diff --git a/MADE-Uno.sln b/MADE-Uno.sln
index 53284e7..9950765 100644
--- a/MADE-Uno.sln
+++ b/MADE-Uno.sln
@@ -41,6 +41,8 @@ Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "MADE.UI.ViewManagement", "s
 EndProject
 Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "MADE.UI.Controls.ChipBox", "src\MADE.UI.Controls.ChipBox\MADE.UI.Controls.ChipBox.csproj", "{D1A16208-5A34-4CC1-B175-01B5AC99E69E}"
 EndProject
+Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "MADE.UI.Controls.RichEditToolbar", "src\MADE.UI.Controls.RichEditToolbar\MADE.UI.Controls.RichEditToolbar.csproj", "{258FB310-DC02-488C-97C7-CD1226EAAEC8}"
+EndProject
 Global
 	GlobalSection(SharedMSBuildProjectFiles) = preSolution
 		samples\MADE.Samples\MADE.Samples.Shared\MADE.Samples.Shared.projitems*{04f1b32d-9056-43fc-b4c2-b8c5481bdacb}*SharedItemsImports = 4
@@ -1032,6 +1034,76 @@ Global
 		{D1A16208-5A34-4CC1-B175-01B5AC99E69E}.Release|x64.Build.0 = Release|Any CPU
 		{D1A16208-5A34-4CC1-B175-01B5AC99E69E}.Release|x86.ActiveCfg = Release|Any CPU
 		{D1A16208-5A34-4CC1-B175-01B5AC99E69E}.Release|x86.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|Any CPU.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|Any CPU.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|ARM.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|ARM.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|ARM64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|ARM64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|iPhone.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|iPhone.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|iPhoneSimulator.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|iPhoneSimulator.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|x64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|x64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|x86.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Ad-Hoc|x86.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|Any CPU.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|Any CPU.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|ARM.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|ARM.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|ARM64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|ARM64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|iPhone.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|iPhone.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|iPhoneSimulator.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|iPhoneSimulator.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|x64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|x64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|x86.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.AppStore|x86.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|Any CPU.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|ARM.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|ARM.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|ARM64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|ARM64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|iPhone.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|iPhone.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|iPhoneSimulator.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|iPhoneSimulator.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|x64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|x64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|x86.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Debug|x86.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|Any CPU.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|Any CPU.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|ARM.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|ARM.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|ARM64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|ARM64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|iPhone.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|iPhone.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|iPhoneSimulator.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|iPhoneSimulator.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|x64.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|x64.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|x86.ActiveCfg = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Package|x86.Build.0 = Debug|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|Any CPU.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|Any CPU.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|ARM.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|ARM.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|ARM64.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|ARM64.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|iPhone.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|iPhone.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|iPhoneSimulator.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|iPhoneSimulator.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|x64.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|x64.Build.0 = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|x86.ActiveCfg = Release|Any CPU
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8}.Release|x86.Build.0 = Release|Any CPU
 	EndGlobalSection
 	GlobalSection(SolutionProperties) = preSolution
 		HideSolutionNode = FALSE
@@ -1053,6 +1125,7 @@ Global
 		{F8D00106-0598-45E7-B92E-EF408249C02E} = {01380FB8-F8A7-4416-AABA-5407574B7723}
 		{442D1E25-FFD1-405D-A1FC-40CAFCAD190C} = {01380FB8-F8A7-4416-AABA-5407574B7723}
 		{D1A16208-5A34-4CC1-B175-01B5AC99E69E} = {01380FB8-F8A7-4416-AABA-5407574B7723}
+		{258FB310-DC02-488C-97C7-CD1226EAAEC8} = {01380FB8-F8A7-4416-AABA-5407574B7723}
 	EndGlobalSection
 	GlobalSection(ExtensibilityGlobals) = postSolution
 		SolutionGuid = {3921AD86-E6C0-4436-8880-2D9EDFAD6151}
diff --git a/assets/SampleIcons.afdesign b/assets/SampleIcons.afdesign
index 601622e..be606b8 100644
Binary files a/assets/SampleIcons.afdesign and b/assets/SampleIcons.afdesign differ
diff --git a/docs/articles/features/ui-controls-richedittoolbar.md b/docs/articles/features/ui-controls-richedittoolbar.md
new file mode 100644
index 0000000..dac9d74
--- /dev/null
+++ b/docs/articles/features/ui-controls-richedittoolbar.md
@@ -0,0 +1,125 @@
+---
+uid: package-ui-controls-richedittoolbar
+title: Using the RichEditToolbar control
+---
+
+# Using the RichEditToolbar control
+
+The `MADE.UI.Controls.RichEditToolbar` element is a custom-built UI element that works with [Uno's supported platforms](https://platform.uno/) that provides customizable and extensible collection of buttons that activate rich text features in an associated [RichEditBox](https://docs.microsoft.com/en-us/uwp/api/Windows.UI.Xaml.Controls.RichEditBox?view=winrt-22000).
+
+Shown below is the visuals for the control in its default state.
+
+<img src="../../images/RichEditToolbar.png" alt="RichEditToolbar with default button options" />
+
+## Example usage
+
+```xml
+<Page
+    x:Class="ChipBoxSample.MainPage"
+    xmlns="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
+    xmlns:x="http://schemas.microsoft.com/winfx/2006/xaml"
+    xmlns:controls="using:MADE.UI.Controls"
+    xmlns:d="http://schemas.microsoft.com/expression/blend/2008"
+    xmlns:mc="http://schemas.openxmlformats.org/markup-compatibility/2006"
+    xmlns:win="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
+    Background="{ThemeResource ApplicationPageBackgroundThemeBrush}"
+    mc:Ignorable="d">
+
+  <Grid>
+      <Grid.RowDefinitions>
+          <RowDefinition Height="Auto" />
+          <RowDefinition Height="*" />
+      </Grid.RowDefinitions>
+
+      <controls:RichEditToolbar
+          x:Name="RichEditToolbarControl"
+          TargetRichEditBox="{x:Bind RichEditBox}"
+          ShowFontSizeOptions="True"
+          ShowTextColorOptions="True"
+          ShowListStyleOptions="True">
+          <controls:RichEditToolbar.CustomOptions>
+              <AppBarSeparator />
+              <AppBarButton x:Name="SaveButton" Icon="Save" Label="Save" />
+              <AppBarButton x:Name="UndoButton" Icon="Undo" Label="Undo" />
+              <AppBarButton x:Name="RedoButton" Icon="Redo" Label="Redo" />
+          </controls:RichEditToolbar.CustomOptions>
+      </controls:RichEditToolbar>
+
+      <win:RichEditBox x:Name="RichEditBox" Grid.Row="1" />
+  </Grid>
+</Page>
+```
+
+## Supporting Uno Platform
+
+Unfortunately, Uno Platform doesn't currently support the use of `RichEditBox`.
+
+The control has been custom built now to structure around the unsupported direct attachment to a `RichEditBox` exposing events that allow a developer to use the control in a different context in Uno Platform applications.
+
+You can listen for these changes by hooking onto the following `RichEditToolbar` events:
+
+- FontSizeChanged
+- FontStyleChanged
+- TextColorChanged
+- ListStyleChanged
+
+These are fired when the user changes the font size, font style, text color, or list style. Each event provides an event argument that provides the new values for that setting.
+
+## Customizing the ChipBox
+
+The control has many customization properties that are exposed to tailor the experience for your application.
+
+### Custom toolbar options
+
+As well as the out-of-the-box options available, the `RichEditToolbar` allows developers to extend the options with additional custom options.
+
+These can be added to the `CustomOptions` collection on the control either via XAML or in code.
+
+```xml
+<controls:RichEditToolbar>
+    <controls:RichEditToolbar.CustomOptions>
+        <AppBarButton x:Name="SaveButton" Icon="Save" Label="Save" />
+        <AppBarButton x:Name="UndoButton" Icon="Undo" Label="Undo" />
+        <AppBarButton x:Name="RedoButton" Icon="Redo" Label="Redo" />
+    </controls:RichEditToolbar.CustomOptions>
+</controls:RichEditToolbar>
+```
+
+### Custom text color options
+
+Exposed on the `RichEditToolbar` is a `CustomTextColorOptions` property that allows you to provide your own custom set of colors to display in the text color options panel.
+
+Here's an example of adding these via code.
+
+```csharp
+private static readonly IList<RichEditToolbarTextColorOption> CustomTextColorOptions =
+            new List<RichEditToolbarTextColorOption>
+            {
+                new() {Name = "Pastel pink", Color = "#ff80ff"},
+                new() {Name = "Pastel orange", Color = "#ffc680"},
+                new() {Name = "Pastel yellow", Color = "#ffff80"},
+                new() {Name = "Pastel green", Color = "#80ff9e"},
+                new() {Name = "Pastel blue", Color = "#80d6ff"},
+                new() {Name = "Pastel purple", Color = "#bcb3ff"},
+            };
+
+this.RichEditToolbar.CustomTextColorOptions = this.CustomTextColorOptions;
+```
+
+### Showing font size options
+
+By default, font size options are shown to the user when using the control out-of-the-box.
+
+If these options are not desired, set the `ShowFontSizeOptions` property to `False`.
+
+### Showing text color options
+
+By default, text color options are shown to the user when using the control out-of-the-box.
+
+If these options are not desired, set the `ShowTextColorOptions` property to `False`.
+
+### Showing list style options
+
+By default, list style options are shown to the user when using the control out-of-the-box.
+
+If these options are not desired, set the `ShowListStyleOptions` property to `False`.
diff --git a/docs/images/RichEditToolbar.png b/docs/images/RichEditToolbar.png
new file mode 100644
index 0000000..99c9dcd
Binary files /dev/null and b/docs/images/RichEditToolbar.png differ
diff --git a/samples/MADE.Samples/MADE.Samples.Droid/MADE.Samples.Droid.csproj b/samples/MADE.Samples/MADE.Samples.Droid/MADE.Samples.Droid.csproj
index 35b84b9..bf04261 100644
--- a/samples/MADE.Samples/MADE.Samples.Droid/MADE.Samples.Droid.csproj
+++ b/samples/MADE.Samples/MADE.Samples.Droid/MADE.Samples.Droid.csproj
@@ -125,6 +125,10 @@
       <Project>{774fd8d5-ccc1-4eed-aa14-f7069bfae5ce}</Project>
       <Name>MADE.UI.Controls.FilePicker</Name>
     </ProjectReference>
+    <ProjectReference Include="..\..\..\src\MADE.UI.Controls.RichEditToolbar\MADE.UI.Controls.RichEditToolbar.csproj">
+      <Project>{258fb310-dc02-488c-97c7-cd1226eaaec8}</Project>
+      <Name>MADE.UI.Controls.RichEditToolbar</Name>
+    </ProjectReference>
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.Validator\MADE.UI.Controls.Validator.csproj">
       <Project>{e2b20928-dae2-4a9c-bdaf-d787b4f48391}</Project>
       <Name>MADE.UI.Controls.Validator</Name>
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Home/ViewModels/MainPageViewModel.cs b/samples/MADE.Samples/MADE.Samples.Shared/Features/Home/ViewModels/MainPageViewModel.cs
index 319915d..076b69f 100644
--- a/samples/MADE.Samples/MADE.Samples.Shared/Features/Home/ViewModels/MainPageViewModel.cs
+++ b/samples/MADE.Samples/MADE.Samples.Shared/Features/Home/ViewModels/MainPageViewModel.cs
@@ -47,7 +47,11 @@ private static ICollection<SampleGroup> GetSampleGroups()
                     new Sample(
                         "InputValidator",
                         typeof(InputValidatorPage),
-                        "/Features/Samples/Assets/InputValidator/InputValidator.png")
+                        "/Features/Samples/Assets/InputValidator/InputValidator.png"),
+                    new Sample(
+                        "RichEditToolbar",
+                        typeof(RichEditToolbarPage),
+                        "/Features/Samples/Assets/RichEditToolbar/RichEditToolbar.png")
                 }
             };
 
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/CustomRichEditToolbarCode.txt b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/CustomRichEditToolbarCode.txt
new file mode 100644
index 0000000..658c97c
--- /dev/null
+++ b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/CustomRichEditToolbarCode.txt
@@ -0,0 +1,2 @@
+// When used in an Uno Platform app, RichEditBox is not supported so the TargetRichEditBox must be set in code.
+this.CustomRichEditToolbarControl.TargetRichEditBox = this.CustomRichEditBox;
\ No newline at end of file
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/CustomRichEditToolbarXaml.txt b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/CustomRichEditToolbarXaml.txt
new file mode 100644
index 0000000..ff741bd
--- /dev/null
+++ b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/CustomRichEditToolbarXaml.txt
@@ -0,0 +1,21 @@
+<Grid>
+    <Grid.RowDefinitions>
+        <RowDefinition Height="Auto" />
+        <RowDefinition Height="*" />
+    </Grid.RowDefinitions>
+    
+    <made:RichEditToolbar
+        x:Name="CustomRichEditToolbarControl"
+        ShowFontSizeOptions="True"
+        ShowTextColorOptions="True"
+        ShowListStyleOptions="True">
+        <made:RichEditToolbar.CustomOptions>
+            <AppBarSeparator />
+            <AppBarButton x:Name="SaveButton" Icon="Save" Label="Save" />
+            <AppBarButton x:Name="UndoButton" Icon="Undo" Label="Undo" />
+            <AppBarButton x:Name="RedoButton" Icon="Redo" Label="Redo" />
+        </made:RichEditToolbar.CustomOptions>
+    </made:RichEditToolbar>
+
+    <win:RichEditBox x:Name="CustomRichEditBox" Grid.Row="1" />
+</Grid>
\ No newline at end of file
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/RichEditToolbar.png b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/RichEditToolbar.png
new file mode 100644
index 0000000..3afee5d
Binary files /dev/null and b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Assets/RichEditToolbar/RichEditToolbar.png differ
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Pages/RichEditToolbarPage.xaml b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Pages/RichEditToolbarPage.xaml
new file mode 100644
index 0000000..6c78502
--- /dev/null
+++ b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Pages/RichEditToolbarPage.xaml
@@ -0,0 +1,80 @@
+<pages:MvvmPage
+    x:Class="MADE.Samples.Features.Samples.Pages.RichEditToolbarPage"
+    xmlns="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
+    xmlns:x="http://schemas.microsoft.com/winfx/2006/xaml"
+    xmlns:d="http://schemas.microsoft.com/expression/blend/2008"
+    xmlns:made="using:MADE.UI.Controls"
+    xmlns:mc="http://schemas.openxmlformats.org/markup-compatibility/2006"
+    xmlns:pages="using:MADE.UI.Views.Navigation.Pages"
+    xmlns:samples="using:MADE.Samples.Infrastructure.Controls"
+    xmlns:win="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
+    mc:Ignorable="d"
+    Background="{ThemeResource ApplicationPageBackgroundThemeBrush}">
+
+    <Grid>
+        <Grid.RowDefinitions>
+            <RowDefinition Height="Auto" />
+            <RowDefinition Height="*" />
+        </Grid.RowDefinitions>
+
+        <win:CommandBar>
+            <win:CommandBar.Content>
+                <Button
+                    x:Name="BackButton"
+                    VerticalAlignment="Top"
+                    Command="{x:Bind ViewModel.GoBackCommand}"
+                    IsEnabled="{x:Bind Frame.CanGoBack, Mode=OneWay}"
+                    Style="{StaticResource NavigationBackButtonNormalStyle}"
+                    ToolTipService.ToolTip="Back" />
+            </win:CommandBar.Content>
+        </win:CommandBar>
+
+        <Grid Grid.Row="1" Padding="16">
+            <Grid.RowDefinitions>
+                <RowDefinition Height="Auto" />
+                <RowDefinition Height="Auto" />
+                <RowDefinition Height="*" />
+            </Grid.RowDefinitions>
+
+            <TextBlock
+                Margin="0,0,0,16"
+                Style="{StaticResource TitleTextBlockStyle}"
+                Text="RichEditToolbar control" />
+
+            <TextBlock
+                Grid.Row="1"
+                Margin="0,0,0,24"
+                Style="{StaticResource BaseTextBlockStyle}"
+                Text="The RichEditToolbar is a custom-built UI element that provides customizable and extensible collection of buttons that activate rich text features in an associated RichEditBox." />
+
+            <ScrollViewer Grid.Row="2">
+                <Grid>
+                    <samples:SampleControl
+                        CodeSource="RichEditToolbar/CustomRichEditToolbarCode.txt"
+                        SampleName="A RichEditToolbar showing standard font style, size, and color options, plus additional buttons"
+                        XamlSource="RichEditToolbar/CustomRichEditToolbarXaml.txt">
+                        <samples:SampleControl.Sample>
+                            <Grid>
+                                <Grid.RowDefinitions>
+                                    <RowDefinition Height="Auto" />
+                                    <RowDefinition Height="*" />
+                                </Grid.RowDefinitions>
+
+                                <made:RichEditToolbar x:Name="CustomRichEditToolbarControl">
+                                    <made:RichEditToolbar.CustomOptions>
+                                        <AppBarSeparator />
+                                        <AppBarButton x:Name="SaveButton" Icon="Save" Label="Save" />
+                                        <AppBarButton x:Name="UndoButton" Icon="Undo" Label="Undo" />
+                                        <AppBarButton x:Name="RedoButton" Icon="Redo" Label="Redo" />
+                                    </made:RichEditToolbar.CustomOptions>
+                                </made:RichEditToolbar>
+
+                                <win:RichEditBox x:Name="CustomRichEditBox" Grid.Row="1" />
+                            </Grid>
+                        </samples:SampleControl.Sample>
+                    </samples:SampleControl>
+                </Grid>
+            </ScrollViewer>
+        </Grid>
+    </Grid>
+</pages:MvvmPage>
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Pages/RichEditToolbarPage.xaml.cs b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Pages/RichEditToolbarPage.xaml.cs
new file mode 100644
index 0000000..520f364
--- /dev/null
+++ b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/Pages/RichEditToolbarPage.xaml.cs
@@ -0,0 +1,25 @@
+namespace MADE.Samples.Features.Samples.Pages
+{
+    using CommunityToolkit.Mvvm.Messaging;
+    using MADE.Samples.Features.Samples.ViewModels;
+    using MADE.UI.Views.Navigation;
+    using MADE.UI.Views.Navigation.Pages;
+    using Microsoft.Extensions.DependencyInjection;
+
+    public sealed partial class RichEditToolbarPage : MvvmPage
+    {
+        public RichEditToolbarPage()
+        {
+            this.InitializeComponent();
+            this.DataContext = new RichEditToolbarPageViewModel(
+                App.Services.GetService<INavigationService>(),
+                App.Services.GetService<IMessenger>());
+
+#if WINDOWS_UWP
+            this.CustomRichEditToolbarControl.TargetRichEditBox = this.CustomRichEditBox;
+#endif
+        }
+
+        public RichEditToolbarPageViewModel ViewModel => this.DataContext as RichEditToolbarPageViewModel;
+    }
+}
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/ViewModels/RichEditToolbarPageViewModel.cs b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/ViewModels/RichEditToolbarPageViewModel.cs
new file mode 100644
index 0000000..56fe39a
--- /dev/null
+++ b/samples/MADE.Samples/MADE.Samples.Shared/Features/Samples/ViewModels/RichEditToolbarPageViewModel.cs
@@ -0,0 +1,14 @@
+namespace MADE.Samples.Features.Samples.ViewModels
+{
+    using CommunityToolkit.Mvvm.Messaging;
+    using MADE.UI.Views.Navigation;
+    using MADE.UI.Views.Navigation.ViewModels;
+
+    public class RichEditToolbarPageViewModel : PageViewModel
+    {
+        public RichEditToolbarPageViewModel(INavigationService navigationService, IMessenger messenger)
+            : base(navigationService, messenger)
+        {
+        }
+    }
+}
\ No newline at end of file
diff --git a/samples/MADE.Samples/MADE.Samples.Shared/MADE.Samples.Shared.projitems b/samples/MADE.Samples/MADE.Samples.Shared/MADE.Samples.Shared.projitems
index 9b5dec4..59c075d 100644
--- a/samples/MADE.Samples/MADE.Samples.Shared/MADE.Samples.Shared.projitems
+++ b/samples/MADE.Samples/MADE.Samples.Shared/MADE.Samples.Shared.projitems
@@ -39,6 +39,9 @@
     <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\Pages\InputValidatorPage.xaml.cs">
       <DependentUpon>InputValidatorPage.xaml</DependentUpon>
     </Compile>
+    <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\Pages\RichEditToolbarPage.xaml.cs">
+      <DependentUpon>RichEditToolbarPage.xaml</DependentUpon>
+    </Compile>
     <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\Pages\WindowManagerPage.xaml.cs">
       <DependentUpon>WindowManagerPage.xaml</DependentUpon>
     </Compile>
@@ -47,6 +50,7 @@
     <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\ViewModels\DropDownListPageViewModel.cs" />
     <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\ViewModels\FilePickerPageViewModel.cs" />
     <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\ViewModels\InputValidatorPageViewModel.cs" />
+    <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\ViewModels\RichEditToolbarPageViewModel.cs" />
     <Compile Include="$(MSBuildThisFileDirectory)Features\Samples\ViewModels\WindowManagerPageViewModel.cs" />
     <Compile Include="$(MSBuildThisFileDirectory)Infrastructure\Controls\SampleControl.xaml.cs">
       <DependentUpon>SampleControl.xaml</DependentUpon>
@@ -108,6 +112,17 @@
       <Generator>
       </Generator>
     </Content>
+    <Content Include="$(MSBuildThisFileDirectory)Features\Samples\Assets\RichEditToolbar\CustomRichEditToolbarCode.txt">
+      <SubType>Designer</SubType>
+      <Generator>
+      </Generator>
+    </Content>
+    <Content Include="$(MSBuildThisFileDirectory)Features\Samples\Assets\RichEditToolbar\CustomRichEditToolbarXaml.txt">
+      <SubType>Designer</SubType>
+      <Generator>
+      </Generator>
+    </Content>
+    <Content Include="$(MSBuildThisFileDirectory)Features\Samples\Assets\RichEditToolbar\RichEditToolbar.png" />
     <Content Include="$(MSBuildThisFileDirectory)Features\Samples\Assets\WindowManager\WindowManagerCode.txt">
       <SubType>Designer</SubType>
       <Generator>
@@ -143,6 +158,10 @@
       <SubType>Designer</SubType>
       <Generator>MSBuild:Compile</Generator>
     </Page>
+    <Page Include="$(MSBuildThisFileDirectory)Features\Samples\Pages\RichEditToolbarPage.xaml">
+      <SubType>Designer</SubType>
+      <Generator>MSBuild:Compile</Generator>
+    </Page>
     <Page Include="$(MSBuildThisFileDirectory)Features\Samples\Pages\WindowManagerPage.xaml">
       <SubType>Designer</SubType>
       <Generator>MSBuild:Compile</Generator>
diff --git a/samples/MADE.Samples/MADE.Samples.UWP/MADE.Samples.UWP.csproj b/samples/MADE.Samples/MADE.Samples.UWP/MADE.Samples.UWP.csproj
index 3204217..0c0f2a8 100644
--- a/samples/MADE.Samples/MADE.Samples.UWP/MADE.Samples.UWP.csproj
+++ b/samples/MADE.Samples/MADE.Samples.UWP/MADE.Samples.UWP.csproj
@@ -170,6 +170,10 @@
       <Project>{774fd8d5-ccc1-4eed-aa14-f7069bfae5ce}</Project>
       <Name>MADE.UI.Controls.FilePicker</Name>
     </ProjectReference>
+    <ProjectReference Include="..\..\..\src\MADE.UI.Controls.RichEditToolbar\MADE.UI.Controls.RichEditToolbar.csproj">
+      <Project>{258fb310-dc02-488c-97c7-cd1226eaaec8}</Project>
+      <Name>MADE.UI.Controls.RichEditToolbar</Name>
+    </ProjectReference>
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.Validator\MADE.UI.Controls.Validator.csproj">
       <Project>{e2b20928-dae2-4a9c-bdaf-d787b4f48391}</Project>
       <Name>MADE.UI.Controls.Validator</Name>
diff --git a/samples/MADE.Samples/MADE.Samples.Wasm/MADE.Samples.Wasm.csproj b/samples/MADE.Samples/MADE.Samples.Wasm/MADE.Samples.Wasm.csproj
index aa6382a..e922015 100644
--- a/samples/MADE.Samples/MADE.Samples.Wasm/MADE.Samples.Wasm.csproj
+++ b/samples/MADE.Samples/MADE.Samples.Wasm/MADE.Samples.Wasm.csproj
@@ -66,6 +66,7 @@
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.ChipBox\MADE.UI.Controls.ChipBox.csproj" />
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.DropDownList\MADE.UI.Controls.DropDownList.csproj" />
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.FilePicker\MADE.UI.Controls.FilePicker.csproj" />
+    <ProjectReference Include="..\..\..\src\MADE.UI.Controls.RichEditToolbar\MADE.UI.Controls.RichEditToolbar.csproj" />
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.Validator\MADE.UI.Controls.Validator.csproj" />
     <ProjectReference Include="..\..\..\src\MADE.UI.Styling\MADE.UI.Styling.csproj" />
     <ProjectReference Include="..\..\..\src\MADE.UI.ViewManagement\MADE.UI.ViewManagement.csproj" />
diff --git a/samples/MADE.Samples/MADE.Samples.iOS/MADE.Samples.iOS.csproj b/samples/MADE.Samples/MADE.Samples.iOS/MADE.Samples.iOS.csproj
index 8eae050..2cc2ab8 100644
--- a/samples/MADE.Samples/MADE.Samples.iOS/MADE.Samples.iOS.csproj
+++ b/samples/MADE.Samples/MADE.Samples.iOS/MADE.Samples.iOS.csproj
@@ -190,6 +190,10 @@
       <Project>{774fd8d5-ccc1-4eed-aa14-f7069bfae5ce}</Project>
       <Name>MADE.UI.Controls.FilePicker</Name>
     </ProjectReference>
+    <ProjectReference Include="..\..\..\src\MADE.UI.Controls.RichEditToolbar\MADE.UI.Controls.RichEditToolbar.csproj">
+      <Project>{258fb310-dc02-488c-97c7-cd1226eaaec8}</Project>
+      <Name>MADE.UI.Controls.RichEditToolbar</Name>
+    </ProjectReference>
     <ProjectReference Include="..\..\..\src\MADE.UI.Controls.Validator\MADE.UI.Controls.Validator.csproj">
       <Project>{e2b20928-dae2-4a9c-bdaf-d787b4f48391}</Project>
       <Name>MADE.UI.Controls.Validator</Name>
diff --git a/src/MADE.UI.Controls.ChipBox/Chip.cs b/src/MADE.UI.Controls.ChipBox/Chip.cs
index f891e42..540c2fc 100644
--- a/src/MADE.UI.Controls.ChipBox/Chip.cs
+++ b/src/MADE.UI.Controls.ChipBox/Chip.cs
@@ -83,7 +83,7 @@ protected override AutomationPeer OnCreateAutomationPeer()
         }
 
         /// <summary>
-        /// Loads the relevant control template so that it's parts can be referenced.
+        /// Loads the relevant control template so that its parts can be referenced.
         /// </summary>
         protected override void OnApplyTemplate()
         {
diff --git a/src/MADE.UI.Controls.ChipBox/ChipBox.cs b/src/MADE.UI.Controls.ChipBox/ChipBox.cs
index eeede25..0bab8b9 100644
--- a/src/MADE.UI.Controls.ChipBox/ChipBox.cs
+++ b/src/MADE.UI.Controls.ChipBox/ChipBox.cs
@@ -278,7 +278,7 @@ public ICommand ChipRemoveCommand
         public ItemsControl ChipItemsView { get; private set; }
 
         /// <summary>
-        /// Loads the relevant control template so that it's parts can be referenced.
+        /// Loads the relevant control template so that its parts can be referenced.
         /// </summary>
         protected override void OnApplyTemplate()
         {
diff --git a/src/MADE.UI.Controls.DropDownList/DropDownList.cs b/src/MADE.UI.Controls.DropDownList/DropDownList.cs
index d0ac8d9..2cd9c31 100644
--- a/src/MADE.UI.Controls.DropDownList/DropDownList.cs
+++ b/src/MADE.UI.Controls.DropDownList/DropDownList.cs
@@ -423,7 +423,7 @@ public double MaxDropDownHeight
         public ListView DropDownContent { get; private set; }
 
         /// <summary>
-        /// Loads the relevant control template so that it's parts can be referenced.
+        /// Loads the relevant control template so that its parts can be referenced.
         /// </summary>
         protected override void OnApplyTemplate()
         {
diff --git a/src/MADE.UI.Controls.FilePicker/FilePicker.cs b/src/MADE.UI.Controls.FilePicker/FilePicker.cs
index a0eedce..bf21130 100644
--- a/src/MADE.UI.Controls.FilePicker/FilePicker.cs
+++ b/src/MADE.UI.Controls.FilePicker/FilePicker.cs
@@ -215,7 +215,7 @@ public Style ItemsViewStyle
         public ListViewBase ItemsView { get; private set; }
 
         /// <summary>
-        /// Loads the relevant control template so that it's parts can be referenced.
+        /// Loads the relevant control template so that its parts can be referenced.
         /// </summary>
         protected override void OnApplyTemplate()
         {
diff --git a/src/MADE.UI.Controls.RichEditToolbar/IRichEditToolbar.cs b/src/MADE.UI.Controls.RichEditToolbar/IRichEditToolbar.cs
new file mode 100644
index 0000000..c75fa8f
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/IRichEditToolbar.cs
@@ -0,0 +1,67 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using System.Collections.Generic;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Controls;
+
+    /// <summary>
+    /// Defines an interface for a customizable and extensible collection of buttons that activate rich text features in an associated <see cref="RichEditBox"/>.
+    /// </summary>
+    public interface IRichEditToolbar
+    {
+        /// <summary>
+        /// Occurs when the font size has changed.
+        /// </summary>
+        event RichEditToolbarFontSizeChangedEventHandler FontSizeChanged;
+
+        /// <summary>
+        /// Occurs when the font style has changed.
+        /// </summary>
+        event RichEditToolbarFontStyleChangedEventHandler FontStyleChanged;
+
+        /// <summary>
+        /// Occurs when the text color has changed.
+        /// </summary>
+        event RichEditToolbarTextColorChangedEventHandler TextColorChanged;
+
+        /// <summary>
+        /// Occurs when the list style has changed.
+        /// </summary>
+        event RichEditToolbarListStyleChangedEventHandler ListStyleChanged;
+
+#if WINDOWS_UWP
+        /// <summary>
+        /// Gets or sets the associated <see cref="RichEditBox"/> control.
+        /// </summary>
+        RichEditBox TargetRichEditBox { get; set; }
+#endif
+
+        /// <summary>
+        /// Gets or sets the additional custom options.
+        /// </summary>
+        IList<ICommandBarElement> CustomOptions { get; set; }
+
+        /// <summary>
+        /// Gets or sets the additional custom text color options.
+        /// </summary>
+        IList<RichEditToolbarTextColorOption> CustomTextColorOptions { get; set; }
+
+        /// <summary>
+        /// Gets or sets a value indicating whether to show font size options.
+        /// </summary>
+        bool ShowFontSizeOptions { get; set; }
+
+        /// <summary>
+        /// Gets or sets a value indicating whether to show text color options.
+        /// </summary>
+        bool ShowTextColorOptions { get; set; }
+
+        /// <summary>
+        /// Gets or sets a value indicating whether to show list style options.
+        /// </summary>
+        bool ShowListStyleOptions { get; set; }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/MADE.UI.Controls.RichEditToolbar.csproj b/src/MADE.UI.Controls.RichEditToolbar/MADE.UI.Controls.RichEditToolbar.csproj
new file mode 100644
index 0000000..969cb35
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/MADE.UI.Controls.RichEditToolbar.csproj
@@ -0,0 +1,39 @@
+<Project Sdk="MSBuild.Sdk.Extras">
+
+  <PropertyGroup>
+    <TargetFrameworks>uap10.0.19041;MonoAndroid11.0;xamarinios10;netstandard2.0;xamarinmac20</TargetFrameworks>
+    <GeneratePackageOnBuild>true</GeneratePackageOnBuild>
+    <Product>MADE.NET UI RichEditToolbar Control</Product>
+    <Description>
+      This package includes UI components for Windows and Uno Platform applications such as:
+      - RichEditToolbar for providing an extension bar for a RichEditBox to easily customize input text.
+    </Description>
+    <PackageTags>MADE UI Views Controls RichEditBox Input Toolbar Windows Android iOS macOS Xamarin Uno</PackageTags>
+    <GenerateLibraryLayout>true</GenerateLibraryLayout>
+    <RootNamespace>MADE.UI.Controls.RichEditToolbarControl</RootNamespace>
+  </PropertyGroup>
+
+  <ItemGroup Condition="'$(TargetFrameworkIdentifier)' == 'MonoAndroid' or '$(TargetFrameworkIdentifier)' == 'Xamarin.iOS' or '$(TargetFrameworkIdentifier)' == '.NETStandard' or '$(TargetFrameworkIdentifier)' == 'Xamarin.Mac'">
+    <PackageReference Include="Uno.UI" Version="4.1.8" />
+  </ItemGroup>
+
+  <ItemGroup>
+    <PackageReference Include="MADE.Collections" Version="1.4.0" />
+    <PackageReference Include="MADE.Data.Validation" Version="1.4.0" />
+    <PackageReference Include="MADE.Foundation" Version="1.4.0" />
+  </ItemGroup>
+
+  <ItemGroup>
+    <Page Include="**\*.xaml" Exclude="bin\**\*.xaml;obj\**\*.xaml">
+      <SubType>Designer</SubType>
+      <Generator>MSBuild:Compile</Generator>
+      <CopyToOutputDirectory>PreserveNewest</CopyToOutputDirectory>
+    </Page>
+  </ItemGroup>
+
+  <ItemGroup>
+    <ProjectReference Include="..\MADE.UI\MADE.UI.csproj" />
+    <ProjectReference Include="..\MADE.UI.Styling\MADE.UI.Styling.csproj" />
+  </ItemGroup>
+
+</Project>
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.FontSize.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.FontSize.cs
new file mode 100644
index 0000000..d44de92
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.FontSize.cs
@@ -0,0 +1,122 @@
+namespace MADE.UI.Controls
+{
+    using MADE.UI.Extensions;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Controls;
+
+    /// <summary>
+    /// Defines the font size logic for the <see cref="RichEditToolbar"/>.
+    /// </summary>
+    public partial class RichEditToolbar
+    {
+        /// <summary>
+        /// Identifies the <see cref="ShowFontSizeOptions"/> dependency property.
+        /// </summary>
+        public static readonly DependencyProperty ShowFontSizeOptionsProperty = DependencyProperty.Register(
+            nameof(ShowFontSizeOptions),
+            typeof(bool),
+            typeof(RichEditToolbar),
+            new PropertyMetadata(true, (o, args) => ((RichEditToolbar)o).UpdateFontSizeOptionsVisibility()));
+
+        private const string RichEditToolbarIncreaseTextSizeButtonPart = "RichEditToolbarIncreaseTextSizeButton";
+        private const string RichEditToolbarDecreaseTextSizeButtonPart = "RichEditToolbarDecreaseTextSizeButton";
+        private const int DefaultFontSize = 11;
+
+#if !WINDOWS_UWP
+        private int currentFontSize = DefaultFontSize;
+#endif
+
+        /// <summary>
+        /// Occurs when the font size has changed.
+        /// </summary>
+        public event RichEditToolbarFontSizeChangedEventHandler FontSizeChanged;
+
+        /// <summary>
+        /// Gets or sets a value indicating whether to show font size options.
+        /// </summary>
+        public bool ShowFontSizeOptions
+        {
+            get => (bool)GetValue(ShowFontSizeOptionsProperty);
+            set => SetValue(ShowFontSizeOptionsProperty, value);
+        }
+
+        /// <summary>
+        /// Gets the view representing the button for increasing the font size.
+        /// </summary>
+        public Button FontSizeIncreaseButton { get; private set; }
+
+        /// <summary>
+        /// Gets the view representing the button for decreasing the font size.
+        /// </summary>
+        public Button FontSizeDecreaseButton { get; private set; }
+
+        private void SetupFontSizeOptions()
+        {
+            this.FontSizeIncreaseButton = this.GetChildView<Button>(RichEditToolbarIncreaseTextSizeButtonPart);
+            this.FontSizeDecreaseButton = this.GetChildView<Button>(RichEditToolbarDecreaseTextSizeButtonPart);
+
+            this.UpdateFontSizeOptionsVisibility();
+
+            if (this.FontSizeDecreaseButton != null)
+            {
+                this.FontSizeDecreaseButton.Click += this.OnFontSizeDecreaseClicked;
+            }
+
+            if (this.FontSizeIncreaseButton != null)
+            {
+                this.FontSizeIncreaseButton.Click += this.OnFontSizeIncreaseClicked;
+            }
+        }
+
+        private void UpdateFontSizeOptionsVisibility()
+        {
+            this.FontSizeIncreaseButton?.SetVisible(this.ShowFontSizeOptions);
+            this.FontSizeDecreaseButton?.SetVisible(this.ShowFontSizeOptions);
+        }
+
+        private void ResetFontSizeOptions()
+        {
+            if (this.FontSizeDecreaseButton != null)
+            {
+                this.FontSizeDecreaseButton.Click -= this.OnFontSizeDecreaseClicked;
+            }
+
+            if (this.FontSizeIncreaseButton != null)
+            {
+                this.FontSizeIncreaseButton.Click -= this.OnFontSizeIncreaseClicked;
+            }
+        }
+
+        private void OnFontSizeIncreaseClicked(object sender, RoutedEventArgs e)
+        {
+#if WINDOWS_UWP
+            if (this.TargetRichEditBox == null || this.TargetRichEditBox.Document.Selection.CharacterFormat.Size <= 0)
+            {
+                return;
+            }
+
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.Size++;
+
+            this.FontSizeChanged?.Invoke(this, new RichEditToolbarFontSizeChangedEventArgs(this.TargetRichEditBox.Document.Selection.CharacterFormat.Size));
+#else
+            currentFontSize++;
+            this.FontSizeChanged?.Invoke(this, new RichEditToolbarFontSizeChangedEventArgs(currentFontSize));
+#endif
+        }
+
+        private void OnFontSizeDecreaseClicked(object sender, RoutedEventArgs e)
+        {
+#if WINDOWS_UWP
+            if (this.TargetRichEditBox == null || this.TargetRichEditBox.Document.Selection.CharacterFormat.Size <= 1)
+            {
+                return;
+            }
+
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.Size--;
+#else
+            currentFontSize--;
+            this.FontSizeChanged?.Invoke(this, new RichEditToolbarFontSizeChangedEventArgs(currentFontSize));
+#endif
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.FontStyle.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.FontStyle.cs
new file mode 100644
index 0000000..97d1bc1
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.FontStyle.cs
@@ -0,0 +1,192 @@
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Text;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Controls.Primitives;
+
+    /// <summary>
+    /// Defines the font style logic for the <see cref="RichEditToolbar"/>.
+    /// </summary>
+    public partial class RichEditToolbar
+    {
+        private const string RichEditToolbarBoldButtonPart = "RichEditToolbarBoldButton";
+        private const string RichEditToolbarItalicButtonPart = "RichEditToolbarItalicButton";
+        private const string RichEditToolbarUnderlineButtonPart = "RichEditToolbarUnderlineButton";
+
+        /// <summary>
+        /// Occurs when the font style has changed.
+        /// </summary>
+        public event RichEditToolbarFontStyleChangedEventHandler FontStyleChanged;
+
+        /// <summary>
+        /// Gets the view representing the button for toggling bold text.
+        /// </summary>
+        public ToggleButton BoldButton { get; private set; }
+
+        /// <summary>
+        /// Gets the view representing the button for toggling italic text.
+        /// </summary>
+        public ToggleButton ItalicButton { get; private set; }
+
+        /// <summary>
+        /// Gets the view representing the button for toggling underline text.
+        /// </summary>
+        public ToggleButton UnderlineButton { get; private set; }
+
+        private void SetupFontStyleOptions()
+        {
+            this.BoldButton = this.GetChildView<ToggleButton>(RichEditToolbarBoldButtonPart);
+            this.ItalicButton = this.GetChildView<ToggleButton>(RichEditToolbarItalicButtonPart);
+            this.UnderlineButton = this.GetChildView<ToggleButton>(RichEditToolbarUnderlineButtonPart);
+
+            if (this.BoldButton != null)
+            {
+                this.BoldButton.Checked += this.OnBoldButtonChecked;
+                this.BoldButton.Unchecked += this.OnBoldButtonChecked;
+            }
+
+            if (this.ItalicButton != null)
+            {
+                this.ItalicButton.Checked += this.OnItalicButtonChecked;
+                this.ItalicButton.Unchecked += this.OnItalicButtonChecked;
+            }
+
+            if (this.UnderlineButton != null)
+            {
+                this.UnderlineButton.Checked += this.OnUnderlineButtonChecked;
+                this.UnderlineButton.Unchecked += this.OnUnderlineButtonChecked;
+            }
+        }
+
+#if WINDOWS_UWP
+        private void UpdateActiveFontStyleOptions()
+        {
+            if (this.BoldButton != null)
+            {
+                this.BoldButton.IsChecked = this.TargetRichEditBox
+                    .Document
+                    .Selection
+                    .CharacterFormat
+                    .Bold == FormatEffect.On;
+            }
+
+            if (this.ItalicButton != null)
+            {
+                this.ItalicButton.IsChecked = this.TargetRichEditBox
+                    .Document
+                    .Selection
+                    .CharacterFormat
+                    .Italic == FormatEffect.On;
+            }
+
+            if (this.UnderlineButton != null)
+            {
+                this.UnderlineButton.IsChecked = this.TargetRichEditBox
+                    .Document
+                    .Selection
+                    .CharacterFormat
+                    .Underline == UnderlineType.Single;
+            }
+
+            this.EmitFontStyleChanged();
+        }
+#endif
+
+        private void ResetFontStyleOptions()
+        {
+            if (this.BoldButton != null)
+            {
+                this.BoldButton.Checked -= this.OnBoldButtonChecked;
+                this.BoldButton.Unchecked -= this.OnBoldButtonChecked;
+            }
+
+            if (this.ItalicButton != null)
+            {
+                this.ItalicButton.Checked -= this.OnItalicButtonChecked;
+                this.ItalicButton.Unchecked -= this.OnItalicButtonChecked;
+            }
+
+            if (this.UnderlineButton != null)
+            {
+                this.UnderlineButton.Checked -= this.OnUnderlineButtonChecked;
+                this.UnderlineButton.Unchecked -= this.OnUnderlineButtonChecked;
+            }
+        }
+
+        private void OnBoldButtonChecked(object sender, RoutedEventArgs e)
+        {
+            if (this.BoldButton == null
+#if WINDOWS_UWP
+                || this.TargetRichEditBox == null
+#endif
+                )
+            {
+                return;
+            }
+
+#if WINDOWS_UWP
+            var isChecked = this.BoldButton.IsChecked ?? false;
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.Bold =
+                isChecked ? FormatEffect.On : FormatEffect.Off;
+#endif
+
+            this.EmitFontStyleChanged();
+        }
+
+        private void OnItalicButtonChecked(object sender, RoutedEventArgs e)
+        {
+            if (this.ItalicButton == null
+#if WINDOWS_UWP
+                || this.TargetRichEditBox == null
+#endif
+                )
+            {
+                return;
+            }
+
+#if WINDOWS_UWP
+            var isChecked = this.ItalicButton.IsChecked ?? false;
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.Italic =
+                isChecked ? FormatEffect.On : FormatEffect.Off;
+#endif
+
+            this.EmitFontStyleChanged();
+        }
+
+        private void OnUnderlineButtonChecked(object sender, RoutedEventArgs e)
+        {
+            if (this.UnderlineButton == null
+#if WINDOWS_UWP
+                || this.TargetRichEditBox == null
+#endif
+                )
+            {
+                return;
+            }
+
+#if WINDOWS_UWP
+            var isChecked = this.UnderlineButton.IsChecked ?? false;
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.Underline =
+                isChecked ? UnderlineType.Single : UnderlineType.None;
+#endif
+
+            this.EmitFontStyleChanged();
+        }
+
+        private void EmitFontStyleChanged()
+        {
+            if (this.FontStyleChanged == null)
+            {
+                return;
+            }
+
+            var bold = this.BoldButton?.IsChecked ?? false;
+            var italic = this.ItalicButton?.IsChecked ?? false;
+            var underline = this.UnderlineButton?.IsChecked ?? false;
+
+            this.FontStyleChanged.Invoke(
+                this,
+                new RichEditToolbarFontStyleChangedEventArgs(bold, italic, underline));
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.ListStyle.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.ListStyle.cs
new file mode 100644
index 0000000..55c669f
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.ListStyle.cs
@@ -0,0 +1,201 @@
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Text;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Controls.Primitives;
+    using Extensions;
+
+    /// <summary>
+    /// Defines the list style logic for the <see cref="RichEditToolbar"/>.
+    /// </summary>
+    public partial class RichEditToolbar
+    {
+        /// <summary>
+        /// Identifies the <see cref="ShowListStyleOptions"/> dependency property.
+        /// </summary>
+        public static readonly DependencyProperty ShowListStyleOptionsProperty = DependencyProperty.Register(
+            nameof(ShowListStyleOptions),
+            typeof(bool),
+            typeof(RichEditToolbar),
+            new PropertyMetadata(true, (o, args) => ((RichEditToolbar)o).UpdateListStyleOptionsVisibility()));
+
+        private const string RichEditToolbarBulletListButtonPart = "RichEditToolbarBulletListButton";
+        private const string RichEditToolbarNumberListButtonPart = "RichEditToolbarNumberListButton";
+
+        /// <summary>
+        /// Occurs when the list style has changed.
+        /// </summary>
+        public event RichEditToolbarListStyleChangedEventHandler ListStyleChanged;
+
+        /// <summary>
+        /// Gets or sets a value indicating whether to show list style options.
+        /// </summary>
+        public bool ShowListStyleOptions
+        {
+            get => (bool)GetValue(ShowListStyleOptionsProperty);
+            set => SetValue(ShowListStyleOptionsProperty, value);
+        }
+
+        /// <summary>
+        /// Gets the view representing the button for toggling bullet list.
+        /// </summary>
+        public ToggleButton BulletListButton { get; private set; }
+
+        /// <summary>
+        /// Gets the view representing the button for toggling number list.
+        /// </summary>
+        public ToggleButton NumberListButton { get; private set; }
+
+        private void SetupListStyleOptions()
+        {
+            this.BulletListButton = this.GetChildView<ToggleButton>(RichEditToolbarBulletListButtonPart);
+            this.NumberListButton = this.GetChildView<ToggleButton>(RichEditToolbarNumberListButtonPart);
+
+            this.UpdateListStyleOptionsVisibility();
+
+            if (this.BulletListButton != null)
+            {
+                this.BulletListButton.Checked += this.OnBulletListButtonChecked;
+                this.BulletListButton.Unchecked += this.OnBulletListButtonChecked;
+            }
+
+            if (this.NumberListButton != null)
+            {
+                this.NumberListButton.Checked += this.OnNumberListButtonChecked;
+                this.NumberListButton.Unchecked += this.OnNumberListButtonChecked;
+            }
+        }
+
+        private void UpdateListStyleOptionsVisibility()
+        {
+            this.BulletListButton?.SetVisible(this.ShowListStyleOptions);
+            this.NumberListButton?.SetVisible(this.ShowListStyleOptions);
+        }
+
+#if WINDOWS_UWP
+        private void UpdateActiveListStyleOptions()
+        {
+            var activeListStyleOption = this.TargetRichEditBox
+                .Document
+                .Selection
+                .ParagraphFormat
+                .ListType;
+
+            if (activeListStyleOption == MarkerType.Undefined)
+            {
+                return;
+            }
+
+            if (this.BulletListButton != null)
+            {
+                this.BulletListButton.IsChecked = activeListStyleOption == MarkerType.Bullet;
+            }
+
+            if (this.NumberListButton != null)
+            {
+                this.NumberListButton.IsChecked = activeListStyleOption == MarkerType.CircledNumber;
+            }
+
+            this.EmitListStyleChanged();
+        }
+#endif
+
+        private void ResetListStyleOptions()
+        {
+            if (this.BulletListButton != null)
+            {
+                this.BulletListButton.Checked -= this.OnBulletListButtonChecked;
+                this.BulletListButton.Unchecked -= this.OnBulletListButtonChecked;
+            }
+
+            if (this.NumberListButton != null)
+            {
+                this.NumberListButton.Checked -= this.OnNumberListButtonChecked;
+                this.NumberListButton.Unchecked -= this.OnNumberListButtonChecked;
+            }
+        }
+
+        private void OnNumberListButtonChecked(object sender, RoutedEventArgs e)
+        {
+            if (this.NumberListButton == null
+#if WINDOWS_UWP
+                || this.TargetRichEditBox == null
+#endif
+               )
+            {
+                return;
+            }
+
+#if WINDOWS_UWP
+            var isChecked = this.NumberListButton.IsChecked ?? false;
+            var isBulletListChecked = this.BulletListButton?.IsChecked ?? false;
+
+            // Resets the bullet list check option.
+            if (isChecked && isBulletListChecked && this.BulletListButton != null)
+            {
+                this.BulletListButton.Unchecked -= this.OnBulletListButtonChecked;
+                this.BulletListButton.IsChecked = false;
+                this.BulletListButton.Unchecked += this.OnBulletListButtonChecked;
+            }
+
+            this.TargetRichEditBox
+                    .Document
+                    .Selection
+                    .ParagraphFormat.ListType =
+                isChecked ? MarkerType.CircledNumber : MarkerType.None;
+
+            this.TargetRichEditBox.Document.Selection.ParagraphFormat.ListStyle = MarkerStyle.Plain;
+#endif
+
+            this.EmitListStyleChanged();
+        }
+
+        private void OnBulletListButtonChecked(object sender, RoutedEventArgs e)
+        {
+            if (this.BulletListButton == null
+#if WINDOWS_UWP
+                || this.TargetRichEditBox == null
+#endif
+               )
+            {
+                return;
+            }
+
+#if WINDOWS_UWP
+            var isChecked = this.BulletListButton.IsChecked ?? false;
+            var isNumberListChecked = this.NumberListButton?.IsChecked ?? false;
+
+            // Resets the number list check option.
+            if (isChecked && isNumberListChecked && this.NumberListButton != null)
+            {
+                this.NumberListButton.Unchecked -= this.OnNumberListButtonChecked;
+                this.NumberListButton.IsChecked = false;
+                this.NumberListButton.Unchecked += this.OnNumberListButtonChecked;
+            }
+
+            this.TargetRichEditBox
+                    .Document
+                    .Selection
+                    .ParagraphFormat.ListType =
+                isChecked ? MarkerType.Bullet : MarkerType.None;
+#endif
+
+            this.EmitListStyleChanged();
+        }
+
+        private void EmitListStyleChanged()
+        {
+            if (this.ListStyleChanged == null)
+            {
+                return;
+            }
+
+            var numberedList = this.NumberListButton?.IsChecked ?? false;
+            var bulletedList = this.BulletListButton?.IsChecked ?? false;
+
+            this.ListStyleChanged.Invoke(
+                this,
+                new RichEditToolbarListStyleChangedEventArgs(bulletedList, numberedList));
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.TextColor.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.TextColor.cs
new file mode 100644
index 0000000..e67c102
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.TextColor.cs
@@ -0,0 +1,211 @@
+namespace MADE.UI.Controls
+{
+    using System.Collections.Generic;
+    using System.Linq;
+    using MADE.UI.Extensions;
+    using MADE.UI.Styling.Colors;
+    using Windows.UI;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Controls;
+    using Windows.UI.Xaml.Media;
+
+    /// <summary>
+    /// Defines the text color logic for the <see cref="RichEditToolbar"/>.
+    /// </summary>
+    public partial class RichEditToolbar
+    {
+        /// <summary>
+        /// Identifies the <see cref="ShowTextColorOptions"/> dependency property.
+        /// </summary>
+        public static readonly DependencyProperty ShowTextColorOptionsProperty = DependencyProperty.Register(
+            nameof(ShowTextColorOptions),
+            typeof(bool),
+            typeof(RichEditToolbar),
+            new PropertyMetadata(true, (o, args) => ((RichEditToolbar)o).UpdateTextColorOptionsVisibility()));
+
+        /// <summary>
+        /// Identifies the <see cref="CustomTextColorOptions"/> dependency property.
+        /// </summary>
+        public static readonly DependencyProperty CustomTextColorOptionsProperty = DependencyProperty.Register(
+            nameof(CustomTextColorOptions),
+            typeof(IList<RichEditToolbarTextColorOption>),
+            typeof(RichEditToolbar),
+            new PropertyMetadata(default(IList<RichEditToolbarTextColorOption>)));
+
+        private const string RichEditToolbarColorButtonPart = "RichEditToolbarColorButton";
+        private const string RichEditToolbarColorOptionsPart = "RichEditToolbarColorOptions";
+
+        private static readonly IList<RichEditToolbarTextColorOption> DefaultTextColorOptions =
+            new List<RichEditToolbarTextColorOption>
+            {
+                new() {Name = "Black", Color = "#000000"},
+                new() {Name = "White", Color = "#ffffff"},
+                new() {Name = "Silver", Color = "#d1d3d4"},
+                new() {Name = "Gray", Color = "#a7a9ac"},
+                new() {Name = "Dark Gray", Color = "#808285"},
+                new() {Name = "Charcoal", Color = "#58595b"},
+                new() {Name = "Magenta", Color = "#b31564"},
+                new() {Name = "Red", Color = "#e61b1b"},
+                new() {Name = "Red-orange", Color = "#ff5500"},
+                new() {Name = "Orange", Color = "#ffaa00"},
+                new() {Name = "Gold", Color = "#ffce00"},
+                new() {Name = "Yellow", Color = "#ffe600"},
+                new() {Name = "Grass green", Color = "#a2e61b"},
+                new() {Name = "Green", Color = "#26e600"},
+                new() {Name = "Dark green", Color = "#008055"},
+                new() {Name = "Teal", Color = "#00aacc"},
+                new() {Name = "Blue", Color = "#004de6"},
+                new() {Name = "Indigo", Color = "#3d00b8"},
+                new() {Name = "Violet", Color = "#6600cc"},
+                new() {Name = "Purple", Color = "#600080"},
+                new() {Name = "Beige", Color = "#f7d7c4"},
+                new() {Name = "Light brown", Color = "#bb9167"},
+                new() {Name = "Brown", Color = "#8e562e"},
+                new() {Name = "Dark brown", Color = "#613d30"},
+                new() {Name = "Pastel pink", Color = "#ff80ff"},
+                new() {Name = "Pastel orange", Color = "#ffc680"},
+                new() {Name = "Pastel yellow", Color = "#ffff80"},
+                new() {Name = "Pastel green", Color = "#80ff9e"},
+                new() {Name = "Pastel blue", Color = "#80d6ff"},
+                new() {Name = "Pastel purple", Color = "#bcb3ff"},
+            };
+
+        /// <summary>
+        /// Occurs when the text color has changed.
+        /// </summary>
+        public event RichEditToolbarTextColorChangedEventHandler TextColorChanged;
+
+        /// <summary>
+        /// Gets or sets the additional custom text color options.
+        /// </summary>
+        public IList<RichEditToolbarTextColorOption> CustomTextColorOptions
+        {
+            get => (IList<RichEditToolbarTextColorOption>)GetValue(CustomTextColorOptionsProperty);
+            set => SetValue(CustomTextColorOptionsProperty, value);
+        }
+
+        /// <summary>
+        /// Gets or sets a value indicating whether to show text color options.
+        /// </summary>
+        public bool ShowTextColorOptions
+        {
+            get => (bool)GetValue(ShowTextColorOptionsProperty);
+            set => SetValue(ShowTextColorOptionsProperty, value);
+        }
+
+        /// <summary>
+        /// Gets the view representing the button for setting text color.
+        /// </summary>
+        public Button TextColorButton { get; private set; }
+
+        /// <summary>
+        /// Gets the view representing the panel for displaying text color options.
+        /// </summary>
+        public Panel TextColorOptionsPanel { get; private set; }
+
+        private void SetupTextColorOptions()
+        {
+            this.TextColorButton = this.GetChildView<Button>(RichEditToolbarColorButtonPart);
+            this.TextColorOptionsPanel = this.GetChildView<Panel>(RichEditToolbarColorOptionsPart);
+
+            this.UpdateTextColorOptionsVisibility();
+
+            if (this.TextColorOptionsPanel == null)
+            {
+                return;
+            }
+
+            var textColorOptions = this.CustomTextColorOptions == null
+                ? DefaultTextColorOptions
+                : DefaultTextColorOptions.Concat(this.CustomTextColorOptions);
+
+            foreach (var textColorOption in textColorOptions)
+            {
+                var textColorButton = new Button {Background = textColorOption.Color.ToSolidColorBrush()};
+
+                var textColorButtonToolTip = new ToolTip {Content = textColorOption.Name};
+
+                ToolTipService.SetToolTip(textColorButton, textColorButtonToolTip);
+
+                textColorButton.Click += this.OnTextColorButtonClicked;
+
+                this.TextColorOptionsPanel.Children.Add(textColorButton);
+            }
+        }
+
+#if WINDOWS_UWP
+        private void UpdateActiveTextColorOptions()
+        {
+            if (this.TextColorButton == null)
+            {
+                return;
+            }
+
+            var color = this.TargetRichEditBox.Document.Selection.CharacterFormat.ForegroundColor;
+
+            this.TextColorButton.Foreground = color.ToSolidColorBrush();
+
+            this.EmitTextColorChanged(color);
+        }
+#endif
+
+        private void UpdateTextColorOptionsVisibility()
+        {
+            this.TextColorButton?.SetVisible(this.ShowTextColorOptions);
+        }
+
+        private void ResetTextColorOptions()
+        {
+            if (this.TextColorOptionsPanel == null)
+            {
+                return;
+            }
+
+            foreach (var element in this.TextColorOptionsPanel.Children)
+            {
+                if (element is Button textColorButton)
+                {
+                    textColorButton.Click -= this.OnTextColorButtonClicked;
+                }
+            }
+
+            this.TextColorOptionsPanel.Children.Clear();
+        }
+
+        private void OnTextColorButtonClicked(object sender, RoutedEventArgs e)
+        {
+            if (sender == null
+#if WINDOWS_UWP
+                || this.TargetRichEditBox == null
+#endif
+               )
+            {
+                return;
+            }
+
+            if (sender is not Button colorElement)
+            {
+                return;
+            }
+
+            var brush = colorElement.Background as SolidColorBrush;
+            var color = brush?.Color ?? Colors.Black;
+
+            if (this.TextColorButton != null)
+            {
+                this.TextColorButton.Foreground = brush ?? Colors.Black.ToSolidColorBrush();
+            }
+
+#if WINDOWS_UWP
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.ForegroundColor = color;
+#endif
+
+            this.EmitTextColorChanged(color);
+        }
+
+        private void EmitTextColorChanged(Color color)
+        {
+            this.TextColorChanged?.Invoke(this, new RichEditToolbarTextColorChangedEventArgs(color.ToHexString()));
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.cs
new file mode 100644
index 0000000..99a9d41
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbar.cs
@@ -0,0 +1,168 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using System.Collections.Generic;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Automation.Peers;
+    using Windows.UI.Xaml.Controls;
+    using Windows.UI.Xaml.Controls.Primitives;
+
+    /// <summary>
+    /// Defines a customizable and extensible collection of buttons that activate rich text features in an associated <see cref="RichEditBox"/>.
+    /// </summary>
+    [TemplatePart(Name = RichEditToolbarOptionsBarPart, Type = typeof(CommandBar))]
+    [TemplatePart(Name = RichEditToolbarIncreaseTextSizeButtonPart, Type = typeof(Button))]
+    [TemplatePart(Name = RichEditToolbarDecreaseTextSizeButtonPart, Type = typeof(Button))]
+    [TemplatePart(Name = RichEditToolbarBoldButtonPart, Type = typeof(ToggleButton))]
+    [TemplatePart(Name = RichEditToolbarItalicButtonPart, Type = typeof(ToggleButton))]
+    [TemplatePart(Name = RichEditToolbarUnderlineButtonPart, Type = typeof(ToggleButton))]
+    [TemplatePart(Name = RichEditToolbarColorButtonPart, Type = typeof(Button))]
+    [TemplatePart(Name = RichEditToolbarColorOptionsPart, Type = typeof(Panel))]
+    public partial class RichEditToolbar : Control, IRichEditToolbar
+    {
+#if WINDOWS_UWP
+        /// <summary>
+        /// Identifies the <see cref="TargetRichEditBox"/> dependency property.
+        /// </summary>
+        public static readonly DependencyProperty TargetRichEditBoxProperty = DependencyProperty.Register(
+            nameof(TargetRichEditBox),
+            typeof(RichEditBox),
+            typeof(RichEditToolbar),
+            new PropertyMetadata(default(RichEditBox), (o, args) => ((RichEditToolbar)o).SetupRichEditBox()));
+#endif
+
+        /// <summary>
+        /// Identifies the <see cref="CustomOptions"/> dependency property.
+        /// </summary>
+        public static readonly DependencyProperty CustomOptionsProperty = DependencyProperty.Register(
+            nameof(CustomOptions),
+            typeof(IList<ICommandBarElement>),
+            typeof(RichEditToolbar),
+            new PropertyMetadata(new List<ICommandBarElement>()));
+
+        private const string RichEditToolbarOptionsBarPart = "LayoutRoot";
+
+        /// <summary>
+        /// Initializes a new instance of the <see cref="RichEditToolbar"/> class.
+        /// </summary>
+        public RichEditToolbar()
+        {
+            this.DefaultStyleKey = typeof(RichEditToolbar);
+        }
+
+#if WINDOWS_UWP
+        /// <summary>
+        /// Gets or sets the associated <see cref="RichEditBox"/> control.
+        /// </summary>
+        public RichEditBox TargetRichEditBox
+        {
+            get => (RichEditBox)GetValue(TargetRichEditBoxProperty);
+            set => SetValue(TargetRichEditBoxProperty, value);
+        }
+#endif
+
+        /// <summary>
+        /// Gets or sets the additional custom options.
+        /// </summary>
+        public IList<ICommandBarElement> CustomOptions
+        {
+            get => (IList<ICommandBarElement>)GetValue(CustomOptionsProperty);
+            set => SetValue(CustomOptionsProperty, value);
+        }
+
+        /// <summary>
+        /// Gets the view representing the option button bar.
+        /// </summary>
+        public CommandBar Toolbar { get; private set; }
+
+        /// <summary>
+        /// Loads the relevant control template so that its parts can be referenced.
+        /// </summary>
+        protected override void OnApplyTemplate()
+        {
+            this.ResetFontSizeOptions();
+            this.ResetFontStyleOptions();
+            this.ResetTextColorOptions();
+            this.ResetListStyleOptions();
+#if WINDOWS_UWP
+            this.ResetRichEditBox();
+#endif
+
+            base.OnApplyTemplate();
+
+            this.Toolbar = this.GetChildView<CommandBar>(RichEditToolbarOptionsBarPart);
+
+            this.SetupFontSizeOptions();
+            this.SetupFontStyleOptions();
+            this.SetupTextColorOptions();
+            this.SetupListStyleOptions();
+
+#if WINDOWS_UWP
+            this.SetupRichEditBox();
+#endif
+
+            this.SetupCustomOptions();
+        }
+
+        /// <summary>
+        /// Provides the class-specific <see cref="RichEditToolbarAutomationPeer"/> implementation for the Microsoft UI Automation infrastructure.
+        /// </summary>
+        /// <returns>The class-specific <see cref="RichEditToolbarAutomationPeer"/> instance.</returns>
+        protected override AutomationPeer OnCreateAutomationPeer()
+        {
+            return new RichEditToolbarAutomationPeer(this);
+        }
+
+#if WINDOWS_UWP
+        private void SetupRichEditBox()
+        {
+            if (this.TargetRichEditBox == null)
+            {
+                return;
+            }
+
+            this.UpdateActiveToolbarOptions();
+            this.TargetRichEditBox.Document.Selection.CharacterFormat.Size = DefaultFontSize;
+            this.TargetRichEditBox.SelectionChanged += this.OnRichEditBoxSelectionChanged;
+        }
+
+        private void ResetRichEditBox()
+        {
+            if (this.TargetRichEditBox != null)
+            {
+                this.TargetRichEditBox.SelectionChanged -= this.OnRichEditBoxSelectionChanged;
+            }
+        }
+
+        private void OnRichEditBoxSelectionChanged(object sender, RoutedEventArgs e)
+        {
+            this.UpdateActiveToolbarOptions();
+        }
+
+        private void UpdateActiveToolbarOptions()
+        {
+            this.UpdateActiveFontStyleOptions();
+            this.UpdateActiveTextColorOptions();
+            this.UpdateActiveListStyleOptions();
+        }
+#endif
+
+        private void SetupCustomOptions()
+        {
+            if (this.Toolbar == null || this.CustomOptions == null)
+            {
+                return;
+            }
+
+            foreach (var option in this.CustomOptions)
+            {
+                if (!this.Toolbar.PrimaryCommands.Contains(option))
+                {
+                    this.Toolbar.PrimaryCommands.Add(option);
+                }
+            }
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarAutomationPeer.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarAutomationPeer.cs
new file mode 100644
index 0000000..ae8ee9f
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarAutomationPeer.cs
@@ -0,0 +1,70 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Xaml.Automation.Peers;
+
+    /// <summary>
+    /// Defines a framework element automation peer for the <see cref="RichEditToolbar"/> control.
+    /// </summary>
+    public class RichEditToolbarAutomationPeer : FrameworkElementAutomationPeer
+    {
+        /// <summary>
+        /// Initializes a new instance of the <see cref="RichEditToolbarAutomationPeer"/> class.
+        /// </summary>
+        /// <param name="owner">
+        /// The <see cref="RichEditToolbar" /> that is associated with this <see cref="AutomationPeer"/>.
+        /// </param>
+        public RichEditToolbarAutomationPeer(RichEditToolbar owner)
+            : base(owner)
+        {
+        }
+
+        private RichEditToolbar OwningRichEditToolbar => this.Owner as RichEditToolbar;
+
+        /// <summary>
+        /// Gets the control type for the element that is associated with the UI Automation peer.
+        /// </summary>
+        /// <returns>The control type.</returns>
+        protected override AutomationControlType GetAutomationControlTypeCore()
+        {
+            return AutomationControlType.Custom;
+        }
+
+        /// <summary>
+        /// Provides the type name of the <see cref="RichEditToolbar"/> when a Microsoft UI Automation client calls GetClassName or an equivalent Microsoft UI Automation client API.
+        /// </summary>
+        /// <returns>The type name of the <see cref="RichEditToolbar"/>.</returns>
+        protected override string GetClassNameCore()
+        {
+            return this.Owner.GetType().Name;
+        }
+
+        /// <summary>
+        /// Provides the name given to the <see cref="RichEditToolbar"/> when a Microsoft UI Automation client calls GetName or an equivalent Microsoft UI Automation client API.
+        /// </summary>
+        /// <returns>The name of the <see cref="RichEditToolbar"/>.</returns>
+        protected override string GetNameCore()
+        {
+            string name = string.Empty;
+
+            if (string.IsNullOrEmpty(name))
+            {
+                name = base.GetNameCore();
+            }
+
+            if (this.OwningRichEditToolbar != null)
+            {
+                name = this.OwningRichEditToolbar.Name;
+            }
+
+            if (string.IsNullOrEmpty(name))
+            {
+                name = this.GetClassName();
+            }
+
+            return name;
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontSizeChangedEventArgs.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontSizeChangedEventArgs.cs
new file mode 100644
index 0000000..988f2f6
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontSizeChangedEventArgs.cs
@@ -0,0 +1,25 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Xaml;
+
+    /// <summary>
+    /// Defines an event argument for when a <see cref="RichEditToolbar"/> font size changed.
+    /// </summary>
+    public class RichEditToolbarFontSizeChangedEventArgs : RoutedEventArgs
+    {
+        /// <summary>
+        /// Initializes a new instance of the <see cref="RichEditToolbarFontSizeChangedEventArgs"/> class.
+        /// </summary>
+        /// <param name="fontSize">The changed font size.</param>
+        public RichEditToolbarFontSizeChangedEventArgs(float fontSize)
+        {
+            this.FontSize = fontSize;
+        }
+
+        /// <summary>Gets changed font size.</summary>
+        public float FontSize { get; }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontSizeChangedEventHandler.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontSizeChangedEventHandler.cs
new file mode 100644
index 0000000..c090b6a
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontSizeChangedEventHandler.cs
@@ -0,0 +1,12 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    /// <summary>
+    /// Defines a delegate for the event which occurs when a <see cref="RichEditToolbar"/> font size changed.
+    /// </summary>
+    /// <param name="sender">The <see cref="RichEditToolbar"/>.</param>
+    /// <param name="args">The event argument.</param>
+    public delegate void RichEditToolbarFontSizeChangedEventHandler(object sender, RichEditToolbarFontSizeChangedEventArgs args);
+}
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontStyleChangedEventArgs.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontStyleChangedEventArgs.cs
new file mode 100644
index 0000000..03f3652
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontStyleChangedEventArgs.cs
@@ -0,0 +1,41 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Xaml;
+
+    /// <summary>
+    /// Defines an event argument for when a <see cref="RichEditToolbar"/> font style changed.
+    /// </summary>
+    public class RichEditToolbarFontStyleChangedEventArgs : RoutedEventArgs
+    {
+        /// <summary>
+        /// Initializes a new instance of the <see cref="RichEditToolbarFontStyleChangedEventArgs"/> class.
+        /// </summary>
+        /// <param name="bold">A value indicating whether bold is enabled.</param>
+        /// <param name="italic">A value indicating whether italic is enabled.</param>
+        /// <param name="underline">A value indicating whether underline is enabled.</param>
+        public RichEditToolbarFontStyleChangedEventArgs(bool bold, bool italic, bool underline)
+        {
+            this.Bold = bold;
+            this.Italic = italic;
+            this.Underline = underline;
+        }
+
+        /// <summary>
+        /// Gets a value indicating whether underline is enabled.
+        /// </summary>
+        public bool Underline { get; }
+
+        /// <summary>
+        /// Gets a value indicating whether italic is enabled.
+        /// </summary>
+        public bool Italic { get; }
+
+        /// <summary>
+        /// Gets a value indicating whether bold is enabled.
+        /// </summary>
+        public bool Bold { get; }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontStyleChangedEventHandler.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontStyleChangedEventHandler.cs
new file mode 100644
index 0000000..9d28575
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarFontStyleChangedEventHandler.cs
@@ -0,0 +1,12 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    /// <summary>
+    /// Defines a delegate for the event which occurs when a <see cref="RichEditToolbar"/> font style changed.
+    /// </summary>
+    /// <param name="sender">The <see cref="RichEditToolbar"/>.</param>
+    /// <param name="args">The event argument.</param>
+    public delegate void RichEditToolbarFontStyleChangedEventHandler(object sender, RichEditToolbarFontStyleChangedEventArgs args);
+}
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarListStyleChangedEventArgs.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarListStyleChangedEventArgs.cs
new file mode 100644
index 0000000..db6cef6
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarListStyleChangedEventArgs.cs
@@ -0,0 +1,34 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Xaml;
+
+    /// <summary>
+    /// Defines an event argument for when a <see cref="RichEditToolbar"/> list style changed.
+    /// </summary>
+    public class RichEditToolbarListStyleChangedEventArgs : RoutedEventArgs
+    {
+        /// <summary>
+        /// Initializes a new instance of the <see cref="RichEditToolbarListStyleChangedEventArgs"/> class with the reference to the clicked item.
+        /// </summary>
+        /// <param name="bulletedList">A value indicating whether bulleted list is enabled.</param>
+        /// <param name="numberedList">A value indicating whether numbered list is enabled.</param>
+        public RichEditToolbarListStyleChangedEventArgs(bool bulletedList, bool numberedList)
+        {
+            this.BulletedList = bulletedList;
+            this.NumberedList = numberedList;
+        }
+
+        /// <summary>
+        /// Gets a value indicating whether bulleted list is enabled.
+        /// </summary>
+        public bool BulletedList { get; }
+
+        /// <summary>
+        /// Gets a value indicating whether numbered list is enabled.
+        /// </summary>
+        public bool NumberedList { get; }
+    }
+}
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarListStyleChangedEventHandler.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarListStyleChangedEventHandler.cs
new file mode 100644
index 0000000..bee792f
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarListStyleChangedEventHandler.cs
@@ -0,0 +1,12 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    /// <summary>
+    /// Defines a delegate for the event which occurs when a <see cref="RichEditToolbar"/> list style changed.
+    /// </summary>
+    /// <param name="sender">The <see cref="RichEditToolbar"/>.</param>
+    /// <param name="args">The event argument.</param>
+    public delegate void RichEditToolbarListStyleChangedEventHandler(object sender, RichEditToolbarListStyleChangedEventArgs args);
+}
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorChangedEventArgs.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorChangedEventArgs.cs
new file mode 100644
index 0000000..44c0c7c
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorChangedEventArgs.cs
@@ -0,0 +1,25 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    using Windows.UI.Xaml;
+
+    /// <summary>
+    /// Defines an event argument for when a <see cref="RichEditToolbar"/> text color changed.
+    /// </summary>
+    public class RichEditToolbarTextColorChangedEventArgs : RoutedEventArgs
+    {
+        /// <summary>
+        /// Initializes a new instance of the <see cref="RichEditToolbarTextColorChangedEventArgs"/> class.
+        /// </summary>
+        /// <param name="color">The color as a hex value.</param>
+        public RichEditToolbarTextColorChangedEventArgs(string color)
+        {
+            this.Color = color;
+        }
+
+        /// <summary>Gets the color as a hex value.</summary>
+        public string Color { get; }
+    }
+}
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorChangedEventHandler.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorChangedEventHandler.cs
new file mode 100644
index 0000000..6396350
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorChangedEventHandler.cs
@@ -0,0 +1,12 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Controls
+{
+    /// <summary>
+    /// Defines a delegate for the event which occurs when a <see cref="RichEditToolbar"/> text color changed.
+    /// </summary>
+    /// <param name="sender">The <see cref="RichEditToolbar"/>.</param>
+    /// <param name="args">The event argument.</param>
+    public delegate void RichEditToolbarTextColorChangedEventHandler(object sender, RichEditToolbarTextColorChangedEventArgs args);
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorOption.cs b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorOption.cs
new file mode 100644
index 0000000..7a7d624
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/RichEditToolbarTextColorOption.cs
@@ -0,0 +1,18 @@
+namespace MADE.UI.Controls
+{
+    /// <summary>
+    /// Defines a text color option for the <see cref="RichEditToolbar"/>.
+    /// </summary>
+    public class RichEditToolbarTextColorOption
+    {
+        /// <summary>
+        /// Gets or sets the name of the color.
+        /// </summary>
+        public string Name { get; set; }
+
+        /// <summary>
+        /// Gets or sets the value representing the color as a hex value.
+        /// </summary>
+        public string Color { get; set; }
+    }
+}
diff --git a/src/MADE.UI.Controls.RichEditToolbar/Themes/Generic.xaml b/src/MADE.UI.Controls.RichEditToolbar/Themes/Generic.xaml
new file mode 100644
index 0000000..4672637
--- /dev/null
+++ b/src/MADE.UI.Controls.RichEditToolbar/Themes/Generic.xaml
@@ -0,0 +1,144 @@
+<ResourceDictionary
+    xmlns="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
+    xmlns:x="http://schemas.microsoft.com/winfx/2006/xaml"
+    xmlns:local="using:MADE.UI.Controls"
+    xmlns:colors="using:MADE.UI.Styling.Colors">
+
+    <Style TargetType="local:RichEditToolbar">
+        <Setter Property="Template">
+            <Setter.Value>
+                <ControlTemplate TargetType="local:RichEditToolbar">
+                    <CommandBar x:Name="LayoutRoot" Background="{TemplateBinding Background}" OverflowButtonVisibility="Auto" DefaultLabelPosition="Collapsed">
+                        <CommandBar.PrimaryCommands>
+                            <AppBarButton x:Name="RichEditToolbarIncreaseTextSizeButton" Label="Increase font size" ToolTipService.ToolTip="Increase font size">
+                                <AppBarButton.Icon>
+                                    <PathIcon Data="M15.1951 5.75446C15.4738 6.06095 15.9481 6.08354 16.2546 5.80491L18.5 3.76358L20.7455 5.80491C21.052 6.08354 21.5263 6.06095 21.805 5.75446C22.0836 5.44797 22.061 4.97364 21.7545 4.69502L19.0045 2.19504C18.7185 1.93499 18.2816 1.93499 17.9956 2.19504L15.2456 4.69502C14.9391 4.97364 14.9165 5.44797 15.1951 5.75446ZM12.0001 3.99998C12.3076 3.99998 12.5839 4.18767 12.6973 4.4735L18.4472 18.9733C18.5999 19.3584 18.4115 19.7943 18.0265 19.947C17.6414 20.0997 17.2055 19.9113 17.0528 19.5263L15.2579 14.9999H8.74231L6.94736 19.5263C6.79467 19.9113 6.35876 20.0997 5.97372 19.947C5.58869 19.7943 5.40033 19.3584 5.55302 18.9733L11.3029 4.4735C11.4163 4.18767 11.6926 3.99998 12.0001 3.99998ZM9.33713 13.4999H14.6631L12.0001 6.78453L9.33713 13.4999Z" />
+                                </AppBarButton.Icon>
+                            </AppBarButton>
+                            <AppBarButton x:Name="RichEditToolbarDecreaseTextSizeButton" Label="Decrease font size" ToolTipService.ToolTip="Decrease font size">
+                                <AppBarButton.Icon>
+                                    <PathIcon Data="M16.2546 2.19505C15.9481 1.91642 15.4738 1.93901 15.1951 2.2455C14.9165 2.55199 14.9391 3.02632 15.2456 3.30495L17.9956 5.80492C18.2816 6.06497 18.7185 6.06497 19.0045 5.80492L21.7545 3.30495C22.061 3.02632 22.0836 2.55199 21.805 2.2455C21.5263 1.93901 21.052 1.91642 20.7455 2.19505L18.5 4.23638L16.2546 2.19505ZM12.0001 3.99998C12.3076 3.99998 12.5839 4.18767 12.6973 4.47351L18.4472 18.9733C18.5999 19.3584 18.4115 19.7943 18.0265 19.947C17.6414 20.0997 17.2055 19.9113 17.0528 19.5263L15.2579 14.9999H8.74231L6.94736 19.5263C6.79467 19.9113 6.35876 20.0997 5.97372 19.947C5.58869 19.7943 5.40033 19.3584 5.55302 18.9733L11.3029 4.47351C11.4163 4.18767 11.6926 3.99998 12.0001 3.99998ZM12.0001 6.78454L9.33713 13.4999H14.6631L12.0001 6.78454Z" />
+                                </AppBarButton.Icon>
+                            </AppBarButton>
+                            <AppBarToggleButton x:Name="RichEditToolbarBoldButton" Label="Bold" ToolTipService.ToolTip="Bold">
+                                <AppBarToggleButton.Icon>
+                                    <PathIcon Data="M6.93514 4.43963C7.21647 4.15815 7.59813 4 7.99609 4H12.3795C15.0161 4 16.9995 6.18211 16.9995 8.62541C16.9995 9.60205 16.6828 10.5367 16.1341 11.307C17.211 12.134 17.9995 13.4274 17.9995 15.12C17.9995 18.2315 15.301 20 13.1195 20H7.99951C7.17108 20 6.49951 19.3284 6.49951 18.5L6.49609 5.50082C6.49588 5.10285 6.65382 4.72111 6.93514 4.43963ZM9.49869 10.2499H12.3795C13.2824 10.2499 13.9995 9.49051 13.9995 8.62541C13.9995 7.76 13.2814 7 12.3795 7H9.49691L9.49869 10.2499ZM9.49951 13.2499V17H13.1195C13.9927 17 14.9995 16.2464 14.9995 15.12C14.9995 13.9901 14.0248 13.2499 13.1195 13.2499H9.49951Z" />
+                                </AppBarToggleButton.Icon>
+                            </AppBarToggleButton>
+                            <AppBarToggleButton x:Name="RichEditToolbarItalicButton" Label="Italic" ToolTipService.ToolTip="Italic">
+                                <AppBarToggleButton.Icon>
+                                    <PathIcon Data="M9.75084 4H18.2544C18.6683 4 19.0039 4.33565 19.0039 4.74969C19.0039 5.12923 18.7219 5.4429 18.3561 5.49254L18.2544 5.49938L15.0569 5.499L10.0369 18.5H14.2497C14.6291 18.5 14.9427 18.7823 14.9923 19.1483L14.9992 19.25C14.9992 19.6295 14.7172 19.9435 14.3514 19.9932L14.2497 20H4.75037C4.33642 20 4.00391 19.664 4.00391 19.25C4.00391 18.8705 4.28331 18.5565 4.64872 18.5068L4.75037 18.5H8.43491L8.45616 18.4349L13.4499 5.499L9.75084 5.49938C9.37138 5.49938 9.05739 5.21735 9.00769 4.85142L9.00084 4.74969C9.00084 4.37015 9.28321 4.05649 9.64912 4.00684L9.75084 4H18.2544H9.75084Z" />
+                                </AppBarToggleButton.Icon>
+                            </AppBarToggleButton>
+                            <AppBarToggleButton x:Name="RichEditToolbarUnderlineButton" Label="Underline" ToolTipService.ToolTip="Underline">
+                                <AppBarToggleButton.Icon>
+                                    <PathIcon Data="M6.75001 19H17.25C17.6642 19 18 19.3358 18 19.75C18 20.1297 17.7179 20.4435 17.3518 20.4932L17.25 20.5H6.75001C6.33579 20.5 6.00001 20.1642 6.00001 19.75C6.00001 19.3703 6.28216 19.0565 6.64824 19.0068L6.75001 19H17.25H6.75001ZM17.25 4C17.6297 4 17.9435 4.28215 17.9932 4.64823L18 4.75V10.75C18 15.1437 15.9371 17.5 11.9971 17.5C8.14241 17.5 6.08619 15.2446 6.00265 11.0336L6 10.75V4.75C6 4.33579 6.33579 4 6.75001 4C7.1297 4 7.44349 4.28215 7.49315 4.64823L7.5 4.75V10.7507C7.49647 14.3568 8.93346 16 11.9971 16C14.9824 16 16.4251 14.4395 16.4972 11.0235L16.5 10.75V4.75C16.5 4.33579 16.8358 4 17.25 4Z" />
+                                </AppBarToggleButton.Icon>
+                            </AppBarToggleButton>
+                            <AppBarButton x:Name="RichEditToolbarColorButton" Label="Text color" ToolTipService.ToolTip="Text color">
+                                <AppBarButton.Icon>
+                                    <PathIcon Data="M17.75 14.5005C18.9926 14.5005 20 15.5079 20 16.7505V19.7504C20 20.993 18.9926 22.0004 17.75 22.0004H5.25C4.00736 22.0004 3 20.993 3 19.7504V16.7505C3 15.5079 4.00736 14.5005 5.25 14.5005H17.75ZM17.75 16.0005H5.25C4.83579 16.0005 4.5 16.3363 4.5 16.7505V19.7504C4.5 20.1646 4.83579 20.5004 5.25 20.5004H17.75C18.1642 20.5004 18.5 20.1646 18.5 19.7504V16.7505C18.5 16.3363 18.1642 16.0005 17.75 16.0005ZM7.05252 11.9694L10.8061 2.47427C11.0415 1.87883 11.8486 1.84415 12.1508 2.36975L12.2013 2.47487L15.9477 11.9754C16.0997 12.3607 15.9105 12.7962 15.5251 12.9482C15.1719 13.0875 14.7765 12.9401 14.596 12.6178L14.5523 12.5256L13.556 10H9.443L8.44748 12.5209C8.30789 12.874 7.93013 13.0621 7.57143 12.9737L7.47427 12.9426C7.12117 12.803 6.93308 12.4253 7.02147 12.0666L7.05252 11.9694L10.8061 2.47427L7.05252 11.9694ZM11.5027 4.79226L10.036 8.5H12.964L11.5027 4.79226Z" />
+                                </AppBarButton.Icon>
+                                <AppBarButton.Flyout>
+                                    <Flyout>
+                                        <VariableSizedWrapGrid x:Name="RichEditToolbarColorOptions" Orientation="Horizontal" MaximumRowsOrColumns="6">
+                                            <VariableSizedWrapGrid.Resources>
+                                                <colors:LightenColorBrushConverter x:Key="RichEditToolbarFlyoutLightenColorConverter" />
+
+                                                <Style TargetType="Button">
+                                                    <Setter Property="Padding" Value="0"/>
+                                                    <Setter Property="Height" Value="32"/>
+                                                    <Setter Property="Width" Value="32"/>
+                                                    <Setter Property="Margin" Value="6"/>
+                                                    <Setter Property="CornerRadius" Value="16" />
+                                                    <Setter Property="BorderBrush" Value="Transparent" />
+                                                    <Setter Property="BorderThickness" Value="2" />
+                                                    <Setter Property="Template">
+                                                        <Setter.Value>
+                                                            <ControlTemplate TargetType="Button">
+                                                                <ContentPresenter x:Name="ContentPresenter"
+                                                                    Background="{TemplateBinding Background}"
+                                                                    BackgroundSizing="{TemplateBinding BackgroundSizing}"
+                                                                    BorderBrush="{TemplateBinding BorderBrush}"
+                                                                    BorderThickness="{TemplateBinding BorderThickness}"
+                                                                    Content="{TemplateBinding Content}"
+                                                                    ContentTemplate="{TemplateBinding ContentTemplate}"
+                                                                    ContentTransitions="{TemplateBinding ContentTransitions}"
+                                                                    CornerRadius="{TemplateBinding CornerRadius}"
+                                                                    Padding="{TemplateBinding Padding}"
+                                                                    HorizontalContentAlignment="{TemplateBinding HorizontalContentAlignment}"
+                                                                    VerticalContentAlignment="{TemplateBinding VerticalContentAlignment}"
+                                                                    AutomationProperties.AccessibilityView="Raw">
+
+                                                                    <VisualStateManager.VisualStateGroups>
+                                                                        <VisualStateGroup x:Name="CommonStates">
+                                                                            <VisualState x:Name="Normal">
+                                                                                <Storyboard>
+                                                                                    <PointerUpThemeAnimation Storyboard.TargetName="ContentPresenter" />
+                                                                                </Storyboard>
+                                                                            </VisualState>
+
+                                                                            <VisualState x:Name="PointerOver">
+                                                                                <VisualState.Setters>
+                                                                                    <Setter Target="ContentPresenter.BorderBrush" Value="{Binding Background, RelativeSource={RelativeSource TemplatedParent}, Converter={StaticResource RichEditToolbarFlyoutLightenColorConverter}, ConverterParameter=50}" />
+                                                                                    <Setter Target="ContentPresenter.Foreground" Value="{ThemeResource ButtonForegroundPointerOver}" />
+                                                                                </VisualState.Setters>
+
+                                                                                <Storyboard>
+                                                                                    <PointerUpThemeAnimation Storyboard.TargetName="ContentPresenter" />
+                                                                                </Storyboard>
+                                                                            </VisualState>
+
+                                                                            <VisualState x:Name="Pressed">
+                                                                                <VisualState.Setters>
+                                                                                    <Setter Target="ContentPresenter.BorderBrush" Value="{Binding Background, RelativeSource={RelativeSource TemplatedParent}, Converter={StaticResource RichEditToolbarFlyoutLightenColorConverter}, ConverterParameter=30}" />
+                                                                                    <Setter Target="ContentPresenter.Foreground" Value="{ThemeResource ButtonForegroundPressed}" />
+                                                                                </VisualState.Setters>
+
+                                                                                <Storyboard>
+                                                                                    <PointerDownThemeAnimation Storyboard.TargetName="ContentPresenter" />
+                                                                                </Storyboard>
+                                                                            </VisualState>
+
+                                                                            <VisualState x:Name="Disabled">
+                                                                                <Storyboard>
+                                                                                    <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ContentPresenter" Storyboard.TargetProperty="Background">
+                                                                                        <DiscreteObjectKeyFrame KeyTime="0" Value="{ThemeResource ButtonBackgroundDisabled}" />
+                                                                                    </ObjectAnimationUsingKeyFrames>
+                                                                                    <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ContentPresenter" Storyboard.TargetProperty="Foreground">
+                                                                                        <DiscreteObjectKeyFrame KeyTime="0" Value="{ThemeResource ButtonForegroundDisabled}" />
+                                                                                    </ObjectAnimationUsingKeyFrames>
+                                                                                </Storyboard>
+                                                                            </VisualState>
+                                                                        </VisualStateGroup>
+
+                                                                    </VisualStateManager.VisualStateGroups>
+                                                                </ContentPresenter>
+
+                                                            </ControlTemplate>
+                                                        </Setter.Value>
+                                                    </Setter>
+                                                </Style>
+                                            </VariableSizedWrapGrid.Resources>
+                                        </VariableSizedWrapGrid>
+                                    </Flyout>
+                                </AppBarButton.Flyout>
+                            </AppBarButton>
+                            <AppBarToggleButton x:Name="RichEditToolbarBulletListButton" Label="Bulleted list" ToolTipService.ToolTip="Bulleted list">
+                                <AppBarToggleButton.Icon>
+                                    <PathIcon Data="M3.24929 17.5C3.93925 17.5 4.49858 18.0593 4.49858 18.7493C4.49858 19.4393 3.93925 19.9986 3.24929 19.9986C2.55933 19.9986 2 19.4393 2 18.7493C2 18.0593 2.55933 17.5 3.24929 17.5ZM6.75 18H21.25C21.6642 18 22 18.3358 22 18.75C22 19.1297 21.7178 19.4435 21.3518 19.4932L21.25 19.5H6.75C6.33579 19.5 6 19.1642 6 18.75C6 18.3703 6.28215 18.0565 6.64823 18.0068L6.75 18H21.25H6.75ZM3.24929 11C3.93925 11 4.49858 11.5593 4.49858 12.2493C4.49858 12.9393 3.93925 13.4986 3.24929 13.4986C2.55933 13.4986 2 12.9393 2 12.2493C2 11.5593 2.55933 11 3.24929 11ZM6.75 11.5H21.25C21.6642 11.5 22 11.8358 22 12.25C22 12.6297 21.7178 12.9435 21.3518 12.9932L21.25 13H6.75C6.33579 13 6 12.6642 6 12.25C6 11.8703 6.28215 11.5565 6.64823 11.5068L6.75 11.5H21.25H6.75ZM3.24929 4.5C3.93925 4.5 4.49858 5.05933 4.49858 5.74929C4.49858 6.43925 3.93925 6.99858 3.24929 6.99858C2.55933 6.99858 2 6.43925 2 5.74929C2 5.05933 2.55933 4.5 3.24929 4.5ZM6.75 5H21.25C21.6642 5 22 5.33579 22 5.75C22 6.1297 21.7178 6.44349 21.3518 6.49315L21.25 6.5H6.75C6.33579 6.5 6 6.16421 6 5.75C6 5.3703 6.28215 5.05651 6.64823 5.00685L6.75 5H21.25H6.75Z" />
+                                </AppBarToggleButton.Icon>
+                            </AppBarToggleButton>
+                            <AppBarToggleButton x:Name="RichEditToolbarNumberListButton" Label="Numbered list" ToolTipService.ToolTip="Numbered list">
+                                <AppBarToggleButton.Icon>
+                                    <PathIcon Data="M6.0001 2.75007C6.0001 2.39585 5.75227 2.08992 5.40576 2.0164C5.06011 1.94307 4.7103 2.12094 4.5658 2.44311L4.56426 2.44645C4.56226 2.45075 4.55842 2.45889 4.55275 2.47049C4.5414 2.49373 4.52282 2.53063 4.49704 2.57815C4.44527 2.67364 4.36584 2.80953 4.2594 2.96255C4.04176 3.27544 3.73538 3.62496 3.35275 3.86399C3.00144 4.08344 2.89456 4.54613 3.11401 4.89743C3.33346 5.24873 3.79615 5.35562 4.14746 5.13616C4.27205 5.05833 4.38956 4.97481 4.5001 4.88772V7.25007C4.5001 7.66429 4.83589 8.00007 5.2501 8.00007C5.66431 8.00007 6.0001 7.66429 6.0001 7.25007V2.75007ZM20.4995 18.7501C20.4995 18.3359 20.1637 18.0001 19.7495 18.0001H10.7495C10.3353 18.0001 9.99951 18.3359 9.99951 18.7501C9.99951 19.1643 10.3353 19.5001 10.7495 19.5001H19.7495C20.1637 19.5001 20.4995 19.1643 20.4995 18.7501ZM20.4995 12.2437C20.4995 11.8295 20.1637 11.4937 19.7495 11.4937H10.7495C10.3353 11.4937 9.99951 11.8295 9.99951 12.2437C9.99951 12.658 10.3353 12.9937 10.7495 12.9937H19.7495C20.1637 12.9937 20.4995 12.658 20.4995 12.2437ZM20.4995 5.75008C20.4995 5.33586 20.1637 5.00008 19.7495 5.00008H10.7495C10.3353 5.00008 9.99951 5.33586 9.99951 5.75008C9.99951 6.16429 10.3353 6.50008 10.7495 6.50008H19.7495C20.1637 6.50008 20.4995 6.16429 20.4995 5.75008ZM5.15093 10.52C4.84957 10.4668 4.47444 10.5864 4.28031 10.7805C3.98741 11.0733 3.51253 11.0733 3.21965 10.7804C2.92677 10.4875 2.92678 10.0127 3.21969 9.71977C3.77556 9.16393 4.65044 8.90848 5.41157 9.04278C5.809 9.11291 6.2173 9.29717 6.52722 9.64842C6.8426 10.0058 7 10.4727 7 11.0001C7 11.6195 6.72895 12.0801 6.39406 12.4206C6.1163 12.7029 5.76315 12.9311 5.48826 13.1087L5.40874 13.1602C5.21348 13.2871 5.05428 13.3971 4.92686 13.5001H6.25C6.66421 13.5001 7 13.8359 7 14.2501C7 14.6643 6.6642 15.0001 6.24999 15.0001H3.75C3.33579 15.0001 3 14.6643 3 14.2501C3 12.9365 3.98385 12.2972 4.57505 11.913L4.63522 11.8739C4.95259 11.6678 5.16843 11.5275 5.32469 11.3687C5.45855 11.2326 5.5 11.1307 5.5 11.0001C5.5 10.7775 5.43865 10.6819 5.40247 10.6409C5.36083 10.5937 5.28475 10.5436 5.15093 10.52ZM2.96967 21.2804C2.96967 21.2804 3.06251 21.3641 2.97426 21.2849L2.97962 21.2902L2.9929 21.3028C3.00287 21.3122 3.01509 21.3233 3.02956 21.336C3.05848 21.3613 3.09653 21.3928 3.14375 21.4282C3.2381 21.499 3.36996 21.5861 3.53959 21.6709C3.88131 21.8418 4.37043 22.0001 5 22.0001C5.63921 22.0001 6.19596 21.8187 6.60132 21.4606C7.00922 21.1001 7.21163 20.6032 7.19553 20.1011C7.18219 19.6847 7.02903 19.3054 6.76986 19.0001C7.02903 18.6948 7.18219 18.3155 7.19553 17.8991C7.21163 17.3969 7.00922 16.9 6.60132 16.5396C6.19596 16.1814 5.63921 16.0001 5 16.0001C4.37043 16.0001 3.88131 16.1584 3.53959 16.3293C3.36996 16.4141 3.2381 16.5012 3.14375 16.572C3.09653 16.6074 3.05848 16.6389 3.02956 16.6642C3.01509 16.6768 3.00287 16.688 2.9929 16.6973L2.97962 16.71L2.97423 16.7152L2.97189 16.7176L2.97091 16.7185L2.96967 16.7197C2.67678 17.0126 2.67678 17.4875 2.96967 17.7804C3.2586 18.0693 3.72462 18.0732 4.01834 17.7921C4.0217 17.7892 4.03018 17.7821 4.04375 17.772C4.0744 17.749 4.13004 17.7111 4.21041 17.6709C4.36869 17.5918 4.62957 17.5001 5 17.5001C5.36079 17.5001 5.53601 17.6 5.60812 17.6637C5.67768 17.7251 5.69823 17.7907 5.6963 17.8511C5.69423 17.9156 5.66403 18.0028 5.57278 18.0819C5.4845 18.1585 5.30962 18.2501 5 18.2501C4.58579 18.2501 4.25 18.5859 4.25 19.0001C4.25 19.4143 4.58579 19.7501 5 19.7501C5.30962 19.7501 5.4845 19.8417 5.57278 19.9183C5.66403 19.9974 5.69423 20.0845 5.6963 20.1491C5.69823 20.2094 5.67768 20.275 5.60812 20.3365C5.53601 20.4002 5.36079 20.5001 5 20.5001C4.62957 20.5001 4.36869 20.4084 4.21041 20.3293C4.13004 20.2891 4.0744 20.2512 4.04375 20.2282C4.03018 20.218 4.0217 20.2109 4.01834 20.208C3.72462 19.9269 3.2586 19.9308 2.96967 20.2197C2.67678 20.5126 2.67678 20.9875 2.96967 21.2804ZM2.97189 16.7176L2.97091 16.7185C2.9776 16.713 3.17182 16.5516 2.97189 16.7176Z" />
+                                </AppBarToggleButton.Icon>
+                            </AppBarToggleButton>
+                        </CommandBar.PrimaryCommands>
+                    </CommandBar>
+                </ControlTemplate>
+            </Setter.Value>
+        </Setter>
+    </Style>
+
+</ResourceDictionary>
\ No newline at end of file
diff --git a/src/MADE.UI.Controls.Validator/InputValidator.cs b/src/MADE.UI.Controls.Validator/InputValidator.cs
index b8f65fe..fd9d321 100644
--- a/src/MADE.UI.Controls.Validator/InputValidator.cs
+++ b/src/MADE.UI.Controls.Validator/InputValidator.cs
@@ -91,7 +91,7 @@ public ValidatorCollection Validators
         public TextBlock ValidatorFeedbackMessage { get; private set; }
 
         /// <summary>
-        /// Loads the relevant control template so that it's parts can be referenced.
+        /// Loads the relevant control template so that its parts can be referenced.
         /// </summary>
         protected override void OnApplyTemplate()
         {
diff --git a/src/MADE.UI.Styling/Colors/DarkenColorBrushConverter.cs b/src/MADE.UI.Styling/Colors/DarkenColorBrushConverter.cs
new file mode 100644
index 0000000..4f8645e
--- /dev/null
+++ b/src/MADE.UI.Styling/Colors/DarkenColorBrushConverter.cs
@@ -0,0 +1,58 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Styling.Colors
+{
+    using System;
+    using MADE.Data.Validation.Extensions;
+    using Windows.UI;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Data;
+    using Windows.UI.Xaml.Media;
+
+    /// <summary>
+    /// Defines a XAML value converter to darken the color of a specified <see cref="SolidColorBrush"/>.
+    /// </summary>
+    public class DarkenColorBrushConverter : IValueConverter
+    {
+        /// <summary>
+        /// Converts the <paramref name="value">value</paramref> to a darker <see cref="SolidColorBrush"/> using the <paramref name="parameter"/> darken value.
+        /// </summary>
+        /// <param name="value">The value to convert.</param>
+        /// <param name="targetType">The target type (unused).</param>
+        /// <param name="parameter">The optional parameter used to define the amount to darken by.</param>
+        /// <param name="language">The display language for the conversion (unused).</param>
+        /// <returns>The darkened <see cref="SolidColorBrush"/> object.</returns>
+        public object Convert(object value, Type targetType, object parameter, string language)
+        {
+            if (value is not SolidColorBrush colorBrush)
+            {
+                colorBrush = value switch
+                {
+                    Color color => color.ToSolidColorBrush(),
+                    System.Drawing.Color systemColor => systemColor.ToSolidColorBrush(),
+                    _ => Colors.Transparent.ToSolidColorBrush()
+                };
+            }
+
+            float.TryParse(parameter?.ToString(), out var darkenAmount);
+            if (darkenAmount.IsZero())
+            {
+                // Apply darken default.
+                darkenAmount = 30;
+            }
+
+            var darkerColor = colorBrush.Color.Darken(darkenAmount);
+
+            return new SolidColorBrush(darkerColor);
+        }
+
+        /// <summary>
+        /// Convert back is not supported by the <see cref="DarkenColorBrushConverter"/>.
+        /// </summary>
+        public object ConvertBack(object value, Type targetType, object parameter, string language)
+        {
+            return DependencyProperty.UnsetValue;
+        }
+    }
+}
diff --git a/src/MADE.UI.Styling/Colors/LightenColorBrushConverter.cs b/src/MADE.UI.Styling/Colors/LightenColorBrushConverter.cs
new file mode 100644
index 0000000..1991047
--- /dev/null
+++ b/src/MADE.UI.Styling/Colors/LightenColorBrushConverter.cs
@@ -0,0 +1,58 @@
+// MADE Apps licenses this file to you under the MIT license.
+// See the LICENSE file in the project root for more information.
+
+namespace MADE.UI.Styling.Colors
+{
+    using System;
+    using MADE.Data.Validation.Extensions;
+    using Windows.UI;
+    using Windows.UI.Xaml;
+    using Windows.UI.Xaml.Data;
+    using Windows.UI.Xaml.Media;
+
+    /// <summary>
+    /// Defines a XAML value converter to lighten the color of a specified <see cref="SolidColorBrush"/>.
+    /// </summary>
+    public class LightenColorBrushConverter : IValueConverter
+    {
+        /// <summary>
+        /// Converts the <paramref name="value">value</paramref> to a lighter <see cref="SolidColorBrush"/> using the <paramref name="parameter"/> lighten value.
+        /// </summary>
+        /// <param name="value">The value to convert.</param>
+        /// <param name="targetType">The target type (unused).</param>
+        /// <param name="parameter">The optional parameter used to define the amount to lighten by.</param>
+        /// <param name="language">The display language for the conversion (unused).</param>
+        /// <returns>The lightened <see cref="SolidColorBrush"/> object.</returns>
+        public object Convert(object value, Type targetType, object parameter, string language)
+        {
+            if (value is not SolidColorBrush colorBrush)
+            {
+                colorBrush = value switch
+                {
+                    Color color => color.ToSolidColorBrush(),
+                    System.Drawing.Color systemColor => systemColor.ToSolidColorBrush(),
+                    _ => Colors.Transparent.ToSolidColorBrush()
+                };
+            }
+
+            float.TryParse(parameter?.ToString(), out var lightenAmount);
+            if (lightenAmount.IsZero())
+            {
+                // Apply lighten default.
+                lightenAmount = 30;
+            }
+
+            var lighterColor = colorBrush.Color.Lighten(lightenAmount);
+
+            return new SolidColorBrush(lighterColor);
+        }
+
+        /// <summary>
+        /// Convert back is not supported by the <see cref="LightenColorBrushConverter"/>.
+        /// </summary>
+        public object ConvertBack(object value, Type targetType, object parameter, string language)
+        {
+            return DependencyProperty.UnsetValue;
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/MADE.UI.Styling/Colors/WindowsColorExtensions.cs b/src/MADE.UI.Styling/Colors/WindowsColorExtensions.cs
index e72c1d2..6766924 100644
--- a/src/MADE.UI.Styling/Colors/WindowsColorExtensions.cs
+++ b/src/MADE.UI.Styling/Colors/WindowsColorExtensions.cs
@@ -32,6 +32,20 @@ public static SolidColorBrush ToSolidColorBrush(this Windows.UI.Color color)
             return new SolidColorBrush(color);
         }
 
+        /// <summary>
+        /// Converts the specified <see cref="string" /> hex value to a <see cref="T:Windows.UI.Xaml.Media.SolidColorBrush" />.
+        /// </summary>
+        /// <param name="hexValue">
+        /// The <see cref="string" /> hex value to convert.
+        /// </param>
+        /// <returns>
+        /// A <see cref="T:Windows.UI.Xaml.Media.SolidColorBrush" /> representation of the specified color.
+        /// </returns>
+        public static SolidColorBrush ToSolidColorBrush(this string hexValue)
+        {
+            return hexValue.ToWindowsColor().ToSolidColorBrush();
+        }
+
         /// <summary>
         /// Gets the hex representation of the specified <see cref="T:Windows.UI.Color" />.
         /// </summary>
diff --git a/src/MADE.UI.Styling/MADE.UI.Styling.csproj b/src/MADE.UI.Styling/MADE.UI.Styling.csproj
index 0a2b05f..47c7802 100644
--- a/src/MADE.UI.Styling/MADE.UI.Styling.csproj
+++ b/src/MADE.UI.Styling/MADE.UI.Styling.csproj
@@ -25,6 +25,10 @@
     </Page>
   </ItemGroup>
 
+  <ItemGroup>
+    <PackageReference Include="MADE.Data.Validation" Version="1.4.0" />
+  </ItemGroup>
+
   <ItemGroup>
     <ProjectReference Include="..\MADE.UI\MADE.UI.csproj" />
   </ItemGroup>