp.replace(r, function(_, M, m, p, pr) {
+ debug('caret', comp, _, M, m, p, pr);
+ var ret;
+
+ if (isX(M))
+ ret = '';
+ else if (isX(m))
+ ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0';
+ else if (isX(p)) {
+ if (M === '0')
+ ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0';
+ else
+ ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0';
+ } else if (pr) {
+ debug('replaceCaret pr', pr);
+ if (pr.charAt(0) !== '-')
+ pr = '-' + pr;
+ if (M === '0') {
+ if (m === '0')
+ ret = '>=' + M + '.' + m + '.' + p + pr +
+ ' <' + M + '.' + m + '.' + (+p + 1);
+ else
+ ret = '>=' + M + '.' + m + '.' + p + pr +
+ ' <' + M + '.' + (+m + 1) + '.0';
+ } else
+ ret = '>=' + M + '.' + m + '.' + p + pr +
+ ' <' + (+M + 1) + '.0.0';
+ } else {
+ debug('no pr');
+ if (M === '0') {
+ if (m === '0')
+ ret = '>=' + M + '.' + m + '.' + p +
+ ' <' + M + '.' + m + '.' + (+p + 1);
+ else
+ ret = '>=' + M + '.' + m + '.' + p +
+ ' <' + M + '.' + (+m + 1) + '.0';
+ } else
+ ret = '>=' + M + '.' + m + '.' + p +
+ ' <' + (+M + 1) + '.0.0';
+ }
+
+ debug('caret return', ret);
+ return ret;
+ });
+}
+
+function replaceXRanges(comp, loose) {
+ debug('replaceXRanges', comp, loose);
+ return comp.split(/\s+/).map(function(comp) {
+ return replaceXRange(comp, loose);
+ }).join(' ');
+}
+
+function replaceXRange(comp, loose) {
+ comp = comp.trim();
+ var r = loose ? re[XRANGELOOSE] : re[XRANGE];
+ return comp.replace(r, function(ret, gtlt, M, m, p, pr) {
+ debug('xRange', comp, ret, gtlt, M, m, p, pr);
+ var xM = isX(M);
+ var xm = xM || isX(m);
+ var xp = xm || isX(p);
+ var anyX = xp;
+
+ if (gtlt === '=' && anyX)
+ gtlt = '';
+
+ if (xM) {
+ if (gtlt === '>' || gtlt === '<') {
+ // nothing is allowed
+ ret = '<0.0.0';
+ } else {
+ // nothing is forbidden
+ ret = '*';
+ }
+ } else if (gtlt && anyX) {
+ // replace X with 0
+ if (xm)
+ m = 0;
+ if (xp)
+ p = 0;
+
+ if (gtlt === '>') {
+ // >1 => >=2.0.0
+ // >1.2 => >=1.3.0
+ // >1.2.3 => >= 1.2.4
+ gtlt = '>=';
+ if (xm) {
+ M = +M + 1;
+ m = 0;
+ p = 0;
+ } else if (xp) {
+ m = +m + 1;
+ p = 0;
+ }
+ } else if (gtlt === '<=') {
+ // <=0.7.x is actually <0.8.0, since any 0.7.x should
+ // pass. Similarly, <=7.x is actually <8.0.0, etc.
+ gtlt = '<';
+ if (xm)
+ M = +M + 1;
+ else
+ m = +m + 1;
+ }
+
+ ret = gtlt + M + '.' + m + '.' + p;
+ } else if (xm) {
+ ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0';
+ } else if (xp) {
+ ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0';
+ }
+
+ debug('xRange return', ret);
+
+ return ret;
+ });
+}
+
+// Because * is AND-ed with everything else in the comparator,
+// and '' means "any version", just remove the *s entirely.
+function replaceStars(comp, loose) {
+ debug('replaceStars', comp, loose);
+ // Looseness is ignored here. star is always as loose as it gets!
+ return comp.trim().replace(re[STAR], '');
+}
+
+// This function is passed to string.replace(re[HYPHENRANGE])
+// M, m, patch, prerelease, build
+// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5
+// 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do
+// 1.2 - 3.4 => >=1.2.0 <3.5.0
+function hyphenReplace($0,
+ from, fM, fm, fp, fpr, fb,
+ to, tM, tm, tp, tpr, tb) {
+
+ if (isX(fM))
+ from = '';
+ else if (isX(fm))
+ from = '>=' + fM + '.0.0';
+ else if (isX(fp))
+ from = '>=' + fM + '.' + fm + '.0';
+ else
+ from = '>=' + from;
+
+ if (isX(tM))
+ to = '';
+ else if (isX(tm))
+ to = '<' + (+tM + 1) + '.0.0';
+ else if (isX(tp))
+ to = '<' + tM + '.' + (+tm + 1) + '.0';
+ else if (tpr)
+ to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr;
+ else
+ to = '<=' + to;
+
+ return (from + ' ' + to).trim();
+}
+
+
+// if ANY of the sets match ALL of its comparators, then pass
+Range.prototype.test = function(version) {
+ if (!version)
+ return false;
+
+ if (typeof version === 'string')
+ version = new SemVer(version, this.loose);
+
+ for (var i = 0; i < this.set.length; i++) {
+ if (testSet(this.set[i], version))
+ return true;
+ }
+ return false;
+};
+
+function testSet(set, version) {
+ for (var i = 0; i < set.length; i++) {
+ if (!set[i].test(version))
+ return false;
+ }
+
+ if (version.prerelease.length) {
+ // Find the set of versions that are allowed to have prereleases
+ // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0
+ // That should allow `1.2.3-pr.2` to pass.
+ // However, `1.2.4-alpha.notready` should NOT be allowed,
+ // even though it's within the range set by the comparators.
+ for (var i = 0; i < set.length; i++) {
+ debug(set[i].semver);
+ if (set[i].semver === ANY)
+ continue;
+
+ if (set[i].semver.prerelease.length > 0) {
+ var allowed = set[i].semver;
+ if (allowed.major === version.major &&
+ allowed.minor === version.minor &&
+ allowed.patch === version.patch)
+ return true;
+ }
+ }
+
+ // Version has a -pre, but it's not one of the ones we like.
+ return false;
+ }
+
+ return true;
+}
+
+exports.satisfies = satisfies;
+function satisfies(version, range, loose) {
+ try {
+ range = new Range(range, loose);
+ } catch (er) {
+ return false;
+ }
+ return range.test(version);
+}
+
+exports.maxSatisfying = maxSatisfying;
+function maxSatisfying(versions, range, loose) {
+ var max = null;
+ var maxSV = null;
+ try {
+ var rangeObj = new Range(range, loose);
+ } catch (er) {
+ return null;
+ }
+ versions.forEach(function (v) {
+ if (rangeObj.test(v)) { // satisfies(v, range, loose)
+ if (!max || maxSV.compare(v) === -1) { // compare(max, v, true)
+ max = v;
+ maxSV = new SemVer(max, loose);
+ }
+ }
+ })
+ return max;
+}
+
+exports.minSatisfying = minSatisfying;
+function minSatisfying(versions, range, loose) {
+ var min = null;
+ var minSV = null;
+ try {
+ var rangeObj = new Range(range, loose);
+ } catch (er) {
+ return null;
+ }
+ versions.forEach(function (v) {
+ if (rangeObj.test(v)) { // satisfies(v, range, loose)
+ if (!min || minSV.compare(v) === 1) { // compare(min, v, true)
+ min = v;
+ minSV = new SemVer(min, loose);
+ }
+ }
+ })
+ return min;
+}
+
+exports.validRange = validRange;
+function validRange(range, loose) {
+ try {
+ // Return '*' instead of '' so that truthiness works.
+ // This will throw if it's invalid anyway
+ return new Range(range, loose).range || '*';
+ } catch (er) {
+ return null;
+ }
+}
+
+// Determine if version is less than all the versions possible in the range
+exports.ltr = ltr;
+function ltr(version, range, loose) {
+ return outside(version, range, '<', loose);
+}
+
+// Determine if version is greater than all the versions possible in the range.
+exports.gtr = gtr;
+function gtr(version, range, loose) {
+ return outside(version, range, '>', loose);
+}
+
+exports.outside = outside;
+function outside(version, range, hilo, loose) {
+ version = new SemVer(version, loose);
+ range = new Range(range, loose);
+
+ var gtfn, ltefn, ltfn, comp, ecomp;
+ switch (hilo) {
+ case '>':
+ gtfn = gt;
+ ltefn = lte;
+ ltfn = lt;
+ comp = '>';
+ ecomp = '>=';
+ break;
+ case '<':
+ gtfn = lt;
+ ltefn = gte;
+ ltfn = gt;
+ comp = '<';
+ ecomp = '<=';
+ break;
+ default:
+ throw new TypeError('Must provide a hilo val of "<" or ">"');
+ }
+
+ // If it satisifes the range it is not outside
+ if (satisfies(version, range, loose)) {
+ return false;
+ }
+
+ // From now on, variable terms are as if we're in "gtr" mode.
+ // but note that everything is flipped for the "ltr" function.
+
+ for (var i = 0; i < range.set.length; ++i) {
+ var comparators = range.set[i];
+
+ var high = null;
+ var low = null;
+
+ comparators.forEach(function(comparator) {
+ if (comparator.semver === ANY) {
+ comparator = new Comparator('>=0.0.0')
+ }
+ high = high || comparator;
+ low = low || comparator;
+ if (gtfn(comparator.semver, high.semver, loose)) {
+ high = comparator;
+ } else if (ltfn(comparator.semver, low.semver, loose)) {
+ low = comparator;
+ }
+ });
+
+ // If the edge version comparator has a operator then our version
+ // isn't outside it
+ if (high.operator === comp || high.operator === ecomp) {
+ return false;
+ }
+
+ // If the lowest version comparator has an operator and our version
+ // is less than it then it isn't higher than the range
+ if ((!low.operator || low.operator === comp) &&
+ ltefn(version, low.semver)) {
+ return false;
+ } else if (low.operator === ecomp && ltfn(version, low.semver)) {
+ return false;
+ }
+ }
+ return true;
+}
+
+exports.prerelease = prerelease;
+function prerelease(version, loose) {
+ var parsed = parse(version, loose);
+ return (parsed && parsed.prerelease.length) ? parsed.prerelease : null;
+}
+
+exports.intersects = intersects;
+function intersects(r1, r2, loose) {
+ r1 = new Range(r1, loose)
+ r2 = new Range(r2, loose)
+ return r1.intersects(r2)
+}
+
+exports.coerce = coerce;
+function coerce(version) {
+ if (version instanceof SemVer)
+ return version;
+
+ if (typeof version !== 'string')
+ return null;
+
+ var match = version.match(re[COERCE]);
+
+ if (match == null)
+ return null;
+
+ return parse((match[1] || '0') + '.' + (match[2] || '0') + '.' + (match[3] || '0'));
+}
+
+
+/***/ }),
+/* 23 */
+/***/ (function(module, exports) {
+
+module.exports = require("stream");
+
+/***/ }),
+/* 24 */
+/***/ (function(module, exports) {
+
+module.exports = require("url");
+
+/***/ }),
+/* 25 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscription; });
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(41);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(444);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(154);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(56);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(48);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(441);
+/** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */
+
+
+
+
+
+
+var Subscription = /*@__PURE__*/ (function () {
+ function Subscription(unsubscribe) {
+ this.closed = false;
+ this._parent = null;
+ this._parents = null;
+ this._subscriptions = null;
+ if (unsubscribe) {
+ this._unsubscribe = unsubscribe;
+ }
+ }
+ Subscription.prototype.unsubscribe = function () {
+ var hasErrors = false;
+ var errors;
+ if (this.closed) {
+ return;
+ }
+ var _a = this, _parent = _a._parent, _parents = _a._parents, _unsubscribe = _a._unsubscribe, _subscriptions = _a._subscriptions;
+ this.closed = true;
+ this._parent = null;
+ this._parents = null;
+ this._subscriptions = null;
+ var index = -1;
+ var len = _parents ? _parents.length : 0;
+ while (_parent) {
+ _parent.remove(this);
+ _parent = ++index < len && _parents[index] || null;
+ }
+ if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__util_isFunction__["a" /* isFunction */])(_unsubscribe)) {
+ var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(_unsubscribe).call(this);
+ if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) {
+ hasErrors = true;
+ errors = errors || (__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */] ?
+ flattenUnsubscriptionErrors(__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e.errors) : [__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e]);
+ }
+ }
+ if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_isArray__["a" /* isArray */])(_subscriptions)) {
+ index = -1;
+ len = _subscriptions.length;
+ while (++index < len) {
+ var sub = _subscriptions[index];
+ if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isObject__["a" /* isObject */])(sub)) {
+ var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(sub.unsubscribe).call(sub);
+ if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) {
+ hasErrors = true;
+ errors = errors || [];
+ var err = __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e;
+ if (err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) {
+ errors = errors.concat(flattenUnsubscriptionErrors(err.errors));
+ }
+ else {
+ errors.push(err);
+ }
+ }
+ }
+ }
+ }
+ if (hasErrors) {
+ throw new __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */](errors);
+ }
+ };
+ Subscription.prototype.add = function (teardown) {
+ if (!teardown || (teardown === Subscription.EMPTY)) {
+ return Subscription.EMPTY;
+ }
+ if (teardown === this) {
+ return this;
+ }
+ var subscription = teardown;
+ switch (typeof teardown) {
+ case 'function':
+ subscription = new Subscription(teardown);
+ case 'object':
+ if (subscription.closed || typeof subscription.unsubscribe !== 'function') {
+ return subscription;
+ }
+ else if (this.closed) {
+ subscription.unsubscribe();
+ return subscription;
+ }
+ else if (typeof subscription._addParent !== 'function') {
+ var tmp = subscription;
+ subscription = new Subscription();
+ subscription._subscriptions = [tmp];
+ }
+ break;
+ default:
+ throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');
+ }
+ var subscriptions = this._subscriptions || (this._subscriptions = []);
+ subscriptions.push(subscription);
+ subscription._addParent(this);
+ return subscription;
+ };
+ Subscription.prototype.remove = function (subscription) {
+ var subscriptions = this._subscriptions;
+ if (subscriptions) {
+ var subscriptionIndex = subscriptions.indexOf(subscription);
+ if (subscriptionIndex !== -1) {
+ subscriptions.splice(subscriptionIndex, 1);
+ }
+ }
+ };
+ Subscription.prototype._addParent = function (parent) {
+ var _a = this, _parent = _a._parent, _parents = _a._parents;
+ if (!_parent || _parent === parent) {
+ this._parent = parent;
+ }
+ else if (!_parents) {
+ this._parents = [parent];
+ }
+ else if (_parents.indexOf(parent) === -1) {
+ _parents.push(parent);
+ }
+ };
+ Subscription.EMPTY = (function (empty) {
+ empty.closed = true;
+ return empty;
+ }(new Subscription()));
+ return Subscription;
+}());
+
+function flattenUnsubscriptionErrors(errors) {
+ return errors.reduce(function (errs, err) { return errs.concat((err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) ? err.errors : err); }, []);
+}
+//# sourceMappingURL=Subscription.js.map
+
+
+/***/ }),
+/* 26 */
+/***/ (function(module, exports, __webpack_require__) {
+
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+ bufferSplit: bufferSplit,
+ addRSAMissing: addRSAMissing,
+ calculateDSAPublic: calculateDSAPublic,
+ calculateED25519Public: calculateED25519Public,
+ calculateX25519Public: calculateX25519Public,
+ mpNormalize: mpNormalize,
+ mpDenormalize: mpDenormalize,
+ ecNormalize: ecNormalize,
+ countZeros: countZeros,
+ assertCompatible: assertCompatible,
+ isCompatible: isCompatible,
+ opensslKeyDeriv: opensslKeyDeriv,
+ opensshCipherInfo: opensshCipherInfo,
+ publicFromPrivateECDSA: publicFromPrivateECDSA,
+ zeroPadToLength: zeroPadToLength,
+ writeBitString: writeBitString,
+ readBitString: readBitString
+};
+
+var assert = __webpack_require__(16);
+var Buffer = __webpack_require__(15).Buffer;
+var PrivateKey = __webpack_require__(33);
+var Key = __webpack_require__(27);
+var crypto = __webpack_require__(11);
+var algs = __webpack_require__(32);
+var asn1 = __webpack_require__(66);
+
+var ec, jsbn;
+var nacl;
+
+var MAX_CLASS_DEPTH = 3;
+
+function isCompatible(obj, klass, needVer) {
+ if (obj === null || typeof (obj) !== 'object')
+ return (false);
+ if (needVer === undefined)
+ needVer = klass.prototype._sshpkApiVersion;
+ if (obj instanceof klass &&
+ klass.prototype._sshpkApiVersion[0] == needVer[0])
+ return (true);
+ var proto = Object.getPrototypeOf(obj);
+ var depth = 0;
+ while (proto.constructor.name !== klass.name) {
+ proto = Object.getPrototypeOf(proto);
+ if (!proto || ++depth > MAX_CLASS_DEPTH)
+ return (false);
+ }
+ if (proto.constructor.name !== klass.name)
+ return (false);
+ var ver = proto._sshpkApiVersion;
+ if (ver === undefined)
+ ver = klass._oldVersionDetect(obj);
+ if (ver[0] != needVer[0] || ver[1] < needVer[1])
+ return (false);
+ return (true);
+}
+
+function assertCompatible(obj, klass, needVer, name) {
+ if (name === undefined)
+ name = 'object';
+ assert.ok(obj, name + ' must not be null');
+ assert.object(obj, name + ' must be an object');
+ if (needVer === undefined)
+ needVer = klass.prototype._sshpkApiVersion;
+ if (obj instanceof klass &&
+ klass.prototype._sshpkApiVersion[0] == needVer[0])
+ return;
+ var proto = Object.getPrototypeOf(obj);
+ var depth = 0;
+ while (proto.constructor.name !== klass.name) {
+ proto = Object.getPrototypeOf(proto);
+ assert.ok(proto && ++depth <= MAX_CLASS_DEPTH,
+ name + ' must be a ' + klass.name + ' instance');
+ }
+ assert.strictEqual(proto.constructor.name, klass.name,
+ name + ' must be a ' + klass.name + ' instance');
+ var ver = proto._sshpkApiVersion;
+ if (ver === undefined)
+ ver = klass._oldVersionDetect(obj);
+ assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1],
+ name + ' must be compatible with ' + klass.name + ' klass ' +
+ 'version ' + needVer[0] + '.' + needVer[1]);
+}
+
+var CIPHER_LEN = {
+ 'des-ede3-cbc': { key: 7, iv: 8 },
+ 'aes-128-cbc': { key: 16, iv: 16 }
+};
+var PKCS5_SALT_LEN = 8;
+
+function opensslKeyDeriv(cipher, salt, passphrase, count) {
+ assert.buffer(salt, 'salt');
+ assert.buffer(passphrase, 'passphrase');
+ assert.number(count, 'iteration count');
+
+ var clen = CIPHER_LEN[cipher];
+ assert.object(clen, 'supported cipher');
+
+ salt = salt.slice(0, PKCS5_SALT_LEN);
+
+ var D, D_prev, bufs;
+ var material = Buffer.alloc(0);
+ while (material.length < clen.key + clen.iv) {
+ bufs = [];
+ if (D_prev)
+ bufs.push(D_prev);
+ bufs.push(passphrase);
+ bufs.push(salt);
+ D = Buffer.concat(bufs);
+ for (var j = 0; j < count; ++j)
+ D = crypto.createHash('md5').update(D).digest();
+ material = Buffer.concat([material, D]);
+ D_prev = D;
+ }
+
+ return ({
+ key: material.slice(0, clen.key),
+ iv: material.slice(clen.key, clen.key + clen.iv)
+ });
+}
+
+/* Count leading zero bits on a buffer */
+function countZeros(buf) {
+ var o = 0, obit = 8;
+ while (o < buf.length) {
+ var mask = (1 << obit);
+ if ((buf[o] & mask) === mask)
+ break;
+ obit--;
+ if (obit < 0) {
+ o++;
+ obit = 8;
+ }
+ }
+ return (o*8 + (8 - obit) - 1);
+}
+
+function bufferSplit(buf, chr) {
+ assert.buffer(buf);
+ assert.string(chr);
+
+ var parts = [];
+ var lastPart = 0;
+ var matches = 0;
+ for (var i = 0; i < buf.length; ++i) {
+ if (buf[i] === chr.charCodeAt(matches))
+ ++matches;
+ else if (buf[i] === chr.charCodeAt(0))
+ matches = 1;
+ else
+ matches = 0;
+
+ if (matches >= chr.length) {
+ var newPart = i + 1;
+ parts.push(buf.slice(lastPart, newPart - matches));
+ lastPart = newPart;
+ matches = 0;
+ }
+ }
+ if (lastPart <= buf.length)
+ parts.push(buf.slice(lastPart, buf.length));
+
+ return (parts);
+}
+
+function ecNormalize(buf, addZero) {
+ assert.buffer(buf);
+ if (buf[0] === 0x00 && buf[1] === 0x04) {
+ if (addZero)
+ return (buf);
+ return (buf.slice(1));
+ } else if (buf[0] === 0x04) {
+ if (!addZero)
+ return (buf);
+ } else {
+ while (buf[0] === 0x00)
+ buf = buf.slice(1);
+ if (buf[0] === 0x02 || buf[0] === 0x03)
+ throw (new Error('Compressed elliptic curve points ' +
+ 'are not supported'));
+ if (buf[0] !== 0x04)
+ throw (new Error('Not a valid elliptic curve point'));
+ if (!addZero)
+ return (buf);
+ }
+ var b = Buffer.alloc(buf.length + 1);
+ b[0] = 0x0;
+ buf.copy(b, 1);
+ return (b);
+}
+
+function readBitString(der, tag) {
+ if (tag === undefined)
+ tag = asn1.Ber.BitString;
+ var buf = der.readString(tag, true);
+ assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' +
+ 'not supported (0x' + buf[0].toString(16) + ')');
+ return (buf.slice(1));
+}
+
+function writeBitString(der, buf, tag) {
+ if (tag === undefined)
+ tag = asn1.Ber.BitString;
+ var b = Buffer.alloc(buf.length + 1);
+ b[0] = 0x00;
+ buf.copy(b, 1);
+ der.writeBuffer(b, tag);
+}
+
+function mpNormalize(buf) {
+ assert.buffer(buf);
+ while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00)
+ buf = buf.slice(1);
+ if ((buf[0] & 0x80) === 0x80) {
+ var b = Buffer.alloc(buf.length + 1);
+ b[0] = 0x00;
+ buf.copy(b, 1);
+ buf = b;
+ }
+ return (buf);
+}
+
+function mpDenormalize(buf) {
+ assert.buffer(buf);
+ while (buf.length > 1 && buf[0] === 0x00)
+ buf = buf.slice(1);
+ return (buf);
+}
+
+function zeroPadToLength(buf, len) {
+ assert.buffer(buf);
+ assert.number(len);
+ while (buf.length > len) {
+ assert.equal(buf[0], 0x00);
+ buf = buf.slice(1);
+ }
+ while (buf.length < len) {
+ var b = Buffer.alloc(buf.length + 1);
+ b[0] = 0x00;
+ buf.copy(b, 1);
+ buf = b;
+ }
+ return (buf);
+}
+
+function bigintToMpBuf(bigint) {
+ var buf = Buffer.from(bigint.toByteArray());
+ buf = mpNormalize(buf);
+ return (buf);
+}
+
+function calculateDSAPublic(g, p, x) {
+ assert.buffer(g);
+ assert.buffer(p);
+ assert.buffer(x);
+ try {
+ var bigInt = __webpack_require__(81).BigInteger;
+ } catch (e) {
+ throw (new Error('To load a PKCS#8 format DSA private key, ' +
+ 'the node jsbn library is required.'));
+ }
+ g = new bigInt(g);
+ p = new bigInt(p);
+ x = new bigInt(x);
+ var y = g.modPow(x, p);
+ var ybuf = bigintToMpBuf(y);
+ return (ybuf);
+}
+
+function calculateED25519Public(k) {
+ assert.buffer(k);
+
+ if (nacl === undefined)
+ nacl = __webpack_require__(76);
+
+ var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k));
+ return (Buffer.from(kp.publicKey));
+}
+
+function calculateX25519Public(k) {
+ assert.buffer(k);
+
+ if (nacl === undefined)
+ nacl = __webpack_require__(76);
+
+ var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k));
+ return (Buffer.from(kp.publicKey));
+}
+
+function addRSAMissing(key) {
+ assert.object(key);
+ assertCompatible(key, PrivateKey, [1, 1]);
+ try {
+ var bigInt = __webpack_require__(81).BigInteger;
+ } catch (e) {
+ throw (new Error('To write a PEM private key from ' +
+ 'this source, the node jsbn lib is required.'));
+ }
+
+ var d = new bigInt(key.part.d.data);
+ var buf;
+
+ if (!key.part.dmodp) {
+ var p = new bigInt(key.part.p.data);
+ var dmodp = d.mod(p.subtract(1));
+
+ buf = bigintToMpBuf(dmodp);
+ key.part.dmodp = {name: 'dmodp', data: buf};
+ key.parts.push(key.part.dmodp);
+ }
+ if (!key.part.dmodq) {
+ var q = new bigInt(key.part.q.data);
+ var dmodq = d.mod(q.subtract(1));
+
+ buf = bigintToMpBuf(dmodq);
+ key.part.dmodq = {name: 'dmodq', data: buf};
+ key.parts.push(key.part.dmodq);
+ }
+}
+
+function publicFromPrivateECDSA(curveName, priv) {
+ assert.string(curveName, 'curveName');
+ assert.buffer(priv);
+ if (ec === undefined)
+ ec = __webpack_require__(139);
+ if (jsbn === undefined)
+ jsbn = __webpack_require__(81).BigInteger;
+ var params = algs.curves[curveName];
+ var p = new jsbn(params.p);
+ var a = new jsbn(params.a);
+ var b = new jsbn(params.b);
+ var curve = new ec.ECCurveFp(p, a, b);
+ var G = curve.decodePointHex(params.G.toString('hex'));
+
+ var d = new jsbn(mpNormalize(priv));
+ var pub = G.multiply(d);
+ pub = Buffer.from(curve.encodePointHex(pub), 'hex');
+
+ var parts = [];
+ parts.push({name: 'curve', data: Buffer.from(curveName)});
+ parts.push({name: 'Q', data: pub});
+
+ var key = new Key({type: 'ecdsa', curve: curve, parts: parts});
+ return (key);
+}
+
+function opensshCipherInfo(cipher) {
+ var inf = {};
+ switch (cipher) {
+ case '3des-cbc':
+ inf.keySize = 24;
+ inf.blockSize = 8;
+ inf.opensslName = 'des-ede3-cbc';
+ break;
+ case 'blowfish-cbc':
+ inf.keySize = 16;
+ inf.blockSize = 8;
+ inf.opensslName = 'bf-cbc';
+ break;
+ case 'aes128-cbc':
+ case 'aes128-ctr':
+ case 'aes128-gcm@openssh.com':
+ inf.keySize = 16;
+ inf.blockSize = 16;
+ inf.opensslName = 'aes-128-' + cipher.slice(7, 10);
+ break;
+ case 'aes192-cbc':
+ case 'aes192-ctr':
+ case 'aes192-gcm@openssh.com':
+ inf.keySize = 24;
+ inf.blockSize = 16;
+ inf.opensslName = 'aes-192-' + cipher.slice(7, 10);
+ break;
+ case 'aes256-cbc':
+ case 'aes256-ctr':
+ case 'aes256-gcm@openssh.com':
+ inf.keySize = 32;
+ inf.blockSize = 16;
+ inf.opensslName = 'aes-256-' + cipher.slice(7, 10);
+ break;
+ default:
+ throw (new Error(
+ 'Unsupported openssl cipher "' + cipher + '"'));
+ }
+ return (inf);
+}
+
+
+/***/ }),
+/* 27 */
+/***/ (function(module, exports, __webpack_require__) {
+
+// Copyright 2017 Joyent, Inc.
+
+module.exports = Key;
+
+var assert = __webpack_require__(16);
+var algs = __webpack_require__(32);
+var crypto = __webpack_require__(11);
+var Fingerprint = __webpack_require__(156);
+var Signature = __webpack_require__(75);
+var DiffieHellman = __webpack_require__(325).DiffieHellman;
+var errs = __webpack_require__(74);
+var utils = __webpack_require__(26);
+var PrivateKey = __webpack_require__(33);
+var edCompat;
+
+try {
+ edCompat = __webpack_require__(454);
+} catch (e) {
+ /* Just continue through, and bail out if we try to use it. */
+}
+
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+var KeyParseError = errs.KeyParseError;
+
+var formats = {};
+formats['auto'] = __webpack_require__(455);
+formats['pem'] = __webpack_require__(86);
+formats['pkcs1'] = __webpack_require__(327);
+formats['pkcs8'] = __webpack_require__(157);
+formats['rfc4253'] = __webpack_require__(103);
+formats['ssh'] = __webpack_require__(456);
+formats['ssh-private'] = __webpack_require__(192);
+formats['openssh'] = formats['ssh-private'];
+formats['dnssec'] = __webpack_require__(326);
+
+function Key(opts) {
+ assert.object(opts, 'options');
+ assert.arrayOfObject(opts.parts, 'options.parts');
+ assert.string(opts.type, 'options.type');
+ assert.optionalString(opts.comment, 'options.comment');
+
+ var algInfo = algs.info[opts.type];
+ if (typeof (algInfo) !== 'object')
+ throw (new InvalidAlgorithmError(opts.type));
+
+ var partLookup = {};
+ for (var i = 0; i < opts.parts.length; ++i) {
+ var part = opts.parts[i];
+ partLookup[part.name] = part;
+ }
+
+ this.type = opts.type;
+ this.parts = opts.parts;
+ this.part = partLookup;
+ this.comment = undefined;
+ this.source = opts.source;
+
+ /* for speeding up hashing/fingerprint operations */
+ this._rfc4253Cache = opts._rfc4253Cache;
+ this._hashCache = {};
+
+ var sz;
+ this.curve = undefined;
+ if (this.type === 'ecdsa') {
+ var curve = this.part.curve.data.toString();
+ this.curve = curve;
+ sz = algs.curves[curve].size;
+ } else if (this.type === 'ed25519' || this.type === 'curve25519') {
+ sz = 256;
+ this.curve = 'curve25519';
+ } else {
+ var szPart = this.part[algInfo.sizePart];
+ sz = szPart.data.length;
+ sz = sz * 8 - utils.countZeros(szPart.data);
+ }
+ this.size = sz;
+}
+
+Key.formats = formats;
+
+Key.prototype.toBuffer = function (format, options) {
+ if (format === undefined)
+ format = 'ssh';
+ assert.string(format, 'format');
+ assert.object(formats[format], 'formats[format]');
+ assert.optionalObject(options, 'options');
+
+ if (format === 'rfc4253') {
+ if (this._rfc4253Cache === undefined)
+ this._rfc4253Cache = formats['rfc4253'].write(this);
+ return (this._rfc4253Cache);
+ }
+
+ return (formats[format].write(this, options));
+};
+
+Key.prototype.toString = function (format, options) {
+ return (this.toBuffer(format, options).toString());
+};
+
+Key.prototype.hash = function (algo) {
+ assert.string(algo, 'algorithm');
+ algo = algo.toLowerCase();
+ if (algs.hashAlgs[algo] === undefined)
+ throw (new InvalidAlgorithmError(algo));
+
+ if (this._hashCache[algo])
+ return (this._hashCache[algo]);
+ var hash = crypto.createHash(algo).
+ update(this.toBuffer('rfc4253')).digest();
+ this._hashCache[algo] = hash;
+ return (hash);
+};
+
+Key.prototype.fingerprint = function (algo) {
+ if (algo === undefined)
+ algo = 'sha256';
+ assert.string(algo, 'algorithm');
+ var opts = {
+ type: 'key',
+ hash: this.hash(algo),
+ algorithm: algo
+ };
+ return (new Fingerprint(opts));
+};
+
+Key.prototype.defaultHashAlgorithm = function () {
+ var hashAlgo = 'sha1';
+ if (this.type === 'rsa')
+ hashAlgo = 'sha256';
+ if (this.type === 'dsa' && this.size > 1024)
+ hashAlgo = 'sha256';
+ if (this.type === 'ed25519')
+ hashAlgo = 'sha512';
+ if (this.type === 'ecdsa') {
+ if (this.size <= 256)
+ hashAlgo = 'sha256';
+ else if (this.size <= 384)
+ hashAlgo = 'sha384';
+ else
+ hashAlgo = 'sha512';
+ }
+ return (hashAlgo);
+};
+
+Key.prototype.createVerify = function (hashAlgo) {
+ if (hashAlgo === undefined)
+ hashAlgo = this.defaultHashAlgorithm();
+ assert.string(hashAlgo, 'hash algorithm');
+
+ /* ED25519 is not supported by OpenSSL, use a javascript impl. */
+ if (this.type === 'ed25519' && edCompat !== undefined)
+ return (new edCompat.Verifier(this, hashAlgo));
+ if (this.type === 'curve25519')
+ throw (new Error('Curve25519 keys are not suitable for ' +
+ 'signing or verification'));
+
+ var v, nm, err;
+ try {
+ nm = hashAlgo.toUpperCase();
+ v = crypto.createVerify(nm);
+ } catch (e) {
+ err = e;
+ }
+ if (v === undefined || (err instanceof Error &&
+ err.message.match(/Unknown message digest/))) {
+ nm = 'RSA-';
+ nm += hashAlgo.toUpperCase();
+ v = crypto.createVerify(nm);
+ }
+ assert.ok(v, 'failed to create verifier');
+ var oldVerify = v.verify.bind(v);
+ var key = this.toBuffer('pkcs8');
+ var curve = this.curve;
+ var self = this;
+ v.verify = function (signature, fmt) {
+ if (Signature.isSignature(signature, [2, 0])) {
+ if (signature.type !== self.type)
+ return (false);
+ if (signature.hashAlgorithm &&
+ signature.hashAlgorithm !== hashAlgo)
+ return (false);
+ if (signature.curve && self.type === 'ecdsa' &&
+ signature.curve !== curve)
+ return (false);
+ return (oldVerify(key, signature.toBuffer('asn1')));
+
+ } else if (typeof (signature) === 'string' ||
+ Buffer.isBuffer(signature)) {
+ return (oldVerify(key, signature, fmt));
+
+ /*
+ * Avoid doing this on valid arguments, walking the prototype
+ * chain can be quite slow.
+ */
+ } else if (Signature.isSignature(signature, [1, 0])) {
+ throw (new Error('signature was created by too old ' +
+ 'a version of sshpk and cannot be verified'));
+
+ } else {
+ throw (new TypeError('signature must be a string, ' +
+ 'Buffer, or Signature object'));
+ }
+ };
+ return (v);
+};
+
+Key.prototype.createDiffieHellman = function () {
+ if (this.type === 'rsa')
+ throw (new Error('RSA keys do not support Diffie-Hellman'));
+
+ return (new DiffieHellman(this));
+};
+Key.prototype.createDH = Key.prototype.createDiffieHellman;
+
+Key.parse = function (data, format, options) {
+ if (typeof (data) !== 'string')
+ assert.buffer(data, 'data');
+ if (format === undefined)
+ format = 'auto';
+ assert.string(format, 'format');
+ if (typeof (options) === 'string')
+ options = { filename: options };
+ assert.optionalObject(options, 'options');
+ if (options === undefined)
+ options = {};
+ assert.optionalString(options.filename, 'options.filename');
+ if (options.filename === undefined)
+ options.filename = '(unnamed)';
+
+ assert.object(formats[format], 'formats[format]');
+
+ try {
+ var k = formats[format].read(data, options);
+ if (k instanceof PrivateKey)
+ k = k.toPublic();
+ if (!k.comment)
+ k.comment = options.filename;
+ return (k);
+ } catch (e) {
+ if (e.name === 'KeyEncryptedError')
+ throw (e);
+ throw (new KeyParseError(options.filename, format, e));
+ }
+};
+
+Key.isKey = function (obj, ver) {
+ return (utils.isCompatible(obj, Key, ver));
+};
+
+/*
+ * API versions for Key:
+ * [1,0] -- initial ver, may take Signature for createVerify or may not
+ * [1,1] -- added pkcs1, pkcs8 formats
+ * [1,2] -- added auto, ssh-private, openssh formats
+ * [1,3] -- added defaultHashAlgorithm
+ * [1,4] -- added ed support, createDH
+ * [1,5] -- first explicitly tagged version
+ * [1,6] -- changed ed25519 part names
+ */
+Key.prototype._sshpkApiVersion = [1, 6];
+
+Key._oldVersionDetect = function (obj) {
+ assert.func(obj.toBuffer);
+ assert.func(obj.fingerprint);
+ if (obj.createDH)
+ return ([1, 4]);
+ if (obj.defaultHashAlgorithm)
+ return ([1, 3]);
+ if (obj.formats['auto'])
+ return ([1, 2]);
+ if (obj.formats['pkcs1'])
+ return ([1, 1]);
+ return ([1, 0]);
+};
+
+
+/***/ }),
+/* 28 */
+/***/ (function(module, exports) {
+
+module.exports = require("assert");
+
+/***/ }),
+/* 29 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.default = nullify;
+function nullify(obj = {}) {
+ if (Array.isArray(obj)) {
+ for (var _iterator = obj, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+ var _ref;
+
+ if (_isArray) {
+ if (_i >= _iterator.length) break;
+ _ref = _iterator[_i++];
+ } else {
+ _i = _iterator.next();
+ if (_i.done) break;
+ _ref = _i.value;
+ }
+
+ const item = _ref;
+
+ nullify(item);
+ }
+ } else if (obj !== null && typeof obj === 'object' || typeof obj === 'function') {
+ Object.setPrototypeOf(obj, null);
+
+ // for..in can only be applied to 'object', not 'function'
+ if (typeof obj === 'object') {
+ for (const key in obj) {
+ nullify(obj[key]);
+ }
+ }
+ }
+
+ return obj;
+}
+
+/***/ }),
+/* 30 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+const escapeStringRegexp = __webpack_require__(388);
+const ansiStyles = __webpack_require__(506);
+const stdoutColor = __webpack_require__(598).stdout;
+
+const template = __webpack_require__(599);
+
+const isSimpleWindowsTerm = process.platform === 'win32' && !(process.env.TERM || '').toLowerCase().startsWith('xterm');
+
+// `supportsColor.level` → `ansiStyles.color[name]` mapping
+const levelMapping = ['ansi', 'ansi', 'ansi256', 'ansi16m'];
+
+// `color-convert` models to exclude from the Chalk API due to conflicts and such
+const skipModels = new Set(['gray']);
+
+const styles = Object.create(null);
+
+function applyOptions(obj, options) {
+ options = options || {};
+
+ // Detect level if not set manually
+ const scLevel = stdoutColor ? stdoutColor.level : 0;
+ obj.level = options.level === undefined ? scLevel : options.level;
+ obj.enabled = 'enabled' in options ? options.enabled : obj.level > 0;
+}
+
+function Chalk(options) {
+ // We check for this.template here since calling `chalk.constructor()`
+ // by itself will have a `this` of a previously constructed chalk object
+ if (!this || !(this instanceof Chalk) || this.template) {
+ const chalk = {};
+ applyOptions(chalk, options);
+
+ chalk.template = function () {
+ const args = [].slice.call(arguments);
+ return chalkTag.apply(null, [chalk.template].concat(args));
+ };
+
+ Object.setPrototypeOf(chalk, Chalk.prototype);
+ Object.setPrototypeOf(chalk.template, chalk);
+
+ chalk.template.constructor = Chalk;
+
+ return chalk.template;
+ }
+
+ applyOptions(this, options);
+}
+
+// Use bright blue on Windows as the normal blue color is illegible
+if (isSimpleWindowsTerm) {
+ ansiStyles.blue.open = '\u001B[94m';
+}
+
+for (const key of Object.keys(ansiStyles)) {
+ ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g');
+
+ styles[key] = {
+ get() {
+ const codes = ansiStyles[key];
+ return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, key);
+ }
+ };
+}
+
+styles.visible = {
+ get() {
+ return build.call(this, this._styles || [], true, 'visible');
+ }
+};
+
+ansiStyles.color.closeRe = new RegExp(escapeStringRegexp(ansiStyles.color.close), 'g');
+for (const model of Object.keys(ansiStyles.color.ansi)) {
+ if (skipModels.has(model)) {
+ continue;
+ }
+
+ styles[model] = {
+ get() {
+ const level = this.level;
+ return function () {
+ const open = ansiStyles.color[levelMapping[level]][model].apply(null, arguments);
+ const codes = {
+ open,
+ close: ansiStyles.color.close,
+ closeRe: ansiStyles.color.closeRe
+ };
+ return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model);
+ };
+ }
+ };
+}
+
+ansiStyles.bgColor.closeRe = new RegExp(escapeStringRegexp(ansiStyles.bgColor.close), 'g');
+for (const model of Object.keys(ansiStyles.bgColor.ansi)) {
+ if (skipModels.has(model)) {
+ continue;
+ }
+
+ const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1);
+ styles[bgModel] = {
+ get() {
+ const level = this.level;
+ return function () {
+ const open = ansiStyles.bgColor[levelMapping[level]][model].apply(null, arguments);
+ const codes = {
+ open,
+ close: ansiStyles.bgColor.close,
+ closeRe: ansiStyles.bgColor.closeRe
+ };
+ return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model);
+ };
+ }
+ };
+}
+
+const proto = Object.defineProperties(() => {}, styles);
+
+function build(_styles, _empty, key) {
+ const builder = function () {
+ return applyStyle.apply(builder, arguments);
+ };
+
+ builder._styles = _styles;
+ builder._empty = _empty;
+
+ const self = this;
+
+ Object.defineProperty(builder, 'level', {
+ enumerable: true,
+ get() {
+ return self.level;
+ },
+ set(level) {
+ self.level = level;
+ }
+ });
+
+ Object.defineProperty(builder, 'enabled', {
+ enumerable: true,
+ get() {
+ return self.enabled;
+ },
+ set(enabled) {
+ self.enabled = enabled;
+ }
+ });
+
+ // See below for fix regarding invisible grey/dim combination on Windows
+ builder.hasGrey = this.hasGrey || key === 'gray' || key === 'grey';
+
+ // `__proto__` is used because we must return a function, but there is
+ // no way to create a function with a different prototype
+ builder.__proto__ = proto; // eslint-disable-line no-proto
+
+ return builder;
+}
+
+function applyStyle() {
+ // Support varags, but simply cast to string in case there's only one arg
+ const args = arguments;
+ const argsLen = args.length;
+ let str = String(arguments[0]);
+
+ if (argsLen === 0) {
+ return '';
+ }
+
+ if (argsLen > 1) {
+ // Don't slice `arguments`, it prevents V8 optimizations
+ for (let a = 1; a < argsLen; a++) {
+ str += ' ' + args[a];
+ }
+ }
+
+ if (!this.enabled || this.level <= 0 || !str) {
+ return this._empty ? '' : str;
+ }
+
+ // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe,
+ // see https://github.com/chalk/chalk/issues/58
+ // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop.
+ const originalDim = ansiStyles.dim.open;
+ if (isSimpleWindowsTerm && this.hasGrey) {
+ ansiStyles.dim.open = '';
+ }
+
+ for (const code of this._styles.slice().reverse()) {
+ // Replace any instances already present with a re-opening code
+ // otherwise only the part of the string until said closing code
+ // will be colored, and the rest will simply be 'plain'.
+ str = code.open + str.replace(code.closeRe, code.open) + code.close;
+
+ // Close the styling before a linebreak and reopen
+ // after next line to fix a bleed issue on macOS
+ // https://github.com/chalk/chalk/pull/92
+ str = str.replace(/\r?\n/g, `${code.close}$&${code.open}`);
+ }
+
+ // Reset the original `dim` if we changed it to work around the Windows dimmed gray issue
+ ansiStyles.dim.open = originalDim;
+
+ return str;
+}
+
+function chalkTag(chalk, strings) {
+ if (!Array.isArray(strings)) {
+ // If chalk() was called by itself or with a string,
+ // return the string itself as a string.
+ return [].slice.call(arguments, 1).join(' ');
+ }
+
+ const args = [].slice.call(arguments, 2);
+ const parts = [strings.raw[0]];
+
+ for (let i = 1; i < strings.length; i++) {
+ parts.push(String(args[i - 1]).replace(/[{}\\]/g, '\\$&'));
+ parts.push(String(strings.raw[i]));
+ }
+
+ return template(chalk, parts.join(''));
+}
+
+Object.defineProperties(Chalk.prototype, styles);
+
+module.exports = Chalk(); // eslint-disable-line new-cap
+module.exports.supportsColor = stdoutColor;
+module.exports.default = module.exports; // For TypeScript
+
+
+/***/ }),
+/* 31 */
+/***/ (function(module, exports) {
+
+var core = module.exports = { version: '2.5.7' };
+if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef
+
+
+/***/ }),
+/* 32 */
+/***/ (function(module, exports, __webpack_require__) {
+
+// Copyright 2015 Joyent, Inc.
+
+var Buffer = __webpack_require__(15).Buffer;
+
+var algInfo = {
+ 'dsa': {
+ parts: ['p', 'q', 'g', 'y'],
+ sizePart: 'p'
+ },
+ 'rsa': {
+ parts: ['e', 'n'],
+ sizePart: 'n'
+ },
+ 'ecdsa': {
+ parts: ['curve', 'Q'],
+ sizePart: 'Q'
+ },
+ 'ed25519': {
+ parts: ['A'],
+ sizePart: 'A'
+ }
+};
+algInfo['curve25519'] = algInfo['ed25519'];
+
+var algPrivInfo = {
+ 'dsa': {
+ parts: ['p', 'q', 'g', 'y', 'x']
+ },
+ 'rsa': {
+ parts: ['n', 'e', 'd', 'iqmp', 'p', 'q']
+ },
+ 'ecdsa': {
+ parts: ['curve', 'Q', 'd']
+ },
+ 'ed25519': {
+ parts: ['A', 'k']
+ }
+};
+algPrivInfo['curve25519'] = algPrivInfo['ed25519'];
+
+var hashAlgs = {
+ 'md5': true,
+ 'sha1': true,
+ 'sha256': true,
+ 'sha384': true,
+ 'sha512': true
+};
+
+/*
+ * Taken from
+ * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf
+ */
+var curves = {
+ 'nistp256': {
+ size: 256,
+ pkcs8oid: '1.2.840.10045.3.1.7',
+ p: Buffer.from(('00' +
+ 'ffffffff 00000001 00000000 00000000' +
+ '00000000 ffffffff ffffffff ffffffff').
+ replace(/ /g, ''), 'hex'),
+ a: Buffer.from(('00' +
+ 'FFFFFFFF 00000001 00000000 00000000' +
+ '00000000 FFFFFFFF FFFFFFFF FFFFFFFC').
+ replace(/ /g, ''), 'hex'),
+ b: Buffer.from((
+ '5ac635d8 aa3a93e7 b3ebbd55 769886bc' +
+ '651d06b0 cc53b0f6 3bce3c3e 27d2604b').
+ replace(/ /g, ''), 'hex'),
+ s: Buffer.from(('00' +
+ 'c49d3608 86e70493 6a6678e1 139d26b7' +
+ '819f7e90').
+ replace(/ /g, ''), 'hex'),
+ n: Buffer.from(('00' +
+ 'ffffffff 00000000 ffffffff ffffffff' +
+ 'bce6faad a7179e84 f3b9cac2 fc632551').
+ replace(/ /g, ''), 'hex'),
+ G: Buffer.from(('04' +
+ '6b17d1f2 e12c4247 f8bce6e5 63a440f2' +
+ '77037d81 2deb33a0 f4a13945 d898c296' +
+ '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' +
+ '2bce3357 6b315ece cbb64068 37bf51f5').
+ replace(/ /g, ''), 'hex')
+ },
+ 'nistp384': {
+ size: 384,
+ pkcs8oid: '1.3.132.0.34',
+ p: Buffer.from(('00' +
+ 'ffffffff ffffffff ffffffff ffffffff' +
+ 'ffffffff ffffffff ffffffff fffffffe' +
+ 'ffffffff 00000000 00000000 ffffffff').
+ replace(/ /g, ''), 'hex'),
+ a: Buffer.from(('00' +
+ 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+ 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' +
+ 'FFFFFFFF 00000000 00000000 FFFFFFFC').
+ replace(/ /g, ''), 'hex'),
+ b: Buffer.from((
+ 'b3312fa7 e23ee7e4 988e056b e3f82d19' +
+ '181d9c6e fe814112 0314088f 5013875a' +
+ 'c656398d 8a2ed19d 2a85c8ed d3ec2aef').
+ replace(/ /g, ''), 'hex'),
+ s: Buffer.from(('00' +
+ 'a335926a a319a27a 1d00896a 6773a482' +
+ '7acdac73').
+ replace(/ /g, ''), 'hex'),
+ n: Buffer.from(('00' +
+ 'ffffffff ffffffff ffffffff ffffffff' +
+ 'ffffffff ffffffff c7634d81 f4372ddf' +
+ '581a0db2 48b0a77a ecec196a ccc52973').
+ replace(/ /g, ''), 'hex'),
+ G: Buffer.from(('04' +
+ 'aa87ca22 be8b0537 8eb1c71e f320ad74' +
+ '6e1d3b62 8ba79b98 59f741e0 82542a38' +
+ '5502f25d bf55296c 3a545e38 72760ab7' +
+ '3617de4a 96262c6f 5d9e98bf 9292dc29' +
+ 'f8f41dbd 289a147c e9da3113 b5f0b8c0' +
+ '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f').
+ replace(/ /g, ''), 'hex')
+ },
+ 'nistp521': {
+ size: 521,
+ pkcs8oid: '1.3.132.0.35',
+ p: Buffer.from((
+ '01ffffff ffffffff ffffffff ffffffff' +
+ 'ffffffff ffffffff ffffffff ffffffff' +
+ 'ffffffff ffffffff ffffffff ffffffff' +
+ 'ffffffff ffffffff ffffffff ffffffff' +
+ 'ffff').replace(/ /g, ''), 'hex'),
+ a: Buffer.from(('01FF' +
+ 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+ 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+ 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+ 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC').
+ replace(/ /g, ''), 'hex'),
+ b: Buffer.from(('51' +
+ '953eb961 8e1c9a1f 929a21a0 b68540ee' +
+ 'a2da725b 99b315f3 b8b48991 8ef109e1' +
+ '56193951 ec7e937b 1652c0bd 3bb1bf07' +
+ '3573df88 3d2c34f1 ef451fd4 6b503f00').
+ replace(/ /g, ''), 'hex'),
+ s: Buffer.from(('00' +
+ 'd09e8800 291cb853 96cc6717 393284aa' +
+ 'a0da64ba').replace(/ /g, ''), 'hex'),
+ n: Buffer.from(('01ff' +
+ 'ffffffff ffffffff ffffffff ffffffff' +
+ 'ffffffff ffffffff ffffffff fffffffa' +
+ '51868783 bf2f966b 7fcc0148 f709a5d0' +
+ '3bb5c9b8 899c47ae bb6fb71e 91386409').
+ replace(/ /g, ''), 'hex'),
+ G: Buffer.from(('04' +
+ '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' +
+ '9c648139 053fb521 f828af60 6b4d3dba' +
+ 'a14b5e77 efe75928 fe1dc127 a2ffa8de' +
+ '3348b3c1 856a429b f97e7e31 c2e5bd66' +
+ '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' +
+ '98f54449 579b4468 17afbd17 273e662c' +
+ '97ee7299 5ef42640 c550b901 3fad0761' +
+ '353c7086 a272c240 88be9476 9fd16650').
+ replace(/ /g, ''), 'hex')
+ }
+};
+
+module.exports = {
+ info: algInfo,
+ privInfo: algPrivInfo,
+ hashAlgs: hashAlgs,
+ curves: curves
+};
+
+
+/***/ }),
+/* 33 */
+/***/ (function(module, exports, __webpack_require__) {
+
+// Copyright 2017 Joyent, Inc.
+
+module.exports = PrivateKey;
+
+var assert = __webpack_require__(16);
+var Buffer = __webpack_require__(15).Buffer;
+var algs = __webpack_require__(32);
+var crypto = __webpack_require__(11);
+var Fingerprint = __webpack_require__(156);
+var Signature = __webpack_require__(75);
+var errs = __webpack_require__(74);
+var util = __webpack_require__(3);
+var utils = __webpack_require__(26);
+var dhe = __webpack_require__(325);
+var generateECDSA = dhe.generateECDSA;
+var generateED25519 = dhe.generateED25519;
+var edCompat;
+var nacl;
+
+try {
+ edCompat = __webpack_require__(454);
+} catch (e) {
+ /* Just continue through, and bail out if we try to use it. */
+}
+
+var Key = __webpack_require__(27);
+
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+var KeyParseError = errs.KeyParseError;
+var KeyEncryptedError = errs.KeyEncryptedError;
+
+var formats = {};
+formats['auto'] = __webpack_require__(455);
+formats['pem'] = __webpack_require__(86);
+formats['pkcs1'] = __webpack_require__(327);
+formats['pkcs8'] = __webpack_require__(157);
+formats['rfc4253'] = __webpack_require__(103);
+formats['ssh-private'] = __webpack_require__(192);
+formats['openssh'] = formats['ssh-private'];
+formats['ssh'] = formats['ssh-private'];
+formats['dnssec'] = __webpack_require__(326);
+
+function PrivateKey(opts) {
+ assert.object(opts, 'options');
+ Key.call(this, opts);
+
+ this._pubCache = undefined;
+}
+util.inherits(PrivateKey, Key);
+
+PrivateKey.formats = formats;
+
+PrivateKey.prototype.toBuffer = function (format, options) {
+ if (format === undefined)
+ format = 'pkcs1';
+ assert.string(format, 'format');
+ assert.object(formats[format], 'formats[format]');
+ assert.optionalObject(options, 'options');
+
+ return (formats[format].write(this, options));
+};
+
+PrivateKey.prototype.hash = function (algo) {
+ return (this.toPublic().hash(algo));
+};
+
+PrivateKey.prototype.toPublic = function () {
+ if (this._pubCache)
+ return (this._pubCache);
+
+ var algInfo = algs.info[this.type];
+ var pubParts = [];
+ for (var i = 0; i < algInfo.parts.length; ++i) {
+ var p = algInfo.parts[i];
+ pubParts.push(this.part[p]);
+ }
+
+ this._pubCache = new Key({
+ type: this.type,
+ source: this,
+ parts: pubParts
+ });
+ if (this.comment)
+ this._pubCache.comment = this.comment;
+ return (this._pubCache);
+};
+
+PrivateKey.prototype.derive = function (newType) {
+ assert.string(newType, 'type');
+ var priv, pub, pair;
+
+ if (this.type === 'ed25519' && newType === 'curve25519') {
+ if (nacl === undefined)
+ nacl = __webpack_require__(76);
+
+ priv = this.part.k.data;
+ if (priv[0] === 0x00)
+ priv = priv.slice(1);
+
+ pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv));
+ pub = Buffer.from(pair.publicKey);
+
+ return (new PrivateKey({
+ type: 'curve25519',
+ parts: [
+ { name: 'A', data: utils.mpNormalize(pub) },
+ { name: 'k', data: utils.mpNormalize(priv) }
+ ]
+ }));
+ } else if (this.type === 'curve25519' && newType === 'ed25519') {
+ if (nacl === undefined)
+ nacl = __webpack_require__(76);
+
+ priv = this.part.k.data;
+ if (priv[0] === 0x00)
+ priv = priv.slice(1);
+
+ pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv));
+ pub = Buffer.from(pair.publicKey);
+
+ return (new PrivateKey({
+ type: 'ed25519',
+ parts: [
+ { name: 'A', data: utils.mpNormalize(pub) },
+ { name: 'k', data: utils.mpNormalize(priv) }
+ ]
+ }));
+ }
+ throw (new Error('Key derivation not supported from ' + this.type +
+ ' to ' + newType));
+};
+
+PrivateKey.prototype.createVerify = function (hashAlgo) {
+ return (this.toPublic().createVerify(hashAlgo));
+};
+
+PrivateKey.prototype.createSign = function (hashAlgo) {
+ if (hashAlgo === undefined)
+ hashAlgo = this.defaultHashAlgorithm();
+ assert.string(hashAlgo, 'hash algorithm');
+
+ /* ED25519 is not supported by OpenSSL, use a javascript impl. */
+ if (this.type === 'ed25519' && edCompat !== undefined)
+ return (new edCompat.Signer(this, hashAlgo));
+ if (this.type === 'curve25519')
+ throw (new Error('Curve25519 keys are not suitable for ' +
+ 'signing or verification'));
+
+ var v, nm, err;
+ try {
+ nm = hashAlgo.toUpperCase();
+ v = crypto.createSign(nm);
+ } catch (e) {
+ err = e;
+ }
+ if (v === undefined || (err instanceof Error &&
+ err.message.match(/Unknown message digest/))) {
+ nm = 'RSA-';
+ nm += hashAlgo.toUpperCase();
+ v = crypto.createSign(nm);
+ }
+ assert.ok(v, 'failed to create verifier');
+ var oldSign = v.sign.bind(v);
+ var key = this.toBuffer('pkcs1');
+ var type = this.type;
+ var curve = this.curve;
+ v.sign = function () {
+ var sig = oldSign(key);
+ if (typeof (sig) === 'string')
+ sig = Buffer.from(sig, 'binary');
+ sig = Signature.parse(sig, type, 'asn1');
+ sig.hashAlgorithm = hashAlgo;
+ sig.curve = curve;
+ return (sig);
+ };
+ return (v);
+};
+
+PrivateKey.parse = function (data, format, options) {
+ if (typeof (data) !== 'string')
+ assert.buffer(data, 'data');
+ if (format === undefined)
+ format = 'auto';
+ assert.string(format, 'format');
+ if (typeof (options) === 'string')
+ options = { filename: options };
+ assert.optionalObject(options, 'options');
+ if (options === undefined)
+ options = {};
+ assert.optionalString(options.filename, 'options.filename');
+ if (options.filename === undefined)
+ options.filename = '(unnamed)';
+
+ assert.object(formats[format], 'formats[format]');
+
+ try {
+ var k = formats[format].read(data, options);
+ assert.ok(k instanceof PrivateKey, 'key is not a private key');
+ if (!k.comment)
+ k.comment = options.filename;
+ return (k);
+ } catch (e) {
+ if (e.name === 'KeyEncryptedError')
+ throw (e);
+ throw (new KeyParseError(options.filename, format, e));
+ }
+};
+
+PrivateKey.isPrivateKey = function (obj, ver) {
+ return (utils.isCompatible(obj, PrivateKey, ver));
+};
+
+PrivateKey.generate = function (type, options) {
+ if (options === undefined)
+ options = {};
+ assert.object(options, 'options');
+
+ switch (type) {
+ case 'ecdsa':
+ if (options.curve === undefined)
+ options.curve = 'nistp256';
+ assert.string(options.curve, 'options.curve');
+ return (generateECDSA(options.curve));
+ case 'ed25519':
+ return (generateED25519());
+ default:
+ throw (new Error('Key generation not supported with key ' +
+ 'type "' + type + '"'));
+ }
+};
+
+/*
+ * API versions for PrivateKey:
+ * [1,0] -- initial ver
+ * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats
+ * [1,2] -- added defaultHashAlgorithm
+ * [1,3] -- added derive, ed, createDH
+ * [1,4] -- first tagged version
+ * [1,5] -- changed ed25519 part names and format
+ */
+PrivateKey.prototype._sshpkApiVersion = [1, 5];
+
+PrivateKey._oldVersionDetect = function (obj) {
+ assert.func(obj.toPublic);
+ assert.func(obj.createSign);
+ if (obj.derive)
+ return ([1, 3]);
+ if (obj.defaultHashAlgorithm)
+ return ([1, 2]);
+ if (obj.formats['auto'])
+ return ([1, 1]);
+ return ([1, 0]);
+};
+
+
+/***/ }),
+/* 34 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefined;
+
+var _extends2;
+
+function _load_extends() {
+ return _extends2 = _interopRequireDefault(__webpack_require__(21));
+}
+
+var _asyncToGenerator2;
+
+function _load_asyncToGenerator() {
+ return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2));
+}
+
+let install = exports.install = (() => {
+ var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, lockfile) {
+ yield wrapLifecycle(config, flags, (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const install = new Install(flags, config, reporter, lockfile);
+ yield install.init();
+ }));
+ });
+
+ return function install(_x7, _x8, _x9, _x10) {
+ return _ref29.apply(this, arguments);
+ };
+})();
+
+let run = exports.run = (() => {
+ var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, args) {
+ let lockfile;
+ let error = 'installCommandRenamed';
+ if (flags.lockfile === false) {
+ lockfile = new (_lockfile || _load_lockfile()).default();
+ } else {
+ lockfile = yield (_lockfile || _load_lockfile()).default.fromDirectory(config.lockfileFolder, reporter);
+ }
+
+ if (args.length) {
+ const exampleArgs = args.slice();
+
+ if (flags.saveDev) {
+ exampleArgs.push('--dev');
+ }
+ if (flags.savePeer) {
+ exampleArgs.push('--peer');
+ }
+ if (flags.saveOptional) {
+ exampleArgs.push('--optional');
+ }
+ if (flags.saveExact) {
+ exampleArgs.push('--exact');
+ }
+ if (flags.saveTilde) {
+ exampleArgs.push('--tilde');
+ }
+ let command = 'add';
+ if (flags.global) {
+ error = 'globalFlagRemoved';
+ command = 'global add';
+ }
+ throw new (_errors || _load_errors()).MessageError(reporter.lang(error, `yarn ${command} ${exampleArgs.join(' ')}`));
+ }
+
+ yield install(config, reporter, flags, lockfile);
+ });
+
+ return function run(_x11, _x12, _x13, _x14) {
+ return _ref31.apply(this, arguments);
+ };
+})();
+
+let wrapLifecycle = exports.wrapLifecycle = (() => {
+ var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, flags, factory) {
+ yield config.executeLifecycleScript('preinstall');
+
+ yield factory();
+
+ // npm behaviour, seems kinda funky but yay compatibility
+ yield config.executeLifecycleScript('install');
+ yield config.executeLifecycleScript('postinstall');
+
+ if (!config.production) {
+ if (!config.disablePrepublish) {
+ yield config.executeLifecycleScript('prepublish');
+ }
+ yield config.executeLifecycleScript('prepare');
+ }
+ });
+
+ return function wrapLifecycle(_x15, _x16, _x17) {
+ return _ref32.apply(this, arguments);
+ };
+})();
+
+exports.hasWrapper = hasWrapper;
+exports.setFlags = setFlags;
+
+var _objectPath;
+
+function _load_objectPath() {
+ return _objectPath = _interopRequireDefault(__webpack_require__(304));
+}
+
+var _hooks;
+
+function _load_hooks() {
+ return _hooks = __webpack_require__(374);
+}
+
+var _index;
+
+function _load_index() {
+ return _index = _interopRequireDefault(__webpack_require__(220));
+}
+
+var _errors;
+
+function _load_errors() {
+ return _errors = __webpack_require__(6);
+}
+
+var _integrityChecker;
+
+function _load_integrityChecker() {
+ return _integrityChecker = _interopRequireDefault(__webpack_require__(208));
+}
+
+var _lockfile;
+
+function _load_lockfile() {
+ return _lockfile = _interopRequireDefault(__webpack_require__(19));
+}
+
+var _lockfile2;
+
+function _load_lockfile2() {
+ return _lockfile2 = __webpack_require__(19);
+}
+
+var _packageFetcher;
+
+function _load_packageFetcher() {
+ return _packageFetcher = _interopRequireWildcard(__webpack_require__(210));
+}
+
+var _packageInstallScripts;
+
+function _load_packageInstallScripts() {
+ return _packageInstallScripts = _interopRequireDefault(__webpack_require__(557));
+}
+
+var _packageCompatibility;
+
+function _load_packageCompatibility() {
+ return _packageCompatibility = _interopRequireWildcard(__webpack_require__(209));
+}
+
+var _packageResolver;
+
+function _load_packageResolver() {
+ return _packageResolver = _interopRequireDefault(__webpack_require__(366));
+}
+
+var _packageLinker;
+
+function _load_packageLinker() {
+ return _packageLinker = _interopRequireDefault(__webpack_require__(211));
+}
+
+var _index2;
+
+function _load_index2() {
+ return _index2 = __webpack_require__(57);
+}
+
+var _index3;
+
+function _load_index3() {
+ return _index3 = __webpack_require__(78);
+}
+
+var _autoclean;
+
+function _load_autoclean() {
+ return _autoclean = __webpack_require__(354);
+}
+
+var _constants;
+
+function _load_constants() {
+ return _constants = _interopRequireWildcard(__webpack_require__(8));
+}
+
+var _normalizePattern;
+
+function _load_normalizePattern() {
+ return _normalizePattern = __webpack_require__(37);
+}
+
+var _fs;
+
+function _load_fs() {
+ return _fs = _interopRequireWildcard(__webpack_require__(4));
+}
+
+var _map;
+
+function _load_map() {
+ return _map = _interopRequireDefault(__webpack_require__(29));
+}
+
+var _yarnVersion;
+
+function _load_yarnVersion() {
+ return _yarnVersion = __webpack_require__(120);
+}
+
+var _generatePnpMap;
+
+function _load_generatePnpMap() {
+ return _generatePnpMap = __webpack_require__(579);
+}
+
+var _workspaceLayout;
+
+function _load_workspaceLayout() {
+ return _workspaceLayout = _interopRequireDefault(__webpack_require__(90));
+}
+
+var _resolutionMap;
+
+function _load_resolutionMap() {
+ return _resolutionMap = _interopRequireDefault(__webpack_require__(214));
+}
+
+var _guessName;
+
+function _load_guessName() {
+ return _guessName = _interopRequireDefault(__webpack_require__(169));
+}
+
+var _audit;
+
+function _load_audit() {
+ return _audit = _interopRequireDefault(__webpack_require__(353));
+}
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const deepEqual = __webpack_require__(631);
+
+const emoji = __webpack_require__(302);
+const invariant = __webpack_require__(9);
+const path = __webpack_require__(0);
+const semver = __webpack_require__(22);
+const uuid = __webpack_require__(119);
+const ssri = __webpack_require__(65);
+
+const ONE_DAY = 1000 * 60 * 60 * 24;
+
+/**
+ * Try and detect the installation method for Yarn and provide a command to update it with.
+ */
+
+function getUpdateCommand(installationMethod) {
+ if (installationMethod === 'tar') {
+ return `curl --compressed -o- -L ${(_constants || _load_constants()).YARN_INSTALLER_SH} | bash`;
+ }
+
+ if (installationMethod === 'homebrew') {
+ return 'brew upgrade yarn';
+ }
+
+ if (installationMethod === 'deb') {
+ return 'sudo apt-get update && sudo apt-get install yarn';
+ }
+
+ if (installationMethod === 'rpm') {
+ return 'sudo yum install yarn';
+ }
+
+ if (installationMethod === 'npm') {
+ return 'npm install --global yarn';
+ }
+
+ if (installationMethod === 'chocolatey') {
+ return 'choco upgrade yarn';
+ }
+
+ if (installationMethod === 'apk') {
+ return 'apk update && apk add -u yarn';
+ }
+
+ if (installationMethod === 'portage') {
+ return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn';
+ }
+
+ return null;
+}
+
+function getUpdateInstaller(installationMethod) {
+ // Windows
+ if (installationMethod === 'msi') {
+ return (_constants || _load_constants()).YARN_INSTALLER_MSI;
+ }
+
+ return null;
+}
+
+function normalizeFlags(config, rawFlags) {
+ const flags = {
+ // install
+ har: !!rawFlags.har,
+ ignorePlatform: !!rawFlags.ignorePlatform,
+ ignoreEngines: !!rawFlags.ignoreEngines,
+ ignoreScripts: !!rawFlags.ignoreScripts,
+ ignoreOptional: !!rawFlags.ignoreOptional,
+ force: !!rawFlags.force,
+ flat: !!rawFlags.flat,
+ lockfile: rawFlags.lockfile !== false,
+ pureLockfile: !!rawFlags.pureLockfile,
+ updateChecksums: !!rawFlags.updateChecksums,
+ skipIntegrityCheck: !!rawFlags.skipIntegrityCheck,
+ frozenLockfile: !!rawFlags.frozenLockfile,
+ linkDuplicates: !!rawFlags.linkDuplicates,
+ checkFiles: !!rawFlags.checkFiles,
+ audit: !!rawFlags.audit,
+
+ // add
+ peer: !!rawFlags.peer,
+ dev: !!rawFlags.dev,
+ optional: !!rawFlags.optional,
+ exact: !!rawFlags.exact,
+ tilde: !!rawFlags.tilde,
+ ignoreWorkspaceRootCheck: !!rawFlags.ignoreWorkspaceRootCheck,
+
+ // outdated, update-interactive
+ includeWorkspaceDeps: !!rawFlags.includeWorkspaceDeps,
+
+ // add, remove, update
+ workspaceRootIsCwd: rawFlags.workspaceRootIsCwd !== false
+ };
+
+ if (config.getOption('ignore-scripts')) {
+ flags.ignoreScripts = true;
+ }
+
+ if (config.getOption('ignore-platform')) {
+ flags.ignorePlatform = true;
+ }
+
+ if (config.getOption('ignore-engines')) {
+ flags.ignoreEngines = true;
+ }
+
+ if (config.getOption('ignore-optional')) {
+ flags.ignoreOptional = true;
+ }
+
+ if (config.getOption('force')) {
+ flags.force = true;
+ }
+
+ return flags;
+}
+
+class Install {
+ constructor(flags, config, reporter, lockfile) {
+ this.rootManifestRegistries = [];
+ this.rootPatternsToOrigin = (0, (_map || _load_map()).default)();
+ this.lockfile = lockfile;
+ this.reporter = reporter;
+ this.config = config;
+ this.flags = normalizeFlags(config, flags);
+ this.resolutions = (0, (_map || _load_map()).default)(); // Legacy resolutions field used for flat install mode
+ this.resolutionMap = new (_resolutionMap || _load_resolutionMap()).default(config); // Selective resolutions for nested dependencies
+ this.resolver = new (_packageResolver || _load_packageResolver()).default(config, lockfile, this.resolutionMap);
+ this.integrityChecker = new (_integrityChecker || _load_integrityChecker()).default(config);
+ this.linker = new (_packageLinker || _load_packageLinker()).default(config, this.resolver);
+ this.scripts = new (_packageInstallScripts || _load_packageInstallScripts()).default(config, this.resolver, this.flags.force);
+ }
+
+ /**
+ * Create a list of dependency requests from the current directories manifests.
+ */
+
+ fetchRequestFromCwd(excludePatterns = [], ignoreUnusedPatterns = false) {
+ var _this = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const patterns = [];
+ const deps = [];
+ let resolutionDeps = [];
+ const manifest = {};
+
+ const ignorePatterns = [];
+ const usedPatterns = [];
+ let workspaceLayout;
+
+ // some commands should always run in the context of the entire workspace
+ const cwd = _this.flags.includeWorkspaceDeps || _this.flags.workspaceRootIsCwd ? _this.config.lockfileFolder : _this.config.cwd;
+
+ // non-workspaces are always root, otherwise check for workspace root
+ const cwdIsRoot = !_this.config.workspaceRootFolder || _this.config.lockfileFolder === cwd;
+
+ // exclude package names that are in install args
+ const excludeNames = [];
+ for (var _iterator = excludePatterns, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+ var _ref;
+
+ if (_isArray) {
+ if (_i >= _iterator.length) break;
+ _ref = _iterator[_i++];
+ } else {
+ _i = _iterator.next();
+ if (_i.done) break;
+ _ref = _i.value;
+ }
+
+ const pattern = _ref;
+
+ if ((0, (_index3 || _load_index3()).getExoticResolver)(pattern)) {
+ excludeNames.push((0, (_guessName || _load_guessName()).default)(pattern));
+ } else {
+ // extract the name
+ const parts = (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern);
+ excludeNames.push(parts.name);
+ }
+ }
+
+ const stripExcluded = function stripExcluded(manifest) {
+ for (var _iterator2 = excludeNames, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+ var _ref2;
+
+ if (_isArray2) {
+ if (_i2 >= _iterator2.length) break;
+ _ref2 = _iterator2[_i2++];
+ } else {
+ _i2 = _iterator2.next();
+ if (_i2.done) break;
+ _ref2 = _i2.value;
+ }
+
+ const exclude = _ref2;
+
+ if (manifest.dependencies && manifest.dependencies[exclude]) {
+ delete manifest.dependencies[exclude];
+ }
+ if (manifest.devDependencies && manifest.devDependencies[exclude]) {
+ delete manifest.devDependencies[exclude];
+ }
+ if (manifest.optionalDependencies && manifest.optionalDependencies[exclude]) {
+ delete manifest.optionalDependencies[exclude];
+ }
+ }
+ };
+
+ for (var _iterator3 = Object.keys((_index2 || _load_index2()).registries), _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) {
+ var _ref3;
+
+ if (_isArray3) {
+ if (_i3 >= _iterator3.length) break;
+ _ref3 = _iterator3[_i3++];
+ } else {
+ _i3 = _iterator3.next();
+ if (_i3.done) break;
+ _ref3 = _i3.value;
+ }
+
+ const registry = _ref3;
+
+ const filename = (_index2 || _load_index2()).registries[registry].filename;
+
+ const loc = path.join(cwd, filename);
+ if (!(yield (_fs || _load_fs()).exists(loc))) {
+ continue;
+ }
+
+ _this.rootManifestRegistries.push(registry);
+
+ const projectManifestJson = yield _this.config.readJson(loc);
+ yield (0, (_index || _load_index()).default)(projectManifestJson, cwd, _this.config, cwdIsRoot);
+
+ Object.assign(_this.resolutions, projectManifestJson.resolutions);
+ Object.assign(manifest, projectManifestJson);
+
+ _this.resolutionMap.init(_this.resolutions);
+ for (var _iterator4 = Object.keys(_this.resolutionMap.resolutionsByPackage), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) {
+ var _ref4;
+
+ if (_isArray4) {
+ if (_i4 >= _iterator4.length) break;
+ _ref4 = _iterator4[_i4++];
+ } else {
+ _i4 = _iterator4.next();
+ if (_i4.done) break;
+ _ref4 = _i4.value;
+ }
+
+ const packageName = _ref4;
+
+ const optional = (_objectPath || _load_objectPath()).default.has(manifest.optionalDependencies, packageName) && _this.flags.ignoreOptional;
+ for (var _iterator8 = _this.resolutionMap.resolutionsByPackage[packageName], _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) {
+ var _ref9;
+
+ if (_isArray8) {
+ if (_i8 >= _iterator8.length) break;
+ _ref9 = _iterator8[_i8++];
+ } else {
+ _i8 = _iterator8.next();
+ if (_i8.done) break;
+ _ref9 = _i8.value;
+ }
+
+ const _ref8 = _ref9;
+ const pattern = _ref8.pattern;
+
+ resolutionDeps = [...resolutionDeps, { registry, pattern, optional, hint: 'resolution' }];
+ }
+ }
+
+ const pushDeps = function pushDeps(depType, manifest, { hint, optional }, isUsed) {
+ if (ignoreUnusedPatterns && !isUsed) {
+ return;
+ }
+ // We only take unused dependencies into consideration to get deterministic hoisting.
+ // Since flat mode doesn't care about hoisting and everything is top level and specified then we can safely
+ // leave these out.
+ if (_this.flags.flat && !isUsed) {
+ return;
+ }
+ const depMap = manifest[depType];
+ for (const name in depMap) {
+ if (excludeNames.indexOf(name) >= 0) {
+ continue;
+ }
+
+ let pattern = name;
+ if (!_this.lockfile.getLocked(pattern)) {
+ // when we use --save we save the dependency to the lockfile with just the name rather than the
+ // version combo
+ pattern += '@' + depMap[name];
+ }
+
+ // normalization made sure packages are mentioned only once
+ if (isUsed) {
+ usedPatterns.push(pattern);
+ } else {
+ ignorePatterns.push(pattern);
+ }
+
+ _this.rootPatternsToOrigin[pattern] = depType;
+ patterns.push(pattern);
+ deps.push({ pattern, registry, hint, optional, workspaceName: manifest.name, workspaceLoc: manifest._loc });
+ }
+ };
+
+ if (cwdIsRoot) {
+ pushDeps('dependencies', projectManifestJson, { hint: null, optional: false }, true);
+ pushDeps('devDependencies', projectManifestJson, { hint: 'dev', optional: false }, !_this.config.production);
+ pushDeps('optionalDependencies', projectManifestJson, { hint: 'optional', optional: true }, true);
+ }
+
+ if (_this.config.workspaceRootFolder) {
+ const workspaceLoc = cwdIsRoot ? loc : path.join(_this.config.lockfileFolder, filename);
+ const workspacesRoot = path.dirname(workspaceLoc);
+
+ let workspaceManifestJson = projectManifestJson;
+ if (!cwdIsRoot) {
+ // the manifest we read before was a child workspace, so get the root
+ workspaceManifestJson = yield _this.config.readJson(workspaceLoc);
+ yield (0, (_index || _load_index()).default)(workspaceManifestJson, workspacesRoot, _this.config, true);
+ }
+
+ const workspaces = yield _this.config.resolveWorkspaces(workspacesRoot, workspaceManifestJson);
+ workspaceLayout = new (_workspaceLayout || _load_workspaceLayout()).default(workspaces, _this.config);
+
+ // add virtual manifest that depends on all workspaces, this way package hoisters and resolvers will work fine
+ const workspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.dependencies);
+ for (var _iterator5 = Object.keys(workspaces), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) {
+ var _ref5;
+
+ if (_isArray5) {
+ if (_i5 >= _iterator5.length) break;
+ _ref5 = _iterator5[_i5++];
+ } else {
+ _i5 = _iterator5.next();
+ if (_i5.done) break;
+ _ref5 = _i5.value;
+ }
+
+ const workspaceName = _ref5;
+
+ const workspaceManifest = workspaces[workspaceName].manifest;
+ workspaceDependencies[workspaceName] = workspaceManifest.version;
+
+ // include dependencies from all workspaces
+ if (_this.flags.includeWorkspaceDeps) {
+ pushDeps('dependencies', workspaceManifest, { hint: null, optional: false }, true);
+ pushDeps('devDependencies', workspaceManifest, { hint: 'dev', optional: false }, !_this.config.production);
+ pushDeps('optionalDependencies', workspaceManifest, { hint: 'optional', optional: true }, true);
+ }
+ }
+ const virtualDependencyManifest = {
+ _uid: '',
+ name: `workspace-aggregator-${uuid.v4()}`,
+ version: '1.0.0',
+ _registry: 'npm',
+ _loc: workspacesRoot,
+ dependencies: workspaceDependencies,
+ devDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.devDependencies),
+ optionalDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.optionalDependencies),
+ private: workspaceManifestJson.private,
+ workspaces: workspaceManifestJson.workspaces
+ };
+ workspaceLayout.virtualManifestName = virtualDependencyManifest.name;
+ const virtualDep = {};
+ virtualDep[virtualDependencyManifest.name] = virtualDependencyManifest.version;
+ workspaces[virtualDependencyManifest.name] = { loc: workspacesRoot, manifest: virtualDependencyManifest };
+
+ // ensure dependencies that should be excluded are stripped from the correct manifest
+ stripExcluded(cwdIsRoot ? virtualDependencyManifest : workspaces[projectManifestJson.name].manifest);
+
+ pushDeps('workspaces', { workspaces: virtualDep }, { hint: 'workspaces', optional: false }, true);
+
+ const implicitWorkspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceDependencies);
+
+ for (var _iterator6 = (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) {
+ var _ref6;
+
+ if (_isArray6) {
+ if (_i6 >= _iterator6.length) break;
+ _ref6 = _iterator6[_i6++];
+ } else {
+ _i6 = _iterator6.next();
+ if (_i6.done) break;
+ _ref6 = _i6.value;
+ }
+
+ const type = _ref6;
+
+ for (var _iterator7 = Object.keys(projectManifestJson[type] || {}), _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) {
+ var _ref7;
+
+ if (_isArray7) {
+ if (_i7 >= _iterator7.length) break;
+ _ref7 = _iterator7[_i7++];
+ } else {
+ _i7 = _iterator7.next();
+ if (_i7.done) break;
+ _ref7 = _i7.value;
+ }
+
+ const dependencyName = _ref7;
+
+ delete implicitWorkspaceDependencies[dependencyName];
+ }
+ }
+
+ pushDeps('dependencies', { dependencies: implicitWorkspaceDependencies }, { hint: 'workspaces', optional: false }, true);
+ }
+
+ break;
+ }
+
+ // inherit root flat flag
+ if (manifest.flat) {
+ _this.flags.flat = true;
+ }
+
+ return {
+ requests: [...resolutionDeps, ...deps],
+ patterns,
+ manifest,
+ usedPatterns,
+ ignorePatterns,
+ workspaceLayout
+ };
+ })();
+ }
+
+ /**
+ * TODO description
+ */
+
+ prepareRequests(requests) {
+ return requests;
+ }
+
+ preparePatterns(patterns) {
+ return patterns;
+ }
+ preparePatternsForLinking(patterns, cwdManifest, cwdIsRoot) {
+ return patterns;
+ }
+
+ prepareManifests() {
+ var _this2 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const manifests = yield _this2.config.getRootManifests();
+ return manifests;
+ })();
+ }
+
+ bailout(patterns, workspaceLayout) {
+ var _this3 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ // We don't want to skip the audit - it could yield important errors
+ if (_this3.flags.audit) {
+ return false;
+ }
+ // PNP is so fast that the integrity check isn't pertinent
+ if (_this3.config.plugnplayEnabled) {
+ return false;
+ }
+ if (_this3.flags.skipIntegrityCheck || _this3.flags.force) {
+ return false;
+ }
+ const lockfileCache = _this3.lockfile.cache;
+ if (!lockfileCache) {
+ return false;
+ }
+ const lockfileClean = _this3.lockfile.parseResultType === 'success';
+ const match = yield _this3.integrityChecker.check(patterns, lockfileCache, _this3.flags, workspaceLayout);
+ if (_this3.flags.frozenLockfile && (!lockfileClean || match.missingPatterns.length > 0)) {
+ throw new (_errors || _load_errors()).MessageError(_this3.reporter.lang('frozenLockfileError'));
+ }
+
+ const haveLockfile = yield (_fs || _load_fs()).exists(path.join(_this3.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME));
+
+ const lockfileIntegrityPresent = !_this3.lockfile.hasEntriesExistWithoutIntegrity();
+ const integrityBailout = lockfileIntegrityPresent || !_this3.config.autoAddIntegrity;
+
+ if (match.integrityMatches && haveLockfile && lockfileClean && integrityBailout) {
+ _this3.reporter.success(_this3.reporter.lang('upToDate'));
+ return true;
+ }
+
+ if (match.integrityFileMissing && haveLockfile) {
+ // Integrity file missing, force script installations
+ _this3.scripts.setForce(true);
+ return false;
+ }
+
+ if (match.hardRefreshRequired) {
+ // e.g. node version doesn't match, force script installations
+ _this3.scripts.setForce(true);
+ return false;
+ }
+
+ if (!patterns.length && !match.integrityFileMissing) {
+ _this3.reporter.success(_this3.reporter.lang('nothingToInstall'));
+ yield _this3.createEmptyManifestFolders();
+ yield _this3.saveLockfileAndIntegrity(patterns, workspaceLayout);
+ return true;
+ }
+
+ return false;
+ })();
+ }
+
+ /**
+ * Produce empty folders for all used root manifests.
+ */
+
+ createEmptyManifestFolders() {
+ var _this4 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ if (_this4.config.modulesFolder) {
+ // already created
+ return;
+ }
+
+ for (var _iterator9 = _this4.rootManifestRegistries, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) {
+ var _ref10;
+
+ if (_isArray9) {
+ if (_i9 >= _iterator9.length) break;
+ _ref10 = _iterator9[_i9++];
+ } else {
+ _i9 = _iterator9.next();
+ if (_i9.done) break;
+ _ref10 = _i9.value;
+ }
+
+ const registryName = _ref10;
+ const folder = _this4.config.registries[registryName].folder;
+
+ yield (_fs || _load_fs()).mkdirp(path.join(_this4.config.lockfileFolder, folder));
+ }
+ })();
+ }
+
+ /**
+ * TODO description
+ */
+
+ markIgnored(patterns) {
+ for (var _iterator10 = patterns, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) {
+ var _ref11;
+
+ if (_isArray10) {
+ if (_i10 >= _iterator10.length) break;
+ _ref11 = _iterator10[_i10++];
+ } else {
+ _i10 = _iterator10.next();
+ if (_i10.done) break;
+ _ref11 = _i10.value;
+ }
+
+ const pattern = _ref11;
+
+ const manifest = this.resolver.getStrictResolvedPattern(pattern);
+ const ref = manifest._reference;
+ invariant(ref, 'expected package reference');
+
+ // just mark the package as ignored. if the package is used by a required package, the hoister
+ // will take care of that.
+ ref.ignore = true;
+ }
+ }
+
+ /**
+ * helper method that gets only recent manifests
+ * used by global.ls command
+ */
+ getFlattenedDeps() {
+ var _this5 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ var _ref12 = yield _this5.fetchRequestFromCwd();
+
+ const depRequests = _ref12.requests,
+ rawPatterns = _ref12.patterns;
+
+
+ yield _this5.resolver.init(depRequests, {});
+
+ const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this5.resolver.getManifests(), _this5.config);
+ _this5.resolver.updateManifests(manifests);
+
+ return _this5.flatten(rawPatterns);
+ })();
+ }
+
+ /**
+ * TODO description
+ */
+
+ init() {
+ var _this6 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ _this6.checkUpdate();
+
+ // warn if we have a shrinkwrap
+ if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_SHRINKWRAP_FILENAME))) {
+ _this6.reporter.warn(_this6.reporter.lang('shrinkwrapWarning'));
+ }
+
+ // warn if we have an npm lockfile
+ if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_LOCK_FILENAME))) {
+ _this6.reporter.warn(_this6.reporter.lang('npmLockfileWarning'));
+ }
+
+ if (_this6.config.plugnplayEnabled) {
+ _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L1'));
+ _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L2'));
+ }
+
+ let flattenedTopLevelPatterns = [];
+ const steps = [];
+
+ var _ref13 = yield _this6.fetchRequestFromCwd();
+
+ const depRequests = _ref13.requests,
+ rawPatterns = _ref13.patterns,
+ ignorePatterns = _ref13.ignorePatterns,
+ workspaceLayout = _ref13.workspaceLayout,
+ manifest = _ref13.manifest;
+
+ let topLevelPatterns = [];
+
+ const artifacts = yield _this6.integrityChecker.getArtifacts();
+ if (artifacts) {
+ _this6.linker.setArtifacts(artifacts);
+ _this6.scripts.setArtifacts(artifacts);
+ }
+
+ if ((_packageCompatibility || _load_packageCompatibility()).shouldCheck(manifest, _this6.flags)) {
+ steps.push((() => {
+ var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) {
+ _this6.reporter.step(curr, total, _this6.reporter.lang('checkingManifest'), emoji.get('mag'));
+ yield _this6.checkCompatibility();
+ });
+
+ return function (_x, _x2) {
+ return _ref14.apply(this, arguments);
+ };
+ })());
+ }
+
+ const audit = new (_audit || _load_audit()).default(_this6.config, _this6.reporter, { groups: (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES });
+ let auditFoundProblems = false;
+
+ steps.push(function (curr, total) {
+ return (0, (_hooks || _load_hooks()).callThroughHook)('resolveStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ _this6.reporter.step(curr, total, _this6.reporter.lang('resolvingPackages'), emoji.get('mag'));
+ yield _this6.resolver.init(_this6.prepareRequests(depRequests), {
+ isFlat: _this6.flags.flat,
+ isFrozen: _this6.flags.frozenLockfile,
+ workspaceLayout
+ });
+ topLevelPatterns = _this6.preparePatterns(rawPatterns);
+ flattenedTopLevelPatterns = yield _this6.flatten(topLevelPatterns);
+ return { bailout: !_this6.flags.audit && (yield _this6.bailout(topLevelPatterns, workspaceLayout)) };
+ }));
+ });
+
+ if (_this6.flags.audit) {
+ steps.push(function (curr, total) {
+ return (0, (_hooks || _load_hooks()).callThroughHook)('auditStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ _this6.reporter.step(curr, total, _this6.reporter.lang('auditRunning'), emoji.get('mag'));
+ if (_this6.flags.offline) {
+ _this6.reporter.warn(_this6.reporter.lang('auditOffline'));
+ return { bailout: false };
+ }
+ const preparedManifests = yield _this6.prepareManifests();
+ // $FlowFixMe - Flow considers `m` in the map operation to be "mixed", so does not recognize `m.object`
+ const mergedManifest = Object.assign({}, ...Object.values(preparedManifests).map(function (m) {
+ return m.object;
+ }));
+ const auditVulnerabilityCounts = yield audit.performAudit(mergedManifest, _this6.lockfile, _this6.resolver, _this6.linker, topLevelPatterns);
+ auditFoundProblems = auditVulnerabilityCounts.info || auditVulnerabilityCounts.low || auditVulnerabilityCounts.moderate || auditVulnerabilityCounts.high || auditVulnerabilityCounts.critical;
+ return { bailout: yield _this6.bailout(topLevelPatterns, workspaceLayout) };
+ }));
+ });
+ }
+
+ steps.push(function (curr, total) {
+ return (0, (_hooks || _load_hooks()).callThroughHook)('fetchStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ _this6.markIgnored(ignorePatterns);
+ _this6.reporter.step(curr, total, _this6.reporter.lang('fetchingPackages'), emoji.get('truck'));
+ const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this6.resolver.getManifests(), _this6.config);
+ _this6.resolver.updateManifests(manifests);
+ yield (_packageCompatibility || _load_packageCompatibility()).check(_this6.resolver.getManifests(), _this6.config, _this6.flags.ignoreEngines);
+ }));
+ });
+
+ steps.push(function (curr, total) {
+ return (0, (_hooks || _load_hooks()).callThroughHook)('linkStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ // remove integrity hash to make this operation atomic
+ yield _this6.integrityChecker.removeIntegrityFile();
+ _this6.reporter.step(curr, total, _this6.reporter.lang('linkingDependencies'), emoji.get('link'));
+ flattenedTopLevelPatterns = _this6.preparePatternsForLinking(flattenedTopLevelPatterns, manifest, _this6.config.lockfileFolder === _this6.config.cwd);
+ yield _this6.linker.init(flattenedTopLevelPatterns, workspaceLayout, {
+ linkDuplicates: _this6.flags.linkDuplicates,
+ ignoreOptional: _this6.flags.ignoreOptional
+ });
+ }));
+ });
+
+ if (_this6.config.plugnplayEnabled) {
+ steps.push(function (curr, total) {
+ return (0, (_hooks || _load_hooks()).callThroughHook)('pnpStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const pnpPath = `${_this6.config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`;
+
+ const code = yield (0, (_generatePnpMap || _load_generatePnpMap()).generatePnpMap)(_this6.config, flattenedTopLevelPatterns, {
+ resolver: _this6.resolver,
+ reporter: _this6.reporter,
+ targetPath: pnpPath,
+ workspaceLayout
+ });
+
+ try {
+ const file = yield (_fs || _load_fs()).readFile(pnpPath);
+ if (file === code) {
+ return;
+ }
+ } catch (error) {}
+
+ yield (_fs || _load_fs()).writeFile(pnpPath, code);
+ yield (_fs || _load_fs()).chmod(pnpPath, 0o755);
+ }));
+ });
+ }
+
+ steps.push(function (curr, total) {
+ return (0, (_hooks || _load_hooks()).callThroughHook)('buildStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ _this6.reporter.step(curr, total, _this6.flags.force ? _this6.reporter.lang('rebuildingPackages') : _this6.reporter.lang('buildingFreshPackages'), emoji.get('hammer'));
+
+ if (_this6.config.ignoreScripts) {
+ _this6.reporter.warn(_this6.reporter.lang('ignoredScripts'));
+ } else {
+ yield _this6.scripts.init(flattenedTopLevelPatterns);
+ }
+ }));
+ });
+
+ if (_this6.flags.har) {
+ steps.push((() => {
+ var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) {
+ const formattedDate = new Date().toISOString().replace(/:/g, '-');
+ const filename = `yarn-install_${formattedDate}.har`;
+ _this6.reporter.step(curr, total, _this6.reporter.lang('savingHar', filename), emoji.get('black_circle_for_record'));
+ yield _this6.config.requestManager.saveHar(filename);
+ });
+
+ return function (_x3, _x4) {
+ return _ref21.apply(this, arguments);
+ };
+ })());
+ }
+
+ if (yield _this6.shouldClean()) {
+ steps.push((() => {
+ var _ref22 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) {
+ _this6.reporter.step(curr, total, _this6.reporter.lang('cleaningModules'), emoji.get('recycle'));
+ yield (0, (_autoclean || _load_autoclean()).clean)(_this6.config, _this6.reporter);
+ });
+
+ return function (_x5, _x6) {
+ return _ref22.apply(this, arguments);
+ };
+ })());
+ }
+
+ let currentStep = 0;
+ for (var _iterator11 = steps, _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) {
+ var _ref23;
+
+ if (_isArray11) {
+ if (_i11 >= _iterator11.length) break;
+ _ref23 = _iterator11[_i11++];
+ } else {
+ _i11 = _iterator11.next();
+ if (_i11.done) break;
+ _ref23 = _i11.value;
+ }
+
+ const step = _ref23;
+
+ const stepResult = yield step(++currentStep, steps.length);
+ if (stepResult && stepResult.bailout) {
+ if (_this6.flags.audit) {
+ audit.summary();
+ }
+ if (auditFoundProblems) {
+ _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails'));
+ }
+ _this6.maybeOutputUpdate();
+ return flattenedTopLevelPatterns;
+ }
+ }
+
+ // fin!
+ if (_this6.flags.audit) {
+ audit.summary();
+ }
+ if (auditFoundProblems) {
+ _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails'));
+ }
+ yield _this6.saveLockfileAndIntegrity(topLevelPatterns, workspaceLayout);
+ yield _this6.persistChanges();
+ _this6.maybeOutputUpdate();
+ _this6.config.requestManager.clearCache();
+ return flattenedTopLevelPatterns;
+ })();
+ }
+
+ checkCompatibility() {
+ var _this7 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ var _ref24 = yield _this7.fetchRequestFromCwd();
+
+ const manifest = _ref24.manifest;
+
+ yield (_packageCompatibility || _load_packageCompatibility()).checkOne(manifest, _this7.config, _this7.flags.ignoreEngines);
+ })();
+ }
+
+ persistChanges() {
+ var _this8 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ // get all the different registry manifests in this folder
+ const manifests = yield _this8.config.getRootManifests();
+
+ if (yield _this8.applyChanges(manifests)) {
+ yield _this8.config.saveRootManifests(manifests);
+ }
+ })();
+ }
+
+ applyChanges(manifests) {
+ let hasChanged = false;
+
+ if (this.config.plugnplayPersist) {
+ const object = manifests.npm.object;
+
+
+ if (typeof object.installConfig !== 'object') {
+ object.installConfig = {};
+ }
+
+ if (this.config.plugnplayEnabled && object.installConfig.pnp !== true) {
+ object.installConfig.pnp = true;
+ hasChanged = true;
+ } else if (!this.config.plugnplayEnabled && typeof object.installConfig.pnp !== 'undefined') {
+ delete object.installConfig.pnp;
+ hasChanged = true;
+ }
+
+ if (Object.keys(object.installConfig).length === 0) {
+ delete object.installConfig;
+ }
+ }
+
+ return Promise.resolve(hasChanged);
+ }
+
+ /**
+ * Check if we should run the cleaning step.
+ */
+
+ shouldClean() {
+ return (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).CLEAN_FILENAME));
+ }
+
+ /**
+ * TODO
+ */
+
+ flatten(patterns) {
+ var _this9 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ if (!_this9.flags.flat) {
+ return patterns;
+ }
+
+ const flattenedPatterns = [];
+
+ for (var _iterator12 = _this9.resolver.getAllDependencyNamesByLevelOrder(patterns), _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) {
+ var _ref25;
+
+ if (_isArray12) {
+ if (_i12 >= _iterator12.length) break;
+ _ref25 = _iterator12[_i12++];
+ } else {
+ _i12 = _iterator12.next();
+ if (_i12.done) break;
+ _ref25 = _i12.value;
+ }
+
+ const name = _ref25;
+
+ const infos = _this9.resolver.getAllInfoForPackageName(name).filter(function (manifest) {
+ const ref = manifest._reference;
+ invariant(ref, 'expected package reference');
+ return !ref.ignore;
+ });
+
+ if (infos.length === 0) {
+ continue;
+ }
+
+ if (infos.length === 1) {
+ // single version of this package
+ // take out a single pattern as multiple patterns may have resolved to this package
+ flattenedPatterns.push(_this9.resolver.patternsByPackage[name][0]);
+ continue;
+ }
+
+ const options = infos.map(function (info) {
+ const ref = info._reference;
+ invariant(ref, 'expected reference');
+ return {
+ // TODO `and is required by {PARENT}`,
+ name: _this9.reporter.lang('manualVersionResolutionOption', ref.patterns.join(', '), info.version),
+
+ value: info.version
+ };
+ });
+ const versions = infos.map(function (info) {
+ return info.version;
+ });
+ let version;
+
+ const resolutionVersion = _this9.resolutions[name];
+ if (resolutionVersion && versions.indexOf(resolutionVersion) >= 0) {
+ // use json `resolution` version
+ version = resolutionVersion;
+ } else {
+ version = yield _this9.reporter.select(_this9.reporter.lang('manualVersionResolution', name), _this9.reporter.lang('answer'), options);
+ _this9.resolutions[name] = version;
+ }
+
+ flattenedPatterns.push(_this9.resolver.collapseAllVersionsOfPackage(name, version));
+ }
+
+ // save resolutions to their appropriate root manifest
+ if (Object.keys(_this9.resolutions).length) {
+ const manifests = yield _this9.config.getRootManifests();
+
+ for (const name in _this9.resolutions) {
+ const version = _this9.resolutions[name];
+
+ const patterns = _this9.resolver.patternsByPackage[name];
+ if (!patterns) {
+ continue;
+ }
+
+ let manifest;
+ for (var _iterator13 = patterns, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) {
+ var _ref26;
+
+ if (_isArray13) {
+ if (_i13 >= _iterator13.length) break;
+ _ref26 = _iterator13[_i13++];
+ } else {
+ _i13 = _iterator13.next();
+ if (_i13.done) break;
+ _ref26 = _i13.value;
+ }
+
+ const pattern = _ref26;
+
+ manifest = _this9.resolver.getResolvedPattern(pattern);
+ if (manifest) {
+ break;
+ }
+ }
+ invariant(manifest, 'expected manifest');
+
+ const ref = manifest._reference;
+ invariant(ref, 'expected reference');
+
+ const object = manifests[ref.registry].object;
+ object.resolutions = object.resolutions || {};
+ object.resolutions[name] = version;
+ }
+
+ yield _this9.config.saveRootManifests(manifests);
+ }
+
+ return flattenedPatterns;
+ })();
+ }
+
+ /**
+ * Remove offline tarballs that are no longer required
+ */
+
+ pruneOfflineMirror(lockfile) {
+ var _this10 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const mirror = _this10.config.getOfflineMirrorPath();
+ if (!mirror) {
+ return;
+ }
+
+ const requiredTarballs = new Set();
+ for (const dependency in lockfile) {
+ const resolved = lockfile[dependency].resolved;
+ if (resolved) {
+ const basename = path.basename(resolved.split('#')[0]);
+ if (dependency[0] === '@' && basename[0] !== '@') {
+ requiredTarballs.add(`${dependency.split('/')[0]}-${basename}`);
+ }
+ requiredTarballs.add(basename);
+ }
+ }
+
+ const mirrorFiles = yield (_fs || _load_fs()).walk(mirror);
+ for (var _iterator14 = mirrorFiles, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) {
+ var _ref27;
+
+ if (_isArray14) {
+ if (_i14 >= _iterator14.length) break;
+ _ref27 = _iterator14[_i14++];
+ } else {
+ _i14 = _iterator14.next();
+ if (_i14.done) break;
+ _ref27 = _i14.value;
+ }
+
+ const file = _ref27;
+
+ const isTarball = path.extname(file.basename) === '.tgz';
+ // if using experimental-pack-script-packages-in-mirror flag, don't unlink prebuilt packages
+ const hasPrebuiltPackage = file.relative.startsWith('prebuilt/');
+ if (isTarball && !hasPrebuiltPackage && !requiredTarballs.has(file.basename)) {
+ yield (_fs || _load_fs()).unlink(file.absolute);
+ }
+ }
+ })();
+ }
+
+ /**
+ * Save updated integrity and lockfiles.
+ */
+
+ saveLockfileAndIntegrity(patterns, workspaceLayout) {
+ var _this11 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const resolvedPatterns = {};
+ Object.keys(_this11.resolver.patterns).forEach(function (pattern) {
+ if (!workspaceLayout || !workspaceLayout.getManifestByPattern(pattern)) {
+ resolvedPatterns[pattern] = _this11.resolver.patterns[pattern];
+ }
+ });
+
+ // TODO this code is duplicated in a few places, need a common way to filter out workspace patterns from lockfile
+ patterns = patterns.filter(function (p) {
+ return !workspaceLayout || !workspaceLayout.getManifestByPattern(p);
+ });
+
+ const lockfileBasedOnResolver = _this11.lockfile.getLockfile(resolvedPatterns);
+
+ if (_this11.config.pruneOfflineMirror) {
+ yield _this11.pruneOfflineMirror(lockfileBasedOnResolver);
+ }
+
+ // write integrity hash
+ if (!_this11.config.plugnplayEnabled) {
+ yield _this11.integrityChecker.save(patterns, lockfileBasedOnResolver, _this11.flags, workspaceLayout, _this11.scripts.getArtifacts());
+ }
+
+ // --no-lockfile or --pure-lockfile or --frozen-lockfile
+ if (_this11.flags.lockfile === false || _this11.flags.pureLockfile || _this11.flags.frozenLockfile) {
+ return;
+ }
+
+ const lockFileHasAllPatterns = patterns.every(function (p) {
+ return _this11.lockfile.getLocked(p);
+ });
+ const lockfilePatternsMatch = Object.keys(_this11.lockfile.cache || {}).every(function (p) {
+ return lockfileBasedOnResolver[p];
+ });
+ const resolverPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) {
+ const manifest = _this11.lockfile.getLocked(pattern);
+ return manifest && manifest.resolved === lockfileBasedOnResolver[pattern].resolved && deepEqual(manifest.prebuiltVariants, lockfileBasedOnResolver[pattern].prebuiltVariants);
+ });
+ const integrityPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) {
+ const existingIntegrityInfo = lockfileBasedOnResolver[pattern].integrity;
+ if (!existingIntegrityInfo) {
+ // if this entry does not have an integrity, no need to re-write the lockfile because of it
+ return true;
+ }
+ const manifest = _this11.lockfile.getLocked(pattern);
+ if (manifest && manifest.integrity) {
+ const manifestIntegrity = ssri.stringify(manifest.integrity);
+ return manifestIntegrity === existingIntegrityInfo;
+ }
+ return false;
+ });
+
+ // remove command is followed by install with force, lockfile will be rewritten in any case then
+ if (!_this11.flags.force && _this11.lockfile.parseResultType === 'success' && lockFileHasAllPatterns && lockfilePatternsMatch && resolverPatternsAreSameAsInLockfile && integrityPatternsAreSameAsInLockfile && patterns.length) {
+ return;
+ }
+
+ // build lockfile location
+ const loc = path.join(_this11.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME);
+
+ // write lockfile
+ const lockSource = (0, (_lockfile2 || _load_lockfile2()).stringify)(lockfileBasedOnResolver, false, _this11.config.enableLockfileVersions);
+ yield (_fs || _load_fs()).writeFilePreservingEol(loc, lockSource);
+
+ _this11._logSuccessSaveLockfile();
+ })();
+ }
+
+ _logSuccessSaveLockfile() {
+ this.reporter.success(this.reporter.lang('savedLockfile'));
+ }
+
+ /**
+ * Load the dependency graph of the current install. Only does package resolving and wont write to the cwd.
+ */
+ hydrate(ignoreUnusedPatterns) {
+ var _this12 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ const request = yield _this12.fetchRequestFromCwd([], ignoreUnusedPatterns);
+ const depRequests = request.requests,
+ rawPatterns = request.patterns,
+ ignorePatterns = request.ignorePatterns,
+ workspaceLayout = request.workspaceLayout;
+
+
+ yield _this12.resolver.init(depRequests, {
+ isFlat: _this12.flags.flat,
+ isFrozen: _this12.flags.frozenLockfile,
+ workspaceLayout
+ });
+ yield _this12.flatten(rawPatterns);
+ _this12.markIgnored(ignorePatterns);
+
+ // fetch packages, should hit cache most of the time
+ const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this12.resolver.getManifests(), _this12.config);
+ _this12.resolver.updateManifests(manifests);
+ yield (_packageCompatibility || _load_packageCompatibility()).check(_this12.resolver.getManifests(), _this12.config, _this12.flags.ignoreEngines);
+
+ // expand minimal manifests
+ for (var _iterator15 = _this12.resolver.getManifests(), _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) {
+ var _ref28;
+
+ if (_isArray15) {
+ if (_i15 >= _iterator15.length) break;
+ _ref28 = _iterator15[_i15++];
+ } else {
+ _i15 = _iterator15.next();
+ if (_i15.done) break;
+ _ref28 = _i15.value;
+ }
+
+ const manifest = _ref28;
+
+ const ref = manifest._reference;
+ invariant(ref, 'expected reference');
+ const type = ref.remote.type;
+ // link specifier won't ever hit cache
+
+ let loc = '';
+ if (type === 'link') {
+ continue;
+ } else if (type === 'workspace') {
+ if (!ref.remote.reference) {
+ continue;
+ }
+ loc = ref.remote.reference;
+ } else {
+ loc = _this12.config.generateModuleCachePath(ref);
+ }
+ const newPkg = yield _this12.config.readManifest(loc);
+ yield _this12.resolver.updateManifest(ref, newPkg);
+ }
+
+ return request;
+ })();
+ }
+
+ /**
+ * Check for updates every day and output a nag message if there's a newer version.
+ */
+
+ checkUpdate() {
+ if (this.config.nonInteractive) {
+ // don't show upgrade dialog on CI or non-TTY terminals
+ return;
+ }
+
+ // don't check if disabled
+ if (this.config.getOption('disable-self-update-check')) {
+ return;
+ }
+
+ // only check for updates once a day
+ const lastUpdateCheck = Number(this.config.getOption('lastUpdateCheck')) || 0;
+ if (lastUpdateCheck && Date.now() - lastUpdateCheck < ONE_DAY) {
+ return;
+ }
+
+ // don't bug for updates on tagged releases
+ if ((_yarnVersion || _load_yarnVersion()).version.indexOf('-') >= 0) {
+ return;
+ }
+
+ this._checkUpdate().catch(() => {
+ // swallow errors
+ });
+ }
+
+ _checkUpdate() {
+ var _this13 = this;
+
+ return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
+ let latestVersion = yield _this13.config.requestManager.request({
+ url: (_constants || _load_constants()).SELF_UPDATE_VERSION_URL
+ });
+ invariant(typeof latestVersion === 'string', 'expected string');
+ latestVersion = latestVersion.trim();
+ if (!semver.valid(latestVersion)) {
+ return;
+ }
+
+ // ensure we only check for updates periodically
+ _this13.config.registries.yarn.saveHomeConfig({
+ lastUpdateCheck: Date.now()
+ });
+
+ if (semver.gt(latestVersion, (_yarnVersion || _load_yarnVersion()).version)) {
+ const installationMethod = yield (0, (_yarnVersion || _load_yarnVersion()).getInstallationMethod)();
+ _this13.maybeOutputUpdate = function () {
+ _this13.reporter.warn(_this13.reporter.lang('yarnOutdated', latestVersion, (_yarnVersion || _load_yarnVersion()).version));
+
+ const command = getUpdateCommand(installationMethod);
+ if (command) {
+ _this13.reporter.info(_this13.reporter.lang('yarnOutdatedCommand'));
+ _this13.reporter.command(command);
+ } else {
+ const installer = getUpdateInstaller(installationMethod);
+ if (installer) {
+ _this13.reporter.info(_this13.reporter.lang('yarnOutdatedInstaller', installer));
+ }
+ }
+ };
+ }
+ })();
+ }
+
+ /**
+ * Method to override with a possible upgrade message.
+ */
+
+ maybeOutputUpdate() {}
+}
+
+exports.Install = Install;
+function hasWrapper(commander, args) {
+ return true;
+}
+
+function setFlags(commander) {
+ commander.description('Yarn install is used to install all dependencies for a project.');
+ commander.usage('install [flags]');
+ commander.option('-A, --audit', 'Run vulnerability audit on installed packages');
+ commander.option('-g, --global', 'DEPRECATED');
+ commander.option('-S, --save', 'DEPRECATED - save package to your `dependencies`');
+ commander.option('-D, --save-dev', 'DEPRECATED - save package to your `devDependencies`');
+ commander.option('-P, --save-peer', 'DEPRECATED - save package to your `peerDependencies`');
+ commander.option('-O, --save-optional', 'DEPRECATED - save package to your `optionalDependencies`');
+ commander.option('-E, --save-exact', 'DEPRECATED');
+ commander.option('-T, --save-tilde', 'DEPRECATED');
+}
+
+/***/ }),
+/* 35 */
+/***/ (function(module, exports, __webpack_require__) {
+
+var isObject = __webpack_require__(52);
+module.exports = function (it) {
+ if (!isObject(it)) throw TypeError(it + ' is not an object!');
+ return it;
+};
+
+
+/***/ }),
+/* 36 */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return SubjectSubscriber; });
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subject; });
+/* unused harmony export AnonymousSubject */
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(12);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__(7);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(189);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(422);
+/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(321);
+/** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */
+
+
+
+
+
+
+
+var SubjectSubscriber = /*@__PURE__*/ (function (_super) {
+ __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SubjectSubscriber, _super);
+ function SubjectSubscriber(destination) {
+ var _this = _super.call(this, destination) || this;
+ _this.destination = destination;
+ return _this;
+ }
+ return SubjectSubscriber;
+}(__WEBPACK_IMPORTED_MODULE_2__Subscriber__["a" /* Subscriber */]));
+
+var Subject = /*@__PURE__*/ (function (_super) {
+ __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subject, _super);
+ function Subject() {
+ var _this = _super.call(this) || this;
+ _this.observers = [];
+ _this.closed = false;
+ _this.isStopped = false;
+ _this.hasError = false;
+ _this.thrownError = null;
+ return _this;
+ }
+ Subject.prototype[__WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () {
+ return new SubjectSubscriber(this);
+ };
+ Subject.prototype.lift = function (operator) {
+ var subject = new AnonymousSubject(this, this);
+ subject.operator = operator;
+ return subject;
+ };
+ Subject.prototype.next = function (value) {
+ if (this.closed) {
+ throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
+ }
+ if (!this.isStopped) {
+ var observers = this.observers;
+ var len = observers.length;
+ var copy = observers.slice();
+ for (var i = 0; i < len; i++) {
+ copy[i].next(value);
+ }
+ }
+ };
+ Subject.prototype.error = function (err) {
+ if (this.closed) {
+ throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
+ }
+ this.hasError = true;
+ this.thrownError = err;
+ this.isStopped = true;
+ var observers = this.observers;
+ var len = observers.length;
+ var copy = observers.slice();
+ for (var i = 0; i < len; i++) {
+ copy[i].error(err);
+ }
+ this.observers.length = 0;
+ };
+ Subject.prototype.complete = function () {
+ if (this.closed) {
+ throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
+ }
+ this.isStopped = true;
+ var observers = this.observers;
+ var len = observers.length;
+ var copy = observers.slice();
+ for (var i = 0; i < len; i++) {
+ copy[i].complete();
+ }
+ this.observers.length = 0;
+ };
+ Subject.prototype.unsubscribe = function () {
+ this.isStopped = true;
+ this.closed = true;
+ this.observers = null;
+ };
+ Subject.prototype._trySubscribe = function (subscriber) {
+ if (this.closed) {
+ throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
+ }
+ else {
+ return _super.prototype._trySubscribe.call(this, subscriber);
+ }
+ };
+ Subject.prototype._subscribe = function (subscriber) {
+ if (this.closed) {
+ throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
+ }
+ else if (this.hasError) {
+ subscriber.error(this.thrownError);
+ return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY;
+ }
+ else if (this.isStopped) {
+ subscriber.complete();
+ return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY;
+ }
+ else {
+ this.observers.push(subscriber);
+ return new __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__["a" /* SubjectSubscription */](this, subscriber);
+ }
+ };
+ Subject.prototype.asObservable = function () {
+ var observable = new __WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */]();
+ observable.source = this;
+ return observable;
+ };
+ Subject.create = function (destination, source) {
+ return new AnonymousSubject(destination, source);
+ };
+ return Subject;
+}(__WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */]));
+
+var AnonymousSubject = /*@__PURE__*/ (function (_super) {
+ __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](AnonymousSubject, _super);
+ function AnonymousSubject(destination, source) {
+ var _this = _super.call(this) || this;
+ _this.destination = destination;
+ _this.source = source;
+ return _this;
+ }
+ AnonymousSubject.prototype.next = function (value) {
+ var destination = this.destination;
+ if (destination && destination.next) {
+ destination.next(value);
+ }
+ };
+ AnonymousSubject.prototype.error = function (err) {
+ var destination = this.destination;
+ if (destination && destination.error) {
+ this.destination.error(err);
+ }
+ };
+ AnonymousSubject.prototype.complete = function () {
+ var destination = this.destination;
+ if (destination && destination.complete) {
+ this.destination.complete();
+ }
+ };
+ AnonymousSubject.prototype._subscribe = function (subscriber) {
+ var source = this.source;
+ if (source) {
+ return this.source.subscribe(subscriber);
+ }
+ else {
+ return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY;
+ }
+ };
+ return AnonymousSubject;
+}(Subject));
+
+//# sourceMappingURL=Subject.js.map
+
+
+/***/ }),
+/* 37 */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+Object.defineProperty(exports, "__esModule", {
+ value: true
+});
+exports.normalizePattern = normalizePattern;
+
+/**
+ * Explode and normalize a pattern into its name and range.
+ */
+
+function normalizePattern(pattern) {
+ let hasVersion = false;
+ let range = 'latest';
+ let name = pattern;
+
+ // if we're a scope then remove the @ and add it back later
+ let isScoped = false;
+ if (name[0] === '@') {
+ isScoped = true;
+ name = name.slice(1);
+ }
+
+ // take first part as the name
+ const parts = name.split('@');
+ if (parts.length > 1) {
+ name = parts.shift();
+ range = parts.join('@');
+
+ if (range) {
+ hasVersion = true;
+ } else {
+ range = '*';
+ }
+ }
+
+ // add back @ scope suffix
+ if (isScoped) {
+ name = `@${name}`;
+ }
+
+ return { name, range, hasVersion };
+}
+
+/***/ }),
+/* 38 */
+/***/ (function(module, exports, __webpack_require__) {
+
+/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**
+ * @license
+ * Lodash
+ * Copyright JS Foundation and other contributors
+ * Released under MIT license
+ * Based on Underscore.js 1.8.3
+ * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ */
+;(function() {
+
+ /** Used as a safe reference for `undefined` in pre-ES5 environments. */
+ var undefined;
+
+ /** Used as the semantic version number. */
+ var VERSION = '4.17.10';
+
+ /** Used as the size to enable large array optimizations. */
+ var LARGE_ARRAY_SIZE = 200;
+
+ /** Error message constants. */
+ var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',
+ FUNC_ERROR_TEXT = 'Expected a function';
+
+ /** Used to stand-in for `undefined` hash values. */
+ var HASH_UNDEFINED = '__lodash_hash_undefined__';
+
+ /** Used as the maximum memoize cache size. */
+ var MAX_MEMOIZE_SIZE = 500;
+
+ /** Used as the internal argument placeholder. */
+ var PLACEHOLDER = '__lodash_placeholder__';
+
+ /** Used to compose bitmasks for cloning. */
+ var CLONE_DEEP_FLAG = 1,
+ CLONE_FLAT_FLAG = 2,
+ CLONE_SYMBOLS_FLAG = 4;
+
+ /** Used to compose bitmasks for value comparisons. */
+ var COMPARE_PARTIAL_FLAG = 1,
+ COMPARE_UNORDERED_FLAG = 2;
+
+ /** Used to compose bitmasks for function metadata. */
+ var WRAP_BIND_FLAG = 1,
+ WRAP_BIND_KEY_FLAG = 2,
+ WRAP_CURRY_BOUND_FLAG = 4,
+ WRAP_CURRY_FLAG = 8,
+ WRAP_CURRY_RIGHT_FLAG = 16,
+ WRAP_PARTIAL_FLAG = 32,
+ WRAP_PARTIAL_RIGHT_FLAG = 64,
+ WRAP_ARY_FLAG = 128,
+ WRAP_REARG_FLAG = 256,
+ WRAP_FLIP_FLAG = 512;
+
+ /** Used as default options for `_.truncate`. */
+ var DEFAULT_TRUNC_LENGTH = 30,
+ DEFAULT_TRUNC_OMISSION = '...';
+
+ /** Used to detect hot functions by number of calls within a span of milliseconds. */
+ var HOT_COUNT = 800,
+ HOT_SPAN = 16;
+
+ /** Used to indicate the type of lazy iteratees. */
+ var LAZY_FILTER_FLAG = 1,
+ LAZY_MAP_FLAG = 2,
+ LAZY_WHILE_FLAG = 3;
+
+ /** Used as references for various `Number` constants. */
+ var INFINITY = 1 / 0,
+ MAX_SAFE_INTEGER = 9007199254740991,
+ MAX_INTEGER = 1.7976931348623157e+308,
+ NAN = 0 / 0;
+
+ /** Used as references for the maximum length and index of an array. */
+ var MAX_ARRAY_LENGTH = 4294967295,
+ MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,
+ HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;
+
+ /** Used to associate wrap methods with their bit flags. */
+ var wrapFlags = [
+ ['ary', WRAP_ARY_FLAG],
+ ['bind', WRAP_BIND_FLAG],
+ ['bindKey', WRAP_BIND_KEY_FLAG],
+ ['curry', WRAP_CURRY_FLAG],
+ ['curryRight', WRAP_CURRY_RIGHT_FLAG],
+ ['flip', WRAP_FLIP_FLAG],
+ ['partial', WRAP_PARTIAL_FLAG],
+ ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],
+ ['rearg', WRAP_REARG_FLAG]
+ ];
+
+ /** `Object#toString` result references. */
+ var argsTag = '[object Arguments]',
+ arrayTag = '[object Array]',
+ asyncTag = '[object AsyncFunction]',
+ boolTag = '[object Boolean]',
+ dateTag = '[object Date]',
+ domExcTag = '[object DOMException]',
+ errorTag = '[object Error]',
+ funcTag = '[object Function]',
+ genTag = '[object GeneratorFunction]',
+ mapTag = '[object Map]',
+ numberTag = '[object Number]',
+ nullTag = '[object Null]',
+ objectTag = '[object Object]',
+ promiseTag = '[object Promise]',
+ proxyTag = '[object Proxy]',
+ regexpTag = '[object RegExp]',
+ setTag = '[object Set]',
+ stringTag = '[object String]',
+ symbolTag = '[object Symbol]',
+ undefinedTag = '[object Undefined]',
+ weakMapTag = '[object WeakMap]',
+ weakSetTag = '[object WeakSet]';
+
+ var arrayBufferTag = '[object ArrayBuffer]',
+ dataViewTag = '[object DataView]',
+ float32Tag = '[object Float32Array]',
+ float64Tag = '[object Float64Array]',
+ int8Tag = '[object Int8Array]',
+ int16Tag = '[object Int16Array]',
+ int32Tag = '[object Int32Array]',
+ uint8Tag = '[object Uint8Array]',
+ uint8ClampedTag = '[object Uint8ClampedArray]',
+ uint16Tag = '[object Uint16Array]',
+ uint32Tag = '[object Uint32Array]';
+
+ /** Used to match empty string literals in compiled template source. */
+ var reEmptyStringLeading = /\b__p \+= '';/g,
+ reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
+ reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
+
+ /** Used to match HTML entities and HTML characters. */
+ var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,
+ reUnescapedHtml = /[&<>"']/g,
+ reHasEscapedHtml = RegExp(reEscapedHtml.source),
+ reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
+
+ /** Used to match template delimiters. */
+ var reEscape = /<%-([\s\S]+?)%>/g,
+ reEvaluate = /<%([\s\S]+?)%>/g,
+ reInterpolate = /<%=([\s\S]+?)%>/g;
+
+ /** Used to match property names within property paths. */
+ var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
+ reIsPlainProp = /^\w*$/,
+ rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
+
+ /**
+ * Used to match `RegExp`
+ * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
+ */
+ var reRegExpChar = /[\\^$.*+?()[\]{}|]/g,
+ reHasRegExpChar = RegExp(reRegExpChar.source);
+
+ /** Used to match leading and trailing whitespace. */
+ var reTrim = /^\s+|\s+$/g,
+ reTrimStart = /^\s+/,
+ reTrimEnd = /\s+$/;
+
+ /** Used to match wrap detail comments. */
+ var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,
+ reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/,
+ reSplitDetails = /,? & /;
+
+ /** Used to match words composed of alphanumeric characters. */
+ var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
+
+ /** Used to match backslashes in property paths. */
+ var reEscapeChar = /\\(\\)?/g;
+
+ /**
+ * Used to match
+ * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).
+ */
+ var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
+
+ /** Used to match `RegExp` flags from their coerced string values. */
+ var reFlags = /\w*$/;
+
+ /** Used to detect bad signed hexadecimal string values. */
+ var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
+
+ /** Used to detect binary string values. */
+ var reIsBinary = /^0b[01]+$/i;
+
+ /** Used to detect host constructors (Safari). */
+ var reIsHostCtor = /^\[object .+?Constructor\]$/;
+
+ /** Used to detect octal string values. */
+ var reIsOctal = /^0o[0-7]+$/i;
+
+ /** Used to detect unsigned integer values. */
+ var reIsUint = /^(?:0|[1-9]\d*)$/;
+
+ /** Used to match Latin Unicode letters (excluding mathematical operators). */
+ var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
+
+ /** Used to ensure capturing order of template delimiters. */
+ var reNoMatch = /($^)/;
+
+ /** Used to match unescaped characters in compiled string literals. */
+ var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
+
+ /** Used to compose unicode character classes. */
+ var rsAstralRange = '\\ud800-\\udfff',
+ rsComboMarksRange = '\\u0300-\\u036f',
+ reComboHalfMarksRange = '\\ufe20-\\ufe2f',
+ rsComboSymbolsRange = '\\u20d0-\\u20ff',
+ rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,
+ rsDingbatRange = '\\u2700-\\u27bf',
+ rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff',
+ rsMathOpRange = '\\xac\\xb1\\xd7\\xf7',
+ rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf',
+ rsPunctuationRange = '\\u2000-\\u206f',
+ rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000',
+ rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde',
+ rsVarRange = '\\ufe0e\\ufe0f',
+ rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
+
+ /** Used to compose unicode capture groups. */
+ var rsApos = "['\u2019]",
+ rsAstral = '[' + rsAstralRange + ']',
+ rsBreak = '[' + rsBreakRange + ']',
+ rsCombo = '[' + rsComboRange + ']',
+ rsDigits = '\\d+',
+ rsDingbat = '[' + rsDingbatRange + ']',
+ rsLower = '[' + rsLowerRange + ']',
+ rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',
+ rsFitz = '\\ud83c[\\udffb-\\udfff]',
+ rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',
+ rsNonAstral = '[^' + rsAstralRange + ']',
+ rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}',
+ rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]',
+ rsUpper = '[' + rsUpperRange + ']',
+ rsZWJ = '\\u200d';
+
+ /** Used to compose unicode regexes. */
+ var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',
+ rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',
+ rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',
+ rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',
+ reOptMod = rsModifier + '?',
+ rsOptVar = '[' + rsVarRange + ']?',
+ rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',
+ rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])',
+ rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])',
+ rsSeq = rsOptVar + reOptMod + rsOptJoin,
+ rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,
+ rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';
+
+ /** Used to match apostrophes. */
+ var reApos = RegExp(rsApos, 'g');
+
+ /**
+ * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and
+ * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).
+ */
+ var reComboMark = RegExp(rsCombo, 'g');
+
+ /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */
+ var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');
+
+ /** Used to match complex or compound words. */
+ var reUnicodeWord = RegExp([
+ rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',
+ rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',
+ rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,
+ rsUpper + '+' + rsOptContrUpper,
+ rsOrdUpper,
+ rsOrdLower,
+ rsDigits,
+ rsEmoji
+ ].join('|'), 'g');
+
+ /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */
+ var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');
+
+ /** Used to detect strings that need a more robust regexp to match words. */
+ var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
+
+ /** Used to assign default `context` object properties. */
+ var contextProps = [
+ 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',
+ 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',
+ 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',
+ 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',
+ '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'
+ ];
+
+ /** Used to make template sourceURLs easier to identify. */
+ var templateCounter = -1;
+
+ /** Used to identify `toStringTag` values of typed arrays. */
+ var typedArrayTags = {};
+ typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
+ typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
+ typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
+ typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
+ typedArrayTags[uint32Tag] = true;
+ typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
+ typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
+ typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =
+ typedArrayTags[errorTag] = typedArrayTags[funcTag] =
+ typedArrayTags[mapTag] = typedArrayTags[numberTag] =
+ typedArrayTags[objectTag] = typedArrayTags[regexpTag] =
+ typedArrayTags[setTag] = typedArrayTags[stringTag] =
+ typedArrayTags[weakMapTag] = false;
+
+ /** Used to identify `toStringTag` values supported by `_.clone`. */
+ var cloneableTags = {};
+ cloneableTags[argsTag] = cloneableTags[arrayTag] =
+ cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =
+ cloneableTags[boolTag] = cloneableTags[dateTag] =
+ cloneableTags[float32Tag] = cloneableTags[float64Tag] =
+ cloneableTags[int8Tag] = cloneableTags[int16Tag] =
+ cloneableTags[int32Tag] = cloneableTags[mapTag] =
+ cloneableTags[numberTag] = cloneableTags[objectTag] =
+ cloneableTags[regexpTag] = cloneableTags[setTag] =
+ cloneableTags[stringTag] = cloneableTags[symbolTag] =
+ cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =
+ cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
+ cloneableTags[errorTag] = cloneableTags[funcTag] =
+ cloneableTags[weakMapTag] = false;
+
+ /** Used to map Latin Unicode letters to basic Latin letters. */
+ var deburredLetters = {
+ // Latin-1 Supplement block.
+ '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A',
+ '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a',
+ '\xc7': 'C', '\xe7': 'c',
+ '\xd0': 'D', '\xf0': 'd',
+ '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E',
+ '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e',
+ '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I',
+ '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i',
+ '\xd1': 'N', '\xf1': 'n',
+ '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O',
+ '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o',
+ '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U',
+ '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u',
+ '\xdd': 'Y', '\xfd': 'y', '\xff': 'y',
+ '\xc6': 'Ae', '\xe6': 'ae',
+ '\xde': 'Th', '\xfe': 'th',
+ '\xdf': 'ss',
+ // Latin Extended-A block.
+ '\u0100': 'A', '\u0102': 'A', '\u0104': 'A',
+ '\u0101': 'a', '\u0103': 'a', '\u0105': 'a',
+ '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C',
+ '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c',
+ '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd',
+ '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E',
+ '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e',
+ '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G',
+ '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g',
+ '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h',
+ '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I',
+ '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i',
+ '\u0134': 'J', '\u0135': 'j',
+ '\u0136': 'K', '\u0137': 'k', '\u0138': 'k',
+ '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L',
+ '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l',
+ '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N',
+ '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n',
+ '\u014c': 'O', '\u014e': 'O', '\u0150': 'O',
+ '\u014d': 'o', '\u014f': 'o', '\u0151': 'o',
+ '\u0154': 'R', '\u0156': 'R', '\u0158': 'R',
+ '\u0155': 'r', '\u0157': 'r', '\u0159': 'r',
+ '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S',
+ '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's',
+ '\u0162': 'T', '\u0164': 'T', '\u0166': 'T',
+ '\u0163': 't', '\u0165': 't', '\u0167': 't',
+ '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U',
+ '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u',
+ '\u0174': 'W', '\u0175': 'w',
+ '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y',
+ '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z',
+ '\u017a': 'z', '\u017c': 'z', '\u017e': 'z',
+ '\u0132': 'IJ', '\u0133': 'ij',
+ '\u0152': 'Oe', '\u0153': 'oe',
+ '\u0149': "'n", '\u017f': 's'
+ };
+
+ /** Used to map characters to HTML entities. */
+ var htmlEscapes = {
+ '&': '&',
+ '<': '<',
+ '>': '>',
+ '"': '"',
+ "'": '''
+ };
+
+ /** Used to map HTML entities to characters. */
+ var htmlUnescapes = {
+ '&': '&',
+ '<': '<',
+ '>': '>',
+ '"': '"',
+ ''': "'"
+ };
+
+ /** Used to escape characters for inclusion in compiled string literals. */
+ var stringEscapes = {
+ '\\': '\\',
+ "'": "'",
+ '\n': 'n',
+ '\r': 'r',
+ '\u2028': 'u2028',
+ '\u2029': 'u2029'
+ };
+
+ /** Built-in method references without a dependency on `root`. */
+ var freeParseFloat = parseFloat,
+ freeParseInt = parseInt;
+
+ /** Detect free variable `global` from Node.js. */
+ var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;
+
+ /** Detect free variable `self`. */
+ var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
+
+ /** Used as a reference to the global object. */
+ var root = freeGlobal || freeSelf || Function('return this')();
+
+ /** Detect free variable `exports`. */
+ var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;
+
+ /** Detect free variable `module`. */
+ var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;
+
+ /** Detect the popular CommonJS extension `module.exports`. */
+ var moduleExports = freeModule && freeModule.exports === freeExports;
+
+ /** Detect free variable `process` from Node.js. */
+ var freeProcess = moduleExports && freeGlobal.process;
+
+ /** Used to access faster Node.js helpers. */
+ var nodeUtil = (function() {
+ try {
+ // Use `util.types` for Node.js 10+.
+ var types = freeModule && freeModule.require && freeModule.require('util').types;
+
+ if (types) {
+ return types;
+ }
+
+ // Legacy `process.binding('util')` for Node.js < 10.
+ return freeProcess && freeProcess.binding && freeProcess.binding('util');
+ } catch (e) {}
+ }());
+
+ /* Node.js helper references. */
+ var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,
+ nodeIsDate = nodeUtil && nodeUtil.isDate,
+ nodeIsMap = nodeUtil && nodeUtil.isMap,
+ nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,
+ nodeIsSet = nodeUtil && nodeUtil.isSet,
+ nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * A faster alternative to `Function#apply`, this function invokes `func`
+ * with the `this` binding of `thisArg` and the arguments of `args`.
+ *
+ * @private
+ * @param {Function} func The function to invoke.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {Array} args The arguments to invoke `func` with.
+ * @returns {*} Returns the result of `func`.
+ */
+ function apply(func, thisArg, args) {
+ switch (args.length) {
+ case 0: return func.call(thisArg);
+ case 1: return func.call(thisArg, args[0]);
+ case 2: return func.call(thisArg, args[0], args[1]);
+ case 3: return func.call(thisArg, args[0], args[1], args[2]);
+ }
+ return func.apply(thisArg, args);
+ }
+
+ /**
+ * A specialized version of `baseAggregator` for arrays.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} setter The function to set `accumulator` values.
+ * @param {Function} iteratee The iteratee to transform keys.
+ * @param {Object} accumulator The initial aggregated object.
+ * @returns {Function} Returns `accumulator`.
+ */
+ function arrayAggregator(array, setter, iteratee, accumulator) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ var value = array[index];
+ setter(accumulator, value, iteratee(value), array);
+ }
+ return accumulator;
+ }
+
+ /**
+ * A specialized version of `_.forEach` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns `array`.
+ */
+ function arrayEach(array, iteratee) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (iteratee(array[index], index, array) === false) {
+ break;
+ }
+ }
+ return array;
+ }
+
+ /**
+ * A specialized version of `_.forEachRight` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns `array`.
+ */
+ function arrayEachRight(array, iteratee) {
+ var length = array == null ? 0 : array.length;
+
+ while (length--) {
+ if (iteratee(array[length], length, array) === false) {
+ break;
+ }
+ }
+ return array;
+ }
+
+ /**
+ * A specialized version of `_.every` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if all elements pass the predicate check,
+ * else `false`.
+ */
+ function arrayEvery(array, predicate) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (!predicate(array[index], index, array)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * A specialized version of `_.filter` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ */
+ function arrayFilter(array, predicate) {
+ var index = -1,
+ length = array == null ? 0 : array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index];
+ if (predicate(value, index, array)) {
+ result[resIndex++] = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * A specialized version of `_.includes` for arrays without support for
+ * specifying an index to search from.
+ *
+ * @private
+ * @param {Array} [array] The array to inspect.
+ * @param {*} target The value to search for.
+ * @returns {boolean} Returns `true` if `target` is found, else `false`.
+ */
+ function arrayIncludes(array, value) {
+ var length = array == null ? 0 : array.length;
+ return !!length && baseIndexOf(array, value, 0) > -1;
+ }
+
+ /**
+ * This function is like `arrayIncludes` except that it accepts a comparator.
+ *
+ * @private
+ * @param {Array} [array] The array to inspect.
+ * @param {*} target The value to search for.
+ * @param {Function} comparator The comparator invoked per element.
+ * @returns {boolean} Returns `true` if `target` is found, else `false`.
+ */
+ function arrayIncludesWith(array, value, comparator) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (comparator(value, array[index])) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ /**
+ * A specialized version of `_.map` for arrays without support for iteratee
+ * shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns the new mapped array.
+ */
+ function arrayMap(array, iteratee) {
+ var index = -1,
+ length = array == null ? 0 : array.length,
+ result = Array(length);
+
+ while (++index < length) {
+ result[index] = iteratee(array[index], index, array);
+ }
+ return result;
+ }
+
+ /**
+ * Appends the elements of `values` to `array`.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to append.
+ * @returns {Array} Returns `array`.
+ */
+ function arrayPush(array, values) {
+ var index = -1,
+ length = values.length,
+ offset = array.length;
+
+ while (++index < length) {
+ array[offset + index] = values[index];
+ }
+ return array;
+ }
+
+ /**
+ * A specialized version of `_.reduce` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @param {boolean} [initAccum] Specify using the first element of `array` as
+ * the initial value.
+ * @returns {*} Returns the accumulated value.
+ */
+ function arrayReduce(array, iteratee, accumulator, initAccum) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ if (initAccum && length) {
+ accumulator = array[++index];
+ }
+ while (++index < length) {
+ accumulator = iteratee(accumulator, array[index], index, array);
+ }
+ return accumulator;
+ }
+
+ /**
+ * A specialized version of `_.reduceRight` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @param {boolean} [initAccum] Specify using the last element of `array` as
+ * the initial value.
+ * @returns {*} Returns the accumulated value.
+ */
+ function arrayReduceRight(array, iteratee, accumulator, initAccum) {
+ var length = array == null ? 0 : array.length;
+ if (initAccum && length) {
+ accumulator = array[--length];
+ }
+ while (length--) {
+ accumulator = iteratee(accumulator, array[length], length, array);
+ }
+ return accumulator;
+ }
+
+ /**
+ * A specialized version of `_.some` for arrays without support for iteratee
+ * shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ * else `false`.
+ */
+ function arraySome(array, predicate) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (predicate(array[index], index, array)) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ /**
+ * Gets the size of an ASCII `string`.
+ *
+ * @private
+ * @param {string} string The string inspect.
+ * @returns {number} Returns the string size.
+ */
+ var asciiSize = baseProperty('length');
+
+ /**
+ * Converts an ASCII `string` to an array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function asciiToArray(string) {
+ return string.split('');
+ }
+
+ /**
+ * Splits an ASCII `string` into an array of its words.
+ *
+ * @private
+ * @param {string} The string to inspect.
+ * @returns {Array} Returns the words of `string`.
+ */
+ function asciiWords(string) {
+ return string.match(reAsciiWord) || [];
+ }
+
+ /**
+ * The base implementation of methods like `_.findKey` and `_.findLastKey`,
+ * without support for iteratee shorthands, which iterates over `collection`
+ * using `eachFunc`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to inspect.
+ * @param {Function} predicate The function invoked per iteration.
+ * @param {Function} eachFunc The function to iterate over `collection`.
+ * @returns {*} Returns the found element or its key, else `undefined`.
+ */
+ function baseFindKey(collection, predicate, eachFunc) {
+ var result;
+ eachFunc(collection, function(value, key, collection) {
+ if (predicate(value, key, collection)) {
+ result = key;
+ return false;
+ }
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.findIndex` and `_.findLastIndex` without
+ * support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Function} predicate The function invoked per iteration.
+ * @param {number} fromIndex The index to search from.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function baseFindIndex(array, predicate, fromIndex, fromRight) {
+ var length = array.length,
+ index = fromIndex + (fromRight ? 1 : -1);
+
+ while ((fromRight ? index-- : ++index < length)) {
+ if (predicate(array[index], index, array)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * The base implementation of `_.indexOf` without `fromIndex` bounds checks.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function baseIndexOf(array, value, fromIndex) {
+ return value === value
+ ? strictIndexOf(array, value, fromIndex)
+ : baseFindIndex(array, baseIsNaN, fromIndex);
+ }
+
+ /**
+ * This function is like `baseIndexOf` except that it accepts a comparator.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @param {Function} comparator The comparator invoked per element.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function baseIndexOfWith(array, value, fromIndex, comparator) {
+ var index = fromIndex - 1,
+ length = array.length;
+
+ while (++index < length) {
+ if (comparator(array[index], value)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * The base implementation of `_.isNaN` without support for number objects.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
+ */
+ function baseIsNaN(value) {
+ return value !== value;
+ }
+
+ /**
+ * The base implementation of `_.mean` and `_.meanBy` without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {number} Returns the mean.
+ */
+ function baseMean(array, iteratee) {
+ var length = array == null ? 0 : array.length;
+ return length ? (baseSum(array, iteratee) / length) : NAN;
+ }
+
+ /**
+ * The base implementation of `_.property` without support for deep paths.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @returns {Function} Returns the new accessor function.
+ */
+ function baseProperty(key) {
+ return function(object) {
+ return object == null ? undefined : object[key];
+ };
+ }
+
+ /**
+ * The base implementation of `_.propertyOf` without support for deep paths.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Function} Returns the new accessor function.
+ */
+ function basePropertyOf(object) {
+ return function(key) {
+ return object == null ? undefined : object[key];
+ };
+ }
+
+ /**
+ * The base implementation of `_.reduce` and `_.reduceRight`, without support
+ * for iteratee shorthands, which iterates over `collection` using `eachFunc`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {*} accumulator The initial value.
+ * @param {boolean} initAccum Specify using the first or last element of
+ * `collection` as the initial value.
+ * @param {Function} eachFunc The function to iterate over `collection`.
+ * @returns {*} Returns the accumulated value.
+ */
+ function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {
+ eachFunc(collection, function(value, index, collection) {
+ accumulator = initAccum
+ ? (initAccum = false, value)
+ : iteratee(accumulator, value, index, collection);
+ });
+ return accumulator;
+ }
+
+ /**
+ * The base implementation of `_.sortBy` which uses `comparer` to define the
+ * sort order of `array` and replaces criteria objects with their corresponding
+ * values.
+ *
+ * @private
+ * @param {Array} array The array to sort.
+ * @param {Function} comparer The function to define sort order.
+ * @returns {Array} Returns `array`.
+ */
+ function baseSortBy(array, comparer) {
+ var length = array.length;
+
+ array.sort(comparer);
+ while (length--) {
+ array[length] = array[length].value;
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.sum` and `_.sumBy` without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {number} Returns the sum.
+ */
+ function baseSum(array, iteratee) {
+ var result,
+ index = -1,
+ length = array.length;
+
+ while (++index < length) {
+ var current = iteratee(array[index]);
+ if (current !== undefined) {
+ result = result === undefined ? current : (result + current);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.times` without support for iteratee shorthands
+ * or max array length checks.
+ *
+ * @private
+ * @param {number} n The number of times to invoke `iteratee`.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns the array of results.
+ */
+ function baseTimes(n, iteratee) {
+ var index = -1,
+ result = Array(n);
+
+ while (++index < n) {
+ result[index] = iteratee(index);
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array
+ * of key-value pairs for `object` corresponding to the property names of `props`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array} props The property names to get values for.
+ * @returns {Object} Returns the key-value pairs.
+ */
+ function baseToPairs(object, props) {
+ return arrayMap(props, function(key) {
+ return [key, object[key]];
+ });
+ }
+
+ /**
+ * The base implementation of `_.unary` without support for storing metadata.
+ *
+ * @private
+ * @param {Function} func The function to cap arguments for.
+ * @returns {Function} Returns the new capped function.
+ */
+ function baseUnary(func) {
+ return function(value) {
+ return func(value);
+ };
+ }
+
+ /**
+ * The base implementation of `_.values` and `_.valuesIn` which creates an
+ * array of `object` property values corresponding to the property names
+ * of `props`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array} props The property names to get values for.
+ * @returns {Object} Returns the array of property values.
+ */
+ function baseValues(object, props) {
+ return arrayMap(props, function(key) {
+ return object[key];
+ });
+ }
+
+ /**
+ * Checks if a `cache` value for `key` exists.
+ *
+ * @private
+ * @param {Object} cache The cache to query.
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function cacheHas(cache, key) {
+ return cache.has(key);
+ }
+
+ /**
+ * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol
+ * that is not found in the character symbols.
+ *
+ * @private
+ * @param {Array} strSymbols The string symbols to inspect.
+ * @param {Array} chrSymbols The character symbols to find.
+ * @returns {number} Returns the index of the first unmatched string symbol.
+ */
+ function charsStartIndex(strSymbols, chrSymbols) {
+ var index = -1,
+ length = strSymbols.length;
+
+ while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
+ return index;
+ }
+
+ /**
+ * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol
+ * that is not found in the character symbols.
+ *
+ * @private
+ * @param {Array} strSymbols The string symbols to inspect.
+ * @param {Array} chrSymbols The character symbols to find.
+ * @returns {number} Returns the index of the last unmatched string symbol.
+ */
+ function charsEndIndex(strSymbols, chrSymbols) {
+ var index = strSymbols.length;
+
+ while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
+ return index;
+ }
+
+ /**
+ * Gets the number of `placeholder` occurrences in `array`.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} placeholder The placeholder to search for.
+ * @returns {number} Returns the placeholder count.
+ */
+ function countHolders(array, placeholder) {
+ var length = array.length,
+ result = 0;
+
+ while (length--) {
+ if (array[length] === placeholder) {
+ ++result;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A
+ * letters to basic Latin letters.
+ *
+ * @private
+ * @param {string} letter The matched letter to deburr.
+ * @returns {string} Returns the deburred letter.
+ */
+ var deburrLetter = basePropertyOf(deburredLetters);
+
+ /**
+ * Used by `_.escape` to convert characters to HTML entities.
+ *
+ * @private
+ * @param {string} chr The matched character to escape.
+ * @returns {string} Returns the escaped character.
+ */
+ var escapeHtmlChar = basePropertyOf(htmlEscapes);
+
+ /**
+ * Used by `_.template` to escape characters for inclusion in compiled string literals.
+ *
+ * @private
+ * @param {string} chr The matched character to escape.
+ * @returns {string} Returns the escaped character.
+ */
+ function escapeStringChar(chr) {
+ return '\\' + stringEscapes[chr];
+ }
+
+ /**
+ * Gets the value at `key` of `object`.
+ *
+ * @private
+ * @param {Object} [object] The object to query.
+ * @param {string} key The key of the property to get.
+ * @returns {*} Returns the property value.
+ */
+ function getValue(object, key) {
+ return object == null ? undefined : object[key];
+ }
+
+ /**
+ * Checks if `string` contains Unicode symbols.
+ *
+ * @private
+ * @param {string} string The string to inspect.
+ * @returns {boolean} Returns `true` if a symbol is found, else `false`.
+ */
+ function hasUnicode(string) {
+ return reHasUnicode.test(string);
+ }
+
+ /**
+ * Checks if `string` contains a word composed of Unicode symbols.
+ *
+ * @private
+ * @param {string} string The string to inspect.
+ * @returns {boolean} Returns `true` if a word is found, else `false`.
+ */
+ function hasUnicodeWord(string) {
+ return reHasUnicodeWord.test(string);
+ }
+
+ /**
+ * Converts `iterator` to an array.
+ *
+ * @private
+ * @param {Object} iterator The iterator to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function iteratorToArray(iterator) {
+ var data,
+ result = [];
+
+ while (!(data = iterator.next()).done) {
+ result.push(data.value);
+ }
+ return result;
+ }
+
+ /**
+ * Converts `map` to its key-value pairs.
+ *
+ * @private
+ * @param {Object} map The map to convert.
+ * @returns {Array} Returns the key-value pairs.
+ */
+ function mapToArray(map) {
+ var index = -1,
+ result = Array(map.size);
+
+ map.forEach(function(value, key) {
+ result[++index] = [key, value];
+ });
+ return result;
+ }
+
+ /**
+ * Creates a unary function that invokes `func` with its argument transformed.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {Function} transform The argument transform.
+ * @returns {Function} Returns the new function.
+ */
+ function overArg(func, transform) {
+ return function(arg) {
+ return func(transform(arg));
+ };
+ }
+
+ /**
+ * Replaces all `placeholder` elements in `array` with an internal placeholder
+ * and returns an array of their indexes.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {*} placeholder The placeholder to replace.
+ * @returns {Array} Returns the new array of placeholder indexes.
+ */
+ function replaceHolders(array, placeholder) {
+ var index = -1,
+ length = array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index];
+ if (value === placeholder || value === PLACEHOLDER) {
+ array[index] = PLACEHOLDER;
+ result[resIndex++] = index;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the value at `key`, unless `key` is "__proto__".
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {string} key The key of the property to get.
+ * @returns {*} Returns the property value.
+ */
+ function safeGet(object, key) {
+ return key == '__proto__'
+ ? undefined
+ : object[key];
+ }
+
+ /**
+ * Converts `set` to an array of its values.
+ *
+ * @private
+ * @param {Object} set The set to convert.
+ * @returns {Array} Returns the values.
+ */
+ function setToArray(set) {
+ var index = -1,
+ result = Array(set.size);
+
+ set.forEach(function(value) {
+ result[++index] = value;
+ });
+ return result;
+ }
+
+ /**
+ * Converts `set` to its value-value pairs.
+ *
+ * @private
+ * @param {Object} set The set to convert.
+ * @returns {Array} Returns the value-value pairs.
+ */
+ function setToPairs(set) {
+ var index = -1,
+ result = Array(set.size);
+
+ set.forEach(function(value) {
+ result[++index] = [value, value];
+ });
+ return result;
+ }
+
+ /**
+ * A specialized version of `_.indexOf` which performs strict equality
+ * comparisons of values, i.e. `===`.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function strictIndexOf(array, value, fromIndex) {
+ var index = fromIndex - 1,
+ length = array.length;
+
+ while (++index < length) {
+ if (array[index] === value) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * A specialized version of `_.lastIndexOf` which performs strict equality
+ * comparisons of values, i.e. `===`.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function strictLastIndexOf(array, value, fromIndex) {
+ var index = fromIndex + 1;
+ while (index--) {
+ if (array[index] === value) {
+ return index;
+ }
+ }
+ return index;
+ }
+
+ /**
+ * Gets the number of symbols in `string`.
+ *
+ * @private
+ * @param {string} string The string to inspect.
+ * @returns {number} Returns the string size.
+ */
+ function stringSize(string) {
+ return hasUnicode(string)
+ ? unicodeSize(string)
+ : asciiSize(string);
+ }
+
+ /**
+ * Converts `string` to an array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function stringToArray(string) {
+ return hasUnicode(string)
+ ? unicodeToArray(string)
+ : asciiToArray(string);
+ }
+
+ /**
+ * Used by `_.unescape` to convert HTML entities to characters.
+ *
+ * @private
+ * @param {string} chr The matched character to unescape.
+ * @returns {string} Returns the unescaped character.
+ */
+ var unescapeHtmlChar = basePropertyOf(htmlUnescapes);
+
+ /**
+ * Gets the size of a Unicode `string`.
+ *
+ * @private
+ * @param {string} string The string inspect.
+ * @returns {number} Returns the string size.
+ */
+ function unicodeSize(string) {
+ var result = reUnicode.lastIndex = 0;
+ while (reUnicode.test(string)) {
+ ++result;
+ }
+ return result;
+ }
+
+ /**
+ * Converts a Unicode `string` to an array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function unicodeToArray(string) {
+ return string.match(reUnicode) || [];
+ }
+
+ /**
+ * Splits a Unicode `string` into an array of its words.
+ *
+ * @private
+ * @param {string} The string to inspect.
+ * @returns {Array} Returns the words of `string`.
+ */
+ function unicodeWords(string) {
+ return string.match(reUnicodeWord) || [];
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Create a new pristine `lodash` function using the `context` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category Util
+ * @param {Object} [context=root] The context object.
+ * @returns {Function} Returns a new `lodash` function.
+ * @example
+ *
+ * _.mixin({ 'foo': _.constant('foo') });
+ *
+ * var lodash = _.runInContext();
+ * lodash.mixin({ 'bar': lodash.constant('bar') });
+ *
+ * _.isFunction(_.foo);
+ * // => true
+ * _.isFunction(_.bar);
+ * // => false
+ *
+ * lodash.isFunction(lodash.foo);
+ * // => false
+ * lodash.isFunction(lodash.bar);
+ * // => true
+ *
+ * // Create a suped-up `defer` in Node.js.
+ * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;
+ */
+ var runInContext = (function runInContext(context) {
+ context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));
+
+ /** Built-in constructor references. */
+ var Array = context.Array,
+ Date = context.Date,
+ Error = context.Error,
+ Function = context.Function,
+ Math = context.Math,
+ Object = context.Object,
+ RegExp = context.RegExp,
+ String = context.String,
+ TypeError = context.TypeError;
+
+ /** Used for built-in method references. */
+ var arrayProto = Array.prototype,
+ funcProto = Function.prototype,
+ objectProto = Object.prototype;
+
+ /** Used to detect overreaching core-js shims. */
+ var coreJsData = context['__core-js_shared__'];
+
+ /** Used to resolve the decompiled source of functions. */
+ var funcToString = funcProto.toString;
+
+ /** Used to check objects for own properties. */
+ var hasOwnProperty = objectProto.hasOwnProperty;
+
+ /** Used to generate unique IDs. */
+ var idCounter = 0;
+
+ /** Used to detect methods masquerading as native. */
+ var maskSrcKey = (function() {
+ var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
+ return uid ? ('Symbol(src)_1.' + uid) : '';
+ }());
+
+ /**
+ * Used to resolve the
+ * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
+ * of values.
+ */
+ var nativeObjectToString = objectProto.toString;
+
+ /** Used to infer the `Object` constructor. */
+ var objectCtorString = funcToString.call(Object);
+
+ /** Used to restore the original `_` reference in `_.noConflict`. */
+ var oldDash = root._;
+
+ /** Used to detect if a method is native. */
+ var reIsNative = RegExp('^' +
+ funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
+ .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
+ );
+
+ /** Built-in value references. */
+ var Buffer = moduleExports ? context.Buffer : undefined,
+ Symbol = context.Symbol,
+ Uint8Array = context.Uint8Array,
+ allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,
+ getPrototype = overArg(Object.getPrototypeOf, Object),
+ objectCreate = Object.create,
+ propertyIsEnumerable = objectProto.propertyIsEnumerable,
+ splice = arrayProto.splice,
+ spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,
+ symIterator = Symbol ? Symbol.iterator : undefined,
+ symToStringTag = Symbol ? Symbol.toStringTag : undefined;
+
+ var defineProperty = (function() {
+ try {
+ var func = getNative(Object, 'defineProperty');
+ func({}, '', {});
+ return func;
+ } catch (e) {}
+ }());
+
+ /** Mocked built-ins. */
+ var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,
+ ctxNow = Date && Date.now !== root.Date.now && Date.now,
+ ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;
+
+ /* Built-in method references for those with the same name as other `lodash` methods. */
+ var nativeCeil = Math.ceil,
+ nativeFloor = Math.floor,
+ nativeGetSymbols = Object.getOwnPropertySymbols,
+ nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
+ nativeIsFinite = context.isFinite,
+ nativeJoin = arrayProto.join,
+ nativeKeys = overArg(Object.keys, Object),
+ nativeMax = Math.max,
+ nativeMin = Math.min,
+ nativeNow = Date.now,
+ nativeParseInt = context.parseInt,
+ nativeRandom = Math.random,
+ nativeReverse = arrayProto.reverse;
+
+ /* Built-in method references that are verified to be native. */
+ var DataView = getNative(context, 'DataView'),
+ Map = getNative(context, 'Map'),
+ Promise = getNative(context, 'Promise'),
+ Set = getNative(context, 'Set'),
+ WeakMap = getNative(context, 'WeakMap'),
+ nativeCreate = getNative(Object, 'create');
+
+ /** Used to store function metadata. */
+ var metaMap = WeakMap && new WeakMap;
+
+ /** Used to lookup unminified function names. */
+ var realNames = {};
+
+ /** Used to detect maps, sets, and weakmaps. */
+ var dataViewCtorString = toSource(DataView),
+ mapCtorString = toSource(Map),
+ promiseCtorString = toSource(Promise),
+ setCtorString = toSource(Set),
+ weakMapCtorString = toSource(WeakMap);
+
+ /** Used to convert symbols to primitives and strings. */
+ var symbolProto = Symbol ? Symbol.prototype : undefined,
+ symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,
+ symbolToString = symbolProto ? symbolProto.toString : undefined;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a `lodash` object which wraps `value` to enable implicit method
+ * chain sequences. Methods that operate on and return arrays, collections,
+ * and functions can be chained together. Methods that retrieve a single value
+ * or may return a primitive value will automatically end the chain sequence
+ * and return the unwrapped value. Otherwise, the value must be unwrapped
+ * with `_#value`.
+ *
+ * Explicit chain sequences, which must be unwrapped with `_#value`, may be
+ * enabled using `_.chain`.
+ *
+ * The execution of chained methods is lazy, that is, it's deferred until
+ * `_#value` is implicitly or explicitly called.
+ *
+ * Lazy evaluation allows several methods to support shortcut fusion.
+ * Shortcut fusion is an optimization to merge iteratee calls; this avoids
+ * the creation of intermediate arrays and can greatly reduce the number of
+ * iteratee executions. Sections of a chain sequence qualify for shortcut
+ * fusion if the section is applied to an array and iteratees accept only
+ * one argument. The heuristic for whether a section qualifies for shortcut
+ * fusion is subject to change.
+ *
+ * Chaining is supported in custom builds as long as the `_#value` method is
+ * directly or indirectly included in the build.
+ *
+ * In addition to lodash methods, wrappers have `Array` and `String` methods.
+ *
+ * The wrapper `Array` methods are:
+ * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`
+ *
+ * The wrapper `String` methods are:
+ * `replace` and `split`
+ *
+ * The wrapper methods that support shortcut fusion are:
+ * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,
+ * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,
+ * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`
+ *
+ * The chainable wrapper methods are:
+ * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,
+ * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,
+ * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,
+ * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,
+ * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,
+ * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,
+ * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,
+ * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,
+ * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,
+ * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,
+ * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,
+ * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,
+ * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,
+ * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,
+ * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,
+ * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,
+ * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,
+ * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,
+ * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,
+ * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,
+ * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,
+ * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,
+ * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,
+ * `zipObject`, `zipObjectDeep`, and `zipWith`
+ *
+ * The wrapper methods that are **not** chainable by default are:
+ * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,
+ * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,
+ * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,
+ * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,
+ * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,
+ * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,
+ * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,
+ * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,
+ * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,
+ * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,
+ * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,
+ * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,
+ * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,
+ * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,
+ * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,
+ * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,
+ * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,
+ * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,
+ * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,
+ * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,
+ * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,
+ * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,
+ * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,
+ * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,
+ * `upperFirst`, `value`, and `words`
+ *
+ * @name _
+ * @constructor
+ * @category Seq
+ * @param {*} value The value to wrap in a `lodash` instance.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var wrapped = _([1, 2, 3]);
+ *
+ * // Returns an unwrapped value.
+ * wrapped.reduce(_.add);
+ * // => 6
+ *
+ * // Returns a wrapped value.
+ * var squares = wrapped.map(square);
+ *
+ * _.isArray(squares);
+ * // => false
+ *
+ * _.isArray(squares.value());
+ * // => true
+ */
+ function lodash(value) {
+ if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {
+ if (value instanceof LodashWrapper) {
+ return value;
+ }
+ if (hasOwnProperty.call(value, '__wrapped__')) {
+ return wrapperClone(value);
+ }
+ }
+ return new LodashWrapper(value);
+ }
+
+ /**
+ * The base implementation of `_.create` without support for assigning
+ * properties to the created object.
+ *
+ * @private
+ * @param {Object} proto The object to inherit from.
+ * @returns {Object} Returns the new object.
+ */
+ var baseCreate = (function() {
+ function object() {}
+ return function(proto) {
+ if (!isObject(proto)) {
+ return {};
+ }
+ if (objectCreate) {
+ return objectCreate(proto);
+ }
+ object.prototype = proto;
+ var result = new object;
+ object.prototype = undefined;
+ return result;
+ };
+ }());
+
+ /**
+ * The function whose prototype chain sequence wrappers inherit from.
+ *
+ * @private
+ */
+ function baseLodash() {
+ // No operation performed.
+ }
+
+ /**
+ * The base constructor for creating `lodash` wrapper objects.
+ *
+ * @private
+ * @param {*} value The value to wrap.
+ * @param {boolean} [chainAll] Enable explicit method chain sequences.
+ */
+ function LodashWrapper(value, chainAll) {
+ this.__wrapped__ = value;
+ this.__actions__ = [];
+ this.__chain__ = !!chainAll;
+ this.__index__ = 0;
+ this.__values__ = undefined;
+ }
+
+ /**
+ * By default, the template delimiters used by lodash are like those in
+ * embedded Ruby (ERB) as well as ES2015 template strings. Change the
+ * following template settings to use alternative delimiters.
+ *
+ * @static
+ * @memberOf _
+ * @type {Object}
+ */
+ lodash.templateSettings = {
+
+ /**
+ * Used to detect `data` property values to be HTML-escaped.
+ *
+ * @memberOf _.templateSettings
+ * @type {RegExp}
+ */
+ 'escape': reEscape,
+
+ /**
+ * Used to detect code to be evaluated.
+ *
+ * @memberOf _.templateSettings
+ * @type {RegExp}
+ */
+ 'evaluate': reEvaluate,
+
+ /**
+ * Used to detect `data` property values to inject.
+ *
+ * @memberOf _.templateSettings
+ * @type {RegExp}
+ */
+ 'interpolate': reInterpolate,
+
+ /**
+ * Used to reference the data object in the template text.
+ *
+ * @memberOf _.templateSettings
+ * @type {string}
+ */
+ 'variable': '',
+
+ /**
+ * Used to import variables into the compiled template.
+ *
+ * @memberOf _.templateSettings
+ * @type {Object}
+ */
+ 'imports': {
+
+ /**
+ * A reference to the `lodash` function.
+ *
+ * @memberOf _.templateSettings.imports
+ * @type {Function}
+ */
+ '_': lodash
+ }
+ };
+
+ // Ensure wrappers are instances of `baseLodash`.
+ lodash.prototype = baseLodash.prototype;
+ lodash.prototype.constructor = lodash;
+
+ LodashWrapper.prototype = baseCreate(baseLodash.prototype);
+ LodashWrapper.prototype.constructor = LodashWrapper;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.
+ *
+ * @private
+ * @constructor
+ * @param {*} value The value to wrap.
+ */
+ function LazyWrapper(value) {
+ this.__wrapped__ = value;
+ this.__actions__ = [];
+ this.__dir__ = 1;
+ this.__filtered__ = false;
+ this.__iteratees__ = [];
+ this.__takeCount__ = MAX_ARRAY_LENGTH;
+ this.__views__ = [];
+ }
+
+ /**
+ * Creates a clone of the lazy wrapper object.
+ *
+ * @private
+ * @name clone
+ * @memberOf LazyWrapper
+ * @returns {Object} Returns the cloned `LazyWrapper` object.
+ */
+ function lazyClone() {
+ var result = new LazyWrapper(this.__wrapped__);
+ result.__actions__ = copyArray(this.__actions__);
+ result.__dir__ = this.__dir__;
+ result.__filtered__ = this.__filtered__;
+ result.__iteratees__ = copyArray(this.__iteratees__);
+ result.__takeCount__ = this.__takeCount__;
+ result.__views__ = copyArray(this.__views__);
+ return result;
+ }
+
+ /**
+ * Reverses the direction of lazy iteration.
+ *
+ * @private
+ * @name reverse
+ * @memberOf LazyWrapper
+ * @returns {Object} Returns the new reversed `LazyWrapper` object.
+ */
+ function lazyReverse() {
+ if (this.__filtered__) {
+ var result = new LazyWrapper(this);
+ result.__dir__ = -1;
+ result.__filtered__ = true;
+ } else {
+ result = this.clone();
+ result.__dir__ *= -1;
+ }
+ return result;
+ }
+
+ /**
+ * Extracts the unwrapped value from its lazy wrapper.
+ *
+ * @private
+ * @name value
+ * @memberOf LazyWrapper
+ * @returns {*} Returns the unwrapped value.
+ */
+ function lazyValue() {
+ var array = this.__wrapped__.value(),
+ dir = this.__dir__,
+ isArr = isArray(array),
+ isRight = dir < 0,
+ arrLength = isArr ? array.length : 0,
+ view = getView(0, arrLength, this.__views__),
+ start = view.start,
+ end = view.end,
+ length = end - start,
+ index = isRight ? end : (start - 1),
+ iteratees = this.__iteratees__,
+ iterLength = iteratees.length,
+ resIndex = 0,
+ takeCount = nativeMin(length, this.__takeCount__);
+
+ if (!isArr || (!isRight && arrLength == length && takeCount == length)) {
+ return baseWrapperValue(array, this.__actions__);
+ }
+ var result = [];
+
+ outer:
+ while (length-- && resIndex < takeCount) {
+ index += dir;
+
+ var iterIndex = -1,
+ value = array[index];
+
+ while (++iterIndex < iterLength) {
+ var data = iteratees[iterIndex],
+ iteratee = data.iteratee,
+ type = data.type,
+ computed = iteratee(value);
+
+ if (type == LAZY_MAP_FLAG) {
+ value = computed;
+ } else if (!computed) {
+ if (type == LAZY_FILTER_FLAG) {
+ continue outer;
+ } else {
+ break outer;
+ }
+ }
+ }
+ result[resIndex++] = value;
+ }
+ return result;
+ }
+
+ // Ensure `LazyWrapper` is an instance of `baseLodash`.
+ LazyWrapper.prototype = baseCreate(baseLodash.prototype);
+ LazyWrapper.prototype.constructor = LazyWrapper;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a hash object.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function Hash(entries) {
+ var index = -1,
+ length = entries == null ? 0 : entries.length;
+
+ this.clear();
+ while (++index < length) {
+ var entry = entries[index];
+ this.set(entry[0], entry[1]);
+ }
+ }
+
+ /**
+ * Removes all key-value entries from the hash.
+ *
+ * @private
+ * @name clear
+ * @memberOf Hash
+ */
+ function hashClear() {
+ this.__data__ = nativeCreate ? nativeCreate(null) : {};
+ this.size = 0;
+ }
+
+ /**
+ * Removes `key` and its value from the hash.
+ *
+ * @private
+ * @name delete
+ * @memberOf Hash
+ * @param {Object} hash The hash to modify.
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function hashDelete(key) {
+ var result = this.has(key) && delete this.__data__[key];
+ this.size -= result ? 1 : 0;
+ return result;
+ }
+
+ /**
+ * Gets the hash value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf Hash
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function hashGet(key) {
+ var data = this.__data__;
+ if (nativeCreate) {
+ var result = data[key];
+ return result === HASH_UNDEFINED ? undefined : result;
+ }
+ return hasOwnProperty.call(data, key) ? data[key] : undefined;
+ }
+
+ /**
+ * Checks if a hash value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf Hash
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function hashHas(key) {
+ var data = this.__data__;
+ return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);
+ }
+
+ /**
+ * Sets the hash `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf Hash
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the hash instance.
+ */
+ function hashSet(key, value) {
+ var data = this.__data__;
+ this.size += this.has(key) ? 0 : 1;
+ data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
+ return this;
+ }
+
+ // Add methods to `Hash`.
+ Hash.prototype.clear = hashClear;
+ Hash.prototype['delete'] = hashDelete;
+ Hash.prototype.get = hashGet;
+ Hash.prototype.has = hashHas;
+ Hash.prototype.set = hashSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an list cache object.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function ListCache(entries) {
+ var index = -1,
+ length = entries == null ? 0 : entries.length;
+
+ this.clear();
+ while (++index < length) {
+ var entry = entries[index];
+ this.set(entry[0], entry[1]);
+ }
+ }
+
+ /**
+ * Removes all key-value entries from the list cache.
+ *
+ * @private
+ * @name clear
+ * @memberOf ListCache
+ */
+ function listCacheClear() {
+ this.__data__ = [];
+ this.size = 0;
+ }
+
+ /**
+ * Removes `key` and its value from the list cache.
+ *
+ * @private
+ * @name delete
+ * @memberOf ListCache
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function listCacheDelete(key) {
+ var data = this.__data__,
+ index = assocIndexOf(data, key);
+
+ if (index < 0) {
+ return false;
+ }
+ var lastIndex = data.length - 1;
+ if (index == lastIndex) {
+ data.pop();
+ } else {
+ splice.call(data, index, 1);
+ }
+ --this.size;
+ return true;
+ }
+
+ /**
+ * Gets the list cache value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf ListCache
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function listCacheGet(key) {
+ var data = this.__data__,
+ index = assocIndexOf(data, key);
+
+ return index < 0 ? undefined : data[index][1];
+ }
+
+ /**
+ * Checks if a list cache value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf ListCache
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function listCacheHas(key) {
+ return assocIndexOf(this.__data__, key) > -1;
+ }
+
+ /**
+ * Sets the list cache `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf ListCache
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the list cache instance.
+ */
+ function listCacheSet(key, value) {
+ var data = this.__data__,
+ index = assocIndexOf(data, key);
+
+ if (index < 0) {
+ ++this.size;
+ data.push([key, value]);
+ } else {
+ data[index][1] = value;
+ }
+ return this;
+ }
+
+ // Add methods to `ListCache`.
+ ListCache.prototype.clear = listCacheClear;
+ ListCache.prototype['delete'] = listCacheDelete;
+ ListCache.prototype.get = listCacheGet;
+ ListCache.prototype.has = listCacheHas;
+ ListCache.prototype.set = listCacheSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a map cache object to store key-value pairs.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function MapCache(entries) {
+ var index = -1,
+ length = entries == null ? 0 : entries.length;
+
+ this.clear();
+ while (++index < length) {
+ var entry = entries[index];
+ this.set(entry[0], entry[1]);
+ }
+ }
+
+ /**
+ * Removes all key-value entries from the map.
+ *
+ * @private
+ * @name clear
+ * @memberOf MapCache
+ */
+ function mapCacheClear() {
+ this.size = 0;
+ this.__data__ = {
+ 'hash': new Hash,
+ 'map': new (Map || ListCache),
+ 'string': new Hash
+ };
+ }
+
+ /**
+ * Removes `key` and its value from the map.
+ *
+ * @private
+ * @name delete
+ * @memberOf MapCache
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function mapCacheDelete(key) {
+ var result = getMapData(this, key)['delete'](key);
+ this.size -= result ? 1 : 0;
+ return result;
+ }
+
+ /**
+ * Gets the map value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf MapCache
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function mapCacheGet(key) {
+ return getMapData(this, key).get(key);
+ }
+
+ /**
+ * Checks if a map value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf MapCache
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function mapCacheHas(key) {
+ return getMapData(this, key).has(key);
+ }
+
+ /**
+ * Sets the map `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf MapCache
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the map cache instance.
+ */
+ function mapCacheSet(key, value) {
+ var data = getMapData(this, key),
+ size = data.size;
+
+ data.set(key, value);
+ this.size += data.size == size ? 0 : 1;
+ return this;
+ }
+
+ // Add methods to `MapCache`.
+ MapCache.prototype.clear = mapCacheClear;
+ MapCache.prototype['delete'] = mapCacheDelete;
+ MapCache.prototype.get = mapCacheGet;
+ MapCache.prototype.has = mapCacheHas;
+ MapCache.prototype.set = mapCacheSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ *
+ * Creates an array cache object to store unique values.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [values] The values to cache.
+ */
+ function SetCache(values) {
+ var index = -1,
+ length = values == null ? 0 : values.length;
+
+ this.__data__ = new MapCache;
+ while (++index < length) {
+ this.add(values[index]);
+ }
+ }
+
+ /**
+ * Adds `value` to the array cache.
+ *
+ * @private
+ * @name add
+ * @memberOf SetCache
+ * @alias push
+ * @param {*} value The value to cache.
+ * @returns {Object} Returns the cache instance.
+ */
+ function setCacheAdd(value) {
+ this.__data__.set(value, HASH_UNDEFINED);
+ return this;
+ }
+
+ /**
+ * Checks if `value` is in the array cache.
+ *
+ * @private
+ * @name has
+ * @memberOf SetCache
+ * @param {*} value The value to search for.
+ * @returns {number} Returns `true` if `value` is found, else `false`.
+ */
+ function setCacheHas(value) {
+ return this.__data__.has(value);
+ }
+
+ // Add methods to `SetCache`.
+ SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
+ SetCache.prototype.has = setCacheHas;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a stack cache object to store key-value pairs.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function Stack(entries) {
+ var data = this.__data__ = new ListCache(entries);
+ this.size = data.size;
+ }
+
+ /**
+ * Removes all key-value entries from the stack.
+ *
+ * @private
+ * @name clear
+ * @memberOf Stack
+ */
+ function stackClear() {
+ this.__data__ = new ListCache;
+ this.size = 0;
+ }
+
+ /**
+ * Removes `key` and its value from the stack.
+ *
+ * @private
+ * @name delete
+ * @memberOf Stack
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function stackDelete(key) {
+ var data = this.__data__,
+ result = data['delete'](key);
+
+ this.size = data.size;
+ return result;
+ }
+
+ /**
+ * Gets the stack value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf Stack
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function stackGet(key) {
+ return this.__data__.get(key);
+ }
+
+ /**
+ * Checks if a stack value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf Stack
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function stackHas(key) {
+ return this.__data__.has(key);
+ }
+
+ /**
+ * Sets the stack `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf Stack
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the stack cache instance.
+ */
+ function stackSet(key, value) {
+ var data = this.__data__;
+ if (data instanceof ListCache) {
+ var pairs = data.__data__;
+ if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {
+ pairs.push([key, value]);
+ this.size = ++data.size;
+ return this;
+ }
+ data = this.__data__ = new MapCache(pairs);
+ }
+ data.set(key, value);
+ this.size = data.size;
+ return this;
+ }
+
+ // Add methods to `Stack`.
+ Stack.prototype.clear = stackClear;
+ Stack.prototype['delete'] = stackDelete;
+ Stack.prototype.get = stackGet;
+ Stack.prototype.has = stackHas;
+ Stack.prototype.set = stackSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an array of the enumerable property names of the array-like `value`.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @param {boolean} inherited Specify returning inherited property names.
+ * @returns {Array} Returns the array of property names.
+ */
+ function arrayLikeKeys(value, inherited) {
+ var isArr = isArray(value),
+ isArg = !isArr && isArguments(value),
+ isBuff = !isArr && !isArg && isBuffer(value),
+ isType = !isArr && !isArg && !isBuff && isTypedArray(value),
+ skipIndexes = isArr || isArg || isBuff || isType,
+ result = skipIndexes ? baseTimes(value.length, String) : [],
+ length = result.length;
+
+ for (var key in value) {
+ if ((inherited || hasOwnProperty.call(value, key)) &&
+ !(skipIndexes && (
+ // Safari 9 has enumerable `arguments.length` in strict mode.
+ key == 'length' ||
+ // Node.js 0.10 has enumerable non-index properties on buffers.
+ (isBuff && (key == 'offset' || key == 'parent')) ||
+ // PhantomJS 2 has enumerable non-index properties on typed arrays.
+ (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||
+ // Skip index properties.
+ isIndex(key, length)
+ ))) {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * A specialized version of `_.sample` for arrays.
+ *
+ * @private
+ * @param {Array} array The array to sample.
+ * @returns {*} Returns the random element.
+ */
+ function arraySample(array) {
+ var length = array.length;
+ return length ? array[baseRandom(0, length - 1)] : undefined;
+ }
+
+ /**
+ * A specialized version of `_.sampleSize` for arrays.
+ *
+ * @private
+ * @param {Array} array The array to sample.
+ * @param {number} n The number of elements to sample.
+ * @returns {Array} Returns the random elements.
+ */
+ function arraySampleSize(array, n) {
+ return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));
+ }
+
+ /**
+ * A specialized version of `_.shuffle` for arrays.
+ *
+ * @private
+ * @param {Array} array The array to shuffle.
+ * @returns {Array} Returns the new shuffled array.
+ */
+ function arrayShuffle(array) {
+ return shuffleSelf(copyArray(array));
+ }
+
+ /**
+ * This function is like `assignValue` except that it doesn't assign
+ * `undefined` values.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {string} key The key of the property to assign.
+ * @param {*} value The value to assign.
+ */
+ function assignMergeValue(object, key, value) {
+ if ((value !== undefined && !eq(object[key], value)) ||
+ (value === undefined && !(key in object))) {
+ baseAssignValue(object, key, value);
+ }
+ }
+
+ /**
+ * Assigns `value` to `key` of `object` if the existing value is not equivalent
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {string} key The key of the property to assign.
+ * @param {*} value The value to assign.
+ */
+ function assignValue(object, key, value) {
+ var objValue = object[key];
+ if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||
+ (value === undefined && !(key in object))) {
+ baseAssignValue(object, key, value);
+ }
+ }
+
+ /**
+ * Gets the index at which the `key` is found in `array` of key-value pairs.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} key The key to search for.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function assocIndexOf(array, key) {
+ var length = array.length;
+ while (length--) {
+ if (eq(array[length][0], key)) {
+ return length;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * Aggregates elements of `collection` on `accumulator` with keys transformed
+ * by `iteratee` and values set by `setter`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} setter The function to set `accumulator` values.
+ * @param {Function} iteratee The iteratee to transform keys.
+ * @param {Object} accumulator The initial aggregated object.
+ * @returns {Function} Returns `accumulator`.
+ */
+ function baseAggregator(collection, setter, iteratee, accumulator) {
+ baseEach(collection, function(value, key, collection) {
+ setter(accumulator, value, iteratee(value), collection);
+ });
+ return accumulator;
+ }
+
+ /**
+ * The base implementation of `_.assign` without support for multiple sources
+ * or `customizer` functions.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @returns {Object} Returns `object`.
+ */
+ function baseAssign(object, source) {
+ return object && copyObject(source, keys(source), object);
+ }
+
+ /**
+ * The base implementation of `_.assignIn` without support for multiple sources
+ * or `customizer` functions.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @returns {Object} Returns `object`.
+ */
+ function baseAssignIn(object, source) {
+ return object && copyObject(source, keysIn(source), object);
+ }
+
+ /**
+ * The base implementation of `assignValue` and `assignMergeValue` without
+ * value checks.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {string} key The key of the property to assign.
+ * @param {*} value The value to assign.
+ */
+ function baseAssignValue(object, key, value) {
+ if (key == '__proto__' && defineProperty) {
+ defineProperty(object, key, {
+ 'configurable': true,
+ 'enumerable': true,
+ 'value': value,
+ 'writable': true
+ });
+ } else {
+ object[key] = value;
+ }
+ }
+
+ /**
+ * The base implementation of `_.at` without support for individual paths.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {string[]} paths The property paths to pick.
+ * @returns {Array} Returns the picked elements.
+ */
+ function baseAt(object, paths) {
+ var index = -1,
+ length = paths.length,
+ result = Array(length),
+ skip = object == null;
+
+ while (++index < length) {
+ result[index] = skip ? undefined : get(object, paths[index]);
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.clamp` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {number} number The number to clamp.
+ * @param {number} [lower] The lower bound.
+ * @param {number} upper The upper bound.
+ * @returns {number} Returns the clamped number.
+ */
+ function baseClamp(number, lower, upper) {
+ if (number === number) {
+ if (upper !== undefined) {
+ number = number <= upper ? number : upper;
+ }
+ if (lower !== undefined) {
+ number = number >= lower ? number : lower;
+ }
+ }
+ return number;
+ }
+
+ /**
+ * The base implementation of `_.clone` and `_.cloneDeep` which tracks
+ * traversed objects.
+ *
+ * @private
+ * @param {*} value The value to clone.
+ * @param {boolean} bitmask The bitmask flags.
+ * 1 - Deep clone
+ * 2 - Flatten inherited properties
+ * 4 - Clone symbols
+ * @param {Function} [customizer] The function to customize cloning.
+ * @param {string} [key] The key of `value`.
+ * @param {Object} [object] The parent object of `value`.
+ * @param {Object} [stack] Tracks traversed objects and their clone counterparts.
+ * @returns {*} Returns the cloned value.
+ */
+ function baseClone(value, bitmask, customizer, key, object, stack) {
+ var result,
+ isDeep = bitmask & CLONE_DEEP_FLAG,
+ isFlat = bitmask & CLONE_FLAT_FLAG,
+ isFull = bitmask & CLONE_SYMBOLS_FLAG;
+
+ if (customizer) {
+ result = object ? customizer(value, key, object, stack) : customizer(value);
+ }
+ if (result !== undefined) {
+ return result;
+ }
+ if (!isObject(value)) {
+ return value;
+ }
+ var isArr = isArray(value);
+ if (isArr) {
+ result = initCloneArray(value);
+ if (!isDeep) {
+ return copyArray(value, result);
+ }
+ } else {
+ var tag = getTag(value),
+ isFunc = tag == funcTag || tag == genTag;
+
+ if (isBuffer(value)) {
+ return cloneBuffer(value, isDeep);
+ }
+ if (tag == objectTag || tag == argsTag || (isFunc && !object)) {
+ result = (isFlat || isFunc) ? {} : initCloneObject(value);
+ if (!isDeep) {
+ return isFlat
+ ? copySymbolsIn(value, baseAssignIn(result, value))
+ : copySymbols(value, baseAssign(result, value));
+ }
+ } else {
+ if (!cloneableTags[tag]) {
+ return object ? value : {};
+ }
+ result = initCloneByTag(value, tag, isDeep);
+ }
+ }
+ // Check for circular references and return its corresponding clone.
+ stack || (stack = new Stack);
+ var stacked = stack.get(value);
+ if (stacked) {
+ return stacked;
+ }
+ stack.set(value, result);
+
+ if (isSet(value)) {
+ value.forEach(function(subValue) {
+ result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
+ });
+
+ return result;
+ }
+
+ if (isMap(value)) {
+ value.forEach(function(subValue, key) {
+ result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));
+ });
+
+ return result;
+ }
+
+ var keysFunc = isFull
+ ? (isFlat ? getAllKeysIn : getAllKeys)
+ : (isFlat ? keysIn : keys);
+
+ var props = isArr ? undefined : keysFunc(value);
+ arrayEach(props || value, function(subValue, key) {
+ if (props) {
+ key = subValue;
+ subValue = value[key];
+ }
+ // Recursively populate clone (susceptible to call stack limits).
+ assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.conforms` which doesn't clone `source`.
+ *
+ * @private
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {Function} Returns the new spec function.
+ */
+ function baseConforms(source) {
+ var props = keys(source);
+ return function(object) {
+ return baseConformsTo(object, source, props);
+ };
+ }
+
+ /**
+ * The base implementation of `_.conformsTo` which accepts `props` to check.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {boolean} Returns `true` if `object` conforms, else `false`.
+ */
+ function baseConformsTo(object, source, props) {
+ var length = props.length;
+ if (object == null) {
+ return !length;
+ }
+ object = Object(object);
+ while (length--) {
+ var key = props[length],
+ predicate = source[key],
+ value = object[key];
+
+ if ((value === undefined && !(key in object)) || !predicate(value)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * The base implementation of `_.delay` and `_.defer` which accepts `args`
+ * to provide to `func`.
+ *
+ * @private
+ * @param {Function} func The function to delay.
+ * @param {number} wait The number of milliseconds to delay invocation.
+ * @param {Array} args The arguments to provide to `func`.
+ * @returns {number|Object} Returns the timer id or timeout object.
+ */
+ function baseDelay(func, wait, args) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ return setTimeout(function() { func.apply(undefined, args); }, wait);
+ }
+
+ /**
+ * The base implementation of methods like `_.difference` without support
+ * for excluding multiple arrays or iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Array} values The values to exclude.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ */
+ function baseDifference(array, values, iteratee, comparator) {
+ var index = -1,
+ includes = arrayIncludes,
+ isCommon = true,
+ length = array.length,
+ result = [],
+ valuesLength = values.length;
+
+ if (!length) {
+ return result;
+ }
+ if (iteratee) {
+ values = arrayMap(values, baseUnary(iteratee));
+ }
+ if (comparator) {
+ includes = arrayIncludesWith;
+ isCommon = false;
+ }
+ else if (values.length >= LARGE_ARRAY_SIZE) {
+ includes = cacheHas;
+ isCommon = false;
+ values = new SetCache(values);
+ }
+ outer:
+ while (++index < length) {
+ var value = array[index],
+ computed = iteratee == null ? value : iteratee(value);
+
+ value = (comparator || value !== 0) ? value : 0;
+ if (isCommon && computed === computed) {
+ var valuesIndex = valuesLength;
+ while (valuesIndex--) {
+ if (values[valuesIndex] === computed) {
+ continue outer;
+ }
+ }
+ result.push(value);
+ }
+ else if (!includes(values, computed, comparator)) {
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.forEach` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ */
+ var baseEach = createBaseEach(baseForOwn);
+
+ /**
+ * The base implementation of `_.forEachRight` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ */
+ var baseEachRight = createBaseEach(baseForOwnRight, true);
+
+ /**
+ * The base implementation of `_.every` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if all elements pass the predicate check,
+ * else `false`
+ */
+ function baseEvery(collection, predicate) {
+ var result = true;
+ baseEach(collection, function(value, index, collection) {
+ result = !!predicate(value, index, collection);
+ return result;
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of methods like `_.max` and `_.min` which accepts a
+ * `comparator` to determine the extremum value.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} iteratee The iteratee invoked per iteration.
+ * @param {Function} comparator The comparator used to compare values.
+ * @returns {*} Returns the extremum value.
+ */
+ function baseExtremum(array, iteratee, comparator) {
+ var index = -1,
+ length = array.length;
+
+ while (++index < length) {
+ var value = array[index],
+ current = iteratee(value);
+
+ if (current != null && (computed === undefined
+ ? (current === current && !isSymbol(current))
+ : comparator(current, computed)
+ )) {
+ var computed = current,
+ result = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.fill` without an iteratee call guard.
+ *
+ * @private
+ * @param {Array} array The array to fill.
+ * @param {*} value The value to fill `array` with.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns `array`.
+ */
+ function baseFill(array, value, start, end) {
+ var length = array.length;
+
+ start = toInteger(start);
+ if (start < 0) {
+ start = -start > length ? 0 : (length + start);
+ }
+ end = (end === undefined || end > length) ? length : toInteger(end);
+ if (end < 0) {
+ end += length;
+ }
+ end = start > end ? 0 : toLength(end);
+ while (start < end) {
+ array[start++] = value;
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.filter` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ */
+ function baseFilter(collection, predicate) {
+ var result = [];
+ baseEach(collection, function(value, index, collection) {
+ if (predicate(value, index, collection)) {
+ result.push(value);
+ }
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.flatten` with support for restricting flattening.
+ *
+ * @private
+ * @param {Array} array The array to flatten.
+ * @param {number} depth The maximum recursion depth.
+ * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
+ * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
+ * @param {Array} [result=[]] The initial result value.
+ * @returns {Array} Returns the new flattened array.
+ */
+ function baseFlatten(array, depth, predicate, isStrict, result) {
+ var index = -1,
+ length = array.length;
+
+ predicate || (predicate = isFlattenable);
+ result || (result = []);
+
+ while (++index < length) {
+ var value = array[index];
+ if (depth > 0 && predicate(value)) {
+ if (depth > 1) {
+ // Recursively flatten arrays (susceptible to call stack limits).
+ baseFlatten(value, depth - 1, predicate, isStrict, result);
+ } else {
+ arrayPush(result, value);
+ }
+ } else if (!isStrict) {
+ result[result.length] = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `baseForOwn` which iterates over `object`
+ * properties returned by `keysFunc` and invokes `iteratee` for each property.
+ * Iteratee functions may exit iteration early by explicitly returning `false`.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @returns {Object} Returns `object`.
+ */
+ var baseFor = createBaseFor();
+
+ /**
+ * This function is like `baseFor` except that it iterates over properties
+ * in the opposite order.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @returns {Object} Returns `object`.
+ */
+ var baseForRight = createBaseFor(true);
+
+ /**
+ * The base implementation of `_.forOwn` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ */
+ function baseForOwn(object, iteratee) {
+ return object && baseFor(object, iteratee, keys);
+ }
+
+ /**
+ * The base implementation of `_.forOwnRight` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ */
+ function baseForOwnRight(object, iteratee) {
+ return object && baseForRight(object, iteratee, keys);
+ }
+
+ /**
+ * The base implementation of `_.functions` which creates an array of
+ * `object` function property names filtered from `props`.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @param {Array} props The property names to filter.
+ * @returns {Array} Returns the function names.
+ */
+ function baseFunctions(object, props) {
+ return arrayFilter(props, function(key) {
+ return isFunction(object[key]);
+ });
+ }
+
+ /**
+ * The base implementation of `_.get` without support for default values.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the property to get.
+ * @returns {*} Returns the resolved value.
+ */
+ function baseGet(object, path) {
+ path = castPath(path, object);
+
+ var index = 0,
+ length = path.length;
+
+ while (object != null && index < length) {
+ object = object[toKey(path[index++])];
+ }
+ return (index && index == length) ? object : undefined;
+ }
+
+ /**
+ * The base implementation of `getAllKeys` and `getAllKeysIn` which uses
+ * `keysFunc` and `symbolsFunc` to get the enumerable property names and
+ * symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @param {Function} symbolsFunc The function to get the symbols of `object`.
+ * @returns {Array} Returns the array of property names and symbols.
+ */
+ function baseGetAllKeys(object, keysFunc, symbolsFunc) {
+ var result = keysFunc(object);
+ return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
+ }
+
+ /**
+ * The base implementation of `getTag` without fallbacks for buggy environments.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @returns {string} Returns the `toStringTag`.
+ */
+ function baseGetTag(value) {
+ if (value == null) {
+ return value === undefined ? undefinedTag : nullTag;
+ }
+ return (symToStringTag && symToStringTag in Object(value))
+ ? getRawTag(value)
+ : objectToString(value);
+ }
+
+ /**
+ * The base implementation of `_.gt` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is greater than `other`,
+ * else `false`.
+ */
+ function baseGt(value, other) {
+ return value > other;
+ }
+
+ /**
+ * The base implementation of `_.has` without support for deep paths.
+ *
+ * @private
+ * @param {Object} [object] The object to query.
+ * @param {Array|string} key The key to check.
+ * @returns {boolean} Returns `true` if `key` exists, else `false`.
+ */
+ function baseHas(object, key) {
+ return object != null && hasOwnProperty.call(object, key);
+ }
+
+ /**
+ * The base implementation of `_.hasIn` without support for deep paths.
+ *
+ * @private
+ * @param {Object} [object] The object to query.
+ * @param {Array|string} key The key to check.
+ * @returns {boolean} Returns `true` if `key` exists, else `false`.
+ */
+ function baseHasIn(object, key) {
+ return object != null && key in Object(object);
+ }
+
+ /**
+ * The base implementation of `_.inRange` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {number} number The number to check.
+ * @param {number} start The start of the range.
+ * @param {number} end The end of the range.
+ * @returns {boolean} Returns `true` if `number` is in the range, else `false`.
+ */
+ function baseInRange(number, start, end) {
+ return number >= nativeMin(start, end) && number < nativeMax(start, end);
+ }
+
+ /**
+ * The base implementation of methods like `_.intersection`, without support
+ * for iteratee shorthands, that accepts an array of arrays to inspect.
+ *
+ * @private
+ * @param {Array} arrays The arrays to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of shared values.
+ */
+ function baseIntersection(arrays, iteratee, comparator) {
+ var includes = comparator ? arrayIncludesWith : arrayIncludes,
+ length = arrays[0].length,
+ othLength = arrays.length,
+ othIndex = othLength,
+ caches = Array(othLength),
+ maxLength = Infinity,
+ result = [];
+
+ while (othIndex--) {
+ var array = arrays[othIndex];
+ if (othIndex && iteratee) {
+ array = arrayMap(array, baseUnary(iteratee));
+ }
+ maxLength = nativeMin(array.length, maxLength);
+ caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))
+ ? new SetCache(othIndex && array)
+ : undefined;
+ }
+ array = arrays[0];
+
+ var index = -1,
+ seen = caches[0];
+
+ outer:
+ while (++index < length && result.length < maxLength) {
+ var value = array[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ value = (comparator || value !== 0) ? value : 0;
+ if (!(seen
+ ? cacheHas(seen, computed)
+ : includes(result, computed, comparator)
+ )) {
+ othIndex = othLength;
+ while (--othIndex) {
+ var cache = caches[othIndex];
+ if (!(cache
+ ? cacheHas(cache, computed)
+ : includes(arrays[othIndex], computed, comparator))
+ ) {
+ continue outer;
+ }
+ }
+ if (seen) {
+ seen.push(computed);
+ }
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.invert` and `_.invertBy` which inverts
+ * `object` with values transformed by `iteratee` and set by `setter`.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} setter The function to set `accumulator` values.
+ * @param {Function} iteratee The iteratee to transform values.
+ * @param {Object} accumulator The initial inverted object.
+ * @returns {Function} Returns `accumulator`.
+ */
+ function baseInverter(object, setter, iteratee, accumulator) {
+ baseForOwn(object, function(value, key, object) {
+ setter(accumulator, iteratee(value), key, object);
+ });
+ return accumulator;
+ }
+
+ /**
+ * The base implementation of `_.invoke` without support for individual
+ * method arguments.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the method to invoke.
+ * @param {Array} args The arguments to invoke the method with.
+ * @returns {*} Returns the result of the invoked method.
+ */
+ function baseInvoke(object, path, args) {
+ path = castPath(path, object);
+ object = parent(object, path);
+ var func = object == null ? object : object[toKey(last(path))];
+ return func == null ? undefined : apply(func, object, args);
+ }
+
+ /**
+ * The base implementation of `_.isArguments`.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an `arguments` object,
+ */
+ function baseIsArguments(value) {
+ return isObjectLike(value) && baseGetTag(value) == argsTag;
+ }
+
+ /**
+ * The base implementation of `_.isArrayBuffer` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
+ */
+ function baseIsArrayBuffer(value) {
+ return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;
+ }
+
+ /**
+ * The base implementation of `_.isDate` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a date object, else `false`.
+ */
+ function baseIsDate(value) {
+ return isObjectLike(value) && baseGetTag(value) == dateTag;
+ }
+
+ /**
+ * The base implementation of `_.isEqual` which supports partial comparisons
+ * and tracks traversed objects.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @param {boolean} bitmask The bitmask flags.
+ * 1 - Unordered comparison
+ * 2 - Partial comparison
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @param {Object} [stack] Tracks traversed `value` and `other` objects.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ */
+ function baseIsEqual(value, other, bitmask, customizer, stack) {
+ if (value === other) {
+ return true;
+ }
+ if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {
+ return value !== value && other !== other;
+ }
+ return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
+ }
+
+ /**
+ * A specialized version of `baseIsEqual` for arrays and objects which performs
+ * deep comparisons and tracks traversed objects enabling objects with circular
+ * references to be compared.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} [stack] Tracks traversed `object` and `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+ function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
+ var objIsArr = isArray(object),
+ othIsArr = isArray(other),
+ objTag = objIsArr ? arrayTag : getTag(object),
+ othTag = othIsArr ? arrayTag : getTag(other);
+
+ objTag = objTag == argsTag ? objectTag : objTag;
+ othTag = othTag == argsTag ? objectTag : othTag;
+
+ var objIsObj = objTag == objectTag,
+ othIsObj = othTag == objectTag,
+ isSameTag = objTag == othTag;
+
+ if (isSameTag && isBuffer(object)) {
+ if (!isBuffer(other)) {
+ return false;
+ }
+ objIsArr = true;
+ objIsObj = false;
+ }
+ if (isSameTag && !objIsObj) {
+ stack || (stack = new Stack);
+ return (objIsArr || isTypedArray(object))
+ ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)
+ : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
+ }
+ if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
+ var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
+ othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
+
+ if (objIsWrapped || othIsWrapped) {
+ var objUnwrapped = objIsWrapped ? object.value() : object,
+ othUnwrapped = othIsWrapped ? other.value() : other;
+
+ stack || (stack = new Stack);
+ return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
+ }
+ }
+ if (!isSameTag) {
+ return false;
+ }
+ stack || (stack = new Stack);
+ return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
+ }
+
+ /**
+ * The base implementation of `_.isMap` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a map, else `false`.
+ */
+ function baseIsMap(value) {
+ return isObjectLike(value) && getTag(value) == mapTag;
+ }
+
+ /**
+ * The base implementation of `_.isMatch` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property values to match.
+ * @param {Array} matchData The property names, values, and compare flags to match.
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @returns {boolean} Returns `true` if `object` is a match, else `false`.
+ */
+ function baseIsMatch(object, source, matchData, customizer) {
+ var index = matchData.length,
+ length = index,
+ noCustomizer = !customizer;
+
+ if (object == null) {
+ return !length;
+ }
+ object = Object(object);
+ while (index--) {
+ var data = matchData[index];
+ if ((noCustomizer && data[2])
+ ? data[1] !== object[data[0]]
+ : !(data[0] in object)
+ ) {
+ return false;
+ }
+ }
+ while (++index < length) {
+ data = matchData[index];
+ var key = data[0],
+ objValue = object[key],
+ srcValue = data[1];
+
+ if (noCustomizer && data[2]) {
+ if (objValue === undefined && !(key in object)) {
+ return false;
+ }
+ } else {
+ var stack = new Stack;
+ if (customizer) {
+ var result = customizer(objValue, srcValue, key, object, source, stack);
+ }
+ if (!(result === undefined
+ ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)
+ : result
+ )) {
+ return false;
+ }
+ }
+ }
+ return true;
+ }
+
+ /**
+ * The base implementation of `_.isNative` without bad shim checks.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a native function,
+ * else `false`.
+ */
+ function baseIsNative(value) {
+ if (!isObject(value) || isMasked(value)) {
+ return false;
+ }
+ var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
+ return pattern.test(toSource(value));
+ }
+
+ /**
+ * The base implementation of `_.isRegExp` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
+ */
+ function baseIsRegExp(value) {
+ return isObjectLike(value) && baseGetTag(value) == regexpTag;
+ }
+
+ /**
+ * The base implementation of `_.isSet` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a set, else `false`.
+ */
+ function baseIsSet(value) {
+ return isObjectLike(value) && getTag(value) == setTag;
+ }
+
+ /**
+ * The base implementation of `_.isTypedArray` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
+ */
+ function baseIsTypedArray(value) {
+ return isObjectLike(value) &&
+ isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
+ }
+
+ /**
+ * The base implementation of `_.iteratee`.
+ *
+ * @private
+ * @param {*} [value=_.identity] The value to convert to an iteratee.
+ * @returns {Function} Returns the iteratee.
+ */
+ function baseIteratee(value) {
+ // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.
+ // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.
+ if (typeof value == 'function') {
+ return value;
+ }
+ if (value == null) {
+ return identity;
+ }
+ if (typeof value == 'object') {
+ return isArray(value)
+ ? baseMatchesProperty(value[0], value[1])
+ : baseMatches(value);
+ }
+ return property(value);
+ }
+
+ /**
+ * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+ function baseKeys(object) {
+ if (!isPrototype(object)) {
+ return nativeKeys(object);
+ }
+ var result = [];
+ for (var key in Object(object)) {
+ if (hasOwnProperty.call(object, key) && key != 'constructor') {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+ function baseKeysIn(object) {
+ if (!isObject(object)) {
+ return nativeKeysIn(object);
+ }
+ var isProto = isPrototype(object),
+ result = [];
+
+ for (var key in object) {
+ if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.lt` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is less than `other`,
+ * else `false`.
+ */
+ function baseLt(value, other) {
+ return value < other;
+ }
+
+ /**
+ * The base implementation of `_.map` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns the new mapped array.
+ */
+ function baseMap(collection, iteratee) {
+ var index = -1,
+ result = isArrayLike(collection) ? Array(collection.length) : [];
+
+ baseEach(collection, function(value, key, collection) {
+ result[++index] = iteratee(value, key, collection);
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.matches` which doesn't clone `source`.
+ *
+ * @private
+ * @param {Object} source The object of property values to match.
+ * @returns {Function} Returns the new spec function.
+ */
+ function baseMatches(source) {
+ var matchData = getMatchData(source);
+ if (matchData.length == 1 && matchData[0][2]) {
+ return matchesStrictComparable(matchData[0][0], matchData[0][1]);
+ }
+ return function(object) {
+ return object === source || baseIsMatch(object, source, matchData);
+ };
+ }
+
+ /**
+ * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.
+ *
+ * @private
+ * @param {string} path The path of the property to get.
+ * @param {*} srcValue The value to match.
+ * @returns {Function} Returns the new spec function.
+ */
+ function baseMatchesProperty(path, srcValue) {
+ if (isKey(path) && isStrictComparable(srcValue)) {
+ return matchesStrictComparable(toKey(path), srcValue);
+ }
+ return function(object) {
+ var objValue = get(object, path);
+ return (objValue === undefined && objValue === srcValue)
+ ? hasIn(object, path)
+ : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
+ };
+ }
+
+ /**
+ * The base implementation of `_.merge` without support for multiple sources.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @param {number} srcIndex The index of `source`.
+ * @param {Function} [customizer] The function to customize merged values.
+ * @param {Object} [stack] Tracks traversed source values and their merged
+ * counterparts.
+ */
+ function baseMerge(object, source, srcIndex, customizer, stack) {
+ if (object === source) {
+ return;
+ }
+ baseFor(source, function(srcValue, key) {
+ if (isObject(srcValue)) {
+ stack || (stack = new Stack);
+ baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);
+ }
+ else {
+ var newValue = customizer
+ ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)
+ : undefined;
+
+ if (newValue === undefined) {
+ newValue = srcValue;
+ }
+ assignMergeValue(object, key, newValue);
+ }
+ }, keysIn);
+ }
+
+ /**
+ * A specialized version of `baseMerge` for arrays and objects which performs
+ * deep merges and tracks traversed objects enabling objects with circular
+ * references to be merged.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @param {string} key The key of the value to merge.
+ * @param {number} srcIndex The index of `source`.
+ * @param {Function} mergeFunc The function to merge values.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @param {Object} [stack] Tracks traversed source values and their merged
+ * counterparts.
+ */
+ function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {
+ var objValue = safeGet(object, key),
+ srcValue = safeGet(source, key),
+ stacked = stack.get(srcValue);
+
+ if (stacked) {
+ assignMergeValue(object, key, stacked);
+ return;
+ }
+ var newValue = customizer
+ ? customizer(objValue, srcValue, (key + ''), object, source, stack)
+ : undefined;
+
+ var isCommon = newValue === undefined;
+
+ if (isCommon) {
+ var isArr = isArray(srcValue),
+ isBuff = !isArr && isBuffer(srcValue),
+ isTyped = !isArr && !isBuff && isTypedArray(srcValue);
+
+ newValue = srcValue;
+ if (isArr || isBuff || isTyped) {
+ if (isArray(objValue)) {
+ newValue = objValue;
+ }
+ else if (isArrayLikeObject(objValue)) {
+ newValue = copyArray(objValue);
+ }
+ else if (isBuff) {
+ isCommon = false;
+ newValue = cloneBuffer(srcValue, true);
+ }
+ else if (isTyped) {
+ isCommon = false;
+ newValue = cloneTypedArray(srcValue, true);
+ }
+ else {
+ newValue = [];
+ }
+ }
+ else if (isPlainObject(srcValue) || isArguments(srcValue)) {
+ newValue = objValue;
+ if (isArguments(objValue)) {
+ newValue = toPlainObject(objValue);
+ }
+ else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) {
+ newValue = initCloneObject(srcValue);
+ }
+ }
+ else {
+ isCommon = false;
+ }
+ }
+ if (isCommon) {
+ // Recursively merge objects and arrays (susceptible to call stack limits).
+ stack.set(srcValue, newValue);
+ mergeFunc(newValue, srcValue, srcIndex, customizer, stack);
+ stack['delete'](srcValue);
+ }
+ assignMergeValue(object, key, newValue);
+ }
+
+ /**
+ * The base implementation of `_.nth` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {Array} array The array to query.
+ * @param {number} n The index of the element to return.
+ * @returns {*} Returns the nth element of `array`.
+ */
+ function baseNth(array, n) {
+ var length = array.length;
+ if (!length) {
+ return;
+ }
+ n += n < 0 ? length : 0;
+ return isIndex(n, length) ? array[n] : undefined;
+ }
+
+ /**
+ * The base implementation of `_.orderBy` without param guards.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.
+ * @param {string[]} orders The sort orders of `iteratees`.
+ * @returns {Array} Returns the new sorted array.
+ */
+ function baseOrderBy(collection, iteratees, orders) {
+ var index = -1;
+ iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));
+
+ var result = baseMap(collection, function(value, key, collection) {
+ var criteria = arrayMap(iteratees, function(iteratee) {
+ return iteratee(value);
+ });
+ return { 'criteria': criteria, 'index': ++index, 'value': value };
+ });
+
+ return baseSortBy(result, function(object, other) {
+ return compareMultiple(object, other, orders);
+ });
+ }
+
+ /**
+ * The base implementation of `_.pick` without support for individual
+ * property identifiers.
+ *
+ * @private
+ * @param {Object} object The source object.
+ * @param {string[]} paths The property paths to pick.
+ * @returns {Object} Returns the new object.
+ */
+ function basePick(object, paths) {
+ return basePickBy(object, paths, function(value, path) {
+ return hasIn(object, path);
+ });
+ }
+
+ /**
+ * The base implementation of `_.pickBy` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The source object.
+ * @param {string[]} paths The property paths to pick.
+ * @param {Function} predicate The function invoked per property.
+ * @returns {Object} Returns the new object.
+ */
+ function basePickBy(object, paths, predicate) {
+ var index = -1,
+ length = paths.length,
+ result = {};
+
+ while (++index < length) {
+ var path = paths[index],
+ value = baseGet(object, path);
+
+ if (predicate(value, path)) {
+ baseSet(result, castPath(path, object), value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * A specialized version of `baseProperty` which supports deep paths.
+ *
+ * @private
+ * @param {Array|string} path The path of the property to get.
+ * @returns {Function} Returns the new accessor function.
+ */
+ function basePropertyDeep(path) {
+ return function(object) {
+ return baseGet(object, path);
+ };
+ }
+
+ /**
+ * The base implementation of `_.pullAllBy` without support for iteratee
+ * shorthands.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns `array`.
+ */
+ function basePullAll(array, values, iteratee, comparator) {
+ var indexOf = comparator ? baseIndexOfWith : baseIndexOf,
+ index = -1,
+ length = values.length,
+ seen = array;
+
+ if (array === values) {
+ values = copyArray(values);
+ }
+ if (iteratee) {
+ seen = arrayMap(array, baseUnary(iteratee));
+ }
+ while (++index < length) {
+ var fromIndex = 0,
+ value = values[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {
+ if (seen !== array) {
+ splice.call(seen, fromIndex, 1);
+ }
+ splice.call(array, fromIndex, 1);
+ }
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.pullAt` without support for individual
+ * indexes or capturing the removed elements.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {number[]} indexes The indexes of elements to remove.
+ * @returns {Array} Returns `array`.
+ */
+ function basePullAt(array, indexes) {
+ var length = array ? indexes.length : 0,
+ lastIndex = length - 1;
+
+ while (length--) {
+ var index = indexes[length];
+ if (length == lastIndex || index !== previous) {
+ var previous = index;
+ if (isIndex(index)) {
+ splice.call(array, index, 1);
+ } else {
+ baseUnset(array, index);
+ }
+ }
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.random` without support for returning
+ * floating-point numbers.
+ *
+ * @private
+ * @param {number} lower The lower bound.
+ * @param {number} upper The upper bound.
+ * @returns {number} Returns the random number.
+ */
+ function baseRandom(lower, upper) {
+ return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
+ }
+
+ /**
+ * The base implementation of `_.range` and `_.rangeRight` which doesn't
+ * coerce arguments.
+ *
+ * @private
+ * @param {number} start The start of the range.
+ * @param {number} end The end of the range.
+ * @param {number} step The value to increment or decrement by.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Array} Returns the range of numbers.
+ */
+ function baseRange(start, end, step, fromRight) {
+ var index = -1,
+ length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),
+ result = Array(length);
+
+ while (length--) {
+ result[fromRight ? length : ++index] = start;
+ start += step;
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.repeat` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {string} string The string to repeat.
+ * @param {number} n The number of times to repeat the string.
+ * @returns {string} Returns the repeated string.
+ */
+ function baseRepeat(string, n) {
+ var result = '';
+ if (!string || n < 1 || n > MAX_SAFE_INTEGER) {
+ return result;
+ }
+ // Leverage the exponentiation by squaring algorithm for a faster repeat.
+ // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.
+ do {
+ if (n % 2) {
+ result += string;
+ }
+ n = nativeFloor(n / 2);
+ if (n) {
+ string += string;
+ }
+ } while (n);
+
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.rest` which doesn't validate or coerce arguments.
+ *
+ * @private
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @returns {Function} Returns the new function.
+ */
+ function baseRest(func, start) {
+ return setToString(overRest(func, start, identity), func + '');
+ }
+
+ /**
+ * The base implementation of `_.sample`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to sample.
+ * @returns {*} Returns the random element.
+ */
+ function baseSample(collection) {
+ return arraySample(values(collection));
+ }
+
+ /**
+ * The base implementation of `_.sampleSize` without param guards.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to sample.
+ * @param {number} n The number of elements to sample.
+ * @returns {Array} Returns the random elements.
+ */
+ function baseSampleSize(collection, n) {
+ var array = values(collection);
+ return shuffleSelf(array, baseClamp(n, 0, array.length));
+ }
+
+ /**
+ * The base implementation of `_.set`.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {*} value The value to set.
+ * @param {Function} [customizer] The function to customize path creation.
+ * @returns {Object} Returns `object`.
+ */
+ function baseSet(object, path, value, customizer) {
+ if (!isObject(object)) {
+ return object;
+ }
+ path = castPath(path, object);
+
+ var index = -1,
+ length = path.length,
+ lastIndex = length - 1,
+ nested = object;
+
+ while (nested != null && ++index < length) {
+ var key = toKey(path[index]),
+ newValue = value;
+
+ if (index != lastIndex) {
+ var objValue = nested[key];
+ newValue = customizer ? customizer(objValue, key, nested) : undefined;
+ if (newValue === undefined) {
+ newValue = isObject(objValue)
+ ? objValue
+ : (isIndex(path[index + 1]) ? [] : {});
+ }
+ }
+ assignValue(nested, key, newValue);
+ nested = nested[key];
+ }
+ return object;
+ }
+
+ /**
+ * The base implementation of `setData` without support for hot loop shorting.
+ *
+ * @private
+ * @param {Function} func The function to associate metadata with.
+ * @param {*} data The metadata.
+ * @returns {Function} Returns `func`.
+ */
+ var baseSetData = !metaMap ? identity : function(func, data) {
+ metaMap.set(func, data);
+ return func;
+ };
+
+ /**
+ * The base implementation of `setToString` without support for hot loop shorting.
+ *
+ * @private
+ * @param {Function} func The function to modify.
+ * @param {Function} string The `toString` result.
+ * @returns {Function} Returns `func`.
+ */
+ var baseSetToString = !defineProperty ? identity : function(func, string) {
+ return defineProperty(func, 'toString', {
+ 'configurable': true,
+ 'enumerable': false,
+ 'value': constant(string),
+ 'writable': true
+ });
+ };
+
+ /**
+ * The base implementation of `_.shuffle`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to shuffle.
+ * @returns {Array} Returns the new shuffled array.
+ */
+ function baseShuffle(collection) {
+ return shuffleSelf(values(collection));
+ }
+
+ /**
+ * The base implementation of `_.slice` without an iteratee call guard.
+ *
+ * @private
+ * @param {Array} array The array to slice.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns the slice of `array`.
+ */
+ function baseSlice(array, start, end) {
+ var index = -1,
+ length = array.length;
+
+ if (start < 0) {
+ start = -start > length ? 0 : (length + start);
+ }
+ end = end > length ? length : end;
+ if (end < 0) {
+ end += length;
+ }
+ length = start > end ? 0 : ((end - start) >>> 0);
+ start >>>= 0;
+
+ var result = Array(length);
+ while (++index < length) {
+ result[index] = array[index + start];
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.some` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ * else `false`.
+ */
+ function baseSome(collection, predicate) {
+ var result;
+
+ baseEach(collection, function(value, index, collection) {
+ result = predicate(value, index, collection);
+ return !result;
+ });
+ return !!result;
+ }
+
+ /**
+ * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which
+ * performs a binary search of `array` to determine the index at which `value`
+ * should be inserted into `array` in order to maintain its sort order.
+ *
+ * @private
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {boolean} [retHighest] Specify returning the highest qualified index.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ */
+ function baseSortedIndex(array, value, retHighest) {
+ var low = 0,
+ high = array == null ? low : array.length;
+
+ if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {
+ while (low < high) {
+ var mid = (low + high) >>> 1,
+ computed = array[mid];
+
+ if (computed !== null && !isSymbol(computed) &&
+ (retHighest ? (computed <= value) : (computed < value))) {
+ low = mid + 1;
+ } else {
+ high = mid;
+ }
+ }
+ return high;
+ }
+ return baseSortedIndexBy(array, value, identity, retHighest);
+ }
+
+ /**
+ * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`
+ * which invokes `iteratee` for `value` and each element of `array` to compute
+ * their sort ranking. The iteratee is invoked with one argument; (value).
+ *
+ * @private
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {Function} iteratee The iteratee invoked per element.
+ * @param {boolean} [retHighest] Specify returning the highest qualified index.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ */
+ function baseSortedIndexBy(array, value, iteratee, retHighest) {
+ value = iteratee(value);
+
+ var low = 0,
+ high = array == null ? 0 : array.length,
+ valIsNaN = value !== value,
+ valIsNull = value === null,
+ valIsSymbol = isSymbol(value),
+ valIsUndefined = value === undefined;
+
+ while (low < high) {
+ var mid = nativeFloor((low + high) / 2),
+ computed = iteratee(array[mid]),
+ othIsDefined = computed !== undefined,
+ othIsNull = computed === null,
+ othIsReflexive = computed === computed,
+ othIsSymbol = isSymbol(computed);
+
+ if (valIsNaN) {
+ var setLow = retHighest || othIsReflexive;
+ } else if (valIsUndefined) {
+ setLow = othIsReflexive && (retHighest || othIsDefined);
+ } else if (valIsNull) {
+ setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);
+ } else if (valIsSymbol) {
+ setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);
+ } else if (othIsNull || othIsSymbol) {
+ setLow = false;
+ } else {
+ setLow = retHighest ? (computed <= value) : (computed < value);
+ }
+ if (setLow) {
+ low = mid + 1;
+ } else {
+ high = mid;
+ }
+ }
+ return nativeMin(high, MAX_ARRAY_INDEX);
+ }
+
+ /**
+ * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without
+ * support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ */
+ function baseSortedUniq(array, iteratee) {
+ var index = -1,
+ length = array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ if (!index || !eq(computed, seen)) {
+ var seen = computed;
+ result[resIndex++] = value === 0 ? 0 : value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.toNumber` which doesn't ensure correct
+ * conversions of binary, hexadecimal, or octal string values.
+ *
+ * @private
+ * @param {*} value The value to process.
+ * @returns {number} Returns the number.
+ */
+ function baseToNumber(value) {
+ if (typeof value == 'number') {
+ return value;
+ }
+ if (isSymbol(value)) {
+ return NAN;
+ }
+ return +value;
+ }
+
+ /**
+ * The base implementation of `_.toString` which doesn't convert nullish
+ * values to empty strings.
+ *
+ * @private
+ * @param {*} value The value to process.
+ * @returns {string} Returns the string.
+ */
+ function baseToString(value) {
+ // Exit early for strings to avoid a performance hit in some environments.
+ if (typeof value == 'string') {
+ return value;
+ }
+ if (isArray(value)) {
+ // Recursively convert values (susceptible to call stack limits).
+ return arrayMap(value, baseToString) + '';
+ }
+ if (isSymbol(value)) {
+ return symbolToString ? symbolToString.call(value) : '';
+ }
+ var result = (value + '');
+ return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
+ }
+
+ /**
+ * The base implementation of `_.uniqBy` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ */
+ function baseUniq(array, iteratee, comparator) {
+ var index = -1,
+ includes = arrayIncludes,
+ length = array.length,
+ isCommon = true,
+ result = [],
+ seen = result;
+
+ if (comparator) {
+ isCommon = false;
+ includes = arrayIncludesWith;
+ }
+ else if (length >= LARGE_ARRAY_SIZE) {
+ var set = iteratee ? null : createSet(array);
+ if (set) {
+ return setToArray(set);
+ }
+ isCommon = false;
+ includes = cacheHas;
+ seen = new SetCache;
+ }
+ else {
+ seen = iteratee ? [] : result;
+ }
+ outer:
+ while (++index < length) {
+ var value = array[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ value = (comparator || value !== 0) ? value : 0;
+ if (isCommon && computed === computed) {
+ var seenIndex = seen.length;
+ while (seenIndex--) {
+ if (seen[seenIndex] === computed) {
+ continue outer;
+ }
+ }
+ if (iteratee) {
+ seen.push(computed);
+ }
+ result.push(value);
+ }
+ else if (!includes(seen, computed, comparator)) {
+ if (seen !== result) {
+ seen.push(computed);
+ }
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.unset`.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The property path to unset.
+ * @returns {boolean} Returns `true` if the property is deleted, else `false`.
+ */
+ function baseUnset(object, path) {
+ path = castPath(path, object);
+ object = parent(object, path);
+ return object == null || delete object[toKey(last(path))];
+ }
+
+ /**
+ * The base implementation of `_.update`.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to update.
+ * @param {Function} updater The function to produce the updated value.
+ * @param {Function} [customizer] The function to customize path creation.
+ * @returns {Object} Returns `object`.
+ */
+ function baseUpdate(object, path, updater, customizer) {
+ return baseSet(object, path, updater(baseGet(object, path)), customizer);
+ }
+
+ /**
+ * The base implementation of methods like `_.dropWhile` and `_.takeWhile`
+ * without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to query.
+ * @param {Function} predicate The function invoked per iteration.
+ * @param {boolean} [isDrop] Specify dropping elements instead of taking them.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Array} Returns the slice of `array`.
+ */
+ function baseWhile(array, predicate, isDrop, fromRight) {
+ var length = array.length,
+ index = fromRight ? length : -1;
+
+ while ((fromRight ? index-- : ++index < length) &&
+ predicate(array[index], index, array)) {}
+
+ return isDrop
+ ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))
+ : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));
+ }
+
+ /**
+ * The base implementation of `wrapperValue` which returns the result of
+ * performing a sequence of actions on the unwrapped `value`, where each
+ * successive action is supplied the return value of the previous.
+ *
+ * @private
+ * @param {*} value The unwrapped value.
+ * @param {Array} actions Actions to perform to resolve the unwrapped value.
+ * @returns {*} Returns the resolved value.
+ */
+ function baseWrapperValue(value, actions) {
+ var result = value;
+ if (result instanceof LazyWrapper) {
+ result = result.value();
+ }
+ return arrayReduce(actions, function(result, action) {
+ return action.func.apply(action.thisArg, arrayPush([result], action.args));
+ }, result);
+ }
+
+ /**
+ * The base implementation of methods like `_.xor`, without support for
+ * iteratee shorthands, that accepts an array of arrays to inspect.
+ *
+ * @private
+ * @param {Array} arrays The arrays to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of values.
+ */
+ function baseXor(arrays, iteratee, comparator) {
+ var length = arrays.length;
+ if (length < 2) {
+ return length ? baseUniq(arrays[0]) : [];
+ }
+ var index = -1,
+ result = Array(length);
+
+ while (++index < length) {
+ var array = arrays[index],
+ othIndex = -1;
+
+ while (++othIndex < length) {
+ if (othIndex != index) {
+ result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);
+ }
+ }
+ }
+ return baseUniq(baseFlatten(result, 1), iteratee, comparator);
+ }
+
+ /**
+ * This base implementation of `_.zipObject` which assigns values using `assignFunc`.
+ *
+ * @private
+ * @param {Array} props The property identifiers.
+ * @param {Array} values The property values.
+ * @param {Function} assignFunc The function to assign values.
+ * @returns {Object} Returns the new object.
+ */
+ function baseZipObject(props, values, assignFunc) {
+ var index = -1,
+ length = props.length,
+ valsLength = values.length,
+ result = {};
+
+ while (++index < length) {
+ var value = index < valsLength ? values[index] : undefined;
+ assignFunc(result, props[index], value);
+ }
+ return result;
+ }
+
+ /**
+ * Casts `value` to an empty array if it's not an array like object.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @returns {Array|Object} Returns the cast array-like object.
+ */
+ function castArrayLikeObject(value) {
+ return isArrayLikeObject(value) ? value : [];
+ }
+
+ /**
+ * Casts `value` to `identity` if it's not a function.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @returns {Function} Returns cast function.
+ */
+ function castFunction(value) {
+ return typeof value == 'function' ? value : identity;
+ }
+
+ /**
+ * Casts `value` to a path array if it's not one.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @param {Object} [object] The object to query keys on.
+ * @returns {Array} Returns the cast property path array.
+ */
+ function castPath(value, object) {
+ if (isArray(value)) {
+ return value;
+ }
+ return isKey(value, object) ? [value] : stringToPath(toString(value));
+ }
+
+ /**
+ * A `baseRest` alias which can be replaced with `identity` by module
+ * replacement plugins.
+ *
+ * @private
+ * @type {Function}
+ * @param {Function} func The function to apply a rest parameter to.
+ * @returns {Function} Returns the new function.
+ */
+ var castRest = baseRest;
+
+ /**
+ * Casts `array` to a slice if it's needed.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {number} start The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns the cast slice.
+ */
+ function castSlice(array, start, end) {
+ var length = array.length;
+ end = end === undefined ? length : end;
+ return (!start && end >= length) ? array : baseSlice(array, start, end);
+ }
+
+ /**
+ * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).
+ *
+ * @private
+ * @param {number|Object} id The timer id or timeout object of the timer to clear.
+ */
+ var clearTimeout = ctxClearTimeout || function(id) {
+ return root.clearTimeout(id);
+ };
+
+ /**
+ * Creates a clone of `buffer`.
+ *
+ * @private
+ * @param {Buffer} buffer The buffer to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Buffer} Returns the cloned buffer.
+ */
+ function cloneBuffer(buffer, isDeep) {
+ if (isDeep) {
+ return buffer.slice();
+ }
+ var length = buffer.length,
+ result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
+
+ buffer.copy(result);
+ return result;
+ }
+
+ /**
+ * Creates a clone of `arrayBuffer`.
+ *
+ * @private
+ * @param {ArrayBuffer} arrayBuffer The array buffer to clone.
+ * @returns {ArrayBuffer} Returns the cloned array buffer.
+ */
+ function cloneArrayBuffer(arrayBuffer) {
+ var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
+ new Uint8Array(result).set(new Uint8Array(arrayBuffer));
+ return result;
+ }
+
+ /**
+ * Creates a clone of `dataView`.
+ *
+ * @private
+ * @param {Object} dataView The data view to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Object} Returns the cloned data view.
+ */
+ function cloneDataView(dataView, isDeep) {
+ var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
+ return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
+ }
+
+ /**
+ * Creates a clone of `regexp`.
+ *
+ * @private
+ * @param {Object} regexp The regexp to clone.
+ * @returns {Object} Returns the cloned regexp.
+ */
+ function cloneRegExp(regexp) {
+ var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
+ result.lastIndex = regexp.lastIndex;
+ return result;
+ }
+
+ /**
+ * Creates a clone of the `symbol` object.
+ *
+ * @private
+ * @param {Object} symbol The symbol object to clone.
+ * @returns {Object} Returns the cloned symbol object.
+ */
+ function cloneSymbol(symbol) {
+ return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
+ }
+
+ /**
+ * Creates a clone of `typedArray`.
+ *
+ * @private
+ * @param {Object} typedArray The typed array to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Object} Returns the cloned typed array.
+ */
+ function cloneTypedArray(typedArray, isDeep) {
+ var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
+ return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
+ }
+
+ /**
+ * Compares values to sort them in ascending order.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {number} Returns the sort order indicator for `value`.
+ */
+ function compareAscending(value, other) {
+ if (value !== other) {
+ var valIsDefined = value !== undefined,
+ valIsNull = value === null,
+ valIsReflexive = value === value,
+ valIsSymbol = isSymbol(value);
+
+ var othIsDefined = other !== undefined,
+ othIsNull = other === null,
+ othIsReflexive = other === other,
+ othIsSymbol = isSymbol(other);
+
+ if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||
+ (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||
+ (valIsNull && othIsDefined && othIsReflexive) ||
+ (!valIsDefined && othIsReflexive) ||
+ !valIsReflexive) {
+ return 1;
+ }
+ if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||
+ (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||
+ (othIsNull && valIsDefined && valIsReflexive) ||
+ (!othIsDefined && valIsReflexive) ||
+ !othIsReflexive) {
+ return -1;
+ }
+ }
+ return 0;
+ }
+
+ /**
+ * Used by `_.orderBy` to compare multiple properties of a value to another
+ * and stable sort them.
+ *
+ * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,
+ * specify an order of "desc" for descending or "asc" for ascending sort order
+ * of corresponding values.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {boolean[]|string[]} orders The order to sort by for each property.
+ * @returns {number} Returns the sort order indicator for `object`.
+ */
+ function compareMultiple(object, other, orders) {
+ var index = -1,
+ objCriteria = object.criteria,
+ othCriteria = other.criteria,
+ length = objCriteria.length,
+ ordersLength = orders.length;
+
+ while (++index < length) {
+ var result = compareAscending(objCriteria[index], othCriteria[index]);
+ if (result) {
+ if (index >= ordersLength) {
+ return result;
+ }
+ var order = orders[index];
+ return result * (order == 'desc' ? -1 : 1);
+ }
+ }
+ // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications
+ // that causes it, under certain circumstances, to provide the same value for
+ // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247
+ // for more details.
+ //
+ // This also ensures a stable sort in V8 and other engines.
+ // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.
+ return object.index - other.index;
+ }
+
+ /**
+ * Creates an array that is the composition of partially applied arguments,
+ * placeholders, and provided arguments into a single array of arguments.
+ *
+ * @private
+ * @param {Array} args The provided arguments.
+ * @param {Array} partials The arguments to prepend to those provided.
+ * @param {Array} holders The `partials` placeholder indexes.
+ * @params {boolean} [isCurried] Specify composing for a curried function.
+ * @returns {Array} Returns the new array of composed arguments.
+ */
+ function composeArgs(args, partials, holders, isCurried) {
+ var argsIndex = -1,
+ argsLength = args.length,
+ holdersLength = holders.length,
+ leftIndex = -1,
+ leftLength = partials.length,
+ rangeLength = nativeMax(argsLength - holdersLength, 0),
+ result = Array(leftLength + rangeLength),
+ isUncurried = !isCurried;
+
+ while (++leftIndex < leftLength) {
+ result[leftIndex] = partials[leftIndex];
+ }
+ while (++argsIndex < holdersLength) {
+ if (isUncurried || argsIndex < argsLength) {
+ result[holders[argsIndex]] = args[argsIndex];
+ }
+ }
+ while (rangeLength--) {
+ result[leftIndex++] = args[argsIndex++];
+ }
+ return result;
+ }
+
+ /**
+ * This function is like `composeArgs` except that the arguments composition
+ * is tailored for `_.partialRight`.
+ *
+ * @private
+ * @param {Array} args The provided arguments.
+ * @param {Array} partials The arguments to append to those provided.
+ * @param {Array} holders The `partials` placeholder indexes.
+ * @params {boolean} [isCurried] Specify composing for a curried function.
+ * @returns {Array} Returns the new array of composed arguments.
+ */
+ function composeArgsRight(args, partials, holders, isCurried) {
+ var argsIndex = -1,
+ argsLength = args.length,
+ holdersIndex = -1,
+ holdersLength = holders.length,
+ rightIndex = -1,
+ rightLength = partials.length,
+ rangeLength = nativeMax(argsLength - holdersLength, 0),
+ result = Array(rangeLength + rightLength),
+ isUncurried = !isCurried;
+
+ while (++argsIndex < rangeLength) {
+ result[argsIndex] = args[argsIndex];
+ }
+ var offset = argsIndex;
+ while (++rightIndex < rightLength) {
+ result[offset + rightIndex] = partials[rightIndex];
+ }
+ while (++holdersIndex < holdersLength) {
+ if (isUncurried || argsIndex < argsLength) {
+ result[offset + holders[holdersIndex]] = args[argsIndex++];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Copies the values of `source` to `array`.
+ *
+ * @private
+ * @param {Array} source The array to copy values from.
+ * @param {Array} [array=[]] The array to copy values to.
+ * @returns {Array} Returns `array`.
+ */
+ function copyArray(source, array) {
+ var index = -1,
+ length = source.length;
+
+ array || (array = Array(length));
+ while (++index < length) {
+ array[index] = source[index];
+ }
+ return array;
+ }
+
+ /**
+ * Copies properties of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy properties from.
+ * @param {Array} props The property identifiers to copy.
+ * @param {Object} [object={}] The object to copy properties to.
+ * @param {Function} [customizer] The function to customize copied values.
+ * @returns {Object} Returns `object`.
+ */
+ function copyObject(source, props, object, customizer) {
+ var isNew = !object;
+ object || (object = {});
+
+ var index = -1,
+ length = props.length;
+
+ while (++index < length) {
+ var key = props[index];
+
+ var newValue = customizer
+ ? customizer(object[key], source[key], key, object, source)
+ : undefined;
+
+ if (newValue === undefined) {
+ newValue = source[key];
+ }
+ if (isNew) {
+ baseAssignValue(object, key, newValue);
+ } else {
+ assignValue(object, key, newValue);
+ }
+ }
+ return object;
+ }
+
+ /**
+ * Copies own symbols of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy symbols from.
+ * @param {Object} [object={}] The object to copy symbols to.
+ * @returns {Object} Returns `object`.
+ */
+ function copySymbols(source, object) {
+ return copyObject(source, getSymbols(source), object);
+ }
+
+ /**
+ * Copies own and inherited symbols of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy symbols from.
+ * @param {Object} [object={}] The object to copy symbols to.
+ * @returns {Object} Returns `object`.
+ */
+ function copySymbolsIn(source, object) {
+ return copyObject(source, getSymbolsIn(source), object);
+ }
+
+ /**
+ * Creates a function like `_.groupBy`.
+ *
+ * @private
+ * @param {Function} setter The function to set accumulator values.
+ * @param {Function} [initializer] The accumulator object initializer.
+ * @returns {Function} Returns the new aggregator function.
+ */
+ function createAggregator(setter, initializer) {
+ return function(collection, iteratee) {
+ var func = isArray(collection) ? arrayAggregator : baseAggregator,
+ accumulator = initializer ? initializer() : {};
+
+ return func(collection, setter, getIteratee(iteratee, 2), accumulator);
+ };
+ }
+
+ /**
+ * Creates a function like `_.assign`.
+ *
+ * @private
+ * @param {Function} assigner The function to assign values.
+ * @returns {Function} Returns the new assigner function.
+ */
+ function createAssigner(assigner) {
+ return baseRest(function(object, sources) {
+ var index = -1,
+ length = sources.length,
+ customizer = length > 1 ? sources[length - 1] : undefined,
+ guard = length > 2 ? sources[2] : undefined;
+
+ customizer = (assigner.length > 3 && typeof customizer == 'function')
+ ? (length--, customizer)
+ : undefined;
+
+ if (guard && isIterateeCall(sources[0], sources[1], guard)) {
+ customizer = length < 3 ? undefined : customizer;
+ length = 1;
+ }
+ object = Object(object);
+ while (++index < length) {
+ var source = sources[index];
+ if (source) {
+ assigner(object, source, index, customizer);
+ }
+ }
+ return object;
+ });
+ }
+
+ /**
+ * Creates a `baseEach` or `baseEachRight` function.
+ *
+ * @private
+ * @param {Function} eachFunc The function to iterate over a collection.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new base function.
+ */
+ function createBaseEach(eachFunc, fromRight) {
+ return function(collection, iteratee) {
+ if (collection == null) {
+ return collection;
+ }
+ if (!isArrayLike(collection)) {
+ return eachFunc(collection, iteratee);
+ }
+ var length = collection.length,
+ index = fromRight ? length : -1,
+ iterable = Object(collection);
+
+ while ((fromRight ? index-- : ++index < length)) {
+ if (iteratee(iterable[index], index, iterable) === false) {
+ break;
+ }
+ }
+ return collection;
+ };
+ }
+
+ /**
+ * Creates a base function for methods like `_.forIn` and `_.forOwn`.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new base function.
+ */
+ function createBaseFor(fromRight) {
+ return function(object, iteratee, keysFunc) {
+ var index = -1,
+ iterable = Object(object),
+ props = keysFunc(object),
+ length = props.length;
+
+ while (length--) {
+ var key = props[fromRight ? length : ++index];
+ if (iteratee(iterable[key], key, iterable) === false) {
+ break;
+ }
+ }
+ return object;
+ };
+ }
+
+ /**
+ * Creates a function that wraps `func` to invoke it with the optional `this`
+ * binding of `thisArg`.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createBind(func, bitmask, thisArg) {
+ var isBind = bitmask & WRAP_BIND_FLAG,
+ Ctor = createCtor(func);
+
+ function wrapper() {
+ var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
+ return fn.apply(isBind ? thisArg : this, arguments);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a function like `_.lowerFirst`.
+ *
+ * @private
+ * @param {string} methodName The name of the `String` case method to use.
+ * @returns {Function} Returns the new case function.
+ */
+ function createCaseFirst(methodName) {
+ return function(string) {
+ string = toString(string);
+
+ var strSymbols = hasUnicode(string)
+ ? stringToArray(string)
+ : undefined;
+
+ var chr = strSymbols
+ ? strSymbols[0]
+ : string.charAt(0);
+
+ var trailing = strSymbols
+ ? castSlice(strSymbols, 1).join('')
+ : string.slice(1);
+
+ return chr[methodName]() + trailing;
+ };
+ }
+
+ /**
+ * Creates a function like `_.camelCase`.
+ *
+ * @private
+ * @param {Function} callback The function to combine each word.
+ * @returns {Function} Returns the new compounder function.
+ */
+ function createCompounder(callback) {
+ return function(string) {
+ return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');
+ };
+ }
+
+ /**
+ * Creates a function that produces an instance of `Ctor` regardless of
+ * whether it was invoked as part of a `new` expression or by `call` or `apply`.
+ *
+ * @private
+ * @param {Function} Ctor The constructor to wrap.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createCtor(Ctor) {
+ return function() {
+ // Use a `switch` statement to work with class constructors. See
+ // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist
+ // for more details.
+ var args = arguments;
+ switch (args.length) {
+ case 0: return new Ctor;
+ case 1: return new Ctor(args[0]);
+ case 2: return new Ctor(args[0], args[1]);
+ case 3: return new Ctor(args[0], args[1], args[2]);
+ case 4: return new Ctor(args[0], args[1], args[2], args[3]);
+ case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);
+ case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);
+ case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);
+ }
+ var thisBinding = baseCreate(Ctor.prototype),
+ result = Ctor.apply(thisBinding, args);
+
+ // Mimic the constructor's `return` behavior.
+ // See https://es5.github.io/#x13.2.2 for more details.
+ return isObject(result) ? result : thisBinding;
+ };
+ }
+
+ /**
+ * Creates a function that wraps `func` to enable currying.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {number} arity The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createCurry(func, bitmask, arity) {
+ var Ctor = createCtor(func);
+
+ function wrapper() {
+ var length = arguments.length,
+ args = Array(length),
+ index = length,
+ placeholder = getHolder(wrapper);
+
+ while (index--) {
+ args[index] = arguments[index];
+ }
+ var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)
+ ? []
+ : replaceHolders(args, placeholder);
+
+ length -= holders.length;
+ if (length < arity) {
+ return createRecurry(
+ func, bitmask, createHybrid, wrapper.placeholder, undefined,
+ args, holders, undefined, undefined, arity - length);
+ }
+ var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
+ return apply(fn, this, args);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a `_.find` or `_.findLast` function.
+ *
+ * @private
+ * @param {Function} findIndexFunc The function to find the collection index.
+ * @returns {Function} Returns the new find function.
+ */
+ function createFind(findIndexFunc) {
+ return function(collection, predicate, fromIndex) {
+ var iterable = Object(collection);
+ if (!isArrayLike(collection)) {
+ var iteratee = getIteratee(predicate, 3);
+ collection = keys(collection);
+ predicate = function(key) { return iteratee(iterable[key], key, iterable); };
+ }
+ var index = findIndexFunc(collection, predicate, fromIndex);
+ return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;
+ };
+ }
+
+ /**
+ * Creates a `_.flow` or `_.flowRight` function.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new flow function.
+ */
+ function createFlow(fromRight) {
+ return flatRest(function(funcs) {
+ var length = funcs.length,
+ index = length,
+ prereq = LodashWrapper.prototype.thru;
+
+ if (fromRight) {
+ funcs.reverse();
+ }
+ while (index--) {
+ var func = funcs[index];
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ if (prereq && !wrapper && getFuncName(func) == 'wrapper') {
+ var wrapper = new LodashWrapper([], true);
+ }
+ }
+ index = wrapper ? index : length;
+ while (++index < length) {
+ func = funcs[index];
+
+ var funcName = getFuncName(func),
+ data = funcName == 'wrapper' ? getData(func) : undefined;
+
+ if (data && isLaziable(data[0]) &&
+ data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&
+ !data[4].length && data[9] == 1
+ ) {
+ wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);
+ } else {
+ wrapper = (func.length == 1 && isLaziable(func))
+ ? wrapper[funcName]()
+ : wrapper.thru(func);
+ }
+ }
+ return function() {
+ var args = arguments,
+ value = args[0];
+
+ if (wrapper && args.length == 1 && isArray(value)) {
+ return wrapper.plant(value).value();
+ }
+ var index = 0,
+ result = length ? funcs[index].apply(this, args) : value;
+
+ while (++index < length) {
+ result = funcs[index].call(this, result);
+ }
+ return result;
+ };
+ });
+ }
+
+ /**
+ * Creates a function that wraps `func` to invoke it with optional `this`
+ * binding of `thisArg`, partial application, and currying.
+ *
+ * @private
+ * @param {Function|string} func The function or method name to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @param {Array} [partials] The arguments to prepend to those provided to
+ * the new function.
+ * @param {Array} [holders] The `partials` placeholder indexes.
+ * @param {Array} [partialsRight] The arguments to append to those provided
+ * to the new function.
+ * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.
+ * @param {Array} [argPos] The argument positions of the new function.
+ * @param {number} [ary] The arity cap of `func`.
+ * @param {number} [arity] The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {
+ var isAry = bitmask & WRAP_ARY_FLAG,
+ isBind = bitmask & WRAP_BIND_FLAG,
+ isBindKey = bitmask & WRAP_BIND_KEY_FLAG,
+ isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),
+ isFlip = bitmask & WRAP_FLIP_FLAG,
+ Ctor = isBindKey ? undefined : createCtor(func);
+
+ function wrapper() {
+ var length = arguments.length,
+ args = Array(length),
+ index = length;
+
+ while (index--) {
+ args[index] = arguments[index];
+ }
+ if (isCurried) {
+ var placeholder = getHolder(wrapper),
+ holdersCount = countHolders(args, placeholder);
+ }
+ if (partials) {
+ args = composeArgs(args, partials, holders, isCurried);
+ }
+ if (partialsRight) {
+ args = composeArgsRight(args, partialsRight, holdersRight, isCurried);
+ }
+ length -= holdersCount;
+ if (isCurried && length < arity) {
+ var newHolders = replaceHolders(args, placeholder);
+ return createRecurry(
+ func, bitmask, createHybrid, wrapper.placeholder, thisArg,
+ args, newHolders, argPos, ary, arity - length
+ );
+ }
+ var thisBinding = isBind ? thisArg : this,
+ fn = isBindKey ? thisBinding[func] : func;
+
+ length = args.length;
+ if (argPos) {
+ args = reorder(args, argPos);
+ } else if (isFlip && length > 1) {
+ args.reverse();
+ }
+ if (isAry && ary < length) {
+ args.length = ary;
+ }
+ if (this && this !== root && this instanceof wrapper) {
+ fn = Ctor || createCtor(fn);
+ }
+ return fn.apply(thisBinding, args);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a function like `_.invertBy`.
+ *
+ * @private
+ * @param {Function} setter The function to set accumulator values.
+ * @param {Function} toIteratee The function to resolve iteratees.
+ * @returns {Function} Returns the new inverter function.
+ */
+ function createInverter(setter, toIteratee) {
+ return function(object, iteratee) {
+ return baseInverter(object, setter, toIteratee(iteratee), {});
+ };
+ }
+
+ /**
+ * Creates a function that performs a mathematical operation on two values.
+ *
+ * @private
+ * @param {Function} operator The function to perform the operation.
+ * @param {number} [defaultValue] The value used for `undefined` arguments.
+ * @returns {Function} Returns the new mathematical operation function.
+ */
+ function createMathOperation(operator, defaultValue) {
+ return function(value, other) {
+ var result;
+ if (value === undefined && other === undefined) {
+ return defaultValue;
+ }
+ if (value !== undefined) {
+ result = value;
+ }
+ if (other !== undefined) {
+ if (result === undefined) {
+ return other;
+ }
+ if (typeof value == 'string' || typeof other == 'string') {
+ value = baseToString(value);
+ other = baseToString(other);
+ } else {
+ value = baseToNumber(value);
+ other = baseToNumber(other);
+ }
+ result = operator(value, other);
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Creates a function like `_.over`.
+ *
+ * @private
+ * @param {Function} arrayFunc The function to iterate over iteratees.
+ * @returns {Function} Returns the new over function.
+ */
+ function createOver(arrayFunc) {
+ return flatRest(function(iteratees) {
+ iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
+ return baseRest(function(args) {
+ var thisArg = this;
+ return arrayFunc(iteratees, function(iteratee) {
+ return apply(iteratee, thisArg, args);
+ });
+ });
+ });
+ }
+
+ /**
+ * Creates the padding for `string` based on `length`. The `chars` string
+ * is truncated if the number of characters exceeds `length`.
+ *
+ * @private
+ * @param {number} length The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padding for `string`.
+ */
+ function createPadding(length, chars) {
+ chars = chars === undefined ? ' ' : baseToString(chars);
+
+ var charsLength = chars.length;
+ if (charsLength < 2) {
+ return charsLength ? baseRepeat(chars, length) : chars;
+ }
+ var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));
+ return hasUnicode(chars)
+ ? castSlice(stringToArray(result), 0, length).join('')
+ : result.slice(0, length);
+ }
+
+ /**
+ * Creates a function that wraps `func` to invoke it with the `this` binding
+ * of `thisArg` and `partials` prepended to the arguments it receives.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {Array} partials The arguments to prepend to those provided to
+ * the new function.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createPartial(func, bitmask, thisArg, partials) {
+ var isBind = bitmask & WRAP_BIND_FLAG,
+ Ctor = createCtor(func);
+
+ function wrapper() {
+ var argsIndex = -1,
+ argsLength = arguments.length,
+ leftIndex = -1,
+ leftLength = partials.length,
+ args = Array(leftLength + argsLength),
+ fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
+
+ while (++leftIndex < leftLength) {
+ args[leftIndex] = partials[leftIndex];
+ }
+ while (argsLength--) {
+ args[leftIndex++] = arguments[++argsIndex];
+ }
+ return apply(fn, isBind ? thisArg : this, args);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a `_.range` or `_.rangeRight` function.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new range function.
+ */
+ function createRange(fromRight) {
+ return function(start, end, step) {
+ if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {
+ end = step = undefined;
+ }
+ // Ensure the sign of `-0` is preserved.
+ start = toFinite(start);
+ if (end === undefined) {
+ end = start;
+ start = 0;
+ } else {
+ end = toFinite(end);
+ }
+ step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);
+ return baseRange(start, end, step, fromRight);
+ };
+ }
+
+ /**
+ * Creates a function that performs a relational operation on two values.
+ *
+ * @private
+ * @param {Function} operator The function to perform the operation.
+ * @returns {Function} Returns the new relational operation function.
+ */
+ function createRelationalOperation(operator) {
+ return function(value, other) {
+ if (!(typeof value == 'string' && typeof other == 'string')) {
+ value = toNumber(value);
+ other = toNumber(other);
+ }
+ return operator(value, other);
+ };
+ }
+
+ /**
+ * Creates a function that wraps `func` to continue currying.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {Function} wrapFunc The function to create the `func` wrapper.
+ * @param {*} placeholder The placeholder value.
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @param {Array} [partials] The arguments to prepend to those provided to
+ * the new function.
+ * @param {Array} [holders] The `partials` placeholder indexes.
+ * @param {Array} [argPos] The argument positions of the new function.
+ * @param {number} [ary] The arity cap of `func`.
+ * @param {number} [arity] The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {
+ var isCurry = bitmask & WRAP_CURRY_FLAG,
+ newHolders = isCurry ? holders : undefined,
+ newHoldersRight = isCurry ? undefined : holders,
+ newPartials = isCurry ? partials : undefined,
+ newPartialsRight = isCurry ? undefined : partials;
+
+ bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);
+ bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);
+
+ if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {
+ bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);
+ }
+ var newData = [
+ func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,
+ newHoldersRight, argPos, ary, arity
+ ];
+
+ var result = wrapFunc.apply(undefined, newData);
+ if (isLaziable(func)) {
+ setData(result, newData);
+ }
+ result.placeholder = placeholder;
+ return setWrapToString(result, func, bitmask);
+ }
+
+ /**
+ * Creates a function like `_.round`.
+ *
+ * @private
+ * @param {string} methodName The name of the `Math` method to use when rounding.
+ * @returns {Function} Returns the new round function.
+ */
+ function createRound(methodName) {
+ var func = Math[methodName];
+ return function(number, precision) {
+ number = toNumber(number);
+ precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);
+ if (precision) {
+ // Shift with exponential notation to avoid floating-point issues.
+ // See [MDN](https://mdn.io/round#Examples) for more details.
+ var pair = (toString(number) + 'e').split('e'),
+ value = func(pair[0] + 'e' + (+pair[1] + precision));
+
+ pair = (toString(value) + 'e').split('e');
+ return +(pair[0] + 'e' + (+pair[1] - precision));
+ }
+ return func(number);
+ };
+ }
+
+ /**
+ * Creates a set object of `values`.
+ *
+ * @private
+ * @param {Array} values The values to add to the set.
+ * @returns {Object} Returns the new set.
+ */
+ var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {
+ return new Set(values);
+ };
+
+ /**
+ * Creates a `_.toPairs` or `_.toPairsIn` function.
+ *
+ * @private
+ * @param {Function} keysFunc The function to get the keys of a given object.
+ * @returns {Function} Returns the new pairs function.
+ */
+ function createToPairs(keysFunc) {
+ return function(object) {
+ var tag = getTag(object);
+ if (tag == mapTag) {
+ return mapToArray(object);
+ }
+ if (tag == setTag) {
+ return setToPairs(object);
+ }
+ return baseToPairs(object, keysFunc(object));
+ };
+ }
+
+ /**
+ * Creates a function that either curries or invokes `func` with optional
+ * `this` binding and partially applied arguments.
+ *
+ * @private
+ * @param {Function|string} func The function or method name to wrap.
+ * @param {number} bitmask The bitmask flags.
+ * 1 - `_.bind`
+ * 2 - `_.bindKey`
+ * 4 - `_.curry` or `_.curryRight` of a bound function
+ * 8 - `_.curry`
+ * 16 - `_.curryRight`
+ * 32 - `_.partial`
+ * 64 - `_.partialRight`
+ * 128 - `_.rearg`
+ * 256 - `_.ary`
+ * 512 - `_.flip`
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @param {Array} [partials] The arguments to be partially applied.
+ * @param {Array} [holders] The `partials` placeholder indexes.
+ * @param {Array} [argPos] The argument positions of the new function.
+ * @param {number} [ary] The arity cap of `func`.
+ * @param {number} [arity] The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {
+ var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;
+ if (!isBindKey && typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ var length = partials ? partials.length : 0;
+ if (!length) {
+ bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);
+ partials = holders = undefined;
+ }
+ ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);
+ arity = arity === undefined ? arity : toInteger(arity);
+ length -= holders ? holders.length : 0;
+
+ if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {
+ var partialsRight = partials,
+ holdersRight = holders;
+
+ partials = holders = undefined;
+ }
+ var data = isBindKey ? undefined : getData(func);
+
+ var newData = [
+ func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,
+ argPos, ary, arity
+ ];
+
+ if (data) {
+ mergeData(newData, data);
+ }
+ func = newData[0];
+ bitmask = newData[1];
+ thisArg = newData[2];
+ partials = newData[3];
+ holders = newData[4];
+ arity = newData[9] = newData[9] === undefined
+ ? (isBindKey ? 0 : func.length)
+ : nativeMax(newData[9] - length, 0);
+
+ if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {
+ bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);
+ }
+ if (!bitmask || bitmask == WRAP_BIND_FLAG) {
+ var result = createBind(func, bitmask, thisArg);
+ } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {
+ result = createCurry(func, bitmask, arity);
+ } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {
+ result = createPartial(func, bitmask, thisArg, partials);
+ } else {
+ result = createHybrid.apply(undefined, newData);
+ }
+ var setter = data ? baseSetData : setData;
+ return setWrapToString(setter(result, newData), func, bitmask);
+ }
+
+ /**
+ * Used by `_.defaults` to customize its `_.assignIn` use to assign properties
+ * of source objects to the destination object for all destination properties
+ * that resolve to `undefined`.
+ *
+ * @private
+ * @param {*} objValue The destination value.
+ * @param {*} srcValue The source value.
+ * @param {string} key The key of the property to assign.
+ * @param {Object} object The parent object of `objValue`.
+ * @returns {*} Returns the value to assign.
+ */
+ function customDefaultsAssignIn(objValue, srcValue, key, object) {
+ if (objValue === undefined ||
+ (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {
+ return srcValue;
+ }
+ return objValue;
+ }
+
+ /**
+ * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source
+ * objects into destination objects that are passed thru.
+ *
+ * @private
+ * @param {*} objValue The destination value.
+ * @param {*} srcValue The source value.
+ * @param {string} key The key of the property to merge.
+ * @param {Object} object The parent object of `objValue`.
+ * @param {Object} source The parent object of `srcValue`.
+ * @param {Object} [stack] Tracks traversed source values and their merged
+ * counterparts.
+ * @returns {*} Returns the value to assign.
+ */
+ function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {
+ if (isObject(objValue) && isObject(srcValue)) {
+ // Recursively merge objects and arrays (susceptible to call stack limits).
+ stack.set(srcValue, objValue);
+ baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);
+ stack['delete'](srcValue);
+ }
+ return objValue;
+ }
+
+ /**
+ * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain
+ * objects.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @param {string} key The key of the property to inspect.
+ * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.
+ */
+ function customOmitClone(value) {
+ return isPlainObject(value) ? undefined : value;
+ }
+
+ /**
+ * A specialized version of `baseIsEqualDeep` for arrays with support for
+ * partial deep comparisons.
+ *
+ * @private
+ * @param {Array} array The array to compare.
+ * @param {Array} other The other array to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} stack Tracks traversed `array` and `other` objects.
+ * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
+ */
+ function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
+ var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
+ arrLength = array.length,
+ othLength = other.length;
+
+ if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
+ return false;
+ }
+ // Assume cyclic values are equal.
+ var stacked = stack.get(array);
+ if (stacked && stack.get(other)) {
+ return stacked == other;
+ }
+ var index = -1,
+ result = true,
+ seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;
+
+ stack.set(array, other);
+ stack.set(other, array);
+
+ // Ignore non-index properties.
+ while (++index < arrLength) {
+ var arrValue = array[index],
+ othValue = other[index];
+
+ if (customizer) {
+ var compared = isPartial
+ ? customizer(othValue, arrValue, index, other, array, stack)
+ : customizer(arrValue, othValue, index, array, other, stack);
+ }
+ if (compared !== undefined) {
+ if (compared) {
+ continue;
+ }
+ result = false;
+ break;
+ }
+ // Recursively compare arrays (susceptible to call stack limits).
+ if (seen) {
+ if (!arraySome(other, function(othValue, othIndex) {
+ if (!cacheHas(seen, othIndex) &&
+ (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
+ return seen.push(othIndex);
+ }
+ })) {
+ result = false;
+ break;
+ }
+ } else if (!(
+ arrValue === othValue ||
+ equalFunc(arrValue, othValue, bitmask, customizer, stack)
+ )) {
+ result = false;
+ break;
+ }
+ }
+ stack['delete'](array);
+ stack['delete'](other);
+ return result;
+ }
+
+ /**
+ * A specialized version of `baseIsEqualDeep` for comparing objects of
+ * the same `toStringTag`.
+ *
+ * **Note:** This function only supports comparing values with tags of
+ * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {string} tag The `toStringTag` of the objects to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} stack Tracks traversed `object` and `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+ function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
+ switch (tag) {
+ case dataViewTag:
+ if ((object.byteLength != other.byteLength) ||
+ (object.byteOffset != other.byteOffset)) {
+ return false;
+ }
+ object = object.buffer;
+ other = other.buffer;
+
+ case arrayBufferTag:
+ if ((object.byteLength != other.byteLength) ||
+ !equalFunc(new Uint8Array(object), new Uint8Array(other))) {
+ return false;
+ }
+ return true;
+
+ case boolTag:
+ case dateTag:
+ case numberTag:
+ // Coerce booleans to `1` or `0` and dates to milliseconds.
+ // Invalid dates are coerced to `NaN`.
+ return eq(+object, +other);
+
+ case errorTag:
+ return object.name == other.name && object.message == other.message;
+
+ case regexpTag:
+ case stringTag:
+ // Coerce regexes to strings and treat strings, primitives and objects,
+ // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
+ // for more details.
+ return object == (other + '');
+
+ case mapTag:
+ var convert = mapToArray;
+
+ case setTag:
+ var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
+ convert || (convert = setToArray);
+
+ if (object.size != other.size && !isPartial) {
+ return false;
+ }
+ // Assume cyclic values are equal.
+ var stacked = stack.get(object);
+ if (stacked) {
+ return stacked == other;
+ }
+ bitmask |= COMPARE_UNORDERED_FLAG;
+
+ // Recursively compare objects (susceptible to call stack limits).
+ stack.set(object, other);
+ var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
+ stack['delete'](object);
+ return result;
+
+ case symbolTag:
+ if (symbolValueOf) {
+ return symbolValueOf.call(object) == symbolValueOf.call(other);
+ }
+ }
+ return false;
+ }
+
+ /**
+ * A specialized version of `baseIsEqualDeep` for objects with support for
+ * partial deep comparisons.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} stack Tracks traversed `object` and `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+ function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
+ var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
+ objProps = getAllKeys(object),
+ objLength = objProps.length,
+ othProps = getAllKeys(other),
+ othLength = othProps.length;
+
+ if (objLength != othLength && !isPartial) {
+ return false;
+ }
+ var index = objLength;
+ while (index--) {
+ var key = objProps[index];
+ if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
+ return false;
+ }
+ }
+ // Assume cyclic values are equal.
+ var stacked = stack.get(object);
+ if (stacked && stack.get(other)) {
+ return stacked == other;
+ }
+ var result = true;
+ stack.set(object, other);
+ stack.set(other, object);
+
+ var skipCtor = isPartial;
+ while (++index < objLength) {
+ key = objProps[index];
+ var objValue = object[key],
+ othValue = other[key];
+
+ if (customizer) {
+ var compared = isPartial
+ ? customizer(othValue, objValue, key, other, object, stack)
+ : customizer(objValue, othValue, key, object, other, stack);
+ }
+ // Recursively compare objects (susceptible to call stack limits).
+ if (!(compared === undefined
+ ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))
+ : compared
+ )) {
+ result = false;
+ break;
+ }
+ skipCtor || (skipCtor = key == 'constructor');
+ }
+ if (result && !skipCtor) {
+ var objCtor = object.constructor,
+ othCtor = other.constructor;
+
+ // Non `Object` object instances with different constructors are not equal.
+ if (objCtor != othCtor &&
+ ('constructor' in object && 'constructor' in other) &&
+ !(typeof objCtor == 'function' && objCtor instanceof objCtor &&
+ typeof othCtor == 'function' && othCtor instanceof othCtor)) {
+ result = false;
+ }
+ }
+ stack['delete'](object);
+ stack['delete'](other);
+ return result;
+ }
+
+ /**
+ * A specialized version of `baseRest` which flattens the rest array.
+ *
+ * @private
+ * @param {Function} func The function to apply a rest parameter to.
+ * @returns {Function} Returns the new function.
+ */
+ function flatRest(func) {
+ return setToString(overRest(func, undefined, flatten), func + '');
+ }
+
+ /**
+ * Creates an array of own enumerable property names and symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names and symbols.
+ */
+ function getAllKeys(object) {
+ return baseGetAllKeys(object, keys, getSymbols);
+ }
+
+ /**
+ * Creates an array of own and inherited enumerable property names and
+ * symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names and symbols.
+ */
+ function getAllKeysIn(object) {
+ return baseGetAllKeys(object, keysIn, getSymbolsIn);
+ }
+
+ /**
+ * Gets metadata for `func`.
+ *
+ * @private
+ * @param {Function} func The function to query.
+ * @returns {*} Returns the metadata for `func`.
+ */
+ var getData = !metaMap ? noop : function(func) {
+ return metaMap.get(func);
+ };
+
+ /**
+ * Gets the name of `func`.
+ *
+ * @private
+ * @param {Function} func The function to query.
+ * @returns {string} Returns the function name.
+ */
+ function getFuncName(func) {
+ var result = (func.name + ''),
+ array = realNames[result],
+ length = hasOwnProperty.call(realNames, result) ? array.length : 0;
+
+ while (length--) {
+ var data = array[length],
+ otherFunc = data.func;
+ if (otherFunc == null || otherFunc == func) {
+ return data.name;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the argument placeholder value for `func`.
+ *
+ * @private
+ * @param {Function} func The function to inspect.
+ * @returns {*} Returns the placeholder value.
+ */
+ function getHolder(func) {
+ var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;
+ return object.placeholder;
+ }
+
+ /**
+ * Gets the appropriate "iteratee" function. If `_.iteratee` is customized,
+ * this function returns the custom method, otherwise it returns `baseIteratee`.
+ * If arguments are provided, the chosen function is invoked with them and
+ * its result is returned.
+ *
+ * @private
+ * @param {*} [value] The value to convert to an iteratee.
+ * @param {number} [arity] The arity of the created iteratee.
+ * @returns {Function} Returns the chosen function or its result.
+ */
+ function getIteratee() {
+ var result = lodash.iteratee || iteratee;
+ result = result === iteratee ? baseIteratee : result;
+ return arguments.length ? result(arguments[0], arguments[1]) : result;
+ }
+
+ /**
+ * Gets the data for `map`.
+ *
+ * @private
+ * @param {Object} map The map to query.
+ * @param {string} key The reference key.
+ * @returns {*} Returns the map data.
+ */
+ function getMapData(map, key) {
+ var data = map.__data__;
+ return isKeyable(key)
+ ? data[typeof key == 'string' ? 'string' : 'hash']
+ : data.map;
+ }
+
+ /**
+ * Gets the property names, values, and compare flags of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the match data of `object`.
+ */
+ function getMatchData(object) {
+ var result = keys(object),
+ length = result.length;
+
+ while (length--) {
+ var key = result[length],
+ value = object[key];
+
+ result[length] = [key, value, isStrictComparable(value)];
+ }
+ return result;
+ }
+
+ /**
+ * Gets the native function at `key` of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {string} key The key of the method to get.
+ * @returns {*} Returns the function if it's native, else `undefined`.
+ */
+ function getNative(object, key) {
+ var value = getValue(object, key);
+ return baseIsNative(value) ? value : undefined;
+ }
+
+ /**
+ * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @returns {string} Returns the raw `toStringTag`.
+ */
+ function getRawTag(value) {
+ var isOwn = hasOwnProperty.call(value, symToStringTag),
+ tag = value[symToStringTag];
+
+ try {
+ value[symToStringTag] = undefined;
+ var unmasked = true;
+ } catch (e) {}
+
+ var result = nativeObjectToString.call(value);
+ if (unmasked) {
+ if (isOwn) {
+ value[symToStringTag] = tag;
+ } else {
+ delete value[symToStringTag];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates an array of the own enumerable symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of symbols.
+ */
+ var getSymbols = !nativeGetSymbols ? stubArray : function(object) {
+ if (object == null) {
+ return [];
+ }
+ object = Object(object);
+ return arrayFilter(nativeGetSymbols(object), function(symbol) {
+ return propertyIsEnumerable.call(object, symbol);
+ });
+ };
+
+ /**
+ * Creates an array of the own and inherited enumerable symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of symbols.
+ */
+ var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {
+ var result = [];
+ while (object) {
+ arrayPush(result, getSymbols(object));
+ object = getPrototype(object);
+ }
+ return result;
+ };
+
+ /**
+ * Gets the `toStringTag` of `value`.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @returns {string} Returns the `toStringTag`.
+ */
+ var getTag = baseGetTag;
+
+ // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.
+ if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||
+ (Map && getTag(new Map) != mapTag) ||
+ (Promise && getTag(Promise.resolve()) != promiseTag) ||
+ (Set && getTag(new Set) != setTag) ||
+ (WeakMap && getTag(new WeakMap) != weakMapTag)) {
+ getTag = function(value) {
+ var result = baseGetTag(value),
+ Ctor = result == objectTag ? value.constructor : undefined,
+ ctorString = Ctor ? toSource(Ctor) : '';
+
+ if (ctorString) {
+ switch (ctorString) {
+ case dataViewCtorString: return dataViewTag;
+ case mapCtorString: return mapTag;
+ case promiseCtorString: return promiseTag;
+ case setCtorString: return setTag;
+ case weakMapCtorString: return weakMapTag;
+ }
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Gets the view, applying any `transforms` to the `start` and `end` positions.
+ *
+ * @private
+ * @param {number} start The start of the view.
+ * @param {number} end The end of the view.
+ * @param {Array} transforms The transformations to apply to the view.
+ * @returns {Object} Returns an object containing the `start` and `end`
+ * positions of the view.
+ */
+ function getView(start, end, transforms) {
+ var index = -1,
+ length = transforms.length;
+
+ while (++index < length) {
+ var data = transforms[index],
+ size = data.size;
+
+ switch (data.type) {
+ case 'drop': start += size; break;
+ case 'dropRight': end -= size; break;
+ case 'take': end = nativeMin(end, start + size); break;
+ case 'takeRight': start = nativeMax(start, end - size); break;
+ }
+ }
+ return { 'start': start, 'end': end };
+ }
+
+ /**
+ * Extracts wrapper details from the `source` body comment.
+ *
+ * @private
+ * @param {string} source The source to inspect.
+ * @returns {Array} Returns the wrapper details.
+ */
+ function getWrapDetails(source) {
+ var match = source.match(reWrapDetails);
+ return match ? match[1].split(reSplitDetails) : [];
+ }
+
+ /**
+ * Checks if `path` exists on `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path to check.
+ * @param {Function} hasFunc The function to check properties.
+ * @returns {boolean} Returns `true` if `path` exists, else `false`.
+ */
+ function hasPath(object, path, hasFunc) {
+ path = castPath(path, object);
+
+ var index = -1,
+ length = path.length,
+ result = false;
+
+ while (++index < length) {
+ var key = toKey(path[index]);
+ if (!(result = object != null && hasFunc(object, key))) {
+ break;
+ }
+ object = object[key];
+ }
+ if (result || ++index != length) {
+ return result;
+ }
+ length = object == null ? 0 : object.length;
+ return !!length && isLength(length) && isIndex(key, length) &&
+ (isArray(object) || isArguments(object));
+ }
+
+ /**
+ * Initializes an array clone.
+ *
+ * @private
+ * @param {Array} array The array to clone.
+ * @returns {Array} Returns the initialized clone.
+ */
+ function initCloneArray(array) {
+ var length = array.length,
+ result = new array.constructor(length);
+
+ // Add properties assigned by `RegExp#exec`.
+ if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
+ result.index = array.index;
+ result.input = array.input;
+ }
+ return result;
+ }
+
+ /**
+ * Initializes an object clone.
+ *
+ * @private
+ * @param {Object} object The object to clone.
+ * @returns {Object} Returns the initialized clone.
+ */
+ function initCloneObject(object) {
+ return (typeof object.constructor == 'function' && !isPrototype(object))
+ ? baseCreate(getPrototype(object))
+ : {};
+ }
+
+ /**
+ * Initializes an object clone based on its `toStringTag`.
+ *
+ * **Note:** This function only supports cloning values with tags of
+ * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.
+ *
+ * @private
+ * @param {Object} object The object to clone.
+ * @param {string} tag The `toStringTag` of the object to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Object} Returns the initialized clone.
+ */
+ function initCloneByTag(object, tag, isDeep) {
+ var Ctor = object.constructor;
+ switch (tag) {
+ case arrayBufferTag:
+ return cloneArrayBuffer(object);
+
+ case boolTag:
+ case dateTag:
+ return new Ctor(+object);
+
+ case dataViewTag:
+ return cloneDataView(object, isDeep);
+
+ case float32Tag: case float64Tag:
+ case int8Tag: case int16Tag: case int32Tag:
+ case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:
+ return cloneTypedArray(object, isDeep);
+
+ case mapTag:
+ return new Ctor;
+
+ case numberTag:
+ case stringTag:
+ return new Ctor(object);
+
+ case regexpTag:
+ return cloneRegExp(object);
+
+ case setTag:
+ return new Ctor;
+
+ case symbolTag:
+ return cloneSymbol(object);
+ }
+ }
+
+ /**
+ * Inserts wrapper `details` in a comment at the top of the `source` body.
+ *
+ * @private
+ * @param {string} source The source to modify.
+ * @returns {Array} details The details to insert.
+ * @returns {string} Returns the modified source.
+ */
+ function insertWrapDetails(source, details) {
+ var length = details.length;
+ if (!length) {
+ return source;
+ }
+ var lastIndex = length - 1;
+ details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];
+ details = details.join(length > 2 ? ', ' : ' ');
+ return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n');
+ }
+
+ /**
+ * Checks if `value` is a flattenable `arguments` object or array.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.
+ */
+ function isFlattenable(value) {
+ return isArray(value) || isArguments(value) ||
+ !!(spreadableSymbol && value && value[spreadableSymbol]);
+ }
+
+ /**
+ * Checks if `value` is a valid array-like index.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
+ * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
+ */
+ function isIndex(value, length) {
+ var type = typeof value;
+ length = length == null ? MAX_SAFE_INTEGER : length;
+
+ return !!length &&
+ (type == 'number' ||
+ (type != 'symbol' && reIsUint.test(value))) &&
+ (value > -1 && value % 1 == 0 && value < length);
+ }
+
+ /**
+ * Checks if the given arguments are from an iteratee call.
+ *
+ * @private
+ * @param {*} value The potential iteratee value argument.
+ * @param {*} index The potential iteratee index or key argument.
+ * @param {*} object The potential iteratee object argument.
+ * @returns {boolean} Returns `true` if the arguments are from an iteratee call,
+ * else `false`.
+ */
+ function isIterateeCall(value, index, object) {
+ if (!isObject(object)) {
+ return false;
+ }
+ var type = typeof index;
+ if (type == 'number'
+ ? (isArrayLike(object) && isIndex(index, object.length))
+ : (type == 'string' && index in object)
+ ) {
+ return eq(object[index], value);
+ }
+ return false;
+ }
+
+ /**
+ * Checks if `value` is a property name and not a property path.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {Object} [object] The object to query keys on.
+ * @returns {boolean} Returns `true` if `value` is a property name, else `false`.
+ */
+ function isKey(value, object) {
+ if (isArray(value)) {
+ return false;
+ }
+ var type = typeof value;
+ if (type == 'number' || type == 'symbol' || type == 'boolean' ||
+ value == null || isSymbol(value)) {
+ return true;
+ }
+ return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
+ (object != null && value in Object(object));
+ }
+
+ /**
+ * Checks if `value` is suitable for use as unique object key.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is suitable, else `false`.
+ */
+ function isKeyable(value) {
+ var type = typeof value;
+ return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
+ ? (value !== '__proto__')
+ : (value === null);
+ }
+
+ /**
+ * Checks if `func` has a lazy counterpart.
+ *
+ * @private
+ * @param {Function} func The function to check.
+ * @returns {boolean} Returns `true` if `func` has a lazy counterpart,
+ * else `false`.
+ */
+ function isLaziable(func) {
+ var funcName = getFuncName(func),
+ other = lodash[funcName];
+
+ if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {
+ return false;
+ }
+ if (func === other) {
+ return true;
+ }
+ var data = getData(other);
+ return !!data && func === data[0];
+ }
+
+ /**
+ * Checks if `func` has its source masked.
+ *
+ * @private
+ * @param {Function} func The function to check.
+ * @returns {boolean} Returns `true` if `func` is masked, else `false`.
+ */
+ function isMasked(func) {
+ return !!maskSrcKey && (maskSrcKey in func);
+ }
+
+ /**
+ * Checks if `func` is capable of being masked.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `func` is maskable, else `false`.
+ */
+ var isMaskable = coreJsData ? isFunction : stubFalse;
+
+ /**
+ * Checks if `value` is likely a prototype object.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
+ */
+ function isPrototype(value) {
+ var Ctor = value && value.constructor,
+ proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;
+
+ return value === proto;
+ }
+
+ /**
+ * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` if suitable for strict
+ * equality comparisons, else `false`.
+ */
+ function isStrictComparable(value) {
+ return value === value && !isObject(value);
+ }
+
+ /**
+ * A specialized version of `matchesProperty` for source values suitable
+ * for strict equality comparisons, i.e. `===`.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @param {*} srcValue The value to match.
+ * @returns {Function} Returns the new spec function.
+ */
+ function matchesStrictComparable(key, srcValue) {
+ return function(object) {
+ if (object == null) {
+ return false;
+ }
+ return object[key] === srcValue &&
+ (srcValue !== undefined || (key in Object(object)));
+ };
+ }
+
+ /**
+ * A specialized version of `_.memoize` which clears the memoized function's
+ * cache when it exceeds `MAX_MEMOIZE_SIZE`.
+ *
+ * @private
+ * @param {Function} func The function to have its output memoized.
+ * @returns {Function} Returns the new memoized function.
+ */
+ function memoizeCapped(func) {
+ var result = memoize(func, function(key) {
+ if (cache.size === MAX_MEMOIZE_SIZE) {
+ cache.clear();
+ }
+ return key;
+ });
+
+ var cache = result.cache;
+ return result;
+ }
+
+ /**
+ * Merges the function metadata of `source` into `data`.
+ *
+ * Merging metadata reduces the number of wrappers used to invoke a function.
+ * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`
+ * may be applied regardless of execution order. Methods like `_.ary` and
+ * `_.rearg` modify function arguments, making the order in which they are
+ * executed important, preventing the merging of metadata. However, we make
+ * an exception for a safe combined case where curried functions have `_.ary`
+ * and or `_.rearg` applied.
+ *
+ * @private
+ * @param {Array} data The destination metadata.
+ * @param {Array} source The source metadata.
+ * @returns {Array} Returns `data`.
+ */
+ function mergeData(data, source) {
+ var bitmask = data[1],
+ srcBitmask = source[1],
+ newBitmask = bitmask | srcBitmask,
+ isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);
+
+ var isCombo =
+ ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||
+ ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||
+ ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));
+
+ // Exit early if metadata can't be merged.
+ if (!(isCommon || isCombo)) {
+ return data;
+ }
+ // Use source `thisArg` if available.
+ if (srcBitmask & WRAP_BIND_FLAG) {
+ data[2] = source[2];
+ // Set when currying a bound function.
+ newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;
+ }
+ // Compose partial arguments.
+ var value = source[3];
+ if (value) {
+ var partials = data[3];
+ data[3] = partials ? composeArgs(partials, value, source[4]) : value;
+ data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];
+ }
+ // Compose partial right arguments.
+ value = source[5];
+ if (value) {
+ partials = data[5];
+ data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;
+ data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];
+ }
+ // Use source `argPos` if available.
+ value = source[7];
+ if (value) {
+ data[7] = value;
+ }
+ // Use source `ary` if it's smaller.
+ if (srcBitmask & WRAP_ARY_FLAG) {
+ data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);
+ }
+ // Use source `arity` if one is not provided.
+ if (data[9] == null) {
+ data[9] = source[9];
+ }
+ // Use source `func` and merge bitmasks.
+ data[0] = source[0];
+ data[1] = newBitmask;
+
+ return data;
+ }
+
+ /**
+ * This function is like
+ * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
+ * except that it includes inherited enumerable properties.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+ function nativeKeysIn(object) {
+ var result = [];
+ if (object != null) {
+ for (var key in Object(object)) {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Converts `value` to a string using `Object.prototype.toString`.
+ *
+ * @private
+ * @param {*} value The value to convert.
+ * @returns {string} Returns the converted string.
+ */
+ function objectToString(value) {
+ return nativeObjectToString.call(value);
+ }
+
+ /**
+ * A specialized version of `baseRest` which transforms the rest array.
+ *
+ * @private
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @param {Function} transform The rest array transform.
+ * @returns {Function} Returns the new function.
+ */
+ function overRest(func, start, transform) {
+ start = nativeMax(start === undefined ? (func.length - 1) : start, 0);
+ return function() {
+ var args = arguments,
+ index = -1,
+ length = nativeMax(args.length - start, 0),
+ array = Array(length);
+
+ while (++index < length) {
+ array[index] = args[start + index];
+ }
+ index = -1;
+ var otherArgs = Array(start + 1);
+ while (++index < start) {
+ otherArgs[index] = args[index];
+ }
+ otherArgs[start] = transform(array);
+ return apply(func, this, otherArgs);
+ };
+ }
+
+ /**
+ * Gets the parent value at `path` of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array} path The path to get the parent value of.
+ * @returns {*} Returns the parent value.
+ */
+ function parent(object, path) {
+ return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));
+ }
+
+ /**
+ * Reorder `array` according to the specified indexes where the element at
+ * the first index is assigned as the first element, the element at
+ * the second index is assigned as the second element, and so on.
+ *
+ * @private
+ * @param {Array} array The array to reorder.
+ * @param {Array} indexes The arranged array indexes.
+ * @returns {Array} Returns `array`.
+ */
+ function reorder(array, indexes) {
+ var arrLength = array.length,
+ length = nativeMin(indexes.length, arrLength),
+ oldArray = copyArray(array);
+
+ while (length--) {
+ var index = indexes[length];
+ array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;
+ }
+ return array;
+ }
+
+ /**
+ * Sets metadata for `func`.
+ *
+ * **Note:** If this function becomes hot, i.e. is invoked a lot in a short
+ * period of time, it will trip its breaker and transition to an identity
+ * function to avoid garbage collection pauses in V8. See
+ * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)
+ * for more details.
+ *
+ * @private
+ * @param {Function} func The function to associate metadata with.
+ * @param {*} data The metadata.
+ * @returns {Function} Returns `func`.
+ */
+ var setData = shortOut(baseSetData);
+
+ /**
+ * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).
+ *
+ * @private
+ * @param {Function} func The function to delay.
+ * @param {number} wait The number of milliseconds to delay invocation.
+ * @returns {number|Object} Returns the timer id or timeout object.
+ */
+ var setTimeout = ctxSetTimeout || function(func, wait) {
+ return root.setTimeout(func, wait);
+ };
+
+ /**
+ * Sets the `toString` method of `func` to return `string`.
+ *
+ * @private
+ * @param {Function} func The function to modify.
+ * @param {Function} string The `toString` result.
+ * @returns {Function} Returns `func`.
+ */
+ var setToString = shortOut(baseSetToString);
+
+ /**
+ * Sets the `toString` method of `wrapper` to mimic the source of `reference`
+ * with wrapper details in a comment at the top of the source body.
+ *
+ * @private
+ * @param {Function} wrapper The function to modify.
+ * @param {Function} reference The reference function.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @returns {Function} Returns `wrapper`.
+ */
+ function setWrapToString(wrapper, reference, bitmask) {
+ var source = (reference + '');
+ return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));
+ }
+
+ /**
+ * Creates a function that'll short out and invoke `identity` instead
+ * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`
+ * milliseconds.
+ *
+ * @private
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new shortable function.
+ */
+ function shortOut(func) {
+ var count = 0,
+ lastCalled = 0;
+
+ return function() {
+ var stamp = nativeNow(),
+ remaining = HOT_SPAN - (stamp - lastCalled);
+
+ lastCalled = stamp;
+ if (remaining > 0) {
+ if (++count >= HOT_COUNT) {
+ return arguments[0];
+ }
+ } else {
+ count = 0;
+ }
+ return func.apply(undefined, arguments);
+ };
+ }
+
+ /**
+ * A specialized version of `_.shuffle` which mutates and sets the size of `array`.
+ *
+ * @private
+ * @param {Array} array The array to shuffle.
+ * @param {number} [size=array.length] The size of `array`.
+ * @returns {Array} Returns `array`.
+ */
+ function shuffleSelf(array, size) {
+ var index = -1,
+ length = array.length,
+ lastIndex = length - 1;
+
+ size = size === undefined ? length : size;
+ while (++index < size) {
+ var rand = baseRandom(index, lastIndex),
+ value = array[rand];
+
+ array[rand] = array[index];
+ array[index] = value;
+ }
+ array.length = size;
+ return array;
+ }
+
+ /**
+ * Converts `string` to a property path array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the property path array.
+ */
+ var stringToPath = memoizeCapped(function(string) {
+ var result = [];
+ if (string.charCodeAt(0) === 46 /* . */) {
+ result.push('');
+ }
+ string.replace(rePropName, function(match, number, quote, subString) {
+ result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));
+ });
+ return result;
+ });
+
+ /**
+ * Converts `value` to a string key if it's not a string or symbol.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @returns {string|symbol} Returns the key.
+ */
+ function toKey(value) {
+ if (typeof value == 'string' || isSymbol(value)) {
+ return value;
+ }
+ var result = (value + '');
+ return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
+ }
+
+ /**
+ * Converts `func` to its source code.
+ *
+ * @private
+ * @param {Function} func The function to convert.
+ * @returns {string} Returns the source code.
+ */
+ function toSource(func) {
+ if (func != null) {
+ try {
+ return funcToString.call(func);
+ } catch (e) {}
+ try {
+ return (func + '');
+ } catch (e) {}
+ }
+ return '';
+ }
+
+ /**
+ * Updates wrapper `details` based on `bitmask` flags.
+ *
+ * @private
+ * @returns {Array} details The details to modify.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @returns {Array} Returns `details`.
+ */
+ function updateWrapDetails(details, bitmask) {
+ arrayEach(wrapFlags, function(pair) {
+ var value = '_.' + pair[0];
+ if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {
+ details.push(value);
+ }
+ });
+ return details.sort();
+ }
+
+ /**
+ * Creates a clone of `wrapper`.
+ *
+ * @private
+ * @param {Object} wrapper The wrapper to clone.
+ * @returns {Object} Returns the cloned wrapper.
+ */
+ function wrapperClone(wrapper) {
+ if (wrapper instanceof LazyWrapper) {
+ return wrapper.clone();
+ }
+ var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);
+ result.__actions__ = copyArray(wrapper.__actions__);
+ result.__index__ = wrapper.__index__;
+ result.__values__ = wrapper.__values__;
+ return result;
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an array of elements split into groups the length of `size`.
+ * If `array` can't be split evenly, the final chunk will be the remaining
+ * elements.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to process.
+ * @param {number} [size=1] The length of each chunk
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the new array of chunks.
+ * @example
+ *
+ * _.chunk(['a', 'b', 'c', 'd'], 2);
+ * // => [['a', 'b'], ['c', 'd']]
+ *
+ * _.chunk(['a', 'b', 'c', 'd'], 3);
+ * // => [['a', 'b', 'c'], ['d']]
+ */
+ function chunk(array, size, guard) {
+ if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {
+ size = 1;
+ } else {
+ size = nativeMax(toInteger(size), 0);
+ }
+ var length = array == null ? 0 : array.length;
+ if (!length || size < 1) {
+ return [];
+ }
+ var index = 0,
+ resIndex = 0,
+ result = Array(nativeCeil(length / size));
+
+ while (index < length) {
+ result[resIndex++] = baseSlice(array, index, (index += size));
+ }
+ return result;
+ }
+
+ /**
+ * Creates an array with all falsey values removed. The values `false`, `null`,
+ * `0`, `""`, `undefined`, and `NaN` are falsey.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to compact.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * _.compact([0, 1, false, 2, '', 3]);
+ * // => [1, 2, 3]
+ */
+ function compact(array) {
+ var index = -1,
+ length = array == null ? 0 : array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index];
+ if (value) {
+ result[resIndex++] = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates a new array concatenating `array` with any additional arrays
+ * and/or values.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to concatenate.
+ * @param {...*} [values] The values to concatenate.
+ * @returns {Array} Returns the new concatenated array.
+ * @example
+ *
+ * var array = [1];
+ * var other = _.concat(array, 2, [3], [[4]]);
+ *
+ * console.log(other);
+ * // => [1, 2, 3, [4]]
+ *
+ * console.log(array);
+ * // => [1]
+ */
+ function concat() {
+ var length = arguments.length;
+ if (!length) {
+ return [];
+ }
+ var args = Array(length - 1),
+ array = arguments[0],
+ index = length;
+
+ while (index--) {
+ args[index - 1] = arguments[index];
+ }
+ return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));
+ }
+
+ /**
+ * Creates an array of `array` values not included in the other given arrays
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons. The order and references of result values are
+ * determined by the first array.
+ *
+ * **Note:** Unlike `_.pullAll`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...Array} [values] The values to exclude.
+ * @returns {Array} Returns the new array of filtered values.
+ * @see _.without, _.xor
+ * @example
+ *
+ * _.difference([2, 1], [2, 3]);
+ * // => [1]
+ */
+ var difference = baseRest(function(array, values) {
+ return isArrayLikeObject(array)
+ ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))
+ : [];
+ });
+
+ /**
+ * This method is like `_.difference` except that it accepts `iteratee` which
+ * is invoked for each element of `array` and `values` to generate the criterion
+ * by which they're compared. The order and references of result values are
+ * determined by the first array. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * **Note:** Unlike `_.pullAllBy`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...Array} [values] The values to exclude.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);
+ * // => [1.2]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');
+ * // => [{ 'x': 2 }]
+ */
+ var differenceBy = baseRest(function(array, values) {
+ var iteratee = last(values);
+ if (isArrayLikeObject(iteratee)) {
+ iteratee = undefined;
+ }
+ return isArrayLikeObject(array)
+ ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))
+ : [];
+ });
+
+ /**
+ * This method is like `_.difference` except that it accepts `comparator`
+ * which is invoked to compare elements of `array` to `values`. The order and
+ * references of result values are determined by the first array. The comparator
+ * is invoked with two arguments: (arrVal, othVal).
+ *
+ * **Note:** Unlike `_.pullAllWith`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...Array} [values] The values to exclude.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ *
+ * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);
+ * // => [{ 'x': 2, 'y': 1 }]
+ */
+ var differenceWith = baseRest(function(array, values) {
+ var comparator = last(values);
+ if (isArrayLikeObject(comparator)) {
+ comparator = undefined;
+ }
+ return isArrayLikeObject(array)
+ ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)
+ : [];
+ });
+
+ /**
+ * Creates a slice of `array` with `n` elements dropped from the beginning.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.5.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to drop.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.drop([1, 2, 3]);
+ * // => [2, 3]
+ *
+ * _.drop([1, 2, 3], 2);
+ * // => [3]
+ *
+ * _.drop([1, 2, 3], 5);
+ * // => []
+ *
+ * _.drop([1, 2, 3], 0);
+ * // => [1, 2, 3]
+ */
+ function drop(array, n, guard) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ return baseSlice(array, n < 0 ? 0 : n, length);
+ }
+
+ /**
+ * Creates a slice of `array` with `n` elements dropped from the end.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to drop.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.dropRight([1, 2, 3]);
+ * // => [1, 2]
+ *
+ * _.dropRight([1, 2, 3], 2);
+ * // => [1]
+ *
+ * _.dropRight([1, 2, 3], 5);
+ * // => []
+ *
+ * _.dropRight([1, 2, 3], 0);
+ * // => [1, 2, 3]
+ */
+ function dropRight(array, n, guard) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ n = length - n;
+ return baseSlice(array, 0, n < 0 ? 0 : n);
+ }
+
+ /**
+ * Creates a slice of `array` excluding elements dropped from the end.
+ * Elements are dropped until `predicate` returns falsey. The predicate is
+ * invoked with three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': false }
+ * ];
+ *
+ * _.dropRightWhile(users, function(o) { return !o.active; });
+ * // => objects for ['barney']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });
+ * // => objects for ['barney', 'fred']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.dropRightWhile(users, ['active', false]);
+ * // => objects for ['barney']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.dropRightWhile(users, 'active');
+ * // => objects for ['barney', 'fred', 'pebbles']
+ */
+ function dropRightWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3), true, true)
+ : [];
+ }
+
+ /**
+ * Creates a slice of `array` excluding elements dropped from the beginning.
+ * Elements are dropped until `predicate` returns falsey. The predicate is
+ * invoked with three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': false },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': true }
+ * ];
+ *
+ * _.dropWhile(users, function(o) { return !o.active; });
+ * // => objects for ['pebbles']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.dropWhile(users, { 'user': 'barney', 'active': false });
+ * // => objects for ['fred', 'pebbles']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.dropWhile(users, ['active', false]);
+ * // => objects for ['pebbles']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.dropWhile(users, 'active');
+ * // => objects for ['barney', 'fred', 'pebbles']
+ */
+ function dropWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3), true)
+ : [];
+ }
+
+ /**
+ * Fills elements of `array` with `value` from `start` up to, but not
+ * including, `end`.
+ *
+ * **Note:** This method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.2.0
+ * @category Array
+ * @param {Array} array The array to fill.
+ * @param {*} value The value to fill `array` with.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [1, 2, 3];
+ *
+ * _.fill(array, 'a');
+ * console.log(array);
+ * // => ['a', 'a', 'a']
+ *
+ * _.fill(Array(3), 2);
+ * // => [2, 2, 2]
+ *
+ * _.fill([4, 6, 8, 10], '*', 1, 3);
+ * // => [4, '*', '*', 10]
+ */
+ function fill(array, value, start, end) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {
+ start = 0;
+ end = length;
+ }
+ return baseFill(array, value, start, end);
+ }
+
+ /**
+ * This method is like `_.find` except that it returns the index of the first
+ * element `predicate` returns truthy for instead of the element itself.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @returns {number} Returns the index of the found element, else `-1`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': false },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': true }
+ * ];
+ *
+ * _.findIndex(users, function(o) { return o.user == 'barney'; });
+ * // => 0
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findIndex(users, { 'user': 'fred', 'active': false });
+ * // => 1
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findIndex(users, ['active', false]);
+ * // => 0
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findIndex(users, 'active');
+ * // => 2
+ */
+ function findIndex(array, predicate, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = fromIndex == null ? 0 : toInteger(fromIndex);
+ if (index < 0) {
+ index = nativeMax(length + index, 0);
+ }
+ return baseFindIndex(array, getIteratee(predicate, 3), index);
+ }
+
+ /**
+ * This method is like `_.findIndex` except that it iterates over elements
+ * of `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=array.length-1] The index to search from.
+ * @returns {number} Returns the index of the found element, else `-1`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': false }
+ * ];
+ *
+ * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });
+ * // => 2
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findLastIndex(users, { 'user': 'barney', 'active': true });
+ * // => 0
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findLastIndex(users, ['active', false]);
+ * // => 2
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findLastIndex(users, 'active');
+ * // => 0
+ */
+ function findLastIndex(array, predicate, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = length - 1;
+ if (fromIndex !== undefined) {
+ index = toInteger(fromIndex);
+ index = fromIndex < 0
+ ? nativeMax(length + index, 0)
+ : nativeMin(index, length - 1);
+ }
+ return baseFindIndex(array, getIteratee(predicate, 3), index, true);
+ }
+
+ /**
+ * Flattens `array` a single level deep.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to flatten.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * _.flatten([1, [2, [3, [4]], 5]]);
+ * // => [1, 2, [3, [4]], 5]
+ */
+ function flatten(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseFlatten(array, 1) : [];
+ }
+
+ /**
+ * Recursively flattens `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to flatten.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * _.flattenDeep([1, [2, [3, [4]], 5]]);
+ * // => [1, 2, 3, 4, 5]
+ */
+ function flattenDeep(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseFlatten(array, INFINITY) : [];
+ }
+
+ /**
+ * Recursively flatten `array` up to `depth` times.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.4.0
+ * @category Array
+ * @param {Array} array The array to flatten.
+ * @param {number} [depth=1] The maximum recursion depth.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * var array = [1, [2, [3, [4]], 5]];
+ *
+ * _.flattenDepth(array, 1);
+ * // => [1, 2, [3, [4]], 5]
+ *
+ * _.flattenDepth(array, 2);
+ * // => [1, 2, 3, [4], 5]
+ */
+ function flattenDepth(array, depth) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ depth = depth === undefined ? 1 : toInteger(depth);
+ return baseFlatten(array, depth);
+ }
+
+ /**
+ * The inverse of `_.toPairs`; this method returns an object composed
+ * from key-value `pairs`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} pairs The key-value pairs.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * _.fromPairs([['a', 1], ['b', 2]]);
+ * // => { 'a': 1, 'b': 2 }
+ */
+ function fromPairs(pairs) {
+ var index = -1,
+ length = pairs == null ? 0 : pairs.length,
+ result = {};
+
+ while (++index < length) {
+ var pair = pairs[index];
+ result[pair[0]] = pair[1];
+ }
+ return result;
+ }
+
+ /**
+ * Gets the first element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @alias first
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {*} Returns the first element of `array`.
+ * @example
+ *
+ * _.head([1, 2, 3]);
+ * // => 1
+ *
+ * _.head([]);
+ * // => undefined
+ */
+ function head(array) {
+ return (array && array.length) ? array[0] : undefined;
+ }
+
+ /**
+ * Gets the index at which the first occurrence of `value` is found in `array`
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons. If `fromIndex` is negative, it's used as the
+ * offset from the end of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.indexOf([1, 2, 1, 2], 2);
+ * // => 1
+ *
+ * // Search from the `fromIndex`.
+ * _.indexOf([1, 2, 1, 2], 2, 2);
+ * // => 3
+ */
+ function indexOf(array, value, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = fromIndex == null ? 0 : toInteger(fromIndex);
+ if (index < 0) {
+ index = nativeMax(length + index, 0);
+ }
+ return baseIndexOf(array, value, index);
+ }
+
+ /**
+ * Gets all but the last element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.initial([1, 2, 3]);
+ * // => [1, 2]
+ */
+ function initial(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseSlice(array, 0, -1) : [];
+ }
+
+ /**
+ * Creates an array of unique values that are included in all given arrays
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons. The order and references of result values are
+ * determined by the first array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @returns {Array} Returns the new array of intersecting values.
+ * @example
+ *
+ * _.intersection([2, 1], [2, 3]);
+ * // => [2]
+ */
+ var intersection = baseRest(function(arrays) {
+ var mapped = arrayMap(arrays, castArrayLikeObject);
+ return (mapped.length && mapped[0] === arrays[0])
+ ? baseIntersection(mapped)
+ : [];
+ });
+
+ /**
+ * This method is like `_.intersection` except that it accepts `iteratee`
+ * which is invoked for each element of each `arrays` to generate the criterion
+ * by which they're compared. The order and references of result values are
+ * determined by the first array. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of intersecting values.
+ * @example
+ *
+ * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);
+ * // => [2.1]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 1 }]
+ */
+ var intersectionBy = baseRest(function(arrays) {
+ var iteratee = last(arrays),
+ mapped = arrayMap(arrays, castArrayLikeObject);
+
+ if (iteratee === last(mapped)) {
+ iteratee = undefined;
+ } else {
+ mapped.pop();
+ }
+ return (mapped.length && mapped[0] === arrays[0])
+ ? baseIntersection(mapped, getIteratee(iteratee, 2))
+ : [];
+ });
+
+ /**
+ * This method is like `_.intersection` except that it accepts `comparator`
+ * which is invoked to compare elements of `arrays`. The order and references
+ * of result values are determined by the first array. The comparator is
+ * invoked with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of intersecting values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.intersectionWith(objects, others, _.isEqual);
+ * // => [{ 'x': 1, 'y': 2 }]
+ */
+ var intersectionWith = baseRest(function(arrays) {
+ var comparator = last(arrays),
+ mapped = arrayMap(arrays, castArrayLikeObject);
+
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ if (comparator) {
+ mapped.pop();
+ }
+ return (mapped.length && mapped[0] === arrays[0])
+ ? baseIntersection(mapped, undefined, comparator)
+ : [];
+ });
+
+ /**
+ * Converts all elements in `array` into a string separated by `separator`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to convert.
+ * @param {string} [separator=','] The element separator.
+ * @returns {string} Returns the joined string.
+ * @example
+ *
+ * _.join(['a', 'b', 'c'], '~');
+ * // => 'a~b~c'
+ */
+ function join(array, separator) {
+ return array == null ? '' : nativeJoin.call(array, separator);
+ }
+
+ /**
+ * Gets the last element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {*} Returns the last element of `array`.
+ * @example
+ *
+ * _.last([1, 2, 3]);
+ * // => 3
+ */
+ function last(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? array[length - 1] : undefined;
+ }
+
+ /**
+ * This method is like `_.indexOf` except that it iterates over elements of
+ * `array` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} [fromIndex=array.length-1] The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.lastIndexOf([1, 2, 1, 2], 2);
+ * // => 3
+ *
+ * // Search from the `fromIndex`.
+ * _.lastIndexOf([1, 2, 1, 2], 2, 2);
+ * // => 1
+ */
+ function lastIndexOf(array, value, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = length;
+ if (fromIndex !== undefined) {
+ index = toInteger(fromIndex);
+ index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);
+ }
+ return value === value
+ ? strictLastIndexOf(array, value, index)
+ : baseFindIndex(array, baseIsNaN, index, true);
+ }
+
+ /**
+ * Gets the element at index `n` of `array`. If `n` is negative, the nth
+ * element from the end is returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.11.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=0] The index of the element to return.
+ * @returns {*} Returns the nth element of `array`.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'd'];
+ *
+ * _.nth(array, 1);
+ * // => 'b'
+ *
+ * _.nth(array, -2);
+ * // => 'c';
+ */
+ function nth(array, n) {
+ return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;
+ }
+
+ /**
+ * Removes all given values from `array` using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`
+ * to remove elements from an array by predicate.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {...*} [values] The values to remove.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'a', 'b', 'c'];
+ *
+ * _.pull(array, 'a', 'c');
+ * console.log(array);
+ * // => ['b', 'b']
+ */
+ var pull = baseRest(pullAll);
+
+ /**
+ * This method is like `_.pull` except that it accepts an array of values to remove.
+ *
+ * **Note:** Unlike `_.difference`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'a', 'b', 'c'];
+ *
+ * _.pullAll(array, ['a', 'c']);
+ * console.log(array);
+ * // => ['b', 'b']
+ */
+ function pullAll(array, values) {
+ return (array && array.length && values && values.length)
+ ? basePullAll(array, values)
+ : array;
+ }
+
+ /**
+ * This method is like `_.pullAll` except that it accepts `iteratee` which is
+ * invoked for each element of `array` and `values` to generate the criterion
+ * by which they're compared. The iteratee is invoked with one argument: (value).
+ *
+ * **Note:** Unlike `_.differenceBy`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];
+ *
+ * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');
+ * console.log(array);
+ * // => [{ 'x': 2 }]
+ */
+ function pullAllBy(array, values, iteratee) {
+ return (array && array.length && values && values.length)
+ ? basePullAll(array, values, getIteratee(iteratee, 2))
+ : array;
+ }
+
+ /**
+ * This method is like `_.pullAll` except that it accepts `comparator` which
+ * is invoked to compare elements of `array` to `values`. The comparator is
+ * invoked with two arguments: (arrVal, othVal).
+ *
+ * **Note:** Unlike `_.differenceWith`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.6.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];
+ *
+ * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);
+ * console.log(array);
+ * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]
+ */
+ function pullAllWith(array, values, comparator) {
+ return (array && array.length && values && values.length)
+ ? basePullAll(array, values, undefined, comparator)
+ : array;
+ }
+
+ /**
+ * Removes elements from `array` corresponding to `indexes` and returns an
+ * array of removed elements.
+ *
+ * **Note:** Unlike `_.at`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {...(number|number[])} [indexes] The indexes of elements to remove.
+ * @returns {Array} Returns the new array of removed elements.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'd'];
+ * var pulled = _.pullAt(array, [1, 3]);
+ *
+ * console.log(array);
+ * // => ['a', 'c']
+ *
+ * console.log(pulled);
+ * // => ['b', 'd']
+ */
+ var pullAt = flatRest(function(array, indexes) {
+ var length = array == null ? 0 : array.length,
+ result = baseAt(array, indexes);
+
+ basePullAt(array, arrayMap(indexes, function(index) {
+ return isIndex(index, length) ? +index : index;
+ }).sort(compareAscending));
+
+ return result;
+ });
+
+ /**
+ * Removes all elements from `array` that `predicate` returns truthy for
+ * and returns an array of the removed elements. The predicate is invoked
+ * with three arguments: (value, index, array).
+ *
+ * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`
+ * to pull elements from an array by value.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new array of removed elements.
+ * @example
+ *
+ * var array = [1, 2, 3, 4];
+ * var evens = _.remove(array, function(n) {
+ * return n % 2 == 0;
+ * });
+ *
+ * console.log(array);
+ * // => [1, 3]
+ *
+ * console.log(evens);
+ * // => [2, 4]
+ */
+ function remove(array, predicate) {
+ var result = [];
+ if (!(array && array.length)) {
+ return result;
+ }
+ var index = -1,
+ indexes = [],
+ length = array.length;
+
+ predicate = getIteratee(predicate, 3);
+ while (++index < length) {
+ var value = array[index];
+ if (predicate(value, index, array)) {
+ result.push(value);
+ indexes.push(index);
+ }
+ }
+ basePullAt(array, indexes);
+ return result;
+ }
+
+ /**
+ * Reverses `array` so that the first element becomes the last, the second
+ * element becomes the second to last, and so on.
+ *
+ * **Note:** This method mutates `array` and is based on
+ * [`Array#reverse`](https://mdn.io/Array/reverse).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [1, 2, 3];
+ *
+ * _.reverse(array);
+ * // => [3, 2, 1]
+ *
+ * console.log(array);
+ * // => [3, 2, 1]
+ */
+ function reverse(array) {
+ return array == null ? array : nativeReverse.call(array);
+ }
+
+ /**
+ * Creates a slice of `array` from `start` up to, but not including, `end`.
+ *
+ * **Note:** This method is used instead of
+ * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are
+ * returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to slice.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns the slice of `array`.
+ */
+ function slice(array, start, end) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {
+ start = 0;
+ end = length;
+ }
+ else {
+ start = start == null ? 0 : toInteger(start);
+ end = end === undefined ? length : toInteger(end);
+ }
+ return baseSlice(array, start, end);
+ }
+
+ /**
+ * Uses a binary search to determine the lowest index at which `value`
+ * should be inserted into `array` in order to maintain its sort order.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * _.sortedIndex([30, 50], 40);
+ * // => 1
+ */
+ function sortedIndex(array, value) {
+ return baseSortedIndex(array, value);
+ }
+
+ /**
+ * This method is like `_.sortedIndex` except that it accepts `iteratee`
+ * which is invoked for `value` and each element of `array` to compute their
+ * sort ranking. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * var objects = [{ 'x': 4 }, { 'x': 5 }];
+ *
+ * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
+ * // => 0
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.sortedIndexBy(objects, { 'x': 4 }, 'x');
+ * // => 0
+ */
+ function sortedIndexBy(array, value, iteratee) {
+ return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));
+ }
+
+ /**
+ * This method is like `_.indexOf` except that it performs a binary
+ * search on a sorted `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.sortedIndexOf([4, 5, 5, 5, 6], 5);
+ * // => 1
+ */
+ function sortedIndexOf(array, value) {
+ var length = array == null ? 0 : array.length;
+ if (length) {
+ var index = baseSortedIndex(array, value);
+ if (index < length && eq(array[index], value)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * This method is like `_.sortedIndex` except that it returns the highest
+ * index at which `value` should be inserted into `array` in order to
+ * maintain its sort order.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * _.sortedLastIndex([4, 5, 5, 5, 6], 5);
+ * // => 4
+ */
+ function sortedLastIndex(array, value) {
+ return baseSortedIndex(array, value, true);
+ }
+
+ /**
+ * This method is like `_.sortedLastIndex` except that it accepts `iteratee`
+ * which is invoked for `value` and each element of `array` to compute their
+ * sort ranking. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * var objects = [{ 'x': 4 }, { 'x': 5 }];
+ *
+ * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
+ * // => 1
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');
+ * // => 1
+ */
+ function sortedLastIndexBy(array, value, iteratee) {
+ return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);
+ }
+
+ /**
+ * This method is like `_.lastIndexOf` except that it performs a binary
+ * search on a sorted `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);
+ * // => 3
+ */
+ function sortedLastIndexOf(array, value) {
+ var length = array == null ? 0 : array.length;
+ if (length) {
+ var index = baseSortedIndex(array, value, true) - 1;
+ if (eq(array[index], value)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * This method is like `_.uniq` except that it's designed and optimized
+ * for sorted arrays.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.sortedUniq([1, 1, 2]);
+ * // => [1, 2]
+ */
+ function sortedUniq(array) {
+ return (array && array.length)
+ ? baseSortedUniq(array)
+ : [];
+ }
+
+ /**
+ * This method is like `_.uniqBy` except that it's designed and optimized
+ * for sorted arrays.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);
+ * // => [1.1, 2.3]
+ */
+ function sortedUniqBy(array, iteratee) {
+ return (array && array.length)
+ ? baseSortedUniq(array, getIteratee(iteratee, 2))
+ : [];
+ }
+
+ /**
+ * Gets all but the first element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.tail([1, 2, 3]);
+ * // => [2, 3]
+ */
+ function tail(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseSlice(array, 1, length) : [];
+ }
+
+ /**
+ * Creates a slice of `array` with `n` elements taken from the beginning.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to take.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.take([1, 2, 3]);
+ * // => [1]
+ *
+ * _.take([1, 2, 3], 2);
+ * // => [1, 2]
+ *
+ * _.take([1, 2, 3], 5);
+ * // => [1, 2, 3]
+ *
+ * _.take([1, 2, 3], 0);
+ * // => []
+ */
+ function take(array, n, guard) {
+ if (!(array && array.length)) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ return baseSlice(array, 0, n < 0 ? 0 : n);
+ }
+
+ /**
+ * Creates a slice of `array` with `n` elements taken from the end.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to take.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.takeRight([1, 2, 3]);
+ * // => [3]
+ *
+ * _.takeRight([1, 2, 3], 2);
+ * // => [2, 3]
+ *
+ * _.takeRight([1, 2, 3], 5);
+ * // => [1, 2, 3]
+ *
+ * _.takeRight([1, 2, 3], 0);
+ * // => []
+ */
+ function takeRight(array, n, guard) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ n = length - n;
+ return baseSlice(array, n < 0 ? 0 : n, length);
+ }
+
+ /**
+ * Creates a slice of `array` with elements taken from the end. Elements are
+ * taken until `predicate` returns falsey. The predicate is invoked with
+ * three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': false }
+ * ];
+ *
+ * _.takeRightWhile(users, function(o) { return !o.active; });
+ * // => objects for ['fred', 'pebbles']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });
+ * // => objects for ['pebbles']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.takeRightWhile(users, ['active', false]);
+ * // => objects for ['fred', 'pebbles']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.takeRightWhile(users, 'active');
+ * // => []
+ */
+ function takeRightWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3), false, true)
+ : [];
+ }
+
+ /**
+ * Creates a slice of `array` with elements taken from the beginning. Elements
+ * are taken until `predicate` returns falsey. The predicate is invoked with
+ * three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': false },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': true }
+ * ];
+ *
+ * _.takeWhile(users, function(o) { return !o.active; });
+ * // => objects for ['barney', 'fred']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.takeWhile(users, { 'user': 'barney', 'active': false });
+ * // => objects for ['barney']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.takeWhile(users, ['active', false]);
+ * // => objects for ['barney', 'fred']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.takeWhile(users, 'active');
+ * // => []
+ */
+ function takeWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3))
+ : [];
+ }
+
+ /**
+ * Creates an array of unique values, in order, from all given arrays using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @returns {Array} Returns the new array of combined values.
+ * @example
+ *
+ * _.union([2], [1, 2]);
+ * // => [2, 1]
+ */
+ var union = baseRest(function(arrays) {
+ return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));
+ });
+
+ /**
+ * This method is like `_.union` except that it accepts `iteratee` which is
+ * invoked for each element of each `arrays` to generate the criterion by
+ * which uniqueness is computed. Result values are chosen from the first
+ * array in which the value occurs. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of combined values.
+ * @example
+ *
+ * _.unionBy([2.1], [1.2, 2.3], Math.floor);
+ * // => [2.1, 1.2]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 1 }, { 'x': 2 }]
+ */
+ var unionBy = baseRest(function(arrays) {
+ var iteratee = last(arrays);
+ if (isArrayLikeObject(iteratee)) {
+ iteratee = undefined;
+ }
+ return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));
+ });
+
+ /**
+ * This method is like `_.union` except that it accepts `comparator` which
+ * is invoked to compare elements of `arrays`. Result values are chosen from
+ * the first array in which the value occurs. The comparator is invoked
+ * with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of combined values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.unionWith(objects, others, _.isEqual);
+ * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
+ */
+ var unionWith = baseRest(function(arrays) {
+ var comparator = last(arrays);
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);
+ });
+
+ /**
+ * Creates a duplicate-free version of an array, using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons, in which only the first occurrence of each element
+ * is kept. The order of result values is determined by the order they occur
+ * in the array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.uniq([2, 1, 2]);
+ * // => [2, 1]
+ */
+ function uniq(array) {
+ return (array && array.length) ? baseUniq(array) : [];
+ }
+
+ /**
+ * This method is like `_.uniq` except that it accepts `iteratee` which is
+ * invoked for each element in `array` to generate the criterion by which
+ * uniqueness is computed. The order of result values is determined by the
+ * order they occur in the array. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.uniqBy([2.1, 1.2, 2.3], Math.floor);
+ * // => [2.1, 1.2]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 1 }, { 'x': 2 }]
+ */
+ function uniqBy(array, iteratee) {
+ return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];
+ }
+
+ /**
+ * This method is like `_.uniq` except that it accepts `comparator` which
+ * is invoked to compare elements of `array`. The order of result values is
+ * determined by the order they occur in the array.The comparator is invoked
+ * with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.uniqWith(objects, _.isEqual);
+ * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]
+ */
+ function uniqWith(array, comparator) {
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ return (array && array.length) ? baseUniq(array, undefined, comparator) : [];
+ }
+
+ /**
+ * This method is like `_.zip` except that it accepts an array of grouped
+ * elements and creates an array regrouping the elements to their pre-zip
+ * configuration.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.2.0
+ * @category Array
+ * @param {Array} array The array of grouped elements to process.
+ * @returns {Array} Returns the new array of regrouped elements.
+ * @example
+ *
+ * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);
+ * // => [['a', 1, true], ['b', 2, false]]
+ *
+ * _.unzip(zipped);
+ * // => [['a', 'b'], [1, 2], [true, false]]
+ */
+ function unzip(array) {
+ if (!(array && array.length)) {
+ return [];
+ }
+ var length = 0;
+ array = arrayFilter(array, function(group) {
+ if (isArrayLikeObject(group)) {
+ length = nativeMax(group.length, length);
+ return true;
+ }
+ });
+ return baseTimes(length, function(index) {
+ return arrayMap(array, baseProperty(index));
+ });
+ }
+
+ /**
+ * This method is like `_.unzip` except that it accepts `iteratee` to specify
+ * how regrouped values should be combined. The iteratee is invoked with the
+ * elements of each group: (...group).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.8.0
+ * @category Array
+ * @param {Array} array The array of grouped elements to process.
+ * @param {Function} [iteratee=_.identity] The function to combine
+ * regrouped values.
+ * @returns {Array} Returns the new array of regrouped elements.
+ * @example
+ *
+ * var zipped = _.zip([1, 2], [10, 20], [100, 200]);
+ * // => [[1, 10, 100], [2, 20, 200]]
+ *
+ * _.unzipWith(zipped, _.add);
+ * // => [3, 30, 300]
+ */
+ function unzipWith(array, iteratee) {
+ if (!(array && array.length)) {
+ return [];
+ }
+ var result = unzip(array);
+ if (iteratee == null) {
+ return result;
+ }
+ return arrayMap(result, function(group) {
+ return apply(iteratee, undefined, group);
+ });
+ }
+
+ /**
+ * Creates an array excluding all given values using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * **Note:** Unlike `_.pull`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...*} [values] The values to exclude.
+ * @returns {Array} Returns the new array of filtered values.
+ * @see _.difference, _.xor
+ * @example
+ *
+ * _.without([2, 1, 2, 3], 1, 2);
+ * // => [3]
+ */
+ var without = baseRest(function(array, values) {
+ return isArrayLikeObject(array)
+ ? baseDifference(array, values)
+ : [];
+ });
+
+ /**
+ * Creates an array of unique values that is the
+ * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)
+ * of the given arrays. The order of result values is determined by the order
+ * they occur in the arrays.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @returns {Array} Returns the new array of filtered values.
+ * @see _.difference, _.without
+ * @example
+ *
+ * _.xor([2, 1], [2, 3]);
+ * // => [1, 3]
+ */
+ var xor = baseRest(function(arrays) {
+ return baseXor(arrayFilter(arrays, isArrayLikeObject));
+ });
+
+ /**
+ * This method is like `_.xor` except that it accepts `iteratee` which is
+ * invoked for each element of each `arrays` to generate the criterion by
+ * which by which they're compared. The order of result values is determined
+ * by the order they occur in the arrays. The iteratee is invoked with one
+ * argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);
+ * // => [1.2, 3.4]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 2 }]
+ */
+ var xorBy = baseRest(function(arrays) {
+ var iteratee = last(arrays);
+ if (isArrayLikeObject(iteratee)) {
+ iteratee = undefined;
+ }
+ return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));
+ });
+
+ /**
+ * This method is like `_.xor` except that it accepts `comparator` which is
+ * invoked to compare elements of `arrays`. The order of result values is
+ * determined by the order they occur in the arrays. The comparator is invoked
+ * with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.xorWith(objects, others, _.isEqual);
+ * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
+ */
+ var xorWith = baseRest(function(arrays) {
+ var comparator = last(arrays);
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);
+ });
+
+ /**
+ * Creates an array of grouped elements, the first of which contains the
+ * first elements of the given arrays, the second of which contains the
+ * second elements of the given arrays, and so on.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to process.
+ * @returns {Array} Returns the new array of grouped elements.
+ * @example
+ *
+ * _.zip(['a', 'b'], [1, 2], [true, false]);
+ * // => [['a', 1, true], ['b', 2, false]]
+ */
+ var zip = baseRest(unzip);
+
+ /**
+ * This method is like `_.fromPairs` except that it accepts two arrays,
+ * one of property identifiers and one of corresponding values.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.4.0
+ * @category Array
+ * @param {Array} [props=[]] The property identifiers.
+ * @param {Array} [values=[]] The property values.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * _.zipObject(['a', 'b'], [1, 2]);
+ * // => { 'a': 1, 'b': 2 }
+ */
+ function zipObject(props, values) {
+ return baseZipObject(props || [], values || [], assignValue);
+ }
+
+ /**
+ * This method is like `_.zipObject` except that it supports property paths.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.1.0
+ * @category Array
+ * @param {Array} [props=[]] The property identifiers.
+ * @param {Array} [values=[]] The property values.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);
+ * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }
+ */
+ function zipObjectDeep(props, values) {
+ return baseZipObject(props || [], values || [], baseSet);
+ }
+
+ /**
+ * This method is like `_.zip` except that it accepts `iteratee` to specify
+ * how grouped values should be combined. The iteratee is invoked with the
+ * elements of each group: (...group).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.8.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to process.
+ * @param {Function} [iteratee=_.identity] The function to combine
+ * grouped values.
+ * @returns {Array} Returns the new array of grouped elements.
+ * @example
+ *
+ * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {
+ * return a + b + c;
+ * });
+ * // => [111, 222]
+ */
+ var zipWith = baseRest(function(arrays) {
+ var length = arrays.length,
+ iteratee = length > 1 ? arrays[length - 1] : undefined;
+
+ iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;
+ return unzipWith(arrays, iteratee);
+ });
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a `lodash` wrapper instance that wraps `value` with explicit method
+ * chain sequences enabled. The result of such sequences must be unwrapped
+ * with `_#value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.3.0
+ * @category Seq
+ * @param {*} value The value to wrap.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36 },
+ * { 'user': 'fred', 'age': 40 },
+ * { 'user': 'pebbles', 'age': 1 }
+ * ];
+ *
+ * var youngest = _
+ * .chain(users)
+ * .sortBy('age')
+ * .map(function(o) {
+ * return o.user + ' is ' + o.age;
+ * })
+ * .head()
+ * .value();
+ * // => 'pebbles is 1'
+ */
+ function chain(value) {
+ var result = lodash(value);
+ result.__chain__ = true;
+ return result;
+ }
+
+ /**
+ * This method invokes `interceptor` and returns `value`. The interceptor
+ * is invoked with one argument; (value). The purpose of this method is to
+ * "tap into" a method chain sequence in order to modify intermediate results.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Seq
+ * @param {*} value The value to provide to `interceptor`.
+ * @param {Function} interceptor The function to invoke.
+ * @returns {*} Returns `value`.
+ * @example
+ *
+ * _([1, 2, 3])
+ * .tap(function(array) {
+ * // Mutate input array.
+ * array.pop();
+ * })
+ * .reverse()
+ * .value();
+ * // => [2, 1]
+ */
+ function tap(value, interceptor) {
+ interceptor(value);
+ return value;
+ }
+
+ /**
+ * This method is like `_.tap` except that it returns the result of `interceptor`.
+ * The purpose of this method is to "pass thru" values replacing intermediate
+ * results in a method chain sequence.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Seq
+ * @param {*} value The value to provide to `interceptor`.
+ * @param {Function} interceptor The function to invoke.
+ * @returns {*} Returns the result of `interceptor`.
+ * @example
+ *
+ * _(' abc ')
+ * .chain()
+ * .trim()
+ * .thru(function(value) {
+ * return [value];
+ * })
+ * .value();
+ * // => ['abc']
+ */
+ function thru(value, interceptor) {
+ return interceptor(value);
+ }
+
+ /**
+ * This method is the wrapper version of `_.at`.
+ *
+ * @name at
+ * @memberOf _
+ * @since 1.0.0
+ * @category Seq
+ * @param {...(string|string[])} [paths] The property paths to pick.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
+ *
+ * _(object).at(['a[0].b.c', 'a[1]']).value();
+ * // => [3, 4]
+ */
+ var wrapperAt = flatRest(function(paths) {
+ var length = paths.length,
+ start = length ? paths[0] : 0,
+ value = this.__wrapped__,
+ interceptor = function(object) { return baseAt(object, paths); };
+
+ if (length > 1 || this.__actions__.length ||
+ !(value instanceof LazyWrapper) || !isIndex(start)) {
+ return this.thru(interceptor);
+ }
+ value = value.slice(start, +start + (length ? 1 : 0));
+ value.__actions__.push({
+ 'func': thru,
+ 'args': [interceptor],
+ 'thisArg': undefined
+ });
+ return new LodashWrapper(value, this.__chain__).thru(function(array) {
+ if (length && !array.length) {
+ array.push(undefined);
+ }
+ return array;
+ });
+ });
+
+ /**
+ * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.
+ *
+ * @name chain
+ * @memberOf _
+ * @since 0.1.0
+ * @category Seq
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36 },
+ * { 'user': 'fred', 'age': 40 }
+ * ];
+ *
+ * // A sequence without explicit chaining.
+ * _(users).head();
+ * // => { 'user': 'barney', 'age': 36 }
+ *
+ * // A sequence with explicit chaining.
+ * _(users)
+ * .chain()
+ * .head()
+ * .pick('user')
+ * .value();
+ * // => { 'user': 'barney' }
+ */
+ function wrapperChain() {
+ return chain(this);
+ }
+
+ /**
+ * Executes the chain sequence and returns the wrapped result.
+ *
+ * @name commit
+ * @memberOf _
+ * @since 3.2.0
+ * @category Seq
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var array = [1, 2];
+ * var wrapped = _(array).push(3);
+ *
+ * console.log(array);
+ * // => [1, 2]
+ *
+ * wrapped = wrapped.commit();
+ * console.log(array);
+ * // => [1, 2, 3]
+ *
+ * wrapped.last();
+ * // => 3
+ *
+ * console.log(array);
+ * // => [1, 2, 3]
+ */
+ function wrapperCommit() {
+ return new LodashWrapper(this.value(), this.__chain__);
+ }
+
+ /**
+ * Gets the next value on a wrapped object following the
+ * [iterator protocol](https://mdn.io/iteration_protocols#iterator).
+ *
+ * @name next
+ * @memberOf _
+ * @since 4.0.0
+ * @category Seq
+ * @returns {Object} Returns the next iterator value.
+ * @example
+ *
+ * var wrapped = _([1, 2]);
+ *
+ * wrapped.next();
+ * // => { 'done': false, 'value': 1 }
+ *
+ * wrapped.next();
+ * // => { 'done': false, 'value': 2 }
+ *
+ * wrapped.next();
+ * // => { 'done': true, 'value': undefined }
+ */
+ function wrapperNext() {
+ if (this.__values__ === undefined) {
+ this.__values__ = toArray(this.value());
+ }
+ var done = this.__index__ >= this.__values__.length,
+ value = done ? undefined : this.__values__[this.__index__++];
+
+ return { 'done': done, 'value': value };
+ }
+
+ /**
+ * Enables the wrapper to be iterable.
+ *
+ * @name Symbol.iterator
+ * @memberOf _
+ * @since 4.0.0
+ * @category Seq
+ * @returns {Object} Returns the wrapper object.
+ * @example
+ *
+ * var wrapped = _([1, 2]);
+ *
+ * wrapped[Symbol.iterator]() === wrapped;
+ * // => true
+ *
+ * Array.from(wrapped);
+ * // => [1, 2]
+ */
+ function wrapperToIterator() {
+ return this;
+ }
+
+ /**
+ * Creates a clone of the chain sequence planting `value` as the wrapped value.
+ *
+ * @name plant
+ * @memberOf _
+ * @since 3.2.0
+ * @category Seq
+ * @param {*} value The value to plant.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var wrapped = _([1, 2]).map(square);
+ * var other = wrapped.plant([3, 4]);
+ *
+ * other.value();
+ * // => [9, 16]
+ *
+ * wrapped.value();
+ * // => [1, 4]
+ */
+ function wrapperPlant(value) {
+ var result,
+ parent = this;
+
+ while (parent instanceof baseLodash) {
+ var clone = wrapperClone(parent);
+ clone.__index__ = 0;
+ clone.__values__ = undefined;
+ if (result) {
+ previous.__wrapped__ = clone;
+ } else {
+ result = clone;
+ }
+ var previous = clone;
+ parent = parent.__wrapped__;
+ }
+ previous.__wrapped__ = value;
+ return result;
+ }
+
+ /**
+ * This method is the wrapper version of `_.reverse`.
+ *
+ * **Note:** This method mutates the wrapped array.
+ *
+ * @name reverse
+ * @memberOf _
+ * @since 0.1.0
+ * @category Seq
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var array = [1, 2, 3];
+ *
+ * _(array).reverse().value()
+ * // => [3, 2, 1]
+ *
+ * console.log(array);
+ * // => [3, 2, 1]
+ */
+ function wrapperReverse() {
+ var value = this.__wrapped__;
+ if (value instanceof LazyWrapper) {
+ var wrapped = value;
+ if (this.__actions__.length) {
+ wrapped = new LazyWrapper(this);
+ }
+ wrapped = wrapped.reverse();
+ wrapped.__actions__.push({
+ 'func': thru,
+ 'args': [reverse],
+ 'thisArg': undefined
+ });
+ return new LodashWrapper(wrapped, this.__chain__);
+ }
+ return this.thru(reverse);
+ }
+
+ /**
+ * Executes the chain sequence to resolve the unwrapped value.
+ *
+ * @name value
+ * @memberOf _
+ * @since 0.1.0
+ * @alias toJSON, valueOf
+ * @category Seq
+ * @returns {*} Returns the resolved unwrapped value.
+ * @example
+ *
+ * _([1, 2, 3]).value();
+ * // => [1, 2, 3]
+ */
+ function wrapperValue() {
+ return baseWrapperValue(this.__wrapped__, this.__actions__);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an object composed of keys generated from the results of running
+ * each element of `collection` thru `iteratee`. The corresponding value of
+ * each key is the number of times the key was returned by `iteratee`. The
+ * iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.5.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * _.countBy([6.1, 4.2, 6.3], Math.floor);
+ * // => { '4': 1, '6': 2 }
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.countBy(['one', 'two', 'three'], 'length');
+ * // => { '3': 2, '5': 1 }
+ */
+ var countBy = createAggregator(function(result, value, key) {
+ if (hasOwnProperty.call(result, key)) {
+ ++result[key];
+ } else {
+ baseAssignValue(result, key, 1);
+ }
+ });
+
+ /**
+ * Checks if `predicate` returns truthy for **all** elements of `collection`.
+ * Iteration is stopped once `predicate` returns falsey. The predicate is
+ * invoked with three arguments: (value, index|key, collection).
+ *
+ * **Note:** This method returns `true` for
+ * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because
+ * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of
+ * elements of empty collections.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {boolean} Returns `true` if all elements pass the predicate check,
+ * else `false`.
+ * @example
+ *
+ * _.every([true, 1, null, 'yes'], Boolean);
+ * // => false
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': false },
+ * { 'user': 'fred', 'age': 40, 'active': false }
+ * ];
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.every(users, { 'user': 'barney', 'active': false });
+ * // => false
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.every(users, ['active', false]);
+ * // => true
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.every(users, 'active');
+ * // => false
+ */
+ function every(collection, predicate, guard) {
+ var func = isArray(collection) ? arrayEvery : baseEvery;
+ if (guard && isIterateeCall(collection, predicate, guard)) {
+ predicate = undefined;
+ }
+ return func(collection, getIteratee(predicate, 3));
+ }
+
+ /**
+ * Iterates over elements of `collection`, returning an array of all elements
+ * `predicate` returns truthy for. The predicate is invoked with three
+ * arguments: (value, index|key, collection).
+ *
+ * **Note:** Unlike `_.remove`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ * @see _.reject
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': true },
+ * { 'user': 'fred', 'age': 40, 'active': false }
+ * ];
+ *
+ * _.filter(users, function(o) { return !o.active; });
+ * // => objects for ['fred']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.filter(users, { 'age': 36, 'active': true });
+ * // => objects for ['barney']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.filter(users, ['active', false]);
+ * // => objects for ['fred']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.filter(users, 'active');
+ * // => objects for ['barney']
+ */
+ function filter(collection, predicate) {
+ var func = isArray(collection) ? arrayFilter : baseFilter;
+ return func(collection, getIteratee(predicate, 3));
+ }
+
+ /**
+ * Iterates over elements of `collection`, returning the first element
+ * `predicate` returns truthy for. The predicate is invoked with three
+ * arguments: (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @returns {*} Returns the matched element, else `undefined`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': true },
+ * { 'user': 'fred', 'age': 40, 'active': false },
+ * { 'user': 'pebbles', 'age': 1, 'active': true }
+ * ];
+ *
+ * _.find(users, function(o) { return o.age < 40; });
+ * // => object for 'barney'
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.find(users, { 'age': 1, 'active': true });
+ * // => object for 'pebbles'
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.find(users, ['active', false]);
+ * // => object for 'fred'
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.find(users, 'active');
+ * // => object for 'barney'
+ */
+ var find = createFind(findIndex);
+
+ /**
+ * This method is like `_.find` except that it iterates over elements of
+ * `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=collection.length-1] The index to search from.
+ * @returns {*} Returns the matched element, else `undefined`.
+ * @example
+ *
+ * _.findLast([1, 2, 3, 4], function(n) {
+ * return n % 2 == 1;
+ * });
+ * // => 3
+ */
+ var findLast = createFind(findLastIndex);
+
+ /**
+ * Creates a flattened array of values by running each element in `collection`
+ * thru `iteratee` and flattening the mapped results. The iteratee is invoked
+ * with three arguments: (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * function duplicate(n) {
+ * return [n, n];
+ * }
+ *
+ * _.flatMap([1, 2], duplicate);
+ * // => [1, 1, 2, 2]
+ */
+ function flatMap(collection, iteratee) {
+ return baseFlatten(map(collection, iteratee), 1);
+ }
+
+ /**
+ * This method is like `_.flatMap` except that it recursively flattens the
+ * mapped results.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * function duplicate(n) {
+ * return [[[n, n]]];
+ * }
+ *
+ * _.flatMapDeep([1, 2], duplicate);
+ * // => [1, 1, 2, 2]
+ */
+ function flatMapDeep(collection, iteratee) {
+ return baseFlatten(map(collection, iteratee), INFINITY);
+ }
+
+ /**
+ * This method is like `_.flatMap` except that it recursively flattens the
+ * mapped results up to `depth` times.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {number} [depth=1] The maximum recursion depth.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * function duplicate(n) {
+ * return [[[n, n]]];
+ * }
+ *
+ * _.flatMapDepth([1, 2], duplicate, 2);
+ * // => [[1, 1], [2, 2]]
+ */
+ function flatMapDepth(collection, iteratee, depth) {
+ depth = depth === undefined ? 1 : toInteger(depth);
+ return baseFlatten(map(collection, iteratee), depth);
+ }
+
+ /**
+ * Iterates over elements of `collection` and invokes `iteratee` for each element.
+ * The iteratee is invoked with three arguments: (value, index|key, collection).
+ * Iteratee functions may exit iteration early by explicitly returning `false`.
+ *
+ * **Note:** As with other "Collections" methods, objects with a "length"
+ * property are iterated like arrays. To avoid this behavior use `_.forIn`
+ * or `_.forOwn` for object iteration.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @alias each
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ * @see _.forEachRight
+ * @example
+ *
+ * _.forEach([1, 2], function(value) {
+ * console.log(value);
+ * });
+ * // => Logs `1` then `2`.
+ *
+ * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'a' then 'b' (iteration order is not guaranteed).
+ */
+ function forEach(collection, iteratee) {
+ var func = isArray(collection) ? arrayEach : baseEach;
+ return func(collection, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * This method is like `_.forEach` except that it iterates over elements of
+ * `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @alias eachRight
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ * @see _.forEach
+ * @example
+ *
+ * _.forEachRight([1, 2], function(value) {
+ * console.log(value);
+ * });
+ * // => Logs `2` then `1`.
+ */
+ function forEachRight(collection, iteratee) {
+ var func = isArray(collection) ? arrayEachRight : baseEachRight;
+ return func(collection, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * Creates an object composed of keys generated from the results of running
+ * each element of `collection` thru `iteratee`. The order of grouped values
+ * is determined by the order they occur in `collection`. The corresponding
+ * value of each key is an array of elements responsible for generating the
+ * key. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * _.groupBy([6.1, 4.2, 6.3], Math.floor);
+ * // => { '4': [4.2], '6': [6.1, 6.3] }
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.groupBy(['one', 'two', 'three'], 'length');
+ * // => { '3': ['one', 'two'], '5': ['three'] }
+ */
+ var groupBy = createAggregator(function(result, value, key) {
+ if (hasOwnProperty.call(result, key)) {
+ result[key].push(value);
+ } else {
+ baseAssignValue(result, key, [value]);
+ }
+ });
+
+ /**
+ * Checks if `value` is in `collection`. If `collection` is a string, it's
+ * checked for a substring of `value`, otherwise
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * is used for equality comparisons. If `fromIndex` is negative, it's used as
+ * the offset from the end of `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object|string} collection The collection to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
+ * @returns {boolean} Returns `true` if `value` is found, else `false`.
+ * @example
+ *
+ * _.includes([1, 2, 3], 1);
+ * // => true
+ *
+ * _.includes([1, 2, 3], 1, 2);
+ * // => false
+ *
+ * _.includes({ 'a': 1, 'b': 2 }, 1);
+ * // => true
+ *
+ * _.includes('abcd', 'bc');
+ * // => true
+ */
+ function includes(collection, value, fromIndex, guard) {
+ collection = isArrayLike(collection) ? collection : values(collection);
+ fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;
+
+ var length = collection.length;
+ if (fromIndex < 0) {
+ fromIndex = nativeMax(length + fromIndex, 0);
+ }
+ return isString(collection)
+ ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)
+ : (!!length && baseIndexOf(collection, value, fromIndex) > -1);
+ }
+
+ /**
+ * Invokes the method at `path` of each element in `collection`, returning
+ * an array of the results of each invoked method. Any additional arguments
+ * are provided to each invoked method. If `path` is a function, it's invoked
+ * for, and `this` bound to, each element in `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Array|Function|string} path The path of the method to invoke or
+ * the function invoked per iteration.
+ * @param {...*} [args] The arguments to invoke each method with.
+ * @returns {Array} Returns the array of results.
+ * @example
+ *
+ * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');
+ * // => [[1, 5, 7], [1, 2, 3]]
+ *
+ * _.invokeMap([123, 456], String.prototype.split, '');
+ * // => [['1', '2', '3'], ['4', '5', '6']]
+ */
+ var invokeMap = baseRest(function(collection, path, args) {
+ var index = -1,
+ isFunc = typeof path == 'function',
+ result = isArrayLike(collection) ? Array(collection.length) : [];
+
+ baseEach(collection, function(value) {
+ result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);
+ });
+ return result;
+ });
+
+ /**
+ * Creates an object composed of keys generated from the results of running
+ * each element of `collection` thru `iteratee`. The corresponding value of
+ * each key is the last element responsible for generating the key. The
+ * iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * var array = [
+ * { 'dir': 'left', 'code': 97 },
+ * { 'dir': 'right', 'code': 100 }
+ * ];
+ *
+ * _.keyBy(array, function(o) {
+ * return String.fromCharCode(o.code);
+ * });
+ * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }
+ *
+ * _.keyBy(array, 'dir');
+ * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }
+ */
+ var keyBy = createAggregator(function(result, value, key) {
+ baseAssignValue(result, key, value);
+ });
+
+ /**
+ * Creates an array of values by running each element in `collection` thru
+ * `iteratee`. The iteratee is invoked with three arguments:
+ * (value, index|key, collection).
+ *
+ * Many lodash methods are guarded to work as iteratees for methods like
+ * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.
+ *
+ * The guarded methods are:
+ * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,
+ * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,
+ * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,
+ * `template`, `trim`, `trimEnd`, `trimStart`, and `words`
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new mapped array.
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * _.map([4, 8], square);
+ * // => [16, 64]
+ *
+ * _.map({ 'a': 4, 'b': 8 }, square);
+ * // => [16, 64] (iteration order is not guaranteed)
+ *
+ * var users = [
+ * { 'user': 'barney' },
+ * { 'user': 'fred' }
+ * ];
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.map(users, 'user');
+ * // => ['barney', 'fred']
+ */
+ function map(collection, iteratee) {
+ var func = isArray(collection) ? arrayMap : baseMap;
+ return func(collection, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * This method is like `_.sortBy` except that it allows specifying the sort
+ * orders of the iteratees to sort by. If `orders` is unspecified, all values
+ * are sorted in ascending order. Otherwise, specify an order of "desc" for
+ * descending or "asc" for ascending sort order of corresponding values.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]
+ * The iteratees to sort by.
+ * @param {string[]} [orders] The sort orders of `iteratees`.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
+ * @returns {Array} Returns the new sorted array.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'fred', 'age': 48 },
+ * { 'user': 'barney', 'age': 34 },
+ * { 'user': 'fred', 'age': 40 },
+ * { 'user': 'barney', 'age': 36 }
+ * ];
+ *
+ * // Sort by `user` in ascending order and by `age` in descending order.
+ * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);
+ * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
+ */
+ function orderBy(collection, iteratees, orders, guard) {
+ if (collection == null) {
+ return [];
+ }
+ if (!isArray(iteratees)) {
+ iteratees = iteratees == null ? [] : [iteratees];
+ }
+ orders = guard ? undefined : orders;
+ if (!isArray(orders)) {
+ orders = orders == null ? [] : [orders];
+ }
+ return baseOrderBy(collection, iteratees, orders);
+ }
+
+ /**
+ * Creates an array of elements split into two groups, the first of which
+ * contains elements `predicate` returns truthy for, the second of which
+ * contains elements `predicate` returns falsey for. The predicate is
+ * invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the array of grouped elements.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': false },
+ * { 'user': 'fred', 'age': 40, 'active': true },
+ * { 'user': 'pebbles', 'age': 1, 'active': false }
+ * ];
+ *
+ * _.partition(users, function(o) { return o.active; });
+ * // => objects for [['fred'], ['barney', 'pebbles']]
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.partition(users, { 'age': 1, 'active': false });
+ * // => objects for [['pebbles'], ['barney', 'fred']]
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.partition(users, ['active', false]);
+ * // => objects for [['barney', 'pebbles'], ['fred']]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.partition(users, 'active');
+ * // => objects for [['fred'], ['barney', 'pebbles']]
+ */
+ var partition = createAggregator(function(result, value, key) {
+ result[key ? 0 : 1].push(value);
+ }, function() { return [[], []]; });
+
+ /**
+ * Reduces `collection` to a value which is the accumulated result of running
+ * each element in `collection` thru `iteratee`, where each successive
+ * invocation is supplied the return value of the previous. If `accumulator`
+ * is not given, the first element of `collection` is used as the initial
+ * value. The iteratee is invoked with four arguments:
+ * (accumulator, value, index|key, collection).
+ *
+ * Many lodash methods are guarded to work as iteratees for methods like
+ * `_.reduce`, `_.reduceRight`, and `_.transform`.
+ *
+ * The guarded methods are:
+ * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,
+ * and `sortBy`
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @returns {*} Returns the accumulated value.
+ * @see _.reduceRight
+ * @example
+ *
+ * _.reduce([1, 2], function(sum, n) {
+ * return sum + n;
+ * }, 0);
+ * // => 3
+ *
+ * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
+ * (result[value] || (result[value] = [])).push(key);
+ * return result;
+ * }, {});
+ * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)
+ */
+ function reduce(collection, iteratee, accumulator) {
+ var func = isArray(collection) ? arrayReduce : baseReduce,
+ initAccum = arguments.length < 3;
+
+ return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);
+ }
+
+ /**
+ * This method is like `_.reduce` except that it iterates over elements of
+ * `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @returns {*} Returns the accumulated value.
+ * @see _.reduce
+ * @example
+ *
+ * var array = [[0, 1], [2, 3], [4, 5]];
+ *
+ * _.reduceRight(array, function(flattened, other) {
+ * return flattened.concat(other);
+ * }, []);
+ * // => [4, 5, 2, 3, 0, 1]
+ */
+ function reduceRight(collection, iteratee, accumulator) {
+ var func = isArray(collection) ? arrayReduceRight : baseReduce,
+ initAccum = arguments.length < 3;
+
+ return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);
+ }
+
+ /**
+ * The opposite of `_.filter`; this method returns the elements of `collection`
+ * that `predicate` does **not** return truthy for.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ * @see _.filter
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': false },
+ * { 'user': 'fred', 'age': 40, 'active': true }
+ * ];
+ *
+ * _.reject(users, function(o) { return !o.active; });
+ * // => objects for ['fred']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.reject(users, { 'age': 40, 'active': true });
+ * // => objects for ['barney']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.reject(users, ['active', false]);
+ * // => objects for ['fred']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.reject(users, 'active');
+ * // => objects for ['barney']
+ */
+ function reject(collection, predicate) {
+ var func = isArray(collection) ? arrayFilter : baseFilter;
+ return func(collection, negate(getIteratee(predicate, 3)));
+ }
+
+ /**
+ * Gets a random element from `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to sample.
+ * @returns {*} Returns the random element.
+ * @example
+ *
+ * _.sample([1, 2, 3, 4]);
+ * // => 2
+ */
+ function sample(collection) {
+ var func = isArray(collection) ? arraySample : baseSample;
+ return func(collection);
+ }
+
+ /**
+ * Gets `n` random elements at unique keys from `collection` up to the
+ * size of `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to sample.
+ * @param {number} [n=1] The number of elements to sample.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the random elements.
+ * @example
+ *
+ * _.sampleSize([1, 2, 3], 2);
+ * // => [3, 1]
+ *
+ * _.sampleSize([1, 2, 3], 4);
+ * // => [2, 3, 1]
+ */
+ function sampleSize(collection, n, guard) {
+ if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {
+ n = 1;
+ } else {
+ n = toInteger(n);
+ }
+ var func = isArray(collection) ? arraySampleSize : baseSampleSize;
+ return func(collection, n);
+ }
+
+ /**
+ * Creates an array of shuffled values, using a version of the
+ * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to shuffle.
+ * @returns {Array} Returns the new shuffled array.
+ * @example
+ *
+ * _.shuffle([1, 2, 3, 4]);
+ * // => [4, 1, 3, 2]
+ */
+ function shuffle(collection) {
+ var func = isArray(collection) ? arrayShuffle : baseShuffle;
+ return func(collection);
+ }
+
+ /**
+ * Gets the size of `collection` by returning its length for array-like
+ * values or the number of own enumerable string keyed properties for objects.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object|string} collection The collection to inspect.
+ * @returns {number} Returns the collection size.
+ * @example
+ *
+ * _.size([1, 2, 3]);
+ * // => 3
+ *
+ * _.size({ 'a': 1, 'b': 2 });
+ * // => 2
+ *
+ * _.size('pebbles');
+ * // => 7
+ */
+ function size(collection) {
+ if (collection == null) {
+ return 0;
+ }
+ if (isArrayLike(collection)) {
+ return isString(collection) ? stringSize(collection) : collection.length;
+ }
+ var tag = getTag(collection);
+ if (tag == mapTag || tag == setTag) {
+ return collection.size;
+ }
+ return baseKeys(collection).length;
+ }
+
+ /**
+ * Checks if `predicate` returns truthy for **any** element of `collection`.
+ * Iteration is stopped once `predicate` returns truthy. The predicate is
+ * invoked with three arguments: (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ * else `false`.
+ * @example
+ *
+ * _.some([null, 0, 'yes', false], Boolean);
+ * // => true
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false }
+ * ];
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.some(users, { 'user': 'barney', 'active': false });
+ * // => false
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.some(users, ['active', false]);
+ * // => true
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.some(users, 'active');
+ * // => true
+ */
+ function some(collection, predicate, guard) {
+ var func = isArray(collection) ? arraySome : baseSome;
+ if (guard && isIterateeCall(collection, predicate, guard)) {
+ predicate = undefined;
+ }
+ return func(collection, getIteratee(predicate, 3));
+ }
+
+ /**
+ * Creates an array of elements, sorted in ascending order by the results of
+ * running each element in a collection thru each iteratee. This method
+ * performs a stable sort, that is, it preserves the original sort order of
+ * equal elements. The iteratees are invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {...(Function|Function[])} [iteratees=[_.identity]]
+ * The iteratees to sort by.
+ * @returns {Array} Returns the new sorted array.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'fred', 'age': 48 },
+ * { 'user': 'barney', 'age': 36 },
+ * { 'user': 'fred', 'age': 40 },
+ * { 'user': 'barney', 'age': 34 }
+ * ];
+ *
+ * _.sortBy(users, [function(o) { return o.user; }]);
+ * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
+ *
+ * _.sortBy(users, ['user', 'age']);
+ * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]
+ */
+ var sortBy = baseRest(function(collection, iteratees) {
+ if (collection == null) {
+ return [];
+ }
+ var length = iteratees.length;
+ if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {
+ iteratees = [];
+ } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {
+ iteratees = [iteratees[0]];
+ }
+ return baseOrderBy(collection, baseFlatten(iteratees, 1), []);
+ });
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Gets the timestamp of the number of milliseconds that have elapsed since
+ * the Unix epoch (1 January 1970 00:00:00 UTC).
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Date
+ * @returns {number} Returns the timestamp.
+ * @example
+ *
+ * _.defer(function(stamp) {
+ * console.log(_.now() - stamp);
+ * }, _.now());
+ * // => Logs the number of milliseconds it took for the deferred invocation.
+ */
+ var now = ctxNow || function() {
+ return root.Date.now();
+ };
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * The opposite of `_.before`; this method creates a function that invokes
+ * `func` once it's called `n` or more times.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {number} n The number of calls before `func` is invoked.
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * var saves = ['profile', 'settings'];
+ *
+ * var done = _.after(saves.length, function() {
+ * console.log('done saving!');
+ * });
+ *
+ * _.forEach(saves, function(type) {
+ * asyncSave({ 'type': type, 'complete': done });
+ * });
+ * // => Logs 'done saving!' after the two async saves have completed.
+ */
+ function after(n, func) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ n = toInteger(n);
+ return function() {
+ if (--n < 1) {
+ return func.apply(this, arguments);
+ }
+ };
+ }
+
+ /**
+ * Creates a function that invokes `func`, with up to `n` arguments,
+ * ignoring any additional arguments.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} func The function to cap arguments for.
+ * @param {number} [n=func.length] The arity cap.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the new capped function.
+ * @example
+ *
+ * _.map(['6', '8', '10'], _.ary(parseInt, 1));
+ * // => [6, 8, 10]
+ */
+ function ary(func, n, guard) {
+ n = guard ? undefined : n;
+ n = (func && n == null) ? func.length : n;
+ return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);
+ }
+
+ /**
+ * Creates a function that invokes `func`, with the `this` binding and arguments
+ * of the created function, while it's called less than `n` times. Subsequent
+ * calls to the created function return the result of the last `func` invocation.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {number} n The number of calls at which `func` is no longer invoked.
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * jQuery(element).on('click', _.before(5, addContactToList));
+ * // => Allows adding up to 4 contacts to the list.
+ */
+ function before(n, func) {
+ var result;
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ n = toInteger(n);
+ return function() {
+ if (--n > 0) {
+ result = func.apply(this, arguments);
+ }
+ if (n <= 1) {
+ func = undefined;
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Creates a function that invokes `func` with the `this` binding of `thisArg`
+ * and `partials` prepended to the arguments it receives.
+ *
+ * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,
+ * may be used as a placeholder for partially applied arguments.
+ *
+ * **Note:** Unlike native `Function#bind`, this method doesn't set the "length"
+ * property of bound functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to bind.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new bound function.
+ * @example
+ *
+ * function greet(greeting, punctuation) {
+ * return greeting + ' ' + this.user + punctuation;
+ * }
+ *
+ * var object = { 'user': 'fred' };
+ *
+ * var bound = _.bind(greet, object, 'hi');
+ * bound('!');
+ * // => 'hi fred!'
+ *
+ * // Bound with placeholders.
+ * var bound = _.bind(greet, object, _, '!');
+ * bound('hi');
+ * // => 'hi fred!'
+ */
+ var bind = baseRest(function(func, thisArg, partials) {
+ var bitmask = WRAP_BIND_FLAG;
+ if (partials.length) {
+ var holders = replaceHolders(partials, getHolder(bind));
+ bitmask |= WRAP_PARTIAL_FLAG;
+ }
+ return createWrap(func, bitmask, thisArg, partials, holders);
+ });
+
+ /**
+ * Creates a function that invokes the method at `object[key]` with `partials`
+ * prepended to the arguments it receives.
+ *
+ * This method differs from `_.bind` by allowing bound functions to reference
+ * methods that may be redefined or don't yet exist. See
+ * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)
+ * for more details.
+ *
+ * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for partially applied arguments.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.10.0
+ * @category Function
+ * @param {Object} object The object to invoke the method on.
+ * @param {string} key The key of the method.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new bound function.
+ * @example
+ *
+ * var object = {
+ * 'user': 'fred',
+ * 'greet': function(greeting, punctuation) {
+ * return greeting + ' ' + this.user + punctuation;
+ * }
+ * };
+ *
+ * var bound = _.bindKey(object, 'greet', 'hi');
+ * bound('!');
+ * // => 'hi fred!'
+ *
+ * object.greet = function(greeting, punctuation) {
+ * return greeting + 'ya ' + this.user + punctuation;
+ * };
+ *
+ * bound('!');
+ * // => 'hiya fred!'
+ *
+ * // Bound with placeholders.
+ * var bound = _.bindKey(object, 'greet', _, '!');
+ * bound('hi');
+ * // => 'hiya fred!'
+ */
+ var bindKey = baseRest(function(object, key, partials) {
+ var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;
+ if (partials.length) {
+ var holders = replaceHolders(partials, getHolder(bindKey));
+ bitmask |= WRAP_PARTIAL_FLAG;
+ }
+ return createWrap(key, bitmask, object, partials, holders);
+ });
+
+ /**
+ * Creates a function that accepts arguments of `func` and either invokes
+ * `func` returning its result, if at least `arity` number of arguments have
+ * been provided, or returns a function that accepts the remaining `func`
+ * arguments, and so on. The arity of `func` may be specified if `func.length`
+ * is not sufficient.
+ *
+ * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,
+ * may be used as a placeholder for provided arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of curried functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Function
+ * @param {Function} func The function to curry.
+ * @param {number} [arity=func.length] The arity of `func`.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the new curried function.
+ * @example
+ *
+ * var abc = function(a, b, c) {
+ * return [a, b, c];
+ * };
+ *
+ * var curried = _.curry(abc);
+ *
+ * curried(1)(2)(3);
+ * // => [1, 2, 3]
+ *
+ * curried(1, 2)(3);
+ * // => [1, 2, 3]
+ *
+ * curried(1, 2, 3);
+ * // => [1, 2, 3]
+ *
+ * // Curried with placeholders.
+ * curried(1)(_, 3)(2);
+ * // => [1, 2, 3]
+ */
+ function curry(func, arity, guard) {
+ arity = guard ? undefined : arity;
+ var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
+ result.placeholder = curry.placeholder;
+ return result;
+ }
+
+ /**
+ * This method is like `_.curry` except that arguments are applied to `func`
+ * in the manner of `_.partialRight` instead of `_.partial`.
+ *
+ * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for provided arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of curried functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} func The function to curry.
+ * @param {number} [arity=func.length] The arity of `func`.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the new curried function.
+ * @example
+ *
+ * var abc = function(a, b, c) {
+ * return [a, b, c];
+ * };
+ *
+ * var curried = _.curryRight(abc);
+ *
+ * curried(3)(2)(1);
+ * // => [1, 2, 3]
+ *
+ * curried(2, 3)(1);
+ * // => [1, 2, 3]
+ *
+ * curried(1, 2, 3);
+ * // => [1, 2, 3]
+ *
+ * // Curried with placeholders.
+ * curried(3)(1, _)(2);
+ * // => [1, 2, 3]
+ */
+ function curryRight(func, arity, guard) {
+ arity = guard ? undefined : arity;
+ var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
+ result.placeholder = curryRight.placeholder;
+ return result;
+ }
+
+ /**
+ * Creates a debounced function that delays invoking `func` until after `wait`
+ * milliseconds have elapsed since the last time the debounced function was
+ * invoked. The debounced function comes with a `cancel` method to cancel
+ * delayed `func` invocations and a `flush` method to immediately invoke them.
+ * Provide `options` to indicate whether `func` should be invoked on the
+ * leading and/or trailing edge of the `wait` timeout. The `func` is invoked
+ * with the last arguments provided to the debounced function. Subsequent
+ * calls to the debounced function return the result of the last `func`
+ * invocation.
+ *
+ * **Note:** If `leading` and `trailing` options are `true`, `func` is
+ * invoked on the trailing edge of the timeout only if the debounced function
+ * is invoked more than once during the `wait` timeout.
+ *
+ * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
+ * until to the next tick, similar to `setTimeout` with a timeout of `0`.
+ *
+ * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
+ * for details over the differences between `_.debounce` and `_.throttle`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to debounce.
+ * @param {number} [wait=0] The number of milliseconds to delay.
+ * @param {Object} [options={}] The options object.
+ * @param {boolean} [options.leading=false]
+ * Specify invoking on the leading edge of the timeout.
+ * @param {number} [options.maxWait]
+ * The maximum time `func` is allowed to be delayed before it's invoked.
+ * @param {boolean} [options.trailing=true]
+ * Specify invoking on the trailing edge of the timeout.
+ * @returns {Function} Returns the new debounced function.
+ * @example
+ *
+ * // Avoid costly calculations while the window size is in flux.
+ * jQuery(window).on('resize', _.debounce(calculateLayout, 150));
+ *
+ * // Invoke `sendMail` when clicked, debouncing subsequent calls.
+ * jQuery(element).on('click', _.debounce(sendMail, 300, {
+ * 'leading': true,
+ * 'trailing': false
+ * }));
+ *
+ * // Ensure `batchLog` is invoked once after 1 second of debounced calls.
+ * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
+ * var source = new EventSource('/stream');
+ * jQuery(source).on('message', debounced);
+ *
+ * // Cancel the trailing debounced invocation.
+ * jQuery(window).on('popstate', debounced.cancel);
+ */
+ function debounce(func, wait, options) {
+ var lastArgs,
+ lastThis,
+ maxWait,
+ result,
+ timerId,
+ lastCallTime,
+ lastInvokeTime = 0,
+ leading = false,
+ maxing = false,
+ trailing = true;
+
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ wait = toNumber(wait) || 0;
+ if (isObject(options)) {
+ leading = !!options.leading;
+ maxing = 'maxWait' in options;
+ maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
+ trailing = 'trailing' in options ? !!options.trailing : trailing;
+ }
+
+ function invokeFunc(time) {
+ var args = lastArgs,
+ thisArg = lastThis;
+
+ lastArgs = lastThis = undefined;
+ lastInvokeTime = time;
+ result = func.apply(thisArg, args);
+ return result;
+ }
+
+ function leadingEdge(time) {
+ // Reset any `maxWait` timer.
+ lastInvokeTime = time;
+ // Start the timer for the trailing edge.
+ timerId = setTimeout(timerExpired, wait);
+ // Invoke the leading edge.
+ return leading ? invokeFunc(time) : result;
+ }
+
+ function remainingWait(time) {
+ var timeSinceLastCall = time - lastCallTime,
+ timeSinceLastInvoke = time - lastInvokeTime,
+ timeWaiting = wait - timeSinceLastCall;
+
+ return maxing
+ ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)
+ : timeWaiting;
+ }
+
+ function shouldInvoke(time) {
+ var timeSinceLastCall = time - lastCallTime,
+ timeSinceLastInvoke = time - lastInvokeTime;
+
+ // Either this is the first call, activity has stopped and we're at the
+ // trailing edge, the system time has gone backwards and we're treating
+ // it as the trailing edge, or we've hit the `maxWait` limit.
+ return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
+ (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
+ }
+
+ function timerExpired() {
+ var time = now();
+ if (shouldInvoke(time)) {
+ return trailingEdge(time);
+ }
+ // Restart the timer.
+ timerId = setTimeout(timerExpired, remainingWait(time));
+ }
+
+ function trailingEdge(time) {
+ timerId = undefined;
+
+ // Only invoke if we have `lastArgs` which means `func` has been
+ // debounced at least once.
+ if (trailing && lastArgs) {
+ return invokeFunc(time);
+ }
+ lastArgs = lastThis = undefined;
+ return result;
+ }
+
+ function cancel() {
+ if (timerId !== undefined) {
+ clearTimeout(timerId);
+ }
+ lastInvokeTime = 0;
+ lastArgs = lastCallTime = lastThis = timerId = undefined;
+ }
+
+ function flush() {
+ return timerId === undefined ? result : trailingEdge(now());
+ }
+
+ function debounced() {
+ var time = now(),
+ isInvoking = shouldInvoke(time);
+
+ lastArgs = arguments;
+ lastThis = this;
+ lastCallTime = time;
+
+ if (isInvoking) {
+ if (timerId === undefined) {
+ return leadingEdge(lastCallTime);
+ }
+ if (maxing) {
+ // Handle invocations in a tight loop.
+ timerId = setTimeout(timerExpired, wait);
+ return invokeFunc(lastCallTime);
+ }
+ }
+ if (timerId === undefined) {
+ timerId = setTimeout(timerExpired, wait);
+ }
+ return result;
+ }
+ debounced.cancel = cancel;
+ debounced.flush = flush;
+ return debounced;
+ }
+
+ /**
+ * Defers invoking the `func` until the current call stack has cleared. Any
+ * additional arguments are provided to `func` when it's invoked.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to defer.
+ * @param {...*} [args] The arguments to invoke `func` with.
+ * @returns {number} Returns the timer id.
+ * @example
+ *
+ * _.defer(function(text) {
+ * console.log(text);
+ * }, 'deferred');
+ * // => Logs 'deferred' after one millisecond.
+ */
+ var defer = baseRest(function(func, args) {
+ return baseDelay(func, 1, args);
+ });
+
+ /**
+ * Invokes `func` after `wait` milliseconds. Any additional arguments are
+ * provided to `func` when it's invoked.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to delay.
+ * @param {number} wait The number of milliseconds to delay invocation.
+ * @param {...*} [args] The arguments to invoke `func` with.
+ * @returns {number} Returns the timer id.
+ * @example
+ *
+ * _.delay(function(text) {
+ * console.log(text);
+ * }, 1000, 'later');
+ * // => Logs 'later' after one second.
+ */
+ var delay = baseRest(function(func, wait, args) {
+ return baseDelay(func, toNumber(wait) || 0, args);
+ });
+
+ /**
+ * Creates a function that invokes `func` with arguments reversed.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Function
+ * @param {Function} func The function to flip arguments for.
+ * @returns {Function} Returns the new flipped function.
+ * @example
+ *
+ * var flipped = _.flip(function() {
+ * return _.toArray(arguments);
+ * });
+ *
+ * flipped('a', 'b', 'c', 'd');
+ * // => ['d', 'c', 'b', 'a']
+ */
+ function flip(func) {
+ return createWrap(func, WRAP_FLIP_FLAG);
+ }
+
+ /**
+ * Creates a function that memoizes the result of `func`. If `resolver` is
+ * provided, it determines the cache key for storing the result based on the
+ * arguments provided to the memoized function. By default, the first argument
+ * provided to the memoized function is used as the map cache key. The `func`
+ * is invoked with the `this` binding of the memoized function.
+ *
+ * **Note:** The cache is exposed as the `cache` property on the memoized
+ * function. Its creation may be customized by replacing the `_.memoize.Cache`
+ * constructor with one whose instances implement the
+ * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
+ * method interface of `clear`, `delete`, `get`, `has`, and `set`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to have its output memoized.
+ * @param {Function} [resolver] The function to resolve the cache key.
+ * @returns {Function} Returns the new memoized function.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2 };
+ * var other = { 'c': 3, 'd': 4 };
+ *
+ * var values = _.memoize(_.values);
+ * values(object);
+ * // => [1, 2]
+ *
+ * values(other);
+ * // => [3, 4]
+ *
+ * object.a = 2;
+ * values(object);
+ * // => [1, 2]
+ *
+ * // Modify the result cache.
+ * values.cache.set(object, ['a', 'b']);
+ * values(object);
+ * // => ['a', 'b']
+ *
+ * // Replace `_.memoize.Cache`.
+ * _.memoize.Cache = WeakMap;
+ */
+ function memoize(func, resolver) {
+ if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ var memoized = function() {
+ var args = arguments,
+ key = resolver ? resolver.apply(this, args) : args[0],
+ cache = memoized.cache;
+
+ if (cache.has(key)) {
+ return cache.get(key);
+ }
+ var result = func.apply(this, args);
+ memoized.cache = cache.set(key, result) || cache;
+ return result;
+ };
+ memoized.cache = new (memoize.Cache || MapCache);
+ return memoized;
+ }
+
+ // Expose `MapCache`.
+ memoize.Cache = MapCache;
+
+ /**
+ * Creates a function that negates the result of the predicate `func`. The
+ * `func` predicate is invoked with the `this` binding and arguments of the
+ * created function.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} predicate The predicate to negate.
+ * @returns {Function} Returns the new negated function.
+ * @example
+ *
+ * function isEven(n) {
+ * return n % 2 == 0;
+ * }
+ *
+ * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));
+ * // => [1, 3, 5]
+ */
+ function negate(predicate) {
+ if (typeof predicate != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ return function() {
+ var args = arguments;
+ switch (args.length) {
+ case 0: return !predicate.call(this);
+ case 1: return !predicate.call(this, args[0]);
+ case 2: return !predicate.call(this, args[0], args[1]);
+ case 3: return !predicate.call(this, args[0], args[1], args[2]);
+ }
+ return !predicate.apply(this, args);
+ };
+ }
+
+ /**
+ * Creates a function that is restricted to invoking `func` once. Repeat calls
+ * to the function return the value of the first invocation. The `func` is
+ * invoked with the `this` binding and arguments of the created function.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * var initialize = _.once(createApplication);
+ * initialize();
+ * initialize();
+ * // => `createApplication` is invoked once
+ */
+ function once(func) {
+ return before(2, func);
+ }
+
+ /**
+ * Creates a function that invokes `func` with its arguments transformed.
+ *
+ * @static
+ * @since 4.0.0
+ * @memberOf _
+ * @category Function
+ * @param {Function} func The function to wrap.
+ * @param {...(Function|Function[])} [transforms=[_.identity]]
+ * The argument transforms.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * function doubled(n) {
+ * return n * 2;
+ * }
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var func = _.overArgs(function(x, y) {
+ * return [x, y];
+ * }, [square, doubled]);
+ *
+ * func(9, 3);
+ * // => [81, 6]
+ *
+ * func(10, 5);
+ * // => [100, 10]
+ */
+ var overArgs = castRest(function(func, transforms) {
+ transforms = (transforms.length == 1 && isArray(transforms[0]))
+ ? arrayMap(transforms[0], baseUnary(getIteratee()))
+ : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));
+
+ var funcsLength = transforms.length;
+ return baseRest(function(args) {
+ var index = -1,
+ length = nativeMin(args.length, funcsLength);
+
+ while (++index < length) {
+ args[index] = transforms[index].call(this, args[index]);
+ }
+ return apply(func, this, args);
+ });
+ });
+
+ /**
+ * Creates a function that invokes `func` with `partials` prepended to the
+ * arguments it receives. This method is like `_.bind` except it does **not**
+ * alter the `this` binding.
+ *
+ * The `_.partial.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for partially applied arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of partially
+ * applied functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.2.0
+ * @category Function
+ * @param {Function} func The function to partially apply arguments to.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new partially applied function.
+ * @example
+ *
+ * function greet(greeting, name) {
+ * return greeting + ' ' + name;
+ * }
+ *
+ * var sayHelloTo = _.partial(greet, 'hello');
+ * sayHelloTo('fred');
+ * // => 'hello fred'
+ *
+ * // Partially applied with placeholders.
+ * var greetFred = _.partial(greet, _, 'fred');
+ * greetFred('hi');
+ * // => 'hi fred'
+ */
+ var partial = baseRest(function(func, partials) {
+ var holders = replaceHolders(partials, getHolder(partial));
+ return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);
+ });
+
+ /**
+ * This method is like `_.partial` except that partially applied arguments
+ * are appended to the arguments it receives.
+ *
+ * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for partially applied arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of partially
+ * applied functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.0.0
+ * @category Function
+ * @param {Function} func The function to partially apply arguments to.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new partially applied function.
+ * @example
+ *
+ * function greet(greeting, name) {
+ * return greeting + ' ' + name;
+ * }
+ *
+ * var greetFred = _.partialRight(greet, 'fred');
+ * greetFred('hi');
+ * // => 'hi fred'
+ *
+ * // Partially applied with placeholders.
+ * var sayHelloTo = _.partialRight(greet, 'hello', _);
+ * sayHelloTo('fred');
+ * // => 'hello fred'
+ */
+ var partialRight = baseRest(function(func, partials) {
+ var holders = replaceHolders(partials, getHolder(partialRight));
+ return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);
+ });
+
+ /**
+ * Creates a function that invokes `func` with arguments arranged according
+ * to the specified `indexes` where the argument value at the first index is
+ * provided as the first argument, the argument value at the second index is
+ * provided as the second argument, and so on.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} func The function to rearrange arguments for.
+ * @param {...(number|number[])} indexes The arranged argument indexes.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var rearged = _.rearg(function(a, b, c) {
+ * return [a, b, c];
+ * }, [2, 0, 1]);
+ *
+ * rearged('b', 'c', 'a')
+ * // => ['a', 'b', 'c']
+ */
+ var rearg = flatRest(function(func, indexes) {
+ return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);
+ });
+
+ /**
+ * Creates a function that invokes `func` with the `this` binding of the
+ * created function and arguments from `start` and beyond provided as
+ * an array.
+ *
+ * **Note:** This method is based on the
+ * [rest parameter](https://mdn.io/rest_parameters).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Function
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var say = _.rest(function(what, names) {
+ * return what + ' ' + _.initial(names).join(', ') +
+ * (_.size(names) > 1 ? ', & ' : '') + _.last(names);
+ * });
+ *
+ * say('hello', 'fred', 'barney', 'pebbles');
+ * // => 'hello fred, barney, & pebbles'
+ */
+ function rest(func, start) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ start = start === undefined ? start : toInteger(start);
+ return baseRest(func, start);
+ }
+
+ /**
+ * Creates a function that invokes `func` with the `this` binding of the
+ * create function and an array of arguments much like
+ * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).
+ *
+ * **Note:** This method is based on the
+ * [spread operator](https://mdn.io/spread_operator).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.2.0
+ * @category Function
+ * @param {Function} func The function to spread arguments over.
+ * @param {number} [start=0] The start position of the spread.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var say = _.spread(function(who, what) {
+ * return who + ' says ' + what;
+ * });
+ *
+ * say(['fred', 'hello']);
+ * // => 'fred says hello'
+ *
+ * var numbers = Promise.all([
+ * Promise.resolve(40),
+ * Promise.resolve(36)
+ * ]);
+ *
+ * numbers.then(_.spread(function(x, y) {
+ * return x + y;
+ * }));
+ * // => a Promise of 76
+ */
+ function spread(func, start) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ start = start == null ? 0 : nativeMax(toInteger(start), 0);
+ return baseRest(function(args) {
+ var array = args[start],
+ otherArgs = castSlice(args, 0, start);
+
+ if (array) {
+ arrayPush(otherArgs, array);
+ }
+ return apply(func, this, otherArgs);
+ });
+ }
+
+ /**
+ * Creates a throttled function that only invokes `func` at most once per
+ * every `wait` milliseconds. The throttled function comes with a `cancel`
+ * method to cancel delayed `func` invocations and a `flush` method to
+ * immediately invoke them. Provide `options` to indicate whether `func`
+ * should be invoked on the leading and/or trailing edge of the `wait`
+ * timeout. The `func` is invoked with the last arguments provided to the
+ * throttled function. Subsequent calls to the throttled function return the
+ * result of the last `func` invocation.
+ *
+ * **Note:** If `leading` and `trailing` options are `true`, `func` is
+ * invoked on the trailing edge of the timeout only if the throttled function
+ * is invoked more than once during the `wait` timeout.
+ *
+ * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
+ * until to the next tick, similar to `setTimeout` with a timeout of `0`.
+ *
+ * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
+ * for details over the differences between `_.throttle` and `_.debounce`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to throttle.
+ * @param {number} [wait=0] The number of milliseconds to throttle invocations to.
+ * @param {Object} [options={}] The options object.
+ * @param {boolean} [options.leading=true]
+ * Specify invoking on the leading edge of the timeout.
+ * @param {boolean} [options.trailing=true]
+ * Specify invoking on the trailing edge of the timeout.
+ * @returns {Function} Returns the new throttled function.
+ * @example
+ *
+ * // Avoid excessively updating the position while scrolling.
+ * jQuery(window).on('scroll', _.throttle(updatePosition, 100));
+ *
+ * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.
+ * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });
+ * jQuery(element).on('click', throttled);
+ *
+ * // Cancel the trailing throttled invocation.
+ * jQuery(window).on('popstate', throttled.cancel);
+ */
+ function throttle(func, wait, options) {
+ var leading = true,
+ trailing = true;
+
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ if (isObject(options)) {
+ leading = 'leading' in options ? !!options.leading : leading;
+ trailing = 'trailing' in options ? !!options.trailing : trailing;
+ }
+ return debounce(func, wait, {
+ 'leading': leading,
+ 'maxWait': wait,
+ 'trailing': trailing
+ });
+ }
+
+ /**
+ * Creates a function that accepts up to one argument, ignoring any
+ * additional arguments.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Function
+ * @param {Function} func The function to cap arguments for.
+ * @returns {Function} Returns the new capped function.
+ * @example
+ *
+ * _.map(['6', '8', '10'], _.unary(parseInt));
+ * // => [6, 8, 10]
+ */
+ function unary(func) {
+ return ary(func, 1);
+ }
+
+ /**
+ * Creates a function that provides `value` to `wrapper` as its first
+ * argument. Any additional arguments provided to the function are appended
+ * to those provided to the `wrapper`. The wrapper is invoked with the `this`
+ * binding of the created function.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {*} value The value to wrap.
+ * @param {Function} [wrapper=identity] The wrapper function.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var p = _.wrap(_.escape, function(func, text) {
+ * return '' + func(text) + '
';
+ * });
+ *
+ * p('fred, barney, & pebbles');
+ * // => 'fred, barney, & pebbles
'
+ */
+ function wrap(value, wrapper) {
+ return partial(castFunction(wrapper), value);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Casts `value` as an array if it's not one.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.4.0
+ * @category Lang
+ * @param {*} value The value to inspect.
+ * @returns {Array} Returns the cast array.
+ * @example
+ *
+ * _.castArray(1);
+ * // => [1]
+ *
+ * _.castArray({ 'a': 1 });
+ * // => [{ 'a': 1 }]
+ *
+ * _.castArray('abc');
+ * // => ['abc']
+ *
+ * _.castArray(null);
+ * // => [null]
+ *
+ * _.castArray(undefined);
+ * // => [undefined]
+ *
+ * _.castArray();
+ * // => []
+ *
+ * var array = [1, 2, 3];
+ * console.log(_.castArray(array) === array);
+ * // => true
+ */
+ function castArray() {
+ if (!arguments.length) {
+ return [];
+ }
+ var value = arguments[0];
+ return isArray(value) ? value : [value];
+ }
+
+ /**
+ * Creates a shallow clone of `value`.
+ *
+ * **Note:** This method is loosely based on the
+ * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)
+ * and supports cloning arrays, array buffers, booleans, date objects, maps,
+ * numbers, `Object` objects, regexes, sets, strings, symbols, and typed
+ * arrays. The own enumerable properties of `arguments` objects are cloned
+ * as plain objects. An empty object is returned for uncloneable values such
+ * as error objects, functions, DOM nodes, and WeakMaps.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to clone.
+ * @returns {*} Returns the cloned value.
+ * @see _.cloneDeep
+ * @example
+ *
+ * var objects = [{ 'a': 1 }, { 'b': 2 }];
+ *
+ * var shallow = _.clone(objects);
+ * console.log(shallow[0] === objects[0]);
+ * // => true
+ */
+ function clone(value) {
+ return baseClone(value, CLONE_SYMBOLS_FLAG);
+ }
+
+ /**
+ * This method is like `_.clone` except that it accepts `customizer` which
+ * is invoked to produce the cloned value. If `customizer` returns `undefined`,
+ * cloning is handled by the method instead. The `customizer` is invoked with
+ * up to four arguments; (value [, index|key, object, stack]).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to clone.
+ * @param {Function} [customizer] The function to customize cloning.
+ * @returns {*} Returns the cloned value.
+ * @see _.cloneDeepWith
+ * @example
+ *
+ * function customizer(value) {
+ * if (_.isElement(value)) {
+ * return value.cloneNode(false);
+ * }
+ * }
+ *
+ * var el = _.cloneWith(document.body, customizer);
+ *
+ * console.log(el === document.body);
+ * // => false
+ * console.log(el.nodeName);
+ * // => 'BODY'
+ * console.log(el.childNodes.length);
+ * // => 0
+ */
+ function cloneWith(value, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);
+ }
+
+ /**
+ * This method is like `_.clone` except that it recursively clones `value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.0.0
+ * @category Lang
+ * @param {*} value The value to recursively clone.
+ * @returns {*} Returns the deep cloned value.
+ * @see _.clone
+ * @example
+ *
+ * var objects = [{ 'a': 1 }, { 'b': 2 }];
+ *
+ * var deep = _.cloneDeep(objects);
+ * console.log(deep[0] === objects[0]);
+ * // => false
+ */
+ function cloneDeep(value) {
+ return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
+ }
+
+ /**
+ * This method is like `_.cloneWith` except that it recursively clones `value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to recursively clone.
+ * @param {Function} [customizer] The function to customize cloning.
+ * @returns {*} Returns the deep cloned value.
+ * @see _.cloneWith
+ * @example
+ *
+ * function customizer(value) {
+ * if (_.isElement(value)) {
+ * return value.cloneNode(true);
+ * }
+ * }
+ *
+ * var el = _.cloneDeepWith(document.body, customizer);
+ *
+ * console.log(el === document.body);
+ * // => false
+ * console.log(el.nodeName);
+ * // => 'BODY'
+ * console.log(el.childNodes.length);
+ * // => 20
+ */
+ function cloneDeepWith(value, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);
+ }
+
+ /**
+ * Checks if `object` conforms to `source` by invoking the predicate
+ * properties of `source` with the corresponding property values of `object`.
+ *
+ * **Note:** This method is equivalent to `_.conforms` when `source` is
+ * partially applied.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.14.0
+ * @category Lang
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {boolean} Returns `true` if `object` conforms, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2 };
+ *
+ * _.conformsTo(object, { 'b': function(n) { return n > 1; } });
+ * // => true
+ *
+ * _.conformsTo(object, { 'b': function(n) { return n > 2; } });
+ * // => false
+ */
+ function conformsTo(object, source) {
+ return source == null || baseConformsTo(object, source, keys(source));
+ }
+
+ /**
+ * Performs a
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * comparison between two values to determine if they are equivalent.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1 };
+ * var other = { 'a': 1 };
+ *
+ * _.eq(object, object);
+ * // => true
+ *
+ * _.eq(object, other);
+ * // => false
+ *
+ * _.eq('a', 'a');
+ * // => true
+ *
+ * _.eq('a', Object('a'));
+ * // => false
+ *
+ * _.eq(NaN, NaN);
+ * // => true
+ */
+ function eq(value, other) {
+ return value === other || (value !== value && other !== other);
+ }
+
+ /**
+ * Checks if `value` is greater than `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is greater than `other`,
+ * else `false`.
+ * @see _.lt
+ * @example
+ *
+ * _.gt(3, 1);
+ * // => true
+ *
+ * _.gt(3, 3);
+ * // => false
+ *
+ * _.gt(1, 3);
+ * // => false
+ */
+ var gt = createRelationalOperation(baseGt);
+
+ /**
+ * Checks if `value` is greater than or equal to `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is greater than or equal to
+ * `other`, else `false`.
+ * @see _.lte
+ * @example
+ *
+ * _.gte(3, 1);
+ * // => true
+ *
+ * _.gte(3, 3);
+ * // => true
+ *
+ * _.gte(1, 3);
+ * // => false
+ */
+ var gte = createRelationalOperation(function(value, other) {
+ return value >= other;
+ });
+
+ /**
+ * Checks if `value` is likely an `arguments` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an `arguments` object,
+ * else `false`.
+ * @example
+ *
+ * _.isArguments(function() { return arguments; }());
+ * // => true
+ *
+ * _.isArguments([1, 2, 3]);
+ * // => false
+ */
+ var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
+ return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
+ !propertyIsEnumerable.call(value, 'callee');
+ };
+
+ /**
+ * Checks if `value` is classified as an `Array` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array, else `false`.
+ * @example
+ *
+ * _.isArray([1, 2, 3]);
+ * // => true
+ *
+ * _.isArray(document.body.children);
+ * // => false
+ *
+ * _.isArray('abc');
+ * // => false
+ *
+ * _.isArray(_.noop);
+ * // => false
+ */
+ var isArray = Array.isArray;
+
+ /**
+ * Checks if `value` is classified as an `ArrayBuffer` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
+ * @example
+ *
+ * _.isArrayBuffer(new ArrayBuffer(2));
+ * // => true
+ *
+ * _.isArrayBuffer(new Array(2));
+ * // => false
+ */
+ var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;
+
+ /**
+ * Checks if `value` is array-like. A value is considered array-like if it's
+ * not a function and has a `value.length` that's an integer greater than or
+ * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
+ * @example
+ *
+ * _.isArrayLike([1, 2, 3]);
+ * // => true
+ *
+ * _.isArrayLike(document.body.children);
+ * // => true
+ *
+ * _.isArrayLike('abc');
+ * // => true
+ *
+ * _.isArrayLike(_.noop);
+ * // => false
+ */
+ function isArrayLike(value) {
+ return value != null && isLength(value.length) && !isFunction(value);
+ }
+
+ /**
+ * This method is like `_.isArrayLike` except that it also checks if `value`
+ * is an object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array-like object,
+ * else `false`.
+ * @example
+ *
+ * _.isArrayLikeObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isArrayLikeObject(document.body.children);
+ * // => true
+ *
+ * _.isArrayLikeObject('abc');
+ * // => false
+ *
+ * _.isArrayLikeObject(_.noop);
+ * // => false
+ */
+ function isArrayLikeObject(value) {
+ return isObjectLike(value) && isArrayLike(value);
+ }
+
+ /**
+ * Checks if `value` is classified as a boolean primitive or object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.
+ * @example
+ *
+ * _.isBoolean(false);
+ * // => true
+ *
+ * _.isBoolean(null);
+ * // => false
+ */
+ function isBoolean(value) {
+ return value === true || value === false ||
+ (isObjectLike(value) && baseGetTag(value) == boolTag);
+ }
+
+ /**
+ * Checks if `value` is a buffer.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
+ * @example
+ *
+ * _.isBuffer(new Buffer(2));
+ * // => true
+ *
+ * _.isBuffer(new Uint8Array(2));
+ * // => false
+ */
+ var isBuffer = nativeIsBuffer || stubFalse;
+
+ /**
+ * Checks if `value` is classified as a `Date` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a date object, else `false`.
+ * @example
+ *
+ * _.isDate(new Date);
+ * // => true
+ *
+ * _.isDate('Mon April 23 2012');
+ * // => false
+ */
+ var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;
+
+ /**
+ * Checks if `value` is likely a DOM element.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.
+ * @example
+ *
+ * _.isElement(document.body);
+ * // => true
+ *
+ * _.isElement('');
+ * // => false
+ */
+ function isElement(value) {
+ return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);
+ }
+
+ /**
+ * Checks if `value` is an empty object, collection, map, or set.
+ *
+ * Objects are considered empty if they have no own enumerable string keyed
+ * properties.
+ *
+ * Array-like values such as `arguments` objects, arrays, buffers, strings, or
+ * jQuery-like collections are considered empty if they have a `length` of `0`.
+ * Similarly, maps and sets are considered empty if they have a `size` of `0`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is empty, else `false`.
+ * @example
+ *
+ * _.isEmpty(null);
+ * // => true
+ *
+ * _.isEmpty(true);
+ * // => true
+ *
+ * _.isEmpty(1);
+ * // => true
+ *
+ * _.isEmpty([1, 2, 3]);
+ * // => false
+ *
+ * _.isEmpty({ 'a': 1 });
+ * // => false
+ */
+ function isEmpty(value) {
+ if (value == null) {
+ return true;
+ }
+ if (isArrayLike(value) &&
+ (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||
+ isBuffer(value) || isTypedArray(value) || isArguments(value))) {
+ return !value.length;
+ }
+ var tag = getTag(value);
+ if (tag == mapTag || tag == setTag) {
+ return !value.size;
+ }
+ if (isPrototype(value)) {
+ return !baseKeys(value).length;
+ }
+ for (var key in value) {
+ if (hasOwnProperty.call(value, key)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Performs a deep comparison between two values to determine if they are
+ * equivalent.
+ *
+ * **Note:** This method supports comparing arrays, array buffers, booleans,
+ * date objects, error objects, maps, numbers, `Object` objects, regexes,
+ * sets, strings, symbols, and typed arrays. `Object` objects are compared
+ * by their own, not inherited, enumerable properties. Functions and DOM
+ * nodes are compared by strict equality, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1 };
+ * var other = { 'a': 1 };
+ *
+ * _.isEqual(object, other);
+ * // => true
+ *
+ * object === other;
+ * // => false
+ */
+ function isEqual(value, other) {
+ return baseIsEqual(value, other);
+ }
+
+ /**
+ * This method is like `_.isEqual` except that it accepts `customizer` which
+ * is invoked to compare values. If `customizer` returns `undefined`, comparisons
+ * are handled by the method instead. The `customizer` is invoked with up to
+ * six arguments: (objValue, othValue [, index|key, object, other, stack]).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * function isGreeting(value) {
+ * return /^h(?:i|ello)$/.test(value);
+ * }
+ *
+ * function customizer(objValue, othValue) {
+ * if (isGreeting(objValue) && isGreeting(othValue)) {
+ * return true;
+ * }
+ * }
+ *
+ * var array = ['hello', 'goodbye'];
+ * var other = ['hi', 'goodbye'];
+ *
+ * _.isEqualWith(array, other, customizer);
+ * // => true
+ */
+ function isEqualWith(value, other, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ var result = customizer ? customizer(value, other) : undefined;
+ return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
+ }
+
+ /**
+ * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,
+ * `SyntaxError`, `TypeError`, or `URIError` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an error object, else `false`.
+ * @example
+ *
+ * _.isError(new Error);
+ * // => true
+ *
+ * _.isError(Error);
+ * // => false
+ */
+ function isError(value) {
+ if (!isObjectLike(value)) {
+ return false;
+ }
+ var tag = baseGetTag(value);
+ return tag == errorTag || tag == domExcTag ||
+ (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));
+ }
+
+ /**
+ * Checks if `value` is a finite primitive number.
+ *
+ * **Note:** This method is based on
+ * [`Number.isFinite`](https://mdn.io/Number/isFinite).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.
+ * @example
+ *
+ * _.isFinite(3);
+ * // => true
+ *
+ * _.isFinite(Number.MIN_VALUE);
+ * // => true
+ *
+ * _.isFinite(Infinity);
+ * // => false
+ *
+ * _.isFinite('3');
+ * // => false
+ */
+ function isFinite(value) {
+ return typeof value == 'number' && nativeIsFinite(value);
+ }
+
+ /**
+ * Checks if `value` is classified as a `Function` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a function, else `false`.
+ * @example
+ *
+ * _.isFunction(_);
+ * // => true
+ *
+ * _.isFunction(/abc/);
+ * // => false
+ */
+ function isFunction(value) {
+ if (!isObject(value)) {
+ return false;
+ }
+ // The use of `Object#toString` avoids issues with the `typeof` operator
+ // in Safari 9 which returns 'object' for typed arrays and other constructors.
+ var tag = baseGetTag(value);
+ return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
+ }
+
+ /**
+ * Checks if `value` is an integer.
+ *
+ * **Note:** This method is based on
+ * [`Number.isInteger`](https://mdn.io/Number/isInteger).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an integer, else `false`.
+ * @example
+ *
+ * _.isInteger(3);
+ * // => true
+ *
+ * _.isInteger(Number.MIN_VALUE);
+ * // => false
+ *
+ * _.isInteger(Infinity);
+ * // => false
+ *
+ * _.isInteger('3');
+ * // => false
+ */
+ function isInteger(value) {
+ return typeof value == 'number' && value == toInteger(value);
+ }
+
+ /**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This method is loosely based on
+ * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ * @example
+ *
+ * _.isLength(3);
+ * // => true
+ *
+ * _.isLength(Number.MIN_VALUE);
+ * // => false
+ *
+ * _.isLength(Infinity);
+ * // => false
+ *
+ * _.isLength('3');
+ * // => false
+ */
+ function isLength(value) {
+ return typeof value == 'number' &&
+ value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+ }
+
+ /**
+ * Checks if `value` is the
+ * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
+ * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(_.noop);
+ * // => true
+ *
+ * _.isObject(null);
+ * // => false
+ */
+ function isObject(value) {
+ var type = typeof value;
+ return value != null && (type == 'object' || type == 'function');
+ }
+
+ /**
+ * Checks if `value` is object-like. A value is object-like if it's not `null`
+ * and has a `typeof` result of "object".
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ * @example
+ *
+ * _.isObjectLike({});
+ * // => true
+ *
+ * _.isObjectLike([1, 2, 3]);
+ * // => true
+ *
+ * _.isObjectLike(_.noop);
+ * // => false
+ *
+ * _.isObjectLike(null);
+ * // => false
+ */
+ function isObjectLike(value) {
+ return value != null && typeof value == 'object';
+ }
+
+ /**
+ * Checks if `value` is classified as a `Map` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a map, else `false`.
+ * @example
+ *
+ * _.isMap(new Map);
+ * // => true
+ *
+ * _.isMap(new WeakMap);
+ * // => false
+ */
+ var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
+
+ /**
+ * Performs a partial deep comparison between `object` and `source` to
+ * determine if `object` contains equivalent property values.
+ *
+ * **Note:** This method is equivalent to `_.matches` when `source` is
+ * partially applied.
+ *
+ * Partial comparisons will match empty array and empty object `source`
+ * values against any array or object value, respectively. See `_.isEqual`
+ * for a list of supported value comparisons.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property values to match.
+ * @returns {boolean} Returns `true` if `object` is a match, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2 };
+ *
+ * _.isMatch(object, { 'b': 2 });
+ * // => true
+ *
+ * _.isMatch(object, { 'b': 1 });
+ * // => false
+ */
+ function isMatch(object, source) {
+ return object === source || baseIsMatch(object, source, getMatchData(source));
+ }
+
+ /**
+ * This method is like `_.isMatch` except that it accepts `customizer` which
+ * is invoked to compare values. If `customizer` returns `undefined`, comparisons
+ * are handled by the method instead. The `customizer` is invoked with five
+ * arguments: (objValue, srcValue, index|key, object, source).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property values to match.
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @returns {boolean} Returns `true` if `object` is a match, else `false`.
+ * @example
+ *
+ * function isGreeting(value) {
+ * return /^h(?:i|ello)$/.test(value);
+ * }
+ *
+ * function customizer(objValue, srcValue) {
+ * if (isGreeting(objValue) && isGreeting(srcValue)) {
+ * return true;
+ * }
+ * }
+ *
+ * var object = { 'greeting': 'hello' };
+ * var source = { 'greeting': 'hi' };
+ *
+ * _.isMatchWith(object, source, customizer);
+ * // => true
+ */
+ function isMatchWith(object, source, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return baseIsMatch(object, source, getMatchData(source), customizer);
+ }
+
+ /**
+ * Checks if `value` is `NaN`.
+ *
+ * **Note:** This method is based on
+ * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as
+ * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for
+ * `undefined` and other non-number values.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
+ * @example
+ *
+ * _.isNaN(NaN);
+ * // => true
+ *
+ * _.isNaN(new Number(NaN));
+ * // => true
+ *
+ * isNaN(undefined);
+ * // => true
+ *
+ * _.isNaN(undefined);
+ * // => false
+ */
+ function isNaN(value) {
+ // An `NaN` primitive is the only value that is not equal to itself.
+ // Perform the `toStringTag` check first to avoid errors with some
+ // ActiveX objects in IE.
+ return isNumber(value) && value != +value;
+ }
+
+ /**
+ * Checks if `value` is a pristine native function.
+ *
+ * **Note:** This method can't reliably detect native functions in the presence
+ * of the core-js package because core-js circumvents this kind of detection.
+ * Despite multiple requests, the core-js maintainer has made it clear: any
+ * attempt to fix the detection will be obstructed. As a result, we're left
+ * with little choice but to throw an error. Unfortunately, this also affects
+ * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),
+ * which rely on core-js.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a native function,
+ * else `false`.
+ * @example
+ *
+ * _.isNative(Array.prototype.push);
+ * // => true
+ *
+ * _.isNative(_);
+ * // => false
+ */
+ function isNative(value) {
+ if (isMaskable(value)) {
+ throw new Error(CORE_ERROR_TEXT);
+ }
+ return baseIsNative(value);
+ }
+
+ /**
+ * Checks if `value` is `null`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `null`, else `false`.
+ * @example
+ *
+ * _.isNull(null);
+ * // => true
+ *
+ * _.isNull(void 0);
+ * // => false
+ */
+ function isNull(value) {
+ return value === null;
+ }
+
+ /**
+ * Checks if `value` is `null` or `undefined`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is nullish, else `false`.
+ * @example
+ *
+ * _.isNil(null);
+ * // => true
+ *
+ * _.isNil(void 0);
+ * // => true
+ *
+ * _.isNil(NaN);
+ * // => false
+ */
+ function isNil(value) {
+ return value == null;
+ }
+
+ /**
+ * Checks if `value` is classified as a `Number` primitive or object.
+ *
+ * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are
+ * classified as numbers, use the `_.isFinite` method.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a number, else `false`.
+ * @example
+ *
+ * _.isNumber(3);
+ * // => true
+ *
+ * _.isNumber(Number.MIN_VALUE);
+ * // => true
+ *
+ * _.isNumber(Infinity);
+ * // => true
+ *
+ * _.isNumber('3');
+ * // => false
+ */
+ function isNumber(value) {
+ return typeof value == 'number' ||
+ (isObjectLike(value) && baseGetTag(value) == numberTag);
+ }
+
+ /**
+ * Checks if `value` is a plain object, that is, an object created by the
+ * `Object` constructor or one with a `[[Prototype]]` of `null`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.8.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * }
+ *
+ * _.isPlainObject(new Foo);
+ * // => false
+ *
+ * _.isPlainObject([1, 2, 3]);
+ * // => false
+ *
+ * _.isPlainObject({ 'x': 0, 'y': 0 });
+ * // => true
+ *
+ * _.isPlainObject(Object.create(null));
+ * // => true
+ */
+ function isPlainObject(value) {
+ if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
+ return false;
+ }
+ var proto = getPrototype(value);
+ if (proto === null) {
+ return true;
+ }
+ var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
+ return typeof Ctor == 'function' && Ctor instanceof Ctor &&
+ funcToString.call(Ctor) == objectCtorString;
+ }
+
+ /**
+ * Checks if `value` is classified as a `RegExp` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
+ * @example
+ *
+ * _.isRegExp(/abc/);
+ * // => true
+ *
+ * _.isRegExp('/abc/');
+ * // => false
+ */
+ var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;
+
+ /**
+ * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754
+ * double precision number which isn't the result of a rounded unsafe integer.
+ *
+ * **Note:** This method is based on
+ * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.
+ * @example
+ *
+ * _.isSafeInteger(3);
+ * // => true
+ *
+ * _.isSafeInteger(Number.MIN_VALUE);
+ * // => false
+ *
+ * _.isSafeInteger(Infinity);
+ * // => false
+ *
+ * _.isSafeInteger('3');
+ * // => false
+ */
+ function isSafeInteger(value) {
+ return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;
+ }
+
+ /**
+ * Checks if `value` is classified as a `Set` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a set, else `false`.
+ * @example
+ *
+ * _.isSet(new Set);
+ * // => true
+ *
+ * _.isSet(new WeakSet);
+ * // => false
+ */
+ var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
+
+ /**
+ * Checks if `value` is classified as a `String` primitive or object.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a string, else `false`.
+ * @example
+ *
+ * _.isString('abc');
+ * // => true
+ *
+ * _.isString(1);
+ * // => false
+ */
+ function isString(value) {
+ return typeof value == 'string' ||
+ (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);
+ }
+
+ /**
+ * Checks if `value` is classified as a `Symbol` primitive or object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
+ * @example
+ *
+ * _.isSymbol(Symbol.iterator);
+ * // => true
+ *
+ * _.isSymbol('abc');
+ * // => false
+ */
+ function isSymbol(value) {
+ return typeof value == 'symbol' ||
+ (isObjectLike(value) && baseGetTag(value) == symbolTag);
+ }
+
+ /**
+ * Checks if `value` is classified as a typed array.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
+ * @example
+ *
+ * _.isTypedArray(new Uint8Array);
+ * // => true
+ *
+ * _.isTypedArray([]);
+ * // => false
+ */
+ var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
+
+ /**
+ * Checks if `value` is `undefined`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.
+ * @example
+ *
+ * _.isUndefined(void 0);
+ * // => true
+ *
+ * _.isUndefined(null);
+ * // => false
+ */
+ function isUndefined(value) {
+ return value === undefined;
+ }
+
+ /**
+ * Checks if `value` is classified as a `WeakMap` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.
+ * @example
+ *
+ * _.isWeakMap(new WeakMap);
+ * // => true
+ *
+ * _.isWeakMap(new Map);
+ * // => false
+ */
+ function isWeakMap(value) {
+ return isObjectLike(value) && getTag(value) == weakMapTag;
+ }
+
+ /**
+ * Checks if `value` is classified as a `WeakSet` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.
+ * @example
+ *
+ * _.isWeakSet(new WeakSet);
+ * // => true
+ *
+ * _.isWeakSet(new Set);
+ * // => false
+ */
+ function isWeakSet(value) {
+ return isObjectLike(value) && baseGetTag(value) == weakSetTag;
+ }
+
+ /**
+ * Checks if `value` is less than `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is less than `other`,
+ * else `false`.
+ * @see _.gt
+ * @example
+ *
+ * _.lt(1, 3);
+ * // => true
+ *
+ * _.lt(3, 3);
+ * // => false
+ *
+ * _.lt(3, 1);
+ * // => false
+ */
+ var lt = createRelationalOperation(baseLt);
+
+ /**
+ * Checks if `value` is less than or equal to `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is less than or equal to
+ * `other`, else `false`.
+ * @see _.gte
+ * @example
+ *
+ * _.lte(1, 3);
+ * // => true
+ *
+ * _.lte(3, 3);
+ * // => true
+ *
+ * _.lte(3, 1);
+ * // => false
+ */
+ var lte = createRelationalOperation(function(value, other) {
+ return value <= other;
+ });
+
+ /**
+ * Converts `value` to an array.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {Array} Returns the converted array.
+ * @example
+ *
+ * _.toArray({ 'a': 1, 'b': 2 });
+ * // => [1, 2]
+ *
+ * _.toArray('abc');
+ * // => ['a', 'b', 'c']
+ *
+ * _.toArray(1);
+ * // => []
+ *
+ * _.toArray(null);
+ * // => []
+ */
+ function toArray(value) {
+ if (!value) {
+ return [];
+ }
+ if (isArrayLike(value)) {
+ return isString(value) ? stringToArray(value) : copyArray(value);
+ }
+ if (symIterator && value[symIterator]) {
+ return iteratorToArray(value[symIterator]());
+ }
+ var tag = getTag(value),
+ func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);
+
+ return func(value);
+ }
+
+ /**
+ * Converts `value` to a finite number.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.12.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted number.
+ * @example
+ *
+ * _.toFinite(3.2);
+ * // => 3.2
+ *
+ * _.toFinite(Number.MIN_VALUE);
+ * // => 5e-324
+ *
+ * _.toFinite(Infinity);
+ * // => 1.7976931348623157e+308
+ *
+ * _.toFinite('3.2');
+ * // => 3.2
+ */
+ function toFinite(value) {
+ if (!value) {
+ return value === 0 ? value : 0;
+ }
+ value = toNumber(value);
+ if (value === INFINITY || value === -INFINITY) {
+ var sign = (value < 0 ? -1 : 1);
+ return sign * MAX_INTEGER;
+ }
+ return value === value ? value : 0;
+ }
+
+ /**
+ * Converts `value` to an integer.
+ *
+ * **Note:** This method is loosely based on
+ * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.toInteger(3.2);
+ * // => 3
+ *
+ * _.toInteger(Number.MIN_VALUE);
+ * // => 0
+ *
+ * _.toInteger(Infinity);
+ * // => 1.7976931348623157e+308
+ *
+ * _.toInteger('3.2');
+ * // => 3
+ */
+ function toInteger(value) {
+ var result = toFinite(value),
+ remainder = result % 1;
+
+ return result === result ? (remainder ? result - remainder : result) : 0;
+ }
+
+ /**
+ * Converts `value` to an integer suitable for use as the length of an
+ * array-like object.
+ *
+ * **Note:** This method is based on
+ * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.toLength(3.2);
+ * // => 3
+ *
+ * _.toLength(Number.MIN_VALUE);
+ * // => 0
+ *
+ * _.toLength(Infinity);
+ * // => 4294967295
+ *
+ * _.toLength('3.2');
+ * // => 3
+ */
+ function toLength(value) {
+ return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;
+ }
+
+ /**
+ * Converts `value` to a number.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to process.
+ * @returns {number} Returns the number.
+ * @example
+ *
+ * _.toNumber(3.2);
+ * // => 3.2
+ *
+ * _.toNumber(Number.MIN_VALUE);
+ * // => 5e-324
+ *
+ * _.toNumber(Infinity);
+ * // => Infinity
+ *
+ * _.toNumber('3.2');
+ * // => 3.2
+ */
+ function toNumber(value) {
+ if (typeof value == 'number') {
+ return value;
+ }
+ if (isSymbol(value)) {
+ return NAN;
+ }
+ if (isObject(value)) {
+ var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
+ value = isObject(other) ? (other + '') : other;
+ }
+ if (typeof value != 'string') {
+ return value === 0 ? value : +value;
+ }
+ value = value.replace(reTrim, '');
+ var isBinary = reIsBinary.test(value);
+ return (isBinary || reIsOctal.test(value))
+ ? freeParseInt(value.slice(2), isBinary ? 2 : 8)
+ : (reIsBadHex.test(value) ? NAN : +value);
+ }
+
+ /**
+ * Converts `value` to a plain object flattening inherited enumerable string
+ * keyed properties of `value` to own properties of the plain object.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {Object} Returns the converted plain object.
+ * @example
+ *
+ * function Foo() {
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.assign({ 'a': 1 }, new Foo);
+ * // => { 'a': 1, 'b': 2 }
+ *
+ * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));
+ * // => { 'a': 1, 'b': 2, 'c': 3 }
+ */
+ function toPlainObject(value) {
+ return copyObject(value, keysIn(value));
+ }
+
+ /**
+ * Converts `value` to a safe integer. A safe integer can be compared and
+ * represented correctly.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.toSafeInteger(3.2);
+ * // => 3
+ *
+ * _.toSafeInteger(Number.MIN_VALUE);
+ * // => 0
+ *
+ * _.toSafeInteger(Infinity);
+ * // => 9007199254740991
+ *
+ * _.toSafeInteger('3.2');
+ * // => 3
+ */
+ function toSafeInteger(value) {
+ return value
+ ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)
+ : (value === 0 ? value : 0);
+ }
+
+ /**
+ * Converts `value` to a string. An empty string is returned for `null`
+ * and `undefined` values. The sign of `-0` is preserved.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {string} Returns the converted string.
+ * @example
+ *
+ * _.toString(null);
+ * // => ''
+ *
+ * _.toString(-0);
+ * // => '-0'
+ *
+ * _.toString([1, 2, 3]);
+ * // => '1,2,3'
+ */
+ function toString(value) {
+ return value == null ? '' : baseToString(value);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Assigns own enumerable string keyed properties of source objects to the
+ * destination object. Source objects are applied from left to right.
+ * Subsequent sources overwrite property assignments of previous sources.
+ *
+ * **Note:** This method mutates `object` and is loosely based on
+ * [`Object.assign`](https://mdn.io/Object/assign).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.10.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.assignIn
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * }
+ *
+ * function Bar() {
+ * this.c = 3;
+ * }
+ *
+ * Foo.prototype.b = 2;
+ * Bar.prototype.d = 4;
+ *
+ * _.assign({ 'a': 0 }, new Foo, new Bar);
+ * // => { 'a': 1, 'c': 3 }
+ */
+ var assign = createAssigner(function(object, source) {
+ if (isPrototype(source) || isArrayLike(source)) {
+ copyObject(source, keys(source), object);
+ return;
+ }
+ for (var key in source) {
+ if (hasOwnProperty.call(source, key)) {
+ assignValue(object, key, source[key]);
+ }
+ }
+ });
+
+ /**
+ * This method is like `_.assign` except that it iterates over own and
+ * inherited source properties.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias extend
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.assign
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * }
+ *
+ * function Bar() {
+ * this.c = 3;
+ * }
+ *
+ * Foo.prototype.b = 2;
+ * Bar.prototype.d = 4;
+ *
+ * _.assignIn({ 'a': 0 }, new Foo, new Bar);
+ * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }
+ */
+ var assignIn = createAssigner(function(object, source) {
+ copyObject(source, keysIn(source), object);
+ });
+
+ /**
+ * This method is like `_.assignIn` except that it accepts `customizer`
+ * which is invoked to produce the assigned values. If `customizer` returns
+ * `undefined`, assignment is handled by the method instead. The `customizer`
+ * is invoked with five arguments: (objValue, srcValue, key, object, source).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias extendWith
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} sources The source objects.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @see _.assignWith
+ * @example
+ *
+ * function customizer(objValue, srcValue) {
+ * return _.isUndefined(objValue) ? srcValue : objValue;
+ * }
+ *
+ * var defaults = _.partialRight(_.assignInWith, customizer);
+ *
+ * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
+ * // => { 'a': 1, 'b': 2 }
+ */
+ var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {
+ copyObject(source, keysIn(source), object, customizer);
+ });
+
+ /**
+ * This method is like `_.assign` except that it accepts `customizer`
+ * which is invoked to produce the assigned values. If `customizer` returns
+ * `undefined`, assignment is handled by the method instead. The `customizer`
+ * is invoked with five arguments: (objValue, srcValue, key, object, source).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} sources The source objects.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @see _.assignInWith
+ * @example
+ *
+ * function customizer(objValue, srcValue) {
+ * return _.isUndefined(objValue) ? srcValue : objValue;
+ * }
+ *
+ * var defaults = _.partialRight(_.assignWith, customizer);
+ *
+ * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
+ * // => { 'a': 1, 'b': 2 }
+ */
+ var assignWith = createAssigner(function(object, source, srcIndex, customizer) {
+ copyObject(source, keys(source), object, customizer);
+ });
+
+ /**
+ * Creates an array of values corresponding to `paths` of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.0.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {...(string|string[])} [paths] The property paths to pick.
+ * @returns {Array} Returns the picked values.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
+ *
+ * _.at(object, ['a[0].b.c', 'a[1]']);
+ * // => [3, 4]
+ */
+ var at = flatRest(baseAt);
+
+ /**
+ * Creates an object that inherits from the `prototype` object. If a
+ * `properties` object is given, its own enumerable string keyed properties
+ * are assigned to the created object.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.3.0
+ * @category Object
+ * @param {Object} prototype The object to inherit from.
+ * @param {Object} [properties] The properties to assign to the object.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * function Shape() {
+ * this.x = 0;
+ * this.y = 0;
+ * }
+ *
+ * function Circle() {
+ * Shape.call(this);
+ * }
+ *
+ * Circle.prototype = _.create(Shape.prototype, {
+ * 'constructor': Circle
+ * });
+ *
+ * var circle = new Circle;
+ * circle instanceof Circle;
+ * // => true
+ *
+ * circle instanceof Shape;
+ * // => true
+ */
+ function create(prototype, properties) {
+ var result = baseCreate(prototype);
+ return properties == null ? result : baseAssign(result, properties);
+ }
+
+ /**
+ * Assigns own and inherited enumerable string keyed properties of source
+ * objects to the destination object for all destination properties that
+ * resolve to `undefined`. Source objects are applied from left to right.
+ * Once a property is set, additional values of the same property are ignored.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.defaultsDeep
+ * @example
+ *
+ * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
+ * // => { 'a': 1, 'b': 2 }
+ */
+ var defaults = baseRest(function(object, sources) {
+ object = Object(object);
+
+ var index = -1;
+ var length = sources.length;
+ var guard = length > 2 ? sources[2] : undefined;
+
+ if (guard && isIterateeCall(sources[0], sources[1], guard)) {
+ length = 1;
+ }
+
+ while (++index < length) {
+ var source = sources[index];
+ var props = keysIn(source);
+ var propsIndex = -1;
+ var propsLength = props.length;
+
+ while (++propsIndex < propsLength) {
+ var key = props[propsIndex];
+ var value = object[key];
+
+ if (value === undefined ||
+ (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {
+ object[key] = source[key];
+ }
+ }
+ }
+
+ return object;
+ });
+
+ /**
+ * This method is like `_.defaults` except that it recursively assigns
+ * default properties.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.10.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.defaults
+ * @example
+ *
+ * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });
+ * // => { 'a': { 'b': 2, 'c': 3 } }
+ */
+ var defaultsDeep = baseRest(function(args) {
+ args.push(undefined, customDefaultsMerge);
+ return apply(mergeWith, undefined, args);
+ });
+
+ /**
+ * This method is like `_.find` except that it returns the key of the first
+ * element `predicate` returns truthy for instead of the element itself.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {string|undefined} Returns the key of the matched element,
+ * else `undefined`.
+ * @example
+ *
+ * var users = {
+ * 'barney': { 'age': 36, 'active': true },
+ * 'fred': { 'age': 40, 'active': false },
+ * 'pebbles': { 'age': 1, 'active': true }
+ * };
+ *
+ * _.findKey(users, function(o) { return o.age < 40; });
+ * // => 'barney' (iteration order is not guaranteed)
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findKey(users, { 'age': 1, 'active': true });
+ * // => 'pebbles'
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findKey(users, ['active', false]);
+ * // => 'fred'
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findKey(users, 'active');
+ * // => 'barney'
+ */
+ function findKey(object, predicate) {
+ return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);
+ }
+
+ /**
+ * This method is like `_.findKey` except that it iterates over elements of
+ * a collection in the opposite order.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {string|undefined} Returns the key of the matched element,
+ * else `undefined`.
+ * @example
+ *
+ * var users = {
+ * 'barney': { 'age': 36, 'active': true },
+ * 'fred': { 'age': 40, 'active': false },
+ * 'pebbles': { 'age': 1, 'active': true }
+ * };
+ *
+ * _.findLastKey(users, function(o) { return o.age < 40; });
+ * // => returns 'pebbles' assuming `_.findKey` returns 'barney'
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findLastKey(users, { 'age': 36, 'active': true });
+ * // => 'barney'
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findLastKey(users, ['active', false]);
+ * // => 'fred'
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findLastKey(users, 'active');
+ * // => 'pebbles'
+ */
+ function findLastKey(object, predicate) {
+ return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);
+ }
+
+ /**
+ * Iterates over own and inherited enumerable string keyed properties of an
+ * object and invokes `iteratee` for each property. The iteratee is invoked
+ * with three arguments: (value, key, object). Iteratee functions may exit
+ * iteration early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.3.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forInRight
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forIn(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).
+ */
+ function forIn(object, iteratee) {
+ return object == null
+ ? object
+ : baseFor(object, getIteratee(iteratee, 3), keysIn);
+ }
+
+ /**
+ * This method is like `_.forIn` except that it iterates over properties of
+ * `object` in the opposite order.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forIn
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forInRight(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.
+ */
+ function forInRight(object, iteratee) {
+ return object == null
+ ? object
+ : baseForRight(object, getIteratee(iteratee, 3), keysIn);
+ }
+
+ /**
+ * Iterates over own enumerable string keyed properties of an object and
+ * invokes `iteratee` for each property. The iteratee is invoked with three
+ * arguments: (value, key, object). Iteratee functions may exit iteration
+ * early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.3.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forOwnRight
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forOwn(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'a' then 'b' (iteration order is not guaranteed).
+ */
+ function forOwn(object, iteratee) {
+ return object && baseForOwn(object, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * This method is like `_.forOwn` except that it iterates over properties of
+ * `object` in the opposite order.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forOwn
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forOwnRight(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.
+ */
+ function forOwnRight(object, iteratee) {
+ return object && baseForOwnRight(object, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * Creates an array of function property names from own enumerable properties
+ * of `object`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns the function names.
+ * @see _.functionsIn
+ * @example
+ *
+ * function Foo() {
+ * this.a = _.constant('a');
+ * this.b = _.constant('b');
+ * }
+ *
+ * Foo.prototype.c = _.constant('c');
+ *
+ * _.functions(new Foo);
+ * // => ['a', 'b']
+ */
+ function functions(object) {
+ return object == null ? [] : baseFunctions(object, keys(object));
+ }
+
+ /**
+ * Creates an array of function property names from own and inherited
+ * enumerable properties of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns the function names.
+ * @see _.functions
+ * @example
+ *
+ * function Foo() {
+ * this.a = _.constant('a');
+ * this.b = _.constant('b');
+ * }
+ *
+ * Foo.prototype.c = _.constant('c');
+ *
+ * _.functionsIn(new Foo);
+ * // => ['a', 'b', 'c']
+ */
+ function functionsIn(object) {
+ return object == null ? [] : baseFunctions(object, keysIn(object));
+ }
+
+ /**
+ * Gets the value at `path` of `object`. If the resolved value is
+ * `undefined`, the `defaultValue` is returned in its place.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.7.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the property to get.
+ * @param {*} [defaultValue] The value returned for `undefined` resolved values.
+ * @returns {*} Returns the resolved value.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }] };
+ *
+ * _.get(object, 'a[0].b.c');
+ * // => 3
+ *
+ * _.get(object, ['a', '0', 'b', 'c']);
+ * // => 3
+ *
+ * _.get(object, 'a.b.c', 'default');
+ * // => 'default'
+ */
+ function get(object, path, defaultValue) {
+ var result = object == null ? undefined : baseGet(object, path);
+ return result === undefined ? defaultValue : result;
+ }
+
+ /**
+ * Checks if `path` is a direct property of `object`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path to check.
+ * @returns {boolean} Returns `true` if `path` exists, else `false`.
+ * @example
+ *
+ * var object = { 'a': { 'b': 2 } };
+ * var other = _.create({ 'a': _.create({ 'b': 2 }) });
+ *
+ * _.has(object, 'a');
+ * // => true
+ *
+ * _.has(object, 'a.b');
+ * // => true
+ *
+ * _.has(object, ['a', 'b']);
+ * // => true
+ *
+ * _.has(other, 'a');
+ * // => false
+ */
+ function has(object, path) {
+ return object != null && hasPath(object, path, baseHas);
+ }
+
+ /**
+ * Checks if `path` is a direct or inherited property of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path to check.
+ * @returns {boolean} Returns `true` if `path` exists, else `false`.
+ * @example
+ *
+ * var object = _.create({ 'a': _.create({ 'b': 2 }) });
+ *
+ * _.hasIn(object, 'a');
+ * // => true
+ *
+ * _.hasIn(object, 'a.b');
+ * // => true
+ *
+ * _.hasIn(object, ['a', 'b']);
+ * // => true
+ *
+ * _.hasIn(object, 'b');
+ * // => false
+ */
+ function hasIn(object, path) {
+ return object != null && hasPath(object, path, baseHasIn);
+ }
+
+ /**
+ * Creates an object composed of the inverted keys and values of `object`.
+ * If `object` contains duplicate values, subsequent values overwrite
+ * property assignments of previous values.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.7.0
+ * @category Object
+ * @param {Object} object The object to invert.
+ * @returns {Object} Returns the new inverted object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2, 'c': 1 };
+ *
+ * _.invert(object);
+ * // => { '1': 'c', '2': 'b' }
+ */
+ var invert = createInverter(function(result, value, key) {
+ if (value != null &&
+ typeof value.toString != 'function') {
+ value = nativeObjectToString.call(value);
+ }
+
+ result[value] = key;
+ }, constant(identity));
+
+ /**
+ * This method is like `_.invert` except that the inverted object is generated
+ * from the results of running each element of `object` thru `iteratee`. The
+ * corresponding inverted value of each inverted key is an array of keys
+ * responsible for generating the inverted value. The iteratee is invoked
+ * with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.1.0
+ * @category Object
+ * @param {Object} object The object to invert.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Object} Returns the new inverted object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2, 'c': 1 };
+ *
+ * _.invertBy(object);
+ * // => { '1': ['a', 'c'], '2': ['b'] }
+ *
+ * _.invertBy(object, function(value) {
+ * return 'group' + value;
+ * });
+ * // => { 'group1': ['a', 'c'], 'group2': ['b'] }
+ */
+ var invertBy = createInverter(function(result, value, key) {
+ if (value != null &&
+ typeof value.toString != 'function') {
+ value = nativeObjectToString.call(value);
+ }
+
+ if (hasOwnProperty.call(result, value)) {
+ result[value].push(key);
+ } else {
+ result[value] = [key];
+ }
+ }, getIteratee);
+
+ /**
+ * Invokes the method at `path` of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the method to invoke.
+ * @param {...*} [args] The arguments to invoke the method with.
+ * @returns {*} Returns the result of the invoked method.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };
+ *
+ * _.invoke(object, 'a[0].b.c.slice', 1, 3);
+ * // => [2, 3]
+ */
+ var invoke = baseRest(baseInvoke);
+
+ /**
+ * Creates an array of the own enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects. See the
+ * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
+ * for more details.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keys(new Foo);
+ * // => ['a', 'b'] (iteration order is not guaranteed)
+ *
+ * _.keys('hi');
+ * // => ['0', '1']
+ */
+ function keys(object) {
+ return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
+ }
+
+ /**
+ * Creates an array of the own and inherited enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keysIn(new Foo);
+ * // => ['a', 'b', 'c'] (iteration order is not guaranteed)
+ */
+ function keysIn(object) {
+ return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
+ }
+
+ /**
+ * The opposite of `_.mapValues`; this method creates an object with the
+ * same values as `object` and keys generated by running each own enumerable
+ * string keyed property of `object` thru `iteratee`. The iteratee is invoked
+ * with three arguments: (value, key, object).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.8.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns the new mapped object.
+ * @see _.mapValues
+ * @example
+ *
+ * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {
+ * return key + value;
+ * });
+ * // => { 'a1': 1, 'b2': 2 }
+ */
+ function mapKeys(object, iteratee) {
+ var result = {};
+ iteratee = getIteratee(iteratee, 3);
+
+ baseForOwn(object, function(value, key, object) {
+ baseAssignValue(result, iteratee(value, key, object), value);
+ });
+ return result;
+ }
+
+ /**
+ * Creates an object with the same keys as `object` and values generated
+ * by running each own enumerable string keyed property of `object` thru
+ * `iteratee`. The iteratee is invoked with three arguments:
+ * (value, key, object).
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns the new mapped object.
+ * @see _.mapKeys
+ * @example
+ *
+ * var users = {
+ * 'fred': { 'user': 'fred', 'age': 40 },
+ * 'pebbles': { 'user': 'pebbles', 'age': 1 }
+ * };
+ *
+ * _.mapValues(users, function(o) { return o.age; });
+ * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.mapValues(users, 'age');
+ * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
+ */
+ function mapValues(object, iteratee) {
+ var result = {};
+ iteratee = getIteratee(iteratee, 3);
+
+ baseForOwn(object, function(value, key, object) {
+ baseAssignValue(result, key, iteratee(value, key, object));
+ });
+ return result;
+ }
+
+ /**
+ * This method is like `_.assign` except that it recursively merges own and
+ * inherited enumerable string keyed properties of source objects into the
+ * destination object. Source properties that resolve to `undefined` are
+ * skipped if a destination value exists. Array and plain object properties
+ * are merged recursively. Other objects and value types are overridden by
+ * assignment. Source objects are applied from left to right. Subsequent
+ * sources overwrite property assignments of previous sources.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.5.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = {
+ * 'a': [{ 'b': 2 }, { 'd': 4 }]
+ * };
+ *
+ * var other = {
+ * 'a': [{ 'c': 3 }, { 'e': 5 }]
+ * };
+ *
+ * _.merge(object, other);
+ * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }
+ */
+ var merge = createAssigner(function(object, source, srcIndex) {
+ baseMerge(object, source, srcIndex);
+ });
+
+ /**
+ * This method is like `_.merge` except that it accepts `customizer` which
+ * is invoked to produce the merged values of the destination and source
+ * properties. If `customizer` returns `undefined`, merging is handled by the
+ * method instead. The `customizer` is invoked with six arguments:
+ * (objValue, srcValue, key, object, source, stack).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} sources The source objects.
+ * @param {Function} customizer The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * function customizer(objValue, srcValue) {
+ * if (_.isArray(objValue)) {
+ * return objValue.concat(srcValue);
+ * }
+ * }
+ *
+ * var object = { 'a': [1], 'b': [2] };
+ * var other = { 'a': [3], 'b': [4] };
+ *
+ * _.mergeWith(object, other, customizer);
+ * // => { 'a': [1, 3], 'b': [2, 4] }
+ */
+ var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {
+ baseMerge(object, source, srcIndex, customizer);
+ });
+
+ /**
+ * The opposite of `_.pick`; this method creates an object composed of the
+ * own and inherited enumerable property paths of `object` that are not omitted.
+ *
+ * **Note:** This method is considerably slower than `_.pick`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {...(string|string[])} [paths] The property paths to omit.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.omit(object, ['a', 'c']);
+ * // => { 'b': '2' }
+ */
+ var omit = flatRest(function(object, paths) {
+ var result = {};
+ if (object == null) {
+ return result;
+ }
+ var isDeep = false;
+ paths = arrayMap(paths, function(path) {
+ path = castPath(path, object);
+ isDeep || (isDeep = path.length > 1);
+ return path;
+ });
+ copyObject(object, getAllKeysIn(object), result);
+ if (isDeep) {
+ result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);
+ }
+ var length = paths.length;
+ while (length--) {
+ baseUnset(result, paths[length]);
+ }
+ return result;
+ });
+
+ /**
+ * The opposite of `_.pickBy`; this method creates an object composed of
+ * the own and inherited enumerable string keyed properties of `object` that
+ * `predicate` doesn't return truthy for. The predicate is invoked with two
+ * arguments: (value, key).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {Function} [predicate=_.identity] The function invoked per property.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.omitBy(object, _.isNumber);
+ * // => { 'b': '2' }
+ */
+ function omitBy(object, predicate) {
+ return pickBy(object, negate(getIteratee(predicate)));
+ }
+
+ /**
+ * Creates an object composed of the picked `object` properties.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {...(string|string[])} [paths] The property paths to pick.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.pick(object, ['a', 'c']);
+ * // => { 'a': 1, 'c': 3 }
+ */
+ var pick = flatRest(function(object, paths) {
+ return object == null ? {} : basePick(object, paths);
+ });
+
+ /**
+ * Creates an object composed of the `object` properties `predicate` returns
+ * truthy for. The predicate is invoked with two arguments: (value, key).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {Function} [predicate=_.identity] The function invoked per property.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.pickBy(object, _.isNumber);
+ * // => { 'a': 1, 'c': 3 }
+ */
+ function pickBy(object, predicate) {
+ if (object == null) {
+ return {};
+ }
+ var props = arrayMap(getAllKeysIn(object), function(prop) {
+ return [prop];
+ });
+ predicate = getIteratee(predicate);
+ return basePickBy(object, props, function(value, path) {
+ return predicate(value, path[0]);
+ });
+ }
+
+ /**
+ * This method is like `_.get` except that if the resolved value is a
+ * function it's invoked with the `this` binding of its parent object and
+ * its result is returned.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the property to resolve.
+ * @param {*} [defaultValue] The value returned for `undefined` resolved values.
+ * @returns {*} Returns the resolved value.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };
+ *
+ * _.result(object, 'a[0].b.c1');
+ * // => 3
+ *
+ * _.result(object, 'a[0].b.c2');
+ * // => 4
+ *
+ * _.result(object, 'a[0].b.c3', 'default');
+ * // => 'default'
+ *
+ * _.result(object, 'a[0].b.c3', _.constant('default'));
+ * // => 'default'
+ */
+ function result(object, path, defaultValue) {
+ path = castPath(path, object);
+
+ var index = -1,
+ length = path.length;
+
+ // Ensure the loop is entered when path is empty.
+ if (!length) {
+ length = 1;
+ object = undefined;
+ }
+ while (++index < length) {
+ var value = object == null ? undefined : object[toKey(path[index])];
+ if (value === undefined) {
+ index = length;
+ value = defaultValue;
+ }
+ object = isFunction(value) ? value.call(object) : value;
+ }
+ return object;
+ }
+
+ /**
+ * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
+ * it's created. Arrays are created for missing index properties while objects
+ * are created for all other missing properties. Use `_.setWith` to customize
+ * `path` creation.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.7.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }] };
+ *
+ * _.set(object, 'a[0].b.c', 4);
+ * console.log(object.a[0].b.c);
+ * // => 4
+ *
+ * _.set(object, ['x', '0', 'y', 'z'], 5);
+ * console.log(object.x[0].y.z);
+ * // => 5
+ */
+ function set(object, path, value) {
+ return object == null ? object : baseSet(object, path, value);
+ }
+
+ /**
+ * This method is like `_.set` except that it accepts `customizer` which is
+ * invoked to produce the objects of `path`. If `customizer` returns `undefined`
+ * path creation is handled by the method instead. The `customizer` is invoked
+ * with three arguments: (nsValue, key, nsObject).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {*} value The value to set.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = {};
+ *
+ * _.setWith(object, '[0][1]', 'a', Object);
+ * // => { '0': { '1': 'a' } }
+ */
+ function setWith(object, path, value, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return object == null ? object : baseSet(object, path, value, customizer);
+ }
+
+ /**
+ * Creates an array of own enumerable string keyed-value pairs for `object`
+ * which can be consumed by `_.fromPairs`. If `object` is a map or set, its
+ * entries are returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias entries
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the key-value pairs.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.toPairs(new Foo);
+ * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)
+ */
+ var toPairs = createToPairs(keys);
+
+ /**
+ * Creates an array of own and inherited enumerable string keyed-value pairs
+ * for `object` which can be consumed by `_.fromPairs`. If `object` is a map
+ * or set, its entries are returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias entriesIn
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the key-value pairs.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.toPairsIn(new Foo);
+ * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)
+ */
+ var toPairsIn = createToPairs(keysIn);
+
+ /**
+ * An alternative to `_.reduce`; this method transforms `object` to a new
+ * `accumulator` object which is the result of running each of its own
+ * enumerable string keyed properties thru `iteratee`, with each invocation
+ * potentially mutating the `accumulator` object. If `accumulator` is not
+ * provided, a new object with the same `[[Prototype]]` will be used. The
+ * iteratee is invoked with four arguments: (accumulator, value, key, object).
+ * Iteratee functions may exit iteration early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.3.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {*} [accumulator] The custom accumulator value.
+ * @returns {*} Returns the accumulated value.
+ * @example
+ *
+ * _.transform([2, 3, 4], function(result, n) {
+ * result.push(n *= n);
+ * return n % 2 == 0;
+ * }, []);
+ * // => [4, 9]
+ *
+ * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
+ * (result[value] || (result[value] = [])).push(key);
+ * }, {});
+ * // => { '1': ['a', 'c'], '2': ['b'] }
+ */
+ function transform(object, iteratee, accumulator) {
+ var isArr = isArray(object),
+ isArrLike = isArr || isBuffer(object) || isTypedArray(object);
+
+ iteratee = getIteratee(iteratee, 4);
+ if (accumulator == null) {
+ var Ctor = object && object.constructor;
+ if (isArrLike) {
+ accumulator = isArr ? new Ctor : [];
+ }
+ else if (isObject(object)) {
+ accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};
+ }
+ else {
+ accumulator = {};
+ }
+ }
+ (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {
+ return iteratee(accumulator, value, index, object);
+ });
+ return accumulator;
+ }
+
+ /**
+ * Removes the property at `path` of `object`.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to unset.
+ * @returns {boolean} Returns `true` if the property is deleted, else `false`.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 7 } }] };
+ * _.unset(object, 'a[0].b.c');
+ * // => true
+ *
+ * console.log(object);
+ * // => { 'a': [{ 'b': {} }] };
+ *
+ * _.unset(object, ['a', '0', 'b', 'c']);
+ * // => true
+ *
+ * console.log(object);
+ * // => { 'a': [{ 'b': {} }] };
+ */
+ function unset(object, path) {
+ return object == null ? true : baseUnset(object, path);
+ }
+
+ /**
+ * This method is like `_.set` except that accepts `updater` to produce the
+ * value to set. Use `_.updateWith` to customize `path` creation. The `updater`
+ * is invoked with one argument: (value).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.6.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {Function} updater The function to produce the updated value.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }] };
+ *
+ * _.update(object, 'a[0].b.c', function(n) { return n * n; });
+ * console.log(object.a[0].b.c);
+ * // => 9
+ *
+ * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });
+ * console.log(object.x[0].y.z);
+ * // => 0
+ */
+ function update(object, path, updater) {
+ return object == null ? object : baseUpdate(object, path, castFunction(updater));
+ }
+
+ /**
+ * This method is like `_.update` except that it accepts `customizer` which is
+ * invoked to produce the objects of `path`. If `customizer` returns `undefined`
+ * path creation is handled by the method instead. The `customizer` is invoked
+ * with three arguments: (nsValue, key, nsObject).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.6.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {Function} updater The function to produce the updated value.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = {};
+ *
+ * _.updateWith(object, '[0][1]', _.constant('a'), Object);
+ * // => { '0': { '1': 'a' } }
+ */
+ function updateWith(object, path, updater, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);
+ }
+
+ /**
+ * Creates an array of the own enumerable string keyed property values of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property values.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.values(new Foo);
+ * // => [1, 2] (iteration order is not guaranteed)
+ *
+ * _.values('hi');
+ * // => ['h', 'i']
+ */
+ function values(object) {
+ return object == null ? [] : baseValues(object, keys(object));
+ }
+
+ /**
+ * Creates an array of the own and inherited enumerable string keyed property
+ * values of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property values.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.valuesIn(new Foo);
+ * // => [1, 2, 3] (iteration order is not guaranteed)
+ */
+ function valuesIn(object) {
+ return object == null ? [] : baseValues(object, keysIn(object));
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Clamps `number` within the inclusive `lower` and `upper` bounds.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Number
+ * @param {number} number The number to clamp.
+ * @param {number} [lower] The lower bound.
+ * @param {number} upper The upper bound.
+ * @returns {number} Returns the clamped number.
+ * @example
+ *
+ * _.clamp(-10, -5, 5);
+ * // => -5
+ *
+ * _.clamp(10, -5, 5);
+ * // => 5
+ */
+ function clamp(number, lower, upper) {
+ if (upper === undefined) {
+ upper = lower;
+ lower = undefined;
+ }
+ if (upper !== undefined) {
+ upper = toNumber(upper);
+ upper = upper === upper ? upper : 0;
+ }
+ if (lower !== undefined) {
+ lower = toNumber(lower);
+ lower = lower === lower ? lower : 0;
+ }
+ return baseClamp(toNumber(number), lower, upper);
+ }
+
+ /**
+ * Checks if `n` is between `start` and up to, but not including, `end`. If
+ * `end` is not specified, it's set to `start` with `start` then set to `0`.
+ * If `start` is greater than `end` the params are swapped to support
+ * negative ranges.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.3.0
+ * @category Number
+ * @param {number} number The number to check.
+ * @param {number} [start=0] The start of the range.
+ * @param {number} end The end of the range.
+ * @returns {boolean} Returns `true` if `number` is in the range, else `false`.
+ * @see _.range, _.rangeRight
+ * @example
+ *
+ * _.inRange(3, 2, 4);
+ * // => true
+ *
+ * _.inRange(4, 8);
+ * // => true
+ *
+ * _.inRange(4, 2);
+ * // => false
+ *
+ * _.inRange(2, 2);
+ * // => false
+ *
+ * _.inRange(1.2, 2);
+ * // => true
+ *
+ * _.inRange(5.2, 4);
+ * // => false
+ *
+ * _.inRange(-3, -2, -6);
+ * // => true
+ */
+ function inRange(number, start, end) {
+ start = toFinite(start);
+ if (end === undefined) {
+ end = start;
+ start = 0;
+ } else {
+ end = toFinite(end);
+ }
+ number = toNumber(number);
+ return baseInRange(number, start, end);
+ }
+
+ /**
+ * Produces a random number between the inclusive `lower` and `upper` bounds.
+ * If only one argument is provided a number between `0` and the given number
+ * is returned. If `floating` is `true`, or either `lower` or `upper` are
+ * floats, a floating-point number is returned instead of an integer.
+ *
+ * **Note:** JavaScript follows the IEEE-754 standard for resolving
+ * floating-point values which can produce unexpected results.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.7.0
+ * @category Number
+ * @param {number} [lower=0] The lower bound.
+ * @param {number} [upper=1] The upper bound.
+ * @param {boolean} [floating] Specify returning a floating-point number.
+ * @returns {number} Returns the random number.
+ * @example
+ *
+ * _.random(0, 5);
+ * // => an integer between 0 and 5
+ *
+ * _.random(5);
+ * // => also an integer between 0 and 5
+ *
+ * _.random(5, true);
+ * // => a floating-point number between 0 and 5
+ *
+ * _.random(1.2, 5.2);
+ * // => a floating-point number between 1.2 and 5.2
+ */
+ function random(lower, upper, floating) {
+ if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {
+ upper = floating = undefined;
+ }
+ if (floating === undefined) {
+ if (typeof upper == 'boolean') {
+ floating = upper;
+ upper = undefined;
+ }
+ else if (typeof lower == 'boolean') {
+ floating = lower;
+ lower = undefined;
+ }
+ }
+ if (lower === undefined && upper === undefined) {
+ lower = 0;
+ upper = 1;
+ }
+ else {
+ lower = toFinite(lower);
+ if (upper === undefined) {
+ upper = lower;
+ lower = 0;
+ } else {
+ upper = toFinite(upper);
+ }
+ }
+ if (lower > upper) {
+ var temp = lower;
+ lower = upper;
+ upper = temp;
+ }
+ if (floating || lower % 1 || upper % 1) {
+ var rand = nativeRandom();
+ return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);
+ }
+ return baseRandom(lower, upper);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the camel cased string.
+ * @example
+ *
+ * _.camelCase('Foo Bar');
+ * // => 'fooBar'
+ *
+ * _.camelCase('--foo-bar--');
+ * // => 'fooBar'
+ *
+ * _.camelCase('__FOO_BAR__');
+ * // => 'fooBar'
+ */
+ var camelCase = createCompounder(function(result, word, index) {
+ word = word.toLowerCase();
+ return result + (index ? capitalize(word) : word);
+ });
+
+ /**
+ * Converts the first character of `string` to upper case and the remaining
+ * to lower case.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to capitalize.
+ * @returns {string} Returns the capitalized string.
+ * @example
+ *
+ * _.capitalize('FRED');
+ * // => 'Fred'
+ */
+ function capitalize(string) {
+ return upperFirst(toString(string).toLowerCase());
+ }
+
+ /**
+ * Deburrs `string` by converting
+ * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)
+ * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)
+ * letters to basic Latin letters and removing
+ * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to deburr.
+ * @returns {string} Returns the deburred string.
+ * @example
+ *
+ * _.deburr('déjà vu');
+ * // => 'deja vu'
+ */
+ function deburr(string) {
+ string = toString(string);
+ return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');
+ }
+
+ /**
+ * Checks if `string` ends with the given target string.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to inspect.
+ * @param {string} [target] The string to search for.
+ * @param {number} [position=string.length] The position to search up to.
+ * @returns {boolean} Returns `true` if `string` ends with `target`,
+ * else `false`.
+ * @example
+ *
+ * _.endsWith('abc', 'c');
+ * // => true
+ *
+ * _.endsWith('abc', 'b');
+ * // => false
+ *
+ * _.endsWith('abc', 'b', 2);
+ * // => true
+ */
+ function endsWith(string, target, position) {
+ string = toString(string);
+ target = baseToString(target);
+
+ var length = string.length;
+ position = position === undefined
+ ? length
+ : baseClamp(toInteger(position), 0, length);
+
+ var end = position;
+ position -= target.length;
+ return position >= 0 && string.slice(position, end) == target;
+ }
+
+ /**
+ * Converts the characters "&", "<", ">", '"', and "'" in `string` to their
+ * corresponding HTML entities.
+ *
+ * **Note:** No other characters are escaped. To escape additional
+ * characters use a third-party library like [_he_](https://mths.be/he).
+ *
+ * Though the ">" character is escaped for symmetry, characters like
+ * ">" and "/" don't need escaping in HTML and have no special meaning
+ * unless they're part of a tag or unquoted attribute value. See
+ * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)
+ * (under "semi-related fun fact") for more details.
+ *
+ * When working with HTML you should always
+ * [quote attribute values](http://wonko.com/post/html-escaping) to reduce
+ * XSS vectors.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category String
+ * @param {string} [string=''] The string to escape.
+ * @returns {string} Returns the escaped string.
+ * @example
+ *
+ * _.escape('fred, barney, & pebbles');
+ * // => 'fred, barney, & pebbles'
+ */
+ function escape(string) {
+ string = toString(string);
+ return (string && reHasUnescapedHtml.test(string))
+ ? string.replace(reUnescapedHtml, escapeHtmlChar)
+ : string;
+ }
+
+ /**
+ * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+",
+ * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to escape.
+ * @returns {string} Returns the escaped string.
+ * @example
+ *
+ * _.escapeRegExp('[lodash](https://lodash.com/)');
+ * // => '\[lodash\]\(https://lodash\.com/\)'
+ */
+ function escapeRegExp(string) {
+ string = toString(string);
+ return (string && reHasRegExpChar.test(string))
+ ? string.replace(reRegExpChar, '\\$&')
+ : string;
+ }
+
+ /**
+ * Converts `string` to
+ * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the kebab cased string.
+ * @example
+ *
+ * _.kebabCase('Foo Bar');
+ * // => 'foo-bar'
+ *
+ * _.kebabCase('fooBar');
+ * // => 'foo-bar'
+ *
+ * _.kebabCase('__FOO_BAR__');
+ * // => 'foo-bar'
+ */
+ var kebabCase = createCompounder(function(result, word, index) {
+ return result + (index ? '-' : '') + word.toLowerCase();
+ });
+
+ /**
+ * Converts `string`, as space separated words, to lower case.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the lower cased string.
+ * @example
+ *
+ * _.lowerCase('--Foo-Bar--');
+ * // => 'foo bar'
+ *
+ * _.lowerCase('fooBar');
+ * // => 'foo bar'
+ *
+ * _.lowerCase('__FOO_BAR__');
+ * // => 'foo bar'
+ */
+ var lowerCase = createCompounder(function(result, word, index) {
+ return result + (index ? ' ' : '') + word.toLowerCase();
+ });
+
+ /**
+ * Converts the first character of `string` to lower case.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the converted string.
+ * @example
+ *
+ * _.lowerFirst('Fred');
+ * // => 'fred'
+ *
+ * _.lowerFirst('FRED');
+ * // => 'fRED'
+ */
+ var lowerFirst = createCaseFirst('toLowerCase');
+
+ /**
+ * Pads `string` on the left and right sides if it's shorter than `length`.
+ * Padding characters are truncated if they can't be evenly divided by `length`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to pad.
+ * @param {number} [length=0] The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padded string.
+ * @example
+ *
+ * _.pad('abc', 8);
+ * // => ' abc '
+ *
+ * _.pad('abc', 8, '_-');
+ * // => '_-abc_-_'
+ *
+ * _.pad('abc', 3);
+ * // => 'abc'
+ */
+ function pad(string, length, chars) {
+ string = toString(string);
+ length = toInteger(length);
+
+ var strLength = length ? stringSize(string) : 0;
+ if (!length || strLength >= length) {
+ return string;
+ }
+ var mid = (length - strLength) / 2;
+ return (
+ createPadding(nativeFloor(mid), chars) +
+ string +
+ createPadding(nativeCeil(mid), chars)
+ );
+ }
+
+ /**
+ * Pads `string` on the right side if it's shorter than `length`. Padding
+ * characters are truncated if they exceed `length`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to pad.
+ * @param {number} [length=0] The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padded string.
+ * @example
+ *
+ * _.padEnd('abc', 6);
+ * // => 'abc '
+ *
+ * _.padEnd('abc', 6, '_-');
+ * // => 'abc_-_'
+ *
+ * _.padEnd('abc', 3);
+ * // => 'abc'
+ */
+ function padEnd(string, length, chars) {
+ string = toString(string);
+ length = toInteger(length);
+
+ var strLength = length ? stringSize(string) : 0;
+ return (length && strLength < length)
+ ? (string + createPadding(length - strLength, chars))
+ : string;
+ }
+
+ /**
+ * Pads `string` on the left side if it's shorter than `length`. Padding
+ * characters are truncated if they exceed `length`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to pad.
+ * @param {number} [length=0] The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padded string.
+ * @example
+ *
+ * _.padStart('abc', 6);
+ * // => ' abc'
+ *
+ * _.padStart('abc', 6, '_-');
+ * // => '_-_abc'
+ *
+ * _.padStart('abc', 3);
+ * // => 'abc'
+ */
+ function padStart(string, length, chars) {
+ string = toString(string);
+ length = toInteger(length);
+
+ var strLength = length ? stringSize(string) : 0;
+ return (length && strLength < length)
+ ? (createPadding(length - strLength, chars) + string)
+ : string;
+ }
+
+ /**
+ * Converts `string` to an integer of the specified radix. If `radix` is
+ * `undefined` or `0`, a `radix` of `10` is used unless `value` is a
+ * hexadecimal, in which case a `radix` of `16` is used.
+ *
+ * **Note:** This method aligns with the
+ * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category String
+ * @param {string} string The string to convert.
+ * @param {number} [radix=10] The radix to interpret `value` by.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.parseInt('08');
+ * // => 8
+ *
+ * _.map(['6', '08', '10'], _.parseInt);
+ * // => [6, 8, 10]
+ */
+ function parseInt(string, radix, guard) {
+ if (guard || radix == null) {
+ radix = 0;
+ } else if (radix) {
+ radix = +radix;
+ }
+ return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);
+ }
+
+ /**
+ * Repeats the given string `n` times.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to repeat.
+ * @param {number} [n=1] The number of times to repeat the string.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {string} Returns the repeated string.
+ * @example
+ *
+ * _.repeat('*', 3);
+ * // => '***'
+ *
+ * _.repeat('abc', 2);
+ * // => 'abcabc'
+ *
+ * _.repeat('abc', 0);
+ * // => ''
+ */
+ function repeat(string, n, guard) {
+ if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {
+ n = 1;
+ } else {
+ n = toInteger(n);
+ }
+ return baseRepeat(toString(string), n);
+ }
+
+ /**
+ * Replaces matches for `pattern` in `string` with `replacement`.
+ *
+ * **Note:** This method is based on
+ * [`String#replace`](https://mdn.io/String/replace).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to modify.
+ * @param {RegExp|string} pattern The pattern to replace.
+ * @param {Function|string} replacement The match replacement.
+ * @returns {string} Returns the modified string.
+ * @example
+ *
+ * _.replace('Hi Fred', 'Fred', 'Barney');
+ * // => 'Hi Barney'
+ */
+ function replace() {
+ var args = arguments,
+ string = toString(args[0]);
+
+ return args.length < 3 ? string : string.replace(args[1], args[2]);
+ }
+
+ /**
+ * Converts `string` to
+ * [snake case](https://en.wikipedia.org/wiki/Snake_case).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the snake cased string.
+ * @example
+ *
+ * _.snakeCase('Foo Bar');
+ * // => 'foo_bar'
+ *
+ * _.snakeCase('fooBar');
+ * // => 'foo_bar'
+ *
+ * _.snakeCase('--FOO-BAR--');
+ * // => 'foo_bar'
+ */
+ var snakeCase = createCompounder(function(result, word, index) {
+ return result + (index ? '_' : '') + word.toLowerCase();
+ });
+
+ /**
+ * Splits `string` by `separator`.
+ *
+ * **Note:** This method is based on
+ * [`String#split`](https://mdn.io/String/split).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to split.
+ * @param {RegExp|string} separator The separator pattern to split by.
+ * @param {number} [limit] The length to truncate results to.
+ * @returns {Array} Returns the string segments.
+ * @example
+ *
+ * _.split('a-b-c', '-', 2);
+ * // => ['a', 'b']
+ */
+ function split(string, separator, limit) {
+ if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {
+ separator = limit = undefined;
+ }
+ limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;
+ if (!limit) {
+ return [];
+ }
+ string = toString(string);
+ if (string && (
+ typeof separator == 'string' ||
+ (separator != null && !isRegExp(separator))
+ )) {
+ separator = baseToString(separator);
+ if (!separator && hasUnicode(string)) {
+ return castSlice(stringToArray(string), 0, limit);
+ }
+ }
+ return string.split(separator, limit);
+ }
+
+ /**
+ * Converts `string` to
+ * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.1.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the start cased string.
+ * @example
+ *
+ * _.startCase('--foo-bar--');
+ * // => 'Foo Bar'
+ *
+ * _.startCase('fooBar');
+ * // => 'Foo Bar'
+ *
+ * _.startCase('__FOO_BAR__');
+ * // => 'FOO BAR'
+ */
+ var startCase = createCompounder(function(result, word, index) {
+ return result + (index ? ' ' : '') + upperFirst(word);
+ });
+
+ /**
+ * Checks if `string` starts with the given target string.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to inspect.
+ * @param {string} [target] The string to search for.
+ * @param {number} [position=0] The position to search from.
+ * @returns {boolean} Returns `true` if `string` starts with `target`,
+ * else `false`.
+ * @example
+ *
+ * _.startsWith('abc', 'a');
+ * // => true
+ *
+ * _.startsWith('abc', 'b');
+ * // => false
+ *
+ * _.startsWith('abc', 'b', 1);
+ * // => true
+ */
+ function startsWith(string, target, position) {
+ string = toString(string);
+ position = position == null
+ ? 0
+ : baseClamp(toInteger(position), 0, string.length);
+
+ target = baseToString(target);
+ return string.slice(position, position + target.length) == target;
+ }
+
+ /**
+ * Creates a compiled template function that can interpolate data properties
+ * in "interpolate" delimiters, HTML-escape interpolated data properties in
+ * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data
+ * properties may be accessed as free variables in the template. If a setting
+ * object is given, it takes precedence over `_.templateSettings` values.
+ *
+ * **Note:** In the development build `_.template` utilizes
+ * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)
+ * for easier debugging.
+ *
+ * For more information on precompiling templates see
+ * [lodash's custom builds documentation](https://lodash.com/custom-builds).
+ *
+ * For more information on Chrome extension sandboxes see
+ * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category String
+ * @param {string} [string=''] The template string.
+ * @param {Object} [options={}] The options object.
+ * @param {RegExp} [options.escape=_.templateSettings.escape]
+ * The HTML "escape" delimiter.
+ * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]
+ * The "evaluate" delimiter.
+ * @param {Object} [options.imports=_.templateSettings.imports]
+ * An object to import into the template as free variables.
+ * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]
+ * The "interpolate" delimiter.
+ * @param {string} [options.sourceURL='lodash.templateSources[n]']
+ * The sourceURL of the compiled template.
+ * @param {string} [options.variable='obj']
+ * The data object variable name.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the compiled template function.
+ * @example
+ *
+ * // Use the "interpolate" delimiter to create a compiled template.
+ * var compiled = _.template('hello <%= user %>!');
+ * compiled({ 'user': 'fred' });
+ * // => 'hello fred!'
+ *
+ * // Use the HTML "escape" delimiter to escape data property values.
+ * var compiled = _.template('<%- value %>');
+ * compiled({ 'value': '