diff --git a/LICENSE b/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/README.md b/camera-app/README.md old mode 100644 new mode 100755 diff --git a/camera-app/assets/ipc/androidjs.js b/camera-app/assets/ipc/androidjs.js old mode 100644 new mode 100755 diff --git a/camera-app/assets/ipc/back.js b/camera-app/assets/ipc/back.js old mode 100644 new mode 100755 diff --git a/camera-app/main.js b/camera-app/main.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/@sindresorhus/is/dist/index.d.ts b/camera-app/node_modules/@sindresorhus/is/dist/index.d.ts old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/@sindresorhus/is/dist/index.js b/camera-app/node_modules/@sindresorhus/is/dist/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/@sindresorhus/is/dist/index.js.map b/camera-app/node_modules/@sindresorhus/is/dist/index.js.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/@sindresorhus/is/license b/camera-app/node_modules/@sindresorhus/is/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/@sindresorhus/is/package.json b/camera-app/node_modules/@sindresorhus/is/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/@sindresorhus/is/readme.md b/camera-app/node_modules/@sindresorhus/is/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/Buffer/README.md b/camera-app/node_modules/Buffer/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/Buffer/index.js b/camera-app/node_modules/Buffer/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/Buffer/package.json b/camera-app/node_modules/Buffer/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/FileReader/FileReader.js b/camera-app/node_modules/FileReader/FileReader.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/FileReader/package.json b/camera-app/node_modules/FileReader/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/accepts/HISTORY.md b/camera-app/node_modules/accepts/HISTORY.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/accepts/LICENSE b/camera-app/node_modules/accepts/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/accepts/README.md b/camera-app/node_modules/accepts/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/accepts/index.js b/camera-app/node_modules/accepts/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/accepts/package.json b/camera-app/node_modules/accepts/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/.npmignore b/camera-app/node_modules/after/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/.travis.yml b/camera-app/node_modules/after/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/LICENCE b/camera-app/node_modules/after/LICENCE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/README.md b/camera-app/node_modules/after/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/index.js b/camera-app/node_modules/after/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/package.json b/camera-app/node_modules/after/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/after/test/after-test.js b/camera-app/node_modules/after/test/after-test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/LICENSE b/camera-app/node_modules/androidjs/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/example/index.html b/camera-app/node_modules/androidjs/example/index.html old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/example/test.js b/camera-app/node_modules/androidjs/example/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/index.js b/camera-app/node_modules/androidjs/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/lib/back.js b/camera-app/node_modules/androidjs/lib/back.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/lib/front.js b/camera-app/node_modules/androidjs/lib/front.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/androidjs/package.json b/camera-app/node_modules/androidjs/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ansi-regex/index.js b/camera-app/node_modules/ansi-regex/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ansi-regex/license b/camera-app/node_modules/ansi-regex/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ansi-regex/package.json b/camera-app/node_modules/ansi-regex/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ansi-regex/readme.md b/camera-app/node_modules/ansi-regex/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/.npmignore b/camera-app/node_modules/arraybuffer.slice/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/LICENCE b/camera-app/node_modules/arraybuffer.slice/LICENCE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/Makefile b/camera-app/node_modules/arraybuffer.slice/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/README.md b/camera-app/node_modules/arraybuffer.slice/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/index.js b/camera-app/node_modules/arraybuffer.slice/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/package.json b/camera-app/node_modules/arraybuffer.slice/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/arraybuffer.slice/test/slice-buffer.js b/camera-app/node_modules/arraybuffer.slice/test/slice-buffer.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/.travis.yml b/camera-app/node_modules/async-limiter/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/LICENSE b/camera-app/node_modules/async-limiter/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/coverage.json b/camera-app/node_modules/async-limiter/coverage/coverage.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.html b/camera-app/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.html old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.js.html b/camera-app/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.js.html old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/base.css b/camera-app/node_modules/async-limiter/coverage/lcov-report/base.css old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/index.html b/camera-app/node_modules/async-limiter/coverage/lcov-report/index.html old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/prettify.css b/camera-app/node_modules/async-limiter/coverage/lcov-report/prettify.css old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/prettify.js b/camera-app/node_modules/async-limiter/coverage/lcov-report/prettify.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/sort-arrow-sprite.png b/camera-app/node_modules/async-limiter/coverage/lcov-report/sort-arrow-sprite.png old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov-report/sorter.js b/camera-app/node_modules/async-limiter/coverage/lcov-report/sorter.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/coverage/lcov.info b/camera-app/node_modules/async-limiter/coverage/lcov.info old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/index.js b/camera-app/node_modules/async-limiter/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/package.json b/camera-app/node_modules/async-limiter/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/async-limiter/readme.md b/camera-app/node_modules/async-limiter/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/CHANGELOG.md b/camera-app/node_modules/axios/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/LICENSE b/camera-app/node_modules/axios/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/README.md b/camera-app/node_modules/axios/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/UPGRADE_GUIDE.md b/camera-app/node_modules/axios/UPGRADE_GUIDE.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/dist/axios.js b/camera-app/node_modules/axios/dist/axios.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/dist/axios.map b/camera-app/node_modules/axios/dist/axios.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/dist/axios.min.js b/camera-app/node_modules/axios/dist/axios.min.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/dist/axios.min.map b/camera-app/node_modules/axios/dist/axios.min.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/index.d.ts b/camera-app/node_modules/axios/index.d.ts old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/index.js b/camera-app/node_modules/axios/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/adapters/README.md b/camera-app/node_modules/axios/lib/adapters/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/adapters/http.js b/camera-app/node_modules/axios/lib/adapters/http.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/adapters/xhr.js b/camera-app/node_modules/axios/lib/adapters/xhr.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/axios.js b/camera-app/node_modules/axios/lib/axios.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/cancel/Cancel.js b/camera-app/node_modules/axios/lib/cancel/Cancel.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/cancel/CancelToken.js b/camera-app/node_modules/axios/lib/cancel/CancelToken.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/cancel/isCancel.js b/camera-app/node_modules/axios/lib/cancel/isCancel.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/Axios.js b/camera-app/node_modules/axios/lib/core/Axios.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/InterceptorManager.js b/camera-app/node_modules/axios/lib/core/InterceptorManager.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/README.md b/camera-app/node_modules/axios/lib/core/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/createError.js b/camera-app/node_modules/axios/lib/core/createError.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/dispatchRequest.js b/camera-app/node_modules/axios/lib/core/dispatchRequest.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/enhanceError.js b/camera-app/node_modules/axios/lib/core/enhanceError.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/settle.js b/camera-app/node_modules/axios/lib/core/settle.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/core/transformData.js b/camera-app/node_modules/axios/lib/core/transformData.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/defaults.js b/camera-app/node_modules/axios/lib/defaults.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/README.md b/camera-app/node_modules/axios/lib/helpers/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/bind.js b/camera-app/node_modules/axios/lib/helpers/bind.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/btoa.js b/camera-app/node_modules/axios/lib/helpers/btoa.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/buildURL.js b/camera-app/node_modules/axios/lib/helpers/buildURL.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/combineURLs.js b/camera-app/node_modules/axios/lib/helpers/combineURLs.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/cookies.js b/camera-app/node_modules/axios/lib/helpers/cookies.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/deprecatedMethod.js b/camera-app/node_modules/axios/lib/helpers/deprecatedMethod.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/isAbsoluteURL.js b/camera-app/node_modules/axios/lib/helpers/isAbsoluteURL.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/isURLSameOrigin.js b/camera-app/node_modules/axios/lib/helpers/isURLSameOrigin.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/normalizeHeaderName.js b/camera-app/node_modules/axios/lib/helpers/normalizeHeaderName.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/parseHeaders.js b/camera-app/node_modules/axios/lib/helpers/parseHeaders.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/helpers/spread.js b/camera-app/node_modules/axios/lib/helpers/spread.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/lib/utils.js b/camera-app/node_modules/axios/lib/utils.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/axios/package.json b/camera-app/node_modules/axios/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/.npmignore b/camera-app/node_modules/backo2/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/History.md b/camera-app/node_modules/backo2/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/Makefile b/camera-app/node_modules/backo2/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/Readme.md b/camera-app/node_modules/backo2/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/component.json b/camera-app/node_modules/backo2/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/index.js b/camera-app/node_modules/backo2/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/package.json b/camera-app/node_modules/backo2/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/backo2/test/index.js b/camera-app/node_modules/backo2/test/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64-arraybuffer/.npmignore b/camera-app/node_modules/base64-arraybuffer/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64-arraybuffer/.travis.yml b/camera-app/node_modules/base64-arraybuffer/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64-arraybuffer/LICENSE-MIT b/camera-app/node_modules/base64-arraybuffer/LICENSE-MIT old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64-arraybuffer/README.md b/camera-app/node_modules/base64-arraybuffer/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64-arraybuffer/lib/base64-arraybuffer.js b/camera-app/node_modules/base64-arraybuffer/lib/base64-arraybuffer.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64-arraybuffer/package.json b/camera-app/node_modules/base64-arraybuffer/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64id/.npmignore b/camera-app/node_modules/base64id/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64id/LICENSE b/camera-app/node_modules/base64id/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64id/README.md b/camera-app/node_modules/base64id/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64id/lib/base64id.js b/camera-app/node_modules/base64id/lib/base64id.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/base64id/package.json b/camera-app/node_modules/base64id/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/.npmignore b/camera-app/node_modules/better-assert/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/History.md b/camera-app/node_modules/better-assert/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/Makefile b/camera-app/node_modules/better-assert/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/Readme.md b/camera-app/node_modules/better-assert/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/example.js b/camera-app/node_modules/better-assert/example.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/index.js b/camera-app/node_modules/better-assert/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/better-assert/package.json b/camera-app/node_modules/better-assert/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/blob.iml b/camera-app/node_modules/blob/.idea/blob.iml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/inspectionProfiles/profiles_settings.xml b/camera-app/node_modules/blob/.idea/inspectionProfiles/profiles_settings.xml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/markdown-navigator.xml b/camera-app/node_modules/blob/.idea/markdown-navigator.xml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/markdown-navigator/profiles_settings.xml b/camera-app/node_modules/blob/.idea/markdown-navigator/profiles_settings.xml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/modules.xml b/camera-app/node_modules/blob/.idea/modules.xml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/vcs.xml b/camera-app/node_modules/blob/.idea/vcs.xml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.idea/workspace.xml b/camera-app/node_modules/blob/.idea/workspace.xml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/.zuul.yml b/camera-app/node_modules/blob/.zuul.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/LICENSE b/camera-app/node_modules/blob/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/Makefile b/camera-app/node_modules/blob/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/README.md b/camera-app/node_modules/blob/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/component.json b/camera-app/node_modules/blob/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/index.js b/camera-app/node_modules/blob/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/package.json b/camera-app/node_modules/blob/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/blob/test/index.js b/camera-app/node_modules/blob/test/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cacheable-request/LICENSE b/camera-app/node_modules/cacheable-request/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cacheable-request/README.md b/camera-app/node_modules/cacheable-request/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cacheable-request/package.json b/camera-app/node_modules/cacheable-request/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cacheable-request/src/index.js b/camera-app/node_modules/cacheable-request/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/callsite/.npmignore b/camera-app/node_modules/callsite/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/callsite/History.md b/camera-app/node_modules/callsite/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/callsite/Makefile b/camera-app/node_modules/callsite/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/callsite/Readme.md b/camera-app/node_modules/callsite/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/callsite/index.js b/camera-app/node_modules/callsite/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/callsite/package.json b/camera-app/node_modules/callsite/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/camelcase/index.js b/camera-app/node_modules/camelcase/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/camelcase/license b/camera-app/node_modules/camelcase/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/camelcase/package.json b/camera-app/node_modules/camelcase/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/camelcase/readme.md b/camera-app/node_modules/camelcase/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cliui/CHANGELOG.md b/camera-app/node_modules/cliui/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cliui/LICENSE.txt b/camera-app/node_modules/cliui/LICENSE.txt old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cliui/README.md b/camera-app/node_modules/cliui/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cliui/index.js b/camera-app/node_modules/cliui/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cliui/package.json b/camera-app/node_modules/cliui/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/clone-response/LICENSE b/camera-app/node_modules/clone-response/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/clone-response/README.md b/camera-app/node_modules/clone-response/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/clone-response/package.json b/camera-app/node_modules/clone-response/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/clone-response/src/index.js b/camera-app/node_modules/clone-response/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/code-point-at/index.js b/camera-app/node_modules/code-point-at/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/code-point-at/license b/camera-app/node_modules/code-point-at/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/code-point-at/package.json b/camera-app/node_modules/code-point-at/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/code-point-at/readme.md b/camera-app/node_modules/code-point-at/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/.npmignore b/camera-app/node_modules/component-bind/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/History.md b/camera-app/node_modules/component-bind/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/Makefile b/camera-app/node_modules/component-bind/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/Readme.md b/camera-app/node_modules/component-bind/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/component.json b/camera-app/node_modules/component-bind/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/index.js b/camera-app/node_modules/component-bind/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-bind/package.json b/camera-app/node_modules/component-bind/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-emitter/History.md b/camera-app/node_modules/component-emitter/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-emitter/LICENSE b/camera-app/node_modules/component-emitter/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-emitter/Readme.md b/camera-app/node_modules/component-emitter/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-emitter/index.js b/camera-app/node_modules/component-emitter/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-emitter/package.json b/camera-app/node_modules/component-emitter/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/.npmignore b/camera-app/node_modules/component-inherit/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/History.md b/camera-app/node_modules/component-inherit/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/Makefile b/camera-app/node_modules/component-inherit/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/Readme.md b/camera-app/node_modules/component-inherit/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/component.json b/camera-app/node_modules/component-inherit/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/index.js b/camera-app/node_modules/component-inherit/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/package.json b/camera-app/node_modules/component-inherit/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/component-inherit/test/inherit.js b/camera-app/node_modules/component-inherit/test/inherit.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cookie/HISTORY.md b/camera-app/node_modules/cookie/HISTORY.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cookie/LICENSE b/camera-app/node_modules/cookie/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cookie/README.md b/camera-app/node_modules/cookie/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cookie/index.js b/camera-app/node_modules/cookie/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/cookie/package.json b/camera-app/node_modules/cookie/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/LICENSE b/camera-app/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/README.md b/camera-app/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/dist/debug.js b/camera-app/node_modules/debug/dist/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/package.json b/camera-app/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/src/browser.js b/camera-app/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/src/common.js b/camera-app/node_modules/debug/src/common.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/src/index.js b/camera-app/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/debug/src/node.js b/camera-app/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decamelize/index.js b/camera-app/node_modules/decamelize/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decamelize/license b/camera-app/node_modules/decamelize/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decamelize/package.json b/camera-app/node_modules/decamelize/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decamelize/readme.md b/camera-app/node_modules/decamelize/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decompress-response/index.js b/camera-app/node_modules/decompress-response/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decompress-response/license b/camera-app/node_modules/decompress-response/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decompress-response/package.json b/camera-app/node_modules/decompress-response/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/decompress-response/readme.md b/camera-app/node_modules/decompress-response/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/defer-to-connect/LICENSE b/camera-app/node_modules/defer-to-connect/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/defer-to-connect/README.md b/camera-app/node_modules/defer-to-connect/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/defer-to-connect/index.js b/camera-app/node_modules/defer-to-connect/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/defer-to-connect/package.json b/camera-app/node_modules/defer-to-connect/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/CHANGELOG.md b/camera-app/node_modules/dns-packet/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/LICENSE b/camera-app/node_modules/dns-packet/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/README.md b/camera-app/node_modules/dns-packet/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/classes.js b/camera-app/node_modules/dns-packet/classes.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/index.js b/camera-app/node_modules/dns-packet/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/opcodes.js b/camera-app/node_modules/dns-packet/opcodes.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/optioncodes.js b/camera-app/node_modules/dns-packet/optioncodes.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/package.json b/camera-app/node_modules/dns-packet/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/rcodes.js b/camera-app/node_modules/dns-packet/rcodes.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-packet/types.js b/camera-app/node_modules/dns-packet/types.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-socket/CHANGELOG.md b/camera-app/node_modules/dns-socket/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-socket/LICENSE b/camera-app/node_modules/dns-socket/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-socket/README.md b/camera-app/node_modules/dns-socket/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-socket/index.js b/camera-app/node_modules/dns-socket/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/dns-socket/package.json b/camera-app/node_modules/dns-socket/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/duplexer3/LICENSE.md b/camera-app/node_modules/duplexer3/LICENSE.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/duplexer3/README.md b/camera-app/node_modules/duplexer3/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/duplexer3/index.js b/camera-app/node_modules/duplexer3/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/duplexer3/package.json b/camera-app/node_modules/duplexer3/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/end-of-stream/LICENSE b/camera-app/node_modules/end-of-stream/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/end-of-stream/README.md b/camera-app/node_modules/end-of-stream/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/end-of-stream/index.js b/camera-app/node_modules/end-of-stream/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/end-of-stream/package.json b/camera-app/node_modules/end-of-stream/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/LICENSE b/camera-app/node_modules/engine.io-client/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/README.md b/camera-app/node_modules/engine.io-client/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/engine.io.js b/camera-app/node_modules/engine.io-client/engine.io.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/index.js b/camera-app/node_modules/engine.io-client/lib/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/socket.js b/camera-app/node_modules/engine.io-client/lib/socket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/transport.js b/camera-app/node_modules/engine.io-client/lib/transport.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/transports/polling-jsonp.js b/camera-app/node_modules/engine.io-client/lib/transports/polling-jsonp.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/transports/polling.js b/camera-app/node_modules/engine.io-client/lib/transports/polling.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/transports/websocket.js b/camera-app/node_modules/engine.io-client/lib/transports/websocket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/lib/xmlhttprequest.js b/camera-app/node_modules/engine.io-client/lib/xmlhttprequest.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/.coveralls.yml b/camera-app/node_modules/engine.io-client/node_modules/debug/.coveralls.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/.eslintrc b/camera-app/node_modules/engine.io-client/node_modules/debug/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/.npmignore b/camera-app/node_modules/engine.io-client/node_modules/debug/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/.travis.yml b/camera-app/node_modules/engine.io-client/node_modules/debug/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/engine.io-client/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/LICENSE b/camera-app/node_modules/engine.io-client/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/Makefile b/camera-app/node_modules/engine.io-client/node_modules/debug/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/README.md b/camera-app/node_modules/engine.io-client/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/karma.conf.js b/camera-app/node_modules/engine.io-client/node_modules/debug/karma.conf.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/node.js b/camera-app/node_modules/engine.io-client/node_modules/debug/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/package.json b/camera-app/node_modules/engine.io-client/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/src/browser.js b/camera-app/node_modules/engine.io-client/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/src/debug.js b/camera-app/node_modules/engine.io-client/node_modules/debug/src/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/src/index.js b/camera-app/node_modules/engine.io-client/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/debug/src/node.js b/camera-app/node_modules/engine.io-client/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/ms/index.js b/camera-app/node_modules/engine.io-client/node_modules/ms/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/ms/license.md b/camera-app/node_modules/engine.io-client/node_modules/ms/license.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/ms/package.json b/camera-app/node_modules/engine.io-client/node_modules/ms/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/node_modules/ms/readme.md b/camera-app/node_modules/engine.io-client/node_modules/ms/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-client/package.json b/camera-app/node_modules/engine.io-client/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/LICENSE b/camera-app/node_modules/engine.io-parser/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/Readme.md b/camera-app/node_modules/engine.io-parser/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/lib/browser.js b/camera-app/node_modules/engine.io-parser/lib/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/lib/index.js b/camera-app/node_modules/engine.io-parser/lib/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/lib/keys.js b/camera-app/node_modules/engine.io-parser/lib/keys.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/lib/utf8.js b/camera-app/node_modules/engine.io-parser/lib/utf8.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io-parser/package.json b/camera-app/node_modules/engine.io-parser/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/LICENSE b/camera-app/node_modules/engine.io/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/README.md b/camera-app/node_modules/engine.io/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/engine.io.js b/camera-app/node_modules/engine.io/lib/engine.io.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/server.js b/camera-app/node_modules/engine.io/lib/server.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/socket.js b/camera-app/node_modules/engine.io/lib/socket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/transport.js b/camera-app/node_modules/engine.io/lib/transport.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/transports/index.js b/camera-app/node_modules/engine.io/lib/transports/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/transports/polling-jsonp.js b/camera-app/node_modules/engine.io/lib/transports/polling-jsonp.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/transports/polling-xhr.js b/camera-app/node_modules/engine.io/lib/transports/polling-xhr.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/transports/polling.js b/camera-app/node_modules/engine.io/lib/transports/polling.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/lib/transports/websocket.js b/camera-app/node_modules/engine.io/lib/transports/websocket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/.coveralls.yml b/camera-app/node_modules/engine.io/node_modules/debug/.coveralls.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/.eslintrc b/camera-app/node_modules/engine.io/node_modules/debug/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/.npmignore b/camera-app/node_modules/engine.io/node_modules/debug/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/.travis.yml b/camera-app/node_modules/engine.io/node_modules/debug/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/engine.io/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/LICENSE b/camera-app/node_modules/engine.io/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/Makefile b/camera-app/node_modules/engine.io/node_modules/debug/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/README.md b/camera-app/node_modules/engine.io/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/karma.conf.js b/camera-app/node_modules/engine.io/node_modules/debug/karma.conf.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/node.js b/camera-app/node_modules/engine.io/node_modules/debug/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/package.json b/camera-app/node_modules/engine.io/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/src/browser.js b/camera-app/node_modules/engine.io/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/src/debug.js b/camera-app/node_modules/engine.io/node_modules/debug/src/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/src/index.js b/camera-app/node_modules/engine.io/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/debug/src/node.js b/camera-app/node_modules/engine.io/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/ms/index.js b/camera-app/node_modules/engine.io/node_modules/ms/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/ms/license.md b/camera-app/node_modules/engine.io/node_modules/ms/license.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/ms/package.json b/camera-app/node_modules/engine.io/node_modules/ms/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/node_modules/ms/readme.md b/camera-app/node_modules/engine.io/node_modules/ms/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/engine.io/package.json b/camera-app/node_modules/engine.io/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/error-ex/LICENSE b/camera-app/node_modules/error-ex/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/error-ex/README.md b/camera-app/node_modules/error-ex/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/error-ex/index.js b/camera-app/node_modules/error-ex/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/error-ex/package.json b/camera-app/node_modules/error-ex/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/find-up/index.js b/camera-app/node_modules/find-up/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/find-up/license b/camera-app/node_modules/find-up/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/find-up/package.json b/camera-app/node_modules/find-up/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/find-up/readme.md b/camera-app/node_modules/find-up/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/LICENSE b/camera-app/node_modules/follow-redirects/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/README.md b/camera-app/node_modules/follow-redirects/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/http.js b/camera-app/node_modules/follow-redirects/http.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/https.js b/camera-app/node_modules/follow-redirects/https.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/index.js b/camera-app/node_modules/follow-redirects/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/follow-redirects/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/LICENSE b/camera-app/node_modules/follow-redirects/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/README.md b/camera-app/node_modules/follow-redirects/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/dist/debug.js b/camera-app/node_modules/follow-redirects/node_modules/debug/dist/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/node.js b/camera-app/node_modules/follow-redirects/node_modules/debug/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/package.json b/camera-app/node_modules/follow-redirects/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/src/browser.js b/camera-app/node_modules/follow-redirects/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/src/common.js b/camera-app/node_modules/follow-redirects/node_modules/debug/src/common.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/src/index.js b/camera-app/node_modules/follow-redirects/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/node_modules/debug/src/node.js b/camera-app/node_modules/follow-redirects/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/follow-redirects/package.json b/camera-app/node_modules/follow-redirects/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-caller-file/LICENSE.md b/camera-app/node_modules/get-caller-file/LICENSE.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-caller-file/README.md b/camera-app/node_modules/get-caller-file/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-caller-file/index.js b/camera-app/node_modules/get-caller-file/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-caller-file/package.json b/camera-app/node_modules/get-caller-file/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-stream/buffer-stream.js b/camera-app/node_modules/get-stream/buffer-stream.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-stream/index.js b/camera-app/node_modules/get-stream/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-stream/license b/camera-app/node_modules/get-stream/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-stream/package.json b/camera-app/node_modules/get-stream/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/get-stream/readme.md b/camera-app/node_modules/get-stream/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/license b/camera-app/node_modules/got/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/package.json b/camera-app/node_modules/got/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/readme.md b/camera-app/node_modules/got/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/as-promise.js b/camera-app/node_modules/got/source/as-promise.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/as-stream.js b/camera-app/node_modules/got/source/as-stream.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/create.js b/camera-app/node_modules/got/source/create.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/errors.js b/camera-app/node_modules/got/source/errors.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/get-response.js b/camera-app/node_modules/got/source/get-response.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/index.js b/camera-app/node_modules/got/source/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/known-hook-events.js b/camera-app/node_modules/got/source/known-hook-events.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/merge.js b/camera-app/node_modules/got/source/merge.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/normalize-arguments.js b/camera-app/node_modules/got/source/normalize-arguments.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/progress.js b/camera-app/node_modules/got/source/progress.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/request-as-event-emitter.js b/camera-app/node_modules/got/source/request-as-event-emitter.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/utils/deep-freeze.js b/camera-app/node_modules/got/source/utils/deep-freeze.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/utils/get-body-size.js b/camera-app/node_modules/got/source/utils/get-body-size.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/utils/is-form-data.js b/camera-app/node_modules/got/source/utils/is-form-data.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/utils/timed-out.js b/camera-app/node_modules/got/source/utils/timed-out.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/got/source/utils/url-to-options.js b/camera-app/node_modules/got/source/utils/url-to-options.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/LICENSE b/camera-app/node_modules/graceful-fs/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/README.md b/camera-app/node_modules/graceful-fs/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/clone.js b/camera-app/node_modules/graceful-fs/clone.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/graceful-fs.js b/camera-app/node_modules/graceful-fs/graceful-fs.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/legacy-streams.js b/camera-app/node_modules/graceful-fs/legacy-streams.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/package.json b/camera-app/node_modules/graceful-fs/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/graceful-fs/polyfills.js b/camera-app/node_modules/graceful-fs/polyfills.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-binary2/History.md b/camera-app/node_modules/has-binary2/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-binary2/LICENSE b/camera-app/node_modules/has-binary2/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-binary2/README.md b/camera-app/node_modules/has-binary2/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-binary2/index.js b/camera-app/node_modules/has-binary2/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-binary2/package.json b/camera-app/node_modules/has-binary2/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/.npmignore b/camera-app/node_modules/has-cors/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/History.md b/camera-app/node_modules/has-cors/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/Makefile b/camera-app/node_modules/has-cors/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/Readme.md b/camera-app/node_modules/has-cors/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/component.json b/camera-app/node_modules/has-cors/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/index.js b/camera-app/node_modules/has-cors/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/package.json b/camera-app/node_modules/has-cors/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/has-cors/test.js b/camera-app/node_modules/has-cors/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/CHANGELOG.md b/camera-app/node_modules/hosted-git-info/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/LICENSE b/camera-app/node_modules/hosted-git-info/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/README.md b/camera-app/node_modules/hosted-git-info/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/git-host-info.js b/camera-app/node_modules/hosted-git-info/git-host-info.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/git-host.js b/camera-app/node_modules/hosted-git-info/git-host.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/index.js b/camera-app/node_modules/hosted-git-info/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/hosted-git-info/package.json b/camera-app/node_modules/hosted-git-info/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/http-cache-semantics/LICENSE b/camera-app/node_modules/http-cache-semantics/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/http-cache-semantics/README.md b/camera-app/node_modules/http-cache-semantics/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/http-cache-semantics/index.js b/camera-app/node_modules/http-cache-semantics/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/http-cache-semantics/package.json b/camera-app/node_modules/http-cache-semantics/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/indexof/.npmignore b/camera-app/node_modules/indexof/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/indexof/Makefile b/camera-app/node_modules/indexof/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/indexof/Readme.md b/camera-app/node_modules/indexof/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/indexof/component.json b/camera-app/node_modules/indexof/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/indexof/index.js b/camera-app/node_modules/indexof/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/indexof/package.json b/camera-app/node_modules/indexof/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/invert-kv/index.js b/camera-app/node_modules/invert-kv/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/invert-kv/package.json b/camera-app/node_modules/invert-kv/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/invert-kv/readme.md b/camera-app/node_modules/invert-kv/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip-regex/index.js b/camera-app/node_modules/ip-regex/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip-regex/license b/camera-app/node_modules/ip-regex/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip-regex/package.json b/camera-app/node_modules/ip-regex/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip-regex/readme.md b/camera-app/node_modules/ip-regex/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/.jscsrc b/camera-app/node_modules/ip/.jscsrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/.jshintrc b/camera-app/node_modules/ip/.jshintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/.npmignore b/camera-app/node_modules/ip/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/.travis.yml b/camera-app/node_modules/ip/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/README.md b/camera-app/node_modules/ip/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/lib/ip.js b/camera-app/node_modules/ip/lib/ip.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/package.json b/camera-app/node_modules/ip/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ip/test/api-test.js b/camera-app/node_modules/ip/test/api-test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/.editorconfig b/camera-app/node_modules/is-arrayish/.editorconfig old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/.istanbul.yml b/camera-app/node_modules/is-arrayish/.istanbul.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/.npmignore b/camera-app/node_modules/is-arrayish/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/.travis.yml b/camera-app/node_modules/is-arrayish/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/LICENSE b/camera-app/node_modules/is-arrayish/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/README.md b/camera-app/node_modules/is-arrayish/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/index.js b/camera-app/node_modules/is-arrayish/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-arrayish/package.json b/camera-app/node_modules/is-arrayish/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-buffer/LICENSE b/camera-app/node_modules/is-buffer/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-buffer/README.md b/camera-app/node_modules/is-buffer/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-buffer/index.js b/camera-app/node_modules/is-buffer/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-buffer/package.json b/camera-app/node_modules/is-buffer/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-buffer/test/basic.js b/camera-app/node_modules/is-buffer/test/basic.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-fullwidth-code-point/index.js b/camera-app/node_modules/is-fullwidth-code-point/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-fullwidth-code-point/license b/camera-app/node_modules/is-fullwidth-code-point/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-fullwidth-code-point/package.json b/camera-app/node_modules/is-fullwidth-code-point/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-fullwidth-code-point/readme.md b/camera-app/node_modules/is-fullwidth-code-point/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-ip/index.js b/camera-app/node_modules/is-ip/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-ip/license b/camera-app/node_modules/is-ip/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-ip/package.json b/camera-app/node_modules/is-ip/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-ip/readme.md b/camera-app/node_modules/is-ip/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-utf8/LICENSE b/camera-app/node_modules/is-utf8/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-utf8/README.md b/camera-app/node_modules/is-utf8/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-utf8/is-utf8.js b/camera-app/node_modules/is-utf8/is-utf8.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/is-utf8/package.json b/camera-app/node_modules/is-utf8/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/isarray/README.md b/camera-app/node_modules/isarray/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/isarray/index.js b/camera-app/node_modules/isarray/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/isarray/package.json b/camera-app/node_modules/isarray/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/.npmignore b/camera-app/node_modules/json-buffer/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/.travis.yml b/camera-app/node_modules/json-buffer/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/LICENSE b/camera-app/node_modules/json-buffer/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/README.md b/camera-app/node_modules/json-buffer/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/index.js b/camera-app/node_modules/json-buffer/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/package.json b/camera-app/node_modules/json-buffer/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/json-buffer/test/index.js b/camera-app/node_modules/json-buffer/test/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/keyv/LICENSE b/camera-app/node_modules/keyv/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/keyv/README.md b/camera-app/node_modules/keyv/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/keyv/package.json b/camera-app/node_modules/keyv/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/keyv/src/index.js b/camera-app/node_modules/keyv/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lcid/index.js b/camera-app/node_modules/lcid/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lcid/lcid.json b/camera-app/node_modules/lcid/lcid.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lcid/license b/camera-app/node_modules/lcid/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lcid/package.json b/camera-app/node_modules/lcid/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lcid/readme.md b/camera-app/node_modules/lcid/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/.travis.yml b/camera-app/node_modules/left-pad/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/COPYING b/camera-app/node_modules/left-pad/COPYING old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/README.md b/camera-app/node_modules/left-pad/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/index.d.ts b/camera-app/node_modules/left-pad/index.d.ts old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/index.js b/camera-app/node_modules/left-pad/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/package.json b/camera-app/node_modules/left-pad/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/perf/O(n).js b/camera-app/node_modules/left-pad/perf/O(n).js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/perf/es6Repeat.js b/camera-app/node_modules/left-pad/perf/es6Repeat.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/perf/perf.js b/camera-app/node_modules/left-pad/perf/perf.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/left-pad/test.js b/camera-app/node_modules/left-pad/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/load-json-file/index.js b/camera-app/node_modules/load-json-file/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/load-json-file/license b/camera-app/node_modules/load-json-file/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/load-json-file/package.json b/camera-app/node_modules/load-json-file/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/load-json-file/readme.md b/camera-app/node_modules/load-json-file/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/.travis.yml b/camera-app/node_modules/localtunnel/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/History.md b/camera-app/node_modules/localtunnel/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/LICENSE b/camera-app/node_modules/localtunnel/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/README.md b/camera-app/node_modules/localtunnel/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/client.js b/camera-app/node_modules/localtunnel/client.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/lib/HeaderHostTransformer.js b/camera-app/node_modules/localtunnel/lib/HeaderHostTransformer.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/lib/Tunnel.js b/camera-app/node_modules/localtunnel/lib/Tunnel.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/lib/TunnelCluster.js b/camera-app/node_modules/localtunnel/lib/TunnelCluster.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/.coveralls.yml b/camera-app/node_modules/localtunnel/node_modules/debug/.coveralls.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/.eslintrc b/camera-app/node_modules/localtunnel/node_modules/debug/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/.npmignore b/camera-app/node_modules/localtunnel/node_modules/debug/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/.travis.yml b/camera-app/node_modules/localtunnel/node_modules/debug/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/localtunnel/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/LICENSE b/camera-app/node_modules/localtunnel/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/Makefile b/camera-app/node_modules/localtunnel/node_modules/debug/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/README.md b/camera-app/node_modules/localtunnel/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/component.json b/camera-app/node_modules/localtunnel/node_modules/debug/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/karma.conf.js b/camera-app/node_modules/localtunnel/node_modules/debug/karma.conf.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/node.js b/camera-app/node_modules/localtunnel/node_modules/debug/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/package.json b/camera-app/node_modules/localtunnel/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/src/browser.js b/camera-app/node_modules/localtunnel/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/src/debug.js b/camera-app/node_modules/localtunnel/node_modules/debug/src/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/src/index.js b/camera-app/node_modules/localtunnel/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/src/inspector-log.js b/camera-app/node_modules/localtunnel/node_modules/debug/src/inspector-log.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/debug/src/node.js b/camera-app/node_modules/localtunnel/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/ms/index.js b/camera-app/node_modules/localtunnel/node_modules/ms/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/ms/license.md b/camera-app/node_modules/localtunnel/node_modules/ms/license.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/ms/package.json b/camera-app/node_modules/localtunnel/node_modules/ms/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/node_modules/ms/readme.md b/camera-app/node_modules/localtunnel/node_modules/ms/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/package.json b/camera-app/node_modules/localtunnel/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/test/index.js b/camera-app/node_modules/localtunnel/test/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/localtunnel/yarn.lock b/camera-app/node_modules/localtunnel/yarn.lock old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lowercase-keys/index.js b/camera-app/node_modules/lowercase-keys/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lowercase-keys/license b/camera-app/node_modules/lowercase-keys/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lowercase-keys/package.json b/camera-app/node_modules/lowercase-keys/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/lowercase-keys/readme.md b/camera-app/node_modules/lowercase-keys/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-db/HISTORY.md b/camera-app/node_modules/mime-db/HISTORY.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-db/LICENSE b/camera-app/node_modules/mime-db/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-db/README.md b/camera-app/node_modules/mime-db/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-db/db.json b/camera-app/node_modules/mime-db/db.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-db/index.js b/camera-app/node_modules/mime-db/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-db/package.json b/camera-app/node_modules/mime-db/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-types/HISTORY.md b/camera-app/node_modules/mime-types/HISTORY.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-types/LICENSE b/camera-app/node_modules/mime-types/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-types/README.md b/camera-app/node_modules/mime-types/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-types/index.js b/camera-app/node_modules/mime-types/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mime-types/package.json b/camera-app/node_modules/mime-types/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mimic-response/index.js b/camera-app/node_modules/mimic-response/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mimic-response/license b/camera-app/node_modules/mimic-response/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mimic-response/package.json b/camera-app/node_modules/mimic-response/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/mimic-response/readme.md b/camera-app/node_modules/mimic-response/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ms/index.js b/camera-app/node_modules/ms/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ms/license.md b/camera-app/node_modules/ms/license.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ms/package.json b/camera-app/node_modules/ms/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ms/readme.md b/camera-app/node_modules/ms/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/HISTORY.md b/camera-app/node_modules/negotiator/HISTORY.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/LICENSE b/camera-app/node_modules/negotiator/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/README.md b/camera-app/node_modules/negotiator/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/index.js b/camera-app/node_modules/negotiator/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/lib/charset.js b/camera-app/node_modules/negotiator/lib/charset.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/lib/encoding.js b/camera-app/node_modules/negotiator/lib/encoding.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/lib/language.js b/camera-app/node_modules/negotiator/lib/language.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/lib/mediaType.js b/camera-app/node_modules/negotiator/lib/mediaType.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/negotiator/package.json b/camera-app/node_modules/negotiator/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/AUTHORS b/camera-app/node_modules/normalize-package-data/AUTHORS old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/LICENSE b/camera-app/node_modules/normalize-package-data/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/README.md b/camera-app/node_modules/normalize-package-data/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/extract_description.js b/camera-app/node_modules/normalize-package-data/lib/extract_description.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/fixer.js b/camera-app/node_modules/normalize-package-data/lib/fixer.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/make_warning.js b/camera-app/node_modules/normalize-package-data/lib/make_warning.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/normalize.js b/camera-app/node_modules/normalize-package-data/lib/normalize.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/safe_format.js b/camera-app/node_modules/normalize-package-data/lib/safe_format.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/typos.json b/camera-app/node_modules/normalize-package-data/lib/typos.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/lib/warning_messages.json b/camera-app/node_modules/normalize-package-data/lib/warning_messages.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-package-data/package.json b/camera-app/node_modules/normalize-package-data/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-url/index.js b/camera-app/node_modules/normalize-url/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-url/license b/camera-app/node_modules/normalize-url/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-url/package.json b/camera-app/node_modules/normalize-url/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/normalize-url/readme.md b/camera-app/node_modules/normalize-url/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/number-is-nan/index.js b/camera-app/node_modules/number-is-nan/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/number-is-nan/license b/camera-app/node_modules/number-is-nan/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/number-is-nan/package.json b/camera-app/node_modules/number-is-nan/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/number-is-nan/readme.md b/camera-app/node_modules/number-is-nan/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/.npmignore b/camera-app/node_modules/object-component/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/History.md b/camera-app/node_modules/object-component/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/Makefile b/camera-app/node_modules/object-component/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/Readme.md b/camera-app/node_modules/object-component/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/component.json b/camera-app/node_modules/object-component/component.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/index.js b/camera-app/node_modules/object-component/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/package.json b/camera-app/node_modules/object-component/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/object-component/test/object.js b/camera-app/node_modules/object-component/test/object.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/once/LICENSE b/camera-app/node_modules/once/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/once/README.md b/camera-app/node_modules/once/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/once/once.js b/camera-app/node_modules/once/once.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/once/package.json b/camera-app/node_modules/once/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/openurl/.npmignore b/camera-app/node_modules/openurl/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/openurl/README.md b/camera-app/node_modules/openurl/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/openurl/openurl.js b/camera-app/node_modules/openurl/openurl.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/openurl/package.json b/camera-app/node_modules/openurl/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/os-locale/index.js b/camera-app/node_modules/os-locale/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/os-locale/license b/camera-app/node_modules/os-locale/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/os-locale/package.json b/camera-app/node_modules/os-locale/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/os-locale/readme.md b/camera-app/node_modules/os-locale/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/p-cancelable/index.d.ts b/camera-app/node_modules/p-cancelable/index.d.ts old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/p-cancelable/index.js b/camera-app/node_modules/p-cancelable/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/p-cancelable/license b/camera-app/node_modules/p-cancelable/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/p-cancelable/package.json b/camera-app/node_modules/p-cancelable/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/p-cancelable/readme.md b/camera-app/node_modules/p-cancelable/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parse-json/index.js b/camera-app/node_modules/parse-json/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parse-json/license b/camera-app/node_modules/parse-json/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parse-json/package.json b/camera-app/node_modules/parse-json/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parse-json/readme.md b/camera-app/node_modules/parse-json/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parse-json/vendor/parse.js b/camera-app/node_modules/parse-json/vendor/parse.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parse-json/vendor/unicode.js b/camera-app/node_modules/parse-json/vendor/unicode.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/.npmignore b/camera-app/node_modules/parseqs/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/LICENSE b/camera-app/node_modules/parseqs/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/Makefile b/camera-app/node_modules/parseqs/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/README.md b/camera-app/node_modules/parseqs/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/index.js b/camera-app/node_modules/parseqs/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/package.json b/camera-app/node_modules/parseqs/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseqs/test.js b/camera-app/node_modules/parseqs/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/.npmignore b/camera-app/node_modules/parseuri/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/History.md b/camera-app/node_modules/parseuri/History.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/LICENSE b/camera-app/node_modules/parseuri/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/Makefile b/camera-app/node_modules/parseuri/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/README.md b/camera-app/node_modules/parseuri/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/index.js b/camera-app/node_modules/parseuri/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/package.json b/camera-app/node_modules/parseuri/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/parseuri/test.js b/camera-app/node_modules/parseuri/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-exists/index.js b/camera-app/node_modules/path-exists/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-exists/license b/camera-app/node_modules/path-exists/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-exists/package.json b/camera-app/node_modules/path-exists/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-exists/readme.md b/camera-app/node_modules/path-exists/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-parse/.travis.yml b/camera-app/node_modules/path-parse/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-parse/LICENSE b/camera-app/node_modules/path-parse/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-parse/README.md b/camera-app/node_modules/path-parse/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-parse/index.js b/camera-app/node_modules/path-parse/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-parse/package.json b/camera-app/node_modules/path-parse/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-parse/test.js b/camera-app/node_modules/path-parse/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-type/index.js b/camera-app/node_modules/path-type/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-type/license b/camera-app/node_modules/path-type/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-type/package.json b/camera-app/node_modules/path-type/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/path-type/readme.md b/camera-app/node_modules/path-type/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pify/index.js b/camera-app/node_modules/pify/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pify/license b/camera-app/node_modules/pify/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pify/package.json b/camera-app/node_modules/pify/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pify/readme.md b/camera-app/node_modules/pify/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie-promise/index.js b/camera-app/node_modules/pinkie-promise/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie-promise/license b/camera-app/node_modules/pinkie-promise/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie-promise/package.json b/camera-app/node_modules/pinkie-promise/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie-promise/readme.md b/camera-app/node_modules/pinkie-promise/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie/index.js b/camera-app/node_modules/pinkie/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie/license b/camera-app/node_modules/pinkie/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie/package.json b/camera-app/node_modules/pinkie/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pinkie/readme.md b/camera-app/node_modules/pinkie/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/prepend-http/index.js b/camera-app/node_modules/prepend-http/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/prepend-http/license b/camera-app/node_modules/prepend-http/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/prepend-http/package.json b/camera-app/node_modules/prepend-http/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/prepend-http/readme.md b/camera-app/node_modules/prepend-http/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/public-ip/browser.js b/camera-app/node_modules/public-ip/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/public-ip/index.js b/camera-app/node_modules/public-ip/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/public-ip/license b/camera-app/node_modules/public-ip/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/public-ip/package.json b/camera-app/node_modules/public-ip/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/public-ip/readme.md b/camera-app/node_modules/public-ip/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/.travis.yml b/camera-app/node_modules/pump/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/LICENSE b/camera-app/node_modules/pump/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/README.md b/camera-app/node_modules/pump/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/index.js b/camera-app/node_modules/pump/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/package.json b/camera-app/node_modules/pump/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/test-browser.js b/camera-app/node_modules/pump/test-browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/pump/test-node.js b/camera-app/node_modules/pump/test-node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg-up/index.js b/camera-app/node_modules/read-pkg-up/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg-up/license b/camera-app/node_modules/read-pkg-up/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg-up/package.json b/camera-app/node_modules/read-pkg-up/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg-up/readme.md b/camera-app/node_modules/read-pkg-up/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg/index.js b/camera-app/node_modules/read-pkg/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg/license b/camera-app/node_modules/read-pkg/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg/package.json b/camera-app/node_modules/read-pkg/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/read-pkg/readme.md b/camera-app/node_modules/read-pkg/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/.jshintrc b/camera-app/node_modules/require-directory/.jshintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/.npmignore b/camera-app/node_modules/require-directory/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/.travis.yml b/camera-app/node_modules/require-directory/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/LICENSE b/camera-app/node_modules/require-directory/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/README.markdown b/camera-app/node_modules/require-directory/README.markdown old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/index.js b/camera-app/node_modules/require-directory/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-directory/package.json b/camera-app/node_modules/require-directory/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/.npmignore b/camera-app/node_modules/require-main-filename/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/.travis.yml b/camera-app/node_modules/require-main-filename/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/LICENSE.txt b/camera-app/node_modules/require-main-filename/LICENSE.txt old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/README.md b/camera-app/node_modules/require-main-filename/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/index.js b/camera-app/node_modules/require-main-filename/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/package.json b/camera-app/node_modules/require-main-filename/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/require-main-filename/test.js b/camera-app/node_modules/require-main-filename/test.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/.editorconfig b/camera-app/node_modules/resolve/.editorconfig old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/.eslintignore b/camera-app/node_modules/resolve/.eslintignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/.eslintrc b/camera-app/node_modules/resolve/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/.travis.yml b/camera-app/node_modules/resolve/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/CHANGELOG.md b/camera-app/node_modules/resolve/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/LICENSE b/camera-app/node_modules/resolve/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/appveyor.yml b/camera-app/node_modules/resolve/appveyor.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/changelog.hbs b/camera-app/node_modules/resolve/changelog.hbs old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/example/async.js b/camera-app/node_modules/resolve/example/async.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/example/sync.js b/camera-app/node_modules/resolve/example/sync.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/index.js b/camera-app/node_modules/resolve/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/async.js b/camera-app/node_modules/resolve/lib/async.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/caller.js b/camera-app/node_modules/resolve/lib/caller.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/core.js b/camera-app/node_modules/resolve/lib/core.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/core.json b/camera-app/node_modules/resolve/lib/core.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/node-modules-paths.js b/camera-app/node_modules/resolve/lib/node-modules-paths.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/normalize-options.js b/camera-app/node_modules/resolve/lib/normalize-options.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/lib/sync.js b/camera-app/node_modules/resolve/lib/sync.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/package.json b/camera-app/node_modules/resolve/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/readme.markdown b/camera-app/node_modules/resolve/readme.markdown old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/.eslintrc b/camera-app/node_modules/resolve/test/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/core.js b/camera-app/node_modules/resolve/test/core.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/dotdot.js b/camera-app/node_modules/resolve/test/dotdot.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/dotdot/abc/index.js b/camera-app/node_modules/resolve/test/dotdot/abc/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/dotdot/index.js b/camera-app/node_modules/resolve/test/dotdot/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/faulty_basedir.js b/camera-app/node_modules/resolve/test/faulty_basedir.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/filter.js b/camera-app/node_modules/resolve/test/filter.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/filter_sync.js b/camera-app/node_modules/resolve/test/filter_sync.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/mock.js b/camera-app/node_modules/resolve/test/mock.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/mock_sync.js b/camera-app/node_modules/resolve/test/mock_sync.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/module_dir.js b/camera-app/node_modules/resolve/test/module_dir.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/module_dir/xmodules/aaa/index.js b/camera-app/node_modules/resolve/test/module_dir/xmodules/aaa/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/module_dir/ymodules/aaa/index.js b/camera-app/node_modules/resolve/test/module_dir/ymodules/aaa/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/module_dir/zmodules/bbb/main.js b/camera-app/node_modules/resolve/test/module_dir/zmodules/bbb/main.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/module_dir/zmodules/bbb/package.json b/camera-app/node_modules/resolve/test/module_dir/zmodules/bbb/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/node-modules-paths.js b/camera-app/node_modules/resolve/test/node-modules-paths.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/node_path.js b/camera-app/node_modules/resolve/test/node_path.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/node_path/x/aaa/index.js b/camera-app/node_modules/resolve/test/node_path/x/aaa/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/node_path/x/ccc/index.js b/camera-app/node_modules/resolve/test/node_path/x/ccc/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/node_path/y/bbb/index.js b/camera-app/node_modules/resolve/test/node_path/y/bbb/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/node_path/y/ccc/index.js b/camera-app/node_modules/resolve/test/node_path/y/ccc/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/nonstring.js b/camera-app/node_modules/resolve/test/nonstring.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/pathfilter.js b/camera-app/node_modules/resolve/test/pathfilter.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/pathfilter/deep_ref/main.js b/camera-app/node_modules/resolve/test/pathfilter/deep_ref/main.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/precedence.js b/camera-app/node_modules/resolve/test/precedence.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/precedence/aaa.js b/camera-app/node_modules/resolve/test/precedence/aaa.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/precedence/aaa/index.js b/camera-app/node_modules/resolve/test/precedence/aaa/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/precedence/aaa/main.js b/camera-app/node_modules/resolve/test/precedence/aaa/main.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/precedence/bbb.js b/camera-app/node_modules/resolve/test/precedence/bbb.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/precedence/bbb/main.js b/camera-app/node_modules/resolve/test/precedence/bbb/main.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver.js b/camera-app/node_modules/resolve/test/resolver.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/baz/doom.js b/camera-app/node_modules/resolve/test/resolver/baz/doom.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/baz/package.json b/camera-app/node_modules/resolve/test/resolver/baz/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/baz/quux.js b/camera-app/node_modules/resolve/test/resolver/baz/quux.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/browser_field/a.js b/camera-app/node_modules/resolve/test/resolver/browser_field/a.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/browser_field/b.js b/camera-app/node_modules/resolve/test/resolver/browser_field/b.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/browser_field/package.json b/camera-app/node_modules/resolve/test/resolver/browser_field/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/cup.coffee b/camera-app/node_modules/resolve/test/resolver/cup.coffee old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/dot_main/index.js b/camera-app/node_modules/resolve/test/resolver/dot_main/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/dot_main/package.json b/camera-app/node_modules/resolve/test/resolver/dot_main/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/dot_slash_main/index.js b/camera-app/node_modules/resolve/test/resolver/dot_slash_main/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/dot_slash_main/package.json b/camera-app/node_modules/resolve/test/resolver/dot_slash_main/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/foo.js b/camera-app/node_modules/resolve/test/resolver/foo.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/incorrect_main/index.js b/camera-app/node_modules/resolve/test/resolver/incorrect_main/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/incorrect_main/package.json b/camera-app/node_modules/resolve/test/resolver/incorrect_main/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/invalid_main/package.json b/camera-app/node_modules/resolve/test/resolver/invalid_main/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/mug.coffee b/camera-app/node_modules/resolve/test/resolver/mug.coffee old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/mug.js b/camera-app/node_modules/resolve/test/resolver/mug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/multirepo/lerna.json b/camera-app/node_modules/resolve/test/resolver/multirepo/lerna.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/multirepo/package.json b/camera-app/node_modules/resolve/test/resolver/multirepo/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-a/index.js b/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-a/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-a/package.json b/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-a/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-b/index.js b/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-b/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-b/package.json b/camera-app/node_modules/resolve/test/resolver/multirepo/packages/package-b/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/other_path/lib/other-lib.js b/camera-app/node_modules/resolve/test/resolver/other_path/lib/other-lib.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/other_path/root.js b/camera-app/node_modules/resolve/test/resolver/other_path/root.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/quux/foo/index.js b/camera-app/node_modules/resolve/test/resolver/quux/foo/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/same_names/foo.js b/camera-app/node_modules/resolve/test/resolver/same_names/foo.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/same_names/foo/index.js b/camera-app/node_modules/resolve/test/resolver/same_names/foo/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/symlinked/_/node_modules/foo.js b/camera-app/node_modules/resolve/test/resolver/symlinked/_/node_modules/foo.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/symlinked/_/symlink_target/.gitkeep b/camera-app/node_modules/resolve/test/resolver/symlinked/_/symlink_target/.gitkeep old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver/without_basedir/main.js b/camera-app/node_modules/resolve/test/resolver/without_basedir/main.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/resolver_sync.js b/camera-app/node_modules/resolve/test/resolver_sync.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/subdirs.js b/camera-app/node_modules/resolve/test/subdirs.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/resolve/test/symlinks.js b/camera-app/node_modules/resolve/test/symlinks.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/responselike/LICENSE b/camera-app/node_modules/responselike/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/responselike/README.md b/camera-app/node_modules/responselike/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/responselike/package.json b/camera-app/node_modules/responselike/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/responselike/src/index.js b/camera-app/node_modules/responselike/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/semver/CHANGELOG.md b/camera-app/node_modules/semver/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/semver/LICENSE b/camera-app/node_modules/semver/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/semver/README.md b/camera-app/node_modules/semver/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/semver/package.json b/camera-app/node_modules/semver/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/semver/range.bnf b/camera-app/node_modules/semver/range.bnf old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/semver/semver.js b/camera-app/node_modules/semver/semver.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/set-blocking/CHANGELOG.md b/camera-app/node_modules/set-blocking/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/set-blocking/LICENSE.txt b/camera-app/node_modules/set-blocking/LICENSE.txt old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/set-blocking/README.md b/camera-app/node_modules/set-blocking/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/set-blocking/index.js b/camera-app/node_modules/set-blocking/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/set-blocking/package.json b/camera-app/node_modules/set-blocking/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-adapter/.npmignore b/camera-app/node_modules/socket.io-adapter/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-adapter/LICENSE b/camera-app/node_modules/socket.io-adapter/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-adapter/Readme.md b/camera-app/node_modules/socket.io-adapter/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-adapter/index.js b/camera-app/node_modules/socket.io-adapter/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-adapter/package.json b/camera-app/node_modules/socket.io-adapter/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/LICENSE b/camera-app/node_modules/socket.io-client/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/README.md b/camera-app/node_modules/socket.io-client/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.dev.js b/camera-app/node_modules/socket.io-client/dist/socket.io.dev.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.dev.js.map b/camera-app/node_modules/socket.io-client/dist/socket.io.dev.js.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.js b/camera-app/node_modules/socket.io-client/dist/socket.io.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.js.map b/camera-app/node_modules/socket.io-client/dist/socket.io.js.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.slim.dev.js b/camera-app/node_modules/socket.io-client/dist/socket.io.slim.dev.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.slim.dev.js.map b/camera-app/node_modules/socket.io-client/dist/socket.io.slim.dev.js.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.slim.js b/camera-app/node_modules/socket.io-client/dist/socket.io.slim.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/dist/socket.io.slim.js.map b/camera-app/node_modules/socket.io-client/dist/socket.io.slim.js.map old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/lib/index.js b/camera-app/node_modules/socket.io-client/lib/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/lib/manager.js b/camera-app/node_modules/socket.io-client/lib/manager.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/lib/on.js b/camera-app/node_modules/socket.io-client/lib/on.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/lib/socket.js b/camera-app/node_modules/socket.io-client/lib/socket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/lib/url.js b/camera-app/node_modules/socket.io-client/lib/url.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/.coveralls.yml b/camera-app/node_modules/socket.io-client/node_modules/debug/.coveralls.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/.eslintrc b/camera-app/node_modules/socket.io-client/node_modules/debug/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/.npmignore b/camera-app/node_modules/socket.io-client/node_modules/debug/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/.travis.yml b/camera-app/node_modules/socket.io-client/node_modules/debug/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/LICENSE b/camera-app/node_modules/socket.io-client/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/Makefile b/camera-app/node_modules/socket.io-client/node_modules/debug/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/README.md b/camera-app/node_modules/socket.io-client/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/karma.conf.js b/camera-app/node_modules/socket.io-client/node_modules/debug/karma.conf.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/node.js b/camera-app/node_modules/socket.io-client/node_modules/debug/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/package.json b/camera-app/node_modules/socket.io-client/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/src/browser.js b/camera-app/node_modules/socket.io-client/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/src/debug.js b/camera-app/node_modules/socket.io-client/node_modules/debug/src/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/src/index.js b/camera-app/node_modules/socket.io-client/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/debug/src/node.js b/camera-app/node_modules/socket.io-client/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/ms/index.js b/camera-app/node_modules/socket.io-client/node_modules/ms/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/ms/license.md b/camera-app/node_modules/socket.io-client/node_modules/ms/license.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/ms/package.json b/camera-app/node_modules/socket.io-client/node_modules/ms/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/node_modules/ms/readme.md b/camera-app/node_modules/socket.io-client/node_modules/ms/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-client/package.json b/camera-app/node_modules/socket.io-client/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/LICENSE b/camera-app/node_modules/socket.io-parser/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/Readme.md b/camera-app/node_modules/socket.io-parser/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/binary.js b/camera-app/node_modules/socket.io-parser/binary.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/index.js b/camera-app/node_modules/socket.io-parser/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/is-buffer.js b/camera-app/node_modules/socket.io-parser/is-buffer.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/.coveralls.yml b/camera-app/node_modules/socket.io-parser/node_modules/debug/.coveralls.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/.eslintrc b/camera-app/node_modules/socket.io-parser/node_modules/debug/.eslintrc old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/.npmignore b/camera-app/node_modules/socket.io-parser/node_modules/debug/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/.travis.yml b/camera-app/node_modules/socket.io-parser/node_modules/debug/.travis.yml old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/CHANGELOG.md b/camera-app/node_modules/socket.io-parser/node_modules/debug/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/LICENSE b/camera-app/node_modules/socket.io-parser/node_modules/debug/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/Makefile b/camera-app/node_modules/socket.io-parser/node_modules/debug/Makefile old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/README.md b/camera-app/node_modules/socket.io-parser/node_modules/debug/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/karma.conf.js b/camera-app/node_modules/socket.io-parser/node_modules/debug/karma.conf.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/node.js b/camera-app/node_modules/socket.io-parser/node_modules/debug/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/package.json b/camera-app/node_modules/socket.io-parser/node_modules/debug/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/src/browser.js b/camera-app/node_modules/socket.io-parser/node_modules/debug/src/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/src/debug.js b/camera-app/node_modules/socket.io-parser/node_modules/debug/src/debug.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/src/index.js b/camera-app/node_modules/socket.io-parser/node_modules/debug/src/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/debug/src/node.js b/camera-app/node_modules/socket.io-parser/node_modules/debug/src/node.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/ms/index.js b/camera-app/node_modules/socket.io-parser/node_modules/ms/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/ms/license.md b/camera-app/node_modules/socket.io-parser/node_modules/ms/license.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/ms/package.json b/camera-app/node_modules/socket.io-parser/node_modules/ms/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/node_modules/ms/readme.md b/camera-app/node_modules/socket.io-parser/node_modules/ms/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io-parser/package.json b/camera-app/node_modules/socket.io-parser/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/LICENSE b/camera-app/node_modules/socket.io/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/Readme.md b/camera-app/node_modules/socket.io/Readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/lib/client.js b/camera-app/node_modules/socket.io/lib/client.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/lib/index.js b/camera-app/node_modules/socket.io/lib/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/lib/namespace.js b/camera-app/node_modules/socket.io/lib/namespace.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/lib/parent-namespace.js b/camera-app/node_modules/socket.io/lib/parent-namespace.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/lib/socket.js b/camera-app/node_modules/socket.io/lib/socket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/socket.io/package.json b/camera-app/node_modules/socket.io/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-correct/LICENSE b/camera-app/node_modules/spdx-correct/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-correct/README.md b/camera-app/node_modules/spdx-correct/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-correct/index.js b/camera-app/node_modules/spdx-correct/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-correct/package.json b/camera-app/node_modules/spdx-correct/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-exceptions/README.md b/camera-app/node_modules/spdx-exceptions/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-exceptions/index.json b/camera-app/node_modules/spdx-exceptions/index.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-exceptions/package.json b/camera-app/node_modules/spdx-exceptions/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-exceptions/test.log b/camera-app/node_modules/spdx-exceptions/test.log old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/AUTHORS b/camera-app/node_modules/spdx-expression-parse/AUTHORS old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/LICENSE b/camera-app/node_modules/spdx-expression-parse/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/README.md b/camera-app/node_modules/spdx-expression-parse/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/index.js b/camera-app/node_modules/spdx-expression-parse/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/package.json b/camera-app/node_modules/spdx-expression-parse/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/parse.js b/camera-app/node_modules/spdx-expression-parse/parse.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-expression-parse/scan.js b/camera-app/node_modules/spdx-expression-parse/scan.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-license-ids/README.md b/camera-app/node_modules/spdx-license-ids/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-license-ids/deprecated.json b/camera-app/node_modules/spdx-license-ids/deprecated.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-license-ids/index.json b/camera-app/node_modules/spdx-license-ids/index.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/spdx-license-ids/package.json b/camera-app/node_modules/spdx-license-ids/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/string-width/index.js b/camera-app/node_modules/string-width/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/string-width/license b/camera-app/node_modules/string-width/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/string-width/package.json b/camera-app/node_modules/string-width/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/string-width/readme.md b/camera-app/node_modules/string-width/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-ansi/index.js b/camera-app/node_modules/strip-ansi/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-ansi/license b/camera-app/node_modules/strip-ansi/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-ansi/package.json b/camera-app/node_modules/strip-ansi/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-ansi/readme.md b/camera-app/node_modules/strip-ansi/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-bom/index.js b/camera-app/node_modules/strip-bom/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-bom/license b/camera-app/node_modules/strip-bom/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-bom/package.json b/camera-app/node_modules/strip-bom/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/strip-bom/readme.md b/camera-app/node_modules/strip-bom/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-array/.npmignore b/camera-app/node_modules/to-array/.npmignore old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-array/LICENCE b/camera-app/node_modules/to-array/LICENCE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-array/README.md b/camera-app/node_modules/to-array/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-array/index.js b/camera-app/node_modules/to-array/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-array/package.json b/camera-app/node_modules/to-array/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-readable-stream/index.js b/camera-app/node_modules/to-readable-stream/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-readable-stream/license b/camera-app/node_modules/to-readable-stream/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-readable-stream/package.json b/camera-app/node_modules/to-readable-stream/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/to-readable-stream/readme.md b/camera-app/node_modules/to-readable-stream/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/url-parse-lax/index.js b/camera-app/node_modules/url-parse-lax/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/url-parse-lax/license b/camera-app/node_modules/url-parse-lax/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/url-parse-lax/package.json b/camera-app/node_modules/url-parse-lax/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/url-parse-lax/readme.md b/camera-app/node_modules/url-parse-lax/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/validate-npm-package-license/LICENSE b/camera-app/node_modules/validate-npm-package-license/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/validate-npm-package-license/README.md b/camera-app/node_modules/validate-npm-package-license/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/validate-npm-package-license/index.js b/camera-app/node_modules/validate-npm-package-license/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/validate-npm-package-license/package.json b/camera-app/node_modules/validate-npm-package-license/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/which-module/CHANGELOG.md b/camera-app/node_modules/which-module/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/which-module/LICENSE b/camera-app/node_modules/which-module/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/which-module/README.md b/camera-app/node_modules/which-module/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/which-module/index.js b/camera-app/node_modules/which-module/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/which-module/package.json b/camera-app/node_modules/which-module/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrap-ansi/license b/camera-app/node_modules/wrap-ansi/license old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrap-ansi/package.json b/camera-app/node_modules/wrap-ansi/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrap-ansi/readme.md b/camera-app/node_modules/wrap-ansi/readme.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrappy/LICENSE b/camera-app/node_modules/wrappy/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrappy/README.md b/camera-app/node_modules/wrappy/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrappy/package.json b/camera-app/node_modules/wrappy/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/wrappy/wrappy.js b/camera-app/node_modules/wrappy/wrappy.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/LICENSE b/camera-app/node_modules/ws/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/README.md b/camera-app/node_modules/ws/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/browser.js b/camera-app/node_modules/ws/browser.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/index.js b/camera-app/node_modules/ws/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/buffer-util.js b/camera-app/node_modules/ws/lib/buffer-util.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/constants.js b/camera-app/node_modules/ws/lib/constants.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/event-target.js b/camera-app/node_modules/ws/lib/event-target.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/extension.js b/camera-app/node_modules/ws/lib/extension.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/permessage-deflate.js b/camera-app/node_modules/ws/lib/permessage-deflate.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/receiver.js b/camera-app/node_modules/ws/lib/receiver.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/sender.js b/camera-app/node_modules/ws/lib/sender.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/validation.js b/camera-app/node_modules/ws/lib/validation.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/websocket-server.js b/camera-app/node_modules/ws/lib/websocket-server.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/lib/websocket.js b/camera-app/node_modules/ws/lib/websocket.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/ws/package.json b/camera-app/node_modules/ws/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/LICENSE b/camera-app/node_modules/xmlhttprequest-ssl/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/README.md b/camera-app/node_modules/xmlhttprequest-ssl/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/autotest.watchr b/camera-app/node_modules/xmlhttprequest-ssl/autotest.watchr old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/example/demo.js b/camera-app/node_modules/xmlhttprequest-ssl/example/demo.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/lib/XMLHttpRequest.js b/camera-app/node_modules/xmlhttprequest-ssl/lib/XMLHttpRequest.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/package.json b/camera-app/node_modules/xmlhttprequest-ssl/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-constants.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-constants.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-events.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-events.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-exceptions.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-exceptions.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-headers.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-headers.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-redirect-302.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-redirect-302.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-redirect-303.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-redirect-303.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-redirect-307.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-redirect-307.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-request-methods.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-request-methods.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/test-request-protocols.js b/camera-app/node_modules/xmlhttprequest-ssl/tests/test-request-protocols.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/xmlhttprequest-ssl/tests/testdata.txt b/camera-app/node_modules/xmlhttprequest-ssl/tests/testdata.txt old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/y18n/LICENSE b/camera-app/node_modules/y18n/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/y18n/README.md b/camera-app/node_modules/y18n/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/y18n/index.js b/camera-app/node_modules/y18n/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/y18n/package.json b/camera-app/node_modules/y18n/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs-parser/CHANGELOG.md b/camera-app/node_modules/yargs-parser/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs-parser/LICENSE.txt b/camera-app/node_modules/yargs-parser/LICENSE.txt old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs-parser/README.md b/camera-app/node_modules/yargs-parser/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs-parser/index.js b/camera-app/node_modules/yargs-parser/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs-parser/lib/tokenize-arg-string.js b/camera-app/node_modules/yargs-parser/lib/tokenize-arg-string.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs-parser/package.json b/camera-app/node_modules/yargs-parser/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/CHANGELOG.md b/camera-app/node_modules/yargs/CHANGELOG.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/LICENSE b/camera-app/node_modules/yargs/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/README.md b/camera-app/node_modules/yargs/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/completion.sh.hbs b/camera-app/node_modules/yargs/completion.sh.hbs old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/index.js b/camera-app/node_modules/yargs/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/assign.js b/camera-app/node_modules/yargs/lib/assign.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/command.js b/camera-app/node_modules/yargs/lib/command.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/completion.js b/camera-app/node_modules/yargs/lib/completion.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/levenshtein.js b/camera-app/node_modules/yargs/lib/levenshtein.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/obj-filter.js b/camera-app/node_modules/yargs/lib/obj-filter.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/usage.js b/camera-app/node_modules/yargs/lib/usage.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/lib/validation.js b/camera-app/node_modules/yargs/lib/validation.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/be.json b/camera-app/node_modules/yargs/locales/be.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/de.json b/camera-app/node_modules/yargs/locales/de.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/en.json b/camera-app/node_modules/yargs/locales/en.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/es.json b/camera-app/node_modules/yargs/locales/es.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/fr.json b/camera-app/node_modules/yargs/locales/fr.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/hi.json b/camera-app/node_modules/yargs/locales/hi.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/hu.json b/camera-app/node_modules/yargs/locales/hu.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/id.json b/camera-app/node_modules/yargs/locales/id.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/it.json b/camera-app/node_modules/yargs/locales/it.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/ja.json b/camera-app/node_modules/yargs/locales/ja.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/ko.json b/camera-app/node_modules/yargs/locales/ko.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/nb.json b/camera-app/node_modules/yargs/locales/nb.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/nl.json b/camera-app/node_modules/yargs/locales/nl.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/pirate.json b/camera-app/node_modules/yargs/locales/pirate.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/pl.json b/camera-app/node_modules/yargs/locales/pl.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/pt.json b/camera-app/node_modules/yargs/locales/pt.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/pt_BR.json b/camera-app/node_modules/yargs/locales/pt_BR.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/ru.json b/camera-app/node_modules/yargs/locales/ru.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/th.json b/camera-app/node_modules/yargs/locales/th.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/tr.json b/camera-app/node_modules/yargs/locales/tr.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/locales/zh_CN.json b/camera-app/node_modules/yargs/locales/zh_CN.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/package.json b/camera-app/node_modules/yargs/package.json old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yargs/yargs.js b/camera-app/node_modules/yargs/yargs.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yeast/LICENSE b/camera-app/node_modules/yeast/LICENSE old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yeast/README.md b/camera-app/node_modules/yeast/README.md old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yeast/index.js b/camera-app/node_modules/yeast/index.js old mode 100644 new mode 100755 diff --git a/camera-app/node_modules/yeast/package.json b/camera-app/node_modules/yeast/package.json old mode 100644 new mode 100755 diff --git a/camera-app/package-lock.json b/camera-app/package-lock.json old mode 100644 new mode 100755 diff --git a/camera-app/package.json b/camera-app/package.json old mode 100644 new mode 100755 index 3d97656..f16d66b --- a/camera-app/package.json +++ b/camera-app/package.json @@ -3,6 +3,7 @@ "version": "1.0.0", "description": "", "main": "main.js", + "project-type": "native-app", "scripts": { "test": "node main.js", "build": "androidjs build" diff --git a/chat-app/assets/icon/courses-icon-10.png b/chat-app/assets/icon/courses-icon-10.png old mode 100644 new mode 100755 diff --git a/chat-app/assets/icon/ic_launcher.png b/chat-app/assets/icon/ic_launcher.png old mode 100644 new mode 100755 diff --git a/chat-app/assets/icon/icon.png b/chat-app/assets/icon/icon.png old mode 100644 new mode 100755 diff --git a/chat-app/package.json b/chat-app/package.json index 3d62641..450693d 100755 --- a/chat-app/package.json +++ b/chat-app/package.json @@ -4,7 +4,7 @@ "package-name": "chatapp", "app-name": "Chat App", "icon": "./assets/icon/app3.png", - + "project-type": "native-app", "version": "1.0.0", "description": "", "main": "main.js", diff --git a/helloworld/README.md b/helloworld/README.md new file mode 100755 index 0000000..4000300 --- /dev/null +++ b/helloworld/README.md @@ -0,0 +1,6 @@ + +## Build +```bash +$ androidjs b +``` + diff --git a/helloworld/assets/icon/courses-icon-10.png b/helloworld/assets/icon/courses-icon-10.png new file mode 100755 index 0000000..baabb8f Binary files /dev/null and b/helloworld/assets/icon/courses-icon-10.png differ diff --git a/helloworld/assets/icon/ic_launcher.png b/helloworld/assets/icon/ic_launcher.png new file mode 100755 index 0000000..e33de9c Binary files /dev/null and b/helloworld/assets/icon/ic_launcher.png differ diff --git a/helloworld/assets/icon/icon.png b/helloworld/assets/icon/icon.png new file mode 100755 index 0000000..2676dbd Binary files /dev/null and b/helloworld/assets/icon/icon.png differ diff --git a/helloworld/assets/ipc/androidjs.js b/helloworld/assets/ipc/androidjs.js new file mode 100755 index 0000000..86fcdf1 --- /dev/null +++ b/helloworld/assets/ipc/androidjs.js @@ -0,0 +1,289 @@ + +/*! + * Socket.IO v2.2.0 + * (c) 2014-2018 Guillermo Rauch + * Released under the MIT License. + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.io=e():t.io=e()}(this,function(){return function(t){function e(r){if(n[r])return n[r].exports;var o=n[r]={exports:{},id:r,loaded:!1};return t[r].call(o.exports,o,o.exports,e),o.loaded=!0,o.exports}var n={};return e.m=t,e.c=n,e.p="",e(0)}([function(t,e,n){"use strict";function r(t,e){"object"===("undefined"==typeof t?"undefined":o(t))&&(e=t,t=void 0),e=e||{};var n,r=i(t),s=r.source,u=r.id,h=r.path,f=p[u]&&h in p[u].nsps,l=e.forceNew||e["force new connection"]||!1===e.multiplex||f;return l?(c("ignoring socket cache for %s",s),n=a(s,e)):(p[u]||(c("new io instance for %s",s),p[u]=a(s,e)),n=p[u]),r.query&&!e.query&&(e.query=r.query),n.socket(r.path,e)}var o="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t},i=n(1),s=n(7),a=n(12),c=n(3)("socket.io-client");t.exports=e=r;var p=e.managers={};e.protocol=s.protocol,e.connect=r,e.Manager=n(12),e.Socket=n(36)},function(t,e,n){"use strict";function r(t,e){var n=t;e=e||"undefined"!=typeof location&&location,null==t&&(t=e.protocol+"//"+e.host),"string"==typeof t&&("/"===t.charAt(0)&&(t="/"===t.charAt(1)?e.protocol+t:e.host+t),/^(https?|wss?):\/\//.test(t)||(i("protocol-less url %s",t),t="undefined"!=typeof e?e.protocol+"//"+t:"https://"+t),i("parse %s",t),n=o(t)),n.port||(/^(http|ws)$/.test(n.protocol)?n.port="80":/^(http|ws)s$/.test(n.protocol)&&(n.port="443")),n.path=n.path||"/";var r=n.host.indexOf(":")!==-1,s=r?"["+n.host+"]":n.host;return n.id=n.protocol+"://"+s+":"+n.port,n.href=n.protocol+"://"+s+(e&&e.port===n.port?"":":"+n.port),n}var o=n(2),i=n(3)("socket.io-client:url");t.exports=r},function(t,e){var n=/^(?:(?![^:@]+:[^:@\/]*@)(http|https|ws|wss):\/\/)?((?:(([^:@]*)(?::([^:@]*))?)?@)?((?:[a-f0-9]{0,4}:){2,7}[a-f0-9]{0,4}|[^:\/?#]*)(?::(\d*))?)(((\/(?:[^?#](?![^?#\/]*\.[^?#\/.]+(?:[?#]|$)))*\/?)?([^?#\/]*))(?:\?([^#]*))?(?:#(.*))?)/,r=["source","protocol","authority","userInfo","user","password","host","port","relative","path","directory","file","query","anchor"];t.exports=function(t){var e=t,o=t.indexOf("["),i=t.indexOf("]");o!=-1&&i!=-1&&(t=t.substring(0,o)+t.substring(o,i).replace(/:/g,";")+t.substring(i,t.length));for(var s=n.exec(t||""),a={},c=14;c--;)a[r[c]]=s[c]||"";return o!=-1&&i!=-1&&(a.source=e,a.host=a.host.substring(1,a.host.length-1).replace(/;/g,":"),a.authority=a.authority.replace("[","").replace("]","").replace(/;/g,":"),a.ipv6uri=!0),a}},function(t,e,n){(function(r){function o(){return!("undefined"==typeof window||!window.process||"renderer"!==window.process.type)||("undefined"==typeof navigator||!navigator.userAgent||!navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/))&&("undefined"!=typeof document&&document.documentElement&&document.documentElement.style&&document.documentElement.style.WebkitAppearance||"undefined"!=typeof window&&window.console&&(window.console.firebug||window.console.exception&&window.console.table)||"undefined"!=typeof navigator&&navigator.userAgent&&navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)&&parseInt(RegExp.$1,10)>=31||"undefined"!=typeof navigator&&navigator.userAgent&&navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/))}function i(t){var n=this.useColors;if(t[0]=(n?"%c":"")+this.namespace+(n?" %c":" ")+t[0]+(n?"%c ":" ")+"+"+e.humanize(this.diff),n){var r="color: "+this.color;t.splice(1,0,r,"color: inherit");var o=0,i=0;t[0].replace(/%[a-zA-Z%]/g,function(t){"%%"!==t&&(o++,"%c"===t&&(i=o))}),t.splice(i,0,r)}}function s(){return"object"==typeof console&&console.log&&Function.prototype.apply.call(console.log,console,arguments)}function a(t){try{null==t?e.storage.removeItem("debug"):e.storage.debug=t}catch(n){}}function c(){var t;try{t=e.storage.debug}catch(n){}return!t&&"undefined"!=typeof r&&"env"in r&&(t=r.env.DEBUG),t}function p(){try{return window.localStorage}catch(t){}}e=t.exports=n(5),e.log=s,e.formatArgs=i,e.save=a,e.load=c,e.useColors=o,e.storage="undefined"!=typeof chrome&&"undefined"!=typeof chrome.storage?chrome.storage.local:p(),e.colors=["#0000CC","#0000FF","#0033CC","#0033FF","#0066CC","#0066FF","#0099CC","#0099FF","#00CC00","#00CC33","#00CC66","#00CC99","#00CCCC","#00CCFF","#3300CC","#3300FF","#3333CC","#3333FF","#3366CC","#3366FF","#3399CC","#3399FF","#33CC00","#33CC33","#33CC66","#33CC99","#33CCCC","#33CCFF","#6600CC","#6600FF","#6633CC","#6633FF","#66CC00","#66CC33","#9900CC","#9900FF","#9933CC","#9933FF","#99CC00","#99CC33","#CC0000","#CC0033","#CC0066","#CC0099","#CC00CC","#CC00FF","#CC3300","#CC3333","#CC3366","#CC3399","#CC33CC","#CC33FF","#CC6600","#CC6633","#CC9900","#CC9933","#CCCC00","#CCCC33","#FF0000","#FF0033","#FF0066","#FF0099","#FF00CC","#FF00FF","#FF3300","#FF3333","#FF3366","#FF3399","#FF33CC","#FF33FF","#FF6600","#FF6633","#FF9900","#FF9933","#FFCC00","#FFCC33"],e.formatters.j=function(t){try{return JSON.stringify(t)}catch(e){return"[UnexpectedJSONParseError]: "+e.message}},e.enable(c())}).call(e,n(4))},function(t,e){function n(){throw new Error("setTimeout has not been defined")}function r(){throw new Error("clearTimeout has not been defined")}function o(t){if(u===setTimeout)return setTimeout(t,0);if((u===n||!u)&&setTimeout)return u=setTimeout,setTimeout(t,0);try{return u(t,0)}catch(e){try{return u.call(null,t,0)}catch(e){return u.call(this,t,0)}}}function i(t){if(h===clearTimeout)return clearTimeout(t);if((h===r||!h)&&clearTimeout)return h=clearTimeout,clearTimeout(t);try{return h(t)}catch(e){try{return h.call(null,t)}catch(e){return h.call(this,t)}}}function s(){y&&l&&(y=!1,l.length?d=l.concat(d):m=-1,d.length&&a())}function a(){if(!y){var t=o(s);y=!0;for(var e=d.length;e;){for(l=d,d=[];++m1)for(var n=1;n100)){var e=/^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(t);if(e){var n=parseFloat(e[1]),r=(e[2]||"ms").toLowerCase();switch(r){case"years":case"year":case"yrs":case"yr":case"y":return n*u;case"days":case"day":case"d":return n*p;case"hours":case"hour":case"hrs":case"hr":case"h":return n*c;case"minutes":case"minute":case"mins":case"min":case"m":return n*a;case"seconds":case"second":case"secs":case"sec":case"s":return n*s;case"milliseconds":case"millisecond":case"msecs":case"msec":case"ms":return n;default:return}}}}function r(t){return t>=p?Math.round(t/p)+"d":t>=c?Math.round(t/c)+"h":t>=a?Math.round(t/a)+"m":t>=s?Math.round(t/s)+"s":t+"ms"}function o(t){return i(t,p,"day")||i(t,c,"hour")||i(t,a,"minute")||i(t,s,"second")||t+" ms"}function i(t,e,n){if(!(t0)return n(t);if("number"===i&&isNaN(t)===!1)return e["long"]?o(t):r(t);throw new Error("val is not a non-empty string or a valid number. val="+JSON.stringify(t))}},function(t,e,n){function r(){}function o(t){var n=""+t.type;if(e.BINARY_EVENT!==t.type&&e.BINARY_ACK!==t.type||(n+=t.attachments+"-"),t.nsp&&"/"!==t.nsp&&(n+=t.nsp+","),null!=t.id&&(n+=t.id),null!=t.data){var r=i(t.data);if(r===!1)return g;n+=r}return f("encoded %j as %s",t,n),n}function i(t){try{return JSON.stringify(t)}catch(e){return!1}}function s(t,e){function n(t){var n=d.deconstructPacket(t),r=o(n.packet),i=n.buffers;i.unshift(r),e(i)}d.removeBlobs(t,n)}function a(){this.reconstructor=null}function c(t){var n=0,r={type:Number(t.charAt(0))};if(null==e.types[r.type])return h("unknown packet type "+r.type);if(e.BINARY_EVENT===r.type||e.BINARY_ACK===r.type){for(var o="";"-"!==t.charAt(++n)&&(o+=t.charAt(n),n!=t.length););if(o!=Number(o)||"-"!==t.charAt(n))throw new Error("Illegal attachments");r.attachments=Number(o)}if("/"===t.charAt(n+1))for(r.nsp="";++n;){var i=t.charAt(n);if(","===i)break;if(r.nsp+=i,n===t.length)break}else r.nsp="/";var s=t.charAt(n+1);if(""!==s&&Number(s)==s){for(r.id="";++n;){var i=t.charAt(n);if(null==i||Number(i)!=i){--n;break}if(r.id+=t.charAt(n),n===t.length)break}r.id=Number(r.id)}if(t.charAt(++n)){var a=p(t.substr(n)),c=a!==!1&&(r.type===e.ERROR||y(a));if(!c)return h("invalid payload");r.data=a}return f("decoded %s as %j",t,r),r}function p(t){try{return JSON.parse(t)}catch(e){return!1}}function u(t){this.reconPack=t,this.buffers=[]}function h(t){return{type:e.ERROR,data:"parser error: "+t}}var f=n(3)("socket.io-parser"),l=n(8),d=n(9),y=n(10),m=n(11);e.protocol=4,e.types=["CONNECT","DISCONNECT","EVENT","ACK","ERROR","BINARY_EVENT","BINARY_ACK"],e.CONNECT=0,e.DISCONNECT=1,e.EVENT=2,e.ACK=3,e.ERROR=4,e.BINARY_EVENT=5,e.BINARY_ACK=6,e.Encoder=r,e.Decoder=a;var g=e.ERROR+'"encode error"';r.prototype.encode=function(t,n){if(f("encoding packet %j",t),e.BINARY_EVENT===t.type||e.BINARY_ACK===t.type)s(t,n);else{var r=o(t);n([r])}},l(a.prototype),a.prototype.add=function(t){var n;if("string"==typeof t)n=c(t),e.BINARY_EVENT===n.type||e.BINARY_ACK===n.type?(this.reconstructor=new u(n),0===this.reconstructor.reconPack.attachments&&this.emit("decoded",n)):this.emit("decoded",n);else{if(!m(t)&&!t.base64)throw new Error("Unknown type: "+t);if(!this.reconstructor)throw new Error("got binary data when not reconstructing a packet");n=this.reconstructor.takeBinaryData(t),n&&(this.reconstructor=null,this.emit("decoded",n))}},a.prototype.destroy=function(){this.reconstructor&&this.reconstructor.finishedReconstruction()},u.prototype.takeBinaryData=function(t){if(this.buffers.push(t),this.buffers.length===this.reconPack.attachments){var e=d.reconstructPacket(this.reconPack,this.buffers);return this.finishedReconstruction(),e}return null},u.prototype.finishedReconstruction=function(){this.reconPack=null,this.buffers=[]}},function(t,e,n){function r(t){if(t)return o(t)}function o(t){for(var e in r.prototype)t[e]=r.prototype[e];return t}t.exports=r,r.prototype.on=r.prototype.addEventListener=function(t,e){return this._callbacks=this._callbacks||{},(this._callbacks["$"+t]=this._callbacks["$"+t]||[]).push(e),this},r.prototype.once=function(t,e){function n(){this.off(t,n),e.apply(this,arguments)}return n.fn=e,this.on(t,n),this},r.prototype.off=r.prototype.removeListener=r.prototype.removeAllListeners=r.prototype.removeEventListener=function(t,e){if(this._callbacks=this._callbacks||{},0==arguments.length)return this._callbacks={},this;var n=this._callbacks["$"+t];if(!n)return this;if(1==arguments.length)return delete this._callbacks["$"+t],this;for(var r,o=0;o0&&!this.encoding){var t=this.packetBuffer.shift();this.packet(t)}},r.prototype.cleanup=function(){h("cleanup");for(var t=this.subs.length,e=0;e=this._reconnectionAttempts)h("reconnect failed"),this.backoff.reset(),this.emitAll("reconnect_failed"),this.reconnecting=!1;else{var e=this.backoff.duration();h("will wait %dms before reconnect attempt",e),this.reconnecting=!0;var n=setTimeout(function(){t.skipReconnect||(h("attempting reconnect"),t.emitAll("reconnect_attempt",t.backoff.attempts),t.emitAll("reconnecting",t.backoff.attempts),t.skipReconnect||t.open(function(e){e?(h("reconnect attempt error"),t.reconnecting=!1,t.reconnect(),t.emitAll("reconnect_error",e.data)):(h("reconnect success"),t.onreconnect())}))},e);this.subs.push({destroy:function(){clearTimeout(n)}})}},r.prototype.onreconnect=function(){var t=this.backoff.attempts;this.reconnecting=!1,this.backoff.reset(),this.updateSocketIds(),this.emitAll("reconnect",t)}},function(t,e,n){t.exports=n(14),t.exports.parser=n(21)},function(t,e,n){function r(t,e){return this instanceof r?(e=e||{},t&&"object"==typeof t&&(e=t,t=null),t?(t=u(t),e.hostname=t.host,e.secure="https"===t.protocol||"wss"===t.protocol,e.port=t.port,t.query&&(e.query=t.query)):e.host&&(e.hostname=u(e.host).host),this.secure=null!=e.secure?e.secure:"undefined"!=typeof location&&"https:"===location.protocol,e.hostname&&!e.port&&(e.port=this.secure?"443":"80"),this.agent=e.agent||!1,this.hostname=e.hostname||("undefined"!=typeof location?location.hostname:"localhost"),this.port=e.port||("undefined"!=typeof location&&location.port?location.port:this.secure?443:80),this.query=e.query||{},"string"==typeof this.query&&(this.query=h.decode(this.query)),this.upgrade=!1!==e.upgrade,this.path=(e.path||"/engine.io").replace(/\/$/,"")+"/",this.forceJSONP=!!e.forceJSONP,this.jsonp=!1!==e.jsonp,this.forceBase64=!!e.forceBase64,this.enablesXDR=!!e.enablesXDR,this.timestampParam=e.timestampParam||"t",this.timestampRequests=e.timestampRequests,this.transports=e.transports||["polling","websocket"],this.transportOptions=e.transportOptions||{},this.readyState="",this.writeBuffer=[],this.prevBufferLen=0,this.policyPort=e.policyPort||843,this.rememberUpgrade=e.rememberUpgrade||!1,this.binaryType=null,this.onlyBinaryUpgrades=e.onlyBinaryUpgrades,this.perMessageDeflate=!1!==e.perMessageDeflate&&(e.perMessageDeflate||{}),!0===this.perMessageDeflate&&(this.perMessageDeflate={}),this.perMessageDeflate&&null==this.perMessageDeflate.threshold&&(this.perMessageDeflate.threshold=1024),this.pfx=e.pfx||null,this.key=e.key||null,this.passphrase=e.passphrase||null,this.cert=e.cert||null,this.ca=e.ca||null,this.ciphers=e.ciphers||null,this.rejectUnauthorized=void 0===e.rejectUnauthorized||e.rejectUnauthorized,this.forceNode=!!e.forceNode,this.isReactNative="undefined"!=typeof navigator&&"string"==typeof navigator.product&&"reactnative"===navigator.product.toLowerCase(),("undefined"==typeof self||this.isReactNative)&&(e.extraHeaders&&Object.keys(e.extraHeaders).length>0&&(this.extraHeaders=e.extraHeaders),e.localAddress&&(this.localAddress=e.localAddress)),this.id=null,this.upgrades=null,this.pingInterval=null,this.pingTimeout=null,this.pingIntervalTimer=null,this.pingTimeoutTimer=null,void this.open()):new r(t,e)}function o(t){var e={};for(var n in t)t.hasOwnProperty(n)&&(e[n]=t[n]);return e}var i=n(15),s=n(8),a=n(3)("engine.io-client:socket"),c=n(35),p=n(21),u=n(2),h=n(29);t.exports=r,r.priorWebsocketSuccess=!1,s(r.prototype),r.protocol=p.protocol,r.Socket=r,r.Transport=n(20),r.transports=n(15),r.parser=n(21),r.prototype.createTransport=function(t){a('creating transport "%s"',t);var e=o(this.query);e.EIO=p.protocol,e.transport=t;var n=this.transportOptions[t]||{};this.id&&(e.sid=this.id);var r=new i[t]({query:e,socket:this,agent:n.agent||this.agent,hostname:n.hostname||this.hostname,port:n.port||this.port,secure:n.secure||this.secure,path:n.path||this.path,forceJSONP:n.forceJSONP||this.forceJSONP,jsonp:n.jsonp||this.jsonp,forceBase64:n.forceBase64||this.forceBase64,enablesXDR:n.enablesXDR||this.enablesXDR,timestampRequests:n.timestampRequests||this.timestampRequests,timestampParam:n.timestampParam||this.timestampParam,policyPort:n.policyPort||this.policyPort,pfx:n.pfx||this.pfx,key:n.key||this.key,passphrase:n.passphrase||this.passphrase,cert:n.cert||this.cert,ca:n.ca||this.ca,ciphers:n.ciphers||this.ciphers,rejectUnauthorized:n.rejectUnauthorized||this.rejectUnauthorized,perMessageDeflate:n.perMessageDeflate||this.perMessageDeflate,extraHeaders:n.extraHeaders||this.extraHeaders,forceNode:n.forceNode||this.forceNode,localAddress:n.localAddress||this.localAddress,requestTimeout:n.requestTimeout||this.requestTimeout,protocols:n.protocols||void 0,isReactNative:this.isReactNative});return r},r.prototype.open=function(){var t;if(this.rememberUpgrade&&r.priorWebsocketSuccess&&this.transports.indexOf("websocket")!==-1)t="websocket";else{if(0===this.transports.length){var e=this;return void setTimeout(function(){e.emit("error","No transports available")},0)}t=this.transports[0]}this.readyState="opening";try{t=this.createTransport(t)}catch(n){return this.transports.shift(),void this.open()}t.open(),this.setTransport(t)},r.prototype.setTransport=function(t){a("setting transport %s",t.name);var e=this;this.transport&&(a("clearing existing transport %s",this.transport.name),this.transport.removeAllListeners()),this.transport=t,t.on("drain",function(){e.onDrain()}).on("packet",function(t){e.onPacket(t)}).on("error",function(t){e.onError(t)}).on("close",function(){e.onClose("transport close")})},r.prototype.probe=function(t){function e(){if(f.onlyBinaryUpgrades){var e=!this.supportsBinary&&f.transport.supportsBinary;h=h||e}h||(a('probe transport "%s" opened',t),u.send([{type:"ping",data:"probe"}]),u.once("packet",function(e){if(!h)if("pong"===e.type&&"probe"===e.data){if(a('probe transport "%s" pong',t),f.upgrading=!0,f.emit("upgrading",u),!u)return;r.priorWebsocketSuccess="websocket"===u.name,a('pausing current transport "%s"',f.transport.name),f.transport.pause(function(){h||"closed"!==f.readyState&&(a("changing transport and sending upgrade packet"),p(),f.setTransport(u),u.send([{type:"upgrade"}]),f.emit("upgrade",u),u=null,f.upgrading=!1,f.flush())})}else{a('probe transport "%s" failed',t);var n=new Error("probe error");n.transport=u.name,f.emit("upgradeError",n)}}))}function n(){h||(h=!0,p(),u.close(),u=null)}function o(e){var r=new Error("probe error: "+e);r.transport=u.name,n(),a('probe transport "%s" failed because of error: %s',t,e),f.emit("upgradeError",r)}function i(){o("transport closed")}function s(){o("socket closed")}function c(t){u&&t.name!==u.name&&(a('"%s" works - aborting "%s"',t.name,u.name),n())}function p(){u.removeListener("open",e),u.removeListener("error",o),u.removeListener("close",i),f.removeListener("close",s),f.removeListener("upgrading",c)}a('probing transport "%s"',t);var u=this.createTransport(t,{probe:1}),h=!1,f=this;r.priorWebsocketSuccess=!1,u.once("open",e),u.once("error",o),u.once("close",i),this.once("close",s),this.once("upgrading",c),u.open()},r.prototype.onOpen=function(){if(a("socket open"),this.readyState="open",r.priorWebsocketSuccess="websocket"===this.transport.name,this.emit("open"),this.flush(),"open"===this.readyState&&this.upgrade&&this.transport.pause){a("starting upgrade probes");for(var t=0,e=this.upgrades.length;t1?{type:b[o],data:t.substring(1)}:{type:b[o]}:w}var i=new Uint8Array(t),o=i[0],s=f(t,1);return k&&"blob"===n&&(s=new k([s])),{type:b[o],data:s}},e.decodeBase64Packet=function(t,e){var n=b[t.charAt(0)];if(!p)return{type:n,data:{base64:!0,data:t.substr(1)}};var r=p.decode(t.substr(1));return"blob"===e&&k&&(r=new k([r])),{type:n,data:r}},e.encodePayload=function(t,n,r){function o(t){return t.length+":"+t}function i(t,r){e.encodePacket(t,!!s&&n,!1,function(t){r(null,o(t))})}"function"==typeof n&&(r=n,n=null);var s=h(t);return n&&s?k&&!g?e.encodePayloadAsBlob(t,r):e.encodePayloadAsArrayBuffer(t,r):t.length?void c(t,i,function(t,e){return r(e.join(""))}):r("0:")},e.decodePayload=function(t,n,r){if("string"!=typeof t)return e.decodePayloadAsBinary(t,n,r);"function"==typeof n&&(r=n,n=null);var o;if(""===t)return r(w,0,1);for(var i,s,a="",c=0,p=t.length;c0;){for(var s=new Uint8Array(o),a=0===s[0],c="",p=1;255!==s[p];p++){if(c.length>310)return r(w,0,1);c+=s[p]}o=f(o,2+c.length),c=parseInt(c);var u=f(o,0,c);if(a)try{u=String.fromCharCode.apply(null,new Uint8Array(u))}catch(h){var l=new Uint8Array(u);u="";for(var p=0;pr&&(n=r),e>=r||e>=n||0===r)return new ArrayBuffer(0);for(var o=new Uint8Array(t),i=new Uint8Array(n-e),s=e,a=0;s=55296&&e<=56319&&o65535&&(e-=65536,o+=d(e>>>10&1023|55296),e=56320|1023&e),o+=d(e);return o}function o(t,e){if(t>=55296&&t<=57343){if(e)throw Error("Lone surrogate U+"+t.toString(16).toUpperCase()+" is not a scalar value");return!1}return!0}function i(t,e){return d(t>>e&63|128)}function s(t,e){if(0==(4294967168&t))return d(t);var n="";return 0==(4294965248&t)?n=d(t>>6&31|192):0==(4294901760&t)?(o(t,e)||(t=65533),n=d(t>>12&15|224),n+=i(t,6)):0==(4292870144&t)&&(n=d(t>>18&7|240),n+=i(t,12),n+=i(t,6)),n+=d(63&t|128)}function a(t,e){e=e||{};for(var r,o=!1!==e.strict,i=n(t),a=i.length,c=-1,p="";++c=f)throw Error("Invalid byte index");var t=255&h[l];if(l++,128==(192&t))return 63&t;throw Error("Invalid continuation byte")}function p(t){var e,n,r,i,s;if(l>f)throw Error("Invalid byte index");if(l==f)return!1;if(e=255&h[l],l++,0==(128&e))return e;if(192==(224&e)){if(n=c(),s=(31&e)<<6|n,s>=128)return s;throw Error("Invalid continuation byte")}if(224==(240&e)){if(n=c(),r=c(),s=(15&e)<<12|n<<6|r,s>=2048)return o(s,t)?s:65533;throw Error("Invalid continuation byte")}if(240==(248&e)&&(n=c(),r=c(),i=c(),s=(7&e)<<18|n<<12|r<<6|i,s>=65536&&s<=1114111))return s;throw Error("Invalid UTF-8 detected")}function u(t,e){e=e||{};var o=!1!==e.strict;h=n(t),f=h.length,l=0;for(var i,s=[];(i=p(o))!==!1;)s.push(i);return r(s)}/*! https://mths.be/utf8js v2.1.2 by @mathias */ +var h,f,l,d=String.fromCharCode;t.exports={version:"2.1.2",encode:a,decode:u}},function(t,e){!function(){"use strict";for(var t="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/",n=new Uint8Array(256),r=0;r>2],i+=t[(3&r[n])<<4|r[n+1]>>4],i+=t[(15&r[n+1])<<2|r[n+2]>>6],i+=t[63&r[n+2]];return o%3===2?i=i.substring(0,i.length-1)+"=":o%3===1&&(i=i.substring(0,i.length-2)+"=="),i},e.decode=function(t){var e,r,o,i,s,a=.75*t.length,c=t.length,p=0;"="===t[t.length-1]&&(a--,"="===t[t.length-2]&&a--);var u=new ArrayBuffer(a),h=new Uint8Array(u);for(e=0;e>4,h[p++]=(15&o)<<4|i>>2,h[p++]=(3&i)<<6|63&s;return u}}()},function(t,e){function n(t){return t.map(function(t){if(t.buffer instanceof ArrayBuffer){var e=t.buffer;if(t.byteLength!==e.byteLength){var n=new Uint8Array(t.byteLength);n.set(new Uint8Array(e,t.byteOffset,t.byteLength)),e=n.buffer}return e}return t})}function r(t,e){e=e||{};var r=new i;return n(t).forEach(function(t){r.append(t)}),e.type?r.getBlob(e.type):r.getBlob()}function o(t,e){return new Blob(n(t),e||{})}var i="undefined"!=typeof i?i:"undefined"!=typeof WebKitBlobBuilder?WebKitBlobBuilder:"undefined"!=typeof MSBlobBuilder?MSBlobBuilder:"undefined"!=typeof MozBlobBuilder&&MozBlobBuilder,s=function(){try{var t=new Blob(["hi"]);return 2===t.size}catch(e){return!1}}(),a=s&&function(){try{var t=new Blob([new Uint8Array([1,2])]);return 2===t.size}catch(e){return!1}}(),c=i&&i.prototype.append&&i.prototype.getBlob;"undefined"!=typeof Blob&&(r.prototype=Blob.prototype,o.prototype=Blob.prototype),t.exports=function(){return s?a?Blob:o:c?r:void 0}()},function(t,e){e.encode=function(t){var e="";for(var n in t)t.hasOwnProperty(n)&&(e.length&&(e+="&"),e+=encodeURIComponent(n)+"="+encodeURIComponent(t[n]));return e},e.decode=function(t){for(var e={},n=t.split("&"),r=0,o=n.length;r0);return e}function r(t){var e=0;for(u=0;u';i=document.createElement(e)}catch(t){i=document.createElement("iframe"),i.name=o.iframeId,i.src="javascript:0"}i.id=o.iframeId,o.form.appendChild(i),o.iframe=i}var o=this;if(!this.form){var i,s=document.createElement("form"),a=document.createElement("textarea"),c=this.iframeId="eio_iframe_"+this.index;s.className="socketio",s.style.position="absolute",s.style.top="-1000px",s.style.left="-1000px",s.target=c,s.method="POST",s.setAttribute("accept-charset","utf-8"),a.name="d",s.appendChild(a),document.body.appendChild(s),this.form=s,this.area=a}this.form.action=this.uri(),r(),t=t.replace(u,"\\\n"),this.area.value=t.replace(p,"\\n");try{this.form.submit()}catch(h){}this.iframe.attachEvent?this.iframe.onreadystatechange=function(){"complete"===o.iframe.readyState&&n()}:this.iframe.onload=n}}).call(e,function(){return this}())},function(t,e,n){function r(t){var e=t&&t.forceBase64;e&&(this.supportsBinary=!1),this.perMessageDeflate=t.perMessageDeflate,this.usingBrowserWebSocket=o&&!t.forceNode,this.protocols=t.protocols,this.usingBrowserWebSocket||(l=i),s.call(this,t)}var o,i,s=n(20),a=n(21),c=n(29),p=n(30),u=n(31),h=n(3)("engine.io-client:websocket");if("undefined"==typeof self)try{i=n(34)}catch(f){}else o=self.WebSocket||self.MozWebSocket;var l=o||i;t.exports=r,p(r,s),r.prototype.name="websocket",r.prototype.supportsBinary=!0,r.prototype.doOpen=function(){if(this.check()){var t=this.uri(),e=this.protocols,n={agent:this.agent,perMessageDeflate:this.perMessageDeflate};n.pfx=this.pfx,n.key=this.key,n.passphrase=this.passphrase,n.cert=this.cert,n.ca=this.ca,n.ciphers=this.ciphers,n.rejectUnauthorized=this.rejectUnauthorized,this.extraHeaders&&(n.headers=this.extraHeaders),this.localAddress&&(n.localAddress=this.localAddress);try{this.ws=this.usingBrowserWebSocket&&!this.isReactNative?e?new l(t,e):new l(t):new l(t,e,n)}catch(r){return this.emit("error",r)}void 0===this.ws.binaryType&&(this.supportsBinary=!1),this.ws.supports&&this.ws.supports.binary?(this.supportsBinary=!0,this.ws.binaryType="nodebuffer"):this.ws.binaryType="arraybuffer",this.addEventListeners()}},r.prototype.addEventListeners=function(){var t=this;this.ws.onopen=function(){t.onOpen()},this.ws.onclose=function(){t.onClose()},this.ws.onmessage=function(e){t.onData(e.data)},this.ws.onerror=function(e){t.onError("websocket error",e)}},r.prototype.write=function(t){function e(){n.emit("flush"),setTimeout(function(){n.writable=!0,n.emit("drain")},0)}var n=this;this.writable=!1;for(var r=t.length,o=0,i=r;o0&&t.jitter<=1?t.jitter:0,this.attempts=0}t.exports=n,n.prototype.duration=function(){var t=this.ms*Math.pow(this.factor,this.attempts++);if(this.jitter){var e=Math.random(),n=Math.floor(e*this.jitter*t);t=0==(1&Math.floor(10*e))?t-n:t+n}return 0|Math.min(t,this.max)},n.prototype.reset=function(){this.attempts=0},n.prototype.setMin=function(t){this.ms=t},n.prototype.setMax=function(t){this.max=t},n.prototype.setJitter=function(t){this.jitter=t}}])}); +//# sourceMappingURL=socket.io.js.map + + +// document.write(''); + + +var socket = io('http://localhost:3000'); +listeners = {} +var front = { + send:send, + on:on, + sendSync:sendSync +} + +function addListener(event, fn) { + listeners[event] = listeners[event] || []; + listeners[event].push(fn); +} + +function on(event, fn){ + addListener(event, fn); +} + +function exeFunction(event, ...args){ + let fns = listeners[event]; + if (!fns) return false; + fns.forEach(function (f) { + f(...args); + }); + return true; +} + + +function send(event, ...args){ + // console.log('called send'); + socket.emit('response-from-front', event, ...args) +} + +socket.on('response-from-back', function(event, ...args){ + // console.log('reposen sync') + exeFunction(event, ...args); +}) + +socket.on('sync-response', function(eventName, res){ + // console.log('sync-reponse') + // console.log(eventName); + exeFunction(eventName + "-result", res); +}) + +function sendSync(event, ...args){ + socket.emit('sync-response-from-front', event, ...args); +} + +var app = {} + +/** + * Camera API + */ + +var camera = { + init : initCamera, + startRecording: startVideoRecording, + stopRecording: stopVideoRecording, + saveRecording: saveVideoRecording, + previewRecording: previewVideoRecordingIntoDom, + getDevices : getVideoDevices, + getBuffer: getCameraRecordedBuffer, + takePhoto: takePhoto, + savePhoto: saveCameraPhoto, + recordedBlobs : [], + mediaRecorder: null, + canvas : document.createElement('canvas') +} + +function initCamera(dom, constraints){ + if(window.videoStream != undefined){ + stopMediaTracks(window.videoStream); + } + navigator.getUserMedia(constraints, function(stream){ + window.videoStream = stream; + dom.srcObject = stream; + }, function(error){ + console.log(error); + throw error; + }) +} + +function handleCameraDataAvailable(event) { + if (event.data && event.data.size > 0) { + camera.recordedBlobs.push(event.data); + } +} + +function startVideoRecording(options){ + camera.recordedBlobs = []; + try { + camera.mediaRecorder = new MediaRecorder(window.videoStream, options); + } catch (e0) { + console.log('Unable to create MediaRecorder with options Object: ', options, e0); + try { + options = {mimeType: 'video/webm;codecs=vp8', bitsPerSecond: 100000}; + camera.mediaRecorder = new MediaRecorder(window.videoStream, options); + } catch (e1) { + console.log('Unable to create MediaRecorder with options Object: ', options, e1); + try { + options = 'video/mp4'; + camera.mediaRecorder = new MediaRecorder(window.videoStream, options); + } catch (e2) { + alert('MediaRecorder is not supported by this browser.'); + console.error('Exception while creating MediaRecorder:', e2); + return; + } + } + } + // mediaRecorder.onstop = handleStop; + camera.mediaRecorder.ondataavailable = handleCameraDataAvailable; + camera.mediaRecorder.start(); // collect 10ms of data +} + +function stopVideoRecording(){ + camera.mediaRecorder.stop(); +} + +function saveVideoRecording(filepath, filename, options){ + let blob = new Blob(camera.recordedBlobs, options); + saveCameraBlob(filepath, filename, blob); +} + +function previewVideoRecordingIntoDom(dom, options){ + dom.controls = true; + let superBuffer = new Blob(camera.recordedBlobs, options); + dom.src = window.URL.createObjectURL(superBuffer); +} + +function saveCameraBlob(filepath, filename, blob){ + let reader = new FileReader() + reader.onload = function() { + if (reader.readyState == 2) { + send('androidjs:saveBlob', filepath, filename, reader.result, 'video'); + console.log(`Saving ${JSON.stringify({ filename, size: blob.size })}`) + } + } + reader.readAsArrayBuffer(blob) +} + +function getVideoDevices(callback){ + let devices = [] + navigator.mediaDevices.enumerateDevices() + .then(function(mediaDevices){ + for(let i = 0; i < mediaDevices.length; i++){ + if(mediaDevices[i].kind === 'videoinput'){ + devices.push(mediaDevices[i].deviceId); + } + } + callback(devices); + }); +} + +function stopMediaTracks(stream) { + stream.getTracks().forEach(track => { + track.stop(); + }); +} + +function getCameraRecordedBuffer(options, callback){ + let blob = new Blob(camera.recordedBlobs, options); + let reader = new FileReader() + reader.onload = function() { + if (reader.readyState == 2) { + callback(reader.result); + } + } + reader.readAsArrayBuffer(blob) +} + +function takePhoto(cameraDom, previewDom){ + camera.canvas.width = cameraDom.videoWidth; + camera.canvas.height = cameraDom.videoHeight; + camera.canvas.getContext('2d').drawImage(cameraDom, 0, 0); + if(previewDom != undefined){ + previewDom.src = camera.canvas.toDataURL('image/webp'); + } +} + +function saveCameraPhoto(filepath, filename){ + let data = camera.canvas.toDataURL('image/webp').replace(/^data:image\/\w+;base64,/, ""); + send('androidjs:saveBlob', filepath, filename, data, 'image'); + console.log('saving file...'); +} + +app.camera = camera; + + +/** + * Microphone API + */ + + microphone = { + startRecording: startAudioRecording, + getDevices: getAudioDevices, + stopRecording: stopAudioRecording, + previewRecording: previewAudioRecording, + saveRecording: saveAudioRecording, + getBuffer: getAudioRecordedBuffer, + recordedBlobs: [], + mediaRecorder: null + } + + function handleAudioDataAvailable(event){ + if (event.data && event.data.size > 0) { + microphone.recordedBlobs.push(event.data); + } + } + + function startAudioRecording(options){ + if(window.audioStream != undefined){ + stopMediaTracks(window.audioStream); + } + navigator.getUserMedia(options, function(stream){ + window.audioStream = stream; + microphone.mediaRecorder = new MediaRecorder(window.audioStream); + microphone.mediaRecorder.ondataavailable = handleAudioDataAvailable; + microphone.mediaRecorder.start(); + }, function(error){ + console.log(error); + throw error; + }); + } + + function stopAudioRecording(){ + microphone.mediaRecorder.stop(); + } + + function previewAudioRecording(dom, options){ + dom.controls = true; + let blob = new Blob(microphone.recordedBlobs, options); + dom.src = URL.createObjectURL(blob); + } + + function saveAudioRecording(filepath, filename, options){ + let blob = new Blob(microphone.recordedBlobs, options); + saveAudioBlob(filepath, filename, blob); + } + + function saveAudioBlob(filepath, filename, blob){ + let reader = new FileReader() + reader.onload = function() { + if (reader.readyState == 2) { + send('androidjs:saveBlob', filepath, filename, reader.result, 'audio'); + console.log(`Saving ${JSON.stringify({ filename, size: blob.size })}`) + } + } + reader.readAsArrayBuffer(blob); + } + + function getAudioRecordedBuffer(options, callback){ + let blob = new Blob(microphone.recordedBlobs, options); + let reader = new FileReader(); + reader.onload = function(){ + if(reader.readyState == 2){ + callback(reader.result); + } + } + reader.readAsArrayBuffer(blob); + } + + function getAudioDevices(callback){ + let devices = []; + navigator.mediaDevices.enumerateDevices() + .then(function(mediaDevices){ + for(let i = 0; i < mediaDevices.length; i++){ + if(mediaDevices[i].kind == 'audioinput'){ + devices.push(mediaDevices[i].deviceId); + } + } + callback(devices); + }); + } + + app.microphone = microphone; \ No newline at end of file diff --git a/helloworld/main.js b/helloworld/main.js new file mode 100755 index 0000000..e69de29 diff --git a/helloworld/node_modules/@sindresorhus/is/dist/index.d.ts b/helloworld/node_modules/@sindresorhus/is/dist/index.d.ts new file mode 100755 index 0000000..e94d30b --- /dev/null +++ b/helloworld/node_modules/@sindresorhus/is/dist/index.d.ts @@ -0,0 +1,132 @@ +/// +/// +/// +/// +/// +declare type TypedArray = Int8Array | Uint8Array | Uint8ClampedArray | Int16Array | Uint16Array | Int32Array | Uint32Array | Float32Array | Float64Array; +declare type Primitive = null | undefined | string | number | boolean | Symbol; +export interface ArrayLike { + length: number; +} +export interface Class { + new (...args: any[]): T; +} +declare type DomElement = object & { + nodeType: 1; + nodeName: string; +}; +declare type NodeStream = object & { + pipe: Function; +}; +export declare const enum TypeName { + null = "null", + boolean = "boolean", + undefined = "undefined", + string = "string", + number = "number", + symbol = "symbol", + Function = "Function", + GeneratorFunction = "GeneratorFunction", + AsyncFunction = "AsyncFunction", + Observable = "Observable", + Array = "Array", + Buffer = "Buffer", + Object = "Object", + RegExp = "RegExp", + Date = "Date", + Error = "Error", + Map = "Map", + Set = "Set", + WeakMap = "WeakMap", + WeakSet = "WeakSet", + Int8Array = "Int8Array", + Uint8Array = "Uint8Array", + Uint8ClampedArray = "Uint8ClampedArray", + Int16Array = "Int16Array", + Uint16Array = "Uint16Array", + Int32Array = "Int32Array", + Uint32Array = "Uint32Array", + Float32Array = "Float32Array", + Float64Array = "Float64Array", + ArrayBuffer = "ArrayBuffer", + SharedArrayBuffer = "SharedArrayBuffer", + DataView = "DataView", + Promise = "Promise", + URL = "URL" +} +declare function is(value: unknown): TypeName; +declare namespace is { + const undefined: (value: unknown) => value is undefined; + const string: (value: unknown) => value is string; + const number: (value: unknown) => value is number; + const function_: (value: unknown) => value is Function; + const null_: (value: unknown) => value is null; + const class_: (value: unknown) => value is Class; + const boolean: (value: unknown) => value is boolean; + const symbol: (value: unknown) => value is Symbol; + const numericString: (value: unknown) => boolean; + const array: (arg: any) => arg is any[]; + const buffer: (input: unknown) => input is Buffer; + const nullOrUndefined: (value: unknown) => value is null | undefined; + const object: (value: unknown) => value is object; + const iterable: (value: unknown) => value is IterableIterator; + const asyncIterable: (value: unknown) => value is AsyncIterableIterator; + const generator: (value: unknown) => value is Generator; + const nativePromise: (value: unknown) => value is Promise; + const promise: (value: unknown) => value is Promise; + const generatorFunction: (value: unknown) => value is GeneratorFunction; + const asyncFunction: (value: unknown) => value is Function; + const boundFunction: (value: unknown) => value is Function; + const regExp: (value: unknown) => value is RegExp; + const date: (value: unknown) => value is Date; + const error: (value: unknown) => value is Error; + const map: (value: unknown) => value is Map; + const set: (value: unknown) => value is Set; + const weakMap: (value: unknown) => value is WeakMap; + const weakSet: (value: unknown) => value is WeakSet; + const int8Array: (value: unknown) => value is Int8Array; + const uint8Array: (value: unknown) => value is Uint8Array; + const uint8ClampedArray: (value: unknown) => value is Uint8ClampedArray; + const int16Array: (value: unknown) => value is Int16Array; + const uint16Array: (value: unknown) => value is Uint16Array; + const int32Array: (value: unknown) => value is Int32Array; + const uint32Array: (value: unknown) => value is Uint32Array; + const float32Array: (value: unknown) => value is Float32Array; + const float64Array: (value: unknown) => value is Float64Array; + const arrayBuffer: (value: unknown) => value is ArrayBuffer; + const sharedArrayBuffer: (value: unknown) => value is SharedArrayBuffer; + const dataView: (value: unknown) => value is DataView; + const directInstanceOf: (instance: unknown, klass: Class) => instance is T; + const urlInstance: (value: unknown) => value is URL; + const urlString: (value: unknown) => boolean; + const truthy: (value: unknown) => boolean; + const falsy: (value: unknown) => boolean; + const nan: (value: unknown) => boolean; + const primitive: (value: unknown) => value is Primitive; + const integer: (value: unknown) => value is number; + const safeInteger: (value: unknown) => value is number; + const plainObject: (value: unknown) => boolean; + const typedArray: (value: unknown) => value is TypedArray; + const arrayLike: (value: unknown) => value is ArrayLike; + const inRange: (value: number, range: number | number[]) => boolean; + const domElement: (value: unknown) => value is DomElement; + const observable: (value: unknown) => boolean; + const nodeStream: (value: unknown) => value is NodeStream; + const infinite: (value: unknown) => boolean; + const even: (value: number) => boolean; + const odd: (value: number) => boolean; + const emptyArray: (value: unknown) => boolean; + const nonEmptyArray: (value: unknown) => boolean; + const emptyString: (value: unknown) => boolean; + const nonEmptyString: (value: unknown) => boolean; + const emptyStringOrWhitespace: (value: unknown) => boolean; + const emptyObject: (value: unknown) => boolean; + const nonEmptyObject: (value: unknown) => boolean; + const emptySet: (value: unknown) => boolean; + const nonEmptySet: (value: unknown) => boolean; + const emptyMap: (value: unknown) => boolean; + const nonEmptyMap: (value: unknown) => boolean; + const any: (predicate: unknown, ...values: unknown[]) => boolean; + const all: (predicate: unknown, ...values: unknown[]) => boolean; +} +export default is; diff --git a/helloworld/node_modules/@sindresorhus/is/dist/index.js b/helloworld/node_modules/@sindresorhus/is/dist/index.js new file mode 100755 index 0000000..3cbafae --- /dev/null +++ b/helloworld/node_modules/@sindresorhus/is/dist/index.js @@ -0,0 +1,245 @@ +"use strict"; +/// +/// +/// +/// +Object.defineProperty(exports, "__esModule", { value: true }); +// TODO: Use the `URL` global when targeting Node.js 10 +// tslint:disable-next-line +const URLGlobal = typeof URL === 'undefined' ? require('url').URL : URL; +const toString = Object.prototype.toString; +const isOfType = (type) => (value) => typeof value === type; +const isBuffer = (input) => !is.nullOrUndefined(input) && !is.nullOrUndefined(input.constructor) && is.function_(input.constructor.isBuffer) && input.constructor.isBuffer(input); +const getObjectType = (value) => { + const objectName = toString.call(value).slice(8, -1); + if (objectName) { + return objectName; + } + return null; +}; +const isObjectOfType = (type) => (value) => getObjectType(value) === type; +function is(value) { + switch (value) { + case null: + return "null" /* null */; + case true: + case false: + return "boolean" /* boolean */; + default: + } + switch (typeof value) { + case 'undefined': + return "undefined" /* undefined */; + case 'string': + return "string" /* string */; + case 'number': + return "number" /* number */; + case 'symbol': + return "symbol" /* symbol */; + default: + } + if (is.function_(value)) { + return "Function" /* Function */; + } + if (is.observable(value)) { + return "Observable" /* Observable */; + } + if (Array.isArray(value)) { + return "Array" /* Array */; + } + if (isBuffer(value)) { + return "Buffer" /* Buffer */; + } + const tagType = getObjectType(value); + if (tagType) { + return tagType; + } + if (value instanceof String || value instanceof Boolean || value instanceof Number) { + throw new TypeError('Please don\'t use object wrappers for primitive types'); + } + return "Object" /* Object */; +} +(function (is) { + // tslint:disable-next-line:strict-type-predicates + const isObject = (value) => typeof value === 'object'; + // tslint:disable:variable-name + is.undefined = isOfType('undefined'); + is.string = isOfType('string'); + is.number = isOfType('number'); + is.function_ = isOfType('function'); + // tslint:disable-next-line:strict-type-predicates + is.null_ = (value) => value === null; + is.class_ = (value) => is.function_(value) && value.toString().startsWith('class '); + is.boolean = (value) => value === true || value === false; + is.symbol = isOfType('symbol'); + // tslint:enable:variable-name + is.numericString = (value) => is.string(value) && value.length > 0 && !Number.isNaN(Number(value)); + is.array = Array.isArray; + is.buffer = isBuffer; + is.nullOrUndefined = (value) => is.null_(value) || is.undefined(value); + is.object = (value) => !is.nullOrUndefined(value) && (is.function_(value) || isObject(value)); + is.iterable = (value) => !is.nullOrUndefined(value) && is.function_(value[Symbol.iterator]); + is.asyncIterable = (value) => !is.nullOrUndefined(value) && is.function_(value[Symbol.asyncIterator]); + is.generator = (value) => is.iterable(value) && is.function_(value.next) && is.function_(value.throw); + is.nativePromise = (value) => isObjectOfType("Promise" /* Promise */)(value); + const hasPromiseAPI = (value) => !is.null_(value) && + isObject(value) && + is.function_(value.then) && + is.function_(value.catch); + is.promise = (value) => is.nativePromise(value) || hasPromiseAPI(value); + is.generatorFunction = isObjectOfType("GeneratorFunction" /* GeneratorFunction */); + is.asyncFunction = isObjectOfType("AsyncFunction" /* AsyncFunction */); + is.boundFunction = (value) => is.function_(value) && !value.hasOwnProperty('prototype'); + is.regExp = isObjectOfType("RegExp" /* RegExp */); + is.date = isObjectOfType("Date" /* Date */); + is.error = isObjectOfType("Error" /* Error */); + is.map = (value) => isObjectOfType("Map" /* Map */)(value); + is.set = (value) => isObjectOfType("Set" /* Set */)(value); + is.weakMap = (value) => isObjectOfType("WeakMap" /* WeakMap */)(value); + is.weakSet = (value) => isObjectOfType("WeakSet" /* WeakSet */)(value); + is.int8Array = isObjectOfType("Int8Array" /* Int8Array */); + is.uint8Array = isObjectOfType("Uint8Array" /* Uint8Array */); + is.uint8ClampedArray = isObjectOfType("Uint8ClampedArray" /* Uint8ClampedArray */); + is.int16Array = isObjectOfType("Int16Array" /* Int16Array */); + is.uint16Array = isObjectOfType("Uint16Array" /* Uint16Array */); + is.int32Array = isObjectOfType("Int32Array" /* Int32Array */); + is.uint32Array = isObjectOfType("Uint32Array" /* Uint32Array */); + is.float32Array = isObjectOfType("Float32Array" /* Float32Array */); + is.float64Array = isObjectOfType("Float64Array" /* Float64Array */); + is.arrayBuffer = isObjectOfType("ArrayBuffer" /* ArrayBuffer */); + is.sharedArrayBuffer = isObjectOfType("SharedArrayBuffer" /* SharedArrayBuffer */); + is.dataView = isObjectOfType("DataView" /* DataView */); + is.directInstanceOf = (instance, klass) => Object.getPrototypeOf(instance) === klass.prototype; + is.urlInstance = (value) => isObjectOfType("URL" /* URL */)(value); + is.urlString = (value) => { + if (!is.string(value)) { + return false; + } + try { + new URLGlobal(value); // tslint:disable-line no-unused-expression + return true; + } + catch (_a) { + return false; + } + }; + is.truthy = (value) => Boolean(value); + is.falsy = (value) => !value; + is.nan = (value) => Number.isNaN(value); + const primitiveTypes = new Set([ + 'undefined', + 'string', + 'number', + 'boolean', + 'symbol' + ]); + is.primitive = (value) => is.null_(value) || primitiveTypes.has(typeof value); + is.integer = (value) => Number.isInteger(value); + is.safeInteger = (value) => Number.isSafeInteger(value); + is.plainObject = (value) => { + // From: https://github.com/sindresorhus/is-plain-obj/blob/master/index.js + let prototype; + return getObjectType(value) === "Object" /* Object */ && + (prototype = Object.getPrototypeOf(value), prototype === null || // tslint:disable-line:ban-comma-operator + prototype === Object.getPrototypeOf({})); + }; + const typedArrayTypes = new Set([ + "Int8Array" /* Int8Array */, + "Uint8Array" /* Uint8Array */, + "Uint8ClampedArray" /* Uint8ClampedArray */, + "Int16Array" /* Int16Array */, + "Uint16Array" /* Uint16Array */, + "Int32Array" /* Int32Array */, + "Uint32Array" /* Uint32Array */, + "Float32Array" /* Float32Array */, + "Float64Array" /* Float64Array */ + ]); + is.typedArray = (value) => { + const objectType = getObjectType(value); + if (objectType === null) { + return false; + } + return typedArrayTypes.has(objectType); + }; + const isValidLength = (value) => is.safeInteger(value) && value > -1; + is.arrayLike = (value) => !is.nullOrUndefined(value) && !is.function_(value) && isValidLength(value.length); + is.inRange = (value, range) => { + if (is.number(range)) { + return value >= Math.min(0, range) && value <= Math.max(range, 0); + } + if (is.array(range) && range.length === 2) { + return value >= Math.min(...range) && value <= Math.max(...range); + } + throw new TypeError(`Invalid range: ${JSON.stringify(range)}`); + }; + const NODE_TYPE_ELEMENT = 1; + const DOM_PROPERTIES_TO_CHECK = [ + 'innerHTML', + 'ownerDocument', + 'style', + 'attributes', + 'nodeValue' + ]; + is.domElement = (value) => is.object(value) && value.nodeType === NODE_TYPE_ELEMENT && is.string(value.nodeName) && + !is.plainObject(value) && DOM_PROPERTIES_TO_CHECK.every(property => property in value); + is.observable = (value) => { + if (!value) { + return false; + } + if (value[Symbol.observable] && value === value[Symbol.observable]()) { + return true; + } + if (value['@@observable'] && value === value['@@observable']()) { + return true; + } + return false; + }; + is.nodeStream = (value) => !is.nullOrUndefined(value) && isObject(value) && is.function_(value.pipe) && !is.observable(value); + is.infinite = (value) => value === Infinity || value === -Infinity; + const isAbsoluteMod2 = (rem) => (value) => is.integer(value) && Math.abs(value % 2) === rem; + is.even = isAbsoluteMod2(0); + is.odd = isAbsoluteMod2(1); + const isWhiteSpaceString = (value) => is.string(value) && /\S/.test(value) === false; + is.emptyArray = (value) => is.array(value) && value.length === 0; + is.nonEmptyArray = (value) => is.array(value) && value.length > 0; + is.emptyString = (value) => is.string(value) && value.length === 0; + is.nonEmptyString = (value) => is.string(value) && value.length > 0; + is.emptyStringOrWhitespace = (value) => is.emptyString(value) || isWhiteSpaceString(value); + is.emptyObject = (value) => is.object(value) && !is.map(value) && !is.set(value) && Object.keys(value).length === 0; + is.nonEmptyObject = (value) => is.object(value) && !is.map(value) && !is.set(value) && Object.keys(value).length > 0; + is.emptySet = (value) => is.set(value) && value.size === 0; + is.nonEmptySet = (value) => is.set(value) && value.size > 0; + is.emptyMap = (value) => is.map(value) && value.size === 0; + is.nonEmptyMap = (value) => is.map(value) && value.size > 0; + const predicateOnArray = (method, predicate, values) => { + if (is.function_(predicate) === false) { + throw new TypeError(`Invalid predicate: ${JSON.stringify(predicate)}`); + } + if (values.length === 0) { + throw new TypeError('Invalid number of values'); + } + return method.call(values, predicate); + }; + // tslint:disable variable-name + is.any = (predicate, ...values) => predicateOnArray(Array.prototype.some, predicate, values); + is.all = (predicate, ...values) => predicateOnArray(Array.prototype.every, predicate, values); + // tslint:enable variable-name +})(is || (is = {})); +// Some few keywords are reserved, but we'll populate them for Node.js users +// See https://github.com/Microsoft/TypeScript/issues/2536 +Object.defineProperties(is, { + class: { + value: is.class_ + }, + function: { + value: is.function_ + }, + null: { + value: is.null_ + } +}); +exports.default = is; +// For CommonJS default export support +module.exports = is; +module.exports.default = is; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/helloworld/node_modules/@sindresorhus/is/dist/index.js.map b/helloworld/node_modules/@sindresorhus/is/dist/index.js.map new file mode 100755 index 0000000..cd827fc --- /dev/null +++ b/helloworld/node_modules/@sindresorhus/is/dist/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../source/index.ts"],"names":[],"mappings":";AAAA,6BAA6B;AAC7B,0CAA0C;AAC1C,2CAA2C;AAC3C,0BAA0B;;AAE1B,uDAAuD;AACvD,2BAA2B;AAC3B,MAAM,SAAS,GAAG,OAAO,GAAG,KAAK,WAAW,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,CAAC;AAqDxE,MAAM,QAAQ,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC;AAC3C,MAAM,QAAQ,GAAG,CAAI,IAAY,EAAE,EAAE,CAAC,CAAC,KAAc,EAAc,EAAE,CAAC,OAAO,KAAK,KAAK,IAAI,CAAC;AAC5F,MAAM,QAAQ,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,CAAC,EAAE,CAAC,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,EAAE,CAAC,eAAe,CAAE,KAAgB,CAAC,WAAW,CAAC,IAAI,EAAE,CAAC,SAAS,CAAE,KAAgB,CAAC,WAAW,CAAC,QAAQ,CAAC,IAAK,KAAgB,CAAC,WAAW,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;AAEhP,MAAM,aAAa,GAAG,CAAC,KAAc,EAAmB,EAAE;IACzD,MAAM,UAAU,GAAG,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,KAAK,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC;IAErD,IAAI,UAAU,EAAE;QACf,OAAO,UAAsB,CAAC;KAC9B;IAED,OAAO,IAAI,CAAC;AACb,CAAC,CAAC;AAEF,MAAM,cAAc,GAAG,CAAI,IAAc,EAAE,EAAE,CAAC,CAAC,KAAc,EAAc,EAAE,CAAC,aAAa,CAAC,KAAK,CAAC,KAAK,IAAI,CAAC;AAE5G,SAAS,EAAE,CAAC,KAAc;IACzB,QAAQ,KAAK,EAAE;QACd,KAAK,IAAI;YACR,yBAAqB;QACtB,KAAK,IAAI,CAAC;QACV,KAAK,KAAK;YACT,+BAAwB;QACzB,QAAQ;KACR;IAED,QAAQ,OAAO,KAAK,EAAE;QACrB,KAAK,WAAW;YACf,mCAA0B;QAC3B,KAAK,QAAQ;YACZ,6BAAuB;QACxB,KAAK,QAAQ;YACZ,6BAAuB;QACxB,KAAK,QAAQ;YACZ,6BAAuB;QACxB,QAAQ;KACR;IAED,IAAI,EAAE,CAAC,SAAS,CAAC,KAAK,CAAC,EAAE;QACxB,iCAAyB;KACzB;IAED,IAAI,EAAE,CAAC,UAAU,CAAC,KAAK,CAAC,EAAE;QACzB,qCAA2B;KAC3B;IAED,IAAI,KAAK,CAAC,OAAO,CAAC,KAAK,CAAC,EAAE;QACzB,2BAAsB;KACtB;IAED,IAAI,QAAQ,CAAC,KAAK,CAAC,EAAE;QACpB,6BAAuB;KACvB;IAED,MAAM,OAAO,GAAG,aAAa,CAAC,KAAK,CAAC,CAAC;IACrC,IAAI,OAAO,EAAE;QACZ,OAAO,OAAO,CAAC;KACf;IAED,IAAI,KAAK,YAAY,MAAM,IAAI,KAAK,YAAY,OAAO,IAAI,KAAK,YAAY,MAAM,EAAE;QACnF,MAAM,IAAI,SAAS,CAAC,uDAAuD,CAAC,CAAC;KAC7E;IAED,6BAAuB;AACxB,CAAC;AAED,WAAU,EAAE;IACX,kDAAkD;IAClD,MAAM,QAAQ,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,OAAO,KAAK,KAAK,QAAQ,CAAC;IAEhF,+BAA+B;IAClB,YAAS,GAAG,QAAQ,CAAY,WAAW,CAAC,CAAC;IAC7C,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACpC,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACpC,YAAS,GAAG,QAAQ,CAAW,UAAU,CAAC,CAAC;IACxD,kDAAkD;IACrC,QAAK,GAAG,CAAC,KAAc,EAAiB,EAAE,CAAC,KAAK,KAAK,IAAI,CAAC;IAC1D,SAAM,GAAG,CAAC,KAAc,EAAkB,EAAE,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,QAAQ,EAAE,CAAC,UAAU,CAAC,QAAQ,CAAC,CAAC;IACvG,UAAO,GAAG,CAAC,KAAc,EAAoB,EAAE,CAAC,KAAK,KAAK,IAAI,IAAI,KAAK,KAAK,KAAK,CAAC;IAClF,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACjD,8BAA8B;IAEjB,gBAAa,GAAG,CAAC,KAAc,EAAW,EAAE,CACxD,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,KAAK,CAAC,MAAM,CAAC,KAAK,CAAC,CAAC,CAAC;IAEtD,QAAK,GAAG,KAAK,CAAC,OAAO,CAAC;IACtB,SAAM,GAAG,QAAQ,CAAC;IAElB,kBAAe,GAAG,CAAC,KAAc,EAA6B,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,CAAC;IAClG,SAAM,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,QAAQ,CAAC,KAAK,CAAC,CAAC,CAAC;IAC/G,WAAQ,GAAG,CAAC,KAAc,EAAsC,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAE,KAAmC,CAAC,MAAM,CAAC,QAAQ,CAAC,CAAC,CAAC;IAC/J,gBAAa,GAAG,CAAC,KAAc,EAA2C,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAE,KAAwC,CAAC,MAAM,CAAC,aAAa,CAAC,CAAC,CAAC;IACnL,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,GAAA,QAAQ,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,KAAK,CAAC,CAAC;IAEvH,gBAAa,GAAG,CAAC,KAAc,EAA6B,EAAE,CAC1E,cAAc,yBAAoC,CAAC,KAAK,CAAC,CAAC;IAE3D,MAAM,aAAa,GAAG,CAAC,KAAc,EAA6B,EAAE,CACnE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC;QACb,QAAQ,CAAC,KAAK,CAAY;QAC1B,GAAA,SAAS,CAAE,KAA0B,CAAC,IAAI,CAAC;QAC3C,GAAA,SAAS,CAAE,KAA0B,CAAC,KAAK,CAAC,CAAC;IAEjC,UAAO,GAAG,CAAC,KAAc,EAA6B,EAAE,CAAC,GAAA,aAAa,CAAC,KAAK,CAAC,IAAI,aAAa,CAAC,KAAK,CAAC,CAAC;IAEtG,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,gBAAa,GAAG,cAAc,qCAAkC,CAAC;IACjE,gBAAa,GAAG,CAAC,KAAc,EAAqB,EAAE,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,cAAc,CAAC,WAAW,CAAC,CAAC;IAE9G,SAAM,GAAG,cAAc,uBAAyB,CAAC;IACjD,OAAI,GAAG,cAAc,mBAAqB,CAAC;IAC3C,QAAK,GAAG,cAAc,qBAAuB,CAAC;IAC9C,MAAG,GAAG,CAAC,KAAc,EAAkC,EAAE,CAAC,cAAc,iBAAqC,CAAC,KAAK,CAAC,CAAC;IACrH,MAAG,GAAG,CAAC,KAAc,EAAyB,EAAE,CAAC,cAAc,iBAA4B,CAAC,KAAK,CAAC,CAAC;IACnG,UAAO,GAAG,CAAC,KAAc,EAAqC,EAAE,CAAC,cAAc,yBAA4C,CAAC,KAAK,CAAC,CAAC;IACnI,UAAO,GAAG,CAAC,KAAc,EAA4B,EAAE,CAAC,cAAc,yBAAmC,CAAC,KAAK,CAAC,CAAC;IAEjH,YAAS,GAAG,cAAc,6BAA+B,CAAC;IAC1D,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,eAAY,GAAG,cAAc,mCAAqC,CAAC;IACnE,eAAY,GAAG,cAAc,mCAAqC,CAAC;IAEnE,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,WAAQ,GAAG,cAAc,2BAA6B,CAAC;IAEvD,mBAAgB,GAAG,CAAI,QAAiB,EAAE,KAAe,EAAiB,EAAE,CAAC,MAAM,CAAC,cAAc,CAAC,QAAQ,CAAC,KAAK,KAAK,CAAC,SAAS,CAAC;IACjI,cAAW,GAAG,CAAC,KAAc,EAAgB,EAAE,CAAC,cAAc,iBAAmB,CAAC,KAAK,CAAC,CAAC;IAEzF,YAAS,GAAG,CAAC,KAAc,EAAE,EAAE;QAC3C,IAAI,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,EAAE;YACnB,OAAO,KAAK,CAAC;SACb;QAED,IAAI;YACH,IAAI,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,2CAA2C;YACjE,OAAO,IAAI,CAAC;SACZ;QAAC,WAAM;YACP,OAAO,KAAK,CAAC;SACb;IACF,CAAC,CAAC;IAEW,SAAM,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC;IAC5C,QAAK,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,CAAC,KAAK,CAAC;IAEnC,MAAG,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,MAAM,CAAC,KAAK,CAAC,KAAe,CAAC,CAAC;IAErE,MAAM,cAAc,GAAG,IAAI,GAAG,CAAC;QAC9B,WAAW;QACX,QAAQ;QACR,QAAQ;QACR,SAAS;QACT,QAAQ;KACR,CAAC,CAAC;IAEU,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,cAAc,CAAC,GAAG,CAAC,OAAO,KAAK,CAAC,CAAC;IAErG,UAAO,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,MAAM,CAAC,SAAS,CAAC,KAAe,CAAC,CAAC;IACjF,cAAW,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,MAAM,CAAC,aAAa,CAAC,KAAe,CAAC,CAAC;IAEzF,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE;QAC7C,0EAA0E;QAC1E,IAAI,SAAS,CAAC;QAEd,OAAO,aAAa,CAAC,KAAK,CAAC,0BAAoB;YAC9C,CAAC,SAAS,GAAG,MAAM,CAAC,cAAc,CAAC,KAAK,CAAC,EAAE,SAAS,KAAK,IAAI,IAAI,yCAAyC;gBACzG,SAAS,KAAK,MAAM,CAAC,cAAc,CAAC,EAAE,CAAC,CAAC,CAAC;IAC5C,CAAC,CAAC;IAEF,MAAM,eAAe,GAAG,IAAI,GAAG,CAAC;;;;;;;;;;KAU/B,CAAC,CAAC;IACU,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE;QACjE,MAAM,UAAU,GAAG,aAAa,CAAC,KAAK,CAAC,CAAC;QAExC,IAAI,UAAU,KAAK,IAAI,EAAE;YACxB,OAAO,KAAK,CAAC;SACb;QAED,OAAO,eAAe,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;IACxC,CAAC,CAAC;IAEF,MAAM,aAAa,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,KAAK,GAAG,CAAC,CAAC,CAAC;IAC9D,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,aAAa,CAAE,KAAmB,CAAC,MAAM,CAAC,CAAC;IAE/I,UAAO,GAAG,CAAC,KAAa,EAAE,KAAwB,EAAE,EAAE;QAClE,IAAI,GAAA,MAAM,CAAC,KAAK,CAAC,EAAE;YAClB,OAAO,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,CAAC,EAAE,KAAK,CAAC,IAAI,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;SAClE;QAED,IAAI,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,EAAE;YACvC,OAAO,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC,IAAI,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC,CAAC;SAClE;QAED,MAAM,IAAI,SAAS,CAAC,kBAAkB,IAAI,CAAC,SAAS,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC;IAChE,CAAC,CAAC;IAEF,MAAM,iBAAiB,GAAG,CAAC,CAAC;IAC5B,MAAM,uBAAuB,GAAG;QAC/B,WAAW;QACX,eAAe;QACf,OAAO;QACP,YAAY;QACZ,WAAW;KACX,CAAC;IAEW,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAK,KAAoB,CAAC,QAAQ,KAAK,iBAAiB,IAAI,GAAA,MAAM,CAAE,KAAoB,CAAC,QAAQ,CAAC;QACjL,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,uBAAuB,CAAC,KAAK,CAAC,QAAQ,CAAC,EAAE,CAAC,QAAQ,IAAK,KAAoB,CAAC,CAAC;IAExF,aAAU,GAAG,CAAC,KAAc,EAAE,EAAE;QAC5C,IAAI,CAAC,KAAK,EAAE;YACX,OAAO,KAAK,CAAC;SACb;QAED,IAAK,KAAa,CAAC,MAAM,CAAC,UAAU,CAAC,IAAI,KAAK,KAAM,KAAa,CAAC,MAAM,CAAC,UAAU,CAAC,EAAE,EAAE;YACvF,OAAO,IAAI,CAAC;SACZ;QAED,IAAK,KAAa,CAAC,cAAc,CAAC,IAAI,KAAK,KAAM,KAAa,CAAC,cAAc,CAAC,EAAE,EAAE;YACjF,OAAO,IAAI,CAAC;SACZ;QAED,OAAO,KAAK,CAAC;IACd,CAAC,CAAC;IAEW,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,QAAQ,CAAC,KAAK,CAAY,IAAI,GAAA,SAAS,CAAE,KAAoB,CAAC,IAAI,CAAC,IAAI,CAAC,GAAA,UAAU,CAAC,KAAK,CAAC,CAAC;IAE3K,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,KAAK,KAAK,QAAQ,IAAI,KAAK,KAAK,CAAC,QAAQ,CAAC;IAEtF,MAAM,cAAc,GAAG,CAAC,GAAW,EAAE,EAAE,CAAC,CAAC,KAAa,EAAE,EAAE,CAAC,GAAA,OAAO,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,GAAG,CAAC,CAAC,KAAK,GAAG,CAAC;IAC5F,OAAI,GAAG,cAAc,CAAC,CAAC,CAAC,CAAC;IACzB,MAAG,GAAG,cAAc,CAAC,CAAC,CAAC,CAAC;IAErC,MAAM,kBAAkB,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,KAAK,CAAC;IAE9E,aAAU,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,CAAC;IACpE,gBAAa,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;IAErE,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,CAAC;IACtE,iBAAc,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;IACvE,0BAAuB,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,kBAAkB,CAAC,KAAK,CAAC,CAAC;IAE9F,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,KAAK,CAAC,CAAC;IACjH,iBAAc,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,GAAG,CAAC,CAAC;IAElH,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,KAAK,CAAC,CAAC;IAC9D,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,GAAG,CAAC,CAAC;IAE/D,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,KAAK,CAAC,CAAC;IAC9D,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,GAAG,CAAC,CAAC;IAG5E,MAAM,gBAAgB,GAAG,CAAC,MAAmB,EAAE,SAAkB,EAAE,MAAiB,EAAE,EAAE;QACvF,IAAI,GAAA,SAAS,CAAC,SAAS,CAAC,KAAK,KAAK,EAAE;YACnC,MAAM,IAAI,SAAS,CAAC,sBAAsB,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,EAAE,CAAC,CAAC;SACvE;QAED,IAAI,MAAM,CAAC,MAAM,KAAK,CAAC,EAAE;YACxB,MAAM,IAAI,SAAS,CAAC,0BAA0B,CAAC,CAAC;SAChD;QAED,OAAO,MAAM,CAAC,IAAI,CAAC,MAAM,EAAE,SAAgB,CAAC,CAAC;IAC9C,CAAC,CAAC;IAEF,+BAA+B;IAClB,MAAG,GAAG,CAAC,SAAkB,EAAE,GAAG,MAAiB,EAAE,EAAE,CAAC,gBAAgB,CAAC,KAAK,CAAC,SAAS,CAAC,IAAI,EAAE,SAAS,EAAE,MAAM,CAAC,CAAC;IAC9G,MAAG,GAAG,CAAC,SAAkB,EAAE,GAAG,MAAiB,EAAE,EAAE,CAAC,gBAAgB,CAAC,KAAK,CAAC,SAAS,CAAC,KAAK,EAAE,SAAS,EAAE,MAAM,CAAC,CAAC;IAC5H,8BAA8B;AAC/B,CAAC,EAvNS,EAAE,KAAF,EAAE,QAuNX;AAED,4EAA4E;AAC5E,0DAA0D;AAC1D,MAAM,CAAC,gBAAgB,CAAC,EAAE,EAAE;IAC3B,KAAK,EAAE;QACN,KAAK,EAAE,EAAE,CAAC,MAAM;KAChB;IACD,QAAQ,EAAE;QACT,KAAK,EAAE,EAAE,CAAC,SAAS;KACnB;IACD,IAAI,EAAE;QACL,KAAK,EAAE,EAAE,CAAC,KAAK;KACf;CACD,CAAC,CAAC;AAEH,kBAAe,EAAE,CAAC;AAElB,sCAAsC;AACtC,MAAM,CAAC,OAAO,GAAG,EAAE,CAAC;AACpB,MAAM,CAAC,OAAO,CAAC,OAAO,GAAG,EAAE,CAAC"} \ No newline at end of file diff --git a/helloworld/node_modules/@sindresorhus/is/license b/helloworld/node_modules/@sindresorhus/is/license new file mode 100755 index 0000000..e7af2f7 --- /dev/null +++ b/helloworld/node_modules/@sindresorhus/is/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/@sindresorhus/is/readme.md b/helloworld/node_modules/@sindresorhus/is/readme.md new file mode 100755 index 0000000..97c023b --- /dev/null +++ b/helloworld/node_modules/@sindresorhus/is/readme.md @@ -0,0 +1,451 @@ +# is [![Build Status](https://travis-ci.org/sindresorhus/is.svg?branch=master)](https://travis-ci.org/sindresorhus/is) + +> Type check values: `is.string('🦄') //=> true` + + + + +## Install + +``` +$ npm install @sindresorhus/is +``` + + +## Usage + +```js +const is = require('@sindresorhus/is'); + +is('🦄'); +//=> 'string' + +is(new Map()); +//=> 'Map' + +is.number(6); +//=> true +``` + +When using `is` together with TypeScript, [type guards](http://www.typescriptlang.org/docs/handbook/advanced-types.html#type-guards-and-differentiating-types) are being used to infer the correct type inside if-else statements. + +```ts +import is from '@sindresorhus/is'; + +const padLeft = (value: string, padding: string | number) => { + if (is.number(padding)) { + // `padding` is typed as `number` + return Array(padding + 1).join(' ') + value; + } + + if (is.string(padding)) { + // `padding` is typed as `string` + return padding + value; + } + + throw new TypeError(`Expected 'padding' to be of type 'string' or 'number', got '${is(padding)}'.`); +} + +padLeft('🦄', 3); +//=> ' 🦄' + +padLeft('🦄', '🌈'); +//=> '🌈🦄' +``` + + +## API + +### is(value) + +Returns the type of `value`. + +Primitives are lowercase and object types are camelcase. + +Example: + +- `'undefined'` +- `'null'` +- `'string'` +- `'symbol'` +- `'Array'` +- `'Function'` +- `'Object'` + +Note: It will throw an error if you try to feed it object-wrapped primitives, as that's a bad practice. For example `new String('foo')`. + +### is.{method} + +All the below methods accept a value and returns a boolean for whether the value is of the desired type. + +#### Primitives + +##### .undefined(value) +##### .null(value) +##### .string(value) +##### .number(value) +##### .boolean(value) +##### .symbol(value) + +#### Built-in types + +##### .array(value) +##### .function(value) +##### .buffer(value) +##### .object(value) + +Keep in mind that [functions are objects too](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Functions). + +##### .numericString(value) + +Returns `true` for a string that represents a number. For example, `'42'` and `'-8'`. + +Note: `'NaN'` returns `false`, but `'Infinity'` and `'-Infinity'` return `true`. + +##### .regExp(value) +##### .date(value) +##### .error(value) +##### .nativePromise(value) +##### .promise(value) + +Returns `true` for any object with a `.then()` and `.catch()` method. Prefer this one over `.nativePromise()` as you usually want to allow userland promise implementations too. + +##### .generator(value) + +Returns `true` for any object that implements its own `.next()` and `.throw()` methods and has a function definition for `Symbol.iterator`. + +##### .generatorFunction(value) + +##### .asyncFunction(value) + +Returns `true` for any `async` function that can be called with the `await` operator. + +```js +is.asyncFunction(async () => {}); +// => true + +is.asyncFunction(() => {}); +// => false +``` + +##### .boundFunction(value) + +Returns `true` for any `bound` function. + +```js +is.boundFunction(() => {}); +// => true + +is.boundFunction(function () {}.bind(null)); +// => true + +is.boundFunction(function () {}); +// => false +``` + +##### .map(value) +##### .set(value) +##### .weakMap(value) +##### .weakSet(value) + +#### Typed arrays + +##### .int8Array(value) +##### .uint8Array(value) +##### .uint8ClampedArray(value) +##### .int16Array(value) +##### .uint16Array(value) +##### .int32Array(value) +##### .uint32Array(value) +##### .float32Array(value) +##### .float64Array(value) + +#### Structured data + +##### .arrayBuffer(value) +##### .sharedArrayBuffer(value) +##### .dataView(value) + +#### Emptiness + +##### .emptyString(value) + +Returns `true` if the value is a `string` and the `.length` is 0. + +##### .nonEmptyString(value) + +Returns `true` if the value is a `string` and the `.length` is more than 0. + +##### .emptyStringOrWhitespace(value) + +Returns `true` if `is.emptyString(value)` or if it's a `string` that is all whitespace. + +##### .emptyArray(value) + +Returns `true` if the value is an `Array` and the `.length` is 0. + +##### .nonEmptyArray(value) + +Returns `true` if the value is an `Array` and the `.length` is more than 0. + +##### .emptyObject(value) + +Returns `true` if the value is an `Object` and `Object.keys(value).length` is 0. + +Please note that `Object.keys` returns only own enumerable properties. Hence something like this can happen: + +```js +const object1 = {}; + +Object.defineProperty(object1, 'property1', { + value: 42, + writable: true, + enumerable: false, + configurable: true +}); + +is.emptyObject(object1); +// => true +``` + +##### .nonEmptyObject(value) + +Returns `true` if the value is an `Object` and `Object.keys(value).length` is more than 0. + +##### .emptySet(value) + +Returns `true` if the value is a `Set` and the `.size` is 0. + +##### .nonEmptySet(Value) + +Returns `true` if the value is a `Set` and the `.size` is more than 0. + +##### .emptyMap(value) + +Returns `true` if the value is a `Map` and the `.size` is 0. + +##### .nonEmptyMap(value) + +Returns `true` if the value is a `Map` and the `.size` is more than 0. + +#### Miscellaneous + +##### .directInstanceOf(value, class) + +Returns `true` if `value` is a direct instance of `class`. + +```js +is.directInstanceOf(new Error(), Error); +//=> true + +class UnicornError extends Error {} + +is.directInstanceOf(new UnicornError(), Error); +//=> false +``` + +##### .urlInstance(value) + +Returns `true` if `value` is an instance of the [`URL` class](https://developer.mozilla.org/en-US/docs/Web/API/URL). + +```js +const url = new URL('https://example.com'); + +is.urlInstance(url); +//=> true +``` + +### .url(value) + +Returns `true` if `value` is a URL string. + +Note: this only does basic checking using the [`URL` class](https://developer.mozilla.org/en-US/docs/Web/API/URL) constructor. + +```js +const url = 'https://example.com'; + +is.url(url); +//=> true + +is.url(new URL(url)); +//=> false +``` + +##### .truthy(value) + +Returns `true` for all values that evaluate to true in a boolean context: + +```js +is.truthy('🦄'); +//=> true + +is.truthy(undefined); +//=> false +``` + +##### .falsy(value) + +Returns `true` if `value` is one of: `false`, `0`, `''`, `null`, `undefined`, `NaN`. + +##### .nan(value) +##### .nullOrUndefined(value) +##### .primitive(value) + +JavaScript primitives are as follows: `null`, `undefined`, `string`, `number`, `boolean`, `symbol`. + +##### .integer(value) + +##### .safeInteger(value) + +Returns `true` if `value` is a [safe integer](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Number/isSafeInteger). + +##### .plainObject(value) + +An object is plain if it's created by either `{}`, `new Object()`, or `Object.create(null)`. + +##### .iterable(value) +##### .asyncIterable(value) +##### .class(value) + +Returns `true` for instances created by a class. + +##### .typedArray(value) + +##### .arrayLike(value) + +A `value` is array-like if it is not a function and has a `value.length` that is a safe integer greater than or equal to 0. + +```js +is.arrayLike(document.forms); +//=> true + +function foo() { + is.arrayLike(arguments); + //=> true +} +foo(); +``` + +##### .inRange(value, range) + +Check if `value` (number) is in the given `range`. The range is an array of two values, lower bound and upper bound, in no specific order. + +```js +is.inRange(3, [0, 5]); +is.inRange(3, [5, 0]); +is.inRange(0, [-2, 2]); +``` + +##### .inRange(value, upperBound) + +Check if `value` (number) is in the range of `0` to `upperBound`. + +```js +is.inRange(3, 10); +``` + +##### .domElement(value) + +Returns `true` if `value` is a DOM Element. + +##### .nodeStream(value) + +Returns `true` if `value` is a Node.js [stream](https://nodejs.org/api/stream.html). + +```js +const fs = require('fs'); + +is.nodeStream(fs.createReadStream('unicorn.png')); +//=> true +``` + +##### .observable(value) + +Returns `true` if `value` is an `Observable`. + +```js +const {Observable} = require('rxjs'); + +is.observable(new Observable()); +//=> true +``` + +##### .infinite(value) + +Check if `value` is `Infinity` or `-Infinity`. + +##### .even(value) + +Returns `true` if `value` is an even integer. + +##### .odd(value) + +Returns `true` if `value` is an odd integer. + +##### .any(predicate, ...values) + +Returns `true` if **any** of the input `values` returns true in the `predicate`: + +```js +is.any(is.string, {}, true, '🦄'); +//=> true + +is.any(is.boolean, 'unicorns', [], new Map()); +//=> false +``` + +##### .all(predicate, ...values) + +Returns `true` if **all** of the input `values` returns true in the `predicate`: + +```js +is.all(is.object, {}, new Map(), new Set()); +//=> true + +is.all(is.string, '🦄', [], 'unicorns'); +//=> false +``` + + +## FAQ + +### Why yet another type checking module? + +There are hundreds of type checking modules on npm, unfortunately, I couldn't find any that fit my needs: + +- Includes both type methods and ability to get the type +- Types of primitives returned as lowercase and object types as camelcase +- Covers all built-ins +- Unsurprising behavior +- Well-maintained +- Comprehensive test suite + +For the ones I found, pick 3 of these. + +The most common mistakes I noticed in these modules was using `instanceof` for type checking, forgetting that functions are objects, and omitting `symbol` as a primitive. + + +## Related + +- [ow](https://github.com/sindresorhus/ow) - Function argument validation for humans +- [is-stream](https://github.com/sindresorhus/is-stream) - Check if something is a Node.js stream +- [is-observable](https://github.com/sindresorhus/is-observable) - Check if a value is an Observable +- [file-type](https://github.com/sindresorhus/file-type) - Detect the file type of a Buffer/Uint8Array +- [is-ip](https://github.com/sindresorhus/is-ip) - Check if a string is an IP address +- [is-array-sorted](https://github.com/sindresorhus/is-array-sorted) - Check if an Array is sorted +- [is-error-constructor](https://github.com/sindresorhus/is-error-constructor) - Check if a value is an error constructor +- [is-empty-iterable](https://github.com/sindresorhus/is-empty-iterable) - Check if an Iterable is empty +- [is-blob](https://github.com/sindresorhus/is-blob) - Check if a value is a Blob - File-like object of immutable, raw data +- [has-emoji](https://github.com/sindresorhus/has-emoji) - Check whether a string has any emoji + + +## Created by + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Giora Guttsait](https://github.com/gioragutt) +- [Brandon Smith](https://github.com/brandon93s) + + +## License + +MIT diff --git a/helloworld/node_modules/@szmarczak/http-timer/LICENSE b/helloworld/node_modules/@szmarczak/http-timer/LICENSE new file mode 100755 index 0000000..15ad2e8 --- /dev/null +++ b/helloworld/node_modules/@szmarczak/http-timer/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Szymon Marczak + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/helloworld/node_modules/@szmarczak/http-timer/README.md b/helloworld/node_modules/@szmarczak/http-timer/README.md new file mode 100755 index 0000000..13279ed --- /dev/null +++ b/helloworld/node_modules/@szmarczak/http-timer/README.md @@ -0,0 +1,70 @@ +# http-timer +> Timings for HTTP requests + +[![Build Status](https://travis-ci.org/szmarczak/http-timer.svg?branch=master)](https://travis-ci.org/szmarczak/http-timer) +[![Coverage Status](https://coveralls.io/repos/github/szmarczak/http-timer/badge.svg?branch=master)](https://coveralls.io/github/szmarczak/http-timer?branch=master) +[![install size](https://packagephobia.now.sh/badge?p=@szmarczak/http-timer)](https://packagephobia.now.sh/result?p=@szmarczak/http-timer) + +Inspired by the [`request` package](https://github.com/request/request). + +## Usage +```js +'use strict'; +const https = require('https'); +const timer = require('@szmarczak/http-timer'); + +const request = https.get('https://httpbin.org/anything'); +const timings = timer(request); + +request.on('response', response => { + response.on('data', () => {}); // Consume the data somehow + response.on('end', () => { + console.log(timings); + }); +}); + +// { start: 1535708511443, +// socket: 1535708511444, +// lookup: 1535708511444, +// connect: 1535708511582, +// upload: 1535708511887, +// response: 1535708512037, +// end: 1535708512040, +// phases: +// { wait: 1, +// dns: 0, +// tcp: 138, +// request: 305, +// firstByte: 150, +// download: 3, +// total: 597 } } +``` + +## API + +### timer(request) + +Returns: `Object` + +- `start` - Time when the request started. +- `socket` - Time when a socket was assigned to the request. +- `lookup` - Time when the DNS lookup finished. +- `connect` - Time when the socket successfully connected. +- `upload` - Time when the request finished uploading. +- `response` - Time when the request fired the `response` event. +- `end` - Time when the response fired the `end` event. +- `error` - Time when the request fired the `error` event. +- `phases` + - `wait` - `timings.socket - timings.start` + - `dns` - `timings.lookup - timings.socket` + - `tcp` - `timings.connect - timings.lookup` + - `request` - `timings.upload - timings.connect` + - `firstByte` - `timings.response - timings.upload` + - `download` - `timings.end - timings.response` + - `total` - `timings.end - timings.start` or `timings.error - timings.start` + +**Note**: The time is a `number` representing the milliseconds elapsed since the UNIX epoch. + +## License + +MIT diff --git a/helloworld/node_modules/@szmarczak/http-timer/source/index.js b/helloworld/node_modules/@szmarczak/http-timer/source/index.js new file mode 100755 index 0000000..e294580 --- /dev/null +++ b/helloworld/node_modules/@szmarczak/http-timer/source/index.js @@ -0,0 +1,99 @@ +'use strict'; +const deferToConnect = require('defer-to-connect'); + +module.exports = request => { + const timings = { + start: Date.now(), + socket: null, + lookup: null, + connect: null, + upload: null, + response: null, + end: null, + error: null, + phases: { + wait: null, + dns: null, + tcp: null, + request: null, + firstByte: null, + download: null, + total: null + } + }; + + const handleError = origin => { + const emit = origin.emit.bind(origin); + origin.emit = (event, ...args) => { + // Catches the `error` event + if (event === 'error') { + timings.error = Date.now(); + timings.phases.total = timings.error - timings.start; + + origin.emit = emit; + } + + // Saves the original behavior + return emit(event, ...args); + }; + }; + + let uploadFinished = false; + const onUpload = () => { + timings.upload = Date.now(); + timings.phases.request = timings.upload - timings.connect; + }; + + handleError(request); + + request.once('socket', socket => { + timings.socket = Date.now(); + timings.phases.wait = timings.socket - timings.start; + + const lookupListener = () => { + timings.lookup = Date.now(); + timings.phases.dns = timings.lookup - timings.socket; + }; + + socket.once('lookup', lookupListener); + + deferToConnect(socket, () => { + timings.connect = Date.now(); + + if (timings.lookup === null) { + socket.removeListener('lookup', lookupListener); + timings.lookup = timings.connect; + timings.phases.dns = timings.lookup - timings.socket; + } + + timings.phases.tcp = timings.connect - timings.lookup; + + if (uploadFinished && !timings.upload) { + onUpload(); + } + }); + }); + + request.once('finish', () => { + uploadFinished = true; + + if (timings.connect) { + onUpload(); + } + }); + + request.once('response', response => { + timings.response = Date.now(); + timings.phases.firstByte = timings.response - timings.upload; + + handleError(response); + + response.once('end', () => { + timings.end = Date.now(); + timings.phases.download = timings.end - timings.response; + timings.phases.total = timings.end - timings.start; + }); + }); + + return timings; +}; diff --git a/helloworld/node_modules/Buffer/README.md b/helloworld/node_modules/Buffer/README.md new file mode 100755 index 0000000..7cb430a --- /dev/null +++ b/helloworld/node_modules/Buffer/README.md @@ -0,0 +1,24 @@ +Buffer +=== + +The goal is to use `UInt8Array` as a buffer backend that completely follows the Node.JS API. + +For now, however, this just aliases `Array` as `Buffer` which works for many use cases. + +Current Implementation +--- + + var Buffer; + (function () { + "use strict"; + + function createBuffer() { + return Array; + } + + if ('undefined' === typeof Buffer) { + Buffer = createBuffer(); + } + + module.exports = Buffer; + }()); diff --git a/helloworld/node_modules/Buffer/index.js b/helloworld/node_modules/Buffer/index.js new file mode 100755 index 0000000..431d73a --- /dev/null +++ b/helloworld/node_modules/Buffer/index.js @@ -0,0 +1,98 @@ +if ('undefined' === typeof Buffer) { + // implicit global + Buffer = undefined; +} + +(function () { + "use strict"; + + function createBuffer() { + return Array; + + /* + function Buffer(sizeOrArrayOrString, encoding) { + var size, arr, str; + + if ('number' === typeof sizeOrArrayOrString) { + size = sizeOrArrayOrString; + } else if ('string' === typeof sizeOrArrayOrString) { + // TODO handle encoding + str = String(sizeOrArrayOrString); + arr = arr.split(''); + size = arr.length; + } else { + arr = sizeOrArrayOrString; + size = arr.length; + } + + this.length = size; + } + + Buffer.prototype = new Array(); + delete Buffer.prototype.push; + delete Buffer.prototype.pop; + delete Buffer.prototype.shift; + delete Buffer.prototype.unshift; + delete Buffer.prototype.splice; + + Buffer.isBuffer = function (buf) { + return buf instanceof Buffer; + }; + + // TODO + Buffer.byteLength = function (string, encoding) { + console.log('[todo] byteLength'); + encoding = encoding || 'utf8'; + // return string.length; + }; + + // TODO + Buffer.prototype.write = function (string, offset, encoding) { + console.log('[todo] write'); + }; + + Buffer.prototype.toString = function (encoding, start, end) { + var res = {} + , i + ; + + start = start || 0; + end = end || this.length - 1; + res.length = end + 1; + + if (this.length === res.length) { + res = this; + } else { + i = 0; + while (start <= end) { + res[i] = this[start]; + i += 1; + start += 1; + } + } + + return JSON.stringify(res); + }; + + Buffer.prototype.copy = function (targetBuffer, targetStart, sourceStart, sourceEnd) { + targetStart = targetStart || 0; + sourceStart = sourceStart || 0; + sourceEnd = sourceEnd || targetBuffer.length; + + }; + + Buffer.prototype.slice = function (start, end) { + end = end || this.length; + this.slice(start, end); + } + + return Buffer; + */ + } + + if ('undefined' === typeof Buffer) { + Buffer = createBuffer(); + } + + module.exports = Buffer; +}()); diff --git a/helloworld/node_modules/Buffer/package.json b/helloworld/node_modules/Buffer/package.json new file mode 100755 index 0000000..516db45 --- /dev/null +++ b/helloworld/node_modules/Buffer/package.json @@ -0,0 +1,50 @@ +{ + "_from": "Buffer", + "_id": "Buffer@0.0.0", + "_inBundle": false, + "_integrity": "sha1-gs+OmGohCf9tHW8cQ25H0HEnrqQ=", + "_location": "/Buffer", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "Buffer", + "name": "Buffer", + "escapedName": "Buffer", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/Buffer/-/Buffer-0.0.0.tgz", + "_shasum": "82cf8e986a2109ff6d1d6f1c436e47d07127aea4", + "_spec": "Buffer", + "_where": "/Users/chhekur/Desktop/nodejs-mobile-samples-master/android/native-gradle/app/src/main/assets/myapp", + "author": { + "name": "AJ ONeal", + "email": "coolaj86@gmail.com", + "url": "http://coolaj86.info" + }, + "bugs": { + "url": "https://github.com/coolaj86/browser-buffer/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "API-compatible Node.JS Buffer for Ender.js (browser)", + "devDependencies": {}, + "engines": { + "node": ">= 0.2.0" + }, + "homepage": "https://github.com/coolaj86/browser-buffer#readme", + "main": "index.js", + "name": "Buffer", + "repository": { + "type": "git", + "url": "git://github.com/coolaj86/browser-buffer.git" + }, + "version": "0.0.0" +} diff --git a/helloworld/node_modules/FileReader/FileReader.js b/helloworld/node_modules/FileReader/FileReader.js new file mode 100755 index 0000000..19ea284 --- /dev/null +++ b/helloworld/node_modules/FileReader/FileReader.js @@ -0,0 +1,302 @@ +// +// FileReader +// +// http://www.w3.org/TR/FileAPI/#dfn-filereader +// https://developer.mozilla.org/en/DOM/FileReader +(function () { + "use strict"; + + var fs = require("fs") + , EventEmitter = require("events").EventEmitter + ; + + function doop(fn, args, context) { + if ('function' === typeof fn) { + fn.apply(context, args); + } + } + + function toDataUrl(data, type) { + // var data = self.result; + var dataUrl = 'data:'; + + if (type) { + dataUrl += type + ';'; + } + + if (/text/i.test(type)) { + dataUrl += 'charset=utf-8,'; + dataUrl += data.toString('utf8'); + } else { + dataUrl += 'base64,'; + dataUrl += data.toString('base64'); + } + + return dataUrl; + } + + function mapDataToFormat(file, data, format, encoding) { + // var data = self.result; + + switch(format) { + case 'buffer': + return data; + break; + case 'binary': + return data.toString('binary'); + break; + case 'dataUrl': + return toDataUrl(data, file.type); + break; + case 'text': + return data.toString(encoding || 'utf8'); + break; + } + } + + function FileReader() { + var self = this, + emitter = new EventEmitter, + file; + + require('bufferjs/concat'); + + self.addEventListener = function (on, callback) { + emitter.on(on, callback); + }; + self.removeEventListener = function (callback) { + emitter.removeListener(callback); + } + self.dispatchEvent = function (on) { + emitter.emit(on); + } + + self.EMPTY = 0; + self.LOADING = 1; + self.DONE = 2; + + self.error = undefined; // Read only + self.readyState = self.EMPTY; // Read only + self.result = undefined; // Road only + + // non-standard + self.on = function () { + emitter.on.apply(emitter, arguments); + } + self.nodeChunkedEncoding = false; + self.setNodeChunkedEncoding = function (val) { + self.nodeChunkedEncoding = val; + }; + // end non-standard + + + + // Whatever the file object is, turn it into a Node.JS File.Stream + function createFileStream() { + var stream = new EventEmitter(), + chunked = self.nodeChunkedEncoding; + + // attempt to make the length computable + if (!file.size && chunked && file.path) { + fs.stat(file.path, function (err, stat) { + file.size = stat.size; + file.lastModifiedDate = stat.mtime; + }); + } + + + // The stream exists, do nothing more + if (file.stream) { + return; + } + + + // Create a read stream from a buffer + if (file.buffer) { + process.nextTick(function () { + stream.emit('data', file.buffer); + stream.emit('end'); + }); + file.stream = stream; + return; + } + + + // Create a read stream from a file + if (file.path) { + // TODO url + if (!chunked) { + fs.readFile(file.path, function (err, data) { + if (err) { + stream.emit('error', err); + } + if (data) { + stream.emit('data', data); + stream.emit('end'); + } + }); + + file.stream = stream; + return; + } + + // TODO don't duplicate this code here, + // expose a method in File instead + file.stream = fs.createReadStream(file.path); + } + } + + + + // before any other listeners are added + emitter.on('abort', function () { + self.readyState = self.DONE; + }); + + + + // Map `error`, `progress`, `load`, and `loadend` + function mapStreamToEmitter(format, encoding) { + var stream = file.stream, + buffers = [], + chunked = self.nodeChunkedEncoding; + + buffers.dataLength = 0; + + stream.on('error', function (err) { + if (self.DONE === self.readyState) { + return; + } + + self.readyState = self.DONE; + self.error = err; + emitter.emit('error', err); + }); + + stream.on('data', function (data) { + if (self.DONE === self.readyState) { + return; + } + + buffers.dataLength += data.length; + buffers.push(data); + + emitter.emit('progress', { + // fs.stat will probably complete before this + // but possibly it will not, hence the check + lengthComputable: (!isNaN(file.size)) ? true : false, + loaded: buffers.dataLength, + total: file.size + }); + + emitter.emit('data', data); + }); + + stream.on('end', function () { + if (self.DONE === self.readyState) { + return; + } + + var data; + + if (buffers.length > 1 ) { + data = Buffer.concat(buffers); + } else { + data = buffers[0]; + } + + self.readyState = self.DONE; + self.result = mapDataToFormat(file, data, format, encoding); + emitter.emit('load', { + target: { + // non-standard + nodeBufferResult: data, + result: self.result + } + }); + + emitter.emit('loadend'); + }); + } + + + // Abort is overwritten by readAsXyz + self.abort = function () { + if (self.readState == self.DONE) { + return; + } + self.readyState = self.DONE; + emitter.emit('abort'); + }; + + + + // + function mapUserEvents() { + emitter.on('start', function () { + doop(self.onloadstart, arguments); + }); + emitter.on('progress', function () { + doop(self.onprogress, arguments); + }); + emitter.on('error', function (err) { + // TODO translate to FileError + if (self.onerror) { + self.onerror(err); + } else { + if (!emitter.listeners.error || !emitter.listeners.error.length) { + throw err; + } + } + }); + emitter.on('load', function () { + doop(self.onload, arguments); + }); + emitter.on('end', function () { + doop(self.onloadend, arguments); + }); + emitter.on('abort', function () { + doop(self.onabort, arguments); + }); + } + + + + function readFile(_file, format, encoding) { + file = _file; + if (!file || !file.name || !(file.path || file.stream || file.buffer)) { + throw new Error("cannot read as File: " + JSON.stringify(file)); + } + if (0 !== self.readyState) { + console.log("already loading, request to change format ignored"); + return; + } + + // 'process.nextTick' does not ensure order, (i.e. an fs.stat queued later may return faster) + // but `onloadstart` must come before the first `data` event and must be asynchronous. + // Hence we waste a single tick waiting + process.nextTick(function () { + self.readyState = self.LOADING; + emitter.emit('loadstart'); + createFileStream(); + mapStreamToEmitter(format, encoding); + mapUserEvents(); + }); + } + + self.readAsArrayBuffer = function (file) { + readFile(file, 'buffer'); + }; + self.readAsBinaryString = function (file) { + readFile(file, 'binary'); + }; + self.readAsDataURL = function (file) { + readFile(file, 'dataUrl'); + }; + self.readAsText = function (file, encoding) { + readFile(file, 'text', encoding); + }; + } + + module.exports = FileReader; +}()); diff --git a/helloworld/node_modules/FileReader/package.json b/helloworld/node_modules/FileReader/package.json new file mode 100755 index 0000000..d6657a9 --- /dev/null +++ b/helloworld/node_modules/FileReader/package.json @@ -0,0 +1,48 @@ +{ + "_from": "FileReader", + "_id": "FileReader@0.10.2", + "_inBundle": false, + "_integrity": "sha1-GxF722te2F4kGsPLEPG3CGUk5Tk=", + "_location": "/FileReader", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "FileReader", + "name": "FileReader", + "escapedName": "FileReader", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/FileReader/-/FileReader-0.10.2.tgz", + "_shasum": "1b117bdb6b5ed85e241ac3cb10f1b7086524e539", + "_spec": "FileReader", + "_where": "/Users/chhekur/Desktop/nodejs-mobile-samples-master/android/native-gradle/app/src/main/assets/myapp", + "author": { + "name": "AJ ONeal", + "email": "coolaj86@gmail.com" + }, + "bundleDependencies": false, + "contributors": [], + "dependencies": {}, + "deprecated": false, + "description": "HTML5 FileAPI `FileReader` for Node.JS.", + "engines": { + "node": "*" + }, + "keywords": [ + "html5", + "jsdom", + "file-api", + "FileReader" + ], + "main": "FileReader.js", + "name": "FileReader", + "url": "http://github.com/coolaj86/node-file-api/", + "version": "0.10.2" +} diff --git a/helloworld/node_modules/accepts/HISTORY.md b/helloworld/node_modules/accepts/HISTORY.md new file mode 100755 index 0000000..f16c17a --- /dev/null +++ b/helloworld/node_modules/accepts/HISTORY.md @@ -0,0 +1,224 @@ +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/helloworld/node_modules/accepts/LICENSE b/helloworld/node_modules/accepts/LICENSE new file mode 100755 index 0000000..0616607 --- /dev/null +++ b/helloworld/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/accepts/README.md b/helloworld/node_modules/accepts/README.md new file mode 100755 index 0000000..6a2749a --- /dev/null +++ b/helloworld/node_modules/accepts/README.md @@ -0,0 +1,143 @@ +# accepts + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + + + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/accepts.svg +[npm-url]: https://npmjs.org/package/accepts +[node-version-image]: https://img.shields.io/node/v/accepts.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/accepts/master.svg +[travis-url]: https://travis-ci.org/jshttp/accepts +[coveralls-image]: https://img.shields.io/coveralls/jshttp/accepts/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/accepts +[downloads-image]: https://img.shields.io/npm/dm/accepts.svg +[downloads-url]: https://npmjs.org/package/accepts diff --git a/helloworld/node_modules/accepts/index.js b/helloworld/node_modules/accepts/index.js new file mode 100755 index 0000000..e9b2f63 --- /dev/null +++ b/helloworld/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/helloworld/node_modules/after/LICENCE b/helloworld/node_modules/after/LICENCE new file mode 100755 index 0000000..7c35130 --- /dev/null +++ b/helloworld/node_modules/after/LICENCE @@ -0,0 +1,19 @@ +Copyright (c) 2011 Raynos. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/helloworld/node_modules/after/README.md b/helloworld/node_modules/after/README.md new file mode 100755 index 0000000..fc69096 --- /dev/null +++ b/helloworld/node_modules/after/README.md @@ -0,0 +1,115 @@ +# After [![Build Status][1]][2] + +Invoke callback after n calls + +## Status: production ready + +## Example + +```js +var after = require("after") +var db = require("./db") // some db. + +var updateUser = function (req, res) { + // use after to run two tasks in parallel, + // namely get request body and get session + // then run updateUser with the results + var next = after(2, updateUser) + var results = {} + + getJSONBody(req, res, function (err, body) { + if (err) return next(err) + + results.body = body + next(null, results) + }) + + getSessionUser(req, res, function (err, user) { + if (err) return next(err) + + results.user = user + next(null, results) + }) + + // now do the thing! + function updateUser(err, result) { + if (err) { + res.statusCode = 500 + return res.end("Unexpected Error") + } + + if (!result.user || result.user.role !== "admin") { + res.statusCode = 403 + return res.end("Permission Denied") + } + + db.put("users:" + req.params.userId, result.body, function (err) { + if (err) { + res.statusCode = 500 + return res.end("Unexpected Error") + } + + res.statusCode = 200 + res.end("Ok") + }) + } +} +``` + +## Naive Example + +```js +var after = require("after") + , next = after(3, logItWorks) + +next() +next() +next() // it works + +function logItWorks() { + console.log("it works!") +} +``` + +## Example with error handling + +```js +var after = require("after") + , next = after(3, logError) + +next() +next(new Error("oops")) // logs oops +next() // does nothing + +// This callback is only called once. +// If there is an error the callback gets called immediately +// this avoids the situation where errors get lost. +function logError(err) { + console.log(err) +} +``` + +## Installation + +`npm install after` + +## Tests + +`npm test` + +## Contributors + + - Raynos + - defunctzombie + +## MIT Licenced + + [1]: https://secure.travis-ci.org/Raynos/after.png + [2]: http://travis-ci.org/Raynos/after + [3]: http://raynos.org/blog/2/Flow-control-in-node.js + [4]: http://stackoverflow.com/questions/6852059/determining-the-end-of-asynchronous-operations-javascript/6852307#6852307 + [5]: http://stackoverflow.com/questions/6869872/in-javascript-what-are-best-practices-for-executing-multiple-asynchronous-functi/6870031#6870031 + [6]: http://stackoverflow.com/questions/6864397/javascript-performance-long-running-tasks/6889419#6889419 + [7]: http://stackoverflow.com/questions/6597493/synchronous-database-queries-with-node-js/6620091#6620091 + [8]: http://github.com/Raynos/iterators + [9]: http://github.com/Raynos/composite diff --git a/helloworld/node_modules/after/index.js b/helloworld/node_modules/after/index.js new file mode 100755 index 0000000..ec24879 --- /dev/null +++ b/helloworld/node_modules/after/index.js @@ -0,0 +1,28 @@ +module.exports = after + +function after(count, callback, err_cb) { + var bail = false + err_cb = err_cb || noop + proxy.count = count + + return (count === 0) ? callback() : proxy + + function proxy(err, result) { + if (proxy.count <= 0) { + throw new Error('after called too many times') + } + --proxy.count + + // after first error, rest are passed to err_cb + if (err) { + bail = true + callback(err) + // future error callbacks will go to error handler + callback = err_cb + } else if (proxy.count === 0 && !bail) { + callback(null, result) + } + } +} + +function noop() {} diff --git a/helloworld/node_modules/after/package.json b/helloworld/node_modules/after/package.json new file mode 100755 index 0000000..6d423f0 --- /dev/null +++ b/helloworld/node_modules/after/package.json @@ -0,0 +1,63 @@ +{ + "_from": "after@0.8.2", + "_id": "after@0.8.2", + "_inBundle": false, + "_integrity": "sha1-/ts5T58OAqqXaOcCvaI7UF+ufh8=", + "_location": "/after", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "after@0.8.2", + "name": "after", + "escapedName": "after", + "rawSpec": "0.8.2", + "saveSpec": null, + "fetchSpec": "0.8.2" + }, + "_requiredBy": [ + "/engine.io-parser" + ], + "_resolved": "https://registry.npmjs.org/after/-/after-0.8.2.tgz", + "_shasum": "fedb394f9f0e02aa9768e702bda23b505fae7e1f", + "_spec": "after@0.8.2", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/engine.io-parser", + "author": { + "name": "Raynos", + "email": "raynos2@gmail.com" + }, + "bugs": { + "url": "https://github.com/Raynos/after/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Raynos", + "email": "raynos2@gmail.com", + "url": "http://raynos.org" + } + ], + "deprecated": false, + "description": "after - tiny flow control", + "devDependencies": { + "mocha": "~1.8.1" + }, + "homepage": "https://github.com/Raynos/after#readme", + "keywords": [ + "flowcontrol", + "after", + "flow", + "control", + "arch" + ], + "license": "MIT", + "name": "after", + "repository": { + "type": "git", + "url": "git://github.com/Raynos/after.git" + }, + "scripts": { + "test": "mocha --ui tdd --reporter spec test/*.js" + }, + "version": "0.8.2" +} diff --git a/helloworld/node_modules/after/test/after-test.js b/helloworld/node_modules/after/test/after-test.js new file mode 100755 index 0000000..0d63f4c --- /dev/null +++ b/helloworld/node_modules/after/test/after-test.js @@ -0,0 +1,120 @@ +/*global suite, test*/ + +var assert = require("assert") + , after = require("../") + +test("exists", function () { + assert(typeof after === "function", "after is not a function") +}) + +test("after when called with 0 invokes", function (done) { + after(0, done) +}); + +test("after 1", function (done) { + var next = after(1, done) + next() +}) + +test("after 5", function (done) { + var next = after(5, done) + , i = 5 + + while (i--) { + next() + } +}) + +test("manipulate count", function (done) { + var next = after(1, done) + , i = 5 + + next.count = i + while (i--) { + next() + } +}) + +test("after terminates on error", function (done) { + var next = after(2, function(err) { + assert.equal(err.message, 'test'); + done(); + }) + next(new Error('test')) + next(new Error('test2')) +}) + +test('gee', function(done) { + done = after(2, done) + + function cb(err) { + assert.equal(err.message, 1); + done() + } + + var next = after(3, cb, function(err) { + assert.equal(err.message, 2) + done() + }); + + next() + next(new Error(1)) + next(new Error(2)) +}) + +test('eee', function(done) { + done = after(3, done) + + function cb(err) { + assert.equal(err.message, 1); + done() + } + + var next = after(3, cb, function(err) { + assert.equal(err.message, 2) + done() + }); + + next(new Error(1)) + next(new Error(2)) + next(new Error(2)) +}) + +test('gge', function(done) { + function cb(err) { + assert.equal(err.message, 1); + done() + } + + var next = after(3, cb, function(err) { + // should not happen + assert.ok(false); + }); + + next() + next() + next(new Error(1)) +}) + +test('egg', function(done) { + function cb(err) { + assert.equal(err.message, 1); + done() + } + + var next = after(3, cb, function(err) { + // should not happen + assert.ok(false); + }); + + next(new Error(1)) + next() + next() +}) + +test('throws on too many calls', function(done) { + var next = after(1, done); + next() + assert.throws(next, /after called too many times/); +}); + diff --git a/helloworld/node_modules/androidjs/LICENSE b/helloworld/node_modules/androidjs/LICENSE new file mode 100755 index 0000000..775c4c1 --- /dev/null +++ b/helloworld/node_modules/androidjs/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2019 androidjs + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/helloworld/node_modules/androidjs/example/index.html b/helloworld/node_modules/androidjs/example/index.html new file mode 100755 index 0000000..56dd986 --- /dev/null +++ b/helloworld/node_modules/androidjs/example/index.html @@ -0,0 +1,24 @@ + + + + + + + + \ No newline at end of file diff --git a/helloworld/node_modules/androidjs/example/test.js b/helloworld/node_modules/androidjs/example/test.js new file mode 100755 index 0000000..7e19c78 --- /dev/null +++ b/helloworld/node_modules/androidjs/example/test.js @@ -0,0 +1,30 @@ +var back = require('../lib/back.js').back; +// var app = require('./index.js').app; +// console.log(back); + + + +back.on('hello', function(event){ + console.log('hello'); +}) + +back.on('show-details', function(data){ + console.log(data); +}) +// back.send('hello'); +back.on('get', function(data){ + return 'hello get'; +}) + +back.on('get-data', function(data){ + console.log(data); + data.age = 15; + return data; +}) +// console.log(app.getPath()); +setInterval(function(){ + back.send('hello', 'harry'); +}, 5000); +// while(true){ +// back.send('hello', 'harry'); +// } \ No newline at end of file diff --git a/helloworld/node_modules/androidjs/index.js b/helloworld/node_modules/androidjs/index.js new file mode 100755 index 0000000..1761e0a --- /dev/null +++ b/helloworld/node_modules/androidjs/index.js @@ -0,0 +1,2 @@ +module.exports.back = require('./lib/back.js').back +module.exports.io = require('./lib/back.js').io \ No newline at end of file diff --git a/helloworld/node_modules/androidjs/lib/back.js b/helloworld/node_modules/androidjs/lib/back.js new file mode 100755 index 0000000..b7b808e --- /dev/null +++ b/helloworld/node_modules/androidjs/lib/back.js @@ -0,0 +1,79 @@ +const path = require("path"); +const http = require('http').createServer() +const io = require("socket.io")(http); + +http.listen(3000); + +var clients = [] + +listerners = {}; + io.on('connection', function (socket) { + // console.log('user connected'); + clients.push(socket); + socket.on('response-from-front', function (event, ...args) { + // console.log('get response from front'); + let fns = listerners[event]; + if (!fns) return false; + fns.forEach(function (f) { + f(...args); + }); + return true; + }); + socket.on('sync-response-from-front', function(event, ...args){ + // console.log('sync get response from front'); + let fns = listerners[event]; + if (!fns) return false; + fns.forEach(function (f) { + var response = f(...args); + // console.log(response) + socket.emit('sync-response', event ,response); + }); + return true; + }) + }); +module.exports.back = { + listerners:listerners, on:on, send:send +} + +module.exports.io = io; + +function addListener(event, fn) { + listerners[event] = listerners[event] || []; + listerners[event].push(fn); +} + +function on(event, fn){ + addListener(event, fn); +} + +function exeFunction(evemt, ...args){ + let fns = listeners[eventName]; + if (!fns) return false; + fns.forEach(function (f) { + f(...args); + }); + return true; +} + + +function send(event, ...args){ + // console.log('called send'); + for(let i = 0; i < clients.length; i++){ + // console.log('send Client'); + clients[i].emit('response-from-back', event, ...args) + } +} + + +io.on('connection', function (socket) { + // console.log('user connected'); + front = socket; + socket.on('reponse-from-front', function (event, ...args) { + let fns = listeners[eventName]; + if (!fns) return false; + fns.forEach(function (f) { + f(...args); + }); + return true; + }); + }); \ No newline at end of file diff --git a/helloworld/node_modules/androidjs/lib/front.js b/helloworld/node_modules/androidjs/lib/front.js new file mode 100755 index 0000000..a88c158 --- /dev/null +++ b/helloworld/node_modules/androidjs/lib/front.js @@ -0,0 +1,61 @@ + +/*! + * Socket.IO v2.2.0 + * (c) 2014-2018 Guillermo Rauch + * Released under the MIT License. + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.io=e():t.io=e()}(this,function(){return function(t){function e(r){if(n[r])return n[r].exports;var o=n[r]={exports:{},id:r,loaded:!1};return t[r].call(o.exports,o,o.exports,e),o.loaded=!0,o.exports}var n={};return e.m=t,e.c=n,e.p="",e(0)}([function(t,e,n){"use strict";function r(t,e){"object"===("undefined"==typeof t?"undefined":o(t))&&(e=t,t=void 0),e=e||{};var n,r=i(t),s=r.source,u=r.id,h=r.path,f=p[u]&&h in p[u].nsps,l=e.forceNew||e["force new connection"]||!1===e.multiplex||f;return l?(c("ignoring socket cache for %s",s),n=a(s,e)):(p[u]||(c("new io instance for %s",s),p[u]=a(s,e)),n=p[u]),r.query&&!e.query&&(e.query=r.query),n.socket(r.path,e)}var o="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t},i=n(1),s=n(7),a=n(12),c=n(3)("socket.io-client");t.exports=e=r;var p=e.managers={};e.protocol=s.protocol,e.connect=r,e.Manager=n(12),e.Socket=n(36)},function(t,e,n){"use strict";function r(t,e){var n=t;e=e||"undefined"!=typeof location&&location,null==t&&(t=e.protocol+"//"+e.host),"string"==typeof t&&("/"===t.charAt(0)&&(t="/"===t.charAt(1)?e.protocol+t:e.host+t),/^(https?|wss?):\/\//.test(t)||(i("protocol-less url %s",t),t="undefined"!=typeof e?e.protocol+"//"+t:"https://"+t),i("parse %s",t),n=o(t)),n.port||(/^(http|ws)$/.test(n.protocol)?n.port="80":/^(http|ws)s$/.test(n.protocol)&&(n.port="443")),n.path=n.path||"/";var r=n.host.indexOf(":")!==-1,s=r?"["+n.host+"]":n.host;return n.id=n.protocol+"://"+s+":"+n.port,n.href=n.protocol+"://"+s+(e&&e.port===n.port?"":":"+n.port),n}var o=n(2),i=n(3)("socket.io-client:url");t.exports=r},function(t,e){var n=/^(?:(?![^:@]+:[^:@\/]*@)(http|https|ws|wss):\/\/)?((?:(([^:@]*)(?::([^:@]*))?)?@)?((?:[a-f0-9]{0,4}:){2,7}[a-f0-9]{0,4}|[^:\/?#]*)(?::(\d*))?)(((\/(?:[^?#](?![^?#\/]*\.[^?#\/.]+(?:[?#]|$)))*\/?)?([^?#\/]*))(?:\?([^#]*))?(?:#(.*))?)/,r=["source","protocol","authority","userInfo","user","password","host","port","relative","path","directory","file","query","anchor"];t.exports=function(t){var e=t,o=t.indexOf("["),i=t.indexOf("]");o!=-1&&i!=-1&&(t=t.substring(0,o)+t.substring(o,i).replace(/:/g,";")+t.substring(i,t.length));for(var s=n.exec(t||""),a={},c=14;c--;)a[r[c]]=s[c]||"";return o!=-1&&i!=-1&&(a.source=e,a.host=a.host.substring(1,a.host.length-1).replace(/;/g,":"),a.authority=a.authority.replace("[","").replace("]","").replace(/;/g,":"),a.ipv6uri=!0),a}},function(t,e,n){(function(r){function o(){return!("undefined"==typeof window||!window.process||"renderer"!==window.process.type)||("undefined"==typeof navigator||!navigator.userAgent||!navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/))&&("undefined"!=typeof document&&document.documentElement&&document.documentElement.style&&document.documentElement.style.WebkitAppearance||"undefined"!=typeof window&&window.console&&(window.console.firebug||window.console.exception&&window.console.table)||"undefined"!=typeof navigator&&navigator.userAgent&&navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)&&parseInt(RegExp.$1,10)>=31||"undefined"!=typeof navigator&&navigator.userAgent&&navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/))}function i(t){var n=this.useColors;if(t[0]=(n?"%c":"")+this.namespace+(n?" %c":" ")+t[0]+(n?"%c ":" ")+"+"+e.humanize(this.diff),n){var r="color: "+this.color;t.splice(1,0,r,"color: inherit");var o=0,i=0;t[0].replace(/%[a-zA-Z%]/g,function(t){"%%"!==t&&(o++,"%c"===t&&(i=o))}),t.splice(i,0,r)}}function s(){return"object"==typeof console&&console.log&&Function.prototype.apply.call(console.log,console,arguments)}function a(t){try{null==t?e.storage.removeItem("debug"):e.storage.debug=t}catch(n){}}function c(){var t;try{t=e.storage.debug}catch(n){}return!t&&"undefined"!=typeof r&&"env"in r&&(t=r.env.DEBUG),t}function p(){try{return window.localStorage}catch(t){}}e=t.exports=n(5),e.log=s,e.formatArgs=i,e.save=a,e.load=c,e.useColors=o,e.storage="undefined"!=typeof chrome&&"undefined"!=typeof chrome.storage?chrome.storage.local:p(),e.colors=["#0000CC","#0000FF","#0033CC","#0033FF","#0066CC","#0066FF","#0099CC","#0099FF","#00CC00","#00CC33","#00CC66","#00CC99","#00CCCC","#00CCFF","#3300CC","#3300FF","#3333CC","#3333FF","#3366CC","#3366FF","#3399CC","#3399FF","#33CC00","#33CC33","#33CC66","#33CC99","#33CCCC","#33CCFF","#6600CC","#6600FF","#6633CC","#6633FF","#66CC00","#66CC33","#9900CC","#9900FF","#9933CC","#9933FF","#99CC00","#99CC33","#CC0000","#CC0033","#CC0066","#CC0099","#CC00CC","#CC00FF","#CC3300","#CC3333","#CC3366","#CC3399","#CC33CC","#CC33FF","#CC6600","#CC6633","#CC9900","#CC9933","#CCCC00","#CCCC33","#FF0000","#FF0033","#FF0066","#FF0099","#FF00CC","#FF00FF","#FF3300","#FF3333","#FF3366","#FF3399","#FF33CC","#FF33FF","#FF6600","#FF6633","#FF9900","#FF9933","#FFCC00","#FFCC33"],e.formatters.j=function(t){try{return JSON.stringify(t)}catch(e){return"[UnexpectedJSONParseError]: "+e.message}},e.enable(c())}).call(e,n(4))},function(t,e){function n(){throw new Error("setTimeout has not been defined")}function r(){throw new Error("clearTimeout has not been defined")}function o(t){if(u===setTimeout)return setTimeout(t,0);if((u===n||!u)&&setTimeout)return u=setTimeout,setTimeout(t,0);try{return u(t,0)}catch(e){try{return u.call(null,t,0)}catch(e){return u.call(this,t,0)}}}function i(t){if(h===clearTimeout)return clearTimeout(t);if((h===r||!h)&&clearTimeout)return h=clearTimeout,clearTimeout(t);try{return h(t)}catch(e){try{return h.call(null,t)}catch(e){return h.call(this,t)}}}function s(){y&&l&&(y=!1,l.length?d=l.concat(d):m=-1,d.length&&a())}function a(){if(!y){var t=o(s);y=!0;for(var e=d.length;e;){for(l=d,d=[];++m1)for(var n=1;n100)){var e=/^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(t);if(e){var n=parseFloat(e[1]),r=(e[2]||"ms").toLowerCase();switch(r){case"years":case"year":case"yrs":case"yr":case"y":return n*u;case"days":case"day":case"d":return n*p;case"hours":case"hour":case"hrs":case"hr":case"h":return n*c;case"minutes":case"minute":case"mins":case"min":case"m":return n*a;case"seconds":case"second":case"secs":case"sec":case"s":return n*s;case"milliseconds":case"millisecond":case"msecs":case"msec":case"ms":return n;default:return}}}}function r(t){return t>=p?Math.round(t/p)+"d":t>=c?Math.round(t/c)+"h":t>=a?Math.round(t/a)+"m":t>=s?Math.round(t/s)+"s":t+"ms"}function o(t){return i(t,p,"day")||i(t,c,"hour")||i(t,a,"minute")||i(t,s,"second")||t+" ms"}function i(t,e,n){if(!(t0)return n(t);if("number"===i&&isNaN(t)===!1)return e["long"]?o(t):r(t);throw new Error("val is not a non-empty string or a valid number. val="+JSON.stringify(t))}},function(t,e,n){function r(){}function o(t){var n=""+t.type;if(e.BINARY_EVENT!==t.type&&e.BINARY_ACK!==t.type||(n+=t.attachments+"-"),t.nsp&&"/"!==t.nsp&&(n+=t.nsp+","),null!=t.id&&(n+=t.id),null!=t.data){var r=i(t.data);if(r===!1)return g;n+=r}return f("encoded %j as %s",t,n),n}function i(t){try{return JSON.stringify(t)}catch(e){return!1}}function s(t,e){function n(t){var n=d.deconstructPacket(t),r=o(n.packet),i=n.buffers;i.unshift(r),e(i)}d.removeBlobs(t,n)}function a(){this.reconstructor=null}function c(t){var n=0,r={type:Number(t.charAt(0))};if(null==e.types[r.type])return h("unknown packet type "+r.type);if(e.BINARY_EVENT===r.type||e.BINARY_ACK===r.type){for(var o="";"-"!==t.charAt(++n)&&(o+=t.charAt(n),n!=t.length););if(o!=Number(o)||"-"!==t.charAt(n))throw new Error("Illegal attachments");r.attachments=Number(o)}if("/"===t.charAt(n+1))for(r.nsp="";++n;){var i=t.charAt(n);if(","===i)break;if(r.nsp+=i,n===t.length)break}else r.nsp="/";var s=t.charAt(n+1);if(""!==s&&Number(s)==s){for(r.id="";++n;){var i=t.charAt(n);if(null==i||Number(i)!=i){--n;break}if(r.id+=t.charAt(n),n===t.length)break}r.id=Number(r.id)}if(t.charAt(++n)){var a=p(t.substr(n)),c=a!==!1&&(r.type===e.ERROR||y(a));if(!c)return h("invalid payload");r.data=a}return f("decoded %s as %j",t,r),r}function p(t){try{return JSON.parse(t)}catch(e){return!1}}function u(t){this.reconPack=t,this.buffers=[]}function h(t){return{type:e.ERROR,data:"parser error: "+t}}var f=n(3)("socket.io-parser"),l=n(8),d=n(9),y=n(10),m=n(11);e.protocol=4,e.types=["CONNECT","DISCONNECT","EVENT","ACK","ERROR","BINARY_EVENT","BINARY_ACK"],e.CONNECT=0,e.DISCONNECT=1,e.EVENT=2,e.ACK=3,e.ERROR=4,e.BINARY_EVENT=5,e.BINARY_ACK=6,e.Encoder=r,e.Decoder=a;var g=e.ERROR+'"encode error"';r.prototype.encode=function(t,n){if(f("encoding packet %j",t),e.BINARY_EVENT===t.type||e.BINARY_ACK===t.type)s(t,n);else{var r=o(t);n([r])}},l(a.prototype),a.prototype.add=function(t){var n;if("string"==typeof t)n=c(t),e.BINARY_EVENT===n.type||e.BINARY_ACK===n.type?(this.reconstructor=new u(n),0===this.reconstructor.reconPack.attachments&&this.emit("decoded",n)):this.emit("decoded",n);else{if(!m(t)&&!t.base64)throw new Error("Unknown type: "+t);if(!this.reconstructor)throw new Error("got binary data when not reconstructing a packet");n=this.reconstructor.takeBinaryData(t),n&&(this.reconstructor=null,this.emit("decoded",n))}},a.prototype.destroy=function(){this.reconstructor&&this.reconstructor.finishedReconstruction()},u.prototype.takeBinaryData=function(t){if(this.buffers.push(t),this.buffers.length===this.reconPack.attachments){var e=d.reconstructPacket(this.reconPack,this.buffers);return this.finishedReconstruction(),e}return null},u.prototype.finishedReconstruction=function(){this.reconPack=null,this.buffers=[]}},function(t,e,n){function r(t){if(t)return o(t)}function o(t){for(var e in r.prototype)t[e]=r.prototype[e];return t}t.exports=r,r.prototype.on=r.prototype.addEventListener=function(t,e){return this._callbacks=this._callbacks||{},(this._callbacks["$"+t]=this._callbacks["$"+t]||[]).push(e),this},r.prototype.once=function(t,e){function n(){this.off(t,n),e.apply(this,arguments)}return n.fn=e,this.on(t,n),this},r.prototype.off=r.prototype.removeListener=r.prototype.removeAllListeners=r.prototype.removeEventListener=function(t,e){if(this._callbacks=this._callbacks||{},0==arguments.length)return this._callbacks={},this;var n=this._callbacks["$"+t];if(!n)return this;if(1==arguments.length)return delete this._callbacks["$"+t],this;for(var r,o=0;o0&&!this.encoding){var t=this.packetBuffer.shift();this.packet(t)}},r.prototype.cleanup=function(){h("cleanup");for(var t=this.subs.length,e=0;e=this._reconnectionAttempts)h("reconnect failed"),this.backoff.reset(),this.emitAll("reconnect_failed"),this.reconnecting=!1;else{var e=this.backoff.duration();h("will wait %dms before reconnect attempt",e),this.reconnecting=!0;var n=setTimeout(function(){t.skipReconnect||(h("attempting reconnect"),t.emitAll("reconnect_attempt",t.backoff.attempts),t.emitAll("reconnecting",t.backoff.attempts),t.skipReconnect||t.open(function(e){e?(h("reconnect attempt error"),t.reconnecting=!1,t.reconnect(),t.emitAll("reconnect_error",e.data)):(h("reconnect success"),t.onreconnect())}))},e);this.subs.push({destroy:function(){clearTimeout(n)}})}},r.prototype.onreconnect=function(){var t=this.backoff.attempts;this.reconnecting=!1,this.backoff.reset(),this.updateSocketIds(),this.emitAll("reconnect",t)}},function(t,e,n){t.exports=n(14),t.exports.parser=n(21)},function(t,e,n){function r(t,e){return this instanceof r?(e=e||{},t&&"object"==typeof t&&(e=t,t=null),t?(t=u(t),e.hostname=t.host,e.secure="https"===t.protocol||"wss"===t.protocol,e.port=t.port,t.query&&(e.query=t.query)):e.host&&(e.hostname=u(e.host).host),this.secure=null!=e.secure?e.secure:"undefined"!=typeof location&&"https:"===location.protocol,e.hostname&&!e.port&&(e.port=this.secure?"443":"80"),this.agent=e.agent||!1,this.hostname=e.hostname||("undefined"!=typeof location?location.hostname:"localhost"),this.port=e.port||("undefined"!=typeof location&&location.port?location.port:this.secure?443:80),this.query=e.query||{},"string"==typeof this.query&&(this.query=h.decode(this.query)),this.upgrade=!1!==e.upgrade,this.path=(e.path||"/engine.io").replace(/\/$/,"")+"/",this.forceJSONP=!!e.forceJSONP,this.jsonp=!1!==e.jsonp,this.forceBase64=!!e.forceBase64,this.enablesXDR=!!e.enablesXDR,this.timestampParam=e.timestampParam||"t",this.timestampRequests=e.timestampRequests,this.transports=e.transports||["polling","websocket"],this.transportOptions=e.transportOptions||{},this.readyState="",this.writeBuffer=[],this.prevBufferLen=0,this.policyPort=e.policyPort||843,this.rememberUpgrade=e.rememberUpgrade||!1,this.binaryType=null,this.onlyBinaryUpgrades=e.onlyBinaryUpgrades,this.perMessageDeflate=!1!==e.perMessageDeflate&&(e.perMessageDeflate||{}),!0===this.perMessageDeflate&&(this.perMessageDeflate={}),this.perMessageDeflate&&null==this.perMessageDeflate.threshold&&(this.perMessageDeflate.threshold=1024),this.pfx=e.pfx||null,this.key=e.key||null,this.passphrase=e.passphrase||null,this.cert=e.cert||null,this.ca=e.ca||null,this.ciphers=e.ciphers||null,this.rejectUnauthorized=void 0===e.rejectUnauthorized||e.rejectUnauthorized,this.forceNode=!!e.forceNode,this.isReactNative="undefined"!=typeof navigator&&"string"==typeof navigator.product&&"reactnative"===navigator.product.toLowerCase(),("undefined"==typeof self||this.isReactNative)&&(e.extraHeaders&&Object.keys(e.extraHeaders).length>0&&(this.extraHeaders=e.extraHeaders),e.localAddress&&(this.localAddress=e.localAddress)),this.id=null,this.upgrades=null,this.pingInterval=null,this.pingTimeout=null,this.pingIntervalTimer=null,this.pingTimeoutTimer=null,void this.open()):new r(t,e)}function o(t){var e={};for(var n in t)t.hasOwnProperty(n)&&(e[n]=t[n]);return e}var i=n(15),s=n(8),a=n(3)("engine.io-client:socket"),c=n(35),p=n(21),u=n(2),h=n(29);t.exports=r,r.priorWebsocketSuccess=!1,s(r.prototype),r.protocol=p.protocol,r.Socket=r,r.Transport=n(20),r.transports=n(15),r.parser=n(21),r.prototype.createTransport=function(t){a('creating transport "%s"',t);var e=o(this.query);e.EIO=p.protocol,e.transport=t;var n=this.transportOptions[t]||{};this.id&&(e.sid=this.id);var r=new i[t]({query:e,socket:this,agent:n.agent||this.agent,hostname:n.hostname||this.hostname,port:n.port||this.port,secure:n.secure||this.secure,path:n.path||this.path,forceJSONP:n.forceJSONP||this.forceJSONP,jsonp:n.jsonp||this.jsonp,forceBase64:n.forceBase64||this.forceBase64,enablesXDR:n.enablesXDR||this.enablesXDR,timestampRequests:n.timestampRequests||this.timestampRequests,timestampParam:n.timestampParam||this.timestampParam,policyPort:n.policyPort||this.policyPort,pfx:n.pfx||this.pfx,key:n.key||this.key,passphrase:n.passphrase||this.passphrase,cert:n.cert||this.cert,ca:n.ca||this.ca,ciphers:n.ciphers||this.ciphers,rejectUnauthorized:n.rejectUnauthorized||this.rejectUnauthorized,perMessageDeflate:n.perMessageDeflate||this.perMessageDeflate,extraHeaders:n.extraHeaders||this.extraHeaders,forceNode:n.forceNode||this.forceNode,localAddress:n.localAddress||this.localAddress,requestTimeout:n.requestTimeout||this.requestTimeout,protocols:n.protocols||void 0,isReactNative:this.isReactNative});return r},r.prototype.open=function(){var t;if(this.rememberUpgrade&&r.priorWebsocketSuccess&&this.transports.indexOf("websocket")!==-1)t="websocket";else{if(0===this.transports.length){var e=this;return void setTimeout(function(){e.emit("error","No transports available")},0)}t=this.transports[0]}this.readyState="opening";try{t=this.createTransport(t)}catch(n){return this.transports.shift(),void this.open()}t.open(),this.setTransport(t)},r.prototype.setTransport=function(t){a("setting transport %s",t.name);var e=this;this.transport&&(a("clearing existing transport %s",this.transport.name),this.transport.removeAllListeners()),this.transport=t,t.on("drain",function(){e.onDrain()}).on("packet",function(t){e.onPacket(t)}).on("error",function(t){e.onError(t)}).on("close",function(){e.onClose("transport close")})},r.prototype.probe=function(t){function e(){if(f.onlyBinaryUpgrades){var e=!this.supportsBinary&&f.transport.supportsBinary;h=h||e}h||(a('probe transport "%s" opened',t),u.send([{type:"ping",data:"probe"}]),u.once("packet",function(e){if(!h)if("pong"===e.type&&"probe"===e.data){if(a('probe transport "%s" pong',t),f.upgrading=!0,f.emit("upgrading",u),!u)return;r.priorWebsocketSuccess="websocket"===u.name,a('pausing current transport "%s"',f.transport.name),f.transport.pause(function(){h||"closed"!==f.readyState&&(a("changing transport and sending upgrade packet"),p(),f.setTransport(u),u.send([{type:"upgrade"}]),f.emit("upgrade",u),u=null,f.upgrading=!1,f.flush())})}else{a('probe transport "%s" failed',t);var n=new Error("probe error");n.transport=u.name,f.emit("upgradeError",n)}}))}function n(){h||(h=!0,p(),u.close(),u=null)}function o(e){var r=new Error("probe error: "+e);r.transport=u.name,n(),a('probe transport "%s" failed because of error: %s',t,e),f.emit("upgradeError",r)}function i(){o("transport closed")}function s(){o("socket closed")}function c(t){u&&t.name!==u.name&&(a('"%s" works - aborting "%s"',t.name,u.name),n())}function p(){u.removeListener("open",e),u.removeListener("error",o),u.removeListener("close",i),f.removeListener("close",s),f.removeListener("upgrading",c)}a('probing transport "%s"',t);var u=this.createTransport(t,{probe:1}),h=!1,f=this;r.priorWebsocketSuccess=!1,u.once("open",e),u.once("error",o),u.once("close",i),this.once("close",s),this.once("upgrading",c),u.open()},r.prototype.onOpen=function(){if(a("socket open"),this.readyState="open",r.priorWebsocketSuccess="websocket"===this.transport.name,this.emit("open"),this.flush(),"open"===this.readyState&&this.upgrade&&this.transport.pause){a("starting upgrade probes");for(var t=0,e=this.upgrades.length;t1?{type:b[o],data:t.substring(1)}:{type:b[o]}:w}var i=new Uint8Array(t),o=i[0],s=f(t,1);return k&&"blob"===n&&(s=new k([s])),{type:b[o],data:s}},e.decodeBase64Packet=function(t,e){var n=b[t.charAt(0)];if(!p)return{type:n,data:{base64:!0,data:t.substr(1)}};var r=p.decode(t.substr(1));return"blob"===e&&k&&(r=new k([r])),{type:n,data:r}},e.encodePayload=function(t,n,r){function o(t){return t.length+":"+t}function i(t,r){e.encodePacket(t,!!s&&n,!1,function(t){r(null,o(t))})}"function"==typeof n&&(r=n,n=null);var s=h(t);return n&&s?k&&!g?e.encodePayloadAsBlob(t,r):e.encodePayloadAsArrayBuffer(t,r):t.length?void c(t,i,function(t,e){return r(e.join(""))}):r("0:")},e.decodePayload=function(t,n,r){if("string"!=typeof t)return e.decodePayloadAsBinary(t,n,r);"function"==typeof n&&(r=n,n=null);var o;if(""===t)return r(w,0,1);for(var i,s,a="",c=0,p=t.length;c0;){for(var s=new Uint8Array(o),a=0===s[0],c="",p=1;255!==s[p];p++){if(c.length>310)return r(w,0,1);c+=s[p]}o=f(o,2+c.length),c=parseInt(c);var u=f(o,0,c);if(a)try{u=String.fromCharCode.apply(null,new Uint8Array(u))}catch(h){var l=new Uint8Array(u);u="";for(var p=0;pr&&(n=r),e>=r||e>=n||0===r)return new ArrayBuffer(0);for(var o=new Uint8Array(t),i=new Uint8Array(n-e),s=e,a=0;s=55296&&e<=56319&&o65535&&(e-=65536,o+=d(e>>>10&1023|55296),e=56320|1023&e),o+=d(e);return o}function o(t,e){if(t>=55296&&t<=57343){if(e)throw Error("Lone surrogate U+"+t.toString(16).toUpperCase()+" is not a scalar value");return!1}return!0}function i(t,e){return d(t>>e&63|128)}function s(t,e){if(0==(4294967168&t))return d(t);var n="";return 0==(4294965248&t)?n=d(t>>6&31|192):0==(4294901760&t)?(o(t,e)||(t=65533),n=d(t>>12&15|224),n+=i(t,6)):0==(4292870144&t)&&(n=d(t>>18&7|240),n+=i(t,12),n+=i(t,6)),n+=d(63&t|128)}function a(t,e){e=e||{};for(var r,o=!1!==e.strict,i=n(t),a=i.length,c=-1,p="";++c=f)throw Error("Invalid byte index");var t=255&h[l];if(l++,128==(192&t))return 63&t;throw Error("Invalid continuation byte")}function p(t){var e,n,r,i,s;if(l>f)throw Error("Invalid byte index");if(l==f)return!1;if(e=255&h[l],l++,0==(128&e))return e;if(192==(224&e)){if(n=c(),s=(31&e)<<6|n,s>=128)return s;throw Error("Invalid continuation byte")}if(224==(240&e)){if(n=c(),r=c(),s=(15&e)<<12|n<<6|r,s>=2048)return o(s,t)?s:65533;throw Error("Invalid continuation byte")}if(240==(248&e)&&(n=c(),r=c(),i=c(),s=(7&e)<<18|n<<12|r<<6|i,s>=65536&&s<=1114111))return s;throw Error("Invalid UTF-8 detected")}function u(t,e){e=e||{};var o=!1!==e.strict;h=n(t),f=h.length,l=0;for(var i,s=[];(i=p(o))!==!1;)s.push(i);return r(s)}/*! https://mths.be/utf8js v2.1.2 by @mathias */ +var h,f,l,d=String.fromCharCode;t.exports={version:"2.1.2",encode:a,decode:u}},function(t,e){!function(){"use strict";for(var t="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/",n=new Uint8Array(256),r=0;r>2],i+=t[(3&r[n])<<4|r[n+1]>>4],i+=t[(15&r[n+1])<<2|r[n+2]>>6],i+=t[63&r[n+2]];return o%3===2?i=i.substring(0,i.length-1)+"=":o%3===1&&(i=i.substring(0,i.length-2)+"=="),i},e.decode=function(t){var e,r,o,i,s,a=.75*t.length,c=t.length,p=0;"="===t[t.length-1]&&(a--,"="===t[t.length-2]&&a--);var u=new ArrayBuffer(a),h=new Uint8Array(u);for(e=0;e>4,h[p++]=(15&o)<<4|i>>2,h[p++]=(3&i)<<6|63&s;return u}}()},function(t,e){function n(t){return t.map(function(t){if(t.buffer instanceof ArrayBuffer){var e=t.buffer;if(t.byteLength!==e.byteLength){var n=new Uint8Array(t.byteLength);n.set(new Uint8Array(e,t.byteOffset,t.byteLength)),e=n.buffer}return e}return t})}function r(t,e){e=e||{};var r=new i;return n(t).forEach(function(t){r.append(t)}),e.type?r.getBlob(e.type):r.getBlob()}function o(t,e){return new Blob(n(t),e||{})}var i="undefined"!=typeof i?i:"undefined"!=typeof WebKitBlobBuilder?WebKitBlobBuilder:"undefined"!=typeof MSBlobBuilder?MSBlobBuilder:"undefined"!=typeof MozBlobBuilder&&MozBlobBuilder,s=function(){try{var t=new Blob(["hi"]);return 2===t.size}catch(e){return!1}}(),a=s&&function(){try{var t=new Blob([new Uint8Array([1,2])]);return 2===t.size}catch(e){return!1}}(),c=i&&i.prototype.append&&i.prototype.getBlob;"undefined"!=typeof Blob&&(r.prototype=Blob.prototype,o.prototype=Blob.prototype),t.exports=function(){return s?a?Blob:o:c?r:void 0}()},function(t,e){e.encode=function(t){var e="";for(var n in t)t.hasOwnProperty(n)&&(e.length&&(e+="&"),e+=encodeURIComponent(n)+"="+encodeURIComponent(t[n]));return e},e.decode=function(t){for(var e={},n=t.split("&"),r=0,o=n.length;r0);return e}function r(t){var e=0;for(u=0;u';i=document.createElement(e)}catch(t){i=document.createElement("iframe"),i.name=o.iframeId,i.src="javascript:0"}i.id=o.iframeId,o.form.appendChild(i),o.iframe=i}var o=this;if(!this.form){var i,s=document.createElement("form"),a=document.createElement("textarea"),c=this.iframeId="eio_iframe_"+this.index;s.className="socketio",s.style.position="absolute",s.style.top="-1000px",s.style.left="-1000px",s.target=c,s.method="POST",s.setAttribute("accept-charset","utf-8"),a.name="d",s.appendChild(a),document.body.appendChild(s),this.form=s,this.area=a}this.form.action=this.uri(),r(),t=t.replace(u,"\\\n"),this.area.value=t.replace(p,"\\n");try{this.form.submit()}catch(h){}this.iframe.attachEvent?this.iframe.onreadystatechange=function(){"complete"===o.iframe.readyState&&n()}:this.iframe.onload=n}}).call(e,function(){return this}())},function(t,e,n){function r(t){var e=t&&t.forceBase64;e&&(this.supportsBinary=!1),this.perMessageDeflate=t.perMessageDeflate,this.usingBrowserWebSocket=o&&!t.forceNode,this.protocols=t.protocols,this.usingBrowserWebSocket||(l=i),s.call(this,t)}var o,i,s=n(20),a=n(21),c=n(29),p=n(30),u=n(31),h=n(3)("engine.io-client:websocket");if("undefined"==typeof self)try{i=n(34)}catch(f){}else o=self.WebSocket||self.MozWebSocket;var l=o||i;t.exports=r,p(r,s),r.prototype.name="websocket",r.prototype.supportsBinary=!0,r.prototype.doOpen=function(){if(this.check()){var t=this.uri(),e=this.protocols,n={agent:this.agent,perMessageDeflate:this.perMessageDeflate};n.pfx=this.pfx,n.key=this.key,n.passphrase=this.passphrase,n.cert=this.cert,n.ca=this.ca,n.ciphers=this.ciphers,n.rejectUnauthorized=this.rejectUnauthorized,this.extraHeaders&&(n.headers=this.extraHeaders),this.localAddress&&(n.localAddress=this.localAddress);try{this.ws=this.usingBrowserWebSocket&&!this.isReactNative?e?new l(t,e):new l(t):new l(t,e,n)}catch(r){return this.emit("error",r)}void 0===this.ws.binaryType&&(this.supportsBinary=!1),this.ws.supports&&this.ws.supports.binary?(this.supportsBinary=!0,this.ws.binaryType="nodebuffer"):this.ws.binaryType="arraybuffer",this.addEventListeners()}},r.prototype.addEventListeners=function(){var t=this;this.ws.onopen=function(){t.onOpen()},this.ws.onclose=function(){t.onClose()},this.ws.onmessage=function(e){t.onData(e.data)},this.ws.onerror=function(e){t.onError("websocket error",e)}},r.prototype.write=function(t){function e(){n.emit("flush"),setTimeout(function(){n.writable=!0,n.emit("drain")},0)}var n=this;this.writable=!1;for(var r=t.length,o=0,i=r;o0&&t.jitter<=1?t.jitter:0,this.attempts=0}t.exports=n,n.prototype.duration=function(){var t=this.ms*Math.pow(this.factor,this.attempts++);if(this.jitter){var e=Math.random(),n=Math.floor(e*this.jitter*t);t=0==(1&Math.floor(10*e))?t-n:t+n}return 0|Math.min(t,this.max)},n.prototype.reset=function(){this.attempts=0},n.prototype.setMin=function(t){this.ms=t},n.prototype.setMax=function(t){this.max=t},n.prototype.setJitter=function(t){this.jitter=t}}])}); +//# sourceMappingURL=socket.io.js.map + + +// document.write(''); + + +var socket = io('http://localhost:3000'); +listeners = {} +var front = { + send:send, + on:on, + sendSync:sendSync +} + +function addListener(event, fn) { + listeners[event] = listeners[event] || []; + listeners[event].push(fn); +} + +function on(event, fn){ + addListener(event, fn); +} + +function exeFunction(event, ...args){ + let fns = listeners[event]; + if (!fns) return false; + fns.forEach(function (f) { + f(...args); + }); + return true; +} + + +function send(event, ...args){ + // console.log('called send'); + socket.emit('response-from-front', event, ...args) +} + +socket.on('response-from-back', function(event, ...args){ + // console.log('reposen sync') + exeFunction(event, ...args); +}) + +socket.on('sync-response', function(eventName, res){ + // console.log('sync-reponse') + // console.log(eventName); + exeFunction(eventName + "-result", res); +}) + +function sendSync(event, ...args){ + socket.emit('sync-response-from-front', event, ...args); +} diff --git a/helloworld/node_modules/androidjs/package.json b/helloworld/node_modules/androidjs/package.json new file mode 100755 index 0000000..6e5255b --- /dev/null +++ b/helloworld/node_modules/androidjs/package.json @@ -0,0 +1,40 @@ +{ + "_from": "androidjs@latest", + "_id": "androidjs@1.0.1", + "_inBundle": false, + "_integrity": "sha512-ZpLT9hWZEQZbFKKRWbj3MFkbNVuXEKvPXMkY1OqLO9vDoFvKXzs6vkK5i4aW3ulEWTPHZ/DpoAP3OCnzODd9kQ==", + "_location": "/androidjs", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "androidjs@latest", + "name": "androidjs", + "escapedName": "androidjs", + "rawSpec": "latest", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/androidjs/-/androidjs-1.0.1.tgz", + "_shasum": "51aa958c005361f70036788ce68a9137383dbfe1", + "_spec": "androidjs@latest", + "_where": "/Users/chhekur/Desktop/nodejs-mobile-samples-master/android/native-gradle/app/src/main/assets/myapp", + "author": "", + "bundleDependencies": false, + "dependencies": { + "socket.io": "^2.2.0" + }, + "deprecated": false, + "description": "", + "license": "MIT", + "main": "index.js", + "name": "androidjs", + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "version": "1.0.1" +} diff --git a/helloworld/node_modules/ansi-regex/index.js b/helloworld/node_modules/ansi-regex/index.js new file mode 100755 index 0000000..b9574ed --- /dev/null +++ b/helloworld/node_modules/ansi-regex/index.js @@ -0,0 +1,4 @@ +'use strict'; +module.exports = function () { + return /[\u001b\u009b][[()#;?]*(?:[0-9]{1,4}(?:;[0-9]{0,4})*)?[0-9A-PRZcf-nqry=><]/g; +}; diff --git a/helloworld/node_modules/ansi-regex/license b/helloworld/node_modules/ansi-regex/license new file mode 100755 index 0000000..654d0bf --- /dev/null +++ b/helloworld/node_modules/ansi-regex/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/ansi-regex/readme.md b/helloworld/node_modules/ansi-regex/readme.md new file mode 100755 index 0000000..6a928ed --- /dev/null +++ b/helloworld/node_modules/ansi-regex/readme.md @@ -0,0 +1,39 @@ +# ansi-regex [![Build Status](https://travis-ci.org/chalk/ansi-regex.svg?branch=master)](https://travis-ci.org/chalk/ansi-regex) + +> Regular expression for matching [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code) + + +## Install + +``` +$ npm install --save ansi-regex +``` + + +## Usage + +```js +const ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001b[4mcake\u001b[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001b[4mcake\u001b[0m'.match(ansiRegex()); +//=> ['\u001b[4m', '\u001b[0m'] +``` + +## FAQ + +### Why do you test for codes not in the ECMA 48 standard? + +Some of the codes we run as a test are codes that we acquired finding various lists of non-standard or manufacturer specific codes. If I recall correctly, we test for both standard and non-standard codes, as most of them follow the same or similar format and can be safely matched in strings without the risk of removing actual string content. There are a few non-standard control codes that do not follow the traditional format (i.e. they end in numbers) thus forcing us to exclude them from the test because we cannot reliably match them. + +On the historical side, those ECMA standards were established in the early 90's whereas the VT100, for example, was designed in the mid/late 70's. At that point in time, control codes were still pretty ungoverned and engineers used them for a multitude of things, namely to activate hardware ports that may have been proprietary. Somewhere else you see a similar 'anarchy' of codes is in the x86 architecture for processors; there are a ton of "interrupts" that can mean different things on certain brands of processors, most of which have been phased out. + + +## License + +MIT © [Sindre Sorhus](http://sindresorhus.com) diff --git a/helloworld/node_modules/arraybuffer.slice/LICENCE b/helloworld/node_modules/arraybuffer.slice/LICENCE new file mode 100755 index 0000000..35fa375 --- /dev/null +++ b/helloworld/node_modules/arraybuffer.slice/LICENCE @@ -0,0 +1,18 @@ +Copyright (C) 2013 Rase- + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/arraybuffer.slice/Makefile b/helloworld/node_modules/arraybuffer.slice/Makefile new file mode 100755 index 0000000..849887f --- /dev/null +++ b/helloworld/node_modules/arraybuffer.slice/Makefile @@ -0,0 +1,8 @@ + +REPORTER = dot + +test: + @./node_modules/.bin/mocha \ + --reporter $(REPORTER) + +.PHONY: test diff --git a/helloworld/node_modules/arraybuffer.slice/README.md b/helloworld/node_modules/arraybuffer.slice/README.md new file mode 100755 index 0000000..15e465e --- /dev/null +++ b/helloworld/node_modules/arraybuffer.slice/README.md @@ -0,0 +1,17 @@ +# How to +```javascript +var sliceBuffer = require('arraybuffer.slice'); +var ab = (new Int8Array(5)).buffer; +var sliced = sliceBuffer(ab, 1, 3); +sliced = sliceBuffer(ab, 1); +``` + +# Licence (MIT) +Copyright (C) 2013 Rase- + + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/arraybuffer.slice/index.js b/helloworld/node_modules/arraybuffer.slice/index.js new file mode 100755 index 0000000..11ac556 --- /dev/null +++ b/helloworld/node_modules/arraybuffer.slice/index.js @@ -0,0 +1,29 @@ +/** + * An abstraction for slicing an arraybuffer even when + * ArrayBuffer.prototype.slice is not supported + * + * @api public + */ + +module.exports = function(arraybuffer, start, end) { + var bytes = arraybuffer.byteLength; + start = start || 0; + end = end || bytes; + + if (arraybuffer.slice) { return arraybuffer.slice(start, end); } + + if (start < 0) { start += bytes; } + if (end < 0) { end += bytes; } + if (end > bytes) { end = bytes; } + + if (start >= bytes || start >= end || bytes === 0) { + return new ArrayBuffer(0); + } + + var abv = new Uint8Array(arraybuffer); + var result = new Uint8Array(end - start); + for (var i = start, ii = 0; i < end; i++, ii++) { + result[ii] = abv[i]; + } + return result.buffer; +}; diff --git a/helloworld/node_modules/arraybuffer.slice/package.json b/helloworld/node_modules/arraybuffer.slice/package.json new file mode 100755 index 0000000..0bc69dd --- /dev/null +++ b/helloworld/node_modules/arraybuffer.slice/package.json @@ -0,0 +1,44 @@ +{ + "_from": "arraybuffer.slice@~0.0.7", + "_id": "arraybuffer.slice@0.0.7", + "_inBundle": false, + "_integrity": "sha512-wGUIVQXuehL5TCqQun8OW81jGzAWycqzFF8lFp+GOM5BXLYj3bKNsYC4daB7n6XjCqxQA/qgTJ+8ANR3acjrog==", + "_location": "/arraybuffer.slice", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "arraybuffer.slice@~0.0.7", + "name": "arraybuffer.slice", + "escapedName": "arraybuffer.slice", + "rawSpec": "~0.0.7", + "saveSpec": null, + "fetchSpec": "~0.0.7" + }, + "_requiredBy": [ + "/engine.io-parser" + ], + "_resolved": "https://registry.npmjs.org/arraybuffer.slice/-/arraybuffer.slice-0.0.7.tgz", + "_shasum": "3bbc4275dd584cc1b10809b89d4e8b63a69e7675", + "_spec": "arraybuffer.slice@~0.0.7", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/engine.io-parser", + "bugs": { + "url": "https://github.com/rase-/arraybuffer.slice/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Exports a function for slicing ArrayBuffers (no polyfilling)", + "devDependencies": { + "expect.js": "0.2.0", + "mocha": "1.17.1" + }, + "homepage": "https://github.com/rase-/arraybuffer.slice", + "license": "MIT", + "name": "arraybuffer.slice", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/rase-/arraybuffer.slice.git" + }, + "version": "0.0.7" +} diff --git a/helloworld/node_modules/arraybuffer.slice/test/slice-buffer.js b/helloworld/node_modules/arraybuffer.slice/test/slice-buffer.js new file mode 100755 index 0000000..4778da6 --- /dev/null +++ b/helloworld/node_modules/arraybuffer.slice/test/slice-buffer.js @@ -0,0 +1,227 @@ +/* + * Test dependencies + */ + +var sliceBuffer = require('../index.js'); +var expect = require('expect.js'); + +/** + * Tests + */ + +describe('sliceBuffer', function() { + describe('using standard slice', function() { + it('should slice correctly with only start provided', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, 3); + var sabv = new Uint8Array(sliced); + for (var i = 3, ii = 0; i < abv.length; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with start and end provided', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, 3, 8); + var sabv = new Uint8Array(sliced); + for (var i = 3, ii = 0; i < 8; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with negative start', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, -3); + var sabv = new Uint8Array(sliced); + for (var i = abv.length - 3, ii = 0; i < abv.length; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with negative end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, 0, -3); + var sabv = new Uint8Array(sliced); + for (var i = 0, ii = 0; i < abv.length - 3; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with negative start and end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, -6, -3); + var sabv = new Uint8Array(sliced); + for (var i = abv.length - 6, ii = 0; i < abv.length - 3; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with equal start and end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, 1, 1); + expect(sliced.byteLength).to.equal(0); + }); + + it('should slice correctly when end larger than buffer', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, 0, 100); + expect(new Uint8Array(sliced)).to.eql(abv); + }); + + it('shoud slice correctly when start larger than end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + + var sliced = sliceBuffer(abv.buffer, 6, 5); + expect(sliced.byteLength).to.equal(0); + }); + }); + + describe('using fallback', function() { + it('should slice correctly with only start provided', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + var sliced = sliceBuffer(ab, 3); + var sabv = new Uint8Array(sliced); + for (var i = 3, ii = 0; i < abv.length; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with start and end provided', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + + var sliced = sliceBuffer(ab, 3, 8); + var sabv = new Uint8Array(sliced); + for (var i = 3, ii = 0; i < 8; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with negative start', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + + var sliced = sliceBuffer(ab, -3); + var sabv = new Uint8Array(sliced); + for (var i = abv.length - 3, ii = 0; i < abv.length; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with negative end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + var sliced = sliceBuffer(ab, 0, -3); + var sabv = new Uint8Array(sliced); + for (var i = 0, ii = 0; i < abv.length - 3; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with negative start and end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + var sliced = sliceBuffer(ab, -6, -3); + var sabv = new Uint8Array(sliced); + for (var i = abv.length - 6, ii = 0; i < abv.length - 3; i++, ii++) { + expect(abv[i]).to.equal(sabv[ii]); + } + }); + + it('should slice correctly with equal start and end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + var sliced = sliceBuffer(ab, 1, 1); + expect(sliced.byteLength).to.equal(0); + }); + + it('should slice correctly when end larger than buffer', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + var sliced = sliceBuffer(ab, 0, 100); + var sabv = new Uint8Array(sliced); + for (var i = 0; i < abv.length; i++) { + expect(abv[i]).to.equal(sabv[i]); + } + }); + + it('shoud slice correctly when start larger than end', function() { + var abv = new Uint8Array(10); + for (var i = 0; i < abv.length; i++) { + abv[i] = i; + } + var ab = abv.buffer; + ab.slice = undefined; + + var sliced = sliceBuffer(ab, 6, 5); + expect(sliced.byteLength).to.equal(0); + }); + }); +}); diff --git a/helloworld/node_modules/async-limiter/LICENSE b/helloworld/node_modules/async-limiter/LICENSE new file mode 100755 index 0000000..9c91fb2 --- /dev/null +++ b/helloworld/node_modules/async-limiter/LICENSE @@ -0,0 +1,8 @@ +The MIT License (MIT) +Copyright (c) 2017 Samuel Reed + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/async-limiter/coverage/coverage.json b/helloworld/node_modules/async-limiter/coverage/coverage.json new file mode 100755 index 0000000..5b4a358 --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/coverage.json @@ -0,0 +1 @@ +{"/Users/samuelreed/git/forks/async-throttle/index.js":{"path":"/Users/samuelreed/git/forks/async-throttle/index.js","s":{"1":1,"2":7,"3":1,"4":6,"5":6,"6":6,"7":6,"8":6,"9":6,"10":1,"11":1,"12":3,"13":13,"14":13,"15":13,"16":1,"17":19,"18":1,"19":45,"20":6,"21":39,"22":13,"23":13,"24":13,"25":13,"26":39,"27":18,"28":6,"29":6,"30":1,"31":6,"32":6,"33":6,"34":1,"35":13,"36":13,"37":1},"b":{"1":[1,6],"2":[6,5],"3":[6,5],"4":[6,39],"5":[13,26],"6":[18,21],"7":[6,0]},"f":{"1":7,"2":3,"3":13,"4":19,"5":45,"6":6,"7":13},"fnMap":{"1":{"name":"Queue","line":3,"loc":{"start":{"line":3,"column":0},"end":{"line":3,"column":24}}},"2":{"name":"(anonymous_2)","line":22,"loc":{"start":{"line":22,"column":24},"end":{"line":22,"column":41}}},"3":{"name":"(anonymous_3)","line":23,"loc":{"start":{"line":23,"column":28},"end":{"line":23,"column":39}}},"4":{"name":"(anonymous_4)","line":31,"loc":{"start":{"line":31,"column":7},"end":{"line":31,"column":18}}},"5":{"name":"(anonymous_5)","line":36,"loc":{"start":{"line":36,"column":23},"end":{"line":36,"column":34}}},"6":{"name":"(anonymous_6)","line":55,"loc":{"start":{"line":55,"column":25},"end":{"line":55,"column":38}}},"7":{"name":"done","line":62,"loc":{"start":{"line":62,"column":0},"end":{"line":62,"column":16}}}},"statementMap":{"1":{"start":{"line":3,"column":0},"end":{"line":14,"column":1}},"2":{"start":{"line":4,"column":2},"end":{"line":6,"column":3}},"3":{"start":{"line":5,"column":4},"end":{"line":5,"column":30}},"4":{"start":{"line":8,"column":2},"end":{"line":8,"column":26}},"5":{"start":{"line":9,"column":2},"end":{"line":9,"column":53}},"6":{"start":{"line":10,"column":2},"end":{"line":10,"column":19}},"7":{"start":{"line":11,"column":2},"end":{"line":11,"column":17}},"8":{"start":{"line":12,"column":2},"end":{"line":12,"column":16}},"9":{"start":{"line":13,"column":2},"end":{"line":13,"column":31}},"10":{"start":{"line":16,"column":0},"end":{"line":20,"column":2}},"11":{"start":{"line":22,"column":0},"end":{"line":28,"column":3}},"12":{"start":{"line":23,"column":2},"end":{"line":27,"column":4}},"13":{"start":{"line":24,"column":4},"end":{"line":24,"column":75}},"14":{"start":{"line":25,"column":4},"end":{"line":25,"column":16}},"15":{"start":{"line":26,"column":4},"end":{"line":26,"column":24}},"16":{"start":{"line":30,"column":0},"end":{"line":34,"column":3}},"17":{"start":{"line":32,"column":4},"end":{"line":32,"column":43}},"18":{"start":{"line":36,"column":0},"end":{"line":53,"column":2}},"19":{"start":{"line":37,"column":2},"end":{"line":39,"column":3}},"20":{"start":{"line":38,"column":4},"end":{"line":38,"column":11}},"21":{"start":{"line":40,"column":2},"end":{"line":45,"column":3}},"22":{"start":{"line":41,"column":4},"end":{"line":41,"column":32}},"23":{"start":{"line":42,"column":4},"end":{"line":42,"column":19}},"24":{"start":{"line":43,"column":4},"end":{"line":43,"column":20}},"25":{"start":{"line":44,"column":4},"end":{"line":44,"column":16}},"26":{"start":{"line":47,"column":2},"end":{"line":52,"column":3}},"27":{"start":{"line":48,"column":4},"end":{"line":51,"column":5}},"28":{"start":{"line":49,"column":6},"end":{"line":49,"column":30}},"29":{"start":{"line":50,"column":6},"end":{"line":50,"column":27}},"30":{"start":{"line":55,"column":0},"end":{"line":60,"column":2}},"31":{"start":{"line":56,"column":2},"end":{"line":59,"column":3}},"32":{"start":{"line":57,"column":4},"end":{"line":57,"column":22}},"33":{"start":{"line":58,"column":4},"end":{"line":58,"column":16}},"34":{"start":{"line":62,"column":0},"end":{"line":65,"column":1}},"35":{"start":{"line":63,"column":2},"end":{"line":63,"column":17}},"36":{"start":{"line":64,"column":2},"end":{"line":64,"column":14}},"37":{"start":{"line":67,"column":0},"end":{"line":67,"column":23}}},"branchMap":{"1":{"line":4,"type":"if","locations":[{"start":{"line":4,"column":2},"end":{"line":4,"column":2}},{"start":{"line":4,"column":2},"end":{"line":4,"column":2}}]},"2":{"line":8,"type":"binary-expr","locations":[{"start":{"line":8,"column":12},"end":{"line":8,"column":19}},{"start":{"line":8,"column":23},"end":{"line":8,"column":25}}]},"3":{"line":9,"type":"binary-expr","locations":[{"start":{"line":9,"column":21},"end":{"line":9,"column":40}},{"start":{"line":9,"column":44},"end":{"line":9,"column":52}}]},"4":{"line":37,"type":"if","locations":[{"start":{"line":37,"column":2},"end":{"line":37,"column":2}},{"start":{"line":37,"column":2},"end":{"line":37,"column":2}}]},"5":{"line":40,"type":"if","locations":[{"start":{"line":40,"column":2},"end":{"line":40,"column":2}},{"start":{"line":40,"column":2},"end":{"line":40,"column":2}}]},"6":{"line":47,"type":"if","locations":[{"start":{"line":47,"column":2},"end":{"line":47,"column":2}},{"start":{"line":47,"column":2},"end":{"line":47,"column":2}}]},"7":{"line":56,"type":"if","locations":[{"start":{"line":56,"column":2},"end":{"line":56,"column":2}},{"start":{"line":56,"column":2},"end":{"line":56,"column":2}}]}}}} \ No newline at end of file diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.html b/helloworld/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.html new file mode 100755 index 0000000..198882b --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.html @@ -0,0 +1,73 @@ + + + + Code coverage report for async-throttle/ + + + + + + +
+

Code coverage report for async-throttle/

+

+ Statements: 100% (37 / 37)      + Branches: 92.86% (13 / 14)      + Functions: 100% (7 / 7)      + Lines: 100% (37 / 37)      + Ignored: none      +

+
All files » async-throttle/
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
FileStatementsBranchesFunctionsLines
index.js100%(37 / 37)92.86%(13 / 14)100%(7 / 7)100%(37 / 37)
+
+
+ + + + + + diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.js.html b/helloworld/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.js.html new file mode 100755 index 0000000..adc030f --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/async-throttle/index.js.html @@ -0,0 +1,246 @@ + + + + Code coverage report for async-throttle/index.js + + + + + + +
+

Code coverage report for async-throttle/index.js

+

+ Statements: 100% (37 / 37)      + Branches: 92.86% (13 / 14)      + Functions: 100% (7 / 7)      + Lines: 100% (37 / 37)      + Ignored: none      +

+
All files » async-throttle/ » index.js
+
+
+

+
+
1 +2 +3 +4 +5 +6 +7 +8 +9 +10 +11 +12 +13 +14 +15 +16 +17 +18 +19 +20 +21 +22 +23 +24 +25 +26 +27 +28 +29 +30 +31 +32 +33 +34 +35 +36 +37 +38 +39 +40 +41 +42 +43 +44 +45 +46 +47 +48 +49 +50 +51 +52 +53 +54 +55 +56 +57 +58 +59 +60 +61 +62 +63 +64 +65 +66 +67 +68  +  +1 +7 +1 +  +  +6 +6 +6 +6 +6 +6 +  +  +1 +  +  +  +  +  +1 +3 +13 +13 +13 +  +  +  +1 +  +19 +  +  +  +1 +45 +6 +  +39 +13 +13 +13 +13 +  +  +39 +18 +6 +6 +  +  +  +  +1 +6 +6 +6 +  +  +  +1 +13 +13 +  +  +1 + 
'use strict';
+ 
+function Queue(options) {
+  if (!(this instanceof Queue)) {
+    return new Queue(options);
+  }
+ 
+  options = options || {};
+  this.concurrency = options.concurrency || Infinity;
+  this.pending = 0;
+  this.jobs = [];
+  this.cbs = [];
+  this._done = done.bind(this);
+}
+ 
+var arrayAddMethods = [
+  'push',
+  'unshift',
+  'splice'
+];
+ 
+arrayAddMethods.forEach(function(method) {
+  Queue.prototype[method] = function() {
+    var methodResult = Array.prototype[method].apply(this.jobs, arguments);
+    this._run();
+    return methodResult;
+  };
+});
+ 
+Object.defineProperty(Queue.prototype, 'length', {
+  get: function() {
+    return this.pending + this.jobs.length;
+  }
+});
+ 
+Queue.prototype._run = function() {
+  if (this.pending === this.concurrency) {
+    return;
+  }
+  if (this.jobs.length) {
+    var job = this.jobs.shift();
+    this.pending++;
+    job(this._done);
+    this._run();
+  }
+ 
+  if (this.pending === 0) {
+    while (this.cbs.length !== 0) {
+      var cb = this.cbs.pop();
+      process.nextTick(cb);
+    }
+  }
+};
+ 
+Queue.prototype.onDone = function(cb) {
+  Eif (typeof cb === 'function') {
+    this.cbs.push(cb);
+    this._run();
+  }
+};
+ 
+function done() {
+  this.pending--;
+  this._run();
+}
+ 
+module.exports = Queue;
+ 
+ +
+ + + + + + diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/base.css b/helloworld/node_modules/async-limiter/coverage/lcov-report/base.css new file mode 100755 index 0000000..a6a2f32 --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/base.css @@ -0,0 +1,182 @@ +body, html { + margin:0; padding: 0; +} +body { + font-family: Helvetica Neue, Helvetica,Arial; + font-size: 10pt; +} +div.header, div.footer { + background: #eee; + padding: 1em; +} +div.header { + z-index: 100; + position: fixed; + top: 0; + border-bottom: 1px solid #666; + width: 100%; +} +div.footer { + border-top: 1px solid #666; +} +div.body { + margin-top: 10em; +} +div.meta { + font-size: 90%; + text-align: center; +} +h1, h2, h3 { + font-weight: normal; +} +h1 { + font-size: 12pt; +} +h2 { + font-size: 10pt; +} +pre { + font-family: Consolas, Menlo, Monaco, monospace; + margin: 0; + padding: 0; + line-height: 1.3; + font-size: 14px; + -moz-tab-size: 2; + -o-tab-size: 2; + tab-size: 2; +} + +div.path { font-size: 110%; } +div.path a:link, div.path a:visited { color: #000; } +table.coverage { border-collapse: collapse; margin:0; padding: 0 } + +table.coverage td { + margin: 0; + padding: 0; + color: #111; + vertical-align: top; +} +table.coverage td.line-count { + width: 50px; + text-align: right; + padding-right: 5px; +} +table.coverage td.line-coverage { + color: #777 !important; + text-align: right; + border-left: 1px solid #666; + border-right: 1px solid #666; +} + +table.coverage td.text { +} + +table.coverage td span.cline-any { + display: inline-block; + padding: 0 5px; + width: 40px; +} +table.coverage td span.cline-neutral { + background: #eee; +} +table.coverage td span.cline-yes { + background: #b5d592; + color: #999; +} +table.coverage td span.cline-no { + background: #fc8c84; +} + +.cstat-yes { color: #111; } +.cstat-no { background: #fc8c84; color: #111; } +.fstat-no { background: #ffc520; color: #111 !important; } +.cbranch-no { background: yellow !important; color: #111; } + +.cstat-skip { background: #ddd; color: #111; } +.fstat-skip { background: #ddd; color: #111 !important; } +.cbranch-skip { background: #ddd !important; color: #111; } + +.missing-if-branch { + display: inline-block; + margin-right: 10px; + position: relative; + padding: 0 4px; + background: black; + color: yellow; +} + +.skip-if-branch { + display: none; + margin-right: 10px; + position: relative; + padding: 0 4px; + background: #ccc; + color: white; +} + +.missing-if-branch .typ, .skip-if-branch .typ { + color: inherit !important; +} + +.entity, .metric { font-weight: bold; } +.metric { display: inline-block; border: 1px solid #333; padding: 0.3em; background: white; } +.metric small { font-size: 80%; font-weight: normal; color: #666; } + +div.coverage-summary table { border-collapse: collapse; margin: 3em; font-size: 110%; } +div.coverage-summary td, div.coverage-summary table th { margin: 0; padding: 0.25em 1em; border-top: 1px solid #666; border-bottom: 1px solid #666; } +div.coverage-summary th { text-align: left; border: 1px solid #666; background: #eee; font-weight: normal; } +div.coverage-summary th.file { border-right: none !important; } +div.coverage-summary th.pic { border-left: none !important; text-align: right; } +div.coverage-summary th.pct { border-right: none !important; } +div.coverage-summary th.abs { border-left: none !important; text-align: right; } +div.coverage-summary td.pct { text-align: right; border-left: 1px solid #666; } +div.coverage-summary td.abs { text-align: right; font-size: 90%; color: #444; border-right: 1px solid #666; } +div.coverage-summary td.file { border-left: 1px solid #666; white-space: nowrap; } +div.coverage-summary td.pic { min-width: 120px !important; } +div.coverage-summary a:link { text-decoration: none; color: #000; } +div.coverage-summary a:visited { text-decoration: none; color: #777; } +div.coverage-summary a:hover { text-decoration: underline; } +div.coverage-summary tfoot td { border-top: 1px solid #666; } + +div.coverage-summary .sorter { + height: 10px; + width: 7px; + display: inline-block; + margin-left: 0.5em; + background: url(sort-arrow-sprite.png) no-repeat scroll 0 0 transparent; +} +div.coverage-summary .sorted .sorter { + background-position: 0 -20px; +} +div.coverage-summary .sorted-desc .sorter { + background-position: 0 -10px; +} + +.high { background: #b5d592 !important; } +.medium { background: #ffe87c !important; } +.low { background: #fc8c84 !important; } + +span.cover-fill, span.cover-empty { + display:inline-block; + border:1px solid #444; + background: white; + height: 12px; +} +span.cover-fill { + background: #ccc; + border-right: 1px solid #444; +} +span.cover-empty { + background: white; + border-left: none; +} +span.cover-full { + border-right: none !important; +} +pre.prettyprint { + border: none !important; + padding: 0 !important; + margin: 0 !important; +} +.com { color: #999 !important; } +.ignore-none { color: #999; font-weight: normal; } diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/index.html b/helloworld/node_modules/async-limiter/coverage/lcov-report/index.html new file mode 100755 index 0000000..782a1cf --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/index.html @@ -0,0 +1,73 @@ + + + + Code coverage report for All files + + + + + + +
+

Code coverage report for All files

+

+ Statements: 100% (37 / 37)      + Branches: 92.86% (13 / 14)      + Functions: 100% (7 / 7)      + Lines: 100% (37 / 37)      + Ignored: none      +

+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
FileStatementsBranchesFunctionsLines
async-throttle/100%(37 / 37)92.86%(13 / 14)100%(7 / 7)100%(37 / 37)
+
+
+ + + + + + diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/prettify.css b/helloworld/node_modules/async-limiter/coverage/lcov-report/prettify.css new file mode 100755 index 0000000..b317a7c --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/prettify.css @@ -0,0 +1 @@ +.pln{color:#000}@media screen{.str{color:#080}.kwd{color:#008}.com{color:#800}.typ{color:#606}.lit{color:#066}.pun,.opn,.clo{color:#660}.tag{color:#008}.atn{color:#606}.atv{color:#080}.dec,.var{color:#606}.fun{color:red}}@media print,projection{.str{color:#060}.kwd{color:#006;font-weight:bold}.com{color:#600;font-style:italic}.typ{color:#404;font-weight:bold}.lit{color:#044}.pun,.opn,.clo{color:#440}.tag{color:#006;font-weight:bold}.atn{color:#404}.atv{color:#060}}pre.prettyprint{padding:2px;border:1px solid #888}ol.linenums{margin-top:0;margin-bottom:0}li.L0,li.L1,li.L2,li.L3,li.L5,li.L6,li.L7,li.L8{list-style-type:none}li.L1,li.L3,li.L5,li.L7,li.L9{background:#eee} diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/prettify.js b/helloworld/node_modules/async-limiter/coverage/lcov-report/prettify.js new file mode 100755 index 0000000..ef51e03 --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/prettify.js @@ -0,0 +1 @@ +window.PR_SHOULD_USE_CONTINUATION=true;(function(){var h=["break,continue,do,else,for,if,return,while"];var u=[h,"auto,case,char,const,default,double,enum,extern,float,goto,int,long,register,short,signed,sizeof,static,struct,switch,typedef,union,unsigned,void,volatile"];var p=[u,"catch,class,delete,false,import,new,operator,private,protected,public,this,throw,true,try,typeof"];var l=[p,"alignof,align_union,asm,axiom,bool,concept,concept_map,const_cast,constexpr,decltype,dynamic_cast,explicit,export,friend,inline,late_check,mutable,namespace,nullptr,reinterpret_cast,static_assert,static_cast,template,typeid,typename,using,virtual,where"];var x=[p,"abstract,boolean,byte,extends,final,finally,implements,import,instanceof,null,native,package,strictfp,super,synchronized,throws,transient"];var R=[x,"as,base,by,checked,decimal,delegate,descending,dynamic,event,fixed,foreach,from,group,implicit,in,interface,internal,into,is,lock,object,out,override,orderby,params,partial,readonly,ref,sbyte,sealed,stackalloc,string,select,uint,ulong,unchecked,unsafe,ushort,var"];var r="all,and,by,catch,class,else,extends,false,finally,for,if,in,is,isnt,loop,new,no,not,null,of,off,on,or,return,super,then,true,try,unless,until,when,while,yes";var w=[p,"debugger,eval,export,function,get,null,set,undefined,var,with,Infinity,NaN"];var s="caller,delete,die,do,dump,elsif,eval,exit,foreach,for,goto,if,import,last,local,my,next,no,our,print,package,redo,require,sub,undef,unless,until,use,wantarray,while,BEGIN,END";var I=[h,"and,as,assert,class,def,del,elif,except,exec,finally,from,global,import,in,is,lambda,nonlocal,not,or,pass,print,raise,try,with,yield,False,True,None"];var f=[h,"alias,and,begin,case,class,def,defined,elsif,end,ensure,false,in,module,next,nil,not,or,redo,rescue,retry,self,super,then,true,undef,unless,until,when,yield,BEGIN,END"];var H=[h,"case,done,elif,esac,eval,fi,function,in,local,set,then,until"];var A=[l,R,w,s+I,f,H];var e=/^(DIR|FILE|vector|(de|priority_)?queue|list|stack|(const_)?iterator|(multi)?(set|map)|bitset|u?(int|float)\d*)/;var C="str";var z="kwd";var j="com";var O="typ";var G="lit";var L="pun";var F="pln";var m="tag";var E="dec";var J="src";var P="atn";var n="atv";var N="nocode";var M="(?:^^\\.?|[+-]|\\!|\\!=|\\!==|\\#|\\%|\\%=|&|&&|&&=|&=|\\(|\\*|\\*=|\\+=|\\,|\\-=|\\->|\\/|\\/=|:|::|\\;|<|<<|<<=|<=|=|==|===|>|>=|>>|>>=|>>>|>>>=|\\?|\\@|\\[|\\^|\\^=|\\^\\^|\\^\\^=|\\{|\\||\\|=|\\|\\||\\|\\|=|\\~|break|case|continue|delete|do|else|finally|instanceof|return|throw|try|typeof)\\s*";function k(Z){var ad=0;var S=false;var ac=false;for(var V=0,U=Z.length;V122)){if(!(al<65||ag>90)){af.push([Math.max(65,ag)|32,Math.min(al,90)|32])}if(!(al<97||ag>122)){af.push([Math.max(97,ag)&~32,Math.min(al,122)&~32])}}}}af.sort(function(av,au){return(av[0]-au[0])||(au[1]-av[1])});var ai=[];var ap=[NaN,NaN];for(var ar=0;arat[0]){if(at[1]+1>at[0]){an.push("-")}an.push(T(at[1]))}}an.push("]");return an.join("")}function W(al){var aj=al.source.match(new RegExp("(?:\\[(?:[^\\x5C\\x5D]|\\\\[\\s\\S])*\\]|\\\\u[A-Fa-f0-9]{4}|\\\\x[A-Fa-f0-9]{2}|\\\\[0-9]+|\\\\[^ux0-9]|\\(\\?[:!=]|[\\(\\)\\^]|[^\\x5B\\x5C\\(\\)\\^]+)","g"));var ah=aj.length;var an=[];for(var ak=0,am=0;ak=2&&ai==="["){aj[ak]=X(ag)}else{if(ai!=="\\"){aj[ak]=ag.replace(/[a-zA-Z]/g,function(ao){var ap=ao.charCodeAt(0);return"["+String.fromCharCode(ap&~32,ap|32)+"]"})}}}}return aj.join("")}var aa=[];for(var V=0,U=Z.length;V=0;){S[ac.charAt(ae)]=Y}}var af=Y[1];var aa=""+af;if(!ag.hasOwnProperty(aa)){ah.push(af);ag[aa]=null}}ah.push(/[\0-\uffff]/);V=k(ah)})();var X=T.length;var W=function(ah){var Z=ah.sourceCode,Y=ah.basePos;var ad=[Y,F];var af=0;var an=Z.match(V)||[];var aj={};for(var ae=0,aq=an.length;ae=5&&"lang-"===ap.substring(0,5);if(am&&!(ai&&typeof ai[1]==="string")){am=false;ap=J}if(!am){aj[ag]=ap}}var ab=af;af+=ag.length;if(!am){ad.push(Y+ab,ap)}else{var al=ai[1];var ak=ag.indexOf(al);var ac=ak+al.length;if(ai[2]){ac=ag.length-ai[2].length;ak=ac-al.length}var ar=ap.substring(5);B(Y+ab,ag.substring(0,ak),W,ad);B(Y+ab+ak,al,q(ar,al),ad);B(Y+ab+ac,ag.substring(ac),W,ad)}}ah.decorations=ad};return W}function i(T){var W=[],S=[];if(T.tripleQuotedStrings){W.push([C,/^(?:\'\'\'(?:[^\'\\]|\\[\s\S]|\'{1,2}(?=[^\']))*(?:\'\'\'|$)|\"\"\"(?:[^\"\\]|\\[\s\S]|\"{1,2}(?=[^\"]))*(?:\"\"\"|$)|\'(?:[^\\\']|\\[\s\S])*(?:\'|$)|\"(?:[^\\\"]|\\[\s\S])*(?:\"|$))/,null,"'\""])}else{if(T.multiLineStrings){W.push([C,/^(?:\'(?:[^\\\']|\\[\s\S])*(?:\'|$)|\"(?:[^\\\"]|\\[\s\S])*(?:\"|$)|\`(?:[^\\\`]|\\[\s\S])*(?:\`|$))/,null,"'\"`"])}else{W.push([C,/^(?:\'(?:[^\\\'\r\n]|\\.)*(?:\'|$)|\"(?:[^\\\"\r\n]|\\.)*(?:\"|$))/,null,"\"'"])}}if(T.verbatimStrings){S.push([C,/^@\"(?:[^\"]|\"\")*(?:\"|$)/,null])}var Y=T.hashComments;if(Y){if(T.cStyleComments){if(Y>1){W.push([j,/^#(?:##(?:[^#]|#(?!##))*(?:###|$)|.*)/,null,"#"])}else{W.push([j,/^#(?:(?:define|elif|else|endif|error|ifdef|include|ifndef|line|pragma|undef|warning)\b|[^\r\n]*)/,null,"#"])}S.push([C,/^<(?:(?:(?:\.\.\/)*|\/?)(?:[\w-]+(?:\/[\w-]+)+)?[\w-]+\.h|[a-z]\w*)>/,null])}else{W.push([j,/^#[^\r\n]*/,null,"#"])}}if(T.cStyleComments){S.push([j,/^\/\/[^\r\n]*/,null]);S.push([j,/^\/\*[\s\S]*?(?:\*\/|$)/,null])}if(T.regexLiterals){var X=("/(?=[^/*])(?:[^/\\x5B\\x5C]|\\x5C[\\s\\S]|\\x5B(?:[^\\x5C\\x5D]|\\x5C[\\s\\S])*(?:\\x5D|$))+/");S.push(["lang-regex",new RegExp("^"+M+"("+X+")")])}var V=T.types;if(V){S.push([O,V])}var U=(""+T.keywords).replace(/^ | $/g,"");if(U.length){S.push([z,new RegExp("^(?:"+U.replace(/[\s,]+/g,"|")+")\\b"),null])}W.push([F,/^\s+/,null," \r\n\t\xA0"]);S.push([G,/^@[a-z_$][a-z_$@0-9]*/i,null],[O,/^(?:[@_]?[A-Z]+[a-z][A-Za-z_$@0-9]*|\w+_t\b)/,null],[F,/^[a-z_$][a-z_$@0-9]*/i,null],[G,new RegExp("^(?:0x[a-f0-9]+|(?:\\d(?:_\\d+)*\\d*(?:\\.\\d*)?|\\.\\d\\+)(?:e[+\\-]?\\d+)?)[a-z]*","i"),null,"0123456789"],[F,/^\\[\s\S]?/,null],[L,/^.[^\s\w\.$@\'\"\`\/\#\\]*/,null]);return g(W,S)}var K=i({keywords:A,hashComments:true,cStyleComments:true,multiLineStrings:true,regexLiterals:true});function Q(V,ag){var U=/(?:^|\s)nocode(?:\s|$)/;var ab=/\r\n?|\n/;var ac=V.ownerDocument;var S;if(V.currentStyle){S=V.currentStyle.whiteSpace}else{if(window.getComputedStyle){S=ac.defaultView.getComputedStyle(V,null).getPropertyValue("white-space")}}var Z=S&&"pre"===S.substring(0,3);var af=ac.createElement("LI");while(V.firstChild){af.appendChild(V.firstChild)}var W=[af];function ae(al){switch(al.nodeType){case 1:if(U.test(al.className)){break}if("BR"===al.nodeName){ad(al);if(al.parentNode){al.parentNode.removeChild(al)}}else{for(var an=al.firstChild;an;an=an.nextSibling){ae(an)}}break;case 3:case 4:if(Z){var am=al.nodeValue;var aj=am.match(ab);if(aj){var ai=am.substring(0,aj.index);al.nodeValue=ai;var ah=am.substring(aj.index+aj[0].length);if(ah){var ak=al.parentNode;ak.insertBefore(ac.createTextNode(ah),al.nextSibling)}ad(al);if(!ai){al.parentNode.removeChild(al)}}}break}}function ad(ak){while(!ak.nextSibling){ak=ak.parentNode;if(!ak){return}}function ai(al,ar){var aq=ar?al.cloneNode(false):al;var ao=al.parentNode;if(ao){var ap=ai(ao,1);var an=al.nextSibling;ap.appendChild(aq);for(var am=an;am;am=an){an=am.nextSibling;ap.appendChild(am)}}return aq}var ah=ai(ak.nextSibling,0);for(var aj;(aj=ah.parentNode)&&aj.nodeType===1;){ah=aj}W.push(ah)}for(var Y=0;Y=S){ah+=2}if(V>=ap){Z+=2}}}var t={};function c(U,V){for(var S=V.length;--S>=0;){var T=V[S];if(!t.hasOwnProperty(T)){t[T]=U}else{if(window.console){console.warn("cannot override language handler %s",T)}}}}function q(T,S){if(!(T&&t.hasOwnProperty(T))){T=/^\s*]*(?:>|$)/],[j,/^<\!--[\s\S]*?(?:-\->|$)/],["lang-",/^<\?([\s\S]+?)(?:\?>|$)/],["lang-",/^<%([\s\S]+?)(?:%>|$)/],[L,/^(?:<[%?]|[%?]>)/],["lang-",/^]*>([\s\S]+?)<\/xmp\b[^>]*>/i],["lang-js",/^]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-css",/^]*>([\s\S]*?)(<\/style\b[^>]*>)/i],["lang-in.tag",/^(<\/?[a-z][^<>]*>)/i]]),["default-markup","htm","html","mxml","xhtml","xml","xsl"]);c(g([[F,/^[\s]+/,null," \t\r\n"],[n,/^(?:\"[^\"]*\"?|\'[^\']*\'?)/,null,"\"'"]],[[m,/^^<\/?[a-z](?:[\w.:-]*\w)?|\/?>$/i],[P,/^(?!style[\s=]|on)[a-z](?:[\w:-]*\w)?/i],["lang-uq.val",/^=\s*([^>\'\"\s]*(?:[^>\'\"\s\/]|\/(?=\s)))/],[L,/^[=<>\/]+/],["lang-js",/^on\w+\s*=\s*\"([^\"]+)\"/i],["lang-js",/^on\w+\s*=\s*\'([^\']+)\'/i],["lang-js",/^on\w+\s*=\s*([^\"\'>\s]+)/i],["lang-css",/^style\s*=\s*\"([^\"]+)\"/i],["lang-css",/^style\s*=\s*\'([^\']+)\'/i],["lang-css",/^style\s*=\s*([^\"\'>\s]+)/i]]),["in.tag"]);c(g([],[[n,/^[\s\S]+/]]),["uq.val"]);c(i({keywords:l,hashComments:true,cStyleComments:true,types:e}),["c","cc","cpp","cxx","cyc","m"]);c(i({keywords:"null,true,false"}),["json"]);c(i({keywords:R,hashComments:true,cStyleComments:true,verbatimStrings:true,types:e}),["cs"]);c(i({keywords:x,cStyleComments:true}),["java"]);c(i({keywords:H,hashComments:true,multiLineStrings:true}),["bsh","csh","sh"]);c(i({keywords:I,hashComments:true,multiLineStrings:true,tripleQuotedStrings:true}),["cv","py"]);c(i({keywords:s,hashComments:true,multiLineStrings:true,regexLiterals:true}),["perl","pl","pm"]);c(i({keywords:f,hashComments:true,multiLineStrings:true,regexLiterals:true}),["rb"]);c(i({keywords:w,cStyleComments:true,regexLiterals:true}),["js"]);c(i({keywords:r,hashComments:3,cStyleComments:true,multilineStrings:true,tripleQuotedStrings:true,regexLiterals:true}),["coffee"]);c(g([],[[C,/^[\s\S]+/]]),["regex"]);function d(V){var U=V.langExtension;try{var S=a(V.sourceNode);var T=S.sourceCode;V.sourceCode=T;V.spans=S.spans;V.basePos=0;q(U,T)(V);D(V)}catch(W){if("console" in window){console.log(W&&W.stack?W.stack:W)}}}function y(W,V,U){var S=document.createElement("PRE");S.innerHTML=W;if(U){Q(S,U)}var T={langExtension:V,numberLines:U,sourceNode:S};d(T);return S.innerHTML}function b(ad){function Y(af){return document.getElementsByTagName(af)}var ac=[Y("pre"),Y("code"),Y("xmp")];var T=[];for(var aa=0;aa=0){var ah=ai.match(ab);var am;if(!ah&&(am=o(aj))&&"CODE"===am.tagName){ah=am.className.match(ab)}if(ah){ah=ah[1]}var al=false;for(var ak=aj.parentNode;ak;ak=ak.parentNode){if((ak.tagName==="pre"||ak.tagName==="code"||ak.tagName==="xmp")&&ak.className&&ak.className.indexOf("prettyprint")>=0){al=true;break}}if(!al){var af=aj.className.match(/\blinenums\b(?::(\d+))?/);af=af?af[1]&&af[1].length?+af[1]:true:false;if(af){Q(aj,af)}S={langExtension:ah,sourceNode:aj,numberLines:af};d(S)}}}if(X]*(?:>|$)/],[PR.PR_COMMENT,/^<\!--[\s\S]*?(?:-\->|$)/],[PR.PR_PUNCTUATION,/^(?:<[%?]|[%?]>)/],["lang-",/^<\?([\s\S]+?)(?:\?>|$)/],["lang-",/^<%([\s\S]+?)(?:%>|$)/],["lang-",/^]*>([\s\S]+?)<\/xmp\b[^>]*>/i],["lang-handlebars",/^]*type\s*=\s*['"]?text\/x-handlebars-template['"]?\b[^>]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-js",/^]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-css",/^]*>([\s\S]*?)(<\/style\b[^>]*>)/i],["lang-in.tag",/^(<\/?[a-z][^<>]*>)/i],[PR.PR_DECLARATION,/^{{[#^>/]?\s*[\w.][^}]*}}/],[PR.PR_DECLARATION,/^{{&?\s*[\w.][^}]*}}/],[PR.PR_DECLARATION,/^{{{>?\s*[\w.][^}]*}}}/],[PR.PR_COMMENT,/^{{![^}]*}}/]]),["handlebars","hbs"]);PR.registerLangHandler(PR.createSimpleLexer([[PR.PR_PLAIN,/^[ \t\r\n\f]+/,null," \t\r\n\f"]],[[PR.PR_STRING,/^\"(?:[^\n\r\f\\\"]|\\(?:\r\n?|\n|\f)|\\[\s\S])*\"/,null],[PR.PR_STRING,/^\'(?:[^\n\r\f\\\']|\\(?:\r\n?|\n|\f)|\\[\s\S])*\'/,null],["lang-css-str",/^url\(([^\)\"\']*)\)/i],[PR.PR_KEYWORD,/^(?:url|rgb|\!important|@import|@page|@media|@charset|inherit)(?=[^\-\w]|$)/i,null],["lang-css-kw",/^(-?(?:[_a-z]|(?:\\[0-9a-f]+ ?))(?:[_a-z0-9\-]|\\(?:\\[0-9a-f]+ ?))*)\s*:/i],[PR.PR_COMMENT,/^\/\*[^*]*\*+(?:[^\/*][^*]*\*+)*\//],[PR.PR_COMMENT,/^(?:)/],[PR.PR_LITERAL,/^(?:\d+|\d*\.\d+)(?:%|[a-z]+)?/i],[PR.PR_LITERAL,/^#(?:[0-9a-f]{3}){1,2}/i],[PR.PR_PLAIN,/^-?(?:[_a-z]|(?:\\[\da-f]+ ?))(?:[_a-z\d\-]|\\(?:\\[\da-f]+ ?))*/i],[PR.PR_PUNCTUATION,/^[^\s\w\'\"]+/]]),["css"]);PR.registerLangHandler(PR.createSimpleLexer([],[[PR.PR_KEYWORD,/^-?(?:[_a-z]|(?:\\[\da-f]+ ?))(?:[_a-z\d\-]|\\(?:\\[\da-f]+ ?))*/i]]),["css-kw"]);PR.registerLangHandler(PR.createSimpleLexer([],[[PR.PR_STRING,/^[^\)\"\']+/]]),["css-str"]); diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/sort-arrow-sprite.png b/helloworld/node_modules/async-limiter/coverage/lcov-report/sort-arrow-sprite.png new file mode 100755 index 0000000..03f704a Binary files /dev/null and b/helloworld/node_modules/async-limiter/coverage/lcov-report/sort-arrow-sprite.png differ diff --git a/helloworld/node_modules/async-limiter/coverage/lcov-report/sorter.js b/helloworld/node_modules/async-limiter/coverage/lcov-report/sorter.js new file mode 100755 index 0000000..6afb736 --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov-report/sorter.js @@ -0,0 +1,156 @@ +var addSorting = (function () { + "use strict"; + var cols, + currentSort = { + index: 0, + desc: false + }; + + // returns the summary table element + function getTable() { return document.querySelector('.coverage-summary table'); } + // returns the thead element of the summary table + function getTableHeader() { return getTable().querySelector('thead tr'); } + // returns the tbody element of the summary table + function getTableBody() { return getTable().querySelector('tbody'); } + // returns the th element for nth column + function getNthColumn(n) { return getTableHeader().querySelectorAll('th')[n]; } + + // loads all columns + function loadColumns() { + var colNodes = getTableHeader().querySelectorAll('th'), + colNode, + cols = [], + col, + i; + + for (i = 0; i < colNodes.length; i += 1) { + colNode = colNodes[i]; + col = { + key: colNode.getAttribute('data-col'), + sortable: !colNode.getAttribute('data-nosort'), + type: colNode.getAttribute('data-type') || 'string' + }; + cols.push(col); + if (col.sortable) { + col.defaultDescSort = col.type === 'number'; + colNode.innerHTML = colNode.innerHTML + ''; + } + } + return cols; + } + // attaches a data attribute to every tr element with an object + // of data values keyed by column name + function loadRowData(tableRow) { + var tableCols = tableRow.querySelectorAll('td'), + colNode, + col, + data = {}, + i, + val; + for (i = 0; i < tableCols.length; i += 1) { + colNode = tableCols[i]; + col = cols[i]; + val = colNode.getAttribute('data-value'); + if (col.type === 'number') { + val = Number(val); + } + data[col.key] = val; + } + return data; + } + // loads all row data + function loadData() { + var rows = getTableBody().querySelectorAll('tr'), + i; + + for (i = 0; i < rows.length; i += 1) { + rows[i].data = loadRowData(rows[i]); + } + } + // sorts the table using the data for the ith column + function sortByIndex(index, desc) { + var key = cols[index].key, + sorter = function (a, b) { + a = a.data[key]; + b = b.data[key]; + return a < b ? -1 : a > b ? 1 : 0; + }, + finalSorter = sorter, + tableBody = document.querySelector('.coverage-summary tbody'), + rowNodes = tableBody.querySelectorAll('tr'), + rows = [], + i; + + if (desc) { + finalSorter = function (a, b) { + return -1 * sorter(a, b); + }; + } + + for (i = 0; i < rowNodes.length; i += 1) { + rows.push(rowNodes[i]); + tableBody.removeChild(rowNodes[i]); + } + + rows.sort(finalSorter); + + for (i = 0; i < rows.length; i += 1) { + tableBody.appendChild(rows[i]); + } + } + // removes sort indicators for current column being sorted + function removeSortIndicators() { + var col = getNthColumn(currentSort.index), + cls = col.className; + + cls = cls.replace(/ sorted$/, '').replace(/ sorted-desc$/, ''); + col.className = cls; + } + // adds sort indicators for current column being sorted + function addSortIndicators() { + getNthColumn(currentSort.index).className += currentSort.desc ? ' sorted-desc' : ' sorted'; + } + // adds event listeners for all sorter widgets + function enableUI() { + var i, + el, + ithSorter = function ithSorter(i) { + var col = cols[i]; + + return function () { + var desc = col.defaultDescSort; + + if (currentSort.index === i) { + desc = !currentSort.desc; + } + sortByIndex(i, desc); + removeSortIndicators(); + currentSort.index = i; + currentSort.desc = desc; + addSortIndicators(); + }; + }; + for (i =0 ; i < cols.length; i += 1) { + if (cols[i].sortable) { + el = getNthColumn(i).querySelector('.sorter'); + if (el.addEventListener) { + el.addEventListener('click', ithSorter(i)); + } else { + el.attachEvent('onclick', ithSorter(i)); + } + } + } + } + // adds sorting functionality to the UI + return function () { + if (!getTable()) { + return; + } + cols = loadColumns(); + loadData(cols); + addSortIndicators(); + enableUI(); + }; +})(); + +window.addEventListener('load', addSorting); diff --git a/helloworld/node_modules/async-limiter/coverage/lcov.info b/helloworld/node_modules/async-limiter/coverage/lcov.info new file mode 100755 index 0000000..fbf36aa --- /dev/null +++ b/helloworld/node_modules/async-limiter/coverage/lcov.info @@ -0,0 +1,74 @@ +TN: +SF:/Users/samuelreed/git/forks/async-throttle/index.js +FN:3,Queue +FN:22,(anonymous_2) +FN:23,(anonymous_3) +FN:31,(anonymous_4) +FN:36,(anonymous_5) +FN:55,(anonymous_6) +FN:62,done +FNF:7 +FNH:7 +FNDA:7,Queue +FNDA:3,(anonymous_2) +FNDA:13,(anonymous_3) +FNDA:19,(anonymous_4) +FNDA:45,(anonymous_5) +FNDA:6,(anonymous_6) +FNDA:13,done +DA:3,1 +DA:4,7 +DA:5,1 +DA:8,6 +DA:9,6 +DA:10,6 +DA:11,6 +DA:12,6 +DA:13,6 +DA:16,1 +DA:22,1 +DA:23,3 +DA:24,13 +DA:25,13 +DA:26,13 +DA:30,1 +DA:32,19 +DA:36,1 +DA:37,45 +DA:38,6 +DA:40,39 +DA:41,13 +DA:42,13 +DA:43,13 +DA:44,13 +DA:47,39 +DA:48,18 +DA:49,6 +DA:50,6 +DA:55,1 +DA:56,6 +DA:57,6 +DA:58,6 +DA:62,1 +DA:63,13 +DA:64,13 +DA:67,1 +LF:37 +LH:37 +BRDA:4,1,0,1 +BRDA:4,1,1,6 +BRDA:8,2,0,6 +BRDA:8,2,1,5 +BRDA:9,3,0,6 +BRDA:9,3,1,5 +BRDA:37,4,0,6 +BRDA:37,4,1,39 +BRDA:40,5,0,13 +BRDA:40,5,1,26 +BRDA:47,6,0,18 +BRDA:47,6,1,21 +BRDA:56,7,0,6 +BRDA:56,7,1,0 +BRF:14 +BRH:13 +end_of_record diff --git a/helloworld/node_modules/async-limiter/index.js b/helloworld/node_modules/async-limiter/index.js new file mode 100755 index 0000000..c9bd2f9 --- /dev/null +++ b/helloworld/node_modules/async-limiter/index.js @@ -0,0 +1,67 @@ +'use strict'; + +function Queue(options) { + if (!(this instanceof Queue)) { + return new Queue(options); + } + + options = options || {}; + this.concurrency = options.concurrency || Infinity; + this.pending = 0; + this.jobs = []; + this.cbs = []; + this._done = done.bind(this); +} + +var arrayAddMethods = [ + 'push', + 'unshift', + 'splice' +]; + +arrayAddMethods.forEach(function(method) { + Queue.prototype[method] = function() { + var methodResult = Array.prototype[method].apply(this.jobs, arguments); + this._run(); + return methodResult; + }; +}); + +Object.defineProperty(Queue.prototype, 'length', { + get: function() { + return this.pending + this.jobs.length; + } +}); + +Queue.prototype._run = function() { + if (this.pending === this.concurrency) { + return; + } + if (this.jobs.length) { + var job = this.jobs.shift(); + this.pending++; + job(this._done); + this._run(); + } + + if (this.pending === 0) { + while (this.cbs.length !== 0) { + var cb = this.cbs.pop(); + process.nextTick(cb); + } + } +}; + +Queue.prototype.onDone = function(cb) { + if (typeof cb === 'function') { + this.cbs.push(cb); + this._run(); + } +}; + +function done() { + this.pending--; + this._run(); +} + +module.exports = Queue; diff --git a/helloworld/node_modules/async-limiter/package.json b/helloworld/node_modules/async-limiter/package.json new file mode 100755 index 0000000..819835c --- /dev/null +++ b/helloworld/node_modules/async-limiter/package.json @@ -0,0 +1,69 @@ +{ + "_from": "async-limiter@~1.0.0", + "_id": "async-limiter@1.0.0", + "_inBundle": false, + "_integrity": "sha512-jp/uFnooOiO+L211eZOoSyzpOITMXx1rBITauYykG3BRYPu8h0UcxsPNB04RR5vo4Tyz3+ay17tR6JVf9qzYWg==", + "_location": "/async-limiter", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "async-limiter@~1.0.0", + "name": "async-limiter", + "escapedName": "async-limiter", + "rawSpec": "~1.0.0", + "saveSpec": null, + "fetchSpec": "~1.0.0" + }, + "_requiredBy": [ + "/ws" + ], + "_resolved": "https://registry.npmjs.org/async-limiter/-/async-limiter-1.0.0.tgz", + "_shasum": "78faed8c3d074ab81f22b4e985d79e8738f720f8", + "_spec": "async-limiter@~1.0.0", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/ws", + "author": { + "name": "Samuel Reed" + }, + "bugs": { + "url": "https://github.com/strml/async-limiter/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "asynchronous function queue with adjustable concurrency", + "devDependencies": { + "coveralls": "^2.11.2", + "eslint": "^4.6.1", + "eslint-plugin-mocha": "^4.11.0", + "intelli-espower-loader": "^1.0.1", + "istanbul": "^0.3.2", + "mocha": "^3.5.2", + "power-assert": "^1.4.4" + }, + "homepage": "https://github.com/strml/async-limiter#readme", + "keywords": [ + "throttle", + "async", + "limiter", + "asynchronous", + "job", + "task", + "concurrency", + "concurrent" + ], + "license": "MIT", + "name": "async-limiter", + "repository": { + "type": "git", + "url": "git+https://github.com/strml/async-limiter.git" + }, + "scripts": { + "coverage": "istanbul cover ./node_modules/mocha/bin/_mocha --report lcovonly -- -R spec && cat ./coverage/lcov.info | coveralls", + "example": "node example", + "lint": "eslint .", + "test": "mocha --R intelli-espower-loader test/", + "travis": "npm run lint && npm run coverage" + }, + "version": "1.0.0" +} diff --git a/helloworld/node_modules/async-limiter/readme.md b/helloworld/node_modules/async-limiter/readme.md new file mode 100755 index 0000000..dcf4932 --- /dev/null +++ b/helloworld/node_modules/async-limiter/readme.md @@ -0,0 +1,132 @@ +# Async-Limiter + +A module for limiting concurrent asynchronous actions in flight. Forked from [queue](https://github.com/jessetane/queue). + +[![npm](http://img.shields.io/npm/v/async-limiter.svg?style=flat-square)](http://www.npmjs.org/async-limiter) +[![tests](https://img.shields.io/travis/STRML/async-limiter.svg?style=flat-square&branch=master)](https://travis-ci.org/STRML/async-limiter) +[![coverage](https://img.shields.io/coveralls/STRML/async-limiter.svg?style=flat-square&branch=master)](https://coveralls.io/r/STRML/async-limiter) + +This module exports a class `Limiter` that implements some of the `Array` API. +Pass async functions (ones that accept a callback or return a promise) to an instance's additive array methods. + +## Motivation + +Certain functions, like `zlib`, have [undesirable behavior](https://github.com/nodejs/node/issues/8871#issuecomment-250915913) when +run at infinite concurrency. + +In this case, it is actually faster, and takes far less memory, to limit concurrency. + +This module should do the absolute minimum work necessary to queue up functions. PRs are welcome that would +make this module faster or lighter, but new functionality is not desired. + +Style should confirm to nodejs/node style. + +## Example + +``` javascript +var Limiter = require('async-limiter') + +var t = new Limiter({concurrency: 2}); +var results = [] + +// add jobs using the familiar Array API +t.push(function (cb) { + results.push('two') + cb() +}) + +t.push( + function (cb) { + results.push('four') + cb() + }, + function (cb) { + results.push('five') + cb() + } +) + +t.unshift(function (cb) { + results.push('one') + cb() +}) + +t.splice(2, 0, function (cb) { + results.push('three') + cb() +}) + +// Jobs run automatically. If you want a callback when all are done, +// call 'onDone()'. +t.onDone(function () { + console.log('all done:', results) +}) +``` + +## Zlib Example + +```js +const zlib = require('zlib'); +const Limiter = require('async-limiter'); + +const message = {some: "data"}; +const payload = new Buffer(JSON.stringify(message)); + +// Try with different concurrency values to see how this actually +// slows significantly with higher concurrency! +// +// 5: 1398.607ms +// 10: 1375.668ms +// Infinity: 4423.300ms +// +const t = new Limiter({concurrency: 5}); +function deflate(payload, cb) { + t.push(function(done) { + zlib.deflate(payload, function(err, buffer) { + done(); + cb(err, buffer); + }); + }); +} + +console.time('deflate'); +for(let i = 0; i < 30000; ++i) { + deflate(payload, function (err, buffer) {}); +} +q.onDone(function() { + console.timeEnd('deflate'); +}); +``` + +## Install + +`npm install async-limiter` + +## Test + +`npm test` + +## API + +### `var t = new Limiter([opts])` +Constructor. `opts` may contain inital values for: +* `q.concurrency` + +## Instance methods + +### `q.onDone(fn)` +`fn` will be called once and only once, when the queue is empty. + +## Instance methods mixed in from `Array` +Mozilla has docs on how these methods work [here](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array). +### `q.push(element1, ..., elementN)` +### `q.unshift(element1, ..., elementN)` +### `q.splice(index , howMany[, element1[, ...[, elementN]]])` + +## Properties +### `q.concurrency` +Max number of jobs the queue should process concurrently, defaults to `Infinity`. + +### `q.length` +Jobs pending + jobs to process (readonly). + diff --git a/helloworld/node_modules/axios/CHANGELOG.md b/helloworld/node_modules/axios/CHANGELOG.md new file mode 100755 index 0000000..b571b62 --- /dev/null +++ b/helloworld/node_modules/axios/CHANGELOG.md @@ -0,0 +1,234 @@ +# Changelog + +### 0.17.1 (Nov 11, 2017) + +- Fixing issue with web workers ([#1160](https://github.com/axios/axios/pull/1160)) +- Allowing overriding transport ([#1080](https://github.com/axios/axios/pull/1080)) +- Updating TypeScript typings ([#1165](https://github.com/axios/axios/pull/1165), [#1125](https://github.com/axios/axios/pull/1125), [#1131](https://github.com/axios/axios/pull/1131)) + +### 0.17.0 (Oct 21, 2017) + +- **BREAKING** Fixing issue with `baseURL` and interceptors ([#950](https://github.com/axios/axios/pull/950)) +- **BREAKING** Improving handing of duplicate headers ([#874](https://github.com/axios/axios/pull/874)) +- Adding support for disabling proxies ([#691](https://github.com/axios/axios/pull/691)) +- Updating TypeScript typings with generic type parameters ([#1061](https://github.com/axios/axios/pull/1061)) + +### 0.16.2 (Jun 3, 2017) + +- Fixing issue with including `buffer` in bundle ([#887](https://github.com/axios/axios/pull/887)) +- Including underlying request in errors ([#830](https://github.com/axios/axios/pull/830)) +- Convert `method` to lowercase ([#930](https://github.com/axios/axios/pull/930)) + +### 0.16.1 (Apr 8, 2017) + +- Improving HTTP adapter to return last request in case of redirects ([#828](https://github.com/axios/axios/pull/828)) +- Updating `follow-redirects` dependency ([#829](https://github.com/axios/axios/pull/829)) +- Adding support for passing `Buffer` in node ([#773](https://github.com/axios/axios/pull/773)) + +### 0.16.0 (Mar 31, 2017) + +- **BREAKING** Removing `Promise` from axios typings in favor of built-in type declarations ([#480](https://github.com/axios/axios/issues/480)) +- Adding `options` shortcut method ([#461](https://github.com/axios/axios/pull/461)) +- Fixing issue with using `responseType: 'json'` in browsers incompatible with XHR Level 2 ([#654](https://github.com/axios/axios/pull/654)) +- Improving React Native detection ([#731](https://github.com/axios/axios/pull/731)) +- Fixing `combineURLs` to support empty `relativeURL` ([#581](https://github.com/axios/axios/pull/581)) +- Removing `PROTECTION_PREFIX` support ([#561](https://github.com/axios/axios/pull/561)) + +### 0.15.3 (Nov 27, 2016) + +- Fixing issue with custom instances and global defaults ([#443](https://github.com/axios/axios/issues/443)) +- Renaming `axios.d.ts` to `index.d.ts` ([#519](https://github.com/axios/axios/issues/519)) +- Adding `get`, `head`, and `delete` to `defaults.headers` ([#509](https://github.com/axios/axios/issues/509)) +- Fixing issue with `btoa` and IE ([#507](https://github.com/axios/axios/issues/507)) +- Adding support for proxy authentication ([#483](https://github.com/axios/axios/pull/483)) +- Improving HTTP adapter to use `http` protocol by default ([#493](https://github.com/axios/axios/pull/493)) +- Fixing proxy issues ([#491](https://github.com/axios/axios/pull/491)) + +### 0.15.2 (Oct 17, 2016) + +- Fixing issue with calling `cancel` after response has been received ([#482](https://github.com/axios/axios/issues/482)) + +### 0.15.1 (Oct 14, 2016) + +- Fixing issue with UMD ([#485](https://github.com/axios/axios/issues/485)) + +### 0.15.0 (Oct 10, 2016) + +- Adding cancellation support ([#452](https://github.com/axios/axios/pull/452)) +- Moving default adapter to global defaults ([#437](https://github.com/axios/axios/pull/437)) +- Fixing issue with `file` URI scheme ([#440](https://github.com/axios/axios/pull/440)) +- Fixing issue with `params` objects that have no prototype ([#445](https://github.com/axios/axios/pull/445)) + +### 0.14.0 (Aug 27, 2016) + +- **BREAKING** Updating TypeScript definitions ([#419](https://github.com/axios/axios/pull/419)) +- **BREAKING** Replacing `agent` option with `httpAgent` and `httpsAgent` ([#387](https://github.com/axios/axios/pull/387)) +- **BREAKING** Splitting `progress` event handlers into `onUploadProgress` and `onDownloadProgress` ([#423](https://github.com/axios/axios/pull/423)) +- Adding support for `http_proxy` and `https_proxy` environment variables ([#366](https://github.com/axios/axios/pull/366)) +- Fixing issue with `auth` config option and `Authorization` header ([#397](https://github.com/axios/axios/pull/397)) +- Don't set XSRF header if `xsrfCookieName` is `null` ([#406](https://github.com/axios/axios/pull/406)) + +### 0.13.1 (Jul 16, 2016) + +- Fixing issue with response data not being transformed on error ([#378](https://github.com/axios/axios/issues/378)) + +### 0.13.0 (Jul 13, 2016) + +- **BREAKING** Improved error handling ([#345](https://github.com/axios/axios/pull/345)) +- **BREAKING** Response transformer now invoked in dispatcher not adapter ([10eb238](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e)) +- **BREAKING** Request adapters now return a `Promise` ([157efd5](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a)) +- Fixing issue with `withCredentials` not being overwritten ([#343](https://github.com/axios/axios/issues/343)) +- Fixing regression with request transformer being called before request interceptor ([#352](https://github.com/axios/axios/issues/352)) +- Fixing custom instance defaults ([#341](https://github.com/axios/axios/issues/341)) +- Fixing instances created from `axios.create` to have same API as default axios ([#217](https://github.com/axios/axios/issues/217)) + +### 0.12.0 (May 31, 2016) + +- Adding support for `URLSearchParams` ([#317](https://github.com/axios/axios/pull/317)) +- Adding `maxRedirects` option ([#307](https://github.com/axios/axios/pull/307)) + +### 0.11.1 (May 17, 2016) + +- Fixing IE CORS support ([#313](https://github.com/axios/axios/pull/313)) +- Fixing detection of `FormData` ([#325](https://github.com/axios/axios/pull/325)) +- Adding `Axios` class to exports ([#321](https://github.com/axios/axios/pull/321)) + +### 0.11.0 (Apr 26, 2016) + +- Adding support for Stream with HTTP adapter ([#296](https://github.com/axios/axios/pull/296)) +- Adding support for custom HTTP status code error ranges ([#308](https://github.com/axios/axios/pull/308)) +- Fixing issue with ArrayBuffer ([#299](https://github.com/axios/axios/pull/299)) + +### 0.10.0 (Apr 20, 2016) + +- Fixing issue with some requests sending `undefined` instead of `null` ([#250](https://github.com/axios/axios/pull/250)) +- Fixing basic auth for HTTP adapter ([#252](https://github.com/axios/axios/pull/252)) +- Fixing request timeout for XHR adapter ([#227](https://github.com/axios/axios/pull/227)) +- Fixing IE8 support by using `onreadystatechange` instead of `onload` ([#249](https://github.com/axios/axios/pull/249)) +- Fixing IE9 cross domain requests ([#251](https://github.com/axios/axios/pull/251)) +- Adding `maxContentLength` option ([#275](https://github.com/axios/axios/pull/275)) +- Fixing XHR support for WebWorker environment ([#279](https://github.com/axios/axios/pull/279)) +- Adding request instance to response ([#200](https://github.com/axios/axios/pull/200)) + +### 0.9.1 (Jan 24, 2016) + +- Improving handling of request timeout in node ([#124](https://github.com/axios/axios/issues/124)) +- Fixing network errors not rejecting ([#205](https://github.com/axios/axios/pull/205)) +- Fixing issue with IE rejecting on HTTP 204 ([#201](https://github.com/axios/axios/issues/201)) +- Fixing host/port when following redirects ([#198](https://github.com/axios/axios/pull/198)) + +### 0.9.0 (Jan 18, 2016) + +- Adding support for custom adapters +- Fixing Content-Type header being removed when data is false ([#195](https://github.com/axios/axios/pull/195)) +- Improving XDomainRequest implementation ([#185](https://github.com/axios/axios/pull/185)) +- Improving config merging and order of precedence ([#183](https://github.com/axios/axios/pull/183)) +- Fixing XDomainRequest support for only <= IE9 ([#182](https://github.com/axios/axios/pull/182)) + +### 0.8.1 (Dec 14, 2015) + +- Adding support for passing XSRF token for cross domain requests when using `withCredentials` ([#168](https://github.com/axios/axios/pull/168)) +- Fixing error with format of basic auth header ([#178](https://github.com/axios/axios/pull/173)) +- Fixing error with JSON payloads throwing `InvalidStateError` in some cases ([#174](https://github.com/axios/axios/pull/174)) + +### 0.8.0 (Dec 11, 2015) + +- Adding support for creating instances of axios ([#123](https://github.com/axios/axios/pull/123)) +- Fixing http adapter to use `Buffer` instead of `String` in case of `responseType === 'arraybuffer'` ([#128](https://github.com/axios/axios/pull/128)) +- Adding support for using custom parameter serializer with `paramsSerializer` option ([#121](https://github.com/axios/axios/pull/121)) +- Fixing issue in IE8 caused by `forEach` on `arguments` ([#127](https://github.com/axios/axios/pull/127)) +- Adding support for following redirects in node ([#146](https://github.com/axios/axios/pull/146)) +- Adding support for transparent decompression if `content-encoding` is set ([#149](https://github.com/axios/axios/pull/149)) +- Adding support for transparent XDomainRequest to handle cross domain requests in IE9 ([#140](https://github.com/axios/axios/pull/140)) +- Adding support for HTTP basic auth via Authorization header ([#167](https://github.com/axios/axios/pull/167)) +- Adding support for baseURL option ([#160](https://github.com/axios/axios/pull/160)) + +### 0.7.0 (Sep 29, 2015) + +- Fixing issue with minified bundle in IE8 ([#87](https://github.com/axios/axios/pull/87)) +- Adding support for passing agent in node ([#102](https://github.com/axios/axios/pull/102)) +- Adding support for returning result from `axios.spread` for chaining ([#106](https://github.com/axios/axios/pull/106)) +- Fixing typescript definition ([#105](https://github.com/axios/axios/pull/105)) +- Fixing default timeout config for node ([#112](https://github.com/axios/axios/pull/112)) +- Adding support for use in web workers, and react-native ([#70](https://github.com/axios/axios/issue/70)), ([#98](https://github.com/axios/axios/pull/98)) +- Adding support for fetch like API `axios(url[, config])` ([#116](https://github.com/axios/axios/issues/116)) + +### 0.6.0 (Sep 21, 2015) + +- Removing deprecated success/error aliases +- Fixing issue with array params not being properly encoded ([#49](https://github.com/axios/axios/pull/49)) +- Fixing issue with User-Agent getting overridden ([#69](https://github.com/axios/axios/issues/69)) +- Adding support for timeout config ([#56](https://github.com/axios/axios/issues/56)) +- Removing es6-promise dependency +- Fixing issue preventing `length` to be used as a parameter ([#91](https://github.com/axios/axios/pull/91)) +- Fixing issue with IE8 ([#85](https://github.com/axios/axios/pull/85)) +- Converting build to UMD + +### 0.5.4 (Apr 08, 2015) + +- Fixing issue with FormData not being sent ([#53](https://github.com/axios/axios/issues/53)) + +### 0.5.3 (Apr 07, 2015) + +- Using JSON.parse unconditionally when transforming response string ([#55](https://github.com/axios/axios/issues/55)) + +### 0.5.2 (Mar 13, 2015) + +- Adding support for `statusText` in response ([#46](https://github.com/axios/axios/issues/46)) + +### 0.5.1 (Mar 10, 2015) + +- Fixing issue using strict mode ([#45](https://github.com/axios/axios/issues/45)) +- Fixing issue with standalone build ([#47](https://github.com/axios/axios/issues/47)) + +### 0.5.0 (Jan 23, 2015) + +- Adding support for intercepetors ([#14](https://github.com/axios/axios/issues/14)) +- Updating es6-promise dependency + +### 0.4.2 (Dec 10, 2014) + +- Fixing issue with `Content-Type` when using `FormData` ([#22](https://github.com/axios/axios/issues/22)) +- Adding support for TypeScript ([#25](https://github.com/axios/axios/issues/25)) +- Fixing issue with standalone build ([#29](https://github.com/axios/axios/issues/29)) +- Fixing issue with verbs needing to be capitalized in some browsers ([#30](https://github.com/axios/axios/issues/30)) + +### 0.4.1 (Oct 15, 2014) + +- Adding error handling to request for node.js ([#18](https://github.com/axios/axios/issues/18)) + +### 0.4.0 (Oct 03, 2014) + +- Adding support for `ArrayBuffer` and `ArrayBufferView` ([#10](https://github.com/axios/axios/issues/10)) +- Adding support for utf-8 for node.js ([#13](https://github.com/axios/axios/issues/13)) +- Adding support for SSL for node.js ([#12](https://github.com/axios/axios/issues/12)) +- Fixing incorrect `Content-Type` header ([#9](https://github.com/axios/axios/issues/9)) +- Adding standalone build without bundled es6-promise ([#11](https://github.com/axios/axios/issues/11)) +- Deprecating `success`/`error` in favor of `then`/`catch` + +### 0.3.1 (Sep 16, 2014) + +- Fixing missing post body when using node.js ([#3](https://github.com/axios/axios/issues/3)) + +### 0.3.0 (Sep 16, 2014) + +- Fixing `success` and `error` to properly receive response data as individual arguments ([#8](https://github.com/axios/axios/issues/8)) +- Updating `then` and `catch` to receive response data as a single object ([#6](https://github.com/axios/axios/issues/6)) +- Fixing issue with `all` not working ([#7](https://github.com/axios/axios/issues/7)) + +### 0.2.2 (Sep 14, 2014) + +- Fixing bundling with browserify ([#4](https://github.com/axios/axios/issues/4)) + +### 0.2.1 (Sep 12, 2014) + +- Fixing build problem causing ridiculous file sizes + +### 0.2.0 (Sep 12, 2014) + +- Adding support for `all` and `spread` +- Adding support for node.js ([#1](https://github.com/axios/axios/issues/1)) + +### 0.1.0 (Aug 29, 2014) + +- Initial release diff --git a/helloworld/node_modules/axios/LICENSE b/helloworld/node_modules/axios/LICENSE new file mode 100755 index 0000000..9876c2c --- /dev/null +++ b/helloworld/node_modules/axios/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2014 Matt Zabriskie + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/axios/README.md b/helloworld/node_modules/axios/README.md new file mode 100755 index 0000000..95d91e7 --- /dev/null +++ b/helloworld/node_modules/axios/README.md @@ -0,0 +1,612 @@ +# axios + +[![npm version](https://img.shields.io/npm/v/axios.svg?style=flat-square)](https://www.npmjs.org/package/axios) +[![build status](https://img.shields.io/travis/axios/axios.svg?style=flat-square)](https://travis-ci.org/axios/axios) +[![code coverage](https://img.shields.io/coveralls/mzabriskie/axios.svg?style=flat-square)](https://coveralls.io/r/mzabriskie/axios) +[![npm downloads](https://img.shields.io/npm/dm/axios.svg?style=flat-square)](http://npm-stat.com/charts.html?package=axios) +[![gitter chat](https://img.shields.io/gitter/room/mzabriskie/axios.svg?style=flat-square)](https://gitter.im/mzabriskie/axios) + +Promise based HTTP client for the browser and node.js + +## Features + +- Make [XMLHttpRequests](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest) from the browser +- Make [http](http://nodejs.org/api/http.html) requests from node.js +- Supports the [Promise](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise) API +- Intercept request and response +- Transform request and response data +- Cancel requests +- Automatic transforms for JSON data +- Client side support for protecting against [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) + +## Browser Support + +![Chrome](https://raw.github.com/alrra/browser-logos/master/src/chrome/chrome_48x48.png) | ![Firefox](https://raw.github.com/alrra/browser-logos/master/src/firefox/firefox_48x48.png) | ![Safari](https://raw.github.com/alrra/browser-logos/master/src/safari/safari_48x48.png) | ![Opera](https://raw.github.com/alrra/browser-logos/master/src/opera/opera_48x48.png) | ![Edge](https://raw.github.com/alrra/browser-logos/master/src/edge/edge_48x48.png) | ![IE](https://raw.github.com/alrra/browser-logos/master/src/archive/internet-explorer_9-11/internet-explorer_9-11_48x48.png) | +--- | --- | --- | --- | --- | --- | +Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | 8+ ✔ | + +[![Browser Matrix](https://saucelabs.com/open_sauce/build_matrix/axios.svg)](https://saucelabs.com/u/axios) + +## Installing + +Using npm: + +```bash +$ npm install axios +``` + +Using bower: + +```bash +$ bower install axios +``` + +Using cdn: + +```html + +``` + +## Example + +Performing a `GET` request + +```js +// Make a request for a user with a given ID +axios.get('/user?ID=12345') + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); + +// Optionally the request above could also be done as +axios.get('/user', { + params: { + ID: 12345 + } + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); +``` + +Performing a `POST` request + +```js +axios.post('/user', { + firstName: 'Fred', + lastName: 'Flintstone' + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); +``` + +Performing multiple concurrent requests + +```js +function getUserAccount() { + return axios.get('/user/12345'); +} + +function getUserPermissions() { + return axios.get('/user/12345/permissions'); +} + +axios.all([getUserAccount(), getUserPermissions()]) + .then(axios.spread(function (acct, perms) { + // Both requests are now complete + })); +``` + +## axios API + +Requests can be made by passing the relevant config to `axios`. + +##### axios(config) + +```js +// Send a POST request +axios({ + method: 'post', + url: '/user/12345', + data: { + firstName: 'Fred', + lastName: 'Flintstone' + } +}); +``` + +```js +// GET request for remote image +axios({ + method:'get', + url:'http://bit.ly/2mTM3nY', + responseType:'stream' +}) + .then(function(response) { + response.data.pipe(fs.createWriteStream('ada_lovelace.jpg')) +}); +``` + +##### axios(url[, config]) + +```js +// Send a GET request (default method) +axios('/user/12345'); +``` + +### Request method aliases + +For convenience aliases have been provided for all supported request methods. + +##### axios.request(config) +##### axios.get(url[, config]) +##### axios.delete(url[, config]) +##### axios.head(url[, config]) +##### axios.options(url[, config]) +##### axios.post(url[, data[, config]]) +##### axios.put(url[, data[, config]]) +##### axios.patch(url[, data[, config]]) + +###### NOTE +When using the alias methods `url`, `method`, and `data` properties don't need to be specified in config. + +### Concurrency + +Helper functions for dealing with concurrent requests. + +##### axios.all(iterable) +##### axios.spread(callback) + +### Creating an instance + +You can create a new instance of axios with a custom config. + +##### axios.create([config]) + +```js +var instance = axios.create({ + baseURL: 'https://some-domain.com/api/', + timeout: 1000, + headers: {'X-Custom-Header': 'foobar'} +}); +``` + +### Instance methods + +The available instance methods are listed below. The specified config will be merged with the instance config. + +##### axios#request(config) +##### axios#get(url[, config]) +##### axios#delete(url[, config]) +##### axios#head(url[, config]) +##### axios#options(url[, config]) +##### axios#post(url[, data[, config]]) +##### axios#put(url[, data[, config]]) +##### axios#patch(url[, data[, config]]) + +## Request Config + +These are the available config options for making requests. Only the `url` is required. Requests will default to `GET` if `method` is not specified. + +```js +{ + // `url` is the server URL that will be used for the request + url: '/user', + + // `method` is the request method to be used when making the request + method: 'get', // default + + // `baseURL` will be prepended to `url` unless `url` is absolute. + // It can be convenient to set `baseURL` for an instance of axios to pass relative URLs + // to methods of that instance. + baseURL: 'https://some-domain.com/api/', + + // `transformRequest` allows changes to the request data before it is sent to the server + // This is only applicable for request methods 'PUT', 'POST', and 'PATCH' + // The last function in the array must return a string or an instance of Buffer, ArrayBuffer, + // FormData or Stream + // You may modify the headers object. + transformRequest: [function (data, headers) { + // Do whatever you want to transform the data + + return data; + }], + + // `transformResponse` allows changes to the response data to be made before + // it is passed to then/catch + transformResponse: [function (data) { + // Do whatever you want to transform the data + + return data; + }], + + // `headers` are custom headers to be sent + headers: {'X-Requested-With': 'XMLHttpRequest'}, + + // `params` are the URL parameters to be sent with the request + // Must be a plain object or a URLSearchParams object + params: { + ID: 12345 + }, + + // `paramsSerializer` is an optional function in charge of serializing `params` + // (e.g. https://www.npmjs.com/package/qs, http://api.jquery.com/jquery.param/) + paramsSerializer: function(params) { + return Qs.stringify(params, {arrayFormat: 'brackets'}) + }, + + // `data` is the data to be sent as the request body + // Only applicable for request methods 'PUT', 'POST', and 'PATCH' + // When no `transformRequest` is set, must be of one of the following types: + // - string, plain object, ArrayBuffer, ArrayBufferView, URLSearchParams + // - Browser only: FormData, File, Blob + // - Node only: Stream, Buffer + data: { + firstName: 'Fred' + }, + + // `timeout` specifies the number of milliseconds before the request times out. + // If the request takes longer than `timeout`, the request will be aborted. + timeout: 1000, + + // `withCredentials` indicates whether or not cross-site Access-Control requests + // should be made using credentials + withCredentials: false, // default + + // `adapter` allows custom handling of requests which makes testing easier. + // Return a promise and supply a valid response (see lib/adapters/README.md). + adapter: function (config) { + /* ... */ + }, + + // `auth` indicates that HTTP Basic auth should be used, and supplies credentials. + // This will set an `Authorization` header, overwriting any existing + // `Authorization` custom headers you have set using `headers`. + auth: { + username: 'janedoe', + password: 's00pers3cret' + }, + + // `responseType` indicates the type of data that the server will respond with + // options are 'arraybuffer', 'blob', 'document', 'json', 'text', 'stream' + responseType: 'json', // default + + // `xsrfCookieName` is the name of the cookie to use as a value for xsrf token + xsrfCookieName: 'XSRF-TOKEN', // default + + // `xsrfHeaderName` is the name of the http header that carries the xsrf token value + xsrfHeaderName: 'X-XSRF-TOKEN', // default + + // `onUploadProgress` allows handling of progress events for uploads + onUploadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `onDownloadProgress` allows handling of progress events for downloads + onDownloadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `maxContentLength` defines the max size of the http response content allowed + maxContentLength: 2000, + + // `validateStatus` defines whether to resolve or reject the promise for a given + // HTTP response status code. If `validateStatus` returns `true` (or is set to `null` + // or `undefined`), the promise will be resolved; otherwise, the promise will be + // rejected. + validateStatus: function (status) { + return status >= 200 && status < 300; // default + }, + + // `maxRedirects` defines the maximum number of redirects to follow in node.js. + // If set to 0, no redirects will be followed. + maxRedirects: 5, // default + + // `httpAgent` and `httpsAgent` define a custom agent to be used when performing http + // and https requests, respectively, in node.js. This allows options to be added like + // `keepAlive` that are not enabled by default. + httpAgent: new http.Agent({ keepAlive: true }), + httpsAgent: new https.Agent({ keepAlive: true }), + + // 'proxy' defines the hostname and port of the proxy server + // Use `false` to disable proxies, ignoring environment variables. + // `auth` indicates that HTTP Basic auth should be used to connect to the proxy, and + // supplies credentials. + // This will set an `Proxy-Authorization` header, overwriting any existing + // `Proxy-Authorization` custom headers you have set using `headers`. + proxy: { + host: '127.0.0.1', + port: 9000, + auth: { + username: 'mikeymike', + password: 'rapunz3l' + } + }, + + // `cancelToken` specifies a cancel token that can be used to cancel the request + // (see Cancellation section below for details) + cancelToken: new CancelToken(function (cancel) { + }) +} +``` + +## Response Schema + +The response for a request contains the following information. + +```js +{ + // `data` is the response that was provided by the server + data: {}, + + // `status` is the HTTP status code from the server response + status: 200, + + // `statusText` is the HTTP status message from the server response + statusText: 'OK', + + // `headers` the headers that the server responded with + // All header names are lower cased + headers: {}, + + // `config` is the config that was provided to `axios` for the request + config: {}, + + // `request` is the request that generated this response + // It is the last ClientRequest instance in node.js (in redirects) + // and an XMLHttpRequest instance the browser + request: {} +} +``` + +When using `then`, you will receive the response as follows: + +```js +axios.get('/user/12345') + .then(function(response) { + console.log(response.data); + console.log(response.status); + console.log(response.statusText); + console.log(response.headers); + console.log(response.config); + }); +``` + +When using `catch`, or passing a [rejection callback](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise/then) as second parameter of `then`, the response will be available through the `error` object as explained in the [Handling Errors](#handling-errors) section. + +## Config Defaults + +You can specify config defaults that will be applied to every request. + +### Global axios defaults + +```js +axios.defaults.baseURL = 'https://api.example.com'; +axios.defaults.headers.common['Authorization'] = AUTH_TOKEN; +axios.defaults.headers.post['Content-Type'] = 'application/x-www-form-urlencoded'; +``` + +### Custom instance defaults + +```js +// Set config defaults when creating the instance +var instance = axios.create({ + baseURL: 'https://api.example.com' +}); + +// Alter defaults after instance has been created +instance.defaults.headers.common['Authorization'] = AUTH_TOKEN; +``` + +### Config order of precedence + +Config will be merged with an order of precedence. The order is library defaults found in `lib/defaults.js`, then `defaults` property of the instance, and finally `config` argument for the request. The latter will take precedence over the former. Here's an example. + +```js +// Create an instance using the config defaults provided by the library +// At this point the timeout config value is `0` as is the default for the library +var instance = axios.create(); + +// Override timeout default for the library +// Now all requests will wait 2.5 seconds before timing out +instance.defaults.timeout = 2500; + +// Override timeout for this request as it's known to take a long time +instance.get('/longRequest', { + timeout: 5000 +}); +``` + +## Interceptors + +You can intercept requests or responses before they are handled by `then` or `catch`. + +```js +// Add a request interceptor +axios.interceptors.request.use(function (config) { + // Do something before request is sent + return config; + }, function (error) { + // Do something with request error + return Promise.reject(error); + }); + +// Add a response interceptor +axios.interceptors.response.use(function (response) { + // Do something with response data + return response; + }, function (error) { + // Do something with response error + return Promise.reject(error); + }); +``` + +If you may need to remove an interceptor later you can. + +```js +var myInterceptor = axios.interceptors.request.use(function () {/*...*/}); +axios.interceptors.request.eject(myInterceptor); +``` + +You can add interceptors to a custom instance of axios. + +```js +var instance = axios.create(); +instance.interceptors.request.use(function () {/*...*/}); +``` + +## Handling Errors + +```js +axios.get('/user/12345') + .catch(function (error) { + if (error.response) { + // The request was made and the server responded with a status code + // that falls out of the range of 2xx + console.log(error.response.data); + console.log(error.response.status); + console.log(error.response.headers); + } else if (error.request) { + // The request was made but no response was received + // `error.request` is an instance of XMLHttpRequest in the browser and an instance of + // http.ClientRequest in node.js + console.log(error.request); + } else { + // Something happened in setting up the request that triggered an Error + console.log('Error', error.message); + } + console.log(error.config); + }); +``` + +You can define a custom HTTP status code error range using the `validateStatus` config option. + +```js +axios.get('/user/12345', { + validateStatus: function (status) { + return status < 500; // Reject only if the status code is greater than or equal to 500 + } +}) +``` + +## Cancellation + +You can cancel a request using a *cancel token*. + +> The axios cancel token API is based on the withdrawn [cancelable promises proposal](https://github.com/tc39/proposal-cancelable-promises). + +You can create a cancel token using the `CancelToken.source` factory as shown below: + +```js +var CancelToken = axios.CancelToken; +var source = CancelToken.source(); + +axios.get('/user/12345', { + cancelToken: source.token +}).catch(function(thrown) { + if (axios.isCancel(thrown)) { + console.log('Request canceled', thrown.message); + } else { + // handle error + } +}); + +// cancel the request (the message parameter is optional) +source.cancel('Operation canceled by the user.'); +``` + +You can also create a cancel token by passing an executor function to the `CancelToken` constructor: + +```js +var CancelToken = axios.CancelToken; +var cancel; + +axios.get('/user/12345', { + cancelToken: new CancelToken(function executor(c) { + // An executor function receives a cancel function as a parameter + cancel = c; + }) +}); + +// cancel the request +cancel(); +``` + +> Note: you can cancel several requests with the same cancel token. + +## Using application/x-www-form-urlencoded format + +By default, axios serializes JavaScript objects to `JSON`. To send data in the `application/x-www-form-urlencoded` format instead, you can use one of the following options. + +### Browser + +In a browser, you can use the [`URLSearchParams`](https://developer.mozilla.org/en-US/docs/Web/API/URLSearchParams) API as follows: + +```js +var params = new URLSearchParams(); +params.append('param1', 'value1'); +params.append('param2', 'value2'); +axios.post('/foo', params); +``` + +> Note that `URLSearchParams` is not supported by all browsers (see [caniuse.com](http://www.caniuse.com/#feat=urlsearchparams)), but there is a [polyfill](https://github.com/WebReflection/url-search-params) available (make sure to polyfill the global environment). + +Alternatively, you can encode data using the [`qs`](https://github.com/ljharb/qs) library: + +```js +var qs = require('qs'); +axios.post('/foo', qs.stringify({ 'bar': 123 })); +``` + +### Node.js + +In node.js, you can use the [`querystring`](https://nodejs.org/api/querystring.html) module as follows: + +```js +var querystring = require('querystring'); +axios.post('http://something.com/', querystring.stringify({ foo: 'bar' })); +``` + +You can also use the [`qs`](https://github.com/ljharb/qs) library. + +## Semver + +Until axios reaches a `1.0` release, breaking changes will be released with a new minor version. For example `0.5.1`, and `0.5.4` will have the same API, but `0.6.0` will have breaking changes. + +## Promises + +axios depends on a native ES6 Promise implementation to be [supported](http://caniuse.com/promises). +If your environment doesn't support ES6 Promises, you can [polyfill](https://github.com/jakearchibald/es6-promise). + +## TypeScript +axios includes [TypeScript](http://typescriptlang.org) definitions. +```typescript +import axios from 'axios'; +axios.get('/user?ID=12345'); +``` + +## Resources + +* [Changelog](https://github.com/axios/axios/blob/master/CHANGELOG.md) +* [Upgrade Guide](https://github.com/axios/axios/blob/master/UPGRADE_GUIDE.md) +* [Ecosystem](https://github.com/axios/axios/blob/master/ECOSYSTEM.md) +* [Contributing Guide](https://github.com/axios/axios/blob/master/CONTRIBUTING.md) +* [Code of Conduct](https://github.com/axios/axios/blob/master/CODE_OF_CONDUCT.md) + +## Credits + +axios is heavily inspired by the [$http service](https://docs.angularjs.org/api/ng/service/$http) provided in [Angular](https://angularjs.org/). Ultimately axios is an effort to provide a standalone `$http`-like service for use outside of Angular. + +## License + +MIT diff --git a/helloworld/node_modules/axios/UPGRADE_GUIDE.md b/helloworld/node_modules/axios/UPGRADE_GUIDE.md new file mode 100755 index 0000000..eedb049 --- /dev/null +++ b/helloworld/node_modules/axios/UPGRADE_GUIDE.md @@ -0,0 +1,162 @@ +# Upgrade Guide + +### 0.15.x -> 0.16.0 + +#### `Promise` Type Declarations + +The `Promise` type declarations have been removed from the axios typings in favor of the built-in type declarations. If you use axios in a TypeScript project that targets `ES5`, please make sure to include the `es2015.promise` lib. Please see [this post](https://blog.mariusschulz.com/2016/11/25/typescript-2-0-built-in-type-declarations) for details. + +### 0.13.x -> 0.14.0 + +#### TypeScript Definitions + +The axios TypeScript definitions have been updated to match the axios API and use the ES2015 module syntax. + +Please use the following `import` statement to import axios in TypeScript: + +```typescript +import axios from 'axios'; + +axios.get('/foo') + .then(response => console.log(response)) + .catch(error => console.log(error)); +``` + +#### `agent` Config Option + +The `agent` config option has been replaced with two new options: `httpAgent` and `httpsAgent`. Please use them instead. + +```js +{ + // Define a custom agent for HTTP + httpAgent: new http.Agent({ keepAlive: true }), + // Define a custom agent for HTTPS + httpsAgent: new https.Agent({ keepAlive: true }) +} +``` + +#### `progress` Config Option + +The `progress` config option has been replaced with the `onUploadProgress` and `onDownloadProgress` options. + +```js +{ + // Define a handler for upload progress events + onUploadProgress: function (progressEvent) { + // ... + }, + + // Define a handler for download progress events + onDownloadProgress: function (progressEvent) { + // ... + } +} +``` + +### 0.12.x -> 0.13.0 + +The `0.13.0` release contains several changes to custom adapters and error handling. + +#### Error Handling + +Previous to this release an error could either be a server response with bad status code or an actual `Error`. With this release Promise will always reject with an `Error`. In the case that a response was received, the `Error` will also include the response. + +```js +axios.get('/user/12345') + .catch((error) => { + console.log(error.message); + console.log(error.code); // Not always specified + console.log(error.config); // The config that was used to make the request + console.log(error.response); // Only available if response was received from the server + }); +``` + +#### Request Adapters + +This release changes a few things about how request adapters work. Please take note if you are using your own custom adapter. + +1. Response transformer is now called outside of adapter. +2. Request adapter returns a `Promise`. + +This means that you no longer need to invoke `transformData` on response data. You will also no longer receive `resolve` and `reject` as arguments in your adapter. + +Previous code: + +```js +function myAdapter(resolve, reject, config) { + var response = { + data: transformData( + responseData, + responseHeaders, + config.transformResponse + ), + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); +} +``` + +New code: + +```js +function myAdapter(config) { + return new Promise(function (resolve, reject) { + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); + }); +} +``` + +See the related commits for more details: +- [Response transformers](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e) +- [Request adapter Promise](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a) + +### 0.5.x -> 0.6.0 + +The `0.6.0` release contains mostly bug fixes, but there are a couple things to be aware of when upgrading. + +#### ES6 Promise Polyfill + +Up until the `0.6.0` release ES6 `Promise` was being polyfilled using [es6-promise](https://github.com/jakearchibald/es6-promise). With this release, the polyfill has been removed, and you will need to supply it yourself if your environment needs it. + +```js +require('es6-promise').polyfill(); +var axios = require('axios'); +``` + +This will polyfill the global environment, and only needs to be done once. + +#### `axios.success`/`axios.error` + +The `success`, and `error` aliases were deprectated in [0.4.0](https://github.com/axios/axios/blob/master/CHANGELOG.md#040-oct-03-2014). As of this release they have been removed entirely. Instead please use `axios.then`, and `axios.catch` respectively. + +```js +axios.get('some/url') + .then(function (res) { + /* ... */ + }) + .catch(function (err) { + /* ... */ + }); +``` + +#### UMD + +Previous versions of axios shipped with an AMD, CommonJS, and Global build. This has all been rolled into a single UMD build. + +```js +// AMD +require(['bower_components/axios/dist/axios'], function (axios) { + /* ... */ +}); + +// CommonJS +var axios = require('axios/dist/axios'); +``` diff --git a/helloworld/node_modules/axios/dist/axios.js b/helloworld/node_modules/axios/dist/axios.js new file mode 100755 index 0000000..4973268 --- /dev/null +++ b/helloworld/node_modules/axios/dist/axios.js @@ -0,0 +1,1601 @@ +/* axios v0.17.1 | (c) 2017 by Matt Zabriskie */ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["axios"] = factory(); + else + root["axios"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; +/******/ +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.loaded = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + module.exports = __webpack_require__(1); + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var bind = __webpack_require__(3); + var Axios = __webpack_require__(5); + var defaults = __webpack_require__(6); + + /** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ + function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + return instance; + } + + // Create the default instance to be exported + var axios = createInstance(defaults); + + // Expose Axios class to allow class inheritance + axios.Axios = Axios; + + // Factory for creating new instances + axios.create = function create(instanceConfig) { + return createInstance(utils.merge(defaults, instanceConfig)); + }; + + // Expose Cancel & CancelToken + axios.Cancel = __webpack_require__(23); + axios.CancelToken = __webpack_require__(24); + axios.isCancel = __webpack_require__(20); + + // Expose all/spread + axios.all = function all(promises) { + return Promise.all(promises); + }; + axios.spread = __webpack_require__(25); + + module.exports = axios; + + // Allow use of default import syntax in TypeScript + module.exports.default = axios; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var bind = __webpack_require__(3); + var isBuffer = __webpack_require__(4); + + /*global toString:true*/ + + // utils is a library of generic helper functions non-specific to axios + + var toString = Object.prototype.toString; + + /** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ + function isArray(val) { + return toString.call(val) === '[object Array]'; + } + + /** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ + function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; + } + + /** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ + function isFormData(val) { + return (typeof FormData !== 'undefined') && (val instanceof FormData); + } + + /** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ + function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + } + return result; + } + + /** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ + function isString(val) { + return typeof val === 'string'; + } + + /** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ + function isNumber(val) { + return typeof val === 'number'; + } + + /** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ + function isUndefined(val) { + return typeof val === 'undefined'; + } + + /** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ + function isObject(val) { + return val !== null && typeof val === 'object'; + } + + /** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ + function isDate(val) { + return toString.call(val) === '[object Date]'; + } + + /** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ + function isFile(val) { + return toString.call(val) === '[object File]'; + } + + /** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ + function isBlob(val) { + return toString.call(val) === '[object Blob]'; + } + + /** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ + function isFunction(val) { + return toString.call(val) === '[object Function]'; + } + + /** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ + function isStream(val) { + return isObject(val) && isFunction(val.pipe); + } + + /** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ + function isURLSearchParams(val) { + return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; + } + + /** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ + function trim(str) { + return str.replace(/^\s*/, '').replace(/\s*$/, ''); + } + + /** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + */ + function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); + } + + /** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ + function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } + } + + /** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ + function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = merge(result[key], val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; + } + + /** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ + function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; + } + + module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + 'use strict'; + + module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /*! + * Determine if an object is a Buffer + * + * @author Feross Aboukhadijeh + * @license MIT + */ + + // The _isBuffer check is for Safari 5-7 support, because it's missing + // Object.prototype.constructor. Remove this eventually + module.exports = function (obj) { + return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer) + } + + function isBuffer (obj) { + return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj) + } + + // For Node v0.10 support. Remove this eventually. + function isSlowBuffer (obj) { + return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0)) + } + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var defaults = __webpack_require__(6); + var utils = __webpack_require__(2); + var InterceptorManager = __webpack_require__(17); + var dispatchRequest = __webpack_require__(18); + + /** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ + function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; + } + + /** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ + Axios.prototype.request = function request(config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof config === 'string') { + config = utils.merge({ + url: arguments[0] + }, arguments[1]); + } + + config = utils.merge(defaults, this.defaults, { method: 'get' }, config); + config.method = config.method.toLowerCase(); + + // Hook up interceptors middleware + var chain = [dispatchRequest, undefined]; + var promise = Promise.resolve(config); + + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + chain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + chain.push(interceptor.fulfilled, interceptor.rejected); + }); + + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + }; + + // Provide aliases for supported request methods + utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url + })); + }; + }); + + utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url, + data: data + })); + }; + }); + + module.exports = Axios; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var normalizeHeaderName = __webpack_require__(7); + + var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' + }; + + function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } + } + + function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = __webpack_require__(8); + } else if (typeof process !== 'undefined') { + // For node use HTTP adapter + adapter = __webpack_require__(8); + } + return adapter; + } + + var defaults = { + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data)) { + setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); + return JSON.stringify(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + /*eslint no-param-reassign:0*/ + if (typeof data === 'string') { + try { + data = JSON.parse(data); + } catch (e) { /* Ignore */ } + } + return data; + }], + + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + } + }; + + defaults.headers = { + common: { + 'Accept': 'application/json, text/plain, */*' + } + }; + + utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; + }); + + utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); + }); + + module.exports = defaults; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); + }; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var settle = __webpack_require__(9); + var buildURL = __webpack_require__(12); + var parseHeaders = __webpack_require__(13); + var isURLSameOrigin = __webpack_require__(14); + var createError = __webpack_require__(10); + var btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(15); + + module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + var loadEvent = 'onreadystatechange'; + var xDomain = false; + + // For IE 8/9 CORS support + // Only supports POST and GET calls and doesn't returns the response headers. + // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest. + if (("production") !== 'test' && + typeof window !== 'undefined' && + window.XDomainRequest && !('withCredentials' in request) && + !isURLSameOrigin(config.url)) { + request = new window.XDomainRequest(); + loadEvent = 'onload'; + xDomain = true; + request.onprogress = function handleProgress() {}; + request.ontimeout = function handleTimeout() {}; + } + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + // Listen for ready state + request[loadEvent] = function handleLoad() { + if (!request || (request.readyState !== 4 && !xDomain)) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var response = { + data: responseData, + // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201) + status: request.status === 1223 ? 204 : request.status, + statusText: request.status === 1223 ? 'No Content' : request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + var cookies = __webpack_require__(16); + + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (config.withCredentials) { + request.withCredentials = true; + } + + // Add responseType to request if needed + if (config.responseType) { + try { + request.responseType = config.responseType; + } catch (e) { + // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. + // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. + if (config.responseType !== 'json') { + throw e; + } + } + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (!request) { + return; + } + + request.abort(); + reject(cancel); + // Clean up request + request = null; + }); + } + + if (requestData === undefined) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var createError = __webpack_require__(10); + + /** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ + module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + // Note: status is not exposed by XDomainRequest + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var enhanceError = __webpack_require__(11); + + /** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ + module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); + }; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ + module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + error.request = request; + error.response = response; + return error; + }; + + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + function encode(val) { + return encodeURIComponent(val). + replace(/%40/gi, '@'). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); + } + + /** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ + module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } + + if (!utils.isArray(val)) { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; + }; + + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + // Headers whose duplicates are ignored by node + // c.f. https://nodejs.org/api/http.html#http_message_headers + var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' + ]; + + /** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ + module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; + }; + + +/***/ }), +/* 14 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() + ); + + +/***/ }), +/* 15 */ +/***/ (function(module, exports) { + + 'use strict'; + + // btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js + + var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='; + + function E() { + this.message = 'String contains an invalid character'; + } + E.prototype = new Error; + E.prototype.code = 5; + E.prototype.name = 'InvalidCharacterError'; + + function btoa(input) { + var str = String(input); + var output = ''; + for ( + // initialize result and counter + var block, charCode, idx = 0, map = chars; + // if the next str index does not exist: + // change the mapping table to "=" + // check if d has no fractional digits + str.charAt(idx | 0) || (map = '=', idx % 1); + // "8 - idx % 1 * 8" generates the sequence 2, 4, 6, 8 + output += map.charAt(63 & block >> 8 - idx % 1 * 8) + ) { + charCode = str.charCodeAt(idx += 3 / 4); + if (charCode > 0xFF) { + throw new E(); + } + block = block << 8 | charCode; + } + return output; + } + + module.exports = btoa; + + +/***/ }), +/* 16 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() + ); + + +/***/ }), +/* 17 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + function InterceptorManager() { + this.handlers = []; + } + + /** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ + InterceptorManager.prototype.use = function use(fulfilled, rejected) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected + }); + return this.handlers.length - 1; + }; + + /** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ + InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } + }; + + /** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ + InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); + }; + + module.exports = InterceptorManager; + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var transformData = __webpack_require__(19); + var isCancel = __webpack_require__(20); + var defaults = __webpack_require__(6); + var isAbsoluteURL = __webpack_require__(21); + var combineURLs = __webpack_require__(22); + + /** + * Throws a `Cancel` if cancellation has been requested. + */ + function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } + } + + /** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ + module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Support baseURL config + if (config.baseURL && !isAbsoluteURL(config.url)) { + config.url = combineURLs(config.baseURL, config.url); + } + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData( + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers || {} + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData( + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData( + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); + }; + + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + /** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ + module.exports = function transformData(data, headers, fns) { + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn(data, headers); + }); + + return data; + }; + + +/***/ }), +/* 20 */ +/***/ (function(module, exports) { + + 'use strict'; + + module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); + }; + + +/***/ }), +/* 21 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ + module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); + }; + + +/***/ }), +/* 22 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ + module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; + }; + + +/***/ }), +/* 23 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ + function Cancel(message) { + this.message = message; + } + + Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); + }; + + Cancel.prototype.__CANCEL__ = true; + + module.exports = Cancel; + + +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var Cancel = __webpack_require__(23); + + /** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ + function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); + } + + /** + * Throws a `Cancel` if cancellation has been requested. + */ + CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } + }; + + /** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ + CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; + }; + + module.exports = CancelToken; + + +/***/ }), +/* 25 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ + module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; + }; + + +/***/ }) +/******/ ]) +}); +; +//# sourceMappingURL=axios.map \ No newline at end of file diff --git a/helloworld/node_modules/axios/dist/axios.map b/helloworld/node_modules/axios/dist/axios.map new file mode 100755 index 0000000..991d6f4 --- /dev/null +++ b/helloworld/node_modules/axios/dist/axios.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///webpack/bootstrap 7a72bd6f34f8c9d3e179","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./~/is-buffer/index.js","webpack:///./lib/core/Axios.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/btoa.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD,O;ACVA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,uBAAe;AACf;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;ACtCA,yC;;;;;;ACAA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,aAAY,MAAM;AAClB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;;;;;;ACnDA;;AAEA;AACA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,aAAa;AACxB,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,oCAAmC,OAAO;AAC1C;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,SAAS,GAAG,SAAS;AAC5C,4BAA2B;AAC3B;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA,wCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;AC9SA;;AAEA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;;;;;;ACVA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;;;;;ACpBA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA,kDAAiD,gBAAgB;AACjE;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;;AAEH;AACA;AACA,IAAG;;AAEH;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;;;;;;;AC9EA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yEAAwE;AACxE;AACA;AACA;AACA,wDAAuD;AACvD;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA,QAAO,YAAY;AACnB;AACA;AACA,IAAG;;AAEH;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,EAAC;;AAED;AACA;AACA,EAAC;;AAED;;;;;;;AC3FA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;;;;;;ACXA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,6CAA4C;AAC5C;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;;;;;;ACnLA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACzBA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;;;;;;;ACjBA;;AAEA;AACA;AACA;AACA,YAAW,MAAM;AACjB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACpBA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;;;;;;ACnEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA,kBAAiB,eAAe;;AAEhC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACpDA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;;;;;;ACnEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;;;;;;ACnCA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,yCAAwC;AACxC,QAAO;;AAEP;AACA,2DAA0D,wBAAwB;AAClF;AACA,QAAO;;AAEP;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA,iCAAgC;AAChC,8BAA6B,aAAa,EAAE;AAC5C;AACA;AACA,IAAG;AACH;;;;;;;ACpDA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB;AACA,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;AAEA;;;;;;;ACnDA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gCAA+B;AAC/B,wCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;;;;;;;ACrFA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,cAAc;AACzB,YAAW,MAAM;AACjB,YAAW,eAAe;AAC1B,cAAa,EAAE;AACf;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACnBA;;AAEA;AACA;AACA;;;;;;;ACJA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;AACA;AACA;AACA;AACA,YAAW,QAAQ;AACnB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;;;;;;;AClBA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;;;;;;;ACxDA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B;AAC/B;AACA;AACA,YAAW,SAAS;AACpB,cAAa;AACb;AACA;AACA;AACA;AACA;AACA","file":"axios.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 7a72bd6f34f8c9d3e179","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(utils.merge(defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\nvar isBuffer = require('is-buffer');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh \n * @license MIT\n */\n\n// The _isBuffer check is for Safari 5-7 support, because it's missing\n// Object.prototype.constructor. Remove this eventually\nmodule.exports = function (obj) {\n return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n}\n\nfunction isBuffer (obj) {\n return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n// For Node v0.10 support. Remove this eventually.\nfunction isSlowBuffer (obj) {\n return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/is-buffer/index.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar defaults = require('./../defaults');\nvar utils = require('./../utils');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = utils.merge({\n url: arguments[0]\n }, arguments[1]);\n }\n\n config = utils.merge(defaults, this.defaults, { method: 'get' }, config);\n config.method = config.method.toLowerCase();\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\nvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || require('./../helpers/btoa');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n var loadEvent = 'onreadystatechange';\n var xDomain = false;\n\n // For IE 8/9 CORS support\n // Only supports POST and GET calls and doesn't returns the response headers.\n // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n if (process.env.NODE_ENV !== 'test' &&\n typeof window !== 'undefined' &&\n window.XDomainRequest && !('withCredentials' in request) &&\n !isURLSameOrigin(config.url)) {\n request = new window.XDomainRequest();\n loadEvent = 'onload';\n xDomain = true;\n request.onprogress = function handleProgress() {};\n request.ontimeout = function handleTimeout() {};\n }\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request[loadEvent] = function handleLoad() {\n if (!request || (request.readyState !== 4 && !xDomain)) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n status: request.status === 1223 ? 204 : request.status,\n statusText: request.status === 1223 ? 'No Content' : request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n // Note: status is not exposed by XDomainRequest\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 10\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n error.request = request;\n error.response = response;\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n }\n\n if (!utils.isArray(val)) {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 14\n// module chunks = 0","'use strict';\n\n// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\nvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\nfunction E() {\n this.message = 'String contains an invalid character';\n}\nE.prototype = new Error;\nE.prototype.code = 5;\nE.prototype.name = 'InvalidCharacterError';\n\nfunction btoa(input) {\n var str = String(input);\n var output = '';\n for (\n // initialize result and counter\n var block, charCode, idx = 0, map = chars;\n // if the next str index does not exist:\n // change the mapping table to \"=\"\n // check if d has no fractional digits\n str.charAt(idx | 0) || (map = '=', idx % 1);\n // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n ) {\n charCode = str.charCodeAt(idx += 3 / 4);\n if (charCode > 0xFF) {\n throw new E();\n }\n block = block << 8 | charCode;\n }\n return output;\n}\n\nmodule.exports = btoa;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/btoa.js\n// module id = 15\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 16\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 17\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar isAbsoluteURL = require('./../helpers/isAbsoluteURL');\nvar combineURLs = require('./../helpers/combineURLs');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 19\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 20\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 21\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/helloworld/node_modules/axios/dist/axios.min.js b/helloworld/node_modules/axios/dist/axios.min.js new file mode 100755 index 0000000..c27e70b --- /dev/null +++ b/helloworld/node_modules/axios/dist/axios.min.js @@ -0,0 +1,9 @@ +/* axios v0.17.1 | (c) 2017 by Matt Zabriskie */ +!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t():"function"==typeof define&&define.amd?define([],t):"object"==typeof exports?exports.axios=t():e.axios=t()}(this,function(){return function(e){function t(r){if(n[r])return n[r].exports;var o=n[r]={exports:{},id:r,loaded:!1};return e[r].call(o.exports,o,o.exports,t),o.loaded=!0,o.exports}var n={};return t.m=e,t.c=n,t.p="",t(0)}([function(e,t,n){e.exports=n(1)},function(e,t,n){"use strict";function r(e){var t=new s(e),n=i(s.prototype.request,t);return o.extend(n,s.prototype,t),o.extend(n,t),n}var o=n(2),i=n(3),s=n(5),u=n(6),a=r(u);a.Axios=s,a.create=function(e){return r(o.merge(u,e))},a.Cancel=n(23),a.CancelToken=n(24),a.isCancel=n(20),a.all=function(e){return Promise.all(e)},a.spread=n(25),e.exports=a,e.exports.default=a},function(e,t,n){"use strict";function r(e){return"[object Array]"===R.call(e)}function o(e){return"[object ArrayBuffer]"===R.call(e)}function i(e){return"undefined"!=typeof FormData&&e instanceof FormData}function s(e){var t;return t="undefined"!=typeof ArrayBuffer&&ArrayBuffer.isView?ArrayBuffer.isView(e):e&&e.buffer&&e.buffer instanceof ArrayBuffer}function u(e){return"string"==typeof e}function a(e){return"number"==typeof e}function c(e){return"undefined"==typeof e}function f(e){return null!==e&&"object"==typeof e}function p(e){return"[object Date]"===R.call(e)}function d(e){return"[object File]"===R.call(e)}function l(e){return"[object Blob]"===R.call(e)}function h(e){return"[object Function]"===R.call(e)}function m(e){return f(e)&&h(e.pipe)}function y(e){return"undefined"!=typeof URLSearchParams&&e instanceof URLSearchParams}function w(e){return e.replace(/^\s*/,"").replace(/\s*$/,"")}function g(){return("undefined"==typeof navigator||"ReactNative"!==navigator.product)&&("undefined"!=typeof window&&"undefined"!=typeof document)}function v(e,t){if(null!==e&&"undefined"!=typeof e)if("object"!=typeof e&&(e=[e]),r(e))for(var n=0,o=e.length;n + * @license MIT + */ +e.exports=function(e){return null!=e&&(n(e)||r(e)||!!e._isBuffer)}},function(e,t,n){"use strict";function r(e){this.defaults=e,this.interceptors={request:new s,response:new s}}var o=n(6),i=n(2),s=n(17),u=n(18);r.prototype.request=function(e){"string"==typeof e&&(e=i.merge({url:arguments[0]},arguments[1])),e=i.merge(o,this.defaults,{method:"get"},e),e.method=e.method.toLowerCase();var t=[u,void 0],n=Promise.resolve(e);for(this.interceptors.request.forEach(function(e){t.unshift(e.fulfilled,e.rejected)}),this.interceptors.response.forEach(function(e){t.push(e.fulfilled,e.rejected)});t.length;)n=n.then(t.shift(),t.shift());return n},i.forEach(["delete","get","head","options"],function(e){r.prototype[e]=function(t,n){return this.request(i.merge(n||{},{method:e,url:t}))}}),i.forEach(["post","put","patch"],function(e){r.prototype[e]=function(t,n,r){return this.request(i.merge(r||{},{method:e,url:t,data:n}))}}),e.exports=r},function(e,t,n){"use strict";function r(e,t){!i.isUndefined(e)&&i.isUndefined(e["Content-Type"])&&(e["Content-Type"]=t)}function o(){var e;return"undefined"!=typeof XMLHttpRequest?e=n(8):"undefined"!=typeof process&&(e=n(8)),e}var i=n(2),s=n(7),u={"Content-Type":"application/x-www-form-urlencoded"},a={adapter:o(),transformRequest:[function(e,t){return s(t,"Content-Type"),i.isFormData(e)||i.isArrayBuffer(e)||i.isBuffer(e)||i.isStream(e)||i.isFile(e)||i.isBlob(e)?e:i.isArrayBufferView(e)?e.buffer:i.isURLSearchParams(e)?(r(t,"application/x-www-form-urlencoded;charset=utf-8"),e.toString()):i.isObject(e)?(r(t,"application/json;charset=utf-8"),JSON.stringify(e)):e}],transformResponse:[function(e){if("string"==typeof e)try{e=JSON.parse(e)}catch(e){}return e}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,validateStatus:function(e){return e>=200&&e<300}};a.headers={common:{Accept:"application/json, text/plain, */*"}},i.forEach(["delete","get","head"],function(e){a.headers[e]={}}),i.forEach(["post","put","patch"],function(e){a.headers[e]=i.merge(u)}),e.exports=a},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t){r.forEach(e,function(n,r){r!==t&&r.toUpperCase()===t.toUpperCase()&&(e[t]=n,delete e[r])})}},function(e,t,n){"use strict";var r=n(2),o=n(9),i=n(12),s=n(13),u=n(14),a=n(10),c="undefined"!=typeof window&&window.btoa&&window.btoa.bind(window)||n(15);e.exports=function(e){return new Promise(function(t,f){var p=e.data,d=e.headers;r.isFormData(p)&&delete d["Content-Type"];var l=new XMLHttpRequest,h="onreadystatechange",m=!1;if("undefined"==typeof window||!window.XDomainRequest||"withCredentials"in l||u(e.url)||(l=new window.XDomainRequest,h="onload",m=!0,l.onprogress=function(){},l.ontimeout=function(){}),e.auth){var y=e.auth.username||"",w=e.auth.password||"";d.Authorization="Basic "+c(y+":"+w)}if(l.open(e.method.toUpperCase(),i(e.url,e.params,e.paramsSerializer),!0),l.timeout=e.timeout,l[h]=function(){if(l&&(4===l.readyState||m)&&(0!==l.status||l.responseURL&&0===l.responseURL.indexOf("file:"))){var n="getAllResponseHeaders"in l?s(l.getAllResponseHeaders()):null,r=e.responseType&&"text"!==e.responseType?l.response:l.responseText,i={data:r,status:1223===l.status?204:l.status,statusText:1223===l.status?"No Content":l.statusText,headers:n,config:e,request:l};o(t,f,i),l=null}},l.onerror=function(){f(a("Network Error",e,null,l)),l=null},l.ontimeout=function(){f(a("timeout of "+e.timeout+"ms exceeded",e,"ECONNABORTED",l)),l=null},r.isStandardBrowserEnv()){var g=n(16),v=(e.withCredentials||u(e.url))&&e.xsrfCookieName?g.read(e.xsrfCookieName):void 0;v&&(d[e.xsrfHeaderName]=v)}if("setRequestHeader"in l&&r.forEach(d,function(e,t){"undefined"==typeof p&&"content-type"===t.toLowerCase()?delete d[t]:l.setRequestHeader(t,e)}),e.withCredentials&&(l.withCredentials=!0),e.responseType)try{l.responseType=e.responseType}catch(t){if("json"!==e.responseType)throw t}"function"==typeof e.onDownloadProgress&&l.addEventListener("progress",e.onDownloadProgress),"function"==typeof e.onUploadProgress&&l.upload&&l.upload.addEventListener("progress",e.onUploadProgress),e.cancelToken&&e.cancelToken.promise.then(function(e){l&&(l.abort(),f(e),l=null)}),void 0===p&&(p=null),l.send(p)})}},function(e,t,n){"use strict";var r=n(10);e.exports=function(e,t,n){var o=n.config.validateStatus;n.status&&o&&!o(n.status)?t(r("Request failed with status code "+n.status,n.config,null,n.request,n)):e(n)}},function(e,t,n){"use strict";var r=n(11);e.exports=function(e,t,n,o,i){var s=new Error(e);return r(s,t,n,o,i)}},function(e,t){"use strict";e.exports=function(e,t,n,r,o){return e.config=t,n&&(e.code=n),e.request=r,e.response=o,e}},function(e,t,n){"use strict";function r(e){return encodeURIComponent(e).replace(/%40/gi,"@").replace(/%3A/gi,":").replace(/%24/g,"$").replace(/%2C/gi,",").replace(/%20/g,"+").replace(/%5B/gi,"[").replace(/%5D/gi,"]")}var o=n(2);e.exports=function(e,t,n){if(!t)return e;var i;if(n)i=n(t);else if(o.isURLSearchParams(t))i=t.toString();else{var s=[];o.forEach(t,function(e,t){null!==e&&"undefined"!=typeof e&&(o.isArray(e)&&(t+="[]"),o.isArray(e)||(e=[e]),o.forEach(e,function(e){o.isDate(e)?e=e.toISOString():o.isObject(e)&&(e=JSON.stringify(e)),s.push(r(t)+"="+r(e))}))}),i=s.join("&")}return i&&(e+=(e.indexOf("?")===-1?"?":"&")+i),e}},function(e,t,n){"use strict";var r=n(2),o=["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"];e.exports=function(e){var t,n,i,s={};return e?(r.forEach(e.split("\n"),function(e){if(i=e.indexOf(":"),t=r.trim(e.substr(0,i)).toLowerCase(),n=r.trim(e.substr(i+1)),t){if(s[t]&&o.indexOf(t)>=0)return;"set-cookie"===t?s[t]=(s[t]?s[t]:[]).concat([n]):s[t]=s[t]?s[t]+", "+n:n}}),s):s}},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){function e(e){var t=e;return n&&(o.setAttribute("href",t),t=o.href),o.setAttribute("href",t),{href:o.href,protocol:o.protocol?o.protocol.replace(/:$/,""):"",host:o.host,search:o.search?o.search.replace(/^\?/,""):"",hash:o.hash?o.hash.replace(/^#/,""):"",hostname:o.hostname,port:o.port,pathname:"/"===o.pathname.charAt(0)?o.pathname:"/"+o.pathname}}var t,n=/(msie|trident)/i.test(navigator.userAgent),o=document.createElement("a");return t=e(window.location.href),function(n){var o=r.isString(n)?e(n):n;return o.protocol===t.protocol&&o.host===t.host}}():function(){return function(){return!0}}()},function(e,t){"use strict";function n(){this.message="String contains an invalid character"}function r(e){for(var t,r,i=String(e),s="",u=0,a=o;i.charAt(0|u)||(a="=",u%1);s+=a.charAt(63&t>>8-u%1*8)){if(r=i.charCodeAt(u+=.75),r>255)throw new n;t=t<<8|r}return s}var o="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=";n.prototype=new Error,n.prototype.code=5,n.prototype.name="InvalidCharacterError",e.exports=r},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){return{write:function(e,t,n,o,i,s){var u=[];u.push(e+"="+encodeURIComponent(t)),r.isNumber(n)&&u.push("expires="+new Date(n).toGMTString()),r.isString(o)&&u.push("path="+o),r.isString(i)&&u.push("domain="+i),s===!0&&u.push("secure"),document.cookie=u.join("; ")},read:function(e){var t=document.cookie.match(new RegExp("(^|;\\s*)("+e+")=([^;]*)"));return t?decodeURIComponent(t[3]):null},remove:function(e){this.write(e,"",Date.now()-864e5)}}}():function(){return{write:function(){},read:function(){return null},remove:function(){}}}()},function(e,t,n){"use strict";function r(){this.handlers=[]}var o=n(2);r.prototype.use=function(e,t){return this.handlers.push({fulfilled:e,rejected:t}),this.handlers.length-1},r.prototype.eject=function(e){this.handlers[e]&&(this.handlers[e]=null)},r.prototype.forEach=function(e){o.forEach(this.handlers,function(t){null!==t&&e(t)})},e.exports=r},function(e,t,n){"use strict";function r(e){e.cancelToken&&e.cancelToken.throwIfRequested()}var o=n(2),i=n(19),s=n(20),u=n(6),a=n(21),c=n(22);e.exports=function(e){r(e),e.baseURL&&!a(e.url)&&(e.url=c(e.baseURL,e.url)),e.headers=e.headers||{},e.data=i(e.data,e.headers,e.transformRequest),e.headers=o.merge(e.headers.common||{},e.headers[e.method]||{},e.headers||{}),o.forEach(["delete","get","head","post","put","patch","common"],function(t){delete e.headers[t]});var t=e.adapter||u.adapter;return t(e).then(function(t){return r(e),t.data=i(t.data,t.headers,e.transformResponse),t},function(t){return s(t)||(r(e),t&&t.response&&(t.response.data=i(t.response.data,t.response.headers,e.transformResponse))),Promise.reject(t)})}},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t,n){return r.forEach(n,function(n){e=n(e,t)}),e}},function(e,t){"use strict";e.exports=function(e){return!(!e||!e.__CANCEL__)}},function(e,t){"use strict";e.exports=function(e){return/^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(e)}},function(e,t){"use strict";e.exports=function(e,t){return t?e.replace(/\/+$/,"")+"/"+t.replace(/^\/+/,""):e}},function(e,t){"use strict";function n(e){this.message=e}n.prototype.toString=function(){return"Cancel"+(this.message?": "+this.message:"")},n.prototype.__CANCEL__=!0,e.exports=n},function(e,t,n){"use strict";function r(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise(function(e){t=e});var n=this;e(function(e){n.reason||(n.reason=new o(e),t(n.reason))})}var o=n(23);r.prototype.throwIfRequested=function(){if(this.reason)throw this.reason},r.source=function(){var e,t=new r(function(t){e=t});return{token:t,cancel:e}},e.exports=r},function(e,t){"use strict";e.exports=function(e){return function(t){return e.apply(null,t)}}}])}); +//# sourceMappingURL=axios.min.map \ No newline at end of file diff --git a/helloworld/node_modules/axios/dist/axios.min.map b/helloworld/node_modules/axios/dist/axios.min.map new file mode 100755 index 0000000..2b6b0f1 --- /dev/null +++ b/helloworld/node_modules/axios/dist/axios.min.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///axios.min.js","webpack:///webpack/bootstrap 99abf9ea5c2f99fe227c","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./~/is-buffer/index.js","webpack:///./lib/core/Axios.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/btoa.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":["root","factory","exports","module","define","amd","this","modules","__webpack_require__","moduleId","installedModules","id","loaded","call","m","c","p","createInstance","defaultConfig","context","Axios","instance","bind","prototype","request","utils","extend","defaults","axios","create","instanceConfig","merge","Cancel","CancelToken","isCancel","all","promises","Promise","spread","default","isArray","val","toString","isArrayBuffer","isFormData","FormData","isArrayBufferView","result","ArrayBuffer","isView","buffer","isString","isNumber","isUndefined","isObject","isDate","isFile","isBlob","isFunction","isStream","pipe","isURLSearchParams","URLSearchParams","trim","str","replace","isStandardBrowserEnv","navigator","product","window","document","forEach","obj","fn","i","l","length","key","Object","hasOwnProperty","assignValue","arguments","a","b","thisArg","isBuffer","args","Array","apply","constructor","isSlowBuffer","readFloatLE","slice","_isBuffer","interceptors","InterceptorManager","response","dispatchRequest","config","url","method","toLowerCase","chain","undefined","promise","resolve","interceptor","unshift","fulfilled","rejected","push","then","shift","data","setContentTypeIfUnset","headers","value","getDefaultAdapter","adapter","XMLHttpRequest","process","normalizeHeaderName","DEFAULT_CONTENT_TYPE","Content-Type","transformRequest","JSON","stringify","transformResponse","parse","e","timeout","xsrfCookieName","xsrfHeaderName","maxContentLength","validateStatus","status","common","Accept","normalizedName","name","toUpperCase","settle","buildURL","parseHeaders","isURLSameOrigin","createError","btoa","reject","requestData","requestHeaders","loadEvent","xDomain","XDomainRequest","onprogress","ontimeout","auth","username","password","Authorization","open","params","paramsSerializer","readyState","responseURL","indexOf","responseHeaders","getAllResponseHeaders","responseData","responseType","responseText","statusText","onerror","cookies","xsrfValue","withCredentials","read","setRequestHeader","onDownloadProgress","addEventListener","onUploadProgress","upload","cancelToken","cancel","abort","send","enhanceError","message","code","error","Error","encode","encodeURIComponent","serializedParams","parts","v","toISOString","join","ignoreDuplicateOf","parsed","split","line","substr","concat","resolveURL","href","msie","urlParsingNode","setAttribute","protocol","host","search","hash","hostname","port","pathname","charAt","originURL","test","userAgent","createElement","location","requestURL","E","input","block","charCode","String","output","idx","map","chars","charCodeAt","write","expires","path","domain","secure","cookie","Date","toGMTString","match","RegExp","decodeURIComponent","remove","now","handlers","use","eject","h","throwIfCancellationRequested","throwIfRequested","transformData","isAbsoluteURL","combineURLs","baseURL","reason","fns","__CANCEL__","relativeURL","executor","TypeError","resolvePromise","token","source","callback","arr"],"mappings":"CAAA,SAAAA,EAAAC,GACA,gBAAAC,UAAA,gBAAAC,QACAA,OAAAD,QAAAD,IACA,kBAAAG,gBAAAC,IACAD,UAAAH,GACA,gBAAAC,SACAA,QAAA,MAAAD,IAEAD,EAAA,MAAAC,KACCK,KAAA,WACD,MCAgB,UAAUC,GCN1B,QAAAC,GAAAC,GAGA,GAAAC,EAAAD,GACA,MAAAC,GAAAD,GAAAP,OAGA,IAAAC,GAAAO,EAAAD,IACAP,WACAS,GAAAF,EACAG,QAAA,EAUA,OANAL,GAAAE,GAAAI,KAAAV,EAAAD,QAAAC,IAAAD,QAAAM,GAGAL,EAAAS,QAAA,EAGAT,EAAAD,QAvBA,GAAAQ,KAqCA,OATAF,GAAAM,EAAAP,EAGAC,EAAAO,EAAAL,EAGAF,EAAAQ,EAAA,GAGAR,EAAA,KDgBM,SAAUL,EAAQD,EAASM,GEtDjCL,EAAAD,QAAAM,EAAA,IF4DM,SAAUL,EAAQD,EAASM,GG5DjC,YAaA,SAAAS,GAAAC,GACA,GAAAC,GAAA,GAAAC,GAAAF,GACAG,EAAAC,EAAAF,EAAAG,UAAAC,QAAAL,EAQA,OALAM,GAAAC,OAAAL,EAAAD,EAAAG,UAAAJ,GAGAM,EAAAC,OAAAL,EAAAF,GAEAE,EArBA,GAAAI,GAAAjB,EAAA,GACAc,EAAAd,EAAA,GACAY,EAAAZ,EAAA,GACAmB,EAAAnB,EAAA,GAsBAoB,EAAAX,EAAAU,EAGAC,GAAAR,QAGAQ,EAAAC,OAAA,SAAAC,GACA,MAAAb,GAAAQ,EAAAM,MAAAJ,EAAAG,KAIAF,EAAAI,OAAAxB,EAAA,IACAoB,EAAAK,YAAAzB,EAAA,IACAoB,EAAAM,SAAA1B,EAAA,IAGAoB,EAAAO,IAAA,SAAAC,GACA,MAAAC,SAAAF,IAAAC,IAEAR,EAAAU,OAAA9B,EAAA,IAEAL,EAAAD,QAAA0B,EAGAzB,EAAAD,QAAAqC,QAAAX,GHmEM,SAAUzB,EAAQD,EAASM,GItHjC,YAiBA,SAAAgC,GAAAC,GACA,yBAAAC,EAAA7B,KAAA4B,GASA,QAAAE,GAAAF,GACA,+BAAAC,EAAA7B,KAAA4B,GASA,QAAAG,GAAAH,GACA,yBAAAI,WAAAJ,YAAAI,UASA,QAAAC,GAAAL,GACA,GAAAM,EAMA,OAJAA,GADA,mBAAAC,0BAAA,OACAA,YAAAC,OAAAR,GAEA,GAAAA,EAAA,QAAAA,EAAAS,iBAAAF,aAWA,QAAAG,GAAAV,GACA,sBAAAA,GASA,QAAAW,GAAAX,GACA,sBAAAA,GASA,QAAAY,GAAAZ,GACA,yBAAAA,GASA,QAAAa,GAAAb,GACA,cAAAA,GAAA,gBAAAA,GASA,QAAAc,GAAAd,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAe,GAAAf,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAgB,GAAAhB,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAiB,GAAAjB,GACA,4BAAAC,EAAA7B,KAAA4B,GASA,QAAAkB,GAAAlB,GACA,MAAAa,GAAAb,IAAAiB,EAAAjB,EAAAmB,MASA,QAAAC,GAAApB,GACA,yBAAAqB,kBAAArB,YAAAqB,iBASA,QAAAC,GAAAC,GACA,MAAAA,GAAAC,QAAA,WAAAA,QAAA,WAgBA,QAAAC,KACA,0BAAAC,YAAA,gBAAAA,UAAAC,WAIA,mBAAAC,SACA,mBAAAC,WAgBA,QAAAC,GAAAC,EAAAC,GAEA,UAAAD,GAAA,mBAAAA,GAUA,GALA,gBAAAA,KAEAA,OAGAhC,EAAAgC,GAEA,OAAAE,GAAA,EAAAC,EAAAH,EAAAI,OAAmCF,EAAAC,EAAOD,IAC1CD,EAAA5D,KAAA,KAAA2D,EAAAE,KAAAF,OAIA,QAAAK,KAAAL,GACAM,OAAAvD,UAAAwD,eAAAlE,KAAA2D,EAAAK,IACAJ,EAAA5D,KAAA,KAAA2D,EAAAK,KAAAL,GAuBA,QAAAzC,KAEA,QAAAiD,GAAAvC,EAAAoC,GACA,gBAAA9B,GAAA8B,IAAA,gBAAApC,GACAM,EAAA8B,GAAA9C,EAAAgB,EAAA8B,GAAApC,GAEAM,EAAA8B,GAAApC,EAIA,OATAM,MASA2B,EAAA,EAAAC,EAAAM,UAAAL,OAAuCF,EAAAC,EAAOD,IAC9CH,EAAAU,UAAAP,GAAAM,EAEA,OAAAjC,GAWA,QAAArB,GAAAwD,EAAAC,EAAAC,GAQA,MAPAb,GAAAY,EAAA,SAAA1C,EAAAoC,GACAO,GAAA,kBAAA3C,GACAyC,EAAAL,GAAAvD,EAAAmB,EAAA2C,GAEAF,EAAAL,GAAApC,IAGAyC,EApRA,GAAA5D,GAAAd,EAAA,GACA6E,EAAA7E,EAAA,GAMAkC,EAAAoC,OAAAvD,UAAAmB,QAgRAvC,GAAAD,SACAsC,UACAG,gBACA0C,WACAzC,aACAE,oBACAK,WACAC,WACAE,WACAD,cACAE,SACAC,SACAC,SACAC,aACAC,WACAE,oBACAK,uBACAK,UACAxC,QACAL,SACAqC,SJ8HM,SAAU5D,EAAQD,GK3axB,YAEAC,GAAAD,QAAA,SAAAuE,EAAAW,GACA,kBAEA,OADAE,GAAA,GAAAC,OAAAN,UAAAL,QACAF,EAAA,EAAmBA,EAAAY,EAAAV,OAAiBF,IACpCY,EAAAZ,GAAAO,UAAAP,EAEA,OAAAD,GAAAe,MAAAJ,EAAAE,MLobM,SAAUnF,EAAQD,GM/axB,QAAAmF,GAAAb,GACA,QAAAA,EAAAiB,aAAA,kBAAAjB,GAAAiB,YAAAJ,UAAAb,EAAAiB,YAAAJ,SAAAb,GAIA,QAAAkB,GAAAlB,GACA,wBAAAA,GAAAmB,aAAA,kBAAAnB,GAAAoB,OAAAP,EAAAb,EAAAoB,MAAA;;;;;;AAVAzF,EAAAD,QAAA,SAAAsE,GACA,aAAAA,IAAAa,EAAAb,IAAAkB,EAAAlB,QAAAqB,aN6cM,SAAU1F,EAAQD,EAASM,GOvdjC,YAYA,SAAAY,GAAAU,GACAxB,KAAAqB,SAAAG,EACAxB,KAAAwF,cACAtE,QAAA,GAAAuE,GACAC,SAAA,GAAAD,IAdA,GAAApE,GAAAnB,EAAA,GACAiB,EAAAjB,EAAA,GACAuF,EAAAvF,EAAA,IACAyF,EAAAzF,EAAA,GAoBAY,GAAAG,UAAAC,QAAA,SAAA0E,GAGA,gBAAAA,KACAA,EAAAzE,EAAAM,OACAoE,IAAAlB,UAAA,IACKA,UAAA,KAGLiB,EAAAzE,EAAAM,MAAAJ,EAAArB,KAAAqB,UAAiDyE,OAAA,OAAgBF,GACjEA,EAAAE,OAAAF,EAAAE,OAAAC,aAGA,IAAAC,IAAAL,EAAAM,QACAC,EAAAnE,QAAAoE,QAAAP,EAUA,KARA5F,KAAAwF,aAAAtE,QAAA+C,QAAA,SAAAmC,GACAJ,EAAAK,QAAAD,EAAAE,UAAAF,EAAAG,YAGAvG,KAAAwF,aAAAE,SAAAzB,QAAA,SAAAmC,GACAJ,EAAAQ,KAAAJ,EAAAE,UAAAF,EAAAG,YAGAP,EAAA1B,QACA4B,IAAAO,KAAAT,EAAAU,QAAAV,EAAAU,QAGA,OAAAR,IAIA/E,EAAA8C,SAAA,0CAAA6B,GAEAhF,EAAAG,UAAA6E,GAAA,SAAAD,EAAAD,GACA,MAAA5F,MAAAkB,QAAAC,EAAAM,MAAAmE,OACAE,SACAD,YAKA1E,EAAA8C,SAAA,+BAAA6B,GAEAhF,EAAAG,UAAA6E,GAAA,SAAAD,EAAAc,EAAAf,GACA,MAAA5F,MAAAkB,QAAAC,EAAAM,MAAAmE,OACAE,SACAD,MACAc,aAKA9G,EAAAD,QAAAkB,GP8dM,SAAUjB,EAAQD,EAASM,GQ5iBjC,YASA,SAAA0G,GAAAC,EAAAC,IACA3F,EAAA4B,YAAA8D,IAAA1F,EAAA4B,YAAA8D,EAAA,mBACAA,EAAA,gBAAAC,GAIA,QAAAC,KACA,GAAAC,EAQA,OAPA,mBAAAC,gBAEAD,EAAA9G,EAAA,GACG,mBAAAgH,WAEHF,EAAA9G,EAAA,IAEA8G,EAtBA,GAAA7F,GAAAjB,EAAA,GACAiH,EAAAjH,EAAA,GAEAkH,GACAC,eAAA,qCAqBAhG,GACA2F,QAAAD,IAEAO,kBAAA,SAAAX,EAAAE,GAEA,MADAM,GAAAN,EAAA,gBACA1F,EAAAmB,WAAAqE,IACAxF,EAAAkB,cAAAsE,IACAxF,EAAA4D,SAAA4B,IACAxF,EAAAkC,SAAAsD,IACAxF,EAAA+B,OAAAyD,IACAxF,EAAAgC,OAAAwD,GAEAA,EAEAxF,EAAAqB,kBAAAmE,GACAA,EAAA/D,OAEAzB,EAAAoC,kBAAAoD,IACAC,EAAAC,EAAA,mDACAF,EAAAvE,YAEAjB,EAAA6B,SAAA2D,IACAC,EAAAC,EAAA,kCACAU,KAAAC,UAAAb,IAEAA,IAGAc,mBAAA,SAAAd,GAEA,mBAAAA,GACA,IACAA,EAAAY,KAAAG,MAAAf,GACO,MAAAgB,IAEP,MAAAhB,KAGAiB,QAAA,EAEAC,eAAA,aACAC,eAAA,eAEAC,kBAAA,EAEAC,eAAA,SAAAC,GACA,MAAAA,IAAA,KAAAA,EAAA,KAIA5G,GAAAwF,SACAqB,QACAC,OAAA,sCAIAhH,EAAA8C,SAAA,gCAAA6B,GACAzE,EAAAwF,QAAAf,QAGA3E,EAAA8C,SAAA,+BAAA6B,GACAzE,EAAAwF,QAAAf,GAAA3E,EAAAM,MAAA2F,KAGAvH,EAAAD,QAAAyB,GRmjBM,SAAUxB,EAAQD,EAASM,GS9oBjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QAAA,SAAAiH,EAAAuB,GACAjH,EAAA8C,QAAA4C,EAAA,SAAAC,EAAAuB,GACAA,IAAAD,GAAAC,EAAAC,gBAAAF,EAAAE,gBACAzB,EAAAuB,GAAAtB,QACAD,GAAAwB,QTwpBM,SAAUxI,EAAQD,EAASM,GUhqBjC,YAEA,IAAAiB,GAAAjB,EAAA,GACAqI,EAAArI,EAAA,GACAsI,EAAAtI,EAAA,IACAuI,EAAAvI,EAAA,IACAwI,EAAAxI,EAAA,IACAyI,EAAAzI,EAAA,IACA0I,EAAA,mBAAA7E,gBAAA6E,MAAA7E,OAAA6E,KAAA5H,KAAA+C,SAAA7D,EAAA,GAEAL,GAAAD,QAAA,SAAAgG,GACA,UAAA7D,SAAA,SAAAoE,EAAA0C,GACA,GAAAC,GAAAlD,EAAAe,KACAoC,EAAAnD,EAAAiB,OAEA1F,GAAAmB,WAAAwG,UACAC,GAAA,eAGA,IAAA7H,GAAA,GAAA+F,gBACA+B,EAAA,qBACAC,GAAA,CAiBA,IAXA,mBAAAlF,UACAA,OAAAmF,gBAAA,mBAAAhI,IACAwH,EAAA9C,EAAAC,OACA3E,EAAA,GAAA6C,QAAAmF,eACAF,EAAA,SACAC,GAAA,EACA/H,EAAAiI,WAAA,aACAjI,EAAAkI,UAAA,cAIAxD,EAAAyD,KAAA,CACA,GAAAC,GAAA1D,EAAAyD,KAAAC,UAAA,GACAC,EAAA3D,EAAAyD,KAAAE,UAAA,EACAR,GAAAS,cAAA,SAAAZ,EAAAU,EAAA,IAAAC,GA+DA,GA5DArI,EAAAuI,KAAA7D,EAAAE,OAAAwC,cAAAE,EAAA5C,EAAAC,IAAAD,EAAA8D,OAAA9D,EAAA+D,mBAAA,GAGAzI,EAAA0G,QAAAhC,EAAAgC,QAGA1G,EAAA8H,GAAA,WACA,GAAA9H,IAAA,IAAAA,EAAA0I,YAAAX,KAQA,IAAA/H,EAAA+G,QAAA/G,EAAA2I,aAAA,IAAA3I,EAAA2I,YAAAC,QAAA,WAKA,GAAAC,GAAA,yBAAA7I,GAAAuH,EAAAvH,EAAA8I,yBAAA,KACAC,EAAArE,EAAAsE,cAAA,SAAAtE,EAAAsE,aAAAhJ,EAAAwE,SAAAxE,EAAAiJ,aACAzE,GACAiB,KAAAsD,EAEAhC,OAAA,OAAA/G,EAAA+G,OAAA,IAAA/G,EAAA+G,OACAmC,WAAA,OAAAlJ,EAAA+G,OAAA,aAAA/G,EAAAkJ,WACAvD,QAAAkD,EACAnE,SACA1E,UAGAqH,GAAApC,EAAA0C,EAAAnD,GAGAxE,EAAA,OAIAA,EAAAmJ,QAAA,WAGAxB,EAAAF,EAAA,gBAAA/C,EAAA,KAAA1E,IAGAA,EAAA,MAIAA,EAAAkI,UAAA,WACAP,EAAAF,EAAA,cAAA/C,EAAAgC,QAAA,cAAAhC,EAAA,eACA1E,IAGAA,EAAA,MAMAC,EAAAyC,uBAAA,CACA,GAAA0G,GAAApK,EAAA,IAGAqK,GAAA3E,EAAA4E,iBAAA9B,EAAA9C,EAAAC,OAAAD,EAAAiC,eACAyC,EAAAG,KAAA7E,EAAAiC,gBACA5B,MAEAsE,KACAxB,EAAAnD,EAAAkC,gBAAAyC,GAuBA,GAlBA,oBAAArJ,IACAC,EAAA8C,QAAA8E,EAAA,SAAA5G,EAAAoC,GACA,mBAAAuE,IAAA,iBAAAvE,EAAAwB,oBAEAgD,GAAAxE,GAGArD,EAAAwJ,iBAAAnG,EAAApC,KAMAyD,EAAA4E,kBACAtJ,EAAAsJ,iBAAA,GAIA5E,EAAAsE,aACA,IACAhJ,EAAAgJ,aAAAtE,EAAAsE,aACO,MAAAvC,GAGP,YAAA/B,EAAAsE,aACA,KAAAvC,GAMA,kBAAA/B,GAAA+E,oBACAzJ,EAAA0J,iBAAA,WAAAhF,EAAA+E,oBAIA,kBAAA/E,GAAAiF,kBAAA3J,EAAA4J,QACA5J,EAAA4J,OAAAF,iBAAA,WAAAhF,EAAAiF,kBAGAjF,EAAAmF,aAEAnF,EAAAmF,YAAA7E,QAAAO,KAAA,SAAAuE,GACA9J,IAIAA,EAAA+J,QACApC,EAAAmC,GAEA9J,EAAA,QAIA+E,SAAA6C,IACAA,EAAA,MAIA5H,EAAAgK,KAAApC,OVyqBM,SAAUjJ,EAAQD,EAASM,GW11BjC,YAEA,IAAAyI,GAAAzI,EAAA,GASAL,GAAAD,QAAA,SAAAuG,EAAA0C,EAAAnD,GACA,GAAAsC,GAAAtC,EAAAE,OAAAoC,cAEAtC,GAAAuC,QAAAD,MAAAtC,EAAAuC,QAGAY,EAAAF,EACA,mCAAAjD,EAAAuC,OACAvC,EAAAE,OACA,KACAF,EAAAxE,QACAwE,IAPAS,EAAAT,KX22BM,SAAU7F,EAAQD,EAASM,GY13BjC,YAEA,IAAAiL,GAAAjL,EAAA,GAYAL,GAAAD,QAAA,SAAAwL,EAAAxF,EAAAyF,EAAAnK,EAAAwE,GACA,GAAA4F,GAAA,GAAAC,OAAAH,EACA,OAAAD,GAAAG,EAAA1F,EAAAyF,EAAAnK,EAAAwE,KZk4BM,SAAU7F,EAAQD,Gal5BxB,YAYAC,GAAAD,QAAA,SAAA0L,EAAA1F,EAAAyF,EAAAnK,EAAAwE,GAOA,MANA4F,GAAA1F,SACAyF,IACAC,EAAAD,QAEAC,EAAApK,UACAoK,EAAA5F,WACA4F,Ib05BM,SAAUzL,EAAQD,EAASM,Gc76BjC,YAIA,SAAAsL,GAAArJ,GACA,MAAAsJ,oBAAAtJ,GACAwB,QAAA,aACAA,QAAA,aACAA,QAAA,YACAA,QAAA,aACAA,QAAA,YACAA,QAAA,aACAA,QAAA,aAVA,GAAAxC,GAAAjB,EAAA,EAoBAL,GAAAD,QAAA,SAAAiG,EAAA6D,EAAAC,GAEA,IAAAD,EACA,MAAA7D,EAGA,IAAA6F,EACA,IAAA/B,EACA+B,EAAA/B,EAAAD,OACG,IAAAvI,EAAAoC,kBAAAmG,GACHgC,EAAAhC,EAAAtH,eACG,CACH,GAAAuJ,KAEAxK,GAAA8C,QAAAyF,EAAA,SAAAvH,EAAAoC,GACA,OAAApC,GAAA,mBAAAA,KAIAhB,EAAAe,QAAAC,KACAoC,GAAA,MAGApD,EAAAe,QAAAC,KACAA,OAGAhB,EAAA8C,QAAA9B,EAAA,SAAAyJ,GACAzK,EAAA8B,OAAA2I,GACAA,IAAAC,cACS1K,EAAA6B,SAAA4I,KACTA,EAAArE,KAAAC,UAAAoE,IAEAD,EAAAnF,KAAAgF,EAAAjH,GAAA,IAAAiH,EAAAI,SAIAF,EAAAC,EAAAG,KAAA,KAOA,MAJAJ,KACA7F,MAAAiE,QAAA,mBAAA4B,GAGA7F,Idq7BM,SAAUhG,EAAQD,EAASM,Gev/BjC,YAEA,IAAAiB,GAAAjB,EAAA,GAIA6L,GACA,6DACA,kEACA,gEACA,qCAgBAlM,GAAAD,QAAA,SAAAiH,GACA,GACAtC,GACApC,EACAiC,EAHA4H,IAKA,OAAAnF,IAEA1F,EAAA8C,QAAA4C,EAAAoF,MAAA,eAAAC,GAKA,GAJA9H,EAAA8H,EAAApC,QAAA,KACAvF,EAAApD,EAAAsC,KAAAyI,EAAAC,OAAA,EAAA/H,IAAA2B,cACA5D,EAAAhB,EAAAsC,KAAAyI,EAAAC,OAAA/H,EAAA,IAEAG,EAAA,CACA,GAAAyH,EAAAzH,IAAAwH,EAAAjC,QAAAvF,IAAA,EACA,MAEA,gBAAAA,EACAyH,EAAAzH,IAAAyH,EAAAzH,GAAAyH,EAAAzH,OAAA6H,QAAAjK,IAEA6J,EAAAzH,GAAAyH,EAAAzH,GAAAyH,EAAAzH,GAAA,KAAApC,OAKA6J,GAnBiBA,IfkhCX,SAAUnM,EAAQD,EAASM,GgBljCjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QACAuB,EAAAyC,uBAIA,WAWA,QAAAyI,GAAAxG,GACA,GAAAyG,GAAAzG,CAWA,OATA0G,KAEAC,EAAAC,aAAA,OAAAH,GACAA,EAAAE,EAAAF,MAGAE,EAAAC,aAAA,OAAAH,IAIAA,KAAAE,EAAAF,KACAI,SAAAF,EAAAE,SAAAF,EAAAE,SAAA/I,QAAA,YACAgJ,KAAAH,EAAAG,KACAC,OAAAJ,EAAAI,OAAAJ,EAAAI,OAAAjJ,QAAA,aACAkJ,KAAAL,EAAAK,KAAAL,EAAAK,KAAAlJ,QAAA,YACAmJ,SAAAN,EAAAM,SACAC,KAAAP,EAAAO,KACAC,SAAA,MAAAR,EAAAQ,SAAAC,OAAA,GACAT,EAAAQ,SACA,IAAAR,EAAAQ,UAhCA,GAEAE,GAFAX,EAAA,kBAAAY,KAAAtJ,UAAAuJ,WACAZ,EAAAxI,SAAAqJ,cAAA,IA2CA,OARAH,GAAAb,EAAAtI,OAAAuJ,SAAAhB,MAQA,SAAAiB,GACA,GAAAvB,GAAA7K,EAAA0B,SAAA0K,GAAAlB,EAAAkB,IACA,OAAAvB,GAAAU,WAAAQ,EAAAR,UACAV,EAAAW,OAAAO,EAAAP,SAKA,WACA,kBACA,chB4jCM,SAAU9M,EAAQD,GiB5nCxB,YAMA,SAAA4N,KACAxN,KAAAoL,QAAA,uCAMA,QAAAxC,GAAA6E,GAGA,IAEA,GAAAC,GAAAC,EAJAjK,EAAAkK,OAAAH,GACAI,EAAA,GAGAC,EAAA,EAAAC,EAAAC,EAIAtK,EAAAuJ,OAAA,EAAAa,KAAAC,EAAA,IAAAD,EAAA,GAEAD,GAAAE,EAAAd,OAAA,GAAAS,GAAA,EAAAI,EAAA,KACA,CAEA,GADAH,EAAAjK,EAAAuK,WAAAH,GAAA,KACAH,EAAA,IACA,SAAAH,EAEAE,MAAA,EAAAC,EAEA,MAAAE,GA5BA,GAAAG,GAAA,mEAKAR,GAAAvM,UAAA,GAAAsK,OACAiC,EAAAvM,UAAAoK,KAAA,EACAmC,EAAAvM,UAAAoH,KAAA,wBAwBAxI,EAAAD,QAAAgJ,GjBmoCM,SAAU/I,EAAQD,EAASM,GkBtqCjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QACAuB,EAAAyC,uBAGA,WACA,OACAsK,MAAA,SAAA7F,EAAAvB,EAAAqH,EAAAC,EAAAC,EAAAC,GACA,GAAAC,KACAA,GAAA/H,KAAA6B,EAAA,IAAAoD,mBAAA3E,IAEA3F,EAAA2B,SAAAqL,IACAI,EAAA/H,KAAA,cAAAgI,MAAAL,GAAAM,eAGAtN,EAAA0B,SAAAuL,IACAG,EAAA/H,KAAA,QAAA4H,GAGAjN,EAAA0B,SAAAwL,IACAE,EAAA/H,KAAA,UAAA6H,GAGAC,KAAA,GACAC,EAAA/H,KAAA,UAGAxC,SAAAuK,SAAAzC,KAAA,OAGArB,KAAA,SAAApC,GACA,GAAAqG,GAAA1K,SAAAuK,OAAAG,MAAA,GAAAC,QAAA,aAA0DtG,EAAA,aAC1D,OAAAqG,GAAAE,mBAAAF,EAAA,UAGAG,OAAA,SAAAxG,GACArI,KAAAkO,MAAA7F,EAAA,GAAAmG,KAAAM,MAAA,YAMA,WACA,OACAZ,MAAA,aACAzD,KAAA,WAA6B,aAC7BoE,OAAA,kBlBgrCM,SAAUhP,EAAQD,EAASM,GmBjuCjC,YAIA,SAAAuF,KACAzF,KAAA+O,YAHA,GAAA5N,GAAAjB,EAAA,EAcAuF,GAAAxE,UAAA+N,IAAA,SAAA1I,EAAAC,GAKA,MAJAvG,MAAA+O,SAAAvI,MACAF,YACAC,aAEAvG,KAAA+O,SAAAzK,OAAA,GAQAmB,EAAAxE,UAAAgO,MAAA,SAAA5O,GACAL,KAAA+O,SAAA1O,KACAL,KAAA+O,SAAA1O,GAAA,OAYAoF,EAAAxE,UAAAgD,QAAA,SAAAE,GACAhD,EAAA8C,QAAAjE,KAAA+O,SAAA,SAAAG,GACA,OAAAA,GACA/K,EAAA+K,MAKArP,EAAAD,QAAA6F,GnBwuCM,SAAU5F,EAAQD,EAASM,GoB3xCjC,YAYA,SAAAiP,GAAAvJ,GACAA,EAAAmF,aACAnF,EAAAmF,YAAAqE,mBAZA,GAAAjO,GAAAjB,EAAA,GACAmP,EAAAnP,EAAA,IACA0B,EAAA1B,EAAA,IACAmB,EAAAnB,EAAA,GACAoP,EAAApP,EAAA,IACAqP,EAAArP,EAAA,GAiBAL,GAAAD,QAAA,SAAAgG,GACAuJ,EAAAvJ,GAGAA,EAAA4J,UAAAF,EAAA1J,EAAAC,OACAD,EAAAC,IAAA0J,EAAA3J,EAAA4J,QAAA5J,EAAAC,MAIAD,EAAAiB,QAAAjB,EAAAiB,YAGAjB,EAAAe,KAAA0I,EACAzJ,EAAAe,KACAf,EAAAiB,QACAjB,EAAA0B,kBAIA1B,EAAAiB,QAAA1F,EAAAM,MACAmE,EAAAiB,QAAAqB,WACAtC,EAAAiB,QAAAjB,EAAAE,YACAF,EAAAiB,aAGA1F,EAAA8C,SACA,qDACA,SAAA6B,SACAF,GAAAiB,QAAAf,IAIA,IAAAkB,GAAApB,EAAAoB,SAAA3F,EAAA2F,OAEA,OAAAA,GAAApB,GAAAa,KAAA,SAAAf,GAUA,MATAyJ,GAAAvJ,GAGAF,EAAAiB,KAAA0I,EACA3J,EAAAiB,KACAjB,EAAAmB,QACAjB,EAAA6B,mBAGA/B,GACG,SAAA+J,GAcH,MAbA7N,GAAA6N,KACAN,EAAAvJ,GAGA6J,KAAA/J,WACA+J,EAAA/J,SAAAiB,KAAA0I,EACAI,EAAA/J,SAAAiB,KACA8I,EAAA/J,SAAAmB,QACAjB,EAAA6B,qBAKA1F,QAAA8G,OAAA4G,OpBoyCM,SAAU5P,EAAQD,EAASM,GqBv3CjC,YAEA,IAAAiB,GAAAjB,EAAA,EAUAL,GAAAD,QAAA,SAAA+G,EAAAE,EAAA6I,GAMA,MAJAvO,GAAA8C,QAAAyL,EAAA,SAAAvL,GACAwC,EAAAxC,EAAAwC,EAAAE,KAGAF,IrB+3CM,SAAU9G,EAAQD,GsBj5CxB,YAEAC,GAAAD,QAAA,SAAAkH,GACA,SAAAA,MAAA6I,ctBy5CM,SAAU9P,EAAQD,GuB55CxB,YAQAC,GAAAD,QAAA,SAAAiG,GAIA,sCAAAsH,KAAAtH,KvBo6CM,SAAUhG,EAAQD,GwBh7CxB,YASAC,GAAAD,QAAA,SAAA4P,EAAAI,GACA,MAAAA,GACAJ,EAAA7L,QAAA,eAAAiM,EAAAjM,QAAA,WACA6L,IxBw7CM,SAAU3P,EAAQD,GyBp8CxB,YAQA,SAAA8B,GAAA0J,GACApL,KAAAoL,UAGA1J,EAAAT,UAAAmB,SAAA,WACA,gBAAApC,KAAAoL,QAAA,KAAApL,KAAAoL,QAAA,KAGA1J,EAAAT,UAAA0O,YAAA,EAEA9P,EAAAD,QAAA8B,GzB28CM,SAAU7B,EAAQD,EAASM,G0B79CjC,YAUA,SAAAyB,GAAAkO,GACA,qBAAAA,GACA,SAAAC,WAAA,+BAGA,IAAAC,EACA/P,MAAAkG,QAAA,GAAAnE,SAAA,SAAAoE,GACA4J,EAAA5J,GAGA,IAAA6J,GAAAhQ,IACA6P,GAAA,SAAAzE,GACA4E,EAAAP,SAKAO,EAAAP,OAAA,GAAA/N,GAAA0J,GACA2E,EAAAC,EAAAP,WA1BA,GAAA/N,GAAAxB,EAAA,GAiCAyB,GAAAV,UAAAmO,iBAAA,WACA,GAAApP,KAAAyP,OACA,KAAAzP,MAAAyP,QAQA9N,EAAAsO,OAAA,WACA,GAAAjF,GACAgF,EAAA,GAAArO,GAAA,SAAAlB,GACAuK,EAAAvK,GAEA,QACAuP,QACAhF,WAIAnL,EAAAD,QAAA+B,G1Bo+CM,SAAU9B,EAAQD,G2B5hDxB,YAsBAC,GAAAD,QAAA,SAAAsQ,GACA,gBAAAC,GACA,MAAAD,GAAAhL,MAAA,KAAAiL","file":"axios.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition","(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn /******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId])\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\texports: {},\n/******/ \t\t\tid: moduleId,\n/******/ \t\t\tloaded: false\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.loaded = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(0);\n/******/ })\n/************************************************************************/\n/******/ ([\n/* 0 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\tmodule.exports = __webpack_require__(1);\n\n/***/ }),\n/* 1 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar bind = __webpack_require__(3);\n\tvar Axios = __webpack_require__(5);\n\tvar defaults = __webpack_require__(6);\n\t\n\t/**\n\t * Create an instance of Axios\n\t *\n\t * @param {Object} defaultConfig The default config for the instance\n\t * @return {Axios} A new instance of Axios\n\t */\n\tfunction createInstance(defaultConfig) {\n\t var context = new Axios(defaultConfig);\n\t var instance = bind(Axios.prototype.request, context);\n\t\n\t // Copy axios.prototype to instance\n\t utils.extend(instance, Axios.prototype, context);\n\t\n\t // Copy context to instance\n\t utils.extend(instance, context);\n\t\n\t return instance;\n\t}\n\t\n\t// Create the default instance to be exported\n\tvar axios = createInstance(defaults);\n\t\n\t// Expose Axios class to allow class inheritance\n\taxios.Axios = Axios;\n\t\n\t// Factory for creating new instances\n\taxios.create = function create(instanceConfig) {\n\t return createInstance(utils.merge(defaults, instanceConfig));\n\t};\n\t\n\t// Expose Cancel & CancelToken\n\taxios.Cancel = __webpack_require__(23);\n\taxios.CancelToken = __webpack_require__(24);\n\taxios.isCancel = __webpack_require__(20);\n\t\n\t// Expose all/spread\n\taxios.all = function all(promises) {\n\t return Promise.all(promises);\n\t};\n\taxios.spread = __webpack_require__(25);\n\t\n\tmodule.exports = axios;\n\t\n\t// Allow use of default import syntax in TypeScript\n\tmodule.exports.default = axios;\n\n\n/***/ }),\n/* 2 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar bind = __webpack_require__(3);\n\tvar isBuffer = __webpack_require__(4);\n\t\n\t/*global toString:true*/\n\t\n\t// utils is a library of generic helper functions non-specific to axios\n\t\n\tvar toString = Object.prototype.toString;\n\t\n\t/**\n\t * Determine if a value is an Array\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an Array, otherwise false\n\t */\n\tfunction isArray(val) {\n\t return toString.call(val) === '[object Array]';\n\t}\n\t\n\t/**\n\t * Determine if a value is an ArrayBuffer\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n\t */\n\tfunction isArrayBuffer(val) {\n\t return toString.call(val) === '[object ArrayBuffer]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a FormData\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an FormData, otherwise false\n\t */\n\tfunction isFormData(val) {\n\t return (typeof FormData !== 'undefined') && (val instanceof FormData);\n\t}\n\t\n\t/**\n\t * Determine if a value is a view on an ArrayBuffer\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n\t */\n\tfunction isArrayBufferView(val) {\n\t var result;\n\t if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n\t result = ArrayBuffer.isView(val);\n\t } else {\n\t result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Determine if a value is a String\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a String, otherwise false\n\t */\n\tfunction isString(val) {\n\t return typeof val === 'string';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Number\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Number, otherwise false\n\t */\n\tfunction isNumber(val) {\n\t return typeof val === 'number';\n\t}\n\t\n\t/**\n\t * Determine if a value is undefined\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if the value is undefined, otherwise false\n\t */\n\tfunction isUndefined(val) {\n\t return typeof val === 'undefined';\n\t}\n\t\n\t/**\n\t * Determine if a value is an Object\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an Object, otherwise false\n\t */\n\tfunction isObject(val) {\n\t return val !== null && typeof val === 'object';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Date\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Date, otherwise false\n\t */\n\tfunction isDate(val) {\n\t return toString.call(val) === '[object Date]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a File\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a File, otherwise false\n\t */\n\tfunction isFile(val) {\n\t return toString.call(val) === '[object File]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Blob\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Blob, otherwise false\n\t */\n\tfunction isBlob(val) {\n\t return toString.call(val) === '[object Blob]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Function\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Function, otherwise false\n\t */\n\tfunction isFunction(val) {\n\t return toString.call(val) === '[object Function]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Stream\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Stream, otherwise false\n\t */\n\tfunction isStream(val) {\n\t return isObject(val) && isFunction(val.pipe);\n\t}\n\t\n\t/**\n\t * Determine if a value is a URLSearchParams object\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n\t */\n\tfunction isURLSearchParams(val) {\n\t return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n\t}\n\t\n\t/**\n\t * Trim excess whitespace off the beginning and end of a string\n\t *\n\t * @param {String} str The String to trim\n\t * @returns {String} The String freed of excess whitespace\n\t */\n\tfunction trim(str) {\n\t return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n\t}\n\t\n\t/**\n\t * Determine if we're running in a standard browser environment\n\t *\n\t * This allows axios to run in a web worker, and react-native.\n\t * Both environments support XMLHttpRequest, but not fully standard globals.\n\t *\n\t * web workers:\n\t * typeof window -> undefined\n\t * typeof document -> undefined\n\t *\n\t * react-native:\n\t * navigator.product -> 'ReactNative'\n\t */\n\tfunction isStandardBrowserEnv() {\n\t if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n\t return false;\n\t }\n\t return (\n\t typeof window !== 'undefined' &&\n\t typeof document !== 'undefined'\n\t );\n\t}\n\t\n\t/**\n\t * Iterate over an Array or an Object invoking a function for each item.\n\t *\n\t * If `obj` is an Array callback will be called passing\n\t * the value, index, and complete array for each item.\n\t *\n\t * If 'obj' is an Object callback will be called passing\n\t * the value, key, and complete object for each property.\n\t *\n\t * @param {Object|Array} obj The object to iterate\n\t * @param {Function} fn The callback to invoke for each item\n\t */\n\tfunction forEach(obj, fn) {\n\t // Don't bother if no value provided\n\t if (obj === null || typeof obj === 'undefined') {\n\t return;\n\t }\n\t\n\t // Force an array if not already something iterable\n\t if (typeof obj !== 'object') {\n\t /*eslint no-param-reassign:0*/\n\t obj = [obj];\n\t }\n\t\n\t if (isArray(obj)) {\n\t // Iterate over array values\n\t for (var i = 0, l = obj.length; i < l; i++) {\n\t fn.call(null, obj[i], i, obj);\n\t }\n\t } else {\n\t // Iterate over object keys\n\t for (var key in obj) {\n\t if (Object.prototype.hasOwnProperty.call(obj, key)) {\n\t fn.call(null, obj[key], key, obj);\n\t }\n\t }\n\t }\n\t}\n\t\n\t/**\n\t * Accepts varargs expecting each argument to be an object, then\n\t * immutably merges the properties of each object and returns result.\n\t *\n\t * When multiple objects contain the same key the later object in\n\t * the arguments list will take precedence.\n\t *\n\t * Example:\n\t *\n\t * ```js\n\t * var result = merge({foo: 123}, {foo: 456});\n\t * console.log(result.foo); // outputs 456\n\t * ```\n\t *\n\t * @param {Object} obj1 Object to merge\n\t * @returns {Object} Result of all merge properties\n\t */\n\tfunction merge(/* obj1, obj2, obj3, ... */) {\n\t var result = {};\n\t function assignValue(val, key) {\n\t if (typeof result[key] === 'object' && typeof val === 'object') {\n\t result[key] = merge(result[key], val);\n\t } else {\n\t result[key] = val;\n\t }\n\t }\n\t\n\t for (var i = 0, l = arguments.length; i < l; i++) {\n\t forEach(arguments[i], assignValue);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Extends object a by mutably adding to it the properties of object b.\n\t *\n\t * @param {Object} a The object to be extended\n\t * @param {Object} b The object to copy properties from\n\t * @param {Object} thisArg The object to bind function to\n\t * @return {Object} The resulting value of object a\n\t */\n\tfunction extend(a, b, thisArg) {\n\t forEach(b, function assignValue(val, key) {\n\t if (thisArg && typeof val === 'function') {\n\t a[key] = bind(val, thisArg);\n\t } else {\n\t a[key] = val;\n\t }\n\t });\n\t return a;\n\t}\n\t\n\tmodule.exports = {\n\t isArray: isArray,\n\t isArrayBuffer: isArrayBuffer,\n\t isBuffer: isBuffer,\n\t isFormData: isFormData,\n\t isArrayBufferView: isArrayBufferView,\n\t isString: isString,\n\t isNumber: isNumber,\n\t isObject: isObject,\n\t isUndefined: isUndefined,\n\t isDate: isDate,\n\t isFile: isFile,\n\t isBlob: isBlob,\n\t isFunction: isFunction,\n\t isStream: isStream,\n\t isURLSearchParams: isURLSearchParams,\n\t isStandardBrowserEnv: isStandardBrowserEnv,\n\t forEach: forEach,\n\t merge: merge,\n\t extend: extend,\n\t trim: trim\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function bind(fn, thisArg) {\n\t return function wrap() {\n\t var args = new Array(arguments.length);\n\t for (var i = 0; i < args.length; i++) {\n\t args[i] = arguments[i];\n\t }\n\t return fn.apply(thisArg, args);\n\t };\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports) {\n\n\t/*!\n\t * Determine if an object is a Buffer\n\t *\n\t * @author Feross Aboukhadijeh \n\t * @license MIT\n\t */\n\t\n\t// The _isBuffer check is for Safari 5-7 support, because it's missing\n\t// Object.prototype.constructor. Remove this eventually\n\tmodule.exports = function (obj) {\n\t return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n\t}\n\t\n\tfunction isBuffer (obj) {\n\t return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n\t}\n\t\n\t// For Node v0.10 support. Remove this eventually.\n\tfunction isSlowBuffer (obj) {\n\t return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n\t}\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar defaults = __webpack_require__(6);\n\tvar utils = __webpack_require__(2);\n\tvar InterceptorManager = __webpack_require__(17);\n\tvar dispatchRequest = __webpack_require__(18);\n\t\n\t/**\n\t * Create a new instance of Axios\n\t *\n\t * @param {Object} instanceConfig The default config for the instance\n\t */\n\tfunction Axios(instanceConfig) {\n\t this.defaults = instanceConfig;\n\t this.interceptors = {\n\t request: new InterceptorManager(),\n\t response: new InterceptorManager()\n\t };\n\t}\n\t\n\t/**\n\t * Dispatch a request\n\t *\n\t * @param {Object} config The config specific for this request (merged with this.defaults)\n\t */\n\tAxios.prototype.request = function request(config) {\n\t /*eslint no-param-reassign:0*/\n\t // Allow for axios('example/url'[, config]) a la fetch API\n\t if (typeof config === 'string') {\n\t config = utils.merge({\n\t url: arguments[0]\n\t }, arguments[1]);\n\t }\n\t\n\t config = utils.merge(defaults, this.defaults, { method: 'get' }, config);\n\t config.method = config.method.toLowerCase();\n\t\n\t // Hook up interceptors middleware\n\t var chain = [dispatchRequest, undefined];\n\t var promise = Promise.resolve(config);\n\t\n\t this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n\t chain.unshift(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n\t chain.push(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t while (chain.length) {\n\t promise = promise.then(chain.shift(), chain.shift());\n\t }\n\t\n\t return promise;\n\t};\n\t\n\t// Provide aliases for supported request methods\n\tutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url\n\t }));\n\t };\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, data, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url,\n\t data: data\n\t }));\n\t };\n\t});\n\t\n\tmodule.exports = Axios;\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar normalizeHeaderName = __webpack_require__(7);\n\t\n\tvar DEFAULT_CONTENT_TYPE = {\n\t 'Content-Type': 'application/x-www-form-urlencoded'\n\t};\n\t\n\tfunction setContentTypeIfUnset(headers, value) {\n\t if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n\t headers['Content-Type'] = value;\n\t }\n\t}\n\t\n\tfunction getDefaultAdapter() {\n\t var adapter;\n\t if (typeof XMLHttpRequest !== 'undefined') {\n\t // For browsers use XHR adapter\n\t adapter = __webpack_require__(8);\n\t } else if (typeof process !== 'undefined') {\n\t // For node use HTTP adapter\n\t adapter = __webpack_require__(8);\n\t }\n\t return adapter;\n\t}\n\t\n\tvar defaults = {\n\t adapter: getDefaultAdapter(),\n\t\n\t transformRequest: [function transformRequest(data, headers) {\n\t normalizeHeaderName(headers, 'Content-Type');\n\t if (utils.isFormData(data) ||\n\t utils.isArrayBuffer(data) ||\n\t utils.isBuffer(data) ||\n\t utils.isStream(data) ||\n\t utils.isFile(data) ||\n\t utils.isBlob(data)\n\t ) {\n\t return data;\n\t }\n\t if (utils.isArrayBufferView(data)) {\n\t return data.buffer;\n\t }\n\t if (utils.isURLSearchParams(data)) {\n\t setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n\t return data.toString();\n\t }\n\t if (utils.isObject(data)) {\n\t setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n\t return JSON.stringify(data);\n\t }\n\t return data;\n\t }],\n\t\n\t transformResponse: [function transformResponse(data) {\n\t /*eslint no-param-reassign:0*/\n\t if (typeof data === 'string') {\n\t try {\n\t data = JSON.parse(data);\n\t } catch (e) { /* Ignore */ }\n\t }\n\t return data;\n\t }],\n\t\n\t timeout: 0,\n\t\n\t xsrfCookieName: 'XSRF-TOKEN',\n\t xsrfHeaderName: 'X-XSRF-TOKEN',\n\t\n\t maxContentLength: -1,\n\t\n\t validateStatus: function validateStatus(status) {\n\t return status >= 200 && status < 300;\n\t }\n\t};\n\t\n\tdefaults.headers = {\n\t common: {\n\t 'Accept': 'application/json, text/plain, */*'\n\t }\n\t};\n\t\n\tutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n\t defaults.headers[method] = {};\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n\t});\n\t\n\tmodule.exports = defaults;\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n\t utils.forEach(headers, function processHeader(value, name) {\n\t if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n\t headers[normalizedName] = value;\n\t delete headers[name];\n\t }\n\t });\n\t};\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar settle = __webpack_require__(9);\n\tvar buildURL = __webpack_require__(12);\n\tvar parseHeaders = __webpack_require__(13);\n\tvar isURLSameOrigin = __webpack_require__(14);\n\tvar createError = __webpack_require__(10);\n\tvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(15);\n\t\n\tmodule.exports = function xhrAdapter(config) {\n\t return new Promise(function dispatchXhrRequest(resolve, reject) {\n\t var requestData = config.data;\n\t var requestHeaders = config.headers;\n\t\n\t if (utils.isFormData(requestData)) {\n\t delete requestHeaders['Content-Type']; // Let the browser set it\n\t }\n\t\n\t var request = new XMLHttpRequest();\n\t var loadEvent = 'onreadystatechange';\n\t var xDomain = false;\n\t\n\t // For IE 8/9 CORS support\n\t // Only supports POST and GET calls and doesn't returns the response headers.\n\t // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n\t if ((\"production\") !== 'test' &&\n\t typeof window !== 'undefined' &&\n\t window.XDomainRequest && !('withCredentials' in request) &&\n\t !isURLSameOrigin(config.url)) {\n\t request = new window.XDomainRequest();\n\t loadEvent = 'onload';\n\t xDomain = true;\n\t request.onprogress = function handleProgress() {};\n\t request.ontimeout = function handleTimeout() {};\n\t }\n\t\n\t // HTTP basic authentication\n\t if (config.auth) {\n\t var username = config.auth.username || '';\n\t var password = config.auth.password || '';\n\t requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n\t }\n\t\n\t request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\t\n\t // Set the request timeout in MS\n\t request.timeout = config.timeout;\n\t\n\t // Listen for ready state\n\t request[loadEvent] = function handleLoad() {\n\t if (!request || (request.readyState !== 4 && !xDomain)) {\n\t return;\n\t }\n\t\n\t // The request errored out and we didn't get a response, this will be\n\t // handled by onerror instead\n\t // With one exception: request that using file: protocol, most browsers\n\t // will return status as 0 even though it's a successful request\n\t if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n\t return;\n\t }\n\t\n\t // Prepare the response\n\t var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n\t var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n\t var response = {\n\t data: responseData,\n\t // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n\t status: request.status === 1223 ? 204 : request.status,\n\t statusText: request.status === 1223 ? 'No Content' : request.statusText,\n\t headers: responseHeaders,\n\t config: config,\n\t request: request\n\t };\n\t\n\t settle(resolve, reject, response);\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle low level network errors\n\t request.onerror = function handleError() {\n\t // Real errors are hidden from us by the browser\n\t // onerror should only fire if it's a network error\n\t reject(createError('Network Error', config, null, request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle timeout\n\t request.ontimeout = function handleTimeout() {\n\t reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n\t request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Add xsrf header\n\t // This is only done if running in a standard browser environment.\n\t // Specifically not if we're in a web worker, or react-native.\n\t if (utils.isStandardBrowserEnv()) {\n\t var cookies = __webpack_require__(16);\n\t\n\t // Add xsrf header\n\t var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n\t cookies.read(config.xsrfCookieName) :\n\t undefined;\n\t\n\t if (xsrfValue) {\n\t requestHeaders[config.xsrfHeaderName] = xsrfValue;\n\t }\n\t }\n\t\n\t // Add headers to the request\n\t if ('setRequestHeader' in request) {\n\t utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n\t if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n\t // Remove Content-Type if data is undefined\n\t delete requestHeaders[key];\n\t } else {\n\t // Otherwise add header to the request\n\t request.setRequestHeader(key, val);\n\t }\n\t });\n\t }\n\t\n\t // Add withCredentials to request if needed\n\t if (config.withCredentials) {\n\t request.withCredentials = true;\n\t }\n\t\n\t // Add responseType to request if needed\n\t if (config.responseType) {\n\t try {\n\t request.responseType = config.responseType;\n\t } catch (e) {\n\t // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n\t // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n\t if (config.responseType !== 'json') {\n\t throw e;\n\t }\n\t }\n\t }\n\t\n\t // Handle progress if needed\n\t if (typeof config.onDownloadProgress === 'function') {\n\t request.addEventListener('progress', config.onDownloadProgress);\n\t }\n\t\n\t // Not all browsers support upload events\n\t if (typeof config.onUploadProgress === 'function' && request.upload) {\n\t request.upload.addEventListener('progress', config.onUploadProgress);\n\t }\n\t\n\t if (config.cancelToken) {\n\t // Handle cancellation\n\t config.cancelToken.promise.then(function onCanceled(cancel) {\n\t if (!request) {\n\t return;\n\t }\n\t\n\t request.abort();\n\t reject(cancel);\n\t // Clean up request\n\t request = null;\n\t });\n\t }\n\t\n\t if (requestData === undefined) {\n\t requestData = null;\n\t }\n\t\n\t // Send the request\n\t request.send(requestData);\n\t });\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar createError = __webpack_require__(10);\n\t\n\t/**\n\t * Resolve or reject a Promise based on response status.\n\t *\n\t * @param {Function} resolve A function that resolves the promise.\n\t * @param {Function} reject A function that rejects the promise.\n\t * @param {object} response The response.\n\t */\n\tmodule.exports = function settle(resolve, reject, response) {\n\t var validateStatus = response.config.validateStatus;\n\t // Note: status is not exposed by XDomainRequest\n\t if (!response.status || !validateStatus || validateStatus(response.status)) {\n\t resolve(response);\n\t } else {\n\t reject(createError(\n\t 'Request failed with status code ' + response.status,\n\t response.config,\n\t null,\n\t response.request,\n\t response\n\t ));\n\t }\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar enhanceError = __webpack_require__(11);\n\t\n\t/**\n\t * Create an Error with the specified message, config, error code, request and response.\n\t *\n\t * @param {string} message The error message.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The created error.\n\t */\n\tmodule.exports = function createError(message, config, code, request, response) {\n\t var error = new Error(message);\n\t return enhanceError(error, config, code, request, response);\n\t};\n\n\n/***/ }),\n/* 11 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Update an Error with the specified config, error code, and response.\n\t *\n\t * @param {Error} error The error to update.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The error.\n\t */\n\tmodule.exports = function enhanceError(error, config, code, request, response) {\n\t error.config = config;\n\t if (code) {\n\t error.code = code;\n\t }\n\t error.request = request;\n\t error.response = response;\n\t return error;\n\t};\n\n\n/***/ }),\n/* 12 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction encode(val) {\n\t return encodeURIComponent(val).\n\t replace(/%40/gi, '@').\n\t replace(/%3A/gi, ':').\n\t replace(/%24/g, '$').\n\t replace(/%2C/gi, ',').\n\t replace(/%20/g, '+').\n\t replace(/%5B/gi, '[').\n\t replace(/%5D/gi, ']');\n\t}\n\t\n\t/**\n\t * Build a URL by appending params to the end\n\t *\n\t * @param {string} url The base of the url (e.g., http://www.google.com)\n\t * @param {object} [params] The params to be appended\n\t * @returns {string} The formatted url\n\t */\n\tmodule.exports = function buildURL(url, params, paramsSerializer) {\n\t /*eslint no-param-reassign:0*/\n\t if (!params) {\n\t return url;\n\t }\n\t\n\t var serializedParams;\n\t if (paramsSerializer) {\n\t serializedParams = paramsSerializer(params);\n\t } else if (utils.isURLSearchParams(params)) {\n\t serializedParams = params.toString();\n\t } else {\n\t var parts = [];\n\t\n\t utils.forEach(params, function serialize(val, key) {\n\t if (val === null || typeof val === 'undefined') {\n\t return;\n\t }\n\t\n\t if (utils.isArray(val)) {\n\t key = key + '[]';\n\t }\n\t\n\t if (!utils.isArray(val)) {\n\t val = [val];\n\t }\n\t\n\t utils.forEach(val, function parseValue(v) {\n\t if (utils.isDate(v)) {\n\t v = v.toISOString();\n\t } else if (utils.isObject(v)) {\n\t v = JSON.stringify(v);\n\t }\n\t parts.push(encode(key) + '=' + encode(v));\n\t });\n\t });\n\t\n\t serializedParams = parts.join('&');\n\t }\n\t\n\t if (serializedParams) {\n\t url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n\t }\n\t\n\t return url;\n\t};\n\n\n/***/ }),\n/* 13 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t// Headers whose duplicates are ignored by node\n\t// c.f. https://nodejs.org/api/http.html#http_message_headers\n\tvar ignoreDuplicateOf = [\n\t 'age', 'authorization', 'content-length', 'content-type', 'etag',\n\t 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n\t 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n\t 'referer', 'retry-after', 'user-agent'\n\t];\n\t\n\t/**\n\t * Parse headers into an object\n\t *\n\t * ```\n\t * Date: Wed, 27 Aug 2014 08:58:49 GMT\n\t * Content-Type: application/json\n\t * Connection: keep-alive\n\t * Transfer-Encoding: chunked\n\t * ```\n\t *\n\t * @param {String} headers Headers needing to be parsed\n\t * @returns {Object} Headers parsed into an object\n\t */\n\tmodule.exports = function parseHeaders(headers) {\n\t var parsed = {};\n\t var key;\n\t var val;\n\t var i;\n\t\n\t if (!headers) { return parsed; }\n\t\n\t utils.forEach(headers.split('\\n'), function parser(line) {\n\t i = line.indexOf(':');\n\t key = utils.trim(line.substr(0, i)).toLowerCase();\n\t val = utils.trim(line.substr(i + 1));\n\t\n\t if (key) {\n\t if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n\t return;\n\t }\n\t if (key === 'set-cookie') {\n\t parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n\t } else {\n\t parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n\t }\n\t }\n\t });\n\t\n\t return parsed;\n\t};\n\n\n/***/ }),\n/* 14 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs have full support of the APIs needed to test\n\t // whether the request URL is of the same origin as current location.\n\t (function standardBrowserEnv() {\n\t var msie = /(msie|trident)/i.test(navigator.userAgent);\n\t var urlParsingNode = document.createElement('a');\n\t var originURL;\n\t\n\t /**\n\t * Parse a URL to discover it's components\n\t *\n\t * @param {String} url The URL to be parsed\n\t * @returns {Object}\n\t */\n\t function resolveURL(url) {\n\t var href = url;\n\t\n\t if (msie) {\n\t // IE needs attribute set twice to normalize properties\n\t urlParsingNode.setAttribute('href', href);\n\t href = urlParsingNode.href;\n\t }\n\t\n\t urlParsingNode.setAttribute('href', href);\n\t\n\t // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n\t return {\n\t href: urlParsingNode.href,\n\t protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n\t host: urlParsingNode.host,\n\t search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n\t hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n\t hostname: urlParsingNode.hostname,\n\t port: urlParsingNode.port,\n\t pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n\t urlParsingNode.pathname :\n\t '/' + urlParsingNode.pathname\n\t };\n\t }\n\t\n\t originURL = resolveURL(window.location.href);\n\t\n\t /**\n\t * Determine if a URL shares the same origin as the current location\n\t *\n\t * @param {String} requestURL The URL to test\n\t * @returns {boolean} True if URL shares the same origin, otherwise false\n\t */\n\t return function isURLSameOrigin(requestURL) {\n\t var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n\t return (parsed.protocol === originURL.protocol &&\n\t parsed.host === originURL.host);\n\t };\n\t })() :\n\t\n\t // Non standard browser envs (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return function isURLSameOrigin() {\n\t return true;\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 15 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\t\n\tvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\t\n\tfunction E() {\n\t this.message = 'String contains an invalid character';\n\t}\n\tE.prototype = new Error;\n\tE.prototype.code = 5;\n\tE.prototype.name = 'InvalidCharacterError';\n\t\n\tfunction btoa(input) {\n\t var str = String(input);\n\t var output = '';\n\t for (\n\t // initialize result and counter\n\t var block, charCode, idx = 0, map = chars;\n\t // if the next str index does not exist:\n\t // change the mapping table to \"=\"\n\t // check if d has no fractional digits\n\t str.charAt(idx | 0) || (map = '=', idx % 1);\n\t // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n\t output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n\t ) {\n\t charCode = str.charCodeAt(idx += 3 / 4);\n\t if (charCode > 0xFF) {\n\t throw new E();\n\t }\n\t block = block << 8 | charCode;\n\t }\n\t return output;\n\t}\n\t\n\tmodule.exports = btoa;\n\n\n/***/ }),\n/* 16 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs support document.cookie\n\t (function standardBrowserEnv() {\n\t return {\n\t write: function write(name, value, expires, path, domain, secure) {\n\t var cookie = [];\n\t cookie.push(name + '=' + encodeURIComponent(value));\n\t\n\t if (utils.isNumber(expires)) {\n\t cookie.push('expires=' + new Date(expires).toGMTString());\n\t }\n\t\n\t if (utils.isString(path)) {\n\t cookie.push('path=' + path);\n\t }\n\t\n\t if (utils.isString(domain)) {\n\t cookie.push('domain=' + domain);\n\t }\n\t\n\t if (secure === true) {\n\t cookie.push('secure');\n\t }\n\t\n\t document.cookie = cookie.join('; ');\n\t },\n\t\n\t read: function read(name) {\n\t var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n\t return (match ? decodeURIComponent(match[3]) : null);\n\t },\n\t\n\t remove: function remove(name) {\n\t this.write(name, '', Date.now() - 86400000);\n\t }\n\t };\n\t })() :\n\t\n\t // Non standard browser env (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return {\n\t write: function write() {},\n\t read: function read() { return null; },\n\t remove: function remove() {}\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 17 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction InterceptorManager() {\n\t this.handlers = [];\n\t}\n\t\n\t/**\n\t * Add a new interceptor to the stack\n\t *\n\t * @param {Function} fulfilled The function to handle `then` for a `Promise`\n\t * @param {Function} rejected The function to handle `reject` for a `Promise`\n\t *\n\t * @return {Number} An ID used to remove interceptor later\n\t */\n\tInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n\t this.handlers.push({\n\t fulfilled: fulfilled,\n\t rejected: rejected\n\t });\n\t return this.handlers.length - 1;\n\t};\n\t\n\t/**\n\t * Remove an interceptor from the stack\n\t *\n\t * @param {Number} id The ID that was returned by `use`\n\t */\n\tInterceptorManager.prototype.eject = function eject(id) {\n\t if (this.handlers[id]) {\n\t this.handlers[id] = null;\n\t }\n\t};\n\t\n\t/**\n\t * Iterate over all the registered interceptors\n\t *\n\t * This method is particularly useful for skipping over any\n\t * interceptors that may have become `null` calling `eject`.\n\t *\n\t * @param {Function} fn The function to call for each interceptor\n\t */\n\tInterceptorManager.prototype.forEach = function forEach(fn) {\n\t utils.forEach(this.handlers, function forEachHandler(h) {\n\t if (h !== null) {\n\t fn(h);\n\t }\n\t });\n\t};\n\t\n\tmodule.exports = InterceptorManager;\n\n\n/***/ }),\n/* 18 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar transformData = __webpack_require__(19);\n\tvar isCancel = __webpack_require__(20);\n\tvar defaults = __webpack_require__(6);\n\tvar isAbsoluteURL = __webpack_require__(21);\n\tvar combineURLs = __webpack_require__(22);\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tfunction throwIfCancellationRequested(config) {\n\t if (config.cancelToken) {\n\t config.cancelToken.throwIfRequested();\n\t }\n\t}\n\t\n\t/**\n\t * Dispatch a request to the server using the configured adapter.\n\t *\n\t * @param {object} config The config that is to be used for the request\n\t * @returns {Promise} The Promise to be fulfilled\n\t */\n\tmodule.exports = function dispatchRequest(config) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Support baseURL config\n\t if (config.baseURL && !isAbsoluteURL(config.url)) {\n\t config.url = combineURLs(config.baseURL, config.url);\n\t }\n\t\n\t // Ensure headers exist\n\t config.headers = config.headers || {};\n\t\n\t // Transform request data\n\t config.data = transformData(\n\t config.data,\n\t config.headers,\n\t config.transformRequest\n\t );\n\t\n\t // Flatten headers\n\t config.headers = utils.merge(\n\t config.headers.common || {},\n\t config.headers[config.method] || {},\n\t config.headers || {}\n\t );\n\t\n\t utils.forEach(\n\t ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n\t function cleanHeaderConfig(method) {\n\t delete config.headers[method];\n\t }\n\t );\n\t\n\t var adapter = config.adapter || defaults.adapter;\n\t\n\t return adapter(config).then(function onAdapterResolution(response) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t response.data = transformData(\n\t response.data,\n\t response.headers,\n\t config.transformResponse\n\t );\n\t\n\t return response;\n\t }, function onAdapterRejection(reason) {\n\t if (!isCancel(reason)) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t if (reason && reason.response) {\n\t reason.response.data = transformData(\n\t reason.response.data,\n\t reason.response.headers,\n\t config.transformResponse\n\t );\n\t }\n\t }\n\t\n\t return Promise.reject(reason);\n\t });\n\t};\n\n\n/***/ }),\n/* 19 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t/**\n\t * Transform the data for a request or a response\n\t *\n\t * @param {Object|String} data The data to be transformed\n\t * @param {Array} headers The headers for the request or response\n\t * @param {Array|Function} fns A single function or Array of functions\n\t * @returns {*} The resulting transformed data\n\t */\n\tmodule.exports = function transformData(data, headers, fns) {\n\t /*eslint no-param-reassign:0*/\n\t utils.forEach(fns, function transform(fn) {\n\t data = fn(data, headers);\n\t });\n\t\n\t return data;\n\t};\n\n\n/***/ }),\n/* 20 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function isCancel(value) {\n\t return !!(value && value.__CANCEL__);\n\t};\n\n\n/***/ }),\n/* 21 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Determines whether the specified URL is absolute\n\t *\n\t * @param {string} url The URL to test\n\t * @returns {boolean} True if the specified URL is absolute, otherwise false\n\t */\n\tmodule.exports = function isAbsoluteURL(url) {\n\t // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n\t // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n\t // by any combination of letters, digits, plus, period, or hyphen.\n\t return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n\t};\n\n\n/***/ }),\n/* 22 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Creates a new URL by combining the specified URLs\n\t *\n\t * @param {string} baseURL The base URL\n\t * @param {string} relativeURL The relative URL\n\t * @returns {string} The combined URL\n\t */\n\tmodule.exports = function combineURLs(baseURL, relativeURL) {\n\t return relativeURL\n\t ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n\t : baseURL;\n\t};\n\n\n/***/ }),\n/* 23 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * A `Cancel` is an object that is thrown when an operation is canceled.\n\t *\n\t * @class\n\t * @param {string=} message The message.\n\t */\n\tfunction Cancel(message) {\n\t this.message = message;\n\t}\n\t\n\tCancel.prototype.toString = function toString() {\n\t return 'Cancel' + (this.message ? ': ' + this.message : '');\n\t};\n\t\n\tCancel.prototype.__CANCEL__ = true;\n\t\n\tmodule.exports = Cancel;\n\n\n/***/ }),\n/* 24 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar Cancel = __webpack_require__(23);\n\t\n\t/**\n\t * A `CancelToken` is an object that can be used to request cancellation of an operation.\n\t *\n\t * @class\n\t * @param {Function} executor The executor function.\n\t */\n\tfunction CancelToken(executor) {\n\t if (typeof executor !== 'function') {\n\t throw new TypeError('executor must be a function.');\n\t }\n\t\n\t var resolvePromise;\n\t this.promise = new Promise(function promiseExecutor(resolve) {\n\t resolvePromise = resolve;\n\t });\n\t\n\t var token = this;\n\t executor(function cancel(message) {\n\t if (token.reason) {\n\t // Cancellation has already been requested\n\t return;\n\t }\n\t\n\t token.reason = new Cancel(message);\n\t resolvePromise(token.reason);\n\t });\n\t}\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n\t if (this.reason) {\n\t throw this.reason;\n\t }\n\t};\n\t\n\t/**\n\t * Returns an object that contains a new `CancelToken` and a function that, when called,\n\t * cancels the `CancelToken`.\n\t */\n\tCancelToken.source = function source() {\n\t var cancel;\n\t var token = new CancelToken(function executor(c) {\n\t cancel = c;\n\t });\n\t return {\n\t token: token,\n\t cancel: cancel\n\t };\n\t};\n\t\n\tmodule.exports = CancelToken;\n\n\n/***/ }),\n/* 25 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Syntactic sugar for invoking a function and expanding an array for arguments.\n\t *\n\t * Common use case would be to use `Function.prototype.apply`.\n\t *\n\t * ```js\n\t * function f(x, y, z) {}\n\t * var args = [1, 2, 3];\n\t * f.apply(null, args);\n\t * ```\n\t *\n\t * With `spread` this example can be re-written.\n\t *\n\t * ```js\n\t * spread(function(x, y, z) {})([1, 2, 3]);\n\t * ```\n\t *\n\t * @param {Function} callback\n\t * @returns {Function}\n\t */\n\tmodule.exports = function spread(callback) {\n\t return function wrap(arr) {\n\t return callback.apply(null, arr);\n\t };\n\t};\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// axios.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 99abf9ea5c2f99fe227c","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(utils.merge(defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\nvar isBuffer = require('is-buffer');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh \n * @license MIT\n */\n\n// The _isBuffer check is for Safari 5-7 support, because it's missing\n// Object.prototype.constructor. Remove this eventually\nmodule.exports = function (obj) {\n return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n}\n\nfunction isBuffer (obj) {\n return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n// For Node v0.10 support. Remove this eventually.\nfunction isSlowBuffer (obj) {\n return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/is-buffer/index.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar defaults = require('./../defaults');\nvar utils = require('./../utils');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = utils.merge({\n url: arguments[0]\n }, arguments[1]);\n }\n\n config = utils.merge(defaults, this.defaults, { method: 'get' }, config);\n config.method = config.method.toLowerCase();\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\nvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || require('./../helpers/btoa');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n var loadEvent = 'onreadystatechange';\n var xDomain = false;\n\n // For IE 8/9 CORS support\n // Only supports POST and GET calls and doesn't returns the response headers.\n // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n if (process.env.NODE_ENV !== 'test' &&\n typeof window !== 'undefined' &&\n window.XDomainRequest && !('withCredentials' in request) &&\n !isURLSameOrigin(config.url)) {\n request = new window.XDomainRequest();\n loadEvent = 'onload';\n xDomain = true;\n request.onprogress = function handleProgress() {};\n request.ontimeout = function handleTimeout() {};\n }\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request[loadEvent] = function handleLoad() {\n if (!request || (request.readyState !== 4 && !xDomain)) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n status: request.status === 1223 ? 204 : request.status,\n statusText: request.status === 1223 ? 'No Content' : request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n // Note: status is not exposed by XDomainRequest\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 10\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n error.request = request;\n error.response = response;\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n }\n\n if (!utils.isArray(val)) {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 14\n// module chunks = 0","'use strict';\n\n// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\nvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\nfunction E() {\n this.message = 'String contains an invalid character';\n}\nE.prototype = new Error;\nE.prototype.code = 5;\nE.prototype.name = 'InvalidCharacterError';\n\nfunction btoa(input) {\n var str = String(input);\n var output = '';\n for (\n // initialize result and counter\n var block, charCode, idx = 0, map = chars;\n // if the next str index does not exist:\n // change the mapping table to \"=\"\n // check if d has no fractional digits\n str.charAt(idx | 0) || (map = '=', idx % 1);\n // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n ) {\n charCode = str.charCodeAt(idx += 3 / 4);\n if (charCode > 0xFF) {\n throw new E();\n }\n block = block << 8 | charCode;\n }\n return output;\n}\n\nmodule.exports = btoa;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/btoa.js\n// module id = 15\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 16\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 17\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar isAbsoluteURL = require('./../helpers/isAbsoluteURL');\nvar combineURLs = require('./../helpers/combineURLs');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 19\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 20\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 21\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/helloworld/node_modules/axios/index.d.ts b/helloworld/node_modules/axios/index.d.ts new file mode 100755 index 0000000..5204a30 --- /dev/null +++ b/helloworld/node_modules/axios/index.d.ts @@ -0,0 +1,127 @@ +export interface AxiosTransformer { + (data: any, headers?: any): any; +} + +export interface AxiosAdapter { + (config: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosBasicCredentials { + username: string; + password: string; +} + +export interface AxiosProxyConfig { + host: string; + port: number; +} + +export interface AxiosRequestConfig { + url?: string; + method?: string; + baseURL?: string; + transformRequest?: AxiosTransformer | AxiosTransformer[]; + transformResponse?: AxiosTransformer | AxiosTransformer[]; + headers?: any; + params?: any; + paramsSerializer?: (params: any) => string; + data?: any; + timeout?: number; + withCredentials?: boolean; + adapter?: AxiosAdapter; + auth?: AxiosBasicCredentials; + responseType?: string; + xsrfCookieName?: string; + xsrfHeaderName?: string; + onUploadProgress?: (progressEvent: any) => void; + onDownloadProgress?: (progressEvent: any) => void; + maxContentLength?: number; + validateStatus?: (status: number) => boolean; + maxRedirects?: number; + httpAgent?: any; + httpsAgent?: any; + proxy?: AxiosProxyConfig; + cancelToken?: CancelToken; +} + +export interface AxiosResponse { + data: T; + status: number; + statusText: string; + headers: any; + config: AxiosRequestConfig; + request?: any; +} + +export interface AxiosError extends Error { + config: AxiosRequestConfig; + code?: string; + request?: any; + response?: AxiosResponse; +} + +export interface AxiosPromise extends Promise> { +} + +export interface CancelStatic { + new (message?: string): Cancel; +} + +export interface Cancel { + message: string; +} + +export interface Canceler { + (message?: string): void; +} + +export interface CancelTokenStatic { + new (executor: (cancel: Canceler) => void): CancelToken; + source(): CancelTokenSource; +} + +export interface CancelToken { + promise: Promise; + reason?: Cancel; + throwIfRequested(): void; +} + +export interface CancelTokenSource { + token: CancelToken; + cancel: Canceler; +} + +export interface AxiosInterceptorManager { + use(onFulfilled?: (value: V) => V | Promise, onRejected?: (error: any) => any): number; + eject(id: number): void; +} + +export interface AxiosInstance { + defaults: AxiosRequestConfig; + interceptors: { + request: AxiosInterceptorManager; + response: AxiosInterceptorManager; + }; + request(config: AxiosRequestConfig): AxiosPromise; + get(url: string, config?: AxiosRequestConfig): AxiosPromise; + delete(url: string, config?: AxiosRequestConfig): AxiosPromise; + head(url: string, config?: AxiosRequestConfig): AxiosPromise; + post(url: string, data?: any, config?: AxiosRequestConfig): AxiosPromise; + put(url: string, data?: any, config?: AxiosRequestConfig): AxiosPromise; + patch(url: string, data?: any, config?: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosStatic extends AxiosInstance { + (config: AxiosRequestConfig): AxiosPromise; + (url: string, config?: AxiosRequestConfig): AxiosPromise; + create(config?: AxiosRequestConfig): AxiosInstance; + Cancel: CancelStatic; + CancelToken: CancelTokenStatic; + isCancel(value: any): boolean; + all(values: (T | Promise)[]): Promise; + spread(callback: (...args: T[]) => R): (array: T[]) => R; +} + +declare const Axios: AxiosStatic; + +export default Axios; diff --git a/helloworld/node_modules/axios/index.js b/helloworld/node_modules/axios/index.js new file mode 100755 index 0000000..79dfd09 --- /dev/null +++ b/helloworld/node_modules/axios/index.js @@ -0,0 +1 @@ +module.exports = require('./lib/axios'); \ No newline at end of file diff --git a/helloworld/node_modules/axios/lib/adapters/README.md b/helloworld/node_modules/axios/lib/adapters/README.md new file mode 100755 index 0000000..68f1118 --- /dev/null +++ b/helloworld/node_modules/axios/lib/adapters/README.md @@ -0,0 +1,37 @@ +# axios // adapters + +The modules under `adapters/` are modules that handle dispatching a request and settling a returned `Promise` once a response is received. + +## Example + +```js +var settle = require('./../core/settle'); + +module.exports = function myAdapter(config) { + // At this point: + // - config has been merged with defaults + // - request transformers have already run + // - request interceptors have already run + + // Make the request using config provided + // Upon response settle the Promise + + return new Promise(function(resolve, reject) { + + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // From here: + // - response transformers will run + // - response interceptors will run + }); +} +``` diff --git a/helloworld/node_modules/axios/lib/adapters/http.js b/helloworld/node_modules/axios/lib/adapters/http.js new file mode 100755 index 0000000..f6d7067 --- /dev/null +++ b/helloworld/node_modules/axios/lib/adapters/http.js @@ -0,0 +1,228 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildURL = require('./../helpers/buildURL'); +var http = require('http'); +var https = require('https'); +var httpFollow = require('follow-redirects').http; +var httpsFollow = require('follow-redirects').https; +var url = require('url'); +var zlib = require('zlib'); +var pkg = require('./../../package.json'); +var createError = require('../core/createError'); +var enhanceError = require('../core/enhanceError'); + +/*eslint consistent-return:0*/ +module.exports = function httpAdapter(config) { + return new Promise(function dispatchHttpRequest(resolve, reject) { + var data = config.data; + var headers = config.headers; + var timer; + + // Set User-Agent (required by some servers) + // Only set header if it hasn't been set in config + // See https://github.com/axios/axios/issues/69 + if (!headers['User-Agent'] && !headers['user-agent']) { + headers['User-Agent'] = 'axios/' + pkg.version; + } + + if (data && !utils.isStream(data)) { + if (Buffer.isBuffer(data)) { + // Nothing to do... + } else if (utils.isArrayBuffer(data)) { + data = new Buffer(new Uint8Array(data)); + } else if (utils.isString(data)) { + data = new Buffer(data, 'utf-8'); + } else { + return reject(createError( + 'Data after transformation must be a string, an ArrayBuffer, a Buffer, or a Stream', + config + )); + } + + // Add Content-Length header if data exists + headers['Content-Length'] = data.length; + } + + // HTTP basic authentication + var auth = undefined; + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + auth = username + ':' + password; + } + + // Parse url + var parsed = url.parse(config.url); + var protocol = parsed.protocol || 'http:'; + + if (!auth && parsed.auth) { + var urlAuth = parsed.auth.split(':'); + var urlUsername = urlAuth[0] || ''; + var urlPassword = urlAuth[1] || ''; + auth = urlUsername + ':' + urlPassword; + } + + if (auth) { + delete headers.Authorization; + } + + var isHttps = protocol === 'https:'; + var agent = isHttps ? config.httpsAgent : config.httpAgent; + + var options = { + hostname: parsed.hostname, + port: parsed.port, + path: buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''), + method: config.method, + headers: headers, + agent: agent, + auth: auth + }; + + var proxy = config.proxy; + if (!proxy && proxy !== false) { + var proxyEnv = protocol.slice(0, -1) + '_proxy'; + var proxyUrl = process.env[proxyEnv] || process.env[proxyEnv.toUpperCase()]; + if (proxyUrl) { + var parsedProxyUrl = url.parse(proxyUrl); + proxy = { + host: parsedProxyUrl.hostname, + port: parsedProxyUrl.port + }; + + if (parsedProxyUrl.auth) { + var proxyUrlAuth = parsedProxyUrl.auth.split(':'); + proxy.auth = { + username: proxyUrlAuth[0], + password: proxyUrlAuth[1] + }; + } + } + } + + if (proxy) { + options.hostname = proxy.host; + options.host = proxy.host; + options.headers.host = parsed.hostname + (parsed.port ? ':' + parsed.port : ''); + options.port = proxy.port; + options.path = protocol + '//' + parsed.hostname + (parsed.port ? ':' + parsed.port : '') + options.path; + + // Basic proxy authorization + if (proxy.auth) { + var base64 = new Buffer(proxy.auth.username + ':' + proxy.auth.password, 'utf8').toString('base64'); + options.headers['Proxy-Authorization'] = 'Basic ' + base64; + } + } + + var transport; + if (config.transport) { + transport = config.transport; + } else if (config.maxRedirects === 0) { + transport = isHttps ? https : http; + } else { + if (config.maxRedirects) { + options.maxRedirects = config.maxRedirects; + } + transport = isHttps ? httpsFollow : httpFollow; + } + + // Create the request + var req = transport.request(options, function handleResponse(res) { + if (req.aborted) return; + + // Response has been received so kill timer that handles request timeout + clearTimeout(timer); + timer = null; + + // uncompress the response body transparently if required + var stream = res; + switch (res.headers['content-encoding']) { + /*eslint default-case:0*/ + case 'gzip': + case 'compress': + case 'deflate': + // add the unzipper to the body stream processing pipeline + stream = stream.pipe(zlib.createUnzip()); + + // remove the content-encoding in order to not confuse downstream operations + delete res.headers['content-encoding']; + break; + } + + // return the last request in case of redirects + var lastRequest = res.req || req; + + var response = { + status: res.statusCode, + statusText: res.statusMessage, + headers: res.headers, + config: config, + request: lastRequest + }; + + if (config.responseType === 'stream') { + response.data = stream; + settle(resolve, reject, response); + } else { + var responseBuffer = []; + stream.on('data', function handleStreamData(chunk) { + responseBuffer.push(chunk); + + // make sure the content length is not over the maxContentLength if specified + if (config.maxContentLength > -1 && Buffer.concat(responseBuffer).length > config.maxContentLength) { + reject(createError('maxContentLength size of ' + config.maxContentLength + ' exceeded', + config, null, lastRequest)); + } + }); + + stream.on('error', function handleStreamError(err) { + if (req.aborted) return; + reject(enhanceError(err, config, null, lastRequest)); + }); + + stream.on('end', function handleStreamEnd() { + var responseData = Buffer.concat(responseBuffer); + if (config.responseType !== 'arraybuffer') { + responseData = responseData.toString('utf8'); + } + + response.data = responseData; + settle(resolve, reject, response); + }); + } + }); + + // Handle errors + req.on('error', function handleRequestError(err) { + if (req.aborted) return; + reject(enhanceError(err, config, null, req)); + }); + + // Handle request timeout + if (config.timeout && !timer) { + timer = setTimeout(function handleRequestTimeout() { + req.abort(); + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', req)); + }, config.timeout); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (req.aborted) return; + + req.abort(); + reject(cancel); + }); + } + + // Send the request + if (utils.isStream(data)) { + data.pipe(req); + } else { + req.end(data); + } + }); +}; diff --git a/helloworld/node_modules/axios/lib/adapters/xhr.js b/helloworld/node_modules/axios/lib/adapters/xhr.js new file mode 100755 index 0000000..81364bd --- /dev/null +++ b/helloworld/node_modules/axios/lib/adapters/xhr.js @@ -0,0 +1,180 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildURL = require('./../helpers/buildURL'); +var parseHeaders = require('./../helpers/parseHeaders'); +var isURLSameOrigin = require('./../helpers/isURLSameOrigin'); +var createError = require('../core/createError'); +var btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || require('./../helpers/btoa'); + +module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + var loadEvent = 'onreadystatechange'; + var xDomain = false; + + // For IE 8/9 CORS support + // Only supports POST and GET calls and doesn't returns the response headers. + // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest. + if (process.env.NODE_ENV !== 'test' && + typeof window !== 'undefined' && + window.XDomainRequest && !('withCredentials' in request) && + !isURLSameOrigin(config.url)) { + request = new window.XDomainRequest(); + loadEvent = 'onload'; + xDomain = true; + request.onprogress = function handleProgress() {}; + request.ontimeout = function handleTimeout() {}; + } + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + // Listen for ready state + request[loadEvent] = function handleLoad() { + if (!request || (request.readyState !== 4 && !xDomain)) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var response = { + data: responseData, + // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201) + status: request.status === 1223 ? 204 : request.status, + statusText: request.status === 1223 ? 'No Content' : request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + var cookies = require('./../helpers/cookies'); + + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (config.withCredentials) { + request.withCredentials = true; + } + + // Add responseType to request if needed + if (config.responseType) { + try { + request.responseType = config.responseType; + } catch (e) { + // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. + // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. + if (config.responseType !== 'json') { + throw e; + } + } + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (!request) { + return; + } + + request.abort(); + reject(cancel); + // Clean up request + request = null; + }); + } + + if (requestData === undefined) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); +}; diff --git a/helloworld/node_modules/axios/lib/axios.js b/helloworld/node_modules/axios/lib/axios.js new file mode 100755 index 0000000..ed1f519 --- /dev/null +++ b/helloworld/node_modules/axios/lib/axios.js @@ -0,0 +1,52 @@ +'use strict'; + +var utils = require('./utils'); +var bind = require('./helpers/bind'); +var Axios = require('./core/Axios'); +var defaults = require('./defaults'); + +/** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ +function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + return instance; +} + +// Create the default instance to be exported +var axios = createInstance(defaults); + +// Expose Axios class to allow class inheritance +axios.Axios = Axios; + +// Factory for creating new instances +axios.create = function create(instanceConfig) { + return createInstance(utils.merge(defaults, instanceConfig)); +}; + +// Expose Cancel & CancelToken +axios.Cancel = require('./cancel/Cancel'); +axios.CancelToken = require('./cancel/CancelToken'); +axios.isCancel = require('./cancel/isCancel'); + +// Expose all/spread +axios.all = function all(promises) { + return Promise.all(promises); +}; +axios.spread = require('./helpers/spread'); + +module.exports = axios; + +// Allow use of default import syntax in TypeScript +module.exports.default = axios; diff --git a/helloworld/node_modules/axios/lib/cancel/Cancel.js b/helloworld/node_modules/axios/lib/cancel/Cancel.js new file mode 100755 index 0000000..e0de400 --- /dev/null +++ b/helloworld/node_modules/axios/lib/cancel/Cancel.js @@ -0,0 +1,19 @@ +'use strict'; + +/** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ +function Cancel(message) { + this.message = message; +} + +Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); +}; + +Cancel.prototype.__CANCEL__ = true; + +module.exports = Cancel; diff --git a/helloworld/node_modules/axios/lib/cancel/CancelToken.js b/helloworld/node_modules/axios/lib/cancel/CancelToken.js new file mode 100755 index 0000000..6b46e66 --- /dev/null +++ b/helloworld/node_modules/axios/lib/cancel/CancelToken.js @@ -0,0 +1,57 @@ +'use strict'; + +var Cancel = require('./Cancel'); + +/** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ +function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); +} + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } +}; + +/** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ +CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; +}; + +module.exports = CancelToken; diff --git a/helloworld/node_modules/axios/lib/cancel/isCancel.js b/helloworld/node_modules/axios/lib/cancel/isCancel.js new file mode 100755 index 0000000..051f3ae --- /dev/null +++ b/helloworld/node_modules/axios/lib/cancel/isCancel.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); +}; diff --git a/helloworld/node_modules/axios/lib/core/Axios.js b/helloworld/node_modules/axios/lib/core/Axios.js new file mode 100755 index 0000000..f1af3e7 --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/Axios.js @@ -0,0 +1,79 @@ +'use strict'; + +var defaults = require('./../defaults'); +var utils = require('./../utils'); +var InterceptorManager = require('./InterceptorManager'); +var dispatchRequest = require('./dispatchRequest'); + +/** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ +function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; +} + +/** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ +Axios.prototype.request = function request(config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof config === 'string') { + config = utils.merge({ + url: arguments[0] + }, arguments[1]); + } + + config = utils.merge(defaults, this.defaults, { method: 'get' }, config); + config.method = config.method.toLowerCase(); + + // Hook up interceptors middleware + var chain = [dispatchRequest, undefined]; + var promise = Promise.resolve(config); + + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + chain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + chain.push(interceptor.fulfilled, interceptor.rejected); + }); + + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; +}; + +// Provide aliases for supported request methods +utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url + })); + }; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url, + data: data + })); + }; +}); + +module.exports = Axios; diff --git a/helloworld/node_modules/axios/lib/core/InterceptorManager.js b/helloworld/node_modules/axios/lib/core/InterceptorManager.js new file mode 100755 index 0000000..50d667b --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/InterceptorManager.js @@ -0,0 +1,52 @@ +'use strict'; + +var utils = require('./../utils'); + +function InterceptorManager() { + this.handlers = []; +} + +/** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ +InterceptorManager.prototype.use = function use(fulfilled, rejected) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected + }); + return this.handlers.length - 1; +}; + +/** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ +InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } +}; + +/** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ +InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); +}; + +module.exports = InterceptorManager; diff --git a/helloworld/node_modules/axios/lib/core/README.md b/helloworld/node_modules/axios/lib/core/README.md new file mode 100755 index 0000000..253bc48 --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/README.md @@ -0,0 +1,7 @@ +# axios // core + +The modules found in `core/` should be modules that are specific to the domain logic of axios. These modules would most likely not make sense to be consumed outside of the axios module, as their logic is too specific. Some examples of core modules are: + +- Dispatching requests +- Managing interceptors +- Handling config diff --git a/helloworld/node_modules/axios/lib/core/createError.js b/helloworld/node_modules/axios/lib/core/createError.js new file mode 100755 index 0000000..933680f --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/createError.js @@ -0,0 +1,18 @@ +'use strict'; + +var enhanceError = require('./enhanceError'); + +/** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ +module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); +}; diff --git a/helloworld/node_modules/axios/lib/core/dispatchRequest.js b/helloworld/node_modules/axios/lib/core/dispatchRequest.js new file mode 100755 index 0000000..9ea70f2 --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/dispatchRequest.js @@ -0,0 +1,86 @@ +'use strict'; + +var utils = require('./../utils'); +var transformData = require('./transformData'); +var isCancel = require('../cancel/isCancel'); +var defaults = require('../defaults'); +var isAbsoluteURL = require('./../helpers/isAbsoluteURL'); +var combineURLs = require('./../helpers/combineURLs'); + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } +} + +/** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ +module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Support baseURL config + if (config.baseURL && !isAbsoluteURL(config.url)) { + config.url = combineURLs(config.baseURL, config.url); + } + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData( + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers || {} + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData( + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData( + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); +}; diff --git a/helloworld/node_modules/axios/lib/core/enhanceError.js b/helloworld/node_modules/axios/lib/core/enhanceError.js new file mode 100755 index 0000000..8dfd5b4 --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/enhanceError.js @@ -0,0 +1,21 @@ +'use strict'; + +/** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ +module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + error.request = request; + error.response = response; + return error; +}; diff --git a/helloworld/node_modules/axios/lib/core/settle.js b/helloworld/node_modules/axios/lib/core/settle.js new file mode 100755 index 0000000..8db5e23 --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/settle.js @@ -0,0 +1,26 @@ +'use strict'; + +var createError = require('./createError'); + +/** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ +module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + // Note: status is not exposed by XDomainRequest + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } +}; diff --git a/helloworld/node_modules/axios/lib/core/transformData.js b/helloworld/node_modules/axios/lib/core/transformData.js new file mode 100755 index 0000000..e065362 --- /dev/null +++ b/helloworld/node_modules/axios/lib/core/transformData.js @@ -0,0 +1,20 @@ +'use strict'; + +var utils = require('./../utils'); + +/** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ +module.exports = function transformData(data, headers, fns) { + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn(data, headers); + }); + + return data; +}; diff --git a/helloworld/node_modules/axios/lib/defaults.js b/helloworld/node_modules/axios/lib/defaults.js new file mode 100755 index 0000000..9587b28 --- /dev/null +++ b/helloworld/node_modules/axios/lib/defaults.js @@ -0,0 +1,92 @@ +'use strict'; + +var utils = require('./utils'); +var normalizeHeaderName = require('./helpers/normalizeHeaderName'); + +var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' +}; + +function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } +} + +function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = require('./adapters/xhr'); + } else if (typeof process !== 'undefined') { + // For node use HTTP adapter + adapter = require('./adapters/http'); + } + return adapter; +} + +var defaults = { + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data)) { + setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); + return JSON.stringify(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + /*eslint no-param-reassign:0*/ + if (typeof data === 'string') { + try { + data = JSON.parse(data); + } catch (e) { /* Ignore */ } + } + return data; + }], + + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + } +}; + +defaults.headers = { + common: { + 'Accept': 'application/json, text/plain, */*' + } +}; + +utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); +}); + +module.exports = defaults; diff --git a/helloworld/node_modules/axios/lib/helpers/README.md b/helloworld/node_modules/axios/lib/helpers/README.md new file mode 100755 index 0000000..4ae3419 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/README.md @@ -0,0 +1,7 @@ +# axios // helpers + +The modules found in `helpers/` should be generic modules that are _not_ specific to the domain logic of axios. These modules could theoretically be published to npm on their own and consumed by other modules or apps. Some examples of generic modules are things like: + +- Browser polyfills +- Managing cookies +- Parsing HTTP headers diff --git a/helloworld/node_modules/axios/lib/helpers/bind.js b/helloworld/node_modules/axios/lib/helpers/bind.js new file mode 100755 index 0000000..6147c60 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/bind.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; +}; diff --git a/helloworld/node_modules/axios/lib/helpers/btoa.js b/helloworld/node_modules/axios/lib/helpers/btoa.js new file mode 100755 index 0000000..2fe5014 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/btoa.js @@ -0,0 +1,36 @@ +'use strict'; + +// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js + +var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='; + +function E() { + this.message = 'String contains an invalid character'; +} +E.prototype = new Error; +E.prototype.code = 5; +E.prototype.name = 'InvalidCharacterError'; + +function btoa(input) { + var str = String(input); + var output = ''; + for ( + // initialize result and counter + var block, charCode, idx = 0, map = chars; + // if the next str index does not exist: + // change the mapping table to "=" + // check if d has no fractional digits + str.charAt(idx | 0) || (map = '=', idx % 1); + // "8 - idx % 1 * 8" generates the sequence 2, 4, 6, 8 + output += map.charAt(63 & block >> 8 - idx % 1 * 8) + ) { + charCode = str.charCodeAt(idx += 3 / 4); + if (charCode > 0xFF) { + throw new E(); + } + block = block << 8 | charCode; + } + return output; +} + +module.exports = btoa; diff --git a/helloworld/node_modules/axios/lib/helpers/buildURL.js b/helloworld/node_modules/axios/lib/helpers/buildURL.js new file mode 100755 index 0000000..1e66456 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/buildURL.js @@ -0,0 +1,68 @@ +'use strict'; + +var utils = require('./../utils'); + +function encode(val) { + return encodeURIComponent(val). + replace(/%40/gi, '@'). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); +} + +/** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ +module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } + + if (!utils.isArray(val)) { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; +}; diff --git a/helloworld/node_modules/axios/lib/helpers/combineURLs.js b/helloworld/node_modules/axios/lib/helpers/combineURLs.js new file mode 100755 index 0000000..f1b58a5 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/combineURLs.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ +module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; +}; diff --git a/helloworld/node_modules/axios/lib/helpers/cookies.js b/helloworld/node_modules/axios/lib/helpers/cookies.js new file mode 100755 index 0000000..e45a4f9 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/cookies.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() +); diff --git a/helloworld/node_modules/axios/lib/helpers/deprecatedMethod.js b/helloworld/node_modules/axios/lib/helpers/deprecatedMethod.js new file mode 100755 index 0000000..ed40965 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/deprecatedMethod.js @@ -0,0 +1,24 @@ +'use strict'; + +/*eslint no-console:0*/ + +/** + * Supply a warning to the developer that a method they are using + * has been deprecated. + * + * @param {string} method The name of the deprecated method + * @param {string} [instead] The alternate method to use if applicable + * @param {string} [docs] The documentation URL to get further details + */ +module.exports = function deprecatedMethod(method, instead, docs) { + try { + console.warn( + 'DEPRECATED method `' + method + '`.' + + (instead ? ' Use `' + instead + '` instead.' : '') + + ' This method will be removed in a future release.'); + + if (docs) { + console.warn('For more information about usage see ' + docs); + } + } catch (e) { /* Ignore */ } +}; diff --git a/helloworld/node_modules/axios/lib/helpers/isAbsoluteURL.js b/helloworld/node_modules/axios/lib/helpers/isAbsoluteURL.js new file mode 100755 index 0000000..d33e992 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/isAbsoluteURL.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ +module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); +}; diff --git a/helloworld/node_modules/axios/lib/helpers/isURLSameOrigin.js b/helloworld/node_modules/axios/lib/helpers/isURLSameOrigin.js new file mode 100755 index 0000000..e292745 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/isURLSameOrigin.js @@ -0,0 +1,68 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() +); diff --git a/helloworld/node_modules/axios/lib/helpers/normalizeHeaderName.js b/helloworld/node_modules/axios/lib/helpers/normalizeHeaderName.js new file mode 100755 index 0000000..738c9fe --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/normalizeHeaderName.js @@ -0,0 +1,12 @@ +'use strict'; + +var utils = require('../utils'); + +module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); +}; diff --git a/helloworld/node_modules/axios/lib/helpers/parseHeaders.js b/helloworld/node_modules/axios/lib/helpers/parseHeaders.js new file mode 100755 index 0000000..8af2cc7 --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/parseHeaders.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +// Headers whose duplicates are ignored by node +// c.f. https://nodejs.org/api/http.html#http_message_headers +var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' +]; + +/** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ +module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; +}; diff --git a/helloworld/node_modules/axios/lib/helpers/spread.js b/helloworld/node_modules/axios/lib/helpers/spread.js new file mode 100755 index 0000000..25e3cdd --- /dev/null +++ b/helloworld/node_modules/axios/lib/helpers/spread.js @@ -0,0 +1,27 @@ +'use strict'; + +/** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ +module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; +}; diff --git a/helloworld/node_modules/axios/lib/utils.js b/helloworld/node_modules/axios/lib/utils.js new file mode 100755 index 0000000..b3fd865 --- /dev/null +++ b/helloworld/node_modules/axios/lib/utils.js @@ -0,0 +1,303 @@ +'use strict'; + +var bind = require('./helpers/bind'); +var isBuffer = require('is-buffer'); + +/*global toString:true*/ + +// utils is a library of generic helper functions non-specific to axios + +var toString = Object.prototype.toString; + +/** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ +function isArray(val) { + return toString.call(val) === '[object Array]'; +} + +/** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ +function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; +} + +/** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ +function isFormData(val) { + return (typeof FormData !== 'undefined') && (val instanceof FormData); +} + +/** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ +function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + } + return result; +} + +/** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ +function isString(val) { + return typeof val === 'string'; +} + +/** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ +function isNumber(val) { + return typeof val === 'number'; +} + +/** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ +function isUndefined(val) { + return typeof val === 'undefined'; +} + +/** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ +function isObject(val) { + return val !== null && typeof val === 'object'; +} + +/** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ +function isDate(val) { + return toString.call(val) === '[object Date]'; +} + +/** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +function isFile(val) { + return toString.call(val) === '[object File]'; +} + +/** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ +function isBlob(val) { + return toString.call(val) === '[object Blob]'; +} + +/** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ +function isFunction(val) { + return toString.call(val) === '[object Function]'; +} + +/** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ +function isStream(val) { + return isObject(val) && isFunction(val.pipe); +} + +/** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ +function isURLSearchParams(val) { + return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; +} + +/** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ +function trim(str) { + return str.replace(/^\s*/, '').replace(/\s*$/, ''); +} + +/** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + */ +function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); +} + +/** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ +function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } +} + +/** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = merge(result[key], val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ +function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; +} + +module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim +}; diff --git a/helloworld/node_modules/axios/package.json b/helloworld/node_modules/axios/package.json new file mode 100755 index 0000000..e4f5e02 --- /dev/null +++ b/helloworld/node_modules/axios/package.json @@ -0,0 +1,112 @@ +{ + "_from": "axios@0.17.1", + "_id": "axios@0.17.1", + "_inBundle": false, + "_integrity": "sha1-LY4+XQvb1zJ/kbyBT1xXZg+Bgk0=", + "_location": "/axios", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "axios@0.17.1", + "name": "axios", + "escapedName": "axios", + "rawSpec": "0.17.1", + "saveSpec": null, + "fetchSpec": "0.17.1" + }, + "_requiredBy": [ + "/localtunnel" + ], + "_resolved": "https://registry.npmjs.org/axios/-/axios-0.17.1.tgz", + "_shasum": "2d8e3e5d0bdbd7327f91bc814f5c57660f81824d", + "_spec": "axios@0.17.1", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/localtunnel", + "author": { + "name": "Matt Zabriskie" + }, + "browser": { + "./lib/adapters/http.js": "./lib/adapters/xhr.js" + }, + "bugs": { + "url": "https://github.com/axios/axios/issues" + }, + "bundleDependencies": false, + "bundlesize": [ + { + "path": "./dist/axios.min.js", + "threshold": "5kB" + } + ], + "dependencies": { + "follow-redirects": "^1.2.5", + "is-buffer": "^1.1.5" + }, + "deprecated": false, + "description": "Promise based HTTP client for the browser and node.js", + "devDependencies": { + "bundlesize": "^0.5.7", + "coveralls": "^2.11.9", + "es6-promise": "^4.0.5", + "grunt": "^1.0.1", + "grunt-banner": "^0.6.0", + "grunt-cli": "^1.2.0", + "grunt-contrib-clean": "^1.0.0", + "grunt-contrib-nodeunit": "^1.0.0", + "grunt-contrib-watch": "^1.0.0", + "grunt-eslint": "^19.0.0", + "grunt-karma": "^2.0.0", + "grunt-ts": "^6.0.0-beta.3", + "grunt-webpack": "^1.0.18", + "istanbul-instrumenter-loader": "^1.0.0", + "jasmine-core": "^2.4.1", + "karma": "^1.3.0", + "karma-chrome-launcher": "^2.0.0", + "karma-coverage": "^1.0.0", + "karma-firefox-launcher": "^1.0.0", + "karma-jasmine": "^1.0.2", + "karma-jasmine-ajax": "^0.1.13", + "karma-opera-launcher": "^1.0.0", + "karma-phantomjs-launcher": "^1.0.0", + "karma-safari-launcher": "^1.0.0", + "karma-sauce-launcher": "^1.1.0", + "karma-sinon": "^1.0.5", + "karma-sourcemap-loader": "^0.3.7", + "karma-webpack": "^1.7.0", + "load-grunt-tasks": "^3.5.2", + "minimist": "^1.2.0", + "phantomjs-prebuilt": "^2.1.7", + "sinon": "^1.17.4", + "typescript": "^2.0.3", + "url-search-params": "^0.6.1", + "webpack": "^1.13.1", + "webpack-dev-server": "^1.14.1" + }, + "homepage": "https://github.com/axios/axios", + "keywords": [ + "xhr", + "http", + "ajax", + "promise", + "node" + ], + "license": "MIT", + "main": "index.js", + "name": "axios", + "repository": { + "type": "git", + "url": "git+https://github.com/axios/axios.git" + }, + "scripts": { + "build": "NODE_ENV=production grunt build", + "coveralls": "cat coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js", + "examples": "node ./examples/server.js", + "postversion": "git push && git push --tags", + "preversion": "npm test", + "start": "node ./sandbox/server.js", + "test": "grunt test && bundlesize", + "version": "npm run build && grunt version && git add -A dist && git add CHANGELOG.md bower.json package.json" + }, + "typings": "./index.d.ts", + "version": "0.17.1" +} diff --git a/helloworld/node_modules/backo2/History.md b/helloworld/node_modules/backo2/History.md new file mode 100755 index 0000000..8eb28b8 --- /dev/null +++ b/helloworld/node_modules/backo2/History.md @@ -0,0 +1,12 @@ + +1.0.1 / 2014-02-17 +================== + + * go away decimal point + * history + +1.0.0 / 2014-02-17 +================== + + * add jitter option + * Initial commit diff --git a/helloworld/node_modules/backo2/Makefile b/helloworld/node_modules/backo2/Makefile new file mode 100755 index 0000000..9987df8 --- /dev/null +++ b/helloworld/node_modules/backo2/Makefile @@ -0,0 +1,8 @@ + +test: + @./node_modules/.bin/mocha \ + --require should \ + --reporter dot \ + --bail + +.PHONY: test \ No newline at end of file diff --git a/helloworld/node_modules/backo2/Readme.md b/helloworld/node_modules/backo2/Readme.md new file mode 100755 index 0000000..0df2a39 --- /dev/null +++ b/helloworld/node_modules/backo2/Readme.md @@ -0,0 +1,34 @@ +# backo + + Simple exponential backoff because the others seem to have weird abstractions. + +## Installation + +``` +$ npm install backo +``` + +## Options + + - `min` initial timeout in milliseconds [100] + - `max` max timeout [10000] + - `jitter` [0] + - `factor` [2] + +## Example + +```js +var Backoff = require('backo'); +var backoff = new Backoff({ min: 100, max: 20000 }); + +setTimeout(function(){ + something.reconnect(); +}, backoff.duration()); + +// later when something works +backoff.reset() +``` + +# License + + MIT diff --git a/helloworld/node_modules/backo2/component.json b/helloworld/node_modules/backo2/component.json new file mode 100755 index 0000000..994845a --- /dev/null +++ b/helloworld/node_modules/backo2/component.json @@ -0,0 +1,11 @@ +{ + "name": "backo", + "repo": "segmentio/backo", + "dependencies": {}, + "version": "1.0.1", + "description": "simple backoff without the weird abstractions", + "keywords": ["backoff"], + "license": "MIT", + "scripts": ["index.js"], + "main": "index.js" +} diff --git a/helloworld/node_modules/backo2/index.js b/helloworld/node_modules/backo2/index.js new file mode 100755 index 0000000..fac4429 --- /dev/null +++ b/helloworld/node_modules/backo2/index.js @@ -0,0 +1,85 @@ + +/** + * Expose `Backoff`. + */ + +module.exports = Backoff; + +/** + * Initialize backoff timer with `opts`. + * + * - `min` initial timeout in milliseconds [100] + * - `max` max timeout [10000] + * - `jitter` [0] + * - `factor` [2] + * + * @param {Object} opts + * @api public + */ + +function Backoff(opts) { + opts = opts || {}; + this.ms = opts.min || 100; + this.max = opts.max || 10000; + this.factor = opts.factor || 2; + this.jitter = opts.jitter > 0 && opts.jitter <= 1 ? opts.jitter : 0; + this.attempts = 0; +} + +/** + * Return the backoff duration. + * + * @return {Number} + * @api public + */ + +Backoff.prototype.duration = function(){ + var ms = this.ms * Math.pow(this.factor, this.attempts++); + if (this.jitter) { + var rand = Math.random(); + var deviation = Math.floor(rand * this.jitter * ms); + ms = (Math.floor(rand * 10) & 1) == 0 ? ms - deviation : ms + deviation; + } + return Math.min(ms, this.max) | 0; +}; + +/** + * Reset the number of attempts. + * + * @api public + */ + +Backoff.prototype.reset = function(){ + this.attempts = 0; +}; + +/** + * Set the minimum duration + * + * @api public + */ + +Backoff.prototype.setMin = function(min){ + this.ms = min; +}; + +/** + * Set the maximum duration + * + * @api public + */ + +Backoff.prototype.setMax = function(max){ + this.max = max; +}; + +/** + * Set the jitter + * + * @api public + */ + +Backoff.prototype.setJitter = function(jitter){ + this.jitter = jitter; +}; + diff --git a/helloworld/node_modules/backo2/package.json b/helloworld/node_modules/backo2/package.json new file mode 100755 index 0000000..8127be2 --- /dev/null +++ b/helloworld/node_modules/backo2/package.json @@ -0,0 +1,47 @@ +{ + "_from": "backo2@1.0.2", + "_id": "backo2@1.0.2", + "_inBundle": false, + "_integrity": "sha1-MasayLEpNjRj41s+u2n038+6eUc=", + "_location": "/backo2", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "backo2@1.0.2", + "name": "backo2", + "escapedName": "backo2", + "rawSpec": "1.0.2", + "saveSpec": null, + "fetchSpec": "1.0.2" + }, + "_requiredBy": [ + "/socket.io-client" + ], + "_resolved": "https://registry.npmjs.org/backo2/-/backo2-1.0.2.tgz", + "_shasum": "31ab1ac8b129363463e35b3ebb69f4dfcfba7947", + "_spec": "backo2@1.0.2", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/socket.io-client", + "bugs": { + "url": "https://github.com/mokesmokes/backo/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "simple backoff based on segmentio/backo", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "homepage": "https://github.com/mokesmokes/backo#readme", + "keywords": [ + "backoff" + ], + "license": "MIT", + "name": "backo2", + "repository": { + "type": "git", + "url": "git+https://github.com/mokesmokes/backo.git" + }, + "version": "1.0.2" +} diff --git a/helloworld/node_modules/backo2/test/index.js b/helloworld/node_modules/backo2/test/index.js new file mode 100755 index 0000000..ea1f6de --- /dev/null +++ b/helloworld/node_modules/backo2/test/index.js @@ -0,0 +1,18 @@ + +var Backoff = require('..'); +var assert = require('assert'); + +describe('.duration()', function(){ + it('should increase the backoff', function(){ + var b = new Backoff; + + assert(100 == b.duration()); + assert(200 == b.duration()); + assert(400 == b.duration()); + assert(800 == b.duration()); + + b.reset(); + assert(100 == b.duration()); + assert(200 == b.duration()); + }) +}) \ No newline at end of file diff --git a/helloworld/node_modules/base64-arraybuffer/LICENSE-MIT b/helloworld/node_modules/base64-arraybuffer/LICENSE-MIT new file mode 100755 index 0000000..ed27b41 --- /dev/null +++ b/helloworld/node_modules/base64-arraybuffer/LICENSE-MIT @@ -0,0 +1,22 @@ +Copyright (c) 2012 Niklas von Hertzen + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/base64-arraybuffer/README.md b/helloworld/node_modules/base64-arraybuffer/README.md new file mode 100755 index 0000000..50009e4 --- /dev/null +++ b/helloworld/node_modules/base64-arraybuffer/README.md @@ -0,0 +1,20 @@ +# base64-arraybuffer + +[![Build Status](https://travis-ci.org/niklasvh/base64-arraybuffer.png)](https://travis-ci.org/niklasvh/base64-arraybuffer) +[![NPM Downloads](https://img.shields.io/npm/dm/base64-arraybuffer.svg)](https://www.npmjs.org/package/base64-arraybuffer) +[![NPM Version](https://img.shields.io/npm/v/base64-arraybuffer.svg)](https://www.npmjs.org/package/base64-arraybuffer) + +Encode/decode base64 data into ArrayBuffers + +## Getting Started +Install the module with: `npm install base64-arraybuffer` + +## API +The library encodes and decodes base64 to and from ArrayBuffers + + - __encode(buffer)__ - Encodes `ArrayBuffer` into base64 string + - __decode(str)__ - Decodes base64 string to `ArrayBuffer` + +## License +Copyright (c) 2012 Niklas von Hertzen +Licensed under the MIT license. diff --git a/helloworld/node_modules/base64-arraybuffer/lib/base64-arraybuffer.js b/helloworld/node_modules/base64-arraybuffer/lib/base64-arraybuffer.js new file mode 100755 index 0000000..e6b6306 --- /dev/null +++ b/helloworld/node_modules/base64-arraybuffer/lib/base64-arraybuffer.js @@ -0,0 +1,67 @@ +/* + * base64-arraybuffer + * https://github.com/niklasvh/base64-arraybuffer + * + * Copyright (c) 2012 Niklas von Hertzen + * Licensed under the MIT license. + */ +(function(){ + "use strict"; + + var chars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + + // Use a lookup table to find the index. + var lookup = new Uint8Array(256); + for (var i = 0; i < chars.length; i++) { + lookup[chars.charCodeAt(i)] = i; + } + + exports.encode = function(arraybuffer) { + var bytes = new Uint8Array(arraybuffer), + i, len = bytes.length, base64 = ""; + + for (i = 0; i < len; i+=3) { + base64 += chars[bytes[i] >> 2]; + base64 += chars[((bytes[i] & 3) << 4) | (bytes[i + 1] >> 4)]; + base64 += chars[((bytes[i + 1] & 15) << 2) | (bytes[i + 2] >> 6)]; + base64 += chars[bytes[i + 2] & 63]; + } + + if ((len % 3) === 2) { + base64 = base64.substring(0, base64.length - 1) + "="; + } else if (len % 3 === 1) { + base64 = base64.substring(0, base64.length - 2) + "=="; + } + + return base64; + }; + + exports.decode = function(base64) { + var bufferLength = base64.length * 0.75, + len = base64.length, i, p = 0, + encoded1, encoded2, encoded3, encoded4; + + if (base64[base64.length - 1] === "=") { + bufferLength--; + if (base64[base64.length - 2] === "=") { + bufferLength--; + } + } + + var arraybuffer = new ArrayBuffer(bufferLength), + bytes = new Uint8Array(arraybuffer); + + for (i = 0; i < len; i+=4) { + encoded1 = lookup[base64.charCodeAt(i)]; + encoded2 = lookup[base64.charCodeAt(i+1)]; + encoded3 = lookup[base64.charCodeAt(i+2)]; + encoded4 = lookup[base64.charCodeAt(i+3)]; + + bytes[p++] = (encoded1 << 2) | (encoded2 >> 4); + bytes[p++] = ((encoded2 & 15) << 4) | (encoded3 >> 2); + bytes[p++] = ((encoded3 & 3) << 6) | (encoded4 & 63); + } + + return arraybuffer; + }; +})(); diff --git a/helloworld/node_modules/base64-arraybuffer/package.json b/helloworld/node_modules/base64-arraybuffer/package.json new file mode 100755 index 0000000..39dae53 --- /dev/null +++ b/helloworld/node_modules/base64-arraybuffer/package.json @@ -0,0 +1,65 @@ +{ + "_from": "base64-arraybuffer@0.1.5", + "_id": "base64-arraybuffer@0.1.5", + "_inBundle": false, + "_integrity": "sha1-c5JncZI7Whl0etZmqlzUv5xunOg=", + "_location": "/base64-arraybuffer", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "base64-arraybuffer@0.1.5", + "name": "base64-arraybuffer", + "escapedName": "base64-arraybuffer", + "rawSpec": "0.1.5", + "saveSpec": null, + "fetchSpec": "0.1.5" + }, + "_requiredBy": [ + "/engine.io-parser", + "/socket.io-client" + ], + "_resolved": "https://registry.npmjs.org/base64-arraybuffer/-/base64-arraybuffer-0.1.5.tgz", + "_shasum": "73926771923b5a19747ad666aa5cd4bf9c6e9ce8", + "_spec": "base64-arraybuffer@0.1.5", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/engine.io-parser", + "author": { + "name": "Niklas von Hertzen", + "email": "niklasvh@gmail.com", + "url": "http://hertzen.com" + }, + "bugs": { + "url": "https://github.com/niklasvh/base64-arraybuffer/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Encode/decode base64 data into ArrayBuffers", + "devDependencies": { + "grunt": "^0.4.5", + "grunt-cli": "^0.1.13", + "grunt-contrib-jshint": "^0.11.2", + "grunt-contrib-nodeunit": "^0.4.1", + "grunt-contrib-watch": "^0.6.1" + }, + "engines": { + "node": ">= 0.6.0" + }, + "homepage": "https://github.com/niklasvh/base64-arraybuffer", + "keywords": [], + "licenses": [ + { + "type": "MIT", + "url": "https://github.com/niklasvh/base64-arraybuffer/blob/master/LICENSE-MIT" + } + ], + "main": "lib/base64-arraybuffer", + "name": "base64-arraybuffer", + "repository": { + "type": "git", + "url": "git+https://github.com/niklasvh/base64-arraybuffer.git" + }, + "scripts": { + "test": "grunt nodeunit" + }, + "version": "0.1.5" +} diff --git a/helloworld/node_modules/base64id/LICENSE b/helloworld/node_modules/base64id/LICENSE new file mode 100755 index 0000000..0d03c83 --- /dev/null +++ b/helloworld/node_modules/base64id/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2012-2016 Kristian Faeldt + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/base64id/README.md b/helloworld/node_modules/base64id/README.md new file mode 100755 index 0000000..17689e6 --- /dev/null +++ b/helloworld/node_modules/base64id/README.md @@ -0,0 +1,18 @@ +base64id +======== + +Node.js module that generates a base64 id. + +Uses crypto.randomBytes when available, falls back to unsafe methods for node.js <= 0.4. + +To increase performance, random bytes are buffered to minimize the number of synchronous calls to crypto.randomBytes. + +## Installation + + $ npm install base64id + +## Usage + + var base64id = require('base64id'); + + var id = base64id.generateId(); diff --git a/helloworld/node_modules/base64id/lib/base64id.js b/helloworld/node_modules/base64id/lib/base64id.js new file mode 100755 index 0000000..f688159 --- /dev/null +++ b/helloworld/node_modules/base64id/lib/base64id.js @@ -0,0 +1,103 @@ +/*! + * base64id v0.1.0 + */ + +/** + * Module dependencies + */ + +var crypto = require('crypto'); + +/** + * Constructor + */ + +var Base64Id = function() { }; + +/** + * Get random bytes + * + * Uses a buffer if available, falls back to crypto.randomBytes + */ + +Base64Id.prototype.getRandomBytes = function(bytes) { + + var BUFFER_SIZE = 4096 + var self = this; + + bytes = bytes || 12; + + if (bytes > BUFFER_SIZE) { + return crypto.randomBytes(bytes); + } + + var bytesInBuffer = parseInt(BUFFER_SIZE/bytes); + var threshold = parseInt(bytesInBuffer*0.85); + + if (!threshold) { + return crypto.randomBytes(bytes); + } + + if (this.bytesBufferIndex == null) { + this.bytesBufferIndex = -1; + } + + if (this.bytesBufferIndex == bytesInBuffer) { + this.bytesBuffer = null; + this.bytesBufferIndex = -1; + } + + // No buffered bytes available or index above threshold + if (this.bytesBufferIndex == -1 || this.bytesBufferIndex > threshold) { + + if (!this.isGeneratingBytes) { + this.isGeneratingBytes = true; + crypto.randomBytes(BUFFER_SIZE, function(err, bytes) { + self.bytesBuffer = bytes; + self.bytesBufferIndex = 0; + self.isGeneratingBytes = false; + }); + } + + // Fall back to sync call when no buffered bytes are available + if (this.bytesBufferIndex == -1) { + return crypto.randomBytes(bytes); + } + } + + var result = this.bytesBuffer.slice(bytes*this.bytesBufferIndex, bytes*(this.bytesBufferIndex+1)); + this.bytesBufferIndex++; + + return result; +} + +/** + * Generates a base64 id + * + * (Original version from socket.io ) + */ + +Base64Id.prototype.generateId = function () { + var rand = new Buffer(15); // multiple of 3 for base64 + if (!rand.writeInt32BE) { + return Math.abs(Math.random() * Math.random() * Date.now() | 0).toString() + + Math.abs(Math.random() * Math.random() * Date.now() | 0).toString(); + } + this.sequenceNumber = (this.sequenceNumber + 1) | 0; + rand.writeInt32BE(this.sequenceNumber, 11); + if (crypto.randomBytes) { + this.getRandomBytes(12).copy(rand); + } else { + // not secure for node 0.4 + [0, 4, 8].forEach(function(i) { + rand.writeInt32BE(Math.random() * Math.pow(2, 32) | 0, i); + }); + } + return rand.toString('base64').replace(/\//g, '_').replace(/\+/g, '-'); +}; + +/** + * Export + */ + +exports = module.exports = new Base64Id(); diff --git a/helloworld/node_modules/base64id/package.json b/helloworld/node_modules/base64id/package.json new file mode 100755 index 0000000..be67e97 --- /dev/null +++ b/helloworld/node_modules/base64id/package.json @@ -0,0 +1,47 @@ +{ + "_from": "base64id@1.0.0", + "_id": "base64id@1.0.0", + "_inBundle": false, + "_integrity": "sha1-R2iMuZu2gE8OBtPnY7HDLlfY5rY=", + "_location": "/base64id", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "base64id@1.0.0", + "name": "base64id", + "escapedName": "base64id", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/engine.io" + ], + "_resolved": "https://registry.npmjs.org/base64id/-/base64id-1.0.0.tgz", + "_shasum": "47688cb99bb6804f0e06d3e763b1c32e57d8e6b6", + "_spec": "base64id@1.0.0", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/engine.io", + "author": { + "name": "Kristian Faeldt", + "email": "faeldt_kristian@cyberagent.co.jp" + }, + "bugs": { + "url": "https://github.com/faeldt/base64id/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Generates a base64 id", + "engines": { + "node": ">= 0.4.0" + }, + "homepage": "https://github.com/faeldt/base64id#readme", + "license": "MIT", + "main": "./lib/base64id.js", + "name": "base64id", + "repository": { + "type": "git", + "url": "git+https://github.com/faeldt/base64id.git" + }, + "version": "1.0.0" +} diff --git a/helloworld/node_modules/better-assert/History.md b/helloworld/node_modules/better-assert/History.md new file mode 100755 index 0000000..cbb579b --- /dev/null +++ b/helloworld/node_modules/better-assert/History.md @@ -0,0 +1,15 @@ + +1.0.0 / 2013-02-03 +================== + + * Stop using the removed magic __stack global getter + +0.1.0 / 2012-10-04 +================== + + * add throwing of AssertionError for test frameworks etc + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/helloworld/node_modules/better-assert/Makefile b/helloworld/node_modules/better-assert/Makefile new file mode 100755 index 0000000..36a3ed7 --- /dev/null +++ b/helloworld/node_modules/better-assert/Makefile @@ -0,0 +1,5 @@ + +test: + @echo "populate me" + +.PHONY: test \ No newline at end of file diff --git a/helloworld/node_modules/better-assert/Readme.md b/helloworld/node_modules/better-assert/Readme.md new file mode 100755 index 0000000..d8d3a63 --- /dev/null +++ b/helloworld/node_modules/better-assert/Readme.md @@ -0,0 +1,61 @@ + +# better-assert + + Better c-style assertions using [callsite](https://github.com/visionmedia/callsite) for + self-documenting failure messages. + +## Installation + + $ npm install better-assert + +## Example + + By default assertions are enabled, however the __NO_ASSERT__ environment variable + will deactivate them when truthy. + +```js +var assert = require('better-assert'); + +test(); + +function test() { + var user = { name: 'tobi' }; + assert('tobi' == user.name); + assert('number' == typeof user.age); +} + +AssertionError: 'number' == typeof user.age + at test (/Users/tj/projects/better-assert/example.js:9:3) + at Object. (/Users/tj/projects/better-assert/example.js:4:1) + at Module._compile (module.js:449:26) + at Object.Module._extensions..js (module.js:467:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Module.runMain (module.js:492:10) + at process.startup.processNextTick.process._tickCallback (node.js:244:9) +``` + +## License + +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/helloworld/node_modules/better-assert/example.js b/helloworld/node_modules/better-assert/example.js new file mode 100755 index 0000000..688c29e --- /dev/null +++ b/helloworld/node_modules/better-assert/example.js @@ -0,0 +1,10 @@ + +var assert = require('./'); + +test(); + +function test() { + var user = { name: 'tobi' }; + assert('tobi' == user.name); + assert('number' == typeof user.age); +} \ No newline at end of file diff --git a/helloworld/node_modules/better-assert/index.js b/helloworld/node_modules/better-assert/index.js new file mode 100755 index 0000000..fd1c9b7 --- /dev/null +++ b/helloworld/node_modules/better-assert/index.js @@ -0,0 +1,38 @@ +/** + * Module dependencies. + */ + +var AssertionError = require('assert').AssertionError + , callsite = require('callsite') + , fs = require('fs') + +/** + * Expose `assert`. + */ + +module.exports = process.env.NO_ASSERT + ? function(){} + : assert; + +/** + * Assert the given `expr`. + */ + +function assert(expr) { + if (expr) return; + + var stack = callsite(); + var call = stack[1]; + var file = call.getFileName(); + var lineno = call.getLineNumber(); + var src = fs.readFileSync(file, 'utf8'); + var line = src.split('\n')[lineno-1]; + var src = line.match(/assert\((.*)\)/)[1]; + + var err = new AssertionError({ + message: src, + stackStartFunction: stack[0].getFunction() + }); + + throw err; +} diff --git a/helloworld/node_modules/better-assert/package.json b/helloworld/node_modules/better-assert/package.json new file mode 100755 index 0000000..0febc42 --- /dev/null +++ b/helloworld/node_modules/better-assert/package.json @@ -0,0 +1,65 @@ +{ + "_from": "better-assert@~1.0.0", + "_id": "better-assert@1.0.2", + "_inBundle": false, + "_integrity": "sha1-QIZrnhueC1W0gYlDEeaPr/rrxSI=", + "_location": "/better-assert", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "better-assert@~1.0.0", + "name": "better-assert", + "escapedName": "better-assert", + "rawSpec": "~1.0.0", + "saveSpec": null, + "fetchSpec": "~1.0.0" + }, + "_requiredBy": [ + "/parseqs", + "/parseuri" + ], + "_resolved": "https://registry.npmjs.org/better-assert/-/better-assert-1.0.2.tgz", + "_shasum": "40866b9e1b9e0b55b481894311e68faffaebc522", + "_spec": "better-assert@~1.0.0", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/parseqs", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/visionmedia/better-assert/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "TonyHe", + "email": "coolhzb@163.com" + }, + { + "name": "ForbesLindesay" + } + ], + "dependencies": { + "callsite": "1.0.0" + }, + "deprecated": false, + "description": "Better assertions for node, reporting the expr, filename, lineno etc", + "engines": { + "node": "*" + }, + "homepage": "https://github.com/visionmedia/better-assert#readme", + "keywords": [ + "assert", + "stack", + "trace", + "debug" + ], + "main": "index", + "name": "better-assert", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/better-assert.git" + }, + "version": "1.0.2" +} diff --git a/helloworld/node_modules/blob/LICENSE b/helloworld/node_modules/blob/LICENSE new file mode 100755 index 0000000..aa31544 --- /dev/null +++ b/helloworld/node_modules/blob/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (C) 2014 Rase- + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/helloworld/node_modules/blob/Makefile b/helloworld/node_modules/blob/Makefile new file mode 100755 index 0000000..e886c41 --- /dev/null +++ b/helloworld/node_modules/blob/Makefile @@ -0,0 +1,14 @@ +REPORTER = dot + +build: blob.js + +blob.js: + @./node_modules/.bin/browserify --standalone blob index.js > blob.js + +test: + @./node_modules/.bin/zuul -- test/index.js + +clean: + rm blob.js + +.PHONY: test blob.js diff --git a/helloworld/node_modules/blob/README.md b/helloworld/node_modules/blob/README.md new file mode 100755 index 0000000..4073ce9 --- /dev/null +++ b/helloworld/node_modules/blob/README.md @@ -0,0 +1,21 @@ +# Blob + +A cross-browser `Blob` that falls back to `BlobBuilder` when appropriate. +If neither is available, it exports `undefined`. + +## Installation + +``` bash +$ npm install blob +``` + +## Example + +``` js +var Blob = require('blob'); +var b = new Blob(['hi', 'constructing', 'a', 'blob']); +``` + +## License + +MIT diff --git a/helloworld/node_modules/blob/component.json b/helloworld/node_modules/blob/component.json new file mode 100755 index 0000000..0f3a481 --- /dev/null +++ b/helloworld/node_modules/blob/component.json @@ -0,0 +1,11 @@ +{ + "name": "blob", + "repo": "webmodules/blob", + "description": "Abstracts out Blob and uses BlobBulder in cases where it is supported with any vendor prefix.", + "version": "0.0.4", + "license": "MIT", + "dependencies": {}, + "scripts": [ + "index.js" + ] +} diff --git a/helloworld/node_modules/blob/index.js b/helloworld/node_modules/blob/index.js new file mode 100755 index 0000000..ee179d7 --- /dev/null +++ b/helloworld/node_modules/blob/index.js @@ -0,0 +1,100 @@ +/** + * Create a blob builder even when vendor prefixes exist + */ + +var BlobBuilder = typeof BlobBuilder !== 'undefined' ? BlobBuilder : + typeof WebKitBlobBuilder !== 'undefined' ? WebKitBlobBuilder : + typeof MSBlobBuilder !== 'undefined' ? MSBlobBuilder : + typeof MozBlobBuilder !== 'undefined' ? MozBlobBuilder : + false; + +/** + * Check if Blob constructor is supported + */ + +var blobSupported = (function() { + try { + var a = new Blob(['hi']); + return a.size === 2; + } catch(e) { + return false; + } +})(); + +/** + * Check if Blob constructor supports ArrayBufferViews + * Fails in Safari 6, so we need to map to ArrayBuffers there. + */ + +var blobSupportsArrayBufferView = blobSupported && (function() { + try { + var b = new Blob([new Uint8Array([1,2])]); + return b.size === 2; + } catch(e) { + return false; + } +})(); + +/** + * Check if BlobBuilder is supported + */ + +var blobBuilderSupported = BlobBuilder + && BlobBuilder.prototype.append + && BlobBuilder.prototype.getBlob; + +/** + * Helper function that maps ArrayBufferViews to ArrayBuffers + * Used by BlobBuilder constructor and old browsers that didn't + * support it in the Blob constructor. + */ + +function mapArrayBufferViews(ary) { + return ary.map(function(chunk) { + if (chunk.buffer instanceof ArrayBuffer) { + var buf = chunk.buffer; + + // if this is a subarray, make a copy so we only + // include the subarray region from the underlying buffer + if (chunk.byteLength !== buf.byteLength) { + var copy = new Uint8Array(chunk.byteLength); + copy.set(new Uint8Array(buf, chunk.byteOffset, chunk.byteLength)); + buf = copy.buffer; + } + + return buf; + } + + return chunk; + }); +} + +function BlobBuilderConstructor(ary, options) { + options = options || {}; + + var bb = new BlobBuilder(); + mapArrayBufferViews(ary).forEach(function(part) { + bb.append(part); + }); + + return (options.type) ? bb.getBlob(options.type) : bb.getBlob(); +}; + +function BlobConstructor(ary, options) { + return new Blob(mapArrayBufferViews(ary), options || {}); +}; + +if (typeof Blob !== 'undefined') { + BlobBuilderConstructor.prototype = Blob.prototype; + BlobConstructor.prototype = Blob.prototype; +} + +module.exports = (function() { + if (blobSupported) { + return blobSupportsArrayBufferView ? Blob : BlobConstructor; + } else if (blobBuilderSupported) { + return BlobBuilderConstructor; + } else { + return undefined; + } +})(); diff --git a/helloworld/node_modules/blob/package.json b/helloworld/node_modules/blob/package.json new file mode 100755 index 0000000..12e3da0 --- /dev/null +++ b/helloworld/node_modules/blob/package.json @@ -0,0 +1,49 @@ +{ + "_from": "blob@0.0.5", + "_id": "blob@0.0.5", + "_inBundle": false, + "_integrity": "sha512-gaqbzQPqOoamawKg0LGVd7SzLgXS+JH61oWprSLH+P+abTczqJbhTR8CmJ2u9/bUYNmHTGJx/UEmn6doAvvuig==", + "_location": "/blob", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "blob@0.0.5", + "name": "blob", + "escapedName": "blob", + "rawSpec": "0.0.5", + "saveSpec": null, + "fetchSpec": "0.0.5" + }, + "_requiredBy": [ + "/engine.io-parser" + ], + "_resolved": "https://registry.npmjs.org/blob/-/blob-0.0.5.tgz", + "_shasum": "d680eeef25f8cd91ad533f5b01eed48e64caf683", + "_spec": "blob@0.0.5", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/engine.io-parser", + "bugs": { + "url": "https://github.com/webmodules/blob/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Abstracts out Blob and uses BlobBulder in cases where it is supported with any vendor prefix.", + "devDependencies": { + "browserify": "4.2.3", + "expect.js": "0.2.0", + "mocha": "1.17.1", + "zuul": "1.10.2" + }, + "homepage": "https://github.com/webmodules/blob", + "license": "MIT", + "name": "blob", + "repository": { + "type": "git", + "url": "git://github.com/webmodules/blob.git" + }, + "scripts": { + "test": "make test" + }, + "version": "0.0.5" +} diff --git a/helloworld/node_modules/blob/test/index.js b/helloworld/node_modules/blob/test/index.js new file mode 100755 index 0000000..fe9105e --- /dev/null +++ b/helloworld/node_modules/blob/test/index.js @@ -0,0 +1,100 @@ +var Blob = require('../'); +var expect = require('expect.js'); + +describe('blob', function() { + if (!Blob) { + it('should not have a blob or a blob builder in the global namespace, or blob should not be a constructor function if the module exports false', function() { + try { + var ab = (new Uint8Array(5)).buffer; + global.Blob([ab]); + expect().fail('Blob shouldn\'t be constructable'); + } catch (e) {} + + var BlobBuilder = global.BlobBuilder + || global.WebKitBlobBuilder + || global.MSBlobBuilder + || global.MozBlobBuilder; + expect(BlobBuilder).to.be(undefined); + }); + } else { + it('should encode a proper sized blob when given a string argument', function() { + var b = new Blob(['hi']); + expect(b.size).to.be(2); + }); + + it('should encode a blob with proper size when given two strings as arguments', function() { + var b = new Blob(['hi', 'hello']); + expect(b.size).to.be(7); + }); + + it('should encode arraybuffers with right content', function(done) { + var ary = new Uint8Array(5); + for (var i = 0; i < 5; i++) ary[i] = i; + var b = new Blob([ary.buffer]); + var fr = new FileReader(); + fr.onload = function() { + var newAry = new Uint8Array(this.result); + for (var i = 0; i < 5; i++) expect(newAry[i]).to.be(i); + done(); + }; + fr.readAsArrayBuffer(b); + }); + + it('should encode typed arrays with right content', function(done) { + var ary = new Uint8Array(5); + for (var i = 0; i < 5; i++) ary[i] = i; + var b = new Blob([ary]); + var fr = new FileReader(); + fr.onload = function() { + var newAry = new Uint8Array(this.result); + for (var i = 0; i < 5; i++) expect(newAry[i]).to.be(i); + done(); + }; + fr.readAsArrayBuffer(b); + }); + + it('should encode sliced typed arrays with right content', function(done) { + var ary = new Uint8Array(5); + for (var i = 0; i < 5; i++) ary[i] = i; + var b = new Blob([ary.subarray(2)]); + var fr = new FileReader(); + fr.onload = function() { + var newAry = new Uint8Array(this.result); + for (var i = 0; i < 3; i++) expect(newAry[i]).to.be(i + 2); + done(); + }; + fr.readAsArrayBuffer(b); + }); + + it('should encode with blobs', function(done) { + var ary = new Uint8Array(5); + for (var i = 0; i < 5; i++) ary[i] = i; + var b = new Blob([new Blob([ary.buffer])]); + var fr = new FileReader(); + fr.onload = function() { + var newAry = new Uint8Array(this.result); + for (var i = 0; i < 5; i++) expect(newAry[i]).to.be(i); + done(); + }; + fr.readAsArrayBuffer(b); + }); + + it('should enode mixed contents to right size', function() { + var ary = new Uint8Array(5); + for (var i = 0; i < 5; i++) ary[i] = i; + var b = new Blob([ary.buffer, 'hello']); + expect(b.size).to.be(10); + }); + + it('should accept mime type', function() { + var b = new Blob(['hi', 'hello'], { type: 'text/html' }); + expect(b.type).to.be('text/html'); + }); + + it('should be an instance of constructor', function() { + var b = new Blob(['hi']); + expect(b).to.be.a(Blob); + expect(b).to.be.a(global.Blob); + }); + } +}); diff --git a/helloworld/node_modules/cacheable-request/LICENSE b/helloworld/node_modules/cacheable-request/LICENSE new file mode 100755 index 0000000..f27ee9b --- /dev/null +++ b/helloworld/node_modules/cacheable-request/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2017 Luke Childs + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/helloworld/node_modules/cacheable-request/README.md b/helloworld/node_modules/cacheable-request/README.md new file mode 100755 index 0000000..725e7e0 --- /dev/null +++ b/helloworld/node_modules/cacheable-request/README.md @@ -0,0 +1,206 @@ +# cacheable-request + +> Wrap native HTTP requests with RFC compliant cache support + +[![Build Status](https://travis-ci.org/lukechilds/cacheable-request.svg?branch=master)](https://travis-ci.org/lukechilds/cacheable-request) +[![Coverage Status](https://coveralls.io/repos/github/lukechilds/cacheable-request/badge.svg?branch=master)](https://coveralls.io/github/lukechilds/cacheable-request?branch=master) +[![npm](https://img.shields.io/npm/dm/cacheable-request.svg)](https://www.npmjs.com/package/cacheable-request) +[![npm](https://img.shields.io/npm/v/cacheable-request.svg)](https://www.npmjs.com/package/cacheable-request) + +[RFC 7234](http://httpwg.org/specs/rfc7234.html) compliant HTTP caching for native Node.js HTTP/HTTPS requests. Caching works out of the box in memory or is easily pluggable with a wide range of storage adapters. + +**Note:** This is a low level wrapper around the core HTTP modules, it's not a high level request library. + +## Features + +- Only stores cacheable responses as defined by RFC 7234 +- Fresh cache entries are served directly from cache +- Stale cache entries are revalidated with `If-None-Match`/`If-Modified-Since` headers +- 304 responses from revalidation requests use cached body +- Updates `Age` header on cached responses +- Can completely bypass cache on a per request basis +- In memory cache by default +- Official support for Redis, MongoDB, SQLite, PostgreSQL and MySQL storage adapters +- Easily plug in your own or third-party storage adapters +- If DB connection fails, cache is automatically bypassed ([disabled by default](#optsautomaticfailover)) +- Adds cache support to any existing HTTP code with minimal changes +- Uses [http-cache-semantics](https://github.com/pornel/http-cache-semantics) internally for HTTP RFC 7234 compliance + +## Install + +```shell +npm install cacheable-request +``` + +## Usage + +```js +const http = require('http'); +const CacheableRequest = require('cacheable-request'); + +// Then instead of +const req = http.request('http://example.com', cb); +req.end(); + +// You can do +const cacheableRequest = new CacheableRequest(http.request); +const cacheReq = cacheableRequest('http://example.com', cb); +cacheReq.on('request', req => req.end()); +// Future requests to 'example.com' will be returned from cache if still valid + +// You pass in any other http.request API compatible method to be wrapped with cache support: +const cacheableRequest = new CacheableRequest(https.request); +const cacheableRequest = new CacheableRequest(electron.net); +``` + +## Storage Adapters + +`cacheable-request` uses [Keyv](https://github.com/lukechilds/keyv) to support a wide range of storage adapters. + +For example, to use Redis as a cache backend, you just need to install the official Redis Keyv storage adapter: + +``` +npm install @keyv/redis +``` + +And then you can pass `CacheableRequest` your connection string: + +```js +const cacheableRequest = new CacheableRequest(http.request, 'redis://user:pass@localhost:6379'); +``` + +[View all official Keyv storage adapters.](https://github.com/lukechilds/keyv#official-storage-adapters) + +Keyv also supports anything that follows the Map API so it's easy to write your own storage adapter or use a third-party solution. + +e.g The following are all valid storage adapters + +```js +const storageAdapter = new Map(); +// or +const storageAdapter = require('./my-storage-adapter'); +// or +const QuickLRU = require('quick-lru'); +const storageAdapter = new QuickLRU({ maxSize: 1000 }); + +const cacheableRequest = new CacheableRequest(http.request, storageAdapter); +``` + +View the [Keyv docs](https://github.com/lukechilds/keyv) for more information on how to use storage adapters. + +## API + +### new cacheableRequest(request, [storageAdapter]) + +Returns the provided request function wrapped with cache support. + +#### request + +Type: `function` + +Request function to wrap with cache support. Should be [`http.request`](https://nodejs.org/api/http.html#http_http_request_options_callback) or a similar API compatible request function. + +#### storageAdapter + +Type: `Keyv storage adapter`
+Default: `new Map()` + +A [Keyv](https://github.com/lukechilds/keyv) storage adapter instance, or connection string if using with an official Keyv storage adapter. + +### Instance + +#### cacheableRequest(opts, [cb]) + +Returns an event emitter. + +##### opts + +Type: `object`, `string` + +- Any of the default request functions options. +- Any [`http-cache-semantics`](https://github.com/kornelski/http-cache-semantics#constructor-options) options. +- Any of the following: + +###### opts.cache + +Type: `boolean`
+Default: `true` + +If the cache should be used. Setting this to false will completely bypass the cache for the current request. + +###### opts.strictTtl + +Type: `boolean`
+Default: `false` + +If set to `true` once a cached resource has expired it is deleted and will have to be re-requested. + +If set to `false` (default), after a cached resource's TTL expires it is kept in the cache and will be revalidated on the next request with `If-None-Match`/`If-Modified-Since` headers. + +###### opts.maxTtl + +Type: `number`
+Default: `undefined` + +Limits TTL. The `number` represents milliseconds. + +###### opts.automaticFailover + +Type: `boolean`
+Default: `false` + +When set to `true`, if the DB connection fails we will automatically fallback to a network request. DB errors will still be emitted to notify you of the problem even though the request callback may succeed. + +###### opts.forceRefresh + +Type: `boolean`
+Default: `false` + +Forces refreshing the cache. If the response could be retrieved from the cache, it will perform a new request and override the cache instead. + +##### cb + +Type: `function` + +The callback function which will receive the response as an argument. + +The response can be either a [Node.js HTTP response stream](https://nodejs.org/api/http.html#http_class_http_incomingmessage) or a [responselike object](https://github.com/lukechilds/responselike). The response will also have a `fromCache` property set with a boolean value. + +##### .on('request', request) + +`request` event to get the request object of the request. + +**Note:** This event will only fire if an HTTP request is actually made, not when a response is retrieved from cache. However, you should always handle the `request` event to end the request and handle any potential request errors. + +##### .on('response', response) + +`response` event to get the response object from the HTTP request or cache. + +##### .on('error', error) + +`error` event emitted in case of an error with the cache. + +Errors emitted here will be an instance of `CacheableRequest.RequestError` or `CacheableRequest.CacheError`. You will only ever receive a `RequestError` if the request function throws (normally caused by invalid user input). Normal request errors should be handled inside the `request` event. + +To properly handle all error scenarios you should use the following pattern: + +```js +cacheableRequest('example.com', cb) + .on('error', err => { + if (err instanceof CacheableRequest.CacheError) { + handleCacheError(err); // Cache error + } else if (err instanceof CacheableRequest.RequestError) { + handleRequestError(err); // Request function thrown + } + }) + .on('request', req => { + req.on('error', handleRequestError); // Request error emitted + req.end(); + }); +``` + +**Note:** Database connection errors are emitted here, however `cacheable-request` will attempt to re-request the resource and bypass the cache on a connection error. Therefore a database connection error doesn't necessarily mean the request won't be fulfilled. + +## License + +MIT © Luke Childs diff --git a/helloworld/node_modules/cacheable-request/src/index.js b/helloworld/node_modules/cacheable-request/src/index.js new file mode 100755 index 0000000..cf171ad --- /dev/null +++ b/helloworld/node_modules/cacheable-request/src/index.js @@ -0,0 +1,244 @@ +'use strict'; + +const EventEmitter = require('events'); +const urlLib = require('url'); +const normalizeUrl = require('normalize-url'); +const getStream = require('get-stream'); +const CachePolicy = require('http-cache-semantics'); +const Response = require('responselike'); +const lowercaseKeys = require('lowercase-keys'); +const cloneResponse = require('clone-response'); +const Keyv = require('keyv'); + +class CacheableRequest { + constructor(request, cacheAdapter) { + if (typeof request !== 'function') { + throw new TypeError('Parameter `request` must be a function'); + } + + this.cache = new Keyv({ + uri: typeof cacheAdapter === 'string' && cacheAdapter, + store: typeof cacheAdapter !== 'string' && cacheAdapter, + namespace: 'cacheable-request' + }); + + return this.createCacheableRequest(request); + } + + createCacheableRequest(request) { + return (opts, cb) => { + let url; + if (typeof opts === 'string') { + url = normalizeUrlObject(urlLib.parse(opts)); + opts = {}; + } else if (opts instanceof urlLib.URL) { + url = normalizeUrlObject(urlLib.parse(opts.toString())); + opts = {}; + } else { + const [pathname, ...searchParts] = (opts.path || '').split('?'); + const search = searchParts.length > 0 ? + `?${searchParts.join('?')}` : + ''; + url = normalizeUrlObject({ ...opts, pathname, search }); + } + opts = { + headers: {}, + method: 'GET', + cache: true, + strictTtl: false, + automaticFailover: false, + ...opts, + ...urlObjectToRequestOptions(url) + }; + opts.headers = lowercaseKeys(opts.headers); + + const ee = new EventEmitter(); + const normalizedUrlString = normalizeUrl( + urlLib.format(url), + { + stripWWW: false, + removeTrailingSlash: false + } + ); + const key = `${opts.method}:${normalizedUrlString}`; + let revalidate = false; + let madeRequest = false; + + const makeRequest = opts => { + madeRequest = true; + let requestErrored = false; + let requestErrorCallback; + + const requestErrorPromise = new Promise(resolve => { + requestErrorCallback = () => { + requestErrored = true; + resolve(); + }; + }); + + const handler = response => { + if (revalidate && !opts.forceRefresh) { + response.status = response.statusCode; + const revalidatedPolicy = CachePolicy.fromObject(revalidate.cachePolicy).revalidatedPolicy(opts, response); + if (!revalidatedPolicy.modified) { + const headers = revalidatedPolicy.policy.responseHeaders(); + response = new Response(revalidate.statusCode, headers, revalidate.body, revalidate.url); + response.cachePolicy = revalidatedPolicy.policy; + response.fromCache = true; + } + } + + if (!response.fromCache) { + response.cachePolicy = new CachePolicy(opts, response, opts); + response.fromCache = false; + } + + let clonedResponse; + if (opts.cache && response.cachePolicy.storable()) { + clonedResponse = cloneResponse(response); + + (async () => { + try { + const bodyPromise = getStream.buffer(response); + + await Promise.race([ + requestErrorPromise, + new Promise(resolve => response.once('end', resolve)) + ]); + + if (requestErrored) { + return; + } + + const body = await bodyPromise; + + const value = { + cachePolicy: response.cachePolicy.toObject(), + url: response.url, + statusCode: response.fromCache ? revalidate.statusCode : response.statusCode, + body + }; + + let ttl = opts.strictTtl ? response.cachePolicy.timeToLive() : undefined; + if (opts.maxTtl) { + ttl = ttl ? Math.min(ttl, opts.maxTtl) : opts.maxTtl; + } + + await this.cache.set(key, value, ttl); + } catch (err) { + ee.emit('error', new CacheableRequest.CacheError(err)); + } + })(); + } else if (opts.cache && revalidate) { + (async () => { + try { + await this.cache.delete(key); + } catch (err) { + ee.emit('error', new CacheableRequest.CacheError(err)); + } + })(); + } + + ee.emit('response', clonedResponse || response); + if (typeof cb === 'function') { + cb(clonedResponse || response); + } + }; + + try { + const req = request(opts, handler); + req.once('error', requestErrorCallback); + req.once('abort', requestErrorCallback); + ee.emit('request', req); + } catch (err) { + ee.emit('error', new CacheableRequest.RequestError(err)); + } + }; + + (async () => { + const get = async opts => { + await Promise.resolve(); + + const cacheEntry = opts.cache ? await this.cache.get(key) : undefined; + if (typeof cacheEntry === 'undefined') { + return makeRequest(opts); + } + + const policy = CachePolicy.fromObject(cacheEntry.cachePolicy); + if (policy.satisfiesWithoutRevalidation(opts) && !opts.forceRefresh) { + const headers = policy.responseHeaders(); + const response = new Response(cacheEntry.statusCode, headers, cacheEntry.body, cacheEntry.url); + response.cachePolicy = policy; + response.fromCache = true; + + ee.emit('response', response); + if (typeof cb === 'function') { + cb(response); + } + } else { + revalidate = cacheEntry; + opts.headers = policy.revalidationHeaders(opts); + makeRequest(opts); + } + }; + + this.cache.on('error', err => ee.emit('error', new CacheableRequest.CacheError(err))); + + try { + await get(opts); + } catch (err) { + if (opts.automaticFailover && !madeRequest) { + makeRequest(opts); + } + ee.emit('error', new CacheableRequest.CacheError(err)); + } + })(); + + return ee; + }; + } +} + +function urlObjectToRequestOptions(url) { + const options = { ...url }; + options.path = `${url.pathname || '/'}${url.search || ''}`; + delete options.pathname; + delete options.search; + return options; +} + +function normalizeUrlObject(url) { + // If url was parsed by url.parse or new URL: + // - hostname will be set + // - host will be hostname[:port] + // - port will be set if it was explicit in the parsed string + // Otherwise, url was from request options: + // - hostname or host may be set + // - host shall not have port encoded + return { + protocol: url.protocol, + auth: url.auth, + hostname: url.hostname || url.host || 'localhost', + port: url.port, + pathname: url.pathname, + search: url.search + }; +} + +CacheableRequest.RequestError = class extends Error { + constructor(err) { + super(err.message); + this.name = 'RequestError'; + Object.assign(this, err); + } +}; + +CacheableRequest.CacheError = class extends Error { + constructor(err) { + super(err.message); + this.name = 'CacheError'; + Object.assign(this, err); + } +}; + +module.exports = CacheableRequest; diff --git a/helloworld/node_modules/callsite/History.md b/helloworld/node_modules/callsite/History.md new file mode 100755 index 0000000..4994198 --- /dev/null +++ b/helloworld/node_modules/callsite/History.md @@ -0,0 +1,10 @@ + +1.0.0 / 2013-01-24 +================== + + * remove lame magical getters + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/helloworld/node_modules/callsite/Makefile b/helloworld/node_modules/callsite/Makefile new file mode 100755 index 0000000..634e372 --- /dev/null +++ b/helloworld/node_modules/callsite/Makefile @@ -0,0 +1,6 @@ + +test: + @./node_modules/.bin/mocha \ + --require should + +.PHONY: test \ No newline at end of file diff --git a/helloworld/node_modules/callsite/Readme.md b/helloworld/node_modules/callsite/Readme.md new file mode 100755 index 0000000..0dbd16a --- /dev/null +++ b/helloworld/node_modules/callsite/Readme.md @@ -0,0 +1,44 @@ +# callstack + + Access to v8's "raw" `CallSite`s. + +## Installation + + $ npm install callsite + +## Example + +```js +var stack = require('callsite'); + +foo(); + +function foo() { + bar(); +} + +function bar() { + baz(); +} + +function baz() { + console.log(); + stack().forEach(function(site){ + console.log(' \033[36m%s\033[90m in %s:%d\033[0m' + , site.getFunctionName() || 'anonymous' + , site.getFileName() + , site.getLineNumber()); + }); + console.log(); +} +``` + +## Why? + + Because you can do weird, stupid, clever, wacky things such as: + + - [better-assert](https://github.com/visionmedia/better-assert) + +## License + + MIT diff --git a/helloworld/node_modules/callsite/index.js b/helloworld/node_modules/callsite/index.js new file mode 100755 index 0000000..d3ee6f8 --- /dev/null +++ b/helloworld/node_modules/callsite/index.js @@ -0,0 +1,10 @@ + +module.exports = function(){ + var orig = Error.prepareStackTrace; + Error.prepareStackTrace = function(_, stack){ return stack; }; + var err = new Error; + Error.captureStackTrace(err, arguments.callee); + var stack = err.stack; + Error.prepareStackTrace = orig; + return stack; +}; diff --git a/helloworld/node_modules/callsite/package.json b/helloworld/node_modules/callsite/package.json new file mode 100755 index 0000000..920841d --- /dev/null +++ b/helloworld/node_modules/callsite/package.json @@ -0,0 +1,48 @@ +{ + "_from": "callsite@1.0.0", + "_id": "callsite@1.0.0", + "_inBundle": false, + "_integrity": "sha1-KAOY5dZkvXQDi28JBRU+borxvCA=", + "_location": "/callsite", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "callsite@1.0.0", + "name": "callsite", + "escapedName": "callsite", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/better-assert" + ], + "_resolved": "https://registry.npmjs.org/callsite/-/callsite-1.0.0.tgz", + "_shasum": "280398e5d664bd74038b6f0905153e6e8af1bc20", + "_spec": "callsite@1.0.0", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/better-assert", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "access to v8's CallSites", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "engines": { + "node": "*" + }, + "keywords": [ + "stack", + "trace", + "line" + ], + "main": "index", + "name": "callsite", + "version": "1.0.0" +} diff --git a/helloworld/node_modules/camelcase/index.js b/helloworld/node_modules/camelcase/index.js new file mode 100755 index 0000000..5670f73 --- /dev/null +++ b/helloworld/node_modules/camelcase/index.js @@ -0,0 +1,56 @@ +'use strict'; + +function preserveCamelCase(str) { + var isLastCharLower = false; + + for (var i = 0; i < str.length; i++) { + var c = str.charAt(i); + + if (isLastCharLower && (/[a-zA-Z]/).test(c) && c.toUpperCase() === c) { + str = str.substr(0, i) + '-' + str.substr(i); + isLastCharLower = false; + i++; + } else { + isLastCharLower = (c.toLowerCase() === c); + } + } + + return str; +} + +module.exports = function () { + var str = [].map.call(arguments, function (str) { + return str.trim(); + }).filter(function (str) { + return str.length; + }).join('-'); + + if (!str.length) { + return ''; + } + + if (str.length === 1) { + return str.toLowerCase(); + } + + if (!(/[_.\- ]+/).test(str)) { + if (str === str.toUpperCase()) { + return str.toLowerCase(); + } + + if (str[0] !== str[0].toLowerCase()) { + return str[0].toLowerCase() + str.slice(1); + } + + return str; + } + + str = preserveCamelCase(str); + + return str + .replace(/^[_.\- ]+/, '') + .toLowerCase() + .replace(/[_.\- ]+(\w|$)/g, function (m, p1) { + return p1.toUpperCase(); + }); +}; diff --git a/helloworld/node_modules/camelcase/license b/helloworld/node_modules/camelcase/license new file mode 100755 index 0000000..654d0bf --- /dev/null +++ b/helloworld/node_modules/camelcase/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/camelcase/readme.md b/helloworld/node_modules/camelcase/readme.md new file mode 100755 index 0000000..080b2a1 --- /dev/null +++ b/helloworld/node_modules/camelcase/readme.md @@ -0,0 +1,57 @@ +# camelcase [![Build Status](https://travis-ci.org/sindresorhus/camelcase.svg?branch=master)](https://travis-ci.org/sindresorhus/camelcase) + +> Convert a dash/dot/underscore/space separated string to camelCase: `foo-bar` → `fooBar` + + +## Install + +``` +$ npm install --save camelcase +``` + + +## Usage + +```js +const camelCase = require('camelcase'); + +camelCase('foo-bar'); +//=> 'fooBar' + +camelCase('foo_bar'); +//=> 'fooBar' + +camelCase('Foo-Bar'); +//=> 'fooBar' + +camelCase('--foo.bar'); +//=> 'fooBar' + +camelCase('__foo__bar__'); +//=> 'fooBar' + +camelCase('foo bar'); +//=> 'fooBar' + +console.log(process.argv[3]); +//=> '--foo-bar' +camelCase(process.argv[3]); +//=> 'fooBar' + +camelCase('foo', 'bar'); +//=> 'fooBar' + +camelCase('__foo__', '--bar'); +//=> 'fooBar' +``` + + +## Related + +- [decamelize](https://github.com/sindresorhus/decamelize) - The inverse of this module +- [uppercamelcase](https://github.com/SamVerschueren/uppercamelcase) - Like this module, but to PascalCase instead of camelCase + + +## License + +MIT © [Sindre Sorhus](http://sindresorhus.com) diff --git a/helloworld/node_modules/cliui/CHANGELOG.md b/helloworld/node_modules/cliui/CHANGELOG.md new file mode 100755 index 0000000..ef6a35e --- /dev/null +++ b/helloworld/node_modules/cliui/CHANGELOG.md @@ -0,0 +1,15 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + + +# [3.2.0](https://github.com/yargs/cliui/compare/v3.1.2...v3.2.0) (2016-04-11) + + +### Bug Fixes + +* reduces tarball size ([acc6c33](https://github.com/yargs/cliui/commit/acc6c33)) + +### Features + +* adds standard-version for release management ([ff84e32](https://github.com/yargs/cliui/commit/ff84e32)) diff --git a/helloworld/node_modules/cliui/LICENSE.txt b/helloworld/node_modules/cliui/LICENSE.txt new file mode 100755 index 0000000..c7e2747 --- /dev/null +++ b/helloworld/node_modules/cliui/LICENSE.txt @@ -0,0 +1,14 @@ +Copyright (c) 2015, Contributors + +Permission to use, copy, modify, and/or distribute this software +for any purpose with or without fee is hereby granted, provided +that the above copyright notice and this permission notice +appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE +LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES +OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/helloworld/node_modules/cliui/README.md b/helloworld/node_modules/cliui/README.md new file mode 100755 index 0000000..028392c --- /dev/null +++ b/helloworld/node_modules/cliui/README.md @@ -0,0 +1,110 @@ +# cliui + +[![Build Status](https://travis-ci.org/yargs/cliui.svg)](https://travis-ci.org/yargs/cliui) +[![Coverage Status](https://coveralls.io/repos/yargs/cliui/badge.svg?branch=)](https://coveralls.io/r/yargs/cliui?branch=) +[![NPM version](https://img.shields.io/npm/v/cliui.svg)](https://www.npmjs.com/package/cliui) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) + +easily create complex multi-column command-line-interfaces. + +## Example + +```js +var ui = require('cliui')({ + width: 80 +}) + +ui.div('Usage: $0 [command] [options]') + +ui.div({ + text: 'Options:', + padding: [2, 0, 2, 0] +}) + +ui.div( + { + text: "-f, --file", + width: 20, + padding: [0, 4, 0, 4] + }, + { + text: "the file to load." + + chalk.green("(if this description is long it wraps).") + , + width: 20 + }, + { + text: chalk.red("[required]"), + align: 'right' + } +) + +console.log(ui.toString()) +``` + + + +## Layout DSL + +cliui exposes a simple layout DSL: + +If you create a single `ui.row`, passing a string rather than an +object: + +* `\n`: characters will be interpreted as new rows. +* `\t`: characters will be interpreted as new columns. +* `\s`: characters will be interpreted as padding. + +**as an example...** + +```js +var ui = require('./')({ + width: 60 +}) + +ui.div( + 'Usage: node ./bin/foo.js\n' + + ' \t provide a regex\n' + + ' \t provide a glob\t [required]' +) + +console.log(ui.toString()) +``` + +**will output:** + +```shell +Usage: node ./bin/foo.js + provide a regex + provide a glob [required] +``` + +## Methods + +```js +cliui = require('cliui') +``` + +### cliui({width: integer}) + +Specify the maximum width of the UI being generated. + +### cliui({wrap: boolean}) + +Enable or disable the wrapping of text in a column. + +### cliui.div(column, column, column) + +Create a row with any number of columns, a column +can either be a string, or an object with the following +options: + +* **width:** the width of a column. +* **align:** alignment, `right` or `center`. +* **padding:** `[top, right, bottom, left]`. +* **border:** should a border be placed around the div? + +### cliui.span(column, column, column) + +Similar to `div`, except the next row will be appended without +a new line being created. diff --git a/helloworld/node_modules/cliui/index.js b/helloworld/node_modules/cliui/index.js new file mode 100755 index 0000000..e501e78 --- /dev/null +++ b/helloworld/node_modules/cliui/index.js @@ -0,0 +1,316 @@ +var stringWidth = require('string-width') +var stripAnsi = require('strip-ansi') +var wrap = require('wrap-ansi') +var align = { + right: alignRight, + center: alignCenter +} +var top = 0 +var right = 1 +var bottom = 2 +var left = 3 + +function UI (opts) { + this.width = opts.width + this.wrap = opts.wrap + this.rows = [] +} + +UI.prototype.span = function () { + var cols = this.div.apply(this, arguments) + cols.span = true +} + +UI.prototype.div = function () { + if (arguments.length === 0) this.div('') + if (this.wrap && this._shouldApplyLayoutDSL.apply(this, arguments)) { + return this._applyLayoutDSL(arguments[0]) + } + + var cols = [] + + for (var i = 0, arg; (arg = arguments[i]) !== undefined; i++) { + if (typeof arg === 'string') cols.push(this._colFromString(arg)) + else cols.push(arg) + } + + this.rows.push(cols) + return cols +} + +UI.prototype._shouldApplyLayoutDSL = function () { + return arguments.length === 1 && typeof arguments[0] === 'string' && + /[\t\n]/.test(arguments[0]) +} + +UI.prototype._applyLayoutDSL = function (str) { + var _this = this + var rows = str.split('\n') + var leftColumnWidth = 0 + + // simple heuristic for layout, make sure the + // second column lines up along the left-hand. + // don't allow the first column to take up more + // than 50% of the screen. + rows.forEach(function (row) { + var columns = row.split('\t') + if (columns.length > 1 && stringWidth(columns[0]) > leftColumnWidth) { + leftColumnWidth = Math.min( + Math.floor(_this.width * 0.5), + stringWidth(columns[0]) + ) + } + }) + + // generate a table: + // replacing ' ' with padding calculations. + // using the algorithmically generated width. + rows.forEach(function (row) { + var columns = row.split('\t') + _this.div.apply(_this, columns.map(function (r, i) { + return { + text: r.trim(), + padding: _this._measurePadding(r), + width: (i === 0 && columns.length > 1) ? leftColumnWidth : undefined + } + })) + }) + + return this.rows[this.rows.length - 1] +} + +UI.prototype._colFromString = function (str) { + return { + text: str, + padding: this._measurePadding(str) + } +} + +UI.prototype._measurePadding = function (str) { + // measure padding without ansi escape codes + var noAnsi = stripAnsi(str) + return [0, noAnsi.match(/\s*$/)[0].length, 0, noAnsi.match(/^\s*/)[0].length] +} + +UI.prototype.toString = function () { + var _this = this + var lines = [] + + _this.rows.forEach(function (row, i) { + _this.rowToString(row, lines) + }) + + // don't display any lines with the + // hidden flag set. + lines = lines.filter(function (line) { + return !line.hidden + }) + + return lines.map(function (line) { + return line.text + }).join('\n') +} + +UI.prototype.rowToString = function (row, lines) { + var _this = this + var padding + var rrows = this._rasterize(row) + var str = '' + var ts + var width + var wrapWidth + + rrows.forEach(function (rrow, r) { + str = '' + rrow.forEach(function (col, c) { + ts = '' // temporary string used during alignment/padding. + width = row[c].width // the width with padding. + wrapWidth = _this._negatePadding(row[c]) // the width without padding. + + ts += col + + for (var i = 0; i < wrapWidth - stringWidth(col); i++) { + ts += ' ' + } + + // align the string within its column. + if (row[c].align && row[c].align !== 'left' && _this.wrap) { + ts = align[row[c].align](ts, wrapWidth) + if (stringWidth(ts) < wrapWidth) ts += new Array(width - stringWidth(ts)).join(' ') + } + + // apply border and padding to string. + padding = row[c].padding || [0, 0, 0, 0] + if (padding[left]) str += new Array(padding[left] + 1).join(' ') + str += addBorder(row[c], ts, '| ') + str += ts + str += addBorder(row[c], ts, ' |') + if (padding[right]) str += new Array(padding[right] + 1).join(' ') + + // if prior row is span, try to render the + // current row on the prior line. + if (r === 0 && lines.length > 0) { + str = _this._renderInline(str, lines[lines.length - 1]) + } + }) + + // remove trailing whitespace. + lines.push({ + text: str.replace(/ +$/, ''), + span: row.span + }) + }) + + return lines +} + +function addBorder (col, ts, style) { + if (col.border) { + if (/[.']-+[.']/.test(ts)) return '' + else if (ts.trim().length) return style + else return ' ' + } + return '' +} + +// if the full 'source' can render in +// the target line, do so. +UI.prototype._renderInline = function (source, previousLine) { + var leadingWhitespace = source.match(/^ */)[0].length + var target = previousLine.text + var targetTextWidth = stringWidth(target.trimRight()) + + if (!previousLine.span) return source + + // if we're not applying wrapping logic, + // just always append to the span. + if (!this.wrap) { + previousLine.hidden = true + return target + source + } + + if (leadingWhitespace < targetTextWidth) return source + + previousLine.hidden = true + + return target.trimRight() + new Array(leadingWhitespace - targetTextWidth + 1).join(' ') + source.trimLeft() +} + +UI.prototype._rasterize = function (row) { + var _this = this + var i + var rrow + var rrows = [] + var widths = this._columnWidths(row) + var wrapped + + // word wrap all columns, and create + // a data-structure that is easy to rasterize. + row.forEach(function (col, c) { + // leave room for left and right padding. + col.width = widths[c] + if (_this.wrap) wrapped = wrap(col.text, _this._negatePadding(col), {hard: true}).split('\n') + else wrapped = col.text.split('\n') + + if (col.border) { + wrapped.unshift('.' + new Array(_this._negatePadding(col) + 3).join('-') + '.') + wrapped.push("'" + new Array(_this._negatePadding(col) + 3).join('-') + "'") + } + + // add top and bottom padding. + if (col.padding) { + for (i = 0; i < (col.padding[top] || 0); i++) wrapped.unshift('') + for (i = 0; i < (col.padding[bottom] || 0); i++) wrapped.push('') + } + + wrapped.forEach(function (str, r) { + if (!rrows[r]) rrows.push([]) + + rrow = rrows[r] + + for (var i = 0; i < c; i++) { + if (rrow[i] === undefined) rrow.push('') + } + rrow.push(str) + }) + }) + + return rrows +} + +UI.prototype._negatePadding = function (col) { + var wrapWidth = col.width + if (col.padding) wrapWidth -= (col.padding[left] || 0) + (col.padding[right] || 0) + if (col.border) wrapWidth -= 4 + return wrapWidth +} + +UI.prototype._columnWidths = function (row) { + var _this = this + var widths = [] + var unset = row.length + var unsetWidth + var remainingWidth = this.width + + // column widths can be set in config. + row.forEach(function (col, i) { + if (col.width) { + unset-- + widths[i] = col.width + remainingWidth -= col.width + } else { + widths[i] = undefined + } + }) + + // any unset widths should be calculated. + if (unset) unsetWidth = Math.floor(remainingWidth / unset) + widths.forEach(function (w, i) { + if (!_this.wrap) widths[i] = row[i].width || stringWidth(row[i].text) + else if (w === undefined) widths[i] = Math.max(unsetWidth, _minWidth(row[i])) + }) + + return widths +} + +// calculates the minimum width of +// a column, based on padding preferences. +function _minWidth (col) { + var padding = col.padding || [] + var minWidth = 1 + (padding[left] || 0) + (padding[right] || 0) + if (col.border) minWidth += 4 + return minWidth +} + +function alignRight (str, width) { + str = str.trim() + var padding = '' + var strWidth = stringWidth(str) + + if (strWidth < width) { + padding = new Array(width - strWidth + 1).join(' ') + } + + return padding + str +} + +function alignCenter (str, width) { + str = str.trim() + var padding = '' + var strWidth = stringWidth(str.trim()) + + if (strWidth < width) { + padding = new Array(parseInt((width - strWidth) / 2, 10) + 1).join(' ') + } + + return padding + str +} + +module.exports = function (opts) { + opts = opts || {} + + return new UI({ + width: (opts || {}).width || 80, + wrap: typeof opts.wrap === 'boolean' ? opts.wrap : true + }) +} diff --git a/helloworld/node_modules/clone-response/LICENSE b/helloworld/node_modules/clone-response/LICENSE new file mode 100755 index 0000000..f27ee9b --- /dev/null +++ b/helloworld/node_modules/clone-response/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2017 Luke Childs + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/helloworld/node_modules/clone-response/README.md b/helloworld/node_modules/clone-response/README.md new file mode 100755 index 0000000..d037cfe --- /dev/null +++ b/helloworld/node_modules/clone-response/README.md @@ -0,0 +1,62 @@ +# clone-response + +> Clone a Node.js HTTP response stream + +[![Build Status](https://travis-ci.org/lukechilds/clone-response.svg?branch=master)](https://travis-ci.org/lukechilds/clone-response) +[![Coverage Status](https://coveralls.io/repos/github/lukechilds/clone-response/badge.svg?branch=master)](https://coveralls.io/github/lukechilds/clone-response?branch=master) +[![npm](https://img.shields.io/npm/dm/clone-response.svg)](https://www.npmjs.com/package/clone-response) +[![npm](https://img.shields.io/npm/v/clone-response.svg)](https://www.npmjs.com/package/clone-response) + +Returns a new stream and copies over all properties and methods from the original response giving you a complete duplicate. + +This is useful in situations where you need to consume the response stream but also want to pass an unconsumed stream somewhere else to be consumed later. + +## Install + +```shell +npm install --save clone-response +``` + +## Usage + +```js +const http = require('http'); +const cloneResponse = require('clone-response'); + +http.get('http://example.com', response => { + const clonedResponse = cloneResponse(response); + response.pipe(process.stdout); + + setImmediate(() => { + // The response stream has already been consumed by the time this executes, + // however the cloned response stream is still available. + doSomethingWithResponse(clonedResponse); + }); +}); +``` + +Please bear in mind that the process of cloning a stream consumes it. However, you can consume a stream multiple times in the same tick, therefore allowing you to create multiple clones. e.g: + +```js +const clone1 = cloneResponse(response); +const clone2 = cloneResponse(response); +// response can still be consumed in this tick but cannot be consumed if passed +// into any async callbacks. clone1 and clone2 can be passed around and be +// consumed in the future. +``` + +## API + +### cloneResponse(response) + +Returns a clone of the passed in response. + +#### response + +Type: `stream` + +A [Node.js HTTP response stream](https://nodejs.org/api/http.html#http_class_http_incomingmessage) to clone. + +## License + +MIT © Luke Childs diff --git a/helloworld/node_modules/clone-response/package.json b/helloworld/node_modules/clone-response/package.json new file mode 100755 index 0000000..4c21f46 --- /dev/null +++ b/helloworld/node_modules/clone-response/package.json @@ -0,0 +1,73 @@ +{ + "_from": "clone-response@^1.0.2", + "_id": "clone-response@1.0.2", + "_inBundle": false, + "_integrity": "sha1-0dyXOSAxTfZ/vrlCI7TuNQI56Ws=", + "_location": "/clone-response", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "clone-response@^1.0.2", + "name": "clone-response", + "escapedName": "clone-response", + "rawSpec": "^1.0.2", + "saveSpec": null, + "fetchSpec": "^1.0.2" + }, + "_requiredBy": [ + "/cacheable-request" + ], + "_resolved": "https://registry.npmjs.org/clone-response/-/clone-response-1.0.2.tgz", + "_shasum": "d1dc973920314df67fbeb94223b4ee350239e96b", + "_spec": "clone-response@^1.0.2", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/cacheable-request", + "author": { + "name": "Luke Childs", + "email": "lukechilds123@gmail.com", + "url": "http://lukechilds.co.uk" + }, + "bugs": { + "url": "https://github.com/lukechilds/clone-response/issues" + }, + "bundleDependencies": false, + "dependencies": { + "mimic-response": "^1.0.0" + }, + "deprecated": false, + "description": "Clone a Node.js HTTP response stream", + "devDependencies": { + "ava": "^0.22.0", + "coveralls": "^2.13.1", + "create-test-server": "^2.0.1", + "eslint-config-xo-lukechilds": "^1.0.0", + "get-stream": "^3.0.0", + "nyc": "^11.0.2", + "pify": "^3.0.0", + "xo": "^0.19.0" + }, + "homepage": "https://github.com/lukechilds/clone-response", + "keywords": [ + "clone", + "duplicate", + "copy", + "response", + "HTTP", + "stream" + ], + "license": "MIT", + "main": "src/index.js", + "name": "clone-response", + "repository": { + "type": "git", + "url": "git+https://github.com/lukechilds/clone-response.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "test": "xo && nyc ava" + }, + "version": "1.0.2", + "xo": { + "extends": "xo-lukechilds" + } +} diff --git a/helloworld/node_modules/clone-response/src/index.js b/helloworld/node_modules/clone-response/src/index.js new file mode 100755 index 0000000..0285dff --- /dev/null +++ b/helloworld/node_modules/clone-response/src/index.js @@ -0,0 +1,17 @@ +'use strict'; + +const PassThrough = require('stream').PassThrough; +const mimicResponse = require('mimic-response'); + +const cloneResponse = response => { + if (!(response && response.pipe)) { + throw new TypeError('Parameter `response` must be a response stream.'); + } + + const clone = new PassThrough(); + mimicResponse(response, clone); + + return response.pipe(clone); +}; + +module.exports = cloneResponse; diff --git a/helloworld/node_modules/code-point-at/index.js b/helloworld/node_modules/code-point-at/index.js new file mode 100755 index 0000000..0432fe6 --- /dev/null +++ b/helloworld/node_modules/code-point-at/index.js @@ -0,0 +1,32 @@ +/* eslint-disable babel/new-cap, xo/throw-new-error */ +'use strict'; +module.exports = function (str, pos) { + if (str === null || str === undefined) { + throw TypeError(); + } + + str = String(str); + + var size = str.length; + var i = pos ? Number(pos) : 0; + + if (Number.isNaN(i)) { + i = 0; + } + + if (i < 0 || i >= size) { + return undefined; + } + + var first = str.charCodeAt(i); + + if (first >= 0xD800 && first <= 0xDBFF && size > i + 1) { + var second = str.charCodeAt(i + 1); + + if (second >= 0xDC00 && second <= 0xDFFF) { + return ((first - 0xD800) * 0x400) + second - 0xDC00 + 0x10000; + } + } + + return first; +}; diff --git a/helloworld/node_modules/code-point-at/license b/helloworld/node_modules/code-point-at/license new file mode 100755 index 0000000..654d0bf --- /dev/null +++ b/helloworld/node_modules/code-point-at/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/code-point-at/readme.md b/helloworld/node_modules/code-point-at/readme.md new file mode 100755 index 0000000..4c97730 --- /dev/null +++ b/helloworld/node_modules/code-point-at/readme.md @@ -0,0 +1,32 @@ +# code-point-at [![Build Status](https://travis-ci.org/sindresorhus/code-point-at.svg?branch=master)](https://travis-ci.org/sindresorhus/code-point-at) + +> ES2015 [`String#codePointAt()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/String/codePointAt) [ponyfill](https://ponyfill.com) + + +## Install + +``` +$ npm install --save code-point-at +``` + + +## Usage + +```js +var codePointAt = require('code-point-at'); + +codePointAt('🐴'); +//=> 128052 + +codePointAt('abc', 2); +//=> 99 +``` + +## API + +### codePointAt(input, [position]) + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/helloworld/node_modules/component-bind/History.md b/helloworld/node_modules/component-bind/History.md new file mode 100755 index 0000000..2795fdb --- /dev/null +++ b/helloworld/node_modules/component-bind/History.md @@ -0,0 +1,13 @@ + +1.0.0 / 2014-05-27 +================== + + * index: use slice ref (#7, @viatropos) + * package: rename package to "component-bind" + * package: add "repository" field (#6, @repoify) + * package: add "component" section + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/helloworld/node_modules/component-bind/Makefile b/helloworld/node_modules/component-bind/Makefile new file mode 100755 index 0000000..4e9c8d3 --- /dev/null +++ b/helloworld/node_modules/component-bind/Makefile @@ -0,0 +1,7 @@ + +test: + @./node_modules/.bin/mocha \ + --require should \ + --reporter spec + +.PHONY: test \ No newline at end of file diff --git a/helloworld/node_modules/component-bind/Readme.md b/helloworld/node_modules/component-bind/Readme.md new file mode 100755 index 0000000..6a8febc --- /dev/null +++ b/helloworld/node_modules/component-bind/Readme.md @@ -0,0 +1,64 @@ +# bind + + Function binding utility. + +## Installation + +``` +$ component install component/bind +``` + +## API + + - [bind(obj, fn)](#bindobj-fn) + - [bind(obj, fn, ...)](#bindobj-fn-) + - [bind(obj, name)](#bindobj-name) + + + +### bind(obj, fn) +should bind the function to the given object. + +```js +var tobi = { name: 'tobi' }; + +function name() { + return this.name; +} + +var fn = bind(tobi, name); +fn().should.equal('tobi'); +``` + + +### bind(obj, fn, ...) +should curry the remaining arguments. + +```js +function add(a, b) { + return a + b; +} + +bind(null, add)(1, 2).should.equal(3); +bind(null, add, 1)(2).should.equal(3); +bind(null, add, 1, 2)().should.equal(3); +``` + + +### bind(obj, name) +should bind the method of the given name. + +```js +var tobi = { name: 'tobi' }; + +tobi.getName = function() { + return this.name; +}; + +var fn = bind(tobi, 'getName'); +fn().should.equal('tobi'); +``` + +## License + + MIT \ No newline at end of file diff --git a/helloworld/node_modules/component-bind/component.json b/helloworld/node_modules/component-bind/component.json new file mode 100755 index 0000000..4e1e93f --- /dev/null +++ b/helloworld/node_modules/component-bind/component.json @@ -0,0 +1,13 @@ +{ + "name": "bind", + "version": "1.0.0", + "description": "function binding utility", + "keywords": [ + "bind", + "utility" + ], + "dependencies": {}, + "scripts": [ + "index.js" + ] +} diff --git a/helloworld/node_modules/component-bind/index.js b/helloworld/node_modules/component-bind/index.js new file mode 100755 index 0000000..4eeb2c0 --- /dev/null +++ b/helloworld/node_modules/component-bind/index.js @@ -0,0 +1,23 @@ +/** + * Slice reference. + */ + +var slice = [].slice; + +/** + * Bind `obj` to `fn`. + * + * @param {Object} obj + * @param {Function|String} fn or string + * @return {Function} + * @api public + */ + +module.exports = function(obj, fn){ + if ('string' == typeof fn) fn = obj[fn]; + if ('function' != typeof fn) throw new Error('bind() requires a function'); + var args = slice.call(arguments, 2); + return function(){ + return fn.apply(obj, args.concat(slice.call(arguments))); + } +}; diff --git a/helloworld/node_modules/component-bind/package.json b/helloworld/node_modules/component-bind/package.json new file mode 100755 index 0000000..e8b537c --- /dev/null +++ b/helloworld/node_modules/component-bind/package.json @@ -0,0 +1,51 @@ +{ + "_from": "component-bind@1.0.0", + "_id": "component-bind@1.0.0", + "_inBundle": false, + "_integrity": "sha1-AMYIq33Nk4l8AAllGx06jh5zu9E=", + "_location": "/component-bind", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "component-bind@1.0.0", + "name": "component-bind", + "escapedName": "component-bind", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/socket.io-client" + ], + "_resolved": "https://registry.npmjs.org/component-bind/-/component-bind-1.0.0.tgz", + "_shasum": "00c608ab7dcd93897c0009651b1d3a8e1e73bbd1", + "_spec": "component-bind@1.0.0", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/socket.io-client", + "bugs": { + "url": "https://github.com/component/bind/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "bind/index.js": "index.js" + } + }, + "deprecated": false, + "description": "function binding utility", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "homepage": "https://github.com/component/bind#readme", + "keywords": [ + "bind", + "utility" + ], + "name": "component-bind", + "repository": { + "type": "git", + "url": "git+https://github.com/component/bind.git" + }, + "version": "1.0.0" +} diff --git a/helloworld/node_modules/component-emitter/History.md b/helloworld/node_modules/component-emitter/History.md new file mode 100755 index 0000000..9189c60 --- /dev/null +++ b/helloworld/node_modules/component-emitter/History.md @@ -0,0 +1,68 @@ + +1.2.1 / 2016-04-18 +================== + + * enable client side use + +1.2.0 / 2014-02-12 +================== + + * prefix events with `$` to support object prototype method names + +1.1.3 / 2014-06-20 +================== + + * republish for npm + * add LICENSE file + +1.1.2 / 2014-02-10 +================== + + * package: rename to "component-emitter" + * package: update "main" and "component" fields + * Add license to Readme (same format as the other components) + * created .npmignore + * travis stuff + +1.1.1 / 2013-12-01 +================== + + * fix .once adding .on to the listener + * docs: Emitter#off() + * component: add `.repo` prop + +1.1.0 / 2013-10-20 +================== + + * add `.addEventListener()` and `.removeEventListener()` aliases + +1.0.1 / 2013-06-27 +================== + + * add support for legacy ie + +1.0.0 / 2013-02-26 +================== + + * add `.off()` support for removing all listeners + +0.0.6 / 2012-10-08 +================== + + * add `this._callbacks` initialization to prevent funky gotcha + +0.0.5 / 2012-09-07 +================== + + * fix `Emitter.call(this)` usage + +0.0.3 / 2012-07-11 +================== + + * add `.listeners()` + * rename `.has()` to `.hasListeners()` + +0.0.2 / 2012-06-28 +================== + + * fix `.off()` with `.once()`-registered callbacks diff --git a/helloworld/node_modules/component-emitter/LICENSE b/helloworld/node_modules/component-emitter/LICENSE new file mode 100755 index 0000000..d6e43f2 --- /dev/null +++ b/helloworld/node_modules/component-emitter/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2014 Component contributors + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/component-emitter/Readme.md b/helloworld/node_modules/component-emitter/Readme.md new file mode 100755 index 0000000..0466411 --- /dev/null +++ b/helloworld/node_modules/component-emitter/Readme.md @@ -0,0 +1,74 @@ +# Emitter [![Build Status](https://travis-ci.org/component/emitter.png)](https://travis-ci.org/component/emitter) + + Event emitter component. + +## Installation + +``` +$ component install component/emitter +``` + +## API + +### Emitter(obj) + + The `Emitter` may also be used as a mixin. For example + a "plain" object may become an emitter, or you may + extend an existing prototype. + + As an `Emitter` instance: + +```js +var Emitter = require('emitter'); +var emitter = new Emitter; +emitter.emit('something'); +``` + + As a mixin: + +```js +var Emitter = require('emitter'); +var user = { name: 'tobi' }; +Emitter(user); + +user.emit('im a user'); +``` + + As a prototype mixin: + +```js +var Emitter = require('emitter'); +Emitter(User.prototype); +``` + +### Emitter#on(event, fn) + + Register an `event` handler `fn`. + +### Emitter#once(event, fn) + + Register a single-shot `event` handler `fn`, + removed immediately after it is invoked the + first time. + +### Emitter#off(event, fn) + + * Pass `event` and `fn` to remove a listener. + * Pass `event` to remove all listeners on that event. + * Pass nothing to remove all listeners on all events. + +### Emitter#emit(event, ...) + + Emit an `event` with variable option args. + +### Emitter#listeners(event) + + Return an array of callbacks, or an empty array. + +### Emitter#hasListeners(event) + + Check if this emitter has `event` handlers. + +## License + +MIT diff --git a/helloworld/node_modules/component-emitter/index.js b/helloworld/node_modules/component-emitter/index.js new file mode 100755 index 0000000..df94c78 --- /dev/null +++ b/helloworld/node_modules/component-emitter/index.js @@ -0,0 +1,163 @@ + +/** + * Expose `Emitter`. + */ + +if (typeof module !== 'undefined') { + module.exports = Emitter; +} + +/** + * Initialize a new `Emitter`. + * + * @api public + */ + +function Emitter(obj) { + if (obj) return mixin(obj); +}; + +/** + * Mixin the emitter properties. + * + * @param {Object} obj + * @return {Object} + * @api private + */ + +function mixin(obj) { + for (var key in Emitter.prototype) { + obj[key] = Emitter.prototype[key]; + } + return obj; +} + +/** + * Listen on the given `event` with `fn`. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + +Emitter.prototype.on = +Emitter.prototype.addEventListener = function(event, fn){ + this._callbacks = this._callbacks || {}; + (this._callbacks['$' + event] = this._callbacks['$' + event] || []) + .push(fn); + return this; +}; + +/** + * Adds an `event` listener that will be invoked a single + * time then automatically removed. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + +Emitter.prototype.once = function(event, fn){ + function on() { + this.off(event, on); + fn.apply(this, arguments); + } + + on.fn = fn; + this.on(event, on); + return this; +}; + +/** + * Remove the given callback for `event` or all + * registered callbacks. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + +Emitter.prototype.off = +Emitter.prototype.removeListener = +Emitter.prototype.removeAllListeners = +Emitter.prototype.removeEventListener = function(event, fn){ + this._callbacks = this._callbacks || {}; + + // all + if (0 == arguments.length) { + this._callbacks = {}; + return this; + } + + // specific event + var callbacks = this._callbacks['$' + event]; + if (!callbacks) return this; + + // remove all handlers + if (1 == arguments.length) { + delete this._callbacks['$' + event]; + return this; + } + + // remove specific handler + var cb; + for (var i = 0; i < callbacks.length; i++) { + cb = callbacks[i]; + if (cb === fn || cb.fn === fn) { + callbacks.splice(i, 1); + break; + } + } + return this; +}; + +/** + * Emit `event` with the given args. + * + * @param {String} event + * @param {Mixed} ... + * @return {Emitter} + */ + +Emitter.prototype.emit = function(event){ + this._callbacks = this._callbacks || {}; + var args = [].slice.call(arguments, 1) + , callbacks = this._callbacks['$' + event]; + + if (callbacks) { + callbacks = callbacks.slice(0); + for (var i = 0, len = callbacks.length; i < len; ++i) { + callbacks[i].apply(this, args); + } + } + + return this; +}; + +/** + * Return array of callbacks for `event`. + * + * @param {String} event + * @return {Array} + * @api public + */ + +Emitter.prototype.listeners = function(event){ + this._callbacks = this._callbacks || {}; + return this._callbacks['$' + event] || []; +}; + +/** + * Check if this emitter has `event` handlers. + * + * @param {String} event + * @return {Boolean} + * @api public + */ + +Emitter.prototype.hasListeners = function(event){ + return !! this.listeners(event).length; +}; diff --git a/helloworld/node_modules/component-inherit/History.md b/helloworld/node_modules/component-inherit/History.md new file mode 100755 index 0000000..22d87e1 --- /dev/null +++ b/helloworld/node_modules/component-inherit/History.md @@ -0,0 +1,5 @@ + +0.0.2 / 2012-09-03 +================== + + * fix typo in package.json diff --git a/helloworld/node_modules/component-inherit/Makefile b/helloworld/node_modules/component-inherit/Makefile new file mode 100755 index 0000000..ebbc52a --- /dev/null +++ b/helloworld/node_modules/component-inherit/Makefile @@ -0,0 +1,16 @@ + +build: components index.js + @component build + +components: + @Component install + +clean: + rm -fr build components template.js + +test: + @node_modules/.bin/mocha \ + --require should \ + --reporter spec + +.PHONY: clean test diff --git a/helloworld/node_modules/component-inherit/Readme.md b/helloworld/node_modules/component-inherit/Readme.md new file mode 100755 index 0000000..f03ab27 --- /dev/null +++ b/helloworld/node_modules/component-inherit/Readme.md @@ -0,0 +1,24 @@ +# inherit + + Prototype inheritance utility. + +## Installation + +``` +$ component install component/inherit +``` + +## Example + +```js +var inherit = require('inherit'); + +function Human() {} +function Woman() {} + +inherit(Woman, Human); +``` + +## License + + MIT diff --git a/helloworld/node_modules/component-inherit/component.json b/helloworld/node_modules/component-inherit/component.json new file mode 100755 index 0000000..ae57747 --- /dev/null +++ b/helloworld/node_modules/component-inherit/component.json @@ -0,0 +1,10 @@ +{ + "name": "inherit", + "description": "Prototype inheritance utility", + "version": "0.0.3", + "keywords": ["inherit", "utility"], + "dependencies": {}, + "scripts": [ + "index.js" + ] +} diff --git a/helloworld/node_modules/component-inherit/index.js b/helloworld/node_modules/component-inherit/index.js new file mode 100755 index 0000000..aaebc03 --- /dev/null +++ b/helloworld/node_modules/component-inherit/index.js @@ -0,0 +1,7 @@ + +module.exports = function(a, b){ + var fn = function(){}; + fn.prototype = b.prototype; + a.prototype = new fn; + a.prototype.constructor = a; +}; \ No newline at end of file diff --git a/helloworld/node_modules/component-inherit/package.json b/helloworld/node_modules/component-inherit/package.json new file mode 100755 index 0000000..bef693e --- /dev/null +++ b/helloworld/node_modules/component-inherit/package.json @@ -0,0 +1,48 @@ +{ + "_from": "component-inherit@0.0.3", + "_id": "component-inherit@0.0.3", + "_inBundle": false, + "_integrity": "sha1-ZF/ErfWLcrZJ1crmUTVhnbJv8UM=", + "_location": "/component-inherit", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "component-inherit@0.0.3", + "name": "component-inherit", + "escapedName": "component-inherit", + "rawSpec": "0.0.3", + "saveSpec": null, + "fetchSpec": "0.0.3" + }, + "_requiredBy": [ + "/engine.io-client" + ], + "_resolved": "https://registry.npmjs.org/component-inherit/-/component-inherit-0.0.3.tgz", + "_shasum": "645fc4adf58b72b649d5cae65135619db26ff143", + "_spec": "component-inherit@0.0.3", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/engine.io-client", + "bugs": { + "url": "https://github.com/component/inherit/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "inherit/index.js": "index.js" + } + }, + "dependencies": {}, + "deprecated": false, + "description": "Prototype inheritance utility", + "homepage": "https://github.com/component/inherit#readme", + "keywords": [ + "inherit", + "utility" + ], + "name": "component-inherit", + "repository": { + "type": "git", + "url": "git+https://github.com/component/inherit.git" + }, + "version": "0.0.3" +} diff --git a/helloworld/node_modules/component-inherit/test/inherit.js b/helloworld/node_modules/component-inherit/test/inherit.js new file mode 100755 index 0000000..14852f2 --- /dev/null +++ b/helloworld/node_modules/component-inherit/test/inherit.js @@ -0,0 +1,21 @@ + +/** + * Module dependencies. + */ + +var inherit = require('..'); + +describe('inherit(a, b)', function(){ + it('should inherit b\'s prototype', function(){ + function Loki(){} + function Animal(){} + + Animal.prototype.species = 'unknown'; + + inherit(Loki, Animal); + + var loki = new Loki; + loki.species.should.equal('unknown'); + loki.constructor.should.equal(Loki); + }) +}) \ No newline at end of file diff --git a/helloworld/node_modules/cookie/HISTORY.md b/helloworld/node_modules/cookie/HISTORY.md new file mode 100755 index 0000000..5bd6485 --- /dev/null +++ b/helloworld/node_modules/cookie/HISTORY.md @@ -0,0 +1,118 @@ +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/helloworld/node_modules/cookie/LICENSE b/helloworld/node_modules/cookie/LICENSE new file mode 100755 index 0000000..058b6b4 --- /dev/null +++ b/helloworld/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/helloworld/node_modules/cookie/README.md b/helloworld/node_modules/cookie/README.md new file mode 100755 index 0000000..db0d078 --- /dev/null +++ b/helloworld/node_modules/cookie/README.md @@ -0,0 +1,220 @@ +# cookie + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6266-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `ecodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6266-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6266-5.3] states that if both `expires` and +`magAge` are set, then `maxAge` takes precedence, but it is possiblke not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6266-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6266-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6266-5.3] states that if both `expires` and +`magAge` are set, then `maxAge` takes precedence, but it is possiblke not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6266-5.2.4]. By default, the path +is considered the ["default path"][rfc-6266-5.1.4]. By default, no maximum age is set, and most +clients will consider this a "non-persistent cookie" and will delete it on a condition like exiting +a web browser application. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][draft-west-first-party-cookies-07]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in the specification +https://tools.ietf.org/html/draft-west-first-party-cookies-07#section-4.1.1 + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6266-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end(' values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var pairs = str.split(pairSplitRegExp); + var dec = opt.decode || decode; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + var eq_idx = pair.indexOf('='); + + // skip things that don't look like key=value + if (eq_idx < 0) { + continue; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + obj[key] = tryDecode(val, dec); + } + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + if (isNaN(maxAge)) throw new Error('maxAge should be a Number'); + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + if (typeof opt.expires.toUTCString !== 'function') { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + opt.expires.toUTCString(); + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/helloworld/node_modules/debug/CHANGELOG.md b/helloworld/node_modules/debug/CHANGELOG.md new file mode 100755 index 0000000..820d21e --- /dev/null +++ b/helloworld/node_modules/debug/CHANGELOG.md @@ -0,0 +1,395 @@ + +3.1.0 / 2017-09-26 +================== + + * Add `DEBUG_HIDE_DATE` env var (#486) + * Remove ReDoS regexp in %o formatter (#504) + * Remove "component" from package.json + * Remove `component.json` + * Ignore package-lock.json + * Examples: fix colors printout + * Fix: browser detection + * Fix: spelling mistake (#496, @EdwardBetts) + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/helloworld/node_modules/debug/LICENSE b/helloworld/node_modules/debug/LICENSE new file mode 100755 index 0000000..658c933 --- /dev/null +++ b/helloworld/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/helloworld/node_modules/debug/README.md b/helloworld/node_modules/debug/README.md new file mode 100755 index 0000000..88dae35 --- /dev/null +++ b/helloworld/node_modules/debug/README.md @@ -0,0 +1,455 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/debug/dist/debug.js b/helloworld/node_modules/debug/dist/debug.js new file mode 100755 index 0000000..89ad0c2 --- /dev/null +++ b/helloworld/node_modules/debug/dist/debug.js @@ -0,0 +1,912 @@ +"use strict"; + +function _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _nonIterableSpread(); } + +function _nonIterableSpread() { throw new TypeError("Invalid attempt to spread non-iterable instance"); } + +function _iterableToArray(iter) { if (Symbol.iterator in Object(iter) || Object.prototype.toString.call(iter) === "[object Arguments]") return Array.from(iter); } + +function _arrayWithoutHoles(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = new Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } } + +function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); } + +(function (f) { + if ((typeof exports === "undefined" ? "undefined" : _typeof(exports)) === "object" && typeof module !== "undefined") { + module.exports = f(); + } else if (typeof define === "function" && define.amd) { + define([], f); + } else { + var g; + + if (typeof window !== "undefined") { + g = window; + } else if (typeof global !== "undefined") { + g = global; + } else if (typeof self !== "undefined") { + g = self; + } else { + g = this; + } + + g.debug = f(); + } +})(function () { + var define, module, exports; + return function () { + function r(e, n, t) { + function o(i, f) { + if (!n[i]) { + if (!e[i]) { + var c = "function" == typeof require && require; + if (!f && c) return c(i, !0); + if (u) return u(i, !0); + var a = new Error("Cannot find module '" + i + "'"); + throw a.code = "MODULE_NOT_FOUND", a; + } + + var p = n[i] = { + exports: {} + }; + e[i][0].call(p.exports, function (r) { + var n = e[i][1][r]; + return o(n || r); + }, p, p.exports, r, e, n, t); + } + + return n[i].exports; + } + + for (var u = "function" == typeof require && require, i = 0; i < t.length; i++) { + o(t[i]); + } + + return o; + } + + return r; + }()({ + 1: [function (require, module, exports) { + /** + * Helpers. + */ + var s = 1000; + var m = s * 60; + var h = m * 60; + var d = h * 24; + var w = d * 7; + var y = d * 365.25; + /** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + + module.exports = function (val, options) { + options = options || {}; + + var type = _typeof(val); + + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + + throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val)); + }; + /** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + + + function parse(str) { + str = String(str); + + if (str.length > 100) { + return; + } + + var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(str); + + if (!match) { + return; + } + + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + + case 'weeks': + case 'week': + case 'w': + return n * w; + + case 'days': + case 'day': + case 'd': + return n * d; + + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + + default: + return undefined; + } + } + /** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + + + function fmtShort(ms) { + var msAbs = Math.abs(ms); + + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + + return ms + 'ms'; + } + /** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + + + function fmtLong(ms) { + var msAbs = Math.abs(ms); + + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + + return ms + ' ms'; + } + /** + * Pluralization helper. + */ + + + function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); + } + }, {}], + 2: [function (require, module, exports) { + // shim for using process in browser + var process = module.exports = {}; // cached from whatever global is present so that test runners that stub it + // don't break things. But we need to wrap it in a try catch in case it is + // wrapped in strict mode code which doesn't define any globals. It's inside a + // function because try/catches deoptimize in certain engines. + + var cachedSetTimeout; + var cachedClearTimeout; + + function defaultSetTimout() { + throw new Error('setTimeout has not been defined'); + } + + function defaultClearTimeout() { + throw new Error('clearTimeout has not been defined'); + } + + (function () { + try { + if (typeof setTimeout === 'function') { + cachedSetTimeout = setTimeout; + } else { + cachedSetTimeout = defaultSetTimout; + } + } catch (e) { + cachedSetTimeout = defaultSetTimout; + } + + try { + if (typeof clearTimeout === 'function') { + cachedClearTimeout = clearTimeout; + } else { + cachedClearTimeout = defaultClearTimeout; + } + } catch (e) { + cachedClearTimeout = defaultClearTimeout; + } + })(); + + function runTimeout(fun) { + if (cachedSetTimeout === setTimeout) { + //normal enviroments in sane situations + return setTimeout(fun, 0); + } // if setTimeout wasn't available but was latter defined + + + if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) { + cachedSetTimeout = setTimeout; + return setTimeout(fun, 0); + } + + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedSetTimeout(fun, 0); + } catch (e) { + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedSetTimeout.call(null, fun, 0); + } catch (e) { + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error + return cachedSetTimeout.call(this, fun, 0); + } + } + } + + function runClearTimeout(marker) { + if (cachedClearTimeout === clearTimeout) { + //normal enviroments in sane situations + return clearTimeout(marker); + } // if clearTimeout wasn't available but was latter defined + + + if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) { + cachedClearTimeout = clearTimeout; + return clearTimeout(marker); + } + + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedClearTimeout(marker); + } catch (e) { + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedClearTimeout.call(null, marker); + } catch (e) { + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error. + // Some versions of I.E. have different rules for clearTimeout vs setTimeout + return cachedClearTimeout.call(this, marker); + } + } + } + + var queue = []; + var draining = false; + var currentQueue; + var queueIndex = -1; + + function cleanUpNextTick() { + if (!draining || !currentQueue) { + return; + } + + draining = false; + + if (currentQueue.length) { + queue = currentQueue.concat(queue); + } else { + queueIndex = -1; + } + + if (queue.length) { + drainQueue(); + } + } + + function drainQueue() { + if (draining) { + return; + } + + var timeout = runTimeout(cleanUpNextTick); + draining = true; + var len = queue.length; + + while (len) { + currentQueue = queue; + queue = []; + + while (++queueIndex < len) { + if (currentQueue) { + currentQueue[queueIndex].run(); + } + } + + queueIndex = -1; + len = queue.length; + } + + currentQueue = null; + draining = false; + runClearTimeout(timeout); + } + + process.nextTick = function (fun) { + var args = new Array(arguments.length - 1); + + if (arguments.length > 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + + queue.push(new Item(fun, args)); + + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } + }; // v8 likes predictible objects + + + function Item(fun, array) { + this.fun = fun; + this.array = array; + } + + Item.prototype.run = function () { + this.fun.apply(null, this.array); + }; + + process.title = 'browser'; + process.browser = true; + process.env = {}; + process.argv = []; + process.version = ''; // empty string to avoid regexp issues + + process.versions = {}; + + function noop() {} + + process.on = noop; + process.addListener = noop; + process.once = noop; + process.off = noop; + process.removeListener = noop; + process.removeAllListeners = noop; + process.emit = noop; + process.prependListener = noop; + process.prependOnceListener = noop; + + process.listeners = function (name) { + return []; + }; + + process.binding = function (name) { + throw new Error('process.binding is not supported'); + }; + + process.cwd = function () { + return '/'; + }; + + process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); + }; + + process.umask = function () { + return 0; + }; + }, {}], + 3: [function (require, module, exports) { + /** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + Object.keys(env).forEach(function (key) { + createDebug[key] = env[key]; + }); + /** + * Active `debug` instances. + */ + + createDebug.instances = []; + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + + createDebug.formatters = {}; + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + + function selectColor(namespace) { + var hash = 0; + + for (var i = 0; i < namespace.length; i++) { + hash = (hash << 5) - hash + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + + createDebug.selectColor = selectColor; + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + + function createDebug(namespace) { + var prevTime; + + function debug() { + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } + + // Disabled? + if (!debug.enabled) { + return; + } + + var self = debug; // Set `diff` timestamp + + var curr = Number(new Date()); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } // Apply any `formatters` transformations + + + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return match; + } + + index++; + var formatter = createDebug.formatters[format]; + + if (typeof formatter === 'function') { + var val = args[index]; + match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format` + + args.splice(index, 1); + index--; + } + + return match; + }); // Apply env-specific formatting (colors, etc.) + + createDebug.formatArgs.call(self, args); + var logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = createDebug.enabled(namespace); + debug.useColors = createDebug.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + debug.extend = extend; // Debug.formatArgs = formatArgs; + // debug.rawLog = rawLog; + // env-specific initialization logic for debug instances + + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + createDebug.instances.push(debug); + return debug; + } + + function destroy() { + var index = createDebug.instances.indexOf(this); + + if (index !== -1) { + createDebug.instances.splice(index, 1); + return true; + } + + return false; + } + + function extend(namespace, delimiter) { + var newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + + + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.names = []; + createDebug.skips = []; + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < createDebug.instances.length; i++) { + var instance = createDebug.instances[i]; + instance.enabled = createDebug.enabled(instance.namespace); + } + } + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + + + function disable() { + var namespaces = [].concat(_toConsumableArray(createDebug.names.map(toNamespace)), _toConsumableArray(createDebug.skips.map(toNamespace).map(function (namespace) { + return '-' + namespace; + }))).join(','); + createDebug.enable(''); + return namespaces; + } + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + + + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + var i; + var len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + + + function toNamespace(regexp) { + return regexp.toString().substring(2, regexp.toString().length - 2).replace(/\.\*\?$/, '*'); + } + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + + + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + + return val; + } + + createDebug.enable(createDebug.load()); + return createDebug; + } + + module.exports = setup; + }, { + "ms": 1 + }], + 4: [function (require, module, exports) { + (function (process) { + /* eslint-env browser */ + + /** + * This is the web browser implementation of `debug()`. + */ + exports.log = log; + exports.formatArgs = formatArgs; + exports.save = save; + exports.load = load; + exports.useColors = useColors; + exports.storage = localstorage(); + /** + * Colors. + */ + + exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33']; + /** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + // eslint-disable-next-line complexity + + function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } // Internet Explorer and Edge do not support colors. + + + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + + + return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773 + typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker + typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/); + } + /** + * Colorize log arguments if enabled. + * + * @api public + */ + + + function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function (match) { + if (match === '%%') { + return; + } + + index++; + + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + args.splice(lastC, 0, c); + } + /** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + + + function log() { + var _console; + + // This hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments); + } + /** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + + + function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) {// Swallow + // XXX (@Qix-) should we be logging these? + } + } + /** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + + + function load() { + var r; + + try { + r = exports.storage.getItem('debug'); + } catch (error) {} // Swallow + // XXX (@Qix-) should we be logging these? + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + + + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; + } + /** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + + + function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) {// Swallow + // XXX (@Qix-) should we be logging these? + } + } + + module.exports = require('./common')(exports); + var formatters = module.exports.formatters; + /** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + + formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } + }; + }).call(this, require('_process')); + }, { + "./common": 3, + "_process": 2 + }] + }, {}, [4])(4); +}); diff --git a/helloworld/node_modules/debug/src/browser.js b/helloworld/node_modules/debug/src/browser.js new file mode 100755 index 0000000..5f34c0d --- /dev/null +++ b/helloworld/node_modules/debug/src/browser.js @@ -0,0 +1,264 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ +function log(...args) { + // This hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return typeof console === 'object' && + console.log && + console.log(...args); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/helloworld/node_modules/debug/src/common.js b/helloworld/node_modules/debug/src/common.js new file mode 100755 index 0000000..2f82b8d --- /dev/null +++ b/helloworld/node_modules/debug/src/common.js @@ -0,0 +1,266 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * Active `debug` instances. + */ + createDebug.instances = []; + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return match; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = createDebug.enabled(namespace); + debug.useColors = createDebug.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + debug.extend = extend; + // Debug.formatArgs = formatArgs; + // debug.rawLog = rawLog; + + // env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + createDebug.instances.push(debug); + + return debug; + } + + function destroy() { + const index = createDebug.instances.indexOf(this); + if (index !== -1) { + createDebug.instances.splice(index, 1); + return true; + } + return false; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + + createDebug.names = []; + createDebug.skips = []; + + let i; + const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + const len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < createDebug.instances.length; i++) { + const instance = createDebug.instances[i]; + instance.enabled = createDebug.enabled(instance.namespace); + } + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names.map(toNamespace), + ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + let i; + let len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + function toNamespace(regexp) { + return regexp.toString() + .substring(2, regexp.toString().length - 2) + .replace(/\.\*\?$/, '*'); + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/helloworld/node_modules/debug/src/index.js b/helloworld/node_modules/debug/src/index.js new file mode 100755 index 0000000..bf4c57f --- /dev/null +++ b/helloworld/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/helloworld/node_modules/debug/src/node.js b/helloworld/node_modules/debug/src/node.js new file mode 100755 index 0000000..5e1f154 --- /dev/null +++ b/helloworld/node_modules/debug/src/node.js @@ -0,0 +1,257 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.format(...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/helloworld/node_modules/decamelize/index.js b/helloworld/node_modules/decamelize/index.js new file mode 100755 index 0000000..8d5bab7 --- /dev/null +++ b/helloworld/node_modules/decamelize/index.js @@ -0,0 +1,13 @@ +'use strict'; +module.exports = function (str, sep) { + if (typeof str !== 'string') { + throw new TypeError('Expected a string'); + } + + sep = typeof sep === 'undefined' ? '_' : sep; + + return str + .replace(/([a-z\d])([A-Z])/g, '$1' + sep + '$2') + .replace(/([A-Z]+)([A-Z][a-z\d]+)/g, '$1' + sep + '$2') + .toLowerCase(); +}; diff --git a/helloworld/node_modules/decamelize/license b/helloworld/node_modules/decamelize/license new file mode 100755 index 0000000..654d0bf --- /dev/null +++ b/helloworld/node_modules/decamelize/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/decamelize/readme.md b/helloworld/node_modules/decamelize/readme.md new file mode 100755 index 0000000..624c7ee --- /dev/null +++ b/helloworld/node_modules/decamelize/readme.md @@ -0,0 +1,48 @@ +# decamelize [![Build Status](https://travis-ci.org/sindresorhus/decamelize.svg?branch=master)](https://travis-ci.org/sindresorhus/decamelize) + +> Convert a camelized string into a lowercased one with a custom separator
+> Example: `unicornRainbow` → `unicorn_rainbow` + + +## Install + +``` +$ npm install --save decamelize +``` + + +## Usage + +```js +const decamelize = require('decamelize'); + +decamelize('unicornRainbow'); +//=> 'unicorn_rainbow' + +decamelize('unicornRainbow', '-'); +//=> 'unicorn-rainbow' +``` + + +## API + +### decamelize(input, [separator]) + +#### input + +Type: `string` + +#### separator + +Type: `string`
+Default: `_` + + +## Related + +See [`camelcase`](https://github.com/sindresorhus/camelcase) for the inverse. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/helloworld/node_modules/decompress-response/index.js b/helloworld/node_modules/decompress-response/index.js new file mode 100755 index 0000000..d8acd4a --- /dev/null +++ b/helloworld/node_modules/decompress-response/index.js @@ -0,0 +1,29 @@ +'use strict'; +const PassThrough = require('stream').PassThrough; +const zlib = require('zlib'); +const mimicResponse = require('mimic-response'); + +module.exports = response => { + // TODO: Use Array#includes when targeting Node.js 6 + if (['gzip', 'deflate'].indexOf(response.headers['content-encoding']) === -1) { + return response; + } + + const unzip = zlib.createUnzip(); + const stream = new PassThrough(); + + mimicResponse(response, stream); + + unzip.on('error', err => { + if (err.code === 'Z_BUF_ERROR') { + stream.end(); + return; + } + + stream.emit('error', err); + }); + + response.pipe(unzip).pipe(stream); + + return stream; +}; diff --git a/helloworld/node_modules/decompress-response/license b/helloworld/node_modules/decompress-response/license new file mode 100755 index 0000000..32a16ce --- /dev/null +++ b/helloworld/node_modules/decompress-response/license @@ -0,0 +1,21 @@ +`The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/decompress-response/readme.md b/helloworld/node_modules/decompress-response/readme.md new file mode 100755 index 0000000..1b98767 --- /dev/null +++ b/helloworld/node_modules/decompress-response/readme.md @@ -0,0 +1,31 @@ +# decompress-response [![Build Status](https://travis-ci.org/sindresorhus/decompress-response.svg?branch=master)](https://travis-ci.org/sindresorhus/decompress-response) + +> Decompress a HTTP response if needed + +Decompresses the [response](https://nodejs.org/api/http.html#http_class_http_incomingmessage) from [`http.request`](https://nodejs.org/api/http.html#http_http_request_options_callback) if it's gzipped or deflated, otherwise just passes it through. + +Used by [`got`](https://github.com/sindresorhus/got). + + +## Install + +``` +$ npm install decompress-response +``` + + +## Usage + +```js +const http = require('http'); +const decompressResponse = require('decompress-response'); + +http.get('http://sindresorhus.com', response => { + response = decompressResponse(response); +}); +``` + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/helloworld/node_modules/defer-to-connect/LICENSE b/helloworld/node_modules/defer-to-connect/LICENSE new file mode 100755 index 0000000..20c551b --- /dev/null +++ b/helloworld/node_modules/defer-to-connect/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Szymon Marczak + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/helloworld/node_modules/defer-to-connect/README.md b/helloworld/node_modules/defer-to-connect/README.md new file mode 100755 index 0000000..323e645 --- /dev/null +++ b/helloworld/node_modules/defer-to-connect/README.md @@ -0,0 +1,26 @@ +# defer-to-connect + +> The safe way to handle the `connect` socket event + +Once you receive the socket, it may be already connected.
+To avoid checking that, use `defer-to-connect`. It'll do that for you. + +## Usage + +```js +const deferToConnect = require('defer-to-connect'); + +deferToConnect(socket, () => { + console.log('Connected!'); +}); +``` + +## API + +### deferToConnect(socket, fn) + +Calls `fn()` when connected. + +## License + +MIT diff --git a/helloworld/node_modules/defer-to-connect/index.js b/helloworld/node_modules/defer-to-connect/index.js new file mode 100755 index 0000000..9f3b9dc --- /dev/null +++ b/helloworld/node_modules/defer-to-connect/index.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = (socket, callback) => { + if (socket.writable && !socket.connecting) { + callback(); + } else { + socket.once('connect', callback); + } +}; diff --git a/helloworld/node_modules/defer-to-connect/package.json b/helloworld/node_modules/defer-to-connect/package.json new file mode 100755 index 0000000..849abe7 --- /dev/null +++ b/helloworld/node_modules/defer-to-connect/package.json @@ -0,0 +1,51 @@ +{ + "_from": "defer-to-connect@^1.0.1", + "_id": "defer-to-connect@1.0.2", + "_inBundle": false, + "_integrity": "sha512-k09hcQcTDY+cwgiwa6PYKLm3jlagNzQ+RSvhjzESOGOx+MNOuXkxTfEvPrO1IOQ81tArCFYQgi631clB70RpQw==", + "_location": "/defer-to-connect", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "defer-to-connect@^1.0.1", + "name": "defer-to-connect", + "escapedName": "defer-to-connect", + "rawSpec": "^1.0.1", + "saveSpec": null, + "fetchSpec": "^1.0.1" + }, + "_requiredBy": [ + "/@szmarczak/http-timer" + ], + "_resolved": "https://registry.npmjs.org/defer-to-connect/-/defer-to-connect-1.0.2.tgz", + "_shasum": "4bae758a314b034ae33902b5aac25a8dd6a8633e", + "_spec": "defer-to-connect@^1.0.1", + "_where": "/home/devesh/Desktop/pavanSinghal/node_modules/@szmarczak/http-timer", + "author": { + "name": "Szymon Marczak" + }, + "bugs": { + "url": "https://github.com/szmarczak/defer-to-connect/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "The safe way to handle the `connect` socket event", + "homepage": "https://github.com/szmarczak/defer-to-connect#readme", + "keywords": [ + "socket", + "connect", + "event" + ], + "license": "MIT", + "main": "index.js", + "name": "defer-to-connect", + "repository": { + "type": "git", + "url": "git+https://github.com/szmarczak/defer-to-connect.git" + }, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "version": "1.0.2" +} diff --git a/helloworld/node_modules/dns-packet/CHANGELOG.md b/helloworld/node_modules/dns-packet/CHANGELOG.md new file mode 100755 index 0000000..6b714e0 --- /dev/null +++ b/helloworld/node_modules/dns-packet/CHANGELOG.md @@ -0,0 +1,30 @@ +# Version 5.2.0 - 2019-02-21 + +- Feature: Added support for de/encoding certain OPT options. + +# Version 5.1.0 - 2019-01-22 + +- Feature: Added support for the RP record type. + +# Version 5.0.0 - 2018-06-01 + +- Breaking: Node.js 6.0.0 or greater is now required. +- Feature: Added support for DNSSEC record types. + +# Version 4.1.0 - 2018-02-11 + +- Feature: Added support for the MX record type. + +# Version 4.0.0 - 2018-02-04 + +- Feature: Added `streamEncode` and `streamDecode` methods for encoding TCP packets. +- Breaking: Changed the decoded value of TXT records to an array of Buffers. This is to accomodate DNS-SD records which rely on the individual strings record being separated. +- Breaking: Renamed the `flag_trunc` and `flag_auth` to `flag_tc` and `flag_aa` to match the names of these in the dns standards. + +# Version 3.0.0 - 2018-01-12 + +- Breaking: The `class` option has been changed from integer to string. + +# Version 2.0.0 - 2018-01-11 + +- Breaking: Converted module to ES2015, now requires Node.js 4.0 or greater diff --git a/helloworld/node_modules/dns-packet/LICENSE b/helloworld/node_modules/dns-packet/LICENSE new file mode 100755 index 0000000..bae9da7 --- /dev/null +++ b/helloworld/node_modules/dns-packet/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Mathias Buus + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/dns-packet/README.md b/helloworld/node_modules/dns-packet/README.md new file mode 100755 index 0000000..2a729b3 --- /dev/null +++ b/helloworld/node_modules/dns-packet/README.md @@ -0,0 +1,365 @@ +# dns-packet +[![](https://img.shields.io/npm/v/dns-packet.svg?style=flat)](https://www.npmjs.org/package/dns-packet) [![](https://img.shields.io/npm/dm/dns-packet.svg)](https://www.npmjs.org/package/dns-packet) [![](https://api.travis-ci.org/mafintosh/dns-packet.svg?style=flat)](https://travis-ci.org/mafintosh/dns-packet) [![Coverage Status](https://coveralls.io/repos/github/mafintosh/dns-packet/badge.svg?branch=master)](https://coveralls.io/github/mafintosh/dns-packet?branch=master) + +An [abstract-encoding](https://github.com/mafintosh/abstract-encoding) compliant module for encoding / decoding DNS packets. Lifted out of [multicast-dns](https://github.com/mafintosh/multicast-dns) as a separate module. + +``` +npm install dns-packet +``` + +## UDP Usage + +``` js +const dnsPacket = require('dns-packet') +const dgram = require('dgram') + +const socket = dgram.createSocket('udp4') + +const buf = dnsPacket.encode({ + type: 'query', + id: 1, + flags: dnsPacket.RECURSION_DESIRED, + questions: [{ + type: 'A', + name: 'google.com' + }] +}) + +socket.on('message', message => { + console.log(dnsPacket.decode(message)) // prints out a response from google dns +}) + +socket.send(buf, 0, buf.length, 53, '8.8.8.8') +``` + +Also see [the UDP example](examples/udp.js). + +## TCP, TLS, HTTPS + +While DNS has traditionally been used over a datagram transport, it is increasingly being carried over TCP for larger responses commonly including DNSSEC responses and TLS or HTTPS for enhanced security. See below examples on how to use `dns-packet` to wrap DNS packets in these protocols: + +- [TCP](examples/tcp.js) +- [DNS over TLS](examples/tls.js) +- [DNS over HTTPS](examples/doh.js) + +## API + +#### `var buf = packets.encode(packet, [buf], [offset])` + +Encodes a DNS packet into a buffer containing a UDP payload. + +#### `var packet = packets.decode(buf, [offset])` + +Decode a DNS packet from a buffer containing a UDP payload. + +#### `var buf = packets.streamEncode(packet, [buf], [offset])` + +Encodes a DNS packet into a buffer containing a TCP payload. + +#### `var packet = packets.streamDecode(buf, [offset])` + +Decode a DNS packet from a buffer containing a TCP payload. + +#### `var len = packets.encodingLength(packet)` + +Returns how many bytes are needed to encode the DNS packet + +## Packets + +Packets look like this + +``` js +{ + type: 'query|response', + id: optionalIdNumber, + flags: optionalBitFlags, + questions: [...], + answers: [...], + additionals: [...], + authorities: [...] +} +``` + +The bit flags available are + +``` js +packet.RECURSION_DESIRED +packet.RECURSION_AVAILABLE +packet.TRUNCATED_RESPONSE +packet.AUTHORITATIVE_ANSWER +packet.AUTHENTIC_DATA +packet.CHECKING_DISABLED +``` + +To use more than one flag bitwise-or them together + +``` js +var flags = packet.RECURSION_DESIRED | packet.RECURSION_AVAILABLE +``` + +And to check for a flag use bitwise-and + +``` js +var isRecursive = message.flags & packet.RECURSION_DESIRED +``` + +A question looks like this + +``` js +{ + type: 'A', // or SRV, AAAA, etc + class: 'IN', // one of IN, CS, CH, HS, ANY. Default: IN + name: 'google.com' // which record are you looking for +} +``` + +And an answer, additional, or authority looks like this + +``` js +{ + type: 'A', // or SRV, AAAA, etc + class: 'IN', // one of IN, CS, CH, HS + name: 'google.com', // which name is this record for + ttl: optionalTimeToLiveInSeconds, + (record specific data, see below) +} +``` + +## Supported record types + +#### `A` + +``` js +{ + data: 'IPv4 address' // fx 127.0.0.1 +} +``` + +#### `AAAA` + +``` js +{ + data: 'IPv6 address' // fx fe80::1 +} +``` + +#### `CAA` + +``` js +{ + flags: 128, // octet + tag: 'issue|issuewild|iodef', + value: 'ca.example.net', + issuerCritical: false +} +``` + +#### `CNAME` + +``` js +{ + data: 'cname.to.another.record' +} +``` + +#### `DNAME` + +``` js +{ + data: 'dname.to.another.record' +} +``` + +#### `DNSKEY` + +``` js +{ + flags: 257, // 16 bits + algorithm: 1, // octet + key: Buffer +} +``` + +#### `DS` + +``` js +{ + keyTag: 12345, + algorithm: 8, + digestType: 1, + digest: Buffer +} +``` + +#### `HINFO` + +``` js +{ + data: { + cpu: 'cpu info', + os: 'os info' + } +} +``` + +#### `MX` + +``` js +{ + preference: 10, + exchange: 'mail.example.net' +} +``` + +#### `NS` + +``` js +{ + data: nameServer +} +``` + +#### `NSEC` + +``` js +{ + nextDomain: 'a.domain', + rrtypes: ['A', 'TXT', 'RRSIG'] +} +``` + +#### `NSEC3` + +``` js +{ + algorithm: 1, + flags: 0, + iterations: 2, + salt: Buffer, + nextDomain: Buffer, // Hashed per RFC5155 + rrtypes: ['A', 'TXT', 'RRSIG'] +} +``` + +#### `NULL` + +``` js +{ + data: Buffer('any binary data') +} +``` + +#### `OPT` + +[EDNS0](https://tools.ietf.org/html/rfc6891) options. + +``` js +{ + type: 'OPT', + name: '.', + udpPayloadSize: 4096, + flags: packet.DNSSEC_OK, + options: [{ + // pass in any code/data for generic EDNS0 options + code: 12, + data: Buffer.alloc(31) + }, { + // Several EDNS0 options have enhanced support + code: 'PADDING', + length: 31, + }, { + code: 'CLIENT_SUBNET', + family: 2, // 1 for IPv4, 2 for IPv6 + sourcePrefixLength: 64, // used to truncate IP address + scopePrefixLength: 0, + ip: 'fe80::', + }, { + code: 'TCP_KEEPALIVE', + timeout: 150 // increments of 100ms. This means 15s. + }, { + code: 'KEY_TAG', + tags: [1, 2, 3], + }] +} +``` + +The options `PADDING`, `CLIENT_SUBNET`, `TCP_KEEPALIVE` and `KEY_TAG` support enhanced de/encoding. See [optionscodes.js](https://github.com/mafintosh/dns-packet/blob/master/optioncodes.js) for all supported option codes. If the `data` property is present on a option, it takes precedence. On decoding, `data` will always be defined. + +#### `PTR` + +``` js +{ + data: 'points.to.another.record' +} +``` + +#### `RP` + +``` js +{ + mbox: 'admin.example.com', + txt: 'txt.example.com' +} +``` + +#### `RRSIG` + +``` js +{ + typeCovered: 'A', + algorithm: 8, + labels: 1, + originalTTL: 3600, + expiration: timestamp, + inception: timestamp, + keyTag: 12345, + signersName: 'a.name', + signature: Buffer +} +``` + +#### `SOA` + +``` js +{ + data: + { + mname: domainName, + rname: mailbox, + serial: zoneSerial, + refresh: refreshInterval, + retry: retryInterval, + expire: expireInterval, + minimum: minimumTTL + } +} +``` + +#### `SRV` + +``` js +{ + data: { + port: servicePort, + target: serviceHostName, + priority: optionalServicePriority, + weight: optionalServiceWeight + } +} +``` + +#### `TXT` + +``` js +{ + data: 'text' || Buffer || [ Buffer || 'text' ] +} +``` + +When encoding, scalar values are converted to an array and strings are converted to UTF-8 encoded Buffers. When decoding, the return value will always be an array of Buffer. + +If you need another record type, open an issue and we'll try to add it. + +## License + +MIT diff --git a/helloworld/node_modules/dns-packet/classes.js b/helloworld/node_modules/dns-packet/classes.js new file mode 100755 index 0000000..9a3d9b1 --- /dev/null +++ b/helloworld/node_modules/dns-packet/classes.js @@ -0,0 +1,23 @@ +'use strict' + +exports.toString = function (klass) { + switch (klass) { + case 1: return 'IN' + case 2: return 'CS' + case 3: return 'CH' + case 4: return 'HS' + case 255: return 'ANY' + } + return 'UNKNOWN_' + klass +} + +exports.toClass = function (name) { + switch (name.toUpperCase()) { + case 'IN': return 1 + case 'CS': return 2 + case 'CH': return 3 + case 'HS': return 4 + case 'ANY': return 255 + } + return 0 +} diff --git a/helloworld/node_modules/dns-packet/index.js b/helloworld/node_modules/dns-packet/index.js new file mode 100755 index 0000000..b6a52c6 --- /dev/null +++ b/helloworld/node_modules/dns-packet/index.js @@ -0,0 +1,1541 @@ +'use strict' + +const types = require('./types') +const rcodes = require('./rcodes') +const opcodes = require('./opcodes') +const classes = require('./classes') +const optioncodes = require('./optioncodes') +const ip = require('ip') + +const QUERY_FLAG = 0 +const RESPONSE_FLAG = 1 << 15 +const FLUSH_MASK = 1 << 15 +const NOT_FLUSH_MASK = ~FLUSH_MASK +const QU_MASK = 1 << 15 +const NOT_QU_MASK = ~QU_MASK + +const name = exports.txt = exports.name = {} + +name.encode = function (str, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(name.encodingLength(str)) + if (!offset) offset = 0 + const oldOffset = offset + + // strip leading and trailing . + const n = str.replace(/^\.|\.$/gm, '') + if (n.length) { + const list = n.split('.') + + for (let i = 0; i < list.length; i++) { + const len = buf.write(list[i], offset + 1) + buf[offset] = len + offset += len + 1 + } + } + + buf[offset++] = 0 + + name.encode.bytes = offset - oldOffset + return buf +} + +name.encode.bytes = 0 + +name.decode = function (buf, offset) { + if (!offset) offset = 0 + + const list = [] + const oldOffset = offset + let len = buf[offset++] + + if (len === 0) { + name.decode.bytes = 1 + return '.' + } + if (len >= 0xc0) { + const res = name.decode(buf, buf.readUInt16BE(offset - 1) - 0xc000) + name.decode.bytes = 2 + return res + } + + while (len) { + if (len >= 0xc0) { + list.push(name.decode(buf, buf.readUInt16BE(offset - 1) - 0xc000)) + offset++ + break + } + + list.push(buf.toString('utf-8', offset, offset + len)) + offset += len + len = buf[offset++] + } + + name.decode.bytes = offset - oldOffset + return list.join('.') +} + +name.decode.bytes = 0 + +name.encodingLength = function (n) { + if (n === '.') return 1 + return Buffer.byteLength(n) + 2 +} + +const string = {} + +string.encode = function (s, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(string.encodingLength(s)) + if (!offset) offset = 0 + + const len = buf.write(s, offset + 1) + buf[offset] = len + string.encode.bytes = len + 1 + return buf +} + +string.encode.bytes = 0 + +string.decode = function (buf, offset) { + if (!offset) offset = 0 + + const len = buf[offset] + const s = buf.toString('utf-8', offset + 1, offset + 1 + len) + string.decode.bytes = len + 1 + return s +} + +string.decode.bytes = 0 + +string.encodingLength = function (s) { + return Buffer.byteLength(s) + 1 +} + +const header = {} + +header.encode = function (h, buf, offset) { + if (!buf) buf = header.encodingLength(h) + if (!offset) offset = 0 + + const flags = (h.flags || 0) & 32767 + const type = h.type === 'response' ? RESPONSE_FLAG : QUERY_FLAG + + buf.writeUInt16BE(h.id || 0, offset) + buf.writeUInt16BE(flags | type, offset + 2) + buf.writeUInt16BE(h.questions.length, offset + 4) + buf.writeUInt16BE(h.answers.length, offset + 6) + buf.writeUInt16BE(h.authorities.length, offset + 8) + buf.writeUInt16BE(h.additionals.length, offset + 10) + + return buf +} + +header.encode.bytes = 12 + +header.decode = function (buf, offset) { + if (!offset) offset = 0 + if (buf.length < 12) throw new Error('Header must be 12 bytes') + const flags = buf.readUInt16BE(offset + 2) + + return { + id: buf.readUInt16BE(offset), + type: flags & RESPONSE_FLAG ? 'response' : 'query', + flags: flags & 32767, + flag_qr: ((flags >> 15) & 0x1) === 1, + opcode: opcodes.toString((flags >> 11) & 0xf), + flag_aa: ((flags >> 10) & 0x1) === 1, + flag_tc: ((flags >> 9) & 0x1) === 1, + flag_rd: ((flags >> 8) & 0x1) === 1, + flag_ra: ((flags >> 7) & 0x1) === 1, + flag_z: ((flags >> 6) & 0x1) === 1, + flag_ad: ((flags >> 5) & 0x1) === 1, + flag_cd: ((flags >> 4) & 0x1) === 1, + rcode: rcodes.toString(flags & 0xf), + questions: new Array(buf.readUInt16BE(offset + 4)), + answers: new Array(buf.readUInt16BE(offset + 6)), + authorities: new Array(buf.readUInt16BE(offset + 8)), + additionals: new Array(buf.readUInt16BE(offset + 10)) + } +} + +header.decode.bytes = 12 + +header.encodingLength = function () { + return 12 +} + +const runknown = exports.unknown = {} + +runknown.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(runknown.encodingLength(data)) + if (!offset) offset = 0 + + buf.writeUInt16BE(data.length, offset) + data.copy(buf, offset + 2) + + runknown.encode.bytes = data.length + 2 + return buf +} + +runknown.encode.bytes = 0 + +runknown.decode = function (buf, offset) { + if (!offset) offset = 0 + + const len = buf.readUInt16BE(offset) + const data = buf.slice(offset + 2, offset + 2 + len) + runknown.decode.bytes = len + 2 + return data +} + +runknown.decode.bytes = 0 + +runknown.encodingLength = function (data) { + return data.length + 2 +} + +const rns = exports.ns = {} + +rns.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rns.encodingLength(data)) + if (!offset) offset = 0 + + name.encode(data, buf, offset + 2) + buf.writeUInt16BE(name.encode.bytes, offset) + rns.encode.bytes = name.encode.bytes + 2 + return buf +} + +rns.encode.bytes = 0 + +rns.decode = function (buf, offset) { + if (!offset) offset = 0 + + const len = buf.readUInt16BE(offset) + const dd = name.decode(buf, offset + 2) + + rns.decode.bytes = len + 2 + return dd +} + +rns.decode.bytes = 0 + +rns.encodingLength = function (data) { + return name.encodingLength(data) + 2 +} + +const rsoa = exports.soa = {} + +rsoa.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rsoa.encodingLength(data)) + if (!offset) offset = 0 + + const oldOffset = offset + offset += 2 + name.encode(data.mname, buf, offset) + offset += name.encode.bytes + name.encode(data.rname, buf, offset) + offset += name.encode.bytes + buf.writeUInt32BE(data.serial || 0, offset) + offset += 4 + buf.writeUInt32BE(data.refresh || 0, offset) + offset += 4 + buf.writeUInt32BE(data.retry || 0, offset) + offset += 4 + buf.writeUInt32BE(data.expire || 0, offset) + offset += 4 + buf.writeUInt32BE(data.minimum || 0, offset) + offset += 4 + + buf.writeUInt16BE(offset - oldOffset - 2, oldOffset) + rsoa.encode.bytes = offset - oldOffset + return buf +} + +rsoa.encode.bytes = 0 + +rsoa.decode = function (buf, offset) { + if (!offset) offset = 0 + + const oldOffset = offset + + const data = {} + offset += 2 + data.mname = name.decode(buf, offset) + offset += name.decode.bytes + data.rname = name.decode(buf, offset) + offset += name.decode.bytes + data.serial = buf.readUInt32BE(offset) + offset += 4 + data.refresh = buf.readUInt32BE(offset) + offset += 4 + data.retry = buf.readUInt32BE(offset) + offset += 4 + data.expire = buf.readUInt32BE(offset) + offset += 4 + data.minimum = buf.readUInt32BE(offset) + offset += 4 + + rsoa.decode.bytes = offset - oldOffset + return data +} + +rsoa.decode.bytes = 0 + +rsoa.encodingLength = function (data) { + return 22 + name.encodingLength(data.mname) + name.encodingLength(data.rname) +} + +const rtxt = exports.txt = {} + +rtxt.encode = function (data, buf, offset) { + if (!Array.isArray(data)) data = [data] + for (let i = 0; i < data.length; i++) { + if (typeof data[i] === 'string') { + data[i] = Buffer.from(data[i]) + } + if (!Buffer.isBuffer(data[i])) { + throw new Error('Must be a Buffer') + } + } + + if (!buf) buf = Buffer.allocUnsafe(rtxt.encodingLength(data)) + if (!offset) offset = 0 + + const oldOffset = offset + offset += 2 + + data.forEach(function (d) { + buf[offset++] = d.length + d.copy(buf, offset, 0, d.length) + offset += d.length + }) + + buf.writeUInt16BE(offset - oldOffset - 2, oldOffset) + rtxt.encode.bytes = offset - oldOffset + return buf +} + +rtxt.encode.bytes = 0 + +rtxt.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + let remaining = buf.readUInt16BE(offset) + offset += 2 + + let data = [] + while (remaining > 0) { + const len = buf[offset++] + --remaining + if (remaining < len) { + throw new Error('Buffer overflow') + } + data.push(buf.slice(offset, offset + len)) + offset += len + remaining -= len + } + + rtxt.decode.bytes = offset - oldOffset + return data +} + +rtxt.decode.bytes = 0 + +rtxt.encodingLength = function (data) { + if (!Array.isArray(data)) data = [data] + let length = 2 + data.forEach(function (buf) { + if (typeof buf === 'string') { + length += Buffer.byteLength(buf) + 1 + } else { + length += buf.length + 1 + } + }) + return length +} + +const rnull = exports.null = {} + +rnull.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rnull.encodingLength(data)) + if (!offset) offset = 0 + + if (typeof data === 'string') data = Buffer.from(data) + if (!data) data = Buffer.allocUnsafe(0) + + const oldOffset = offset + offset += 2 + + const len = data.length + data.copy(buf, offset, 0, len) + offset += len + + buf.writeUInt16BE(offset - oldOffset - 2, oldOffset) + rnull.encode.bytes = offset - oldOffset + return buf +} + +rnull.encode.bytes = 0 + +rnull.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + const len = buf.readUInt16BE(offset) + + offset += 2 + + const data = buf.slice(offset, offset + len) + offset += len + + rnull.decode.bytes = offset - oldOffset + return data +} + +rnull.decode.bytes = 0 + +rnull.encodingLength = function (data) { + if (!data) return 2 + return (Buffer.isBuffer(data) ? data.length : Buffer.byteLength(data)) + 2 +} + +const rhinfo = exports.hinfo = {} + +rhinfo.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rhinfo.encodingLength(data)) + if (!offset) offset = 0 + + const oldOffset = offset + offset += 2 + string.encode(data.cpu, buf, offset) + offset += string.encode.bytes + string.encode(data.os, buf, offset) + offset += string.encode.bytes + buf.writeUInt16BE(offset - oldOffset - 2, oldOffset) + rhinfo.encode.bytes = offset - oldOffset + return buf +} + +rhinfo.encode.bytes = 0 + +rhinfo.decode = function (buf, offset) { + if (!offset) offset = 0 + + const oldOffset = offset + + const data = {} + offset += 2 + data.cpu = string.decode(buf, offset) + offset += string.decode.bytes + data.os = string.decode(buf, offset) + offset += string.decode.bytes + rhinfo.decode.bytes = offset - oldOffset + return data +} + +rhinfo.decode.bytes = 0 + +rhinfo.encodingLength = function (data) { + return string.encodingLength(data.cpu) + string.encodingLength(data.os) + 2 +} + +const rptr = exports.ptr = {} +const rcname = exports.cname = rptr +const rdname = exports.dname = rptr + +rptr.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rptr.encodingLength(data)) + if (!offset) offset = 0 + + name.encode(data, buf, offset + 2) + buf.writeUInt16BE(name.encode.bytes, offset) + rptr.encode.bytes = name.encode.bytes + 2 + return buf +} + +rptr.encode.bytes = 0 + +rptr.decode = function (buf, offset) { + if (!offset) offset = 0 + + const data = name.decode(buf, offset + 2) + rptr.decode.bytes = name.decode.bytes + 2 + return data +} + +rptr.decode.bytes = 0 + +rptr.encodingLength = function (data) { + return name.encodingLength(data) + 2 +} + +const rsrv = exports.srv = {} + +rsrv.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rsrv.encodingLength(data)) + if (!offset) offset = 0 + + buf.writeUInt16BE(data.priority || 0, offset + 2) + buf.writeUInt16BE(data.weight || 0, offset + 4) + buf.writeUInt16BE(data.port || 0, offset + 6) + name.encode(data.target, buf, offset + 8) + + const len = name.encode.bytes + 6 + buf.writeUInt16BE(len, offset) + + rsrv.encode.bytes = len + 2 + return buf +} + +rsrv.encode.bytes = 0 + +rsrv.decode = function (buf, offset) { + if (!offset) offset = 0 + + const len = buf.readUInt16BE(offset) + + const data = {} + data.priority = buf.readUInt16BE(offset + 2) + data.weight = buf.readUInt16BE(offset + 4) + data.port = buf.readUInt16BE(offset + 6) + data.target = name.decode(buf, offset + 8) + + rsrv.decode.bytes = len + 2 + return data +} + +rsrv.decode.bytes = 0 + +rsrv.encodingLength = function (data) { + return 8 + name.encodingLength(data.target) +} + +const rcaa = exports.caa = {} + +rcaa.ISSUER_CRITICAL = 1 << 7 + +rcaa.encode = function (data, buf, offset) { + const len = rcaa.encodingLength(data) + + if (!buf) buf = Buffer.allocUnsafe(rcaa.encodingLength(data)) + if (!offset) offset = 0 + + if (data.issuerCritical) { + data.flags = rcaa.ISSUER_CRITICAL + } + + buf.writeUInt16BE(len - 2, offset) + offset += 2 + buf.writeUInt8(data.flags || 0, offset) + offset += 1 + string.encode(data.tag, buf, offset) + offset += string.encode.bytes + buf.write(data.value, offset) + offset += Buffer.byteLength(data.value) + + rcaa.encode.bytes = len + return buf +} + +rcaa.encode.bytes = 0 + +rcaa.decode = function (buf, offset) { + if (!offset) offset = 0 + + const len = buf.readUInt16BE(offset) + offset += 2 + + const oldOffset = offset + const data = {} + data.flags = buf.readUInt8(offset) + offset += 1 + data.tag = string.decode(buf, offset) + offset += string.decode.bytes + data.value = buf.toString('utf-8', offset, oldOffset + len) + + data.issuerCritical = !!(data.flags & rcaa.ISSUER_CRITICAL) + + rcaa.decode.bytes = len + 2 + + return data +} + +rcaa.decode.bytes = 0 + +rcaa.encodingLength = function (data) { + return string.encodingLength(data.tag) + string.encodingLength(data.value) + 2 +} + +const rmx = exports.mx = {} + +rmx.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rmx.encodingLength(data)) + if (!offset) offset = 0 + + const oldOffset = offset + offset += 2 + buf.writeUInt16BE(data.preference || 0, offset) + offset += 2 + name.encode(data.exchange, buf, offset) + offset += name.encode.bytes + + buf.writeUInt16BE(offset - oldOffset - 2, oldOffset) + rmx.encode.bytes = offset - oldOffset + return buf +} + +rmx.encode.bytes = 0 + +rmx.decode = function (buf, offset) { + if (!offset) offset = 0 + + const oldOffset = offset + + const data = {} + offset += 2 + data.preference = buf.readUInt16BE(offset) + offset += 2 + data.exchange = name.decode(buf, offset) + offset += name.decode.bytes + + rmx.decode.bytes = offset - oldOffset + return data +} + +rmx.encodingLength = function (data) { + return 4 + name.encodingLength(data.exchange) +} + +const ra = exports.a = {} + +ra.encode = function (host, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(ra.encodingLength(host)) + if (!offset) offset = 0 + + buf.writeUInt16BE(4, offset) + offset += 2 + ip.toBuffer(host, buf, offset) + ra.encode.bytes = 6 + return buf +} + +ra.encode.bytes = 0 + +ra.decode = function (buf, offset) { + if (!offset) offset = 0 + + offset += 2 + const host = ip.toString(buf, offset, 4) + ra.decode.bytes = 6 + return host +} + +ra.decode.bytes = 0 + +ra.encodingLength = function () { + return 6 +} + +const raaaa = exports.aaaa = {} + +raaaa.encode = function (host, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(raaaa.encodingLength(host)) + if (!offset) offset = 0 + + buf.writeUInt16BE(16, offset) + offset += 2 + ip.toBuffer(host, buf, offset) + raaaa.encode.bytes = 18 + return buf +} + +raaaa.encode.bytes = 0 + +raaaa.decode = function (buf, offset) { + if (!offset) offset = 0 + + offset += 2 + const host = ip.toString(buf, offset, 16) + raaaa.decode.bytes = 18 + return host +} + +raaaa.decode.bytes = 0 + +raaaa.encodingLength = function () { + return 18 +} + +const roption = exports.option = {} + +roption.encode = function (option, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(roption.encodingLength(option)) + if (!offset) offset = 0 + const oldOffset = offset + + const code = optioncodes.toCode(option.code) + buf.writeUInt16BE(code, offset) + offset += 2 + if (option.data) { + buf.writeUInt16BE(option.data.length, offset) + offset += 2 + option.data.copy(buf, offset) + offset += option.data.length + } else { + switch (code) { + // case 3: NSID. No encode makes sense. + // case 5,6,7: Not implementable + case 8: // ECS + // note: do IP math before calling + const spl = option.sourcePrefixLength || 0 + const fam = option.family || (ip.isV4Format(option.ip) ? 1 : 2) + const ipBuf = ip.toBuffer(option.ip) + const ipLen = Math.ceil(spl / 8) + buf.writeUInt16BE(ipLen + 4, offset) + offset += 2 + buf.writeUInt16BE(fam, offset) + offset += 2 + buf.writeUInt8(spl, offset++) + buf.writeUInt8(option.scopePrefixLength || 0, offset++) + + ipBuf.copy(buf, offset, 0, ipLen) + offset += ipLen + break + // case 9: EXPIRE (experimental) + // case 10: COOKIE. No encode makes sense. + case 11: // KEEP-ALIVE + if (option.timeout) { + buf.writeUInt16BE(2, offset) + offset += 2 + buf.writeUInt16BE(option.timeout, offset) + offset += 2 + } else { + buf.writeUInt16BE(0, offset) + offset += 2 + } + break + case 12: // PADDING + const len = option.length || 0 + buf.writeUInt16BE(len, offset) + offset += 2 + buf.fill(0, offset, offset + len) + offset += len + break + // case 13: CHAIN. Experimental. + case 14: // KEY-TAG + const tagsLen = option.tags.length * 2 + buf.writeUInt16BE(tagsLen, offset) + offset += 2 + for (const tag of option.tags) { + buf.writeUInt16BE(tag, offset) + offset += 2 + } + break + default: + throw new Error(`Unknown roption code: ${option.code}`) + } + } + + roption.encode.bytes = offset - oldOffset + return buf +} + +roption.encode.bytes = 0 + +roption.decode = function (buf, offset) { + if (!offset) offset = 0 + const option = {} + option.code = buf.readUInt16BE(offset) + option.type = optioncodes.toString(option.code) + offset += 2 + const len = buf.readUInt16BE(offset) + offset += 2 + option.data = buf.slice(offset, offset + len) + switch (option.code) { + // case 3: NSID. No decode makes sense. + case 8: // ECS + option.family = buf.readUInt16BE(offset) + offset += 2 + option.sourcePrefixLength = buf.readUInt8(offset++) + option.scopePrefixLength = buf.readUInt8(offset++) + const padded = Buffer.alloc((option.family === 1) ? 4 : 16) + buf.copy(padded, 0, offset, offset + len - 4) + option.ip = ip.toString(padded) + break + // case 12: Padding. No decode makes sense. + case 11: // KEEP-ALIVE + if (len > 0) { + option.timeout = buf.readUInt16BE(offset) + offset += 2 + } + break + case 14: + option.tags = [] + for (let i = 0; i < len; i += 2) { + option.tags.push(buf.readUInt16BE(offset)) + offset += 2 + } + // don't worry about default. caller will use data if desired + } + + roption.decode.bytes = len + 4 + return option +} + +roption.decode.bytes = 0 + +roption.encodingLength = function (option) { + if (option.data) { + return option.data.length + 4 + } + const code = optioncodes.toCode(option.code) + switch (code) { + case 8: // ECS + const spl = option.sourcePrefixLength || 0 + return Math.ceil(spl / 8) + 8 + case 11: // KEEP-ALIVE + return (typeof option.timeout === 'number') ? 6 : 4 + case 12: // PADDING + return option.length + 4 + case 14: // KEY-TAG + return 4 + (option.tags.length * 2) + } + throw new Error(`Unknown roption code: ${option.code}`) +} + +const ropt = exports.opt = {} + +ropt.encode = function (options, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(ropt.encodingLength(options)) + if (!offset) offset = 0 + const oldOffset = offset + + const rdlen = encodingLengthList(options, roption) + buf.writeUInt16BE(rdlen, offset) + offset = encodeList(options, roption, buf, offset + 2) + + ropt.encode.bytes = offset - oldOffset + return buf +} + +ropt.encode.bytes = 0 + +ropt.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + const options = [] + let rdlen = buf.readUInt16BE(offset) + offset += 2 + let o = 0 + while (rdlen > 0) { + options[o++] = roption.decode(buf, offset) + offset += roption.decode.bytes + rdlen -= roption.decode.bytes + } + ropt.decode.bytes = offset - oldOffset + return options +} + +ropt.decode.bytes = 0 + +ropt.encodingLength = function (options) { + return 2 + encodingLengthList(options || [], roption) +} + +const rdnskey = exports.dnskey = {} + +rdnskey.PROTOCOL_DNSSEC = 3 +rdnskey.ZONE_KEY = 0x80 +rdnskey.SECURE_ENTRYPOINT = 0x8000 + +rdnskey.encode = function (key, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rdnskey.encodingLength(key)) + if (!offset) offset = 0 + const oldOffset = offset + + const keydata = key.key + if (!Buffer.isBuffer(keydata)) { + throw new Error('Key must be a Buffer') + } + + offset += 2 // Leave space for length + buf.writeUInt16BE(key.flags, offset) + offset += 2 + buf.writeUInt8(rdnskey.PROTOCOL_DNSSEC, offset) + offset += 1 + buf.writeUInt8(key.algorithm, offset) + offset += 1 + keydata.copy(buf, offset, 0, keydata.length) + offset += keydata.length + + rdnskey.encode.bytes = offset - oldOffset + buf.writeUInt16BE(rdnskey.encode.bytes - 2, oldOffset) + return buf +} + +rdnskey.encode.bytes = 0 + +rdnskey.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + var key = {} + var length = buf.readUInt16BE(offset) + offset += 2 + key.flags = buf.readUInt16BE(offset) + offset += 2 + if (buf.readUInt8(offset) !== rdnskey.PROTOCOL_DNSSEC) { + throw new Error('Protocol must be 3') + } + offset += 1 + key.algorithm = buf.readUInt8(offset) + offset += 1 + key.key = buf.slice(offset, oldOffset + length + 2) + offset += key.key.length + rdnskey.decode.bytes = offset - oldOffset + return key +} + +rdnskey.decode.bytes = 0 + +rdnskey.encodingLength = function (key) { + return 6 + Buffer.byteLength(key.key) +} + +const rrrsig = exports.rrsig = {} + +rrrsig.encode = function (sig, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rrrsig.encodingLength(sig)) + if (!offset) offset = 0 + const oldOffset = offset + + const signature = sig.signature + if (!Buffer.isBuffer(signature)) { + throw new Error('Signature must be a Buffer') + } + + offset += 2 // Leave space for length + buf.writeUInt16BE(types.toType(sig.typeCovered), offset) + offset += 2 + buf.writeUInt8(sig.algorithm, offset) + offset += 1 + buf.writeUInt8(sig.labels, offset) + offset += 1 + buf.writeUInt32BE(sig.originalTTL, offset) + offset += 4 + buf.writeUInt32BE(sig.expiration, offset) + offset += 4 + buf.writeUInt32BE(sig.inception, offset) + offset += 4 + buf.writeUInt16BE(sig.keyTag, offset) + offset += 2 + name.encode(sig.signersName, buf, offset) + offset += name.encode.bytes + signature.copy(buf, offset, 0, signature.length) + offset += signature.length + + rrrsig.encode.bytes = offset - oldOffset + buf.writeUInt16BE(rrrsig.encode.bytes - 2, oldOffset) + return buf +} + +rrrsig.encode.bytes = 0 + +rrrsig.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + var sig = {} + var length = buf.readUInt16BE(offset) + offset += 2 + sig.typeCovered = types.toString(buf.readUInt16BE(offset)) + offset += 2 + sig.algorithm = buf.readUInt8(offset) + offset += 1 + sig.labels = buf.readUInt8(offset) + offset += 1 + sig.originalTTL = buf.readUInt32BE(offset) + offset += 4 + sig.expiration = buf.readUInt32BE(offset) + offset += 4 + sig.inception = buf.readUInt32BE(offset) + offset += 4 + sig.keyTag = buf.readUInt16BE(offset) + offset += 2 + sig.signersName = name.decode(buf, offset) + offset += name.decode.bytes + sig.signature = buf.slice(offset, oldOffset + length + 2) + offset += sig.signature.length + rrrsig.decode.bytes = offset - oldOffset + return sig +} + +rrrsig.decode.bytes = 0 + +rrrsig.encodingLength = function (sig) { + return 20 + + name.encodingLength(sig.signersName) + + Buffer.byteLength(sig.signature) +} + +const rrp = exports.rp = {} + +rrp.encode = function (data, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rrp.encodingLength(data)) + if (!offset) offset = 0 + const oldOffset = offset + + offset += 2 // Leave space for length + name.encode(data.mbox || '.', buf, offset) + offset += name.encode.bytes + name.encode(data.txt || '.', buf, offset) + offset += name.encode.bytes + rrp.encode.bytes = offset - oldOffset + buf.writeUInt16BE(rrp.encode.bytes - 2, oldOffset) + return buf +} + +rrp.encode.bytes = 0 + +rrp.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + const data = {} + offset += 2 + data.mbox = name.decode(buf, offset) || '.' + offset += name.decode.bytes + data.txt = name.decode(buf, offset) || '.' + offset += name.decode.bytes + rrp.decode.bytes = offset - oldOffset + return data +} + +rrp.decode.bytes = 0 + +rrp.encodingLength = function (data) { + return 2 + name.encodingLength(data.mbox || '.') + name.encodingLength(data.txt || '.') +} + +const typebitmap = {} + +typebitmap.encode = function (typelist, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(typebitmap.encodingLength(typelist)) + if (!offset) offset = 0 + const oldOffset = offset + + var typesByWindow = [] + for (var i = 0; i < typelist.length; i++) { + var typeid = types.toType(typelist[i]) + if (typesByWindow[typeid >> 8] === undefined) { + typesByWindow[typeid >> 8] = [] + } + typesByWindow[typeid >> 8][(typeid >> 3) & 0x1F] |= 1 << (7 - (typeid & 0x7)) + } + + for (i = 0; i < typesByWindow.length; i++) { + if (typesByWindow[i] !== undefined) { + var windowBuf = Buffer.from(typesByWindow[i]) + buf.writeUInt8(i, offset) + offset += 1 + buf.writeUInt8(windowBuf.length, offset) + offset += 1 + windowBuf.copy(buf, offset) + offset += windowBuf.length + } + } + + typebitmap.encode.bytes = offset - oldOffset + return buf +} + +typebitmap.encode.bytes = 0 + +typebitmap.decode = function (buf, offset, length) { + if (!offset) offset = 0 + const oldOffset = offset + + var typelist = [] + while (offset - oldOffset < length) { + var window = buf.readUInt8(offset) + offset += 1 + var windowLength = buf.readUInt8(offset) + offset += 1 + for (var i = 0; i < windowLength; i++) { + var b = buf.readUInt8(offset + i) + for (var j = 0; j < 8; j++) { + if (b & (1 << (7 - j))) { + var typeid = types.toString((window << 8) | (i << 3) | j) + typelist.push(typeid) + } + } + } + offset += windowLength + } + + typebitmap.decode.bytes = offset - oldOffset + return typelist +} + +typebitmap.decode.bytes = 0 + +typebitmap.encodingLength = function (typelist) { + var extents = [] + for (var i = 0; i < typelist.length; i++) { + var typeid = types.toType(typelist[i]) + extents[typeid >> 8] = Math.max(extents[typeid >> 8] || 0, typeid & 0xFF) + } + + var len = 0 + for (i = 0; i < extents.length; i++) { + if (extents[i] !== undefined) { + len += 2 + Math.ceil((extents[i] + 1) / 8) + } + } + + return len +} + +const rnsec = exports.nsec = {} + +rnsec.encode = function (record, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rnsec.encodingLength(record)) + if (!offset) offset = 0 + const oldOffset = offset + + offset += 2 // Leave space for length + name.encode(record.nextDomain, buf, offset) + offset += name.encode.bytes + typebitmap.encode(record.rrtypes, buf, offset) + offset += typebitmap.encode.bytes + + rnsec.encode.bytes = offset - oldOffset + buf.writeUInt16BE(rnsec.encode.bytes - 2, oldOffset) + return buf +} + +rnsec.encode.bytes = 0 + +rnsec.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + var record = {} + var length = buf.readUInt16BE(offset) + offset += 2 + record.nextDomain = name.decode(buf, offset) + offset += name.decode.bytes + record.rrtypes = typebitmap.decode(buf, offset, length - (offset - oldOffset)) + offset += typebitmap.decode.bytes + + rnsec.decode.bytes = offset - oldOffset + return record +} + +rnsec.decode.bytes = 0 + +rnsec.encodingLength = function (record) { + return 2 + + name.encodingLength(record.nextDomain) + + typebitmap.encodingLength(record.rrtypes) +} + +const rnsec3 = exports.nsec3 = {} + +rnsec3.encode = function (record, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rnsec3.encodingLength(record)) + if (!offset) offset = 0 + const oldOffset = offset + + const salt = record.salt + if (!Buffer.isBuffer(salt)) { + throw new Error('salt must be a Buffer') + } + + const nextDomain = record.nextDomain + if (!Buffer.isBuffer(nextDomain)) { + throw new Error('nextDomain must be a Buffer') + } + + offset += 2 // Leave space for length + buf.writeUInt8(record.algorithm, offset) + offset += 1 + buf.writeUInt8(record.flags, offset) + offset += 1 + buf.writeUInt16BE(record.iterations, offset) + offset += 2 + buf.writeUInt8(salt.length, offset) + offset += 1 + salt.copy(buf, offset, 0, salt.length) + offset += salt.length + buf.writeUInt8(nextDomain.length, offset) + offset += 1 + nextDomain.copy(buf, offset, 0, nextDomain.length) + offset += nextDomain.length + typebitmap.encode(record.rrtypes, buf, offset) + offset += typebitmap.encode.bytes + + rnsec3.encode.bytes = offset - oldOffset + buf.writeUInt16BE(rnsec3.encode.bytes - 2, oldOffset) + return buf +} + +rnsec3.encode.bytes = 0 + +rnsec3.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + var record = {} + var length = buf.readUInt16BE(offset) + offset += 2 + record.algorithm = buf.readUInt8(offset) + offset += 1 + record.flags = buf.readUInt8(offset) + offset += 1 + record.iterations = buf.readUInt16BE(offset) + offset += 2 + const saltLength = buf.readUInt8(offset) + offset += 1 + record.salt = buf.slice(offset, offset + saltLength) + offset += saltLength + const hashLength = buf.readUInt8(offset) + offset += 1 + record.nextDomain = buf.slice(offset, offset + hashLength) + offset += hashLength + record.rrtypes = typebitmap.decode(buf, offset, length - (offset - oldOffset)) + offset += typebitmap.decode.bytes + + rnsec3.decode.bytes = offset - oldOffset + return record +} + +rnsec3.decode.bytes = 0 + +rnsec3.encodingLength = function (record) { + return 8 + + record.salt.length + + record.nextDomain.length + + typebitmap.encodingLength(record.rrtypes) +} + +const rds = exports.ds = {} + +rds.encode = function (digest, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(rds.encodingLength(digest)) + if (!offset) offset = 0 + const oldOffset = offset + + const digestdata = digest.digest + if (!Buffer.isBuffer(digestdata)) { + throw new Error('Digest must be a Buffer') + } + + offset += 2 // Leave space for length + buf.writeUInt16BE(digest.keyTag, offset) + offset += 2 + buf.writeUInt8(digest.algorithm, offset) + offset += 1 + buf.writeUInt8(digest.digestType, offset) + offset += 1 + digestdata.copy(buf, offset, 0, digestdata.length) + offset += digestdata.length + + rds.encode.bytes = offset - oldOffset + buf.writeUInt16BE(rds.encode.bytes - 2, oldOffset) + return buf +} + +rds.encode.bytes = 0 + +rds.decode = function (buf, offset) { + if (!offset) offset = 0 + const oldOffset = offset + + var digest = {} + var length = buf.readUInt16BE(offset) + offset += 2 + digest.keyTag = buf.readUInt16BE(offset) + offset += 2 + digest.algorithm = buf.readUInt8(offset) + offset += 1 + digest.digestType = buf.readUInt8(offset) + offset += 1 + digest.digest = buf.slice(offset, oldOffset + length + 2) + offset += digest.digest.length + rds.decode.bytes = offset - oldOffset + return digest +} + +rds.decode.bytes = 0 + +rds.encodingLength = function (digest) { + return 6 + Buffer.byteLength(digest.digest) +} + +const renc = exports.record = function (type) { + switch (type.toUpperCase()) { + case 'A': return ra + case 'PTR': return rptr + case 'CNAME': return rcname + case 'DNAME': return rdname + case 'TXT': return rtxt + case 'NULL': return rnull + case 'AAAA': return raaaa + case 'SRV': return rsrv + case 'HINFO': return rhinfo + case 'CAA': return rcaa + case 'NS': return rns + case 'SOA': return rsoa + case 'MX': return rmx + case 'OPT': return ropt + case 'DNSKEY': return rdnskey + case 'RRSIG': return rrrsig + case 'RP': return rrp + case 'NSEC': return rnsec + case 'NSEC3': return rnsec3 + case 'DS': return rds + } + return runknown +} + +const answer = exports.answer = {} + +answer.encode = function (a, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(answer.encodingLength(a)) + if (!offset) offset = 0 + + const oldOffset = offset + + name.encode(a.name, buf, offset) + offset += name.encode.bytes + + buf.writeUInt16BE(types.toType(a.type), offset) + + if (a.type.toUpperCase() === 'OPT') { + if (a.name !== '.') { + throw new Error('OPT name must be root.') + } + buf.writeUInt16BE(a.udpPayloadSize || 4096, offset + 2) + buf.writeUInt8(a.extendedRcode || 0, offset + 4) + buf.writeUInt8(a.ednsVersion || 0, offset + 5) + buf.writeUInt16BE(a.flags || 0, offset + 6) + + offset += 8 + ropt.encode(a.options || [], buf, offset) + offset += ropt.encode.bytes + } else { + let klass = classes.toClass(a.class === undefined ? 'IN' : a.class) + if (a.flush) klass |= FLUSH_MASK // the 1st bit of the class is the flush bit + buf.writeUInt16BE(klass, offset + 2) + buf.writeUInt32BE(a.ttl || 0, offset + 4) + + offset += 8 + const enc = renc(a.type) + enc.encode(a.data, buf, offset) + offset += enc.encode.bytes + } + + answer.encode.bytes = offset - oldOffset + return buf +} + +answer.encode.bytes = 0 + +answer.decode = function (buf, offset) { + if (!offset) offset = 0 + + const a = {} + const oldOffset = offset + + a.name = name.decode(buf, offset) + offset += name.decode.bytes + a.type = types.toString(buf.readUInt16BE(offset)) + if (a.type === 'OPT') { + a.udpPayloadSize = buf.readUInt16BE(offset + 2) + a.extendedRcode = buf.readUInt8(offset + 4) + a.ednsVersion = buf.readUInt8(offset + 5) + a.flags = buf.readUInt16BE(offset + 6) + a.flag_do = ((a.flags >> 15) & 0x1) === 1 + a.options = ropt.decode(buf, offset + 8) + offset += 8 + ropt.decode.bytes + } else { + const klass = buf.readUInt16BE(offset + 2) + a.ttl = buf.readUInt32BE(offset + 4) + + a.class = classes.toString(klass & NOT_FLUSH_MASK) + a.flush = !!(klass & FLUSH_MASK) + + const enc = renc(a.type) + a.data = enc.decode(buf, offset + 8) + offset += 8 + enc.decode.bytes + } + + answer.decode.bytes = offset - oldOffset + return a +} + +answer.decode.bytes = 0 + +answer.encodingLength = function (a) { + const data = (a.data !== null && a.data !== undefined) ? a.data : a.options + return name.encodingLength(a.name) + 8 + renc(a.type).encodingLength(data) +} + +const question = exports.question = {} + +question.encode = function (q, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(question.encodingLength(q)) + if (!offset) offset = 0 + + const oldOffset = offset + + name.encode(q.name, buf, offset) + offset += name.encode.bytes + + buf.writeUInt16BE(types.toType(q.type), offset) + offset += 2 + + buf.writeUInt16BE(classes.toClass(q.class === undefined ? 'IN' : q.class), offset) + offset += 2 + + question.encode.bytes = offset - oldOffset + return q +} + +question.encode.bytes = 0 + +question.decode = function (buf, offset) { + if (!offset) offset = 0 + + const oldOffset = offset + const q = {} + + q.name = name.decode(buf, offset) + offset += name.decode.bytes + + q.type = types.toString(buf.readUInt16BE(offset)) + offset += 2 + + q.class = classes.toString(buf.readUInt16BE(offset)) + offset += 2 + + const qu = !!(q.class & QU_MASK) + if (qu) q.class &= NOT_QU_MASK + + question.decode.bytes = offset - oldOffset + return q +} + +question.decode.bytes = 0 + +question.encodingLength = function (q) { + return name.encodingLength(q.name) + 4 +} + +exports.AUTHORITATIVE_ANSWER = 1 << 10 +exports.TRUNCATED_RESPONSE = 1 << 9 +exports.RECURSION_DESIRED = 1 << 8 +exports.RECURSION_AVAILABLE = 1 << 7 +exports.AUTHENTIC_DATA = 1 << 5 +exports.CHECKING_DISABLED = 1 << 4 +exports.DNSSEC_OK = 1 << 15 + +exports.encode = function (result, buf, offset) { + if (!buf) buf = Buffer.allocUnsafe(exports.encodingLength(result)) + if (!offset) offset = 0 + + const oldOffset = offset + + if (!result.questions) result.questions = [] + if (!result.answers) result.answers = [] + if (!result.authorities) result.authorities = [] + if (!result.additionals) result.additionals = [] + + header.encode(result, buf, offset) + offset += header.encode.bytes + + offset = encodeList(result.questions, question, buf, offset) + offset = encodeList(result.answers, answer, buf, offset) + offset = encodeList(result.authorities, answer, buf, offset) + offset = encodeList(result.additionals, answer, buf, offset) + + exports.encode.bytes = offset - oldOffset + + return buf +} + +exports.encode.bytes = 0 + +exports.decode = function (buf, offset) { + if (!offset) offset = 0 + + const oldOffset = offset + const result = header.decode(buf, offset) + offset += header.decode.bytes + + offset = decodeList(result.questions, question, buf, offset) + offset = decodeList(result.answers, answer, buf, offset) + offset = decodeList(result.authorities, answer, buf, offset) + offset = decodeList(result.additionals, answer, buf, offset) + + exports.decode.bytes = offset - oldOffset + + return result +} + +exports.decode.bytes = 0 + +exports.encodingLength = function (result) { + return header.encodingLength(result) + + encodingLengthList(result.questions || [], question) + + encodingLengthList(result.answers || [], answer) + + encodingLengthList(result.authorities || [], answer) + + encodingLengthList(result.additionals || [], answer) +} + +exports.streamEncode = function (result) { + const buf = exports.encode(result) + const sbuf = Buffer.allocUnsafe(2) + sbuf.writeUInt16BE(buf.byteLength) + const combine = Buffer.concat([sbuf, buf]) + exports.streamEncode.bytes = combine.byteLength + return combine +} + +exports.streamEncode.bytes = 0 + +exports.streamDecode = function (sbuf) { + const len = sbuf.readUInt16BE(0) + if (sbuf.byteLength < len + 2) { + // not enough data + return null + } + const result = exports.decode(sbuf.slice(2)) + exports.streamDecode.bytes = exports.decode.bytes + return result +} + +exports.streamDecode.bytes = 0 + +function encodingLengthList (list, enc) { + let len = 0 + for (let i = 0; i < list.length; i++) len += enc.encodingLength(list[i]) + return len +} + +function encodeList (list, enc, buf, offset) { + for (let i = 0; i < list.length; i++) { + enc.encode(list[i], buf, offset) + offset += enc.encode.bytes + } + return offset +} + +function decodeList (list, enc, buf, offset) { + for (let i = 0; i < list.length; i++) { + list[i] = enc.decode(buf, offset) + offset += enc.decode.bytes + } + return offset +} diff --git a/helloworld/node_modules/dns-packet/opcodes.js b/helloworld/node_modules/dns-packet/opcodes.js new file mode 100755 index 0000000..32b0a1b --- /dev/null +++ b/helloworld/node_modules/dns-packet/opcodes.js @@ -0,0 +1,50 @@ +'use strict' + +/* + * Traditional DNS header OPCODEs (4-bits) defined by IANA in + * https://www.iana.org/assignments/dns-parameters/dns-parameters.xhtml#dns-parameters-5 + */ + +exports.toString = function (opcode) { + switch (opcode) { + case 0: return 'QUERY' + case 1: return 'IQUERY' + case 2: return 'STATUS' + case 3: return 'OPCODE_3' + case 4: return 'NOTIFY' + case 5: return 'UPDATE' + case 6: return 'OPCODE_6' + case 7: return 'OPCODE_7' + case 8: return 'OPCODE_8' + case 9: return 'OPCODE_9' + case 10: return 'OPCODE_10' + case 11: return 'OPCODE_11' + case 12: return 'OPCODE_12' + case 13: return 'OPCODE_13' + case 14: return 'OPCODE_14' + case 15: return 'OPCODE_15' + } + return 'OPCODE_' + opcode +} + +exports.toOpcode = function (code) { + switch (code.toUpperCase()) { + case 'QUERY': return 0 + case 'IQUERY': return 1 + case 'STATUS': return 2 + case 'OPCODE_3': return 3 + case 'NOTIFY': return 4 + case 'UPDATE': return 5 + case 'OPCODE_6': return 6 + case 'OPCODE_7': return 7 + case 'OPCODE_8': return 8 + case 'OPCODE_9': return 9 + case 'OPCODE_10': return 10 + case 'OPCODE_11': return 11 + case 'OPCODE_12': return 12 + case 'OPCODE_13': return 13 + case 'OPCODE_14': return 14 + case 'OPCODE_15': return 15 + } + return 0 +} diff --git a/helloworld/node_modules/dns-packet/optioncodes.js b/helloworld/node_modules/dns-packet/optioncodes.js new file mode 100755 index 0000000..0d66e05 --- /dev/null +++ b/helloworld/node_modules/dns-packet/optioncodes.js @@ -0,0 +1,59 @@ +'use strict' + +exports.toString = function (type) { + switch (type) { + // list at + // https://www.iana.org/assignments/dns-parameters/dns-parameters.xhtml#dns-parameters-11 + case 1: return 'LLQ' + case 2: return 'UL' + case 3: return 'NSID' + case 5: return 'DAU' + case 6: return 'DHU' + case 7: return 'N3U' + case 8: return 'CLIENT_SUBNET' + case 9: return 'EXPIRE' + case 10: return 'COOKIE' + case 11: return 'TCP_KEEPALIVE' + case 12: return 'PADDING' + case 13: return 'CHAIN' + case 14: return 'KEY_TAG' + case 26946: return 'DEVICEID' + } + if (type < 0) { + return null + } + return `OPTION_${type}` +} + +exports.toCode = function (name) { + if (typeof name === 'number') { + return name + } + if (!name) { + return -1 + } + switch (name.toUpperCase()) { + case 'OPTION_0': return 0 + case 'LLQ': return 1 + case 'UL': return 2 + case 'NSID': return 3 + case 'OPTION_4': return 4 + case 'DAU': return 5 + case 'DHU': return 6 + case 'N3U': return 7 + case 'CLIENT_SUBNET': return 8 + case 'EXPIRE': return 9 + case 'COOKIE': return 10 + case 'TCP_KEEPALIVE': return 11 + case 'PADDING': return 12 + case 'CHAIN': return 13 + case 'KEY_TAG': return 14 + case 'DEVICEID': return 26946 + case 'OPTION_65535': return 65535 + } + const m = name.match(/_(\d+)$/) + if (m) { + return parseInt(m[1], 10) + } + return -1 +} diff --git a/helloworld/node_modules/dns-packet/rcodes.js b/helloworld/node_modules/dns-packet/rcodes.js new file mode 100755 index 0000000..0500887 --- /dev/null +++ b/helloworld/node_modules/dns-packet/rcodes.js @@ -0,0 +1,50 @@ +'use strict' + +/* + * Traditional DNS header RCODEs (4-bits) defined by IANA in + * https://www.iana.org/assignments/dns-parameters/dns-parameters.xhtml + */ + +exports.toString = function (rcode) { + switch (rcode) { + case 0: return 'NOERROR' + case 1: return 'FORMERR' + case 2: return 'SERVFAIL' + case 3: return 'NXDOMAIN' + case 4: return 'NOTIMP' + case 5: return 'REFUSED' + case 6: return 'YXDOMAIN' + case 7: return 'YXRRSET' + case 8: return 'NXRRSET' + case 9: return 'NOTAUTH' + case 10: return 'NOTZONE' + case 11: return 'RCODE_11' + case 12: return 'RCODE_12' + case 13: return 'RCODE_13' + case 14: return 'RCODE_14' + case 15: return 'RCODE_15' + } + return 'RCODE_' + rcode +} + +exports.toRcode = function (code) { + switch (code.toUpperCase()) { + case 'NOERROR': return 0 + case 'FORMERR': return 1 + case 'SERVFAIL': return 2 + case 'NXDOMAIN': return 3 + case 'NOTIMP': return 4 + case 'REFUSED': return 5 + case 'YXDOMAIN': return 6 + case 'YXRRSET': return 7 + case 'NXRRSET': return 8 + case 'NOTAUTH': return 9 + case 'NOTZONE': return 10 + case 'RCODE_11': return 11 + case 'RCODE_12': return 12 + case 'RCODE_13': return 13 + case 'RCODE_14': return 14 + case 'RCODE_15': return 15 + } + return 0 +} diff --git a/helloworld/node_modules/dns-packet/types.js b/helloworld/node_modules/dns-packet/types.js new file mode 100755 index 0000000..3cd78bd --- /dev/null +++ b/helloworld/node_modules/dns-packet/types.js @@ -0,0 +1,103 @@ +'use strict' + +exports.toString = function (type) { + switch (type) { + case 1: return 'A' + case 10: return 'NULL' + case 28: return 'AAAA' + case 18: return 'AFSDB' + case 42: return 'APL' + case 257: return 'CAA' + case 60: return 'CDNSKEY' + case 59: return 'CDS' + case 37: return 'CERT' + case 5: return 'CNAME' + case 49: return 'DHCID' + case 32769: return 'DLV' + case 39: return 'DNAME' + case 48: return 'DNSKEY' + case 43: return 'DS' + case 55: return 'HIP' + case 13: return 'HINFO' + case 45: return 'IPSECKEY' + case 25: return 'KEY' + case 36: return 'KX' + case 29: return 'LOC' + case 15: return 'MX' + case 35: return 'NAPTR' + case 2: return 'NS' + case 47: return 'NSEC' + case 50: return 'NSEC3' + case 51: return 'NSEC3PARAM' + case 12: return 'PTR' + case 46: return 'RRSIG' + case 17: return 'RP' + case 24: return 'SIG' + case 6: return 'SOA' + case 99: return 'SPF' + case 33: return 'SRV' + case 44: return 'SSHFP' + case 32768: return 'TA' + case 249: return 'TKEY' + case 52: return 'TLSA' + case 250: return 'TSIG' + case 16: return 'TXT' + case 252: return 'AXFR' + case 251: return 'IXFR' + case 41: return 'OPT' + case 255: return 'ANY' + } + return 'UNKNOWN_' + type +} + +exports.toType = function (name) { + switch (name.toUpperCase()) { + case 'A': return 1 + case 'NULL': return 10 + case 'AAAA': return 28 + case 'AFSDB': return 18 + case 'APL': return 42 + case 'CAA': return 257 + case 'CDNSKEY': return 60 + case 'CDS': return 59 + case 'CERT': return 37 + case 'CNAME': return 5 + case 'DHCID': return 49 + case 'DLV': return 32769 + case 'DNAME': return 39 + case 'DNSKEY': return 48 + case 'DS': return 43 + case 'HIP': return 55 + case 'HINFO': return 13 + case 'IPSECKEY': return 45 + case 'KEY': return 25 + case 'KX': return 36 + case 'LOC': return 29 + case 'MX': return 15 + case 'NAPTR': return 35 + case 'NS': return 2 + case 'NSEC': return 47 + case 'NSEC3': return 50 + case 'NSEC3PARAM': return 51 + case 'PTR': return 12 + case 'RRSIG': return 46 + case 'RP': return 17 + case 'SIG': return 24 + case 'SOA': return 6 + case 'SPF': return 99 + case 'SRV': return 33 + case 'SSHFP': return 44 + case 'TA': return 32768 + case 'TKEY': return 249 + case 'TLSA': return 52 + case 'TSIG': return 250 + case 'TXT': return 16 + case 'AXFR': return 252 + case 'IXFR': return 251 + case 'OPT': return 41 + case 'ANY': return 255 + case '*': return 255 + } + if (name.toUpperCase().startsWith('UNKNOWN_')) return parseInt(name.slice(8)) + return 0 +} diff --git a/helloworld/node_modules/dns-socket/CHANGELOG.md b/helloworld/node_modules/dns-socket/CHANGELOG.md new file mode 100755 index 0000000..39fdcd0 --- /dev/null +++ b/helloworld/node_modules/dns-socket/CHANGELOG.md @@ -0,0 +1,13 @@ +# Version 3.0.0 - 2018-02-11 + +- Feature: The MX record type is now supported. +- Breaking: The value of TXT records is now always an array of Buffers. +- Breaking: Renamed the `flag_trunc` and `flag_auth` to `flag_tc` and `flag_aa` to match the names of these in the dns standards. + +# Version 2.0.0 - 2018-01-14 + +- Feature: The SOA record type is now supported. +- Feature: The NS record type is now supported. +- Feature: Added header flag properties. +- Breaking: Node.js 4.0.0 is now required. +- Breaking: The `class` option has been changed from integer to string. diff --git a/helloworld/node_modules/dns-socket/LICENSE b/helloworld/node_modules/dns-socket/LICENSE new file mode 100755 index 0000000..bae9da7 --- /dev/null +++ b/helloworld/node_modules/dns-socket/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Mathias Buus + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/helloworld/node_modules/dns-socket/README.md b/helloworld/node_modules/dns-socket/README.md new file mode 100755 index 0000000..e85fcac --- /dev/null +++ b/helloworld/node_modules/dns-socket/README.md @@ -0,0 +1,77 @@ +# dns-socket +[![](https://img.shields.io/npm/v/dns-socket.svg?style=flat)](https://www.npmjs.org/package/dns-socket) [![](https://img.shields.io/npm/dm/dns-socket.svg)](https://www.npmjs.org/package/dns-socket) [![](https://api.travis-ci.org/mafintosh/dns-socket.svg?style=flat)](https://travis-ci.org/mafintosh/dns-socket) + +Make low-level DNS requests with retry and timeout support. + +``` +npm install dns-socket +``` + +## Usage + +``` js +const dnsSocket = require('dns-socket') +const socket = dnsSocket() + +socket.query({ + questions: [{ + type: 'A', + name: 'google.com' + }] +}, 53, '8.8.8.8', (err, res) => { + console.log(err, res) // prints the A record for google.com +}) +``` + +## API + +#### `var socket = dns([options])` + +Create a new DNS socket instance. The `options` object includes: + +- `retries` *Number*: Number of total query attempts made during `timeout`. Default: 5. +- `socket` *Object*: A custom dgram socket. Default: A `'udp4'` socket. +- `timeout` *Number*: Total timeout in milliseconds after which a `'timeout'` event is emitted. Default: 7500. +- `maxQueries` *Number*: Each request has an id, this is stored as static sized array. maxQueries is the size of this array, limiting the max number of inflight requests. Default: 10000. +- `maxRedirects` *Number*: If you query for a single `A` record and get back `CNAME`, the lib will try to follow the chain and resolve the `CNAME` to A. The maximum number of steps is defined by the `maxRedirects`. Default: 0 +- `timeoutChecks` *Number*: Timeouts are checked each `timeoutChecks` ms, for large number of parallel request, you might want to increase this number. Default: `timeout` / 10 + +#### `socket.on('query', query, port, host)` + +Emitted when a dns query is received. The query is a [dns-packet](https://github.com/mafintosh/dns-packet) + +#### `socket.on('response', response, port, host)` + +Emitted when a dns response is received. The response is a [dns-packet](https://github.com/mafintosh/dns-packet) + +#### `var id = socket.query(query, port, [host], [callback])` + +Send a dns query. If host is omitted it defaults to `127.0.0.1`. When the remote replies the callback is called with `(err, response, query)` and an response is emitted as well. If the query times out the callback is called with an error. +The `host` parameter can be an array, during resolve the lib will randomly select one host. + +Returns the query id + +#### `socket.response(query, response, port, [host])` + +Send a response to a query. + +#### `socket.cancel(id)` + +Cancel a query + +#### `socket.bind([port][, address][, onlistening])` +#### `socket.bind(options, [onlistening])` + +Bind the underlying udp socket to a specific port. Takes the same arguments as [socket#bind](https://nodejs.org/docs/latest/api/dgram.html#dgram_socket_bind_port_address_callback). + +#### `socket.destroy([onclose])` + +Destroy the socket. + +#### `socket.inflight` + +Number of inflight queries. + +## License + +MIT diff --git a/helloworld/node_modules/dns-socket/index.js b/helloworld/node_modules/dns-socket/index.js new file mode 100755 index 0000000..810fd05 --- /dev/null +++ b/helloworld/node_modules/dns-socket/index.js @@ -0,0 +1,287 @@ +'use strict' + +const dgram = require('dgram') +const util = require('util') +const packet = require('dns-packet') +const events = require('events') + +module.exports = DNS + +function DNS (opts) { + if (!(this instanceof DNS)) { + return new DNS(opts) + } + if (!opts) { + opts = {} + } + + events.EventEmitter.call(this) + + const self = this + + this.retries = opts.retries || 5 + this.timeout = opts.timeout || 7500 + this.timeoutChecks = opts.timeoutChecks || (this.timeout / 10) + this.destroyed = false + this.inflight = 0 + this.maxQueries = opts.maxQueries || 10000 + this.maxRedirects = opts.maxRedirects || 0 + this.socket = opts.socket || dgram.createSocket('udp4') + this._id = Math.ceil(Math.random() * this.maxQueries) + this._queries = new Array(this.maxQueries).fill(null) + this._interval = null + + this.socket.on('error', onerror) + this.socket.on('message', onmessage) + if (isListening(this.socket)) onlistening() + else this.socket.on('listening', onlistening) + this.socket.on('close', onclose) + + function onerror (err) { + if (err.code === 'EACCES' || err.code === 'EADDRINUSE') { + self.emit('error', err) + } else { + self.emit('warning', err) + } + } + + function onmessage (message, rinfo) { + self._onmessage(message, rinfo) + } + + function ontimeoutCheck () { + self._ontimeoutCheck() + } + + function onlistening () { + self._interval = setInterval(ontimeoutCheck, self.timeoutChecks) + self.emit('listening') + } + + function onclose () { + self.emit('close') + } +} + +util.inherits(DNS, events.EventEmitter) + +DNS.RECURSION_DESIRED = DNS.prototype.RECURSION_DESIRED = packet.RECURSION_DESIRED +DNS.RECURSION_AVAILABLE = DNS.prototype.RECURSION_AVAILABLE = packet.RECURSION_AVAILABLE +DNS.TRUNCATED_RESPONSE = DNS.prototype.TRUNCATED_RESPONSE = packet.TRUNCATED_RESPONSE +DNS.AUTHORITATIVE_ANSWER = DNS.prototype.AUTHORITATIVE_ANSWER = packet.AUTHORITATIVE_ANSWER +DNS.AUTHENTIC_DATA = DNS.prototype.AUTHENTIC_DATA = packet.AUTHENTIC_DATA +DNS.CHECKING_DISABLED = DNS.prototype.CHECKING_DISABLED = packet.CHECKING_DISABLED + +DNS.prototype.address = function () { + return this.socket.address() +} + +DNS.prototype.bind = function (...args) { + const onlistening = args.length > 0 && args[args.length - 1] + if (typeof onlistening === 'function') { + this.once('listening', onlistening) + this.socket.bind(...args.slice(0, -1)) + } else { + this.socket.bind(...args) + } +} + +DNS.prototype.destroy = function (onclose) { + if (onclose) { + this.once('close', onclose) + } + if (this.destroyed) { + return + } + this.destroyed = true + clearInterval(this._interval) + this.socket.close() + + for (let i = 0; i < this.maxQueries; i++) { + const q = this._queries[i] + if (q) { + q.callback(new Error('Socket destroyed')) + this._queries[i] = null + } + } + this.inflight = 0 +} + +DNS.prototype._ontimeoutCheck = function () { + const now = Date.now() + for (let i = 0; i < this.maxQueries; i++) { + const q = this._queries[i] + + if ((!q) || (now - q.firstTry < (q.tries + 1) * this.timeout)) { + continue + } + + if (q.tries > this.retries) { + this._queries[i] = null + this.inflight-- + this.emit('timeout', q.query, q.port, q.host) + q.callback(new Error('Query timed out')) + continue + } + q.tries++ + this.socket.send(q.buffer, 0, q.buffer.length, q.port, Array.isArray(q.host) ? q.host[Math.floor(q.host.length * Math.random())] : q.host || '127.0.0.1') + } +} + +DNS.prototype._shouldRedirect = function (q, result) { + // no redirects, no query, more than 1 questions, has any A record answer + if (this.maxRedirects <= 0 || (!q) || (q.query.questions.length !== 1) || result.answers.filter(e => e.type === 'A').length > 0) { + return false + } + + // no more redirects left + if (q.redirects > this.maxRedirects) { + return false + } + + const cnameresults = result.answers.filter(e => e.type === 'CNAME') + if (cnameresults.length === 0) { + return false + } + + const id = this._getNextEmptyId() + if (id === -1) { + q.callback(new Error('Query array is full!')) + return true + } + + // replace current query with a new one + q.query = { + id: id + 1, + flags: packet.RECURSION_DESIRED, + questions: [{ + type: 'A', + name: cnameresults[0].data + }] + } + q.redirects++ + q.firstTry = Date.now() + q.tries = 0 + q.buffer = packet.encode(q.query) + this._queries[id] = q + this.socket.send(q.buffer, 0, q.buffer.length, q.port, Array.isArray(q.host) ? q.host[Math.floor(q.host.length * Math.random())] : q.host || '127.0.0.1') + return true +} + +DNS.prototype._onmessage = function (buffer, rinfo) { + let message + + try { + message = packet.decode(buffer) + } catch (err) { + this.emit('warning', err) + return + } + + if (message.type === 'response' && message.id) { + const q = this._queries[message.id - 1] + if (q) { + this._queries[message.id - 1] = null + this.inflight-- + + if (!this._shouldRedirect(q, message)) { + q.callback(null, message) + } + } + } + + this.emit(message.type, message, rinfo.port, rinfo.address) +} + +DNS.prototype.unref = function () { + this.socket.unref() +} + +DNS.prototype.ref = function () { + this.socket.ref() +} + +DNS.prototype.response = function (query, response, port, host) { + if (this.destroyed) { + return + } + + response.type = 'response' + response.id = query.id + const buffer = packet.encode(response) + this.socket.send(buffer, 0, buffer.length, port, host) +} + +DNS.prototype.cancel = function (id) { + const q = this._queries[id] + if (!q) return + + this._queries[id] = null + this.inflight-- + q.callback(new Error('Query cancelled')) +} + +DNS.prototype.setRetries = function (id, retries) { + const q = this._queries[id] + if (!q) return + q.firstTry = q.firstTry - this.timeout * (retries - q.retries) + q.retries = this.retries - retries +} + +DNS.prototype._getNextEmptyId = function () { + // try to find the next unused id + let id = -1 + for (let idtries = this.maxQueries; idtries > 0; idtries--) { + const normalizedId = (this._id + idtries) % this.maxQueries + if (this._queries[normalizedId] === null) { + id = normalizedId + this._id = (normalizedId + 1) % this.maxQueries + break + } + } + return id +} + +DNS.prototype.query = function (query, port, host, cb) { + if (this.destroyed) { + cb(new Error('Socket destroyed')) + return 0 + } + + this.inflight++ + query.type = 'query' + query.flags = typeof query.flags === 'number' ? query.flags : DNS.RECURSION_DESIRED + + const id = this._getNextEmptyId() + if (id === -1) { + cb(new Error('Query array is full!')) + return 0 + } + + query.id = id + 1 + const buffer = packet.encode(query) + + this._queries[id] = { + callback: cb || noop, + redirects: 0, + firstTry: Date.now(), + query: query, + tries: 0, + buffer: buffer, + port: port, + host: host + } + this.socket.send(buffer, 0, buffer.length, port, Array.isArray(host) ? host[Math.floor(host.length * Math.random())] : host || '127.0.0.1') + return id +} + +function noop () { +} + +function isListening (socket) { + try { + return socket.address().port !== 0 + } catch (err) { + return false + } +} diff --git a/helloworld/node_modules/duplexer3/LICENSE.md b/helloworld/node_modules/duplexer3/LICENSE.md new file mode 100755 index 0000000..547189a --- /dev/null +++ b/helloworld/node_modules/duplexer3/LICENSE.md @@ -0,0 +1,26 @@ +Copyright (c) 2013, Deoxxa Development +====================================== +All rights reserved. +-------------------- + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. +3. Neither the name of Deoxxa Development nor the names of its contributors + may be used to endorse or promote products derived from this software + without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY DEOXXA DEVELOPMENT ''AS IS'' AND ANY +EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL DEOXXA DEVELOPMENT BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/helloworld/node_modules/duplexer3/README.md b/helloworld/node_modules/duplexer3/README.md new file mode 100755 index 0000000..9f95ddf --- /dev/null +++ b/helloworld/node_modules/duplexer3/README.md @@ -0,0 +1,115 @@ +# duplexer3 [![Build Status](https://travis-ci.org/floatdrop/duplexer3.svg?branch=master)](https://travis-ci.org/floatdrop/duplexer3) [![Coverage Status](https://coveralls.io/repos/floatdrop/duplexer3/badge.svg?branch=master&service=github)](https://coveralls.io/github/floatdrop/duplexer3?branch=master) + +Like [duplexer2](https://github.com/deoxxa/duplexer2) but using Streams3 without readable-stream dependency + +```javascript +var stream = require("stream"); + +var duplexer3 = require("duplexer3"); + +var writable = new stream.Writable({objectMode: true}), + readable = new stream.Readable({objectMode: true}); + +writable._write = function _write(input, encoding, done) { + if (readable.push(input)) { + return done(); + } else { + readable.once("drain", done); + } +}; + +readable._read = function _read(n) { + // no-op +}; + +// simulate the readable thing closing after a bit +writable.once("finish", function() { + setTimeout(function() { + readable.push(null); + }, 500); +}); + +var duplex = duplexer3(writable, readable); + +duplex.on("data", function(e) { + console.log("got data", JSON.stringify(e)); +}); + +duplex.on("finish", function() { + console.log("got finish event"); +}); + +duplex.on("end", function() { + console.log("got end event"); +}); + +duplex.write("oh, hi there", function() { + console.log("finished writing"); +}); + +duplex.end(function() { + console.log("finished ending"); +}); +``` + +``` +got data "oh, hi there" +finished writing +got finish event +finished ending +got end event +``` + +## Overview + +This is a reimplementation of [duplexer](https://www.npmjs.com/package/duplexer) using the +Streams3 API which is standard in Node as of v4. Everything largely +works the same. + + + +## Installation + +[Available via `npm`](https://docs.npmjs.com/cli/install): + +``` +$ npm i duplexer3 +``` + +## API + +### duplexer3 + +Creates a new `DuplexWrapper` object, which is the actual class that implements +most of the fun stuff. All that fun stuff is hidden. DON'T LOOK. + +```javascript +duplexer3([options], writable, readable) +``` + +```javascript +const duplex = duplexer3(new stream.Writable(), new stream.Readable()); +``` + +Arguments + +* __options__ - an object specifying the regular `stream.Duplex` options, as + well as the properties described below. +* __writable__ - a writable stream +* __readable__ - a readable stream + +Options + +* __bubbleErrors__ - a boolean value that specifies whether to bubble errors + from the underlying readable/writable streams. Default is `true`. + + +## License + +3-clause BSD. [A copy](./LICENSE) is included with the source. + +## Contact + +* GitHub ([deoxxa](http://github.com/deoxxa)) +* Twitter ([@deoxxa](http://twitter.com/deoxxa)) +* Email ([deoxxa@fknsrs.biz](mailto:deoxxa@fknsrs.biz)) diff --git a/helloworld/node_modules/duplexer3/index.js b/helloworld/node_modules/duplexer3/index.js new file mode 100755 index 0000000..1339ffc --- /dev/null +++ b/helloworld/node_modules/duplexer3/index.js @@ -0,0 +1,76 @@ +"use strict"; + +var stream = require("stream"); + +function DuplexWrapper(options, writable, readable) { + if (typeof readable === "undefined") { + readable = writable; + writable = options; + options = null; + } + + stream.Duplex.call(this, options); + + if (typeof readable.read !== "function") { + readable = (new stream.Readable(options)).wrap(readable); + } + + this._writable = writable; + this._readable = readable; + this._waiting = false; + + var self = this; + + writable.once("finish", function() { + self.end(); + }); + + this.once("finish", function() { + writable.end(); + }); + + readable.on("readable", function() { + if (self._waiting) { + self._waiting = false; + self._read(); + } + }); + + readable.once("end", function() { + self.push(null); + }); + + if (!options || typeof options.bubbleErrors === "undefined" || options.bubbleErrors) { + writable.on("error", function(err) { + self.emit("error", err); + }); + + readable.on("error", function(err) { + self.emit("error", err); + }); + } +} + +DuplexWrapper.prototype = Object.create(stream.Duplex.prototype, {constructor: {value: DuplexWrapper}}); + +DuplexWrapper.prototype._write = function _write(input, encoding, done) { + this._writable.write(input, encoding, done); +}; + +DuplexWrapper.prototype._read = function _read() { + var buf; + var reads = 0; + while ((buf = this._readable.read()) !== null) { + this.push(buf); + reads++; + } + if (reads === 0) { + this._waiting = true; + } +}; + +module.exports = function duplex2(options, writable, readable) { + return new DuplexWrapper(options, writable, readable); +}; + +module.exports.DuplexWrapper = DuplexWrapper; diff --git a/helloworld/node_modules/end-of-stream/LICENSE b/helloworld/node_modules/end-of-stream/LICENSE new file mode 100755 index 0000000..757562e --- /dev/null +++ b/helloworld/node_modules/end-of-stream/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Mathias Buus + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/helloworld/node_modules/end-of-stream/README.md b/helloworld/node_modules/end-of-stream/README.md new file mode 100755 index 0000000..f2560c9 --- /dev/null +++ b/helloworld/node_modules/end-of-stream/README.md @@ -0,0 +1,52 @@ +# end-of-stream + +A node module that calls a callback when a readable/writable/duplex stream has completed or failed. + + npm install end-of-stream + +## Usage + +Simply pass a stream and a callback to the `eos`. +Both legacy streams, streams2 and stream3 are supported. + +``` js +var eos = require('end-of-stream'); + +eos(readableStream, function(err) { + // this will be set to the stream instance + if (err) return console.log('stream had an error or closed early'); + console.log('stream has ended', this === readableStream); +}); + +eos(writableStream, function(err) { + if (err) return console.log('stream had an error or closed early'); + console.log('stream has finished', this === writableStream); +}); + +eos(duplexStream, function(err) { + if (err) return console.log('stream had an error or closed early'); + console.log('stream has ended and finished', this === duplexStream); +}); + +eos(duplexStream, {readable:false}, function(err) { + if (err) return console.log('stream had an error or closed early'); + console.log('stream has finished but might still be readable'); +}); + +eos(duplexStream, {writable:false}, function(err) { + if (err) return console.log('stream had an error or closed early'); + console.log('stream has ended but might still be writable'); +}); + +eos(readableStream, {error:false}, function(err) { + // do not treat emit('error', err) as a end-of-stream +}); +``` + +## License + +MIT + +## Related + +`end-of-stream` is part of the [mississippi stream utility collection](https://github.com/maxogden/mississippi) which includes more useful stream modules similar to this one. diff --git a/helloworld/node_modules/end-of-stream/index.js b/helloworld/node_modules/end-of-stream/index.js new file mode 100755 index 0000000..be426c2 --- /dev/null +++ b/helloworld/node_modules/end-of-stream/index.js @@ -0,0 +1,87 @@ +var once = require('once'); + +var noop = function() {}; + +var isRequest = function(stream) { + return stream.setHeader && typeof stream.abort === 'function'; +}; + +var isChildProcess = function(stream) { + return stream.stdio && Array.isArray(stream.stdio) && stream.stdio.length === 3 +}; + +var eos = function(stream, opts, callback) { + if (typeof opts === 'function') return eos(stream, null, opts); + if (!opts) opts = {}; + + callback = once(callback || noop); + + var ws = stream._writableState; + var rs = stream._readableState; + var readable = opts.readable || (opts.readable !== false && stream.readable); + var writable = opts.writable || (opts.writable !== false && stream.writable); + + var onlegacyfinish = function() { + if (!stream.writable) onfinish(); + }; + + var onfinish = function() { + writable = false; + if (!readable) callback.call(stream); + }; + + var onend = function() { + readable = false; + if (!writable) callback.call(stream); + }; + + var onexit = function(exitCode) { + callback.call(stream, exitCode ? new Error('exited with error code: ' + exitCode) : null); + }; + + var onerror = function(err) { + callback.call(stream, err); + }; + + var onclose = function() { + if (readable && !(rs && rs.ended)) return callback.call(stream, new Error('premature close')); + if (writable && !(ws && ws.ended)) return callback.call(stream, new Error('premature close')); + }; + + var onrequest = function() { + stream.req.on('finish', onfinish); + }; + + if (isRequest(stream)) { + stream.on('complete', onfinish); + stream.on('abort', onclose); + if (stream.req) onrequest(); + else stream.on('request', onrequest); + } else if (writable && !ws) { // legacy streams + stream.on('end', onlegacyfinish); + stream.on('close', onlegacyfinish); + } + + if (isChildProcess(stream)) stream.on('exit', onexit); + + stream.on('end', onend); + stream.on('finish', onfinish); + if (opts.error !== false) stream.on('error', onerror); + stream.on('close', onclose); + + return function() { + stream.removeListener('complete', onfinish); + stream.removeListener('abort', onclose); + stream.removeListener('request', onrequest); + if (stream.req) stream.req.removeListener('finish', onfinish); + stream.removeListener('end', onlegacyfinish); + stream.removeListener('close', onlegacyfinish); + stream.removeListener('finish', onfinish); + stream.removeListener('exit', onexit); + stream.removeListener('end', onend); + stream.removeListener('error', onerror); + stream.removeListener('close', onclose); + }; +}; + +module.exports = eos; diff --git a/helloworld/node_modules/engine.io-client/LICENSE b/helloworld/node_modules/engine.io-client/LICENSE new file mode 100755 index 0000000..b248ba1 --- /dev/null +++ b/helloworld/node_modules/engine.io-client/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2015 Automattic + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/helloworld/node_modules/engine.io-client/README.md b/helloworld/node_modules/engine.io-client/README.md new file mode 100755 index 0000000..9ab91ca --- /dev/null +++ b/helloworld/node_modules/engine.io-client/README.md @@ -0,0 +1,299 @@ + +# Engine.IO client + +[![Build Status](https://travis-ci.org/socketio/engine.io-client.svg?branch=master)](http://travis-ci.org/socketio/engine.io-client) +[![NPM version](https://badge.fury.io/js/engine.io-client.svg)](http://badge.fury.io/js/engine.io-client) + +This is the client for [Engine.IO](http://github.com/socketio/engine.io), +the implementation of transport-based cross-browser/cross-device +bi-directional communication layer for [Socket.IO](http://github.com/socketio/socket.io). + +## How to use + +### Standalone + +You can find an `engine.io.js` file in this repository, which is a +standalone build you can use as follows: + +```html + + +``` + +### With browserify + +Engine.IO is a commonjs module, which means you can include it by using +`require` on the browser and package using [browserify](http://browserify.org/): + +1. install the client package + + ```bash + $ npm install engine.io-client + ``` + +1. write your app code + + ```js + var socket = require('engine.io-client')('ws://localhost'); + socket.on('open', function(){ + socket.on('message', function(data){}); + socket.on('close', function(){}); + }); + ``` + +1. build your app bundle + + ```bash + $ browserify app.js > bundle.js + ``` + +1. include on your page + + ```html + + ``` + +### Sending and receiving binary + +```html + + +``` + +### Node.JS + +Add `engine.io-client` to your `package.json` and then: + +```js +var socket = require('engine.io-client')('ws://localhost'); +socket.on('open', function(){ + socket.on('message', function(data){}); + socket.on('close', function(){}); +}); +``` + +### Node.js with certificates +```js +var opts = { + key: fs.readFileSync('test/fixtures/client.key'), + cert: fs.readFileSync('test/fixtures/client.crt'), + ca: fs.readFileSync('test/fixtures/ca.crt') +}; + +var socket = require('engine.io-client')('ws://localhost', opts); +socket.on('open', function(){ + socket.on('message', function(data){}); + socket.on('close', function(){}); +}); +``` + +### Node.js with extraHeaders +```js +var opts = { + extraHeaders: { + 'X-Custom-Header-For-My-Project': 'my-secret-access-token', + 'Cookie': 'user_session=NI2JlCKF90aE0sJZD9ZzujtdsUqNYSBYxzlTsvdSUe35ZzdtVRGqYFr0kdGxbfc5gUOkR9RGp20GVKza; path=/; expires=Tue, 07-Apr-2015 18:18:08 GMT; secure; HttpOnly' + } +}; + +var socket = require('engine.io-client')('ws://localhost', opts); +socket.on('open', function(){ + socket.on('message', function(data){}); + socket.on('close', function(){}); +}); +``` + +## Features + +- Lightweight +- Runs on browser and node.js seamlessly +- Transports are independent of `Engine` + - Easy to debug + - Easy to unit test +- Runs inside HTML5 WebWorker +- Can send and receive binary data + - Receives as ArrayBuffer or Blob when in browser, and Buffer or ArrayBuffer + in Node + - When XHR2 or WebSockets are used, binary is emitted directly. Otherwise + binary is encoded into base64 strings, and decoded when binary types are + supported. + - With browsers that don't support ArrayBuffer, an object { base64: true, + data: dataAsBase64String } is emitted on the `message` event. + +## API + +### Socket + +The client class. Mixes in [Emitter](http://github.com/component/emitter). +Exposed as `eio` in the browser standalone build. + +#### Properties + +- `protocol` _(Number)_: protocol revision number +- `binaryType` _(String)_ : can be set to 'arraybuffer' or 'blob' in browsers, + and `buffer` or `arraybuffer` in Node. Blob is only used in browser if it's + supported. + +#### Events + +- `open` + - Fired upon successful connection. +- `message` + - Fired when data is received from the server. + - **Arguments** + - `String` | `ArrayBuffer`: utf-8 encoded data or ArrayBuffer containing + binary data +- `close` + - Fired upon disconnection. In compliance with the WebSocket API spec, this event may be + fired even if the `open` event does not occur (i.e. due to connection error or `close()`). +- `error` + - Fired when an error occurs. +- `flush` + - Fired upon completing a buffer flush +- `drain` + - Fired after `drain` event of transport if writeBuffer is empty +- `upgradeError` + - Fired if an error occurs with a transport we're trying to upgrade to. +- `upgrade` + - Fired upon upgrade success, after the new transport is set +- `ping` + - Fired upon _flushing_ a ping packet (ie: actual packet write out) +- `pong` + - Fired upon receiving a pong packet. + +#### Methods + +- **constructor** + - Initializes the client + - **Parameters** + - `String` uri + - `Object`: optional, options object + - **Options** + - `agent` (`http.Agent`): `http.Agent` to use, defaults to `false` (NodeJS only) + - `upgrade` (`Boolean`): defaults to true, whether the client should try + to upgrade the transport from long-polling to something better. + - `forceJSONP` (`Boolean`): forces JSONP for polling transport. + - `jsonp` (`Boolean`): determines whether to use JSONP when + necessary for polling. If disabled (by settings to false) an error will + be emitted (saying "No transports available") if no other transports + are available. If another transport is available for opening a + connection (e.g. WebSocket) that transport + will be used instead. + - `forceBase64` (`Boolean`): forces base 64 encoding for polling transport even when XHR2 responseType is available and WebSocket even if the used standard supports binary. + - `enablesXDR` (`Boolean`): enables XDomainRequest for IE8 to avoid loading bar flashing with click sound. default to `false` because XDomainRequest has a flaw of not sending cookie. + - `timestampRequests` (`Boolean`): whether to add the timestamp with each + transport request. Note: polling requests are always stamped unless this + option is explicitly set to `false` (`false`) + - `timestampParam` (`String`): timestamp parameter (`t`) + - `policyPort` (`Number`): port the policy server listens on (`843`) + - `path` (`String`): path to connect to, default is `/engine.io` + - `transports` (`Array`): a list of transports to try (in order). + Defaults to `['polling', 'websocket']`. `Engine` + always attempts to connect directly with the first one, provided the + feature detection test for it passes. + - `transportOptions` (`Object`): hash of options, indexed by transport name, overriding the common options for the given transport + - `rememberUpgrade` (`Boolean`): defaults to false. + If true and if the previous websocket connection to the server succeeded, + the connection attempt will bypass the normal upgrade process and will initially + try websocket. A connection attempt following a transport error will use the + normal upgrade process. It is recommended you turn this on only when using + SSL/TLS connections, or if you know that your network does not block websockets. + - `pfx` (`String`|`Buffer`): Certificate, Private key and CA certificates to use for SSL. Can be used in Node.js client environment to manually specify certificate information. + - `key` (`String`): Private key to use for SSL. Can be used in Node.js client environment to manually specify certificate information. + - `passphrase` (`String`): A string of passphrase for the private key or pfx. Can be used in Node.js client environment to manually specify certificate information. + - `cert` (`String`): Public x509 certificate to use. Can be used in Node.js client environment to manually specify certificate information. + - `ca` (`String`|`Array`): An authority certificate or array of authority certificates to check the remote host against.. Can be used in Node.js client environment to manually specify certificate information. + - `ciphers` (`String`): A string describing the ciphers to use or exclude. Consult the [cipher format list](http://www.openssl.org/docs/apps/ciphers.html#CIPHER_LIST_FORMAT) for details on the format. Can be used in Node.js client environment to manually specify certificate information. + - `rejectUnauthorized` (`Boolean`): If true, the server certificate is verified against the list of supplied CAs. An 'error' event is emitted if verification fails. Verification happens at the connection level, before the HTTP request is sent. Can be used in Node.js client environment to manually specify certificate information. + - `perMessageDeflate` (`Object|Boolean`): parameters of the WebSocket permessage-deflate extension + (see [ws module](https://github.com/einaros/ws) api docs). Set to `false` to disable. (`true`) + - `threshold` (`Number`): data is compressed only if the byte size is above this value. This option is ignored on the browser. (`1024`) + - `extraHeaders` (`Object`): Headers that will be passed for each request to the server (via xhr-polling and via websockets). These values then can be used during handshake or for special proxies. Can only be used in Node.js client environment. + - `onlyBinaryUpgrades` (`Boolean`): whether transport upgrades should be restricted to transports supporting binary data (`false`) + - `forceNode` (`Boolean`): Uses NodeJS implementation for websockets - even if there is a native Browser-Websocket available, which is preferred by default over the NodeJS implementation. (This is useful when using hybrid platforms like nw.js or electron) (`false`, NodeJS only) + - `localAddress` (`String`): the local IP address to connect to + - **Polling-only options** + - `requestTimeout` (`Number`): Timeout for xhr-polling requests in milliseconds (`0`) + - **Websocket-only options** + - `protocols` (`Array`): a list of subprotocols (see [MDN reference](https://developer.mozilla.org/en-US/docs/Web/API/WebSockets_API/Writing_WebSocket_servers#Subprotocols)) +- `send` + - Sends a message to the server + - **Parameters** + - `String` | `ArrayBuffer` | `ArrayBufferView` | `Blob`: data to send + - `Object`: optional, options object + - `Function`: optional, callback upon `drain` + - **Options** + - `compress` (`Boolean`): whether to compress sending data. This option is ignored and forced to be `true` on the browser. (`true`) +- `close` + - Disconnects the client. + +### Transport + +The transport class. Private. _Inherits from EventEmitter_. + +#### Events + +- `poll`: emitted by polling transports upon starting a new request +- `pollComplete`: emitted by polling transports upon completing a request +- `drain`: emitted by polling transports upon a buffer drain + +## Tests + +`engine.io-client` is used to test +[engine](http://github.com/socketio/engine.io). Running the `engine.io` +test suite ensures the client works and vice-versa. + +Browser tests are run using [zuul](https://github.com/defunctzombie/zuul). You can +run the tests locally using the following command. + +``` +./node_modules/.bin/zuul --local 8080 -- test/index.js +``` + +Additionally, `engine.io-client` has a standalone test suite you can run +with `make test` which will run node.js and browser tests. You must have zuul setup with +a saucelabs account. + +## Support + +The support channels for `engine.io-client` are the same as `socket.io`: + - irc.freenode.net **#socket.io** + - [Google Groups](http://groups.google.com/group/socket_io) + - [Website](http://socket.io) + +## Development + +To contribute patches, run tests or benchmarks, make sure to clone the +repository: + +```bash +git clone git://github.com/socketio/engine.io-client.git +``` + +Then: + +```bash +cd engine.io-client +npm install +``` + +See the `Tests` section above for how to run tests before submitting any patches. + +## License + +MIT - Copyright (c) 2014 Automattic, Inc. diff --git a/helloworld/node_modules/engine.io-client/engine.io.js b/helloworld/node_modules/engine.io-client/engine.io.js new file mode 100755 index 0000000..1c70c23 --- /dev/null +++ b/helloworld/node_modules/engine.io-client/engine.io.js @@ -0,0 +1,4647 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["eio"] = factory(); + else + root["eio"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.loaded = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + module.exports = __webpack_require__(1); + + /** + * Exports parser + * + * @api public + * + */ + module.exports.parser = __webpack_require__(8); + +/***/ }, +/* 1 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; + + /** + * Module dependencies. + */ + + var transports = __webpack_require__(2); + var Emitter = __webpack_require__(17); + var debug = __webpack_require__(21)('engine.io-client:socket'); + var index = __webpack_require__(28); + var parser = __webpack_require__(8); + var parseuri = __webpack_require__(29); + var parseqs = __webpack_require__(18); + + /** + * Module exports. + */ + + module.exports = Socket; + + /** + * Socket constructor. + * + * @param {String|Object} uri or options + * @param {Object} options + * @api public + */ + + function Socket(uri, opts) { + if (!(this instanceof Socket)) return new Socket(uri, opts); + + opts = opts || {}; + + if (uri && 'object' === (typeof uri === 'undefined' ? 'undefined' : _typeof(uri))) { + opts = uri; + uri = null; + } + + if (uri) { + uri = parseuri(uri); + opts.hostname = uri.host; + opts.secure = uri.protocol === 'https' || uri.protocol === 'wss'; + opts.port = uri.port; + if (uri.query) opts.query = uri.query; + } else if (opts.host) { + opts.hostname = parseuri(opts.host).host; + } + + this.secure = null != opts.secure ? opts.secure : typeof location !== 'undefined' && 'https:' === location.protocol; + + if (opts.hostname && !opts.port) { + // if no port is specified manually, use the protocol default + opts.port = this.secure ? '443' : '80'; + } + + this.agent = opts.agent || false; + this.hostname = opts.hostname || (typeof location !== 'undefined' ? location.hostname : 'localhost'); + this.port = opts.port || (typeof location !== 'undefined' && location.port ? location.port : this.secure ? 443 : 80); + this.query = opts.query || {}; + if ('string' === typeof this.query) this.query = parseqs.decode(this.query); + this.upgrade = false !== opts.upgrade; + this.path = (opts.path || '/engine.io').replace(/\/$/, '') + '/'; + this.forceJSONP = !!opts.forceJSONP; + this.jsonp = false !== opts.jsonp; + this.forceBase64 = !!opts.forceBase64; + this.enablesXDR = !!opts.enablesXDR; + this.timestampParam = opts.timestampParam || 't'; + this.timestampRequests = opts.timestampRequests; + this.transports = opts.transports || ['polling', 'websocket']; + this.transportOptions = opts.transportOptions || {}; + this.readyState = ''; + this.writeBuffer = []; + this.prevBufferLen = 0; + this.policyPort = opts.policyPort || 843; + this.rememberUpgrade = opts.rememberUpgrade || false; + this.binaryType = null; + this.onlyBinaryUpgrades = opts.onlyBinaryUpgrades; + this.perMessageDeflate = false !== opts.perMessageDeflate ? opts.perMessageDeflate || {} : false; + + if (true === this.perMessageDeflate) this.perMessageDeflate = {}; + if (this.perMessageDeflate && null == this.perMessageDeflate.threshold) { + this.perMessageDeflate.threshold = 1024; + } + + // SSL options for Node.js client + this.pfx = opts.pfx || null; + this.key = opts.key || null; + this.passphrase = opts.passphrase || null; + this.cert = opts.cert || null; + this.ca = opts.ca || null; + this.ciphers = opts.ciphers || null; + this.rejectUnauthorized = opts.rejectUnauthorized === undefined ? true : opts.rejectUnauthorized; + this.forceNode = !!opts.forceNode; + + // detect ReactNative environment + this.isReactNative = typeof navigator !== 'undefined' && typeof navigator.product === 'string' && navigator.product.toLowerCase() === 'reactnative'; + + // other options for Node.js or ReactNative client + if (typeof self === 'undefined' || this.isReactNative) { + if (opts.extraHeaders && Object.keys(opts.extraHeaders).length > 0) { + this.extraHeaders = opts.extraHeaders; + } + + if (opts.localAddress) { + this.localAddress = opts.localAddress; + } + } + + // set on handshake + this.id = null; + this.upgrades = null; + this.pingInterval = null; + this.pingTimeout = null; + + // set on heartbeat + this.pingIntervalTimer = null; + this.pingTimeoutTimer = null; + + this.open(); + } + + Socket.priorWebsocketSuccess = false; + + /** + * Mix in `Emitter`. + */ + + Emitter(Socket.prototype); + + /** + * Protocol version. + * + * @api public + */ + + Socket.protocol = parser.protocol; // this is an int + + /** + * Expose deps for legacy compatibility + * and standalone browser access. + */ + + Socket.Socket = Socket; + Socket.Transport = __webpack_require__(7); + Socket.transports = __webpack_require__(2); + Socket.parser = __webpack_require__(8); + + /** + * Creates transport of the given type. + * + * @param {String} transport name + * @return {Transport} + * @api private + */ + + Socket.prototype.createTransport = function (name) { + debug('creating transport "%s"', name); + var query = clone(this.query); + + // append engine.io protocol identifier + query.EIO = parser.protocol; + + // transport name + query.transport = name; + + // per-transport options + var options = this.transportOptions[name] || {}; + + // session id if we already have one + if (this.id) query.sid = this.id; + + var transport = new transports[name]({ + query: query, + socket: this, + agent: options.agent || this.agent, + hostname: options.hostname || this.hostname, + port: options.port || this.port, + secure: options.secure || this.secure, + path: options.path || this.path, + forceJSONP: options.forceJSONP || this.forceJSONP, + jsonp: options.jsonp || this.jsonp, + forceBase64: options.forceBase64 || this.forceBase64, + enablesXDR: options.enablesXDR || this.enablesXDR, + timestampRequests: options.timestampRequests || this.timestampRequests, + timestampParam: options.timestampParam || this.timestampParam, + policyPort: options.policyPort || this.policyPort, + pfx: options.pfx || this.pfx, + key: options.key || this.key, + passphrase: options.passphrase || this.passphrase, + cert: options.cert || this.cert, + ca: options.ca || this.ca, + ciphers: options.ciphers || this.ciphers, + rejectUnauthorized: options.rejectUnauthorized || this.rejectUnauthorized, + perMessageDeflate: options.perMessageDeflate || this.perMessageDeflate, + extraHeaders: options.extraHeaders || this.extraHeaders, + forceNode: options.forceNode || this.forceNode, + localAddress: options.localAddress || this.localAddress, + requestTimeout: options.requestTimeout || this.requestTimeout, + protocols: options.protocols || void 0, + isReactNative: this.isReactNative + }); + + return transport; + }; + + function clone(obj) { + var o = {}; + for (var i in obj) { + if (obj.hasOwnProperty(i)) { + o[i] = obj[i]; + } + } + return o; + } + + /** + * Initializes transport to use and starts probe. + * + * @api private + */ + Socket.prototype.open = function () { + var transport; + if (this.rememberUpgrade && Socket.priorWebsocketSuccess && this.transports.indexOf('websocket') !== -1) { + transport = 'websocket'; + } else if (0 === this.transports.length) { + // Emit error on next tick so it can be listened to + var self = this; + setTimeout(function () { + self.emit('error', 'No transports available'); + }, 0); + return; + } else { + transport = this.transports[0]; + } + this.readyState = 'opening'; + + // Retry with the next transport if the transport is disabled (jsonp: false) + try { + transport = this.createTransport(transport); + } catch (e) { + this.transports.shift(); + this.open(); + return; + } + + transport.open(); + this.setTransport(transport); + }; + + /** + * Sets the current transport. Disables the existing one (if any). + * + * @api private + */ + + Socket.prototype.setTransport = function (transport) { + debug('setting transport %s', transport.name); + var self = this; + + if (this.transport) { + debug('clearing existing transport %s', this.transport.name); + this.transport.removeAllListeners(); + } + + // set up transport + this.transport = transport; + + // set up transport listeners + transport.on('drain', function () { + self.onDrain(); + }).on('packet', function (packet) { + self.onPacket(packet); + }).on('error', function (e) { + self.onError(e); + }).on('close', function () { + self.onClose('transport close'); + }); + }; + + /** + * Probes a transport. + * + * @param {String} transport name + * @api private + */ + + Socket.prototype.probe = function (name) { + debug('probing transport "%s"', name); + var transport = this.createTransport(name, { probe: 1 }); + var failed = false; + var self = this; + + Socket.priorWebsocketSuccess = false; + + function onTransportOpen() { + if (self.onlyBinaryUpgrades) { + var upgradeLosesBinary = !this.supportsBinary && self.transport.supportsBinary; + failed = failed || upgradeLosesBinary; + } + if (failed) return; + + debug('probe transport "%s" opened', name); + transport.send([{ type: 'ping', data: 'probe' }]); + transport.once('packet', function (msg) { + if (failed) return; + if ('pong' === msg.type && 'probe' === msg.data) { + debug('probe transport "%s" pong', name); + self.upgrading = true; + self.emit('upgrading', transport); + if (!transport) return; + Socket.priorWebsocketSuccess = 'websocket' === transport.name; + + debug('pausing current transport "%s"', self.transport.name); + self.transport.pause(function () { + if (failed) return; + if ('closed' === self.readyState) return; + debug('changing transport and sending upgrade packet'); + + cleanup(); + + self.setTransport(transport); + transport.send([{ type: 'upgrade' }]); + self.emit('upgrade', transport); + transport = null; + self.upgrading = false; + self.flush(); + }); + } else { + debug('probe transport "%s" failed', name); + var err = new Error('probe error'); + err.transport = transport.name; + self.emit('upgradeError', err); + } + }); + } + + function freezeTransport() { + if (failed) return; + + // Any callback called by transport should be ignored since now + failed = true; + + cleanup(); + + transport.close(); + transport = null; + } + + // Handle any error that happens while probing + function onerror(err) { + var error = new Error('probe error: ' + err); + error.transport = transport.name; + + freezeTransport(); + + debug('probe transport "%s" failed because of error: %s', name, err); + + self.emit('upgradeError', error); + } + + function onTransportClose() { + onerror('transport closed'); + } + + // When the socket is closed while we're probing + function onclose() { + onerror('socket closed'); + } + + // When the socket is upgraded while we're probing + function onupgrade(to) { + if (transport && to.name !== transport.name) { + debug('"%s" works - aborting "%s"', to.name, transport.name); + freezeTransport(); + } + } + + // Remove all listeners on the transport and on self + function cleanup() { + transport.removeListener('open', onTransportOpen); + transport.removeListener('error', onerror); + transport.removeListener('close', onTransportClose); + self.removeListener('close', onclose); + self.removeListener('upgrading', onupgrade); + } + + transport.once('open', onTransportOpen); + transport.once('error', onerror); + transport.once('close', onTransportClose); + + this.once('close', onclose); + this.once('upgrading', onupgrade); + + transport.open(); + }; + + /** + * Called when connection is deemed open. + * + * @api public + */ + + Socket.prototype.onOpen = function () { + debug('socket open'); + this.readyState = 'open'; + Socket.priorWebsocketSuccess = 'websocket' === this.transport.name; + this.emit('open'); + this.flush(); + + // we check for `readyState` in case an `open` + // listener already closed the socket + if ('open' === this.readyState && this.upgrade && this.transport.pause) { + debug('starting upgrade probes'); + for (var i = 0, l = this.upgrades.length; i < l; i++) { + this.probe(this.upgrades[i]); + } + } + }; + + /** + * Handles a packet. + * + * @api private + */ + + Socket.prototype.onPacket = function (packet) { + if ('opening' === this.readyState || 'open' === this.readyState || 'closing' === this.readyState) { + debug('socket receive: type "%s", data "%s"', packet.type, packet.data); + + this.emit('packet', packet); + + // Socket is live - any packet counts + this.emit('heartbeat'); + + switch (packet.type) { + case 'open': + this.onHandshake(JSON.parse(packet.data)); + break; + + case 'pong': + this.setPing(); + this.emit('pong'); + break; + + case 'error': + var err = new Error('server error'); + err.code = packet.data; + this.onError(err); + break; + + case 'message': + this.emit('data', packet.data); + this.emit('message', packet.data); + break; + } + } else { + debug('packet received with socket readyState "%s"', this.readyState); + } + }; + + /** + * Called upon handshake completion. + * + * @param {Object} handshake obj + * @api private + */ + + Socket.prototype.onHandshake = function (data) { + this.emit('handshake', data); + this.id = data.sid; + this.transport.query.sid = data.sid; + this.upgrades = this.filterUpgrades(data.upgrades); + this.pingInterval = data.pingInterval; + this.pingTimeout = data.pingTimeout; + this.onOpen(); + // In case open handler closes socket + if ('closed' === this.readyState) return; + this.setPing(); + + // Prolong liveness of socket on heartbeat + this.removeListener('heartbeat', this.onHeartbeat); + this.on('heartbeat', this.onHeartbeat); + }; + + /** + * Resets ping timeout. + * + * @api private + */ + + Socket.prototype.onHeartbeat = function (timeout) { + clearTimeout(this.pingTimeoutTimer); + var self = this; + self.pingTimeoutTimer = setTimeout(function () { + if ('closed' === self.readyState) return; + self.onClose('ping timeout'); + }, timeout || self.pingInterval + self.pingTimeout); + }; + + /** + * Pings server every `this.pingInterval` and expects response + * within `this.pingTimeout` or closes connection. + * + * @api private + */ + + Socket.prototype.setPing = function () { + var self = this; + clearTimeout(self.pingIntervalTimer); + self.pingIntervalTimer = setTimeout(function () { + debug('writing ping packet - expecting pong within %sms', self.pingTimeout); + self.ping(); + self.onHeartbeat(self.pingTimeout); + }, self.pingInterval); + }; + + /** + * Sends a ping packet. + * + * @api private + */ + + Socket.prototype.ping = function () { + var self = this; + this.sendPacket('ping', function () { + self.emit('ping'); + }); + }; + + /** + * Called on `drain` event + * + * @api private + */ + + Socket.prototype.onDrain = function () { + this.writeBuffer.splice(0, this.prevBufferLen); + + // setting prevBufferLen = 0 is very important + // for example, when upgrading, upgrade packet is sent over, + // and a nonzero prevBufferLen could cause problems on `drain` + this.prevBufferLen = 0; + + if (0 === this.writeBuffer.length) { + this.emit('drain'); + } else { + this.flush(); + } + }; + + /** + * Flush write buffers. + * + * @api private + */ + + Socket.prototype.flush = function () { + if ('closed' !== this.readyState && this.transport.writable && !this.upgrading && this.writeBuffer.length) { + debug('flushing %d packets in socket', this.writeBuffer.length); + this.transport.send(this.writeBuffer); + // keep track of current length of writeBuffer + // splice writeBuffer and callbackBuffer on `drain` + this.prevBufferLen = this.writeBuffer.length; + this.emit('flush'); + } + }; + + /** + * Sends a message. + * + * @param {String} message. + * @param {Function} callback function. + * @param {Object} options. + * @return {Socket} for chaining. + * @api public + */ + + Socket.prototype.write = Socket.prototype.send = function (msg, options, fn) { + this.sendPacket('message', msg, options, fn); + return this; + }; + + /** + * Sends a packet. + * + * @param {String} packet type. + * @param {String} data. + * @param {Object} options. + * @param {Function} callback function. + * @api private + */ + + Socket.prototype.sendPacket = function (type, data, options, fn) { + if ('function' === typeof data) { + fn = data; + data = undefined; + } + + if ('function' === typeof options) { + fn = options; + options = null; + } + + if ('closing' === this.readyState || 'closed' === this.readyState) { + return; + } + + options = options || {}; + options.compress = false !== options.compress; + + var packet = { + type: type, + data: data, + options: options + }; + this.emit('packetCreate', packet); + this.writeBuffer.push(packet); + if (fn) this.once('flush', fn); + this.flush(); + }; + + /** + * Closes the connection. + * + * @api private + */ + + Socket.prototype.close = function () { + if ('opening' === this.readyState || 'open' === this.readyState) { + this.readyState = 'closing'; + + var self = this; + + if (this.writeBuffer.length) { + this.once('drain', function () { + if (this.upgrading) { + waitForUpgrade(); + } else { + close(); + } + }); + } else if (this.upgrading) { + waitForUpgrade(); + } else { + close(); + } + } + + function close() { + self.onClose('forced close'); + debug('socket closing - telling transport to close'); + self.transport.close(); + } + + function cleanupAndClose() { + self.removeListener('upgrade', cleanupAndClose); + self.removeListener('upgradeError', cleanupAndClose); + close(); + } + + function waitForUpgrade() { + // wait for upgrade to finish since we can't send packets while pausing a transport + self.once('upgrade', cleanupAndClose); + self.once('upgradeError', cleanupAndClose); + } + + return this; + }; + + /** + * Called upon transport error + * + * @api private + */ + + Socket.prototype.onError = function (err) { + debug('socket error %j', err); + Socket.priorWebsocketSuccess = false; + this.emit('error', err); + this.onClose('transport error', err); + }; + + /** + * Called upon transport close. + * + * @api private + */ + + Socket.prototype.onClose = function (reason, desc) { + if ('opening' === this.readyState || 'open' === this.readyState || 'closing' === this.readyState) { + debug('socket close with reason: "%s"', reason); + var self = this; + + // clear timers + clearTimeout(this.pingIntervalTimer); + clearTimeout(this.pingTimeoutTimer); + + // stop event from firing again for transport + this.transport.removeAllListeners('close'); + + // ensure transport won't stay open + this.transport.close(); + + // ignore further transport communication + this.transport.removeAllListeners(); + + // set ready state + this.readyState = 'closed'; + + // clear session id + this.id = null; + + // emit close event + this.emit('close', reason, desc); + + // clean buffers after, so users can still + // grab the buffers on `close` event + self.writeBuffer = []; + self.prevBufferLen = 0; + } + }; + + /** + * Filters upgrades, returning only those matching client transports. + * + * @param {Array} server upgrades + * @api private + * + */ + + Socket.prototype.filterUpgrades = function (upgrades) { + var filteredUpgrades = []; + for (var i = 0, j = upgrades.length; i < j; i++) { + if (~index(this.transports, upgrades[i])) filteredUpgrades.push(upgrades[i]); + } + return filteredUpgrades; + }; + +/***/ }, +/* 2 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + /** + * Module dependencies + */ + + var XMLHttpRequest = __webpack_require__(3); + var XHR = __webpack_require__(5); + var JSONP = __webpack_require__(25); + var websocket = __webpack_require__(26); + + /** + * Export transports. + */ + + exports.polling = polling; + exports.websocket = websocket; + + /** + * Polling transport polymorphic constructor. + * Decides on xhr vs jsonp based on feature detection. + * + * @api private + */ + + function polling(opts) { + var xhr; + var xd = false; + var xs = false; + var jsonp = false !== opts.jsonp; + + if (typeof location !== 'undefined') { + var isSSL = 'https:' === location.protocol; + var port = location.port; + + // some user agents have empty `location.port` + if (!port) { + port = isSSL ? 443 : 80; + } + + xd = opts.hostname !== location.hostname || port !== opts.port; + xs = opts.secure !== isSSL; + } + + opts.xdomain = xd; + opts.xscheme = xs; + xhr = new XMLHttpRequest(opts); + + if ('open' in xhr && !opts.forceJSONP) { + return new XHR(opts); + } else { + if (!jsonp) throw new Error('JSONP disabled'); + return new JSONP(opts); + } + } + +/***/ }, +/* 3 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + // browser shim for xmlhttprequest module + + var hasCORS = __webpack_require__(4); + + module.exports = function (opts) { + var xdomain = opts.xdomain; + + // scheme must be same when usign XDomainRequest + // http://blogs.msdn.com/b/ieinternals/archive/2010/05/13/xdomainrequest-restrictions-limitations-and-workarounds.aspx + var xscheme = opts.xscheme; + + // XDomainRequest has a flow of not sending cookie, therefore it should be disabled as a default. + // https://github.com/Automattic/engine.io-client/pull/217 + var enablesXDR = opts.enablesXDR; + + // XMLHttpRequest can be disabled on IE + try { + if ('undefined' !== typeof XMLHttpRequest && (!xdomain || hasCORS)) { + return new XMLHttpRequest(); + } + } catch (e) {} + + // Use XDomainRequest for IE8 if enablesXDR is true + // because loading bar keeps flashing when using jsonp-polling + // https://github.com/yujiosaka/socke.io-ie8-loading-example + try { + if ('undefined' !== typeof XDomainRequest && !xscheme && enablesXDR) { + return new XDomainRequest(); + } + } catch (e) {} + + if (!xdomain) { + try { + return new self[['Active'].concat('Object').join('X')]('Microsoft.XMLHTTP'); + } catch (e) {} + } + }; + +/***/ }, +/* 4 */ +/***/ function(module, exports) { + + + /** + * Module exports. + * + * Logic borrowed from Modernizr: + * + * - https://github.com/Modernizr/Modernizr/blob/master/feature-detects/cors.js + */ + + try { + module.exports = typeof XMLHttpRequest !== 'undefined' && + 'withCredentials' in new XMLHttpRequest(); + } catch (err) { + // if XMLHttp support is disabled in IE then it will throw + // when trying to create + module.exports = false; + } + + +/***/ }, +/* 5 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + /* global attachEvent */ + + /** + * Module requirements. + */ + + var XMLHttpRequest = __webpack_require__(3); + var Polling = __webpack_require__(6); + var Emitter = __webpack_require__(17); + var inherit = __webpack_require__(19); + var debug = __webpack_require__(21)('engine.io-client:polling-xhr'); + + /** + * Module exports. + */ + + module.exports = XHR; + module.exports.Request = Request; + + /** + * Empty function + */ + + function empty() {} + + /** + * XHR Polling constructor. + * + * @param {Object} opts + * @api public + */ + + function XHR(opts) { + Polling.call(this, opts); + this.requestTimeout = opts.requestTimeout; + this.extraHeaders = opts.extraHeaders; + + if (typeof location !== 'undefined') { + var isSSL = 'https:' === location.protocol; + var port = location.port; + + // some user agents have empty `location.port` + if (!port) { + port = isSSL ? 443 : 80; + } + + this.xd = typeof location !== 'undefined' && opts.hostname !== location.hostname || port !== opts.port; + this.xs = opts.secure !== isSSL; + } + } + + /** + * Inherits from Polling. + */ + + inherit(XHR, Polling); + + /** + * XHR supports binary + */ + + XHR.prototype.supportsBinary = true; + + /** + * Creates a request. + * + * @param {String} method + * @api private + */ + + XHR.prototype.request = function (opts) { + opts = opts || {}; + opts.uri = this.uri(); + opts.xd = this.xd; + opts.xs = this.xs; + opts.agent = this.agent || false; + opts.supportsBinary = this.supportsBinary; + opts.enablesXDR = this.enablesXDR; + + // SSL options for Node.js client + opts.pfx = this.pfx; + opts.key = this.key; + opts.passphrase = this.passphrase; + opts.cert = this.cert; + opts.ca = this.ca; + opts.ciphers = this.ciphers; + opts.rejectUnauthorized = this.rejectUnauthorized; + opts.requestTimeout = this.requestTimeout; + + // other options for Node.js client + opts.extraHeaders = this.extraHeaders; + + return new Request(opts); + }; + + /** + * Sends data. + * + * @param {String} data to send. + * @param {Function} called upon flush. + * @api private + */ + + XHR.prototype.doWrite = function (data, fn) { + var isBinary = typeof data !== 'string' && data !== undefined; + var req = this.request({ method: 'POST', data: data, isBinary: isBinary }); + var self = this; + req.on('success', fn); + req.on('error', function (err) { + self.onError('xhr post error', err); + }); + this.sendXhr = req; + }; + + /** + * Starts a poll cycle. + * + * @api private + */ + + XHR.prototype.doPoll = function () { + debug('xhr poll'); + var req = this.request(); + var self = this; + req.on('data', function (data) { + self.onData(data); + }); + req.on('error', function (err) { + self.onError('xhr poll error', err); + }); + this.pollXhr = req; + }; + + /** + * Request constructor + * + * @param {Object} options + * @api public + */ + + function Request(opts) { + this.method = opts.method || 'GET'; + this.uri = opts.uri; + this.xd = !!opts.xd; + this.xs = !!opts.xs; + this.async = false !== opts.async; + this.data = undefined !== opts.data ? opts.data : null; + this.agent = opts.agent; + this.isBinary = opts.isBinary; + this.supportsBinary = opts.supportsBinary; + this.enablesXDR = opts.enablesXDR; + this.requestTimeout = opts.requestTimeout; + + // SSL options for Node.js client + this.pfx = opts.pfx; + this.key = opts.key; + this.passphrase = opts.passphrase; + this.cert = opts.cert; + this.ca = opts.ca; + this.ciphers = opts.ciphers; + this.rejectUnauthorized = opts.rejectUnauthorized; + + // other options for Node.js client + this.extraHeaders = opts.extraHeaders; + + this.create(); + } + + /** + * Mix in `Emitter`. + */ + + Emitter(Request.prototype); + + /** + * Creates the XHR object and sends the request. + * + * @api private + */ + + Request.prototype.create = function () { + var opts = { agent: this.agent, xdomain: this.xd, xscheme: this.xs, enablesXDR: this.enablesXDR }; + + // SSL options for Node.js client + opts.pfx = this.pfx; + opts.key = this.key; + opts.passphrase = this.passphrase; + opts.cert = this.cert; + opts.ca = this.ca; + opts.ciphers = this.ciphers; + opts.rejectUnauthorized = this.rejectUnauthorized; + + var xhr = this.xhr = new XMLHttpRequest(opts); + var self = this; + + try { + debug('xhr open %s: %s', this.method, this.uri); + xhr.open(this.method, this.uri, this.async); + try { + if (this.extraHeaders) { + xhr.setDisableHeaderCheck && xhr.setDisableHeaderCheck(true); + for (var i in this.extraHeaders) { + if (this.extraHeaders.hasOwnProperty(i)) { + xhr.setRequestHeader(i, this.extraHeaders[i]); + } + } + } + } catch (e) {} + + if ('POST' === this.method) { + try { + if (this.isBinary) { + xhr.setRequestHeader('Content-type', 'application/octet-stream'); + } else { + xhr.setRequestHeader('Content-type', 'text/plain;charset=UTF-8'); + } + } catch (e) {} + } + + try { + xhr.setRequestHeader('Accept', '*/*'); + } catch (e) {} + + // ie6 check + if ('withCredentials' in xhr) { + xhr.withCredentials = true; + } + + if (this.requestTimeout) { + xhr.timeout = this.requestTimeout; + } + + if (this.hasXDR()) { + xhr.onload = function () { + self.onLoad(); + }; + xhr.onerror = function () { + self.onError(xhr.responseText); + }; + } else { + xhr.onreadystatechange = function () { + if (xhr.readyState === 2) { + try { + var contentType = xhr.getResponseHeader('Content-Type'); + if (self.supportsBinary && contentType === 'application/octet-stream') { + xhr.responseType = 'arraybuffer'; + } + } catch (e) {} + } + if (4 !== xhr.readyState) return; + if (200 === xhr.status || 1223 === xhr.status) { + self.onLoad(); + } else { + // make sure the `error` event handler that's user-set + // does not throw in the same tick and gets caught here + setTimeout(function () { + self.onError(xhr.status); + }, 0); + } + }; + } + + debug('xhr data %s', this.data); + xhr.send(this.data); + } catch (e) { + // Need to defer since .create() is called directly fhrom the constructor + // and thus the 'error' event can only be only bound *after* this exception + // occurs. Therefore, also, we cannot throw here at all. + setTimeout(function () { + self.onError(e); + }, 0); + return; + } + + if (typeof document !== 'undefined') { + this.index = Request.requestsCount++; + Request.requests[this.index] = this; + } + }; + + /** + * Called upon successful response. + * + * @api private + */ + + Request.prototype.onSuccess = function () { + this.emit('success'); + this.cleanup(); + }; + + /** + * Called if we have data. + * + * @api private + */ + + Request.prototype.onData = function (data) { + this.emit('data', data); + this.onSuccess(); + }; + + /** + * Called upon error. + * + * @api private + */ + + Request.prototype.onError = function (err) { + this.emit('error', err); + this.cleanup(true); + }; + + /** + * Cleans up house. + * + * @api private + */ + + Request.prototype.cleanup = function (fromError) { + if ('undefined' === typeof this.xhr || null === this.xhr) { + return; + } + // xmlhttprequest + if (this.hasXDR()) { + this.xhr.onload = this.xhr.onerror = empty; + } else { + this.xhr.onreadystatechange = empty; + } + + if (fromError) { + try { + this.xhr.abort(); + } catch (e) {} + } + + if (typeof document !== 'undefined') { + delete Request.requests[this.index]; + } + + this.xhr = null; + }; + + /** + * Called upon load. + * + * @api private + */ + + Request.prototype.onLoad = function () { + var data; + try { + var contentType; + try { + contentType = this.xhr.getResponseHeader('Content-Type'); + } catch (e) {} + if (contentType === 'application/octet-stream') { + data = this.xhr.response || this.xhr.responseText; + } else { + data = this.xhr.responseText; + } + } catch (e) { + this.onError(e); + } + if (null != data) { + this.onData(data); + } + }; + + /** + * Check if it has XDomainRequest. + * + * @api private + */ + + Request.prototype.hasXDR = function () { + return typeof XDomainRequest !== 'undefined' && !this.xs && this.enablesXDR; + }; + + /** + * Aborts the request. + * + * @api public + */ + + Request.prototype.abort = function () { + this.cleanup(); + }; + + /** + * Aborts pending requests when unloading the window. This is needed to prevent + * memory leaks (e.g. when using IE) and to ensure that no spurious error is + * emitted. + */ + + Request.requestsCount = 0; + Request.requests = {}; + + if (typeof document !== 'undefined') { + if (typeof attachEvent === 'function') { + attachEvent('onunload', unloadHandler); + } else if (typeof addEventListener === 'function') { + var terminationEvent = 'onpagehide' in self ? 'pagehide' : 'unload'; + addEventListener(terminationEvent, unloadHandler, false); + } + } + + function unloadHandler() { + for (var i in Request.requests) { + if (Request.requests.hasOwnProperty(i)) { + Request.requests[i].abort(); + } + } + } + +/***/ }, +/* 6 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + /** + * Module dependencies. + */ + + var Transport = __webpack_require__(7); + var parseqs = __webpack_require__(18); + var parser = __webpack_require__(8); + var inherit = __webpack_require__(19); + var yeast = __webpack_require__(20); + var debug = __webpack_require__(21)('engine.io-client:polling'); + + /** + * Module exports. + */ + + module.exports = Polling; + + /** + * Is XHR2 supported? + */ + + var hasXHR2 = function () { + var XMLHttpRequest = __webpack_require__(3); + var xhr = new XMLHttpRequest({ xdomain: false }); + return null != xhr.responseType; + }(); + + /** + * Polling interface. + * + * @param {Object} opts + * @api private + */ + + function Polling(opts) { + var forceBase64 = opts && opts.forceBase64; + if (!hasXHR2 || forceBase64) { + this.supportsBinary = false; + } + Transport.call(this, opts); + } + + /** + * Inherits from Transport. + */ + + inherit(Polling, Transport); + + /** + * Transport name. + */ + + Polling.prototype.name = 'polling'; + + /** + * Opens the socket (triggers polling). We write a PING message to determine + * when the transport is open. + * + * @api private + */ + + Polling.prototype.doOpen = function () { + this.poll(); + }; + + /** + * Pauses polling. + * + * @param {Function} callback upon buffers are flushed and transport is paused + * @api private + */ + + Polling.prototype.pause = function (onPause) { + var self = this; + + this.readyState = 'pausing'; + + function pause() { + debug('paused'); + self.readyState = 'paused'; + onPause(); + } + + if (this.polling || !this.writable) { + var total = 0; + + if (this.polling) { + debug('we are currently polling - waiting to pause'); + total++; + this.once('pollComplete', function () { + debug('pre-pause polling complete'); + --total || pause(); + }); + } + + if (!this.writable) { + debug('we are currently writing - waiting to pause'); + total++; + this.once('drain', function () { + debug('pre-pause writing complete'); + --total || pause(); + }); + } + } else { + pause(); + } + }; + + /** + * Starts polling cycle. + * + * @api public + */ + + Polling.prototype.poll = function () { + debug('polling'); + this.polling = true; + this.doPoll(); + this.emit('poll'); + }; + + /** + * Overloads onData to detect payloads. + * + * @api private + */ + + Polling.prototype.onData = function (data) { + var self = this; + debug('polling got data %s', data); + var callback = function callback(packet, index, total) { + // if its the first message we consider the transport open + if ('opening' === self.readyState) { + self.onOpen(); + } + + // if its a close packet, we close the ongoing requests + if ('close' === packet.type) { + self.onClose(); + return false; + } + + // otherwise bypass onData and handle the message + self.onPacket(packet); + }; + + // decode payload + parser.decodePayload(data, this.socket.binaryType, callback); + + // if an event did not trigger closing + if ('closed' !== this.readyState) { + // if we got data we're not polling + this.polling = false; + this.emit('pollComplete'); + + if ('open' === this.readyState) { + this.poll(); + } else { + debug('ignoring poll - transport state "%s"', this.readyState); + } + } + }; + + /** + * For polling, send a close packet. + * + * @api private + */ + + Polling.prototype.doClose = function () { + var self = this; + + function close() { + debug('writing close packet'); + self.write([{ type: 'close' }]); + } + + if ('open' === this.readyState) { + debug('transport open - closing'); + close(); + } else { + // in case we're trying to close while + // handshaking is in progress (GH-164) + debug('transport not open - deferring close'); + this.once('open', close); + } + }; + + /** + * Writes a packets payload. + * + * @param {Array} data packets + * @param {Function} drain callback + * @api private + */ + + Polling.prototype.write = function (packets) { + var self = this; + this.writable = false; + var callbackfn = function callbackfn() { + self.writable = true; + self.emit('drain'); + }; + + parser.encodePayload(packets, this.supportsBinary, function (data) { + self.doWrite(data, callbackfn); + }); + }; + + /** + * Generates uri for connection. + * + * @api private + */ + + Polling.prototype.uri = function () { + var query = this.query || {}; + var schema = this.secure ? 'https' : 'http'; + var port = ''; + + // cache busting is forced + if (false !== this.timestampRequests) { + query[this.timestampParam] = yeast(); + } + + if (!this.supportsBinary && !query.sid) { + query.b64 = 1; + } + + query = parseqs.encode(query); + + // avoid port if default for schema + if (this.port && ('https' === schema && Number(this.port) !== 443 || 'http' === schema && Number(this.port) !== 80)) { + port = ':' + this.port; + } + + // prepend ? to query + if (query.length) { + query = '?' + query; + } + + var ipv6 = this.hostname.indexOf(':') !== -1; + return schema + '://' + (ipv6 ? '[' + this.hostname + ']' : this.hostname) + port + this.path + query; + }; + +/***/ }, +/* 7 */ +/***/ function(module, exports, __webpack_require__) { + + 'use strict'; + + /** + * Module dependencies. + */ + + var parser = __webpack_require__(8); + var Emitter = __webpack_require__(17); + + /** + * Module exports. + */ + + module.exports = Transport; + + /** + * Transport abstract constructor. + * + * @param {Object} options. + * @api private + */ + + function Transport(opts) { + this.path = opts.path; + this.hostname = opts.hostname; + this.port = opts.port; + this.secure = opts.secure; + this.query = opts.query; + this.timestampParam = opts.timestampParam; + this.timestampRequests = opts.timestampRequests; + this.readyState = ''; + this.agent = opts.agent || false; + this.socket = opts.socket; + this.enablesXDR = opts.enablesXDR; + + // SSL options for Node.js client + this.pfx = opts.pfx; + this.key = opts.key; + this.passphrase = opts.passphrase; + this.cert = opts.cert; + this.ca = opts.ca; + this.ciphers = opts.ciphers; + this.rejectUnauthorized = opts.rejectUnauthorized; + this.forceNode = opts.forceNode; + + // results of ReactNative environment detection + this.isReactNative = opts.isReactNative; + + // other options for Node.js client + this.extraHeaders = opts.extraHeaders; + this.localAddress = opts.localAddress; + } + + /** + * Mix in `Emitter`. + */ + + Emitter(Transport.prototype); + + /** + * Emits an error. + * + * @param {String} str + * @return {Transport} for chaining + * @api public + */ + + Transport.prototype.onError = function (msg, desc) { + var err = new Error(msg); + err.type = 'TransportError'; + err.description = desc; + this.emit('error', err); + return this; + }; + + /** + * Opens the transport. + * + * @api public + */ + + Transport.prototype.open = function () { + if ('closed' === this.readyState || '' === this.readyState) { + this.readyState = 'opening'; + this.doOpen(); + } + + return this; + }; + + /** + * Closes the transport. + * + * @api private + */ + + Transport.prototype.close = function () { + if ('opening' === this.readyState || 'open' === this.readyState) { + this.doClose(); + this.onClose(); + } + + return this; + }; + + /** + * Sends multiple packets. + * + * @param {Array} packets + * @api private + */ + + Transport.prototype.send = function (packets) { + if ('open' === this.readyState) { + this.write(packets); + } else { + throw new Error('Transport not open'); + } + }; + + /** + * Called upon open + * + * @api private + */ + + Transport.prototype.onOpen = function () { + this.readyState = 'open'; + this.writable = true; + this.emit('open'); + }; + + /** + * Called with data. + * + * @param {String} data + * @api private + */ + + Transport.prototype.onData = function (data) { + var packet = parser.decodePacket(data, this.socket.binaryType); + this.onPacket(packet); + }; + + /** + * Called with a decoded packet. + */ + + Transport.prototype.onPacket = function (packet) { + this.emit('packet', packet); + }; + + /** + * Called upon close. + * + * @api private + */ + + Transport.prototype.onClose = function () { + this.readyState = 'closed'; + this.emit('close'); + }; + +/***/ }, +/* 8 */ +/***/ function(module, exports, __webpack_require__) { + + /** + * Module dependencies. + */ + + var keys = __webpack_require__(9); + var hasBinary = __webpack_require__(10); + var sliceBuffer = __webpack_require__(12); + var after = __webpack_require__(13); + var utf8 = __webpack_require__(14); + + var base64encoder; + if (typeof ArrayBuffer !== 'undefined') { + base64encoder = __webpack_require__(15); + } + + /** + * Check if we are running an android browser. That requires us to use + * ArrayBuffer with polling transports... + * + * http://ghinda.net/jpeg-blob-ajax-android/ + */ + + var isAndroid = typeof navigator !== 'undefined' && /Android/i.test(navigator.userAgent); + + /** + * Check if we are running in PhantomJS. + * Uploading a Blob with PhantomJS does not work correctly, as reported here: + * https://github.com/ariya/phantomjs/issues/11395 + * @type boolean + */ + var isPhantomJS = typeof navigator !== 'undefined' && /PhantomJS/i.test(navigator.userAgent); + + /** + * When true, avoids using Blobs to encode payloads. + * @type boolean + */ + var dontSendBlobs = isAndroid || isPhantomJS; + + /** + * Current protocol version. + */ + + exports.protocol = 3; + + /** + * Packet types. + */ + + var packets = exports.packets = { + open: 0 // non-ws + , close: 1 // non-ws + , ping: 2 + , pong: 3 + , message: 4 + , upgrade: 5 + , noop: 6 + }; + + var packetslist = keys(packets); + + /** + * Premade error packet. + */ + + var err = { type: 'error', data: 'parser error' }; + + /** + * Create a blob api even for blob builder when vendor prefixes exist + */ + + var Blob = __webpack_require__(16); + + /** + * Encodes a packet. + * + * [ ] + * + * Example: + * + * 5hello world + * 3 + * 4 + * + * Binary is encoded in an identical principle + * + * @api private + */ + + exports.encodePacket = function (packet, supportsBinary, utf8encode, callback) { + if (typeof supportsBinary === 'function') { + callback = supportsBinary; + supportsBinary = false; + } + + if (typeof utf8encode === 'function') { + callback = utf8encode; + utf8encode = null; + } + + var data = (packet.data === undefined) + ? undefined + : packet.data.buffer || packet.data; + + if (typeof ArrayBuffer !== 'undefined' && data instanceof ArrayBuffer) { + return encodeArrayBuffer(packet, supportsBinary, callback); + } else if (typeof Blob !== 'undefined' && data instanceof Blob) { + return encodeBlob(packet, supportsBinary, callback); + } + + // might be an object with { base64: true, data: dataAsBase64String } + if (data && data.base64) { + return encodeBase64Object(packet, callback); + } + + // Sending data as a utf-8 string + var encoded = packets[packet.type]; + + // data fragment is optional + if (undefined !== packet.data) { + encoded += utf8encode ? utf8.encode(String(packet.data), { strict: false }) : String(packet.data); + } + + return callback('' + encoded); + + }; + + function encodeBase64Object(packet, callback) { + // packet data is an object { base64: true, data: dataAsBase64String } + var message = 'b' + exports.packets[packet.type] + packet.data.data; + return callback(message); + } + + /** + * Encode packet helpers for binary types + */ + + function encodeArrayBuffer(packet, supportsBinary, callback) { + if (!supportsBinary) { + return exports.encodeBase64Packet(packet, callback); + } + + var data = packet.data; + var contentArray = new Uint8Array(data); + var resultBuffer = new Uint8Array(1 + data.byteLength); + + resultBuffer[0] = packets[packet.type]; + for (var i = 0; i < contentArray.length; i++) { + resultBuffer[i+1] = contentArray[i]; + } + + return callback(resultBuffer.buffer); + } + + function encodeBlobAsArrayBuffer(packet, supportsBinary, callback) { + if (!supportsBinary) { + return exports.encodeBase64Packet(packet, callback); + } + + var fr = new FileReader(); + fr.onload = function() { + exports.encodePacket({ type: packet.type, data: fr.result }, supportsBinary, true, callback); + }; + return fr.readAsArrayBuffer(packet.data); + } + + function encodeBlob(packet, supportsBinary, callback) { + if (!supportsBinary) { + return exports.encodeBase64Packet(packet, callback); + } + + if (dontSendBlobs) { + return encodeBlobAsArrayBuffer(packet, supportsBinary, callback); + } + + var length = new Uint8Array(1); + length[0] = packets[packet.type]; + var blob = new Blob([length.buffer, packet.data]); + + return callback(blob); + } + + /** + * Encodes a packet with binary data in a base64 string + * + * @param {Object} packet, has `type` and `data` + * @return {String} base64 encoded message + */ + + exports.encodeBase64Packet = function(packet, callback) { + var message = 'b' + exports.packets[packet.type]; + if (typeof Blob !== 'undefined' && packet.data instanceof Blob) { + var fr = new FileReader(); + fr.onload = function() { + var b64 = fr.result.split(',')[1]; + callback(message + b64); + }; + return fr.readAsDataURL(packet.data); + } + + var b64data; + try { + b64data = String.fromCharCode.apply(null, new Uint8Array(packet.data)); + } catch (e) { + // iPhone Safari doesn't let you apply with typed arrays + var typed = new Uint8Array(packet.data); + var basic = new Array(typed.length); + for (var i = 0; i < typed.length; i++) { + basic[i] = typed[i]; + } + b64data = String.fromCharCode.apply(null, basic); + } + message += btoa(b64data); + return callback(message); + }; + + /** + * Decodes a packet. Changes format to Blob if requested. + * + * @return {Object} with `type` and `data` (if any) + * @api private + */ + + exports.decodePacket = function (data, binaryType, utf8decode) { + if (data === undefined) { + return err; + } + // String data + if (typeof data === 'string') { + if (data.charAt(0) === 'b') { + return exports.decodeBase64Packet(data.substr(1), binaryType); + } + + if (utf8decode) { + data = tryDecode(data); + if (data === false) { + return err; + } + } + var type = data.charAt(0); + + if (Number(type) != type || !packetslist[type]) { + return err; + } + + if (data.length > 1) { + return { type: packetslist[type], data: data.substring(1) }; + } else { + return { type: packetslist[type] }; + } + } + + var asArray = new Uint8Array(data); + var type = asArray[0]; + var rest = sliceBuffer(data, 1); + if (Blob && binaryType === 'blob') { + rest = new Blob([rest]); + } + return { type: packetslist[type], data: rest }; + }; + + function tryDecode(data) { + try { + data = utf8.decode(data, { strict: false }); + } catch (e) { + return false; + } + return data; + } + + /** + * Decodes a packet encoded in a base64 string + * + * @param {String} base64 encoded message + * @return {Object} with `type` and `data` (if any) + */ + + exports.decodeBase64Packet = function(msg, binaryType) { + var type = packetslist[msg.charAt(0)]; + if (!base64encoder) { + return { type: type, data: { base64: true, data: msg.substr(1) } }; + } + + var data = base64encoder.decode(msg.substr(1)); + + if (binaryType === 'blob' && Blob) { + data = new Blob([data]); + } + + return { type: type, data: data }; + }; + + /** + * Encodes multiple messages (payload). + * + * :data + * + * Example: + * + * 11:hello world2:hi + * + * If any contents are binary, they will be encoded as base64 strings. Base64 + * encoded strings are marked with a b before the length specifier + * + * @param {Array} packets + * @api private + */ + + exports.encodePayload = function (packets, supportsBinary, callback) { + if (typeof supportsBinary === 'function') { + callback = supportsBinary; + supportsBinary = null; + } + + var isBinary = hasBinary(packets); + + if (supportsBinary && isBinary) { + if (Blob && !dontSendBlobs) { + return exports.encodePayloadAsBlob(packets, callback); + } + + return exports.encodePayloadAsArrayBuffer(packets, callback); + } + + if (!packets.length) { + return callback('0:'); + } + + function setLengthHeader(message) { + return message.length + ':' + message; + } + + function encodeOne(packet, doneCallback) { + exports.encodePacket(packet, !isBinary ? false : supportsBinary, false, function(message) { + doneCallback(null, setLengthHeader(message)); + }); + } + + map(packets, encodeOne, function(err, results) { + return callback(results.join('')); + }); + }; + + /** + * Async array map using after + */ + + function map(ary, each, done) { + var result = new Array(ary.length); + var next = after(ary.length, done); + + var eachWithIndex = function(i, el, cb) { + each(el, function(error, msg) { + result[i] = msg; + cb(error, result); + }); + }; + + for (var i = 0; i < ary.length; i++) { + eachWithIndex(i, ary[i], next); + } + } + + /* + * Decodes data when a payload is maybe expected. Possible binary contents are + * decoded from their base64 representation + * + * @param {String} data, callback method + * @api public + */ + + exports.decodePayload = function (data, binaryType, callback) { + if (typeof data !== 'string') { + return exports.decodePayloadAsBinary(data, binaryType, callback); + } + + if (typeof binaryType === 'function') { + callback = binaryType; + binaryType = null; + } + + var packet; + if (data === '') { + // parser error - ignoring payload + return callback(err, 0, 1); + } + + var length = '', n, msg; + + for (var i = 0, l = data.length; i < l; i++) { + var chr = data.charAt(i); + + if (chr !== ':') { + length += chr; + continue; + } + + if (length === '' || (length != (n = Number(length)))) { + // parser error - ignoring payload + return callback(err, 0, 1); + } + + msg = data.substr(i + 1, n); + + if (length != msg.length) { + // parser error - ignoring payload + return callback(err, 0, 1); + } + + if (msg.length) { + packet = exports.decodePacket(msg, binaryType, false); + + if (err.type === packet.type && err.data === packet.data) { + // parser error in individual packet - ignoring payload + return callback(err, 0, 1); + } + + var ret = callback(packet, i + n, l); + if (false === ret) return; + } + + // advance cursor + i += n; + length = ''; + } + + if (length !== '') { + // parser error - ignoring payload + return callback(err, 0, 1); + } + + }; + + /** + * Encodes multiple messages (payload) as binary. + * + * <1 = binary, 0 = string>[...] + * + * Example: + * 1 3 255 1 2 3, if the binary contents are interpreted as 8 bit integers + * + * @param {Array} packets + * @return {ArrayBuffer} encoded payload + * @api private + */ + + exports.encodePayloadAsArrayBuffer = function(packets, callback) { + if (!packets.length) { + return callback(new ArrayBuffer(0)); + } + + function encodeOne(packet, doneCallback) { + exports.encodePacket(packet, true, true, function(data) { + return doneCallback(null, data); + }); + } + + map(packets, encodeOne, function(err, encodedPackets) { + var totalLength = encodedPackets.reduce(function(acc, p) { + var len; + if (typeof p === 'string'){ + len = p.length; + } else { + len = p.byteLength; + } + return acc + len.toString().length + len + 2; // string/binary identifier + separator = 2 + }, 0); + + var resultArray = new Uint8Array(totalLength); + + var bufferIndex = 0; + encodedPackets.forEach(function(p) { + var isString = typeof p === 'string'; + var ab = p; + if (isString) { + var view = new Uint8Array(p.length); + for (var i = 0; i < p.length; i++) { + view[i] = p.charCodeAt(i); + } + ab = view.buffer; + } + + if (isString) { // not true binary + resultArray[bufferIndex++] = 0; + } else { // true binary + resultArray[bufferIndex++] = 1; + } + + var lenStr = ab.byteLength.toString(); + for (var i = 0; i < lenStr.length; i++) { + resultArray[bufferIndex++] = parseInt(lenStr[i]); + } + resultArray[bufferIndex++] = 255; + + var view = new Uint8Array(ab); + for (var i = 0; i < view.length; i++) { + resultArray[bufferIndex++] = view[i]; + } + }); + + return callback(resultArray.buffer); + }); + }; + + /** + * Encode as Blob + */ + + exports.encodePayloadAsBlob = function(packets, callback) { + function encodeOne(packet, doneCallback) { + exports.encodePacket(packet, true, true, function(encoded) { + var binaryIdentifier = new Uint8Array(1); + binaryIdentifier[0] = 1; + if (typeof encoded === 'string') { + var view = new Uint8Array(encoded.length); + for (var i = 0; i < encoded.length; i++) { + view[i] = encoded.charCodeAt(i); + } + encoded = view.buffer; + binaryIdentifier[0] = 0; + } + + var len = (encoded instanceof ArrayBuffer) + ? encoded.byteLength + : encoded.size; + + var lenStr = len.toString(); + var lengthAry = new Uint8Array(lenStr.length + 1); + for (var i = 0; i < lenStr.length; i++) { + lengthAry[i] = parseInt(lenStr[i]); + } + lengthAry[lenStr.length] = 255; + + if (Blob) { + var blob = new Blob([binaryIdentifier.buffer, lengthAry.buffer, encoded]); + doneCallback(null, blob); + } + }); + } + + map(packets, encodeOne, function(err, results) { + return callback(new Blob(results)); + }); + }; + + /* + * Decodes data when a payload is maybe expected. Strings are decoded by + * interpreting each byte as a key code for entries marked to start with 0. See + * description of encodePayloadAsBinary + * + * @param {ArrayBuffer} data, callback method + * @api public + */ + + exports.decodePayloadAsBinary = function (data, binaryType, callback) { + if (typeof binaryType === 'function') { + callback = binaryType; + binaryType = null; + } + + var bufferTail = data; + var buffers = []; + + while (bufferTail.byteLength > 0) { + var tailArray = new Uint8Array(bufferTail); + var isString = tailArray[0] === 0; + var msgLength = ''; + + for (var i = 1; ; i++) { + if (tailArray[i] === 255) break; + + // 310 = char length of Number.MAX_VALUE + if (msgLength.length > 310) { + return callback(err, 0, 1); + } + + msgLength += tailArray[i]; + } + + bufferTail = sliceBuffer(bufferTail, 2 + msgLength.length); + msgLength = parseInt(msgLength); + + var msg = sliceBuffer(bufferTail, 0, msgLength); + if (isString) { + try { + msg = String.fromCharCode.apply(null, new Uint8Array(msg)); + } catch (e) { + // iPhone Safari doesn't let you apply to typed arrays + var typed = new Uint8Array(msg); + msg = ''; + for (var i = 0; i < typed.length; i++) { + msg += String.fromCharCode(typed[i]); + } + } + } + + buffers.push(msg); + bufferTail = sliceBuffer(bufferTail, msgLength); + } + + var total = buffers.length; + buffers.forEach(function(buffer, i) { + callback(exports.decodePacket(buffer, binaryType, true), i, total); + }); + }; + + +/***/ }, +/* 9 */ +/***/ function(module, exports) { + + + /** + * Gets the keys for an object. + * + * @return {Array} keys + * @api private + */ + + module.exports = Object.keys || function keys (obj){ + var arr = []; + var has = Object.prototype.hasOwnProperty; + + for (var i in obj) { + if (has.call(obj, i)) { + arr.push(i); + } + } + return arr; + }; + + +/***/ }, +/* 10 */ +/***/ function(module, exports, __webpack_require__) { + + /* global Blob File */ + + /* + * Module requirements. + */ + + var isArray = __webpack_require__(11); + + var toString = Object.prototype.toString; + var withNativeBlob = typeof Blob === 'function' || + typeof Blob !== 'undefined' && toString.call(Blob) === '[object BlobConstructor]'; + var withNativeFile = typeof File === 'function' || + typeof File !== 'undefined' && toString.call(File) === '[object FileConstructor]'; + + /** + * Module exports. + */ + + module.exports = hasBinary; + + /** + * Checks for binary data. + * + * Supports Buffer, ArrayBuffer, Blob and File. + * + * @param {Object} anything + * @api public + */ + + function hasBinary (obj) { + if (!obj || typeof obj !== 'object') { + return false; + } + + if (isArray(obj)) { + for (var i = 0, l = obj.length; i < l; i++) { + if (hasBinary(obj[i])) { + return true; + } + } + return false; + } + + if ((typeof Buffer === 'function' && Buffer.isBuffer && Buffer.isBuffer(obj)) || + (typeof ArrayBuffer === 'function' && obj instanceof ArrayBuffer) || + (withNativeBlob && obj instanceof Blob) || + (withNativeFile && obj instanceof File) + ) { + return true; + } + + // see: https://github.com/Automattic/has-binary/pull/4 + if (obj.toJSON && typeof obj.toJSON === 'function' && arguments.length === 1) { + return hasBinary(obj.toJSON(), true); + } + + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key) && hasBinary(obj[key])) { + return true; + } + } + + return false; + } + + +/***/ }, +/* 11 */ +/***/ function(module, exports) { + + var toString = {}.toString; + + module.exports = Array.isArray || function (arr) { + return toString.call(arr) == '[object Array]'; + }; + + +/***/ }, +/* 12 */ +/***/ function(module, exports) { + + /** + * An abstraction for slicing an arraybuffer even when + * ArrayBuffer.prototype.slice is not supported + * + * @api public + */ + + module.exports = function(arraybuffer, start, end) { + var bytes = arraybuffer.byteLength; + start = start || 0; + end = end || bytes; + + if (arraybuffer.slice) { return arraybuffer.slice(start, end); } + + if (start < 0) { start += bytes; } + if (end < 0) { end += bytes; } + if (end > bytes) { end = bytes; } + + if (start >= bytes || start >= end || bytes === 0) { + return new ArrayBuffer(0); + } + + var abv = new Uint8Array(arraybuffer); + var result = new Uint8Array(end - start); + for (var i = start, ii = 0; i < end; i++, ii++) { + result[ii] = abv[i]; + } + return result.buffer; + }; + + +/***/ }, +/* 13 */ +/***/ function(module, exports) { + + module.exports = after + + function after(count, callback, err_cb) { + var bail = false + err_cb = err_cb || noop + proxy.count = count + + return (count === 0) ? callback() : proxy + + function proxy(err, result) { + if (proxy.count <= 0) { + throw new Error('after called too many times') + } + --proxy.count + + // after first error, rest are passed to err_cb + if (err) { + bail = true + callback(err) + // future error callbacks will go to error handler + callback = err_cb + } else if (proxy.count === 0 && !bail) { + callback(null, result) + } + } + } + + function noop() {} + + +/***/ }, +/* 14 */ +/***/ function(module, exports) { + + /*! https://mths.be/utf8js v2.1.2 by @mathias */ + + var stringFromCharCode = String.fromCharCode; + + // Taken from https://mths.be/punycode + function ucs2decode(string) { + var output = []; + var counter = 0; + var length = string.length; + var value; + var extra; + while (counter < length) { + value = string.charCodeAt(counter++); + if (value >= 0xD800 && value <= 0xDBFF && counter < length) { + // high surrogate, and there is a next character + extra = string.charCodeAt(counter++); + if ((extra & 0xFC00) == 0xDC00) { // low surrogate + output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); + } else { + // unmatched surrogate; only append this code unit, in case the next + // code unit is the high surrogate of a surrogate pair + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; + } + + // Taken from https://mths.be/punycode + function ucs2encode(array) { + var length = array.length; + var index = -1; + var value; + var output = ''; + while (++index < length) { + value = array[index]; + if (value > 0xFFFF) { + value -= 0x10000; + output += stringFromCharCode(value >>> 10 & 0x3FF | 0xD800); + value = 0xDC00 | value & 0x3FF; + } + output += stringFromCharCode(value); + } + return output; + } + + function checkScalarValue(codePoint, strict) { + if (codePoint >= 0xD800 && codePoint <= 0xDFFF) { + if (strict) { + throw Error( + 'Lone surrogate U+' + codePoint.toString(16).toUpperCase() + + ' is not a scalar value' + ); + } + return false; + } + return true; + } + /*--------------------------------------------------------------------------*/ + + function createByte(codePoint, shift) { + return stringFromCharCode(((codePoint >> shift) & 0x3F) | 0x80); + } + + function encodeCodePoint(codePoint, strict) { + if ((codePoint & 0xFFFFFF80) == 0) { // 1-byte sequence + return stringFromCharCode(codePoint); + } + var symbol = ''; + if ((codePoint & 0xFFFFF800) == 0) { // 2-byte sequence + symbol = stringFromCharCode(((codePoint >> 6) & 0x1F) | 0xC0); + } + else if ((codePoint & 0xFFFF0000) == 0) { // 3-byte sequence + if (!checkScalarValue(codePoint, strict)) { + codePoint = 0xFFFD; + } + symbol = stringFromCharCode(((codePoint >> 12) & 0x0F) | 0xE0); + symbol += createByte(codePoint, 6); + } + else if ((codePoint & 0xFFE00000) == 0) { // 4-byte sequence + symbol = stringFromCharCode(((codePoint >> 18) & 0x07) | 0xF0); + symbol += createByte(codePoint, 12); + symbol += createByte(codePoint, 6); + } + symbol += stringFromCharCode((codePoint & 0x3F) | 0x80); + return symbol; + } + + function utf8encode(string, opts) { + opts = opts || {}; + var strict = false !== opts.strict; + + var codePoints = ucs2decode(string); + var length = codePoints.length; + var index = -1; + var codePoint; + var byteString = ''; + while (++index < length) { + codePoint = codePoints[index]; + byteString += encodeCodePoint(codePoint, strict); + } + return byteString; + } + + /*--------------------------------------------------------------------------*/ + + function readContinuationByte() { + if (byteIndex >= byteCount) { + throw Error('Invalid byte index'); + } + + var continuationByte = byteArray[byteIndex] & 0xFF; + byteIndex++; + + if ((continuationByte & 0xC0) == 0x80) { + return continuationByte & 0x3F; + } + + // If we end up here, it’s not a continuation byte + throw Error('Invalid continuation byte'); + } + + function decodeSymbol(strict) { + var byte1; + var byte2; + var byte3; + var byte4; + var codePoint; + + if (byteIndex > byteCount) { + throw Error('Invalid byte index'); + } + + if (byteIndex == byteCount) { + return false; + } + + // Read first byte + byte1 = byteArray[byteIndex] & 0xFF; + byteIndex++; + + // 1-byte sequence (no continuation bytes) + if ((byte1 & 0x80) == 0) { + return byte1; + } + + // 2-byte sequence + if ((byte1 & 0xE0) == 0xC0) { + byte2 = readContinuationByte(); + codePoint = ((byte1 & 0x1F) << 6) | byte2; + if (codePoint >= 0x80) { + return codePoint; + } else { + throw Error('Invalid continuation byte'); + } + } + + // 3-byte sequence (may include unpaired surrogates) + if ((byte1 & 0xF0) == 0xE0) { + byte2 = readContinuationByte(); + byte3 = readContinuationByte(); + codePoint = ((byte1 & 0x0F) << 12) | (byte2 << 6) | byte3; + if (codePoint >= 0x0800) { + return checkScalarValue(codePoint, strict) ? codePoint : 0xFFFD; + } else { + throw Error('Invalid continuation byte'); + } + } + + // 4-byte sequence + if ((byte1 & 0xF8) == 0xF0) { + byte2 = readContinuationByte(); + byte3 = readContinuationByte(); + byte4 = readContinuationByte(); + codePoint = ((byte1 & 0x07) << 0x12) | (byte2 << 0x0C) | + (byte3 << 0x06) | byte4; + if (codePoint >= 0x010000 && codePoint <= 0x10FFFF) { + return codePoint; + } + } + + throw Error('Invalid UTF-8 detected'); + } + + var byteArray; + var byteCount; + var byteIndex; + function utf8decode(byteString, opts) { + opts = opts || {}; + var strict = false !== opts.strict; + + byteArray = ucs2decode(byteString); + byteCount = byteArray.length; + byteIndex = 0; + var codePoints = []; + var tmp; + while ((tmp = decodeSymbol(strict)) !== false) { + codePoints.push(tmp); + } + return ucs2encode(codePoints); + } + + module.exports = { + version: '2.1.2', + encode: utf8encode, + decode: utf8decode + }; + + +/***/ }, +/* 15 */ +/***/ function(module, exports) { + + /* + * base64-arraybuffer + * https://github.com/niklasvh/base64-arraybuffer + * + * Copyright (c) 2012 Niklas von Hertzen + * Licensed under the MIT license. + */ + (function(){ + "use strict"; + + var chars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + + // Use a lookup table to find the index. + var lookup = new Uint8Array(256); + for (var i = 0; i < chars.length; i++) { + lookup[chars.charCodeAt(i)] = i; + } + + exports.encode = function(arraybuffer) { + var bytes = new Uint8Array(arraybuffer), + i, len = bytes.length, base64 = ""; + + for (i = 0; i < len; i+=3) { + base64 += chars[bytes[i] >> 2]; + base64 += chars[((bytes[i] & 3) << 4) | (bytes[i + 1] >> 4)]; + base64 += chars[((bytes[i + 1] & 15) << 2) | (bytes[i + 2] >> 6)]; + base64 += chars[bytes[i + 2] & 63]; + } + + if ((len % 3) === 2) { + base64 = base64.substring(0, base64.length - 1) + "="; + } else if (len % 3 === 1) { + base64 = base64.substring(0, base64.length - 2) + "=="; + } + + return base64; + }; + + exports.decode = function(base64) { + var bufferLength = base64.length * 0.75, + len = base64.length, i, p = 0, + encoded1, encoded2, encoded3, encoded4; + + if (base64[base64.length - 1] === "=") { + bufferLength--; + if (base64[base64.length - 2] === "=") { + bufferLength--; + } + } + + var arraybuffer = new ArrayBuffer(bufferLength), + bytes = new Uint8Array(arraybuffer); + + for (i = 0; i < len; i+=4) { + encoded1 = lookup[base64.charCodeAt(i)]; + encoded2 = lookup[base64.charCodeAt(i+1)]; + encoded3 = lookup[base64.charCodeAt(i+2)]; + encoded4 = lookup[base64.charCodeAt(i+3)]; + + bytes[p++] = (encoded1 << 2) | (encoded2 >> 4); + bytes[p++] = ((encoded2 & 15) << 4) | (encoded3 >> 2); + bytes[p++] = ((encoded3 & 3) << 6) | (encoded4 & 63); + } + + return arraybuffer; + }; + })(); + + +/***/ }, +/* 16 */ +/***/ function(module, exports) { + + /** + * Create a blob builder even when vendor prefixes exist + */ + + var BlobBuilder = typeof BlobBuilder !== 'undefined' ? BlobBuilder : + typeof WebKitBlobBuilder !== 'undefined' ? WebKitBlobBuilder : + typeof MSBlobBuilder !== 'undefined' ? MSBlobBuilder : + typeof MozBlobBuilder !== 'undefined' ? MozBlobBuilder : + false; + + /** + * Check if Blob constructor is supported + */ + + var blobSupported = (function() { + try { + var a = new Blob(['hi']); + return a.size === 2; + } catch(e) { + return false; + } + })(); + + /** + * Check if Blob constructor supports ArrayBufferViews + * Fails in Safari 6, so we need to map to ArrayBuffers there. + */ + + var blobSupportsArrayBufferView = blobSupported && (function() { + try { + var b = new Blob([new Uint8Array([1,2])]); + return b.size === 2; + } catch(e) { + return false; + } + })(); + + /** + * Check if BlobBuilder is supported + */ + + var blobBuilderSupported = BlobBuilder + && BlobBuilder.prototype.append + && BlobBuilder.prototype.getBlob; + + /** + * Helper function that maps ArrayBufferViews to ArrayBuffers + * Used by BlobBuilder constructor and old browsers that didn't + * support it in the Blob constructor. + */ + + function mapArrayBufferViews(ary) { + return ary.map(function(chunk) { + if (chunk.buffer instanceof ArrayBuffer) { + var buf = chunk.buffer; + + // if this is a subarray, make a copy so we only + // include the subarray region from the underlying buffer + if (chunk.byteLength !== buf.byteLength) { + var copy = new Uint8Array(chunk.byteLength); + copy.set(new Uint8Array(buf, chunk.byteOffset, chunk.byteLength)); + buf = copy.buffer; + } + + return buf; + } + + return chunk; + }); + } + + function BlobBuilderConstructor(ary, options) { + options = options || {}; + + var bb = new BlobBuilder(); + mapArrayBufferViews(ary).forEach(function(part) { + bb.append(part); + }); + + return (options.type) ? bb.getBlob(options.type) : bb.getBlob(); + }; + + function BlobConstructor(ary, options) { + return new Blob(mapArrayBufferViews(ary), options || {}); + }; + + if (typeof Blob !== 'undefined') { + BlobBuilderConstructor.prototype = Blob.prototype; + BlobConstructor.prototype = Blob.prototype; + } + + module.exports = (function() { + if (blobSupported) { + return blobSupportsArrayBufferView ? Blob : BlobConstructor; + } else if (blobBuilderSupported) { + return BlobBuilderConstructor; + } else { + return undefined; + } + })(); + + +/***/ }, +/* 17 */ +/***/ function(module, exports, __webpack_require__) { + + + /** + * Expose `Emitter`. + */ + + if (true) { + module.exports = Emitter; + } + + /** + * Initialize a new `Emitter`. + * + * @api public + */ + + function Emitter(obj) { + if (obj) return mixin(obj); + }; + + /** + * Mixin the emitter properties. + * + * @param {Object} obj + * @return {Object} + * @api private + */ + + function mixin(obj) { + for (var key in Emitter.prototype) { + obj[key] = Emitter.prototype[key]; + } + return obj; + } + + /** + * Listen on the given `event` with `fn`. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + + Emitter.prototype.on = + Emitter.prototype.addEventListener = function(event, fn){ + this._callbacks = this._callbacks || {}; + (this._callbacks['$' + event] = this._callbacks['$' + event] || []) + .push(fn); + return this; + }; + + /** + * Adds an `event` listener that will be invoked a single + * time then automatically removed. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + + Emitter.prototype.once = function(event, fn){ + function on() { + this.off(event, on); + fn.apply(this, arguments); + } + + on.fn = fn; + this.on(event, on); + return this; + }; + + /** + * Remove the given callback for `event` or all + * registered callbacks. + * + * @param {String} event + * @param {Function} fn + * @return {Emitter} + * @api public + */ + + Emitter.prototype.off = + Emitter.prototype.removeListener = + Emitter.prototype.removeAllListeners = + Emitter.prototype.removeEventListener = function(event, fn){ + this._callbacks = this._callbacks || {}; + + // all + if (0 == arguments.length) { + this._callbacks = {}; + return this; + } + + // specific event + var callbacks = this._callbacks['$' + event]; + if (!callbacks) return this; + + // remove all handlers + if (1 == arguments.length) { + delete this._callbacks['$' + event]; + return this; + } + + // remove specific handler + var cb; + for (var i = 0; i < callbacks.length; i++) { + cb = callbacks[i]; + if (cb === fn || cb.fn === fn) { + callbacks.splice(i, 1); + break; + } + } + return this; + }; + + /** + * Emit `event` with the given args. + * + * @param {String} event + * @param {Mixed} ... + * @return {Emitter} + */ + + Emitter.prototype.emit = function(event){ + this._callbacks = this._callbacks || {}; + var args = [].slice.call(arguments, 1) + , callbacks = this._callbacks['$' + event]; + + if (callbacks) { + callbacks = callbacks.slice(0); + for (var i = 0, len = callbacks.length; i < len; ++i) { + callbacks[i].apply(this, args); + } + } + + return this; + }; + + /** + * Return array of callbacks for `event`. + * + * @param {String} event + * @return {Array} + * @api public + */ + + Emitter.prototype.listeners = function(event){ + this._callbacks = this._callbacks || {}; + return this._callbacks['$' + event] || []; + }; + + /** + * Check if this emitter has `event` handlers. + * + * @param {String} event + * @return {Boolean} + * @api public + */ + + Emitter.prototype.hasListeners = function(event){ + return !! this.listeners(event).length; + }; + + +/***/ }, +/* 18 */ +/***/ function(module, exports) { + + /** + * Compiles a querystring + * Returns string representation of the object + * + * @param {Object} + * @api private + */ + + exports.encode = function (obj) { + var str = ''; + + for (var i in obj) { + if (obj.hasOwnProperty(i)) { + if (str.length) str += '&'; + str += encodeURIComponent(i) + '=' + encodeURIComponent(obj[i]); + } + } + + return str; + }; + + /** + * Parses a simple querystring into an object + * + * @param {String} qs + * @api private + */ + + exports.decode = function(qs){ + var qry = {}; + var pairs = qs.split('&'); + for (var i = 0, l = pairs.length; i < l; i++) { + var pair = pairs[i].split('='); + qry[decodeURIComponent(pair[0])] = decodeURIComponent(pair[1]); + } + return qry; + }; + + +/***/ }, +/* 19 */ +/***/ function(module, exports) { + + + module.exports = function(a, b){ + var fn = function(){}; + fn.prototype = b.prototype; + a.prototype = new fn; + a.prototype.constructor = a; + }; + +/***/ }, +/* 20 */ +/***/ function(module, exports) { + + 'use strict'; + + var alphabet = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz-_'.split('') + , length = 64 + , map = {} + , seed = 0 + , i = 0 + , prev; + + /** + * Return a string representing the specified number. + * + * @param {Number} num The number to convert. + * @returns {String} The string representation of the number. + * @api public + */ + function encode(num) { + var encoded = ''; + + do { + encoded = alphabet[num % length] + encoded; + num = Math.floor(num / length); + } while (num > 0); + + return encoded; + } + + /** + * Return the integer value specified by the given string. + * + * @param {String} str The string to convert. + * @returns {Number} The integer value represented by the string. + * @api public + */ + function decode(str) { + var decoded = 0; + + for (i = 0; i < str.length; i++) { + decoded = decoded * length + map[str.charAt(i)]; + } + + return decoded; + } + + /** + * Yeast: A tiny growing id generator. + * + * @returns {String} A unique id. + * @api public + */ + function yeast() { + var now = encode(+new Date()); + + if (now !== prev) return seed = 0, prev = now; + return now +'.'+ encode(seed++); + } + + // + // Map each character to its index. + // + for (; i < length; i++) map[alphabet[i]] = i; + + // + // Expose the `yeast`, `encode` and `decode` functions. + // + yeast.encode = encode; + yeast.decode = decode; + module.exports = yeast; + + +/***/ }, +/* 21 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(process) {/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + + exports = module.exports = __webpack_require__(23); + exports.log = log; + exports.formatArgs = formatArgs; + exports.save = save; + exports.load = load; + exports.useColors = useColors; + exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + + /** + * Colors. + */ + + exports.colors = [ + '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', + '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', + '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', + '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', + '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', + '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', + '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', + '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', + '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', + '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', + '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' + ]; + + /** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + + function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); + } + + /** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + + exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } + }; + + + /** + * Colorize log arguments if enabled. + * + * @api public + */ + + function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); + } + + /** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + + function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); + } + + /** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + + function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} + } + + /** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + + function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; + } + + /** + * Enable namespaces listed in `localStorage.debug` initially. + */ + + exports.enable(load()); + + /** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + + function localstorage() { + try { + return window.localStorage; + } catch (e) {} + } + + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(22))) + +/***/ }, +/* 22 */ +/***/ function(module, exports) { + + // shim for using process in browser + var process = module.exports = {}; + + // cached from whatever global is present so that test runners that stub it + // don't break things. But we need to wrap it in a try catch in case it is + // wrapped in strict mode code which doesn't define any globals. It's inside a + // function because try/catches deoptimize in certain engines. + + var cachedSetTimeout; + var cachedClearTimeout; + + function defaultSetTimout() { + throw new Error('setTimeout has not been defined'); + } + function defaultClearTimeout () { + throw new Error('clearTimeout has not been defined'); + } + (function () { + try { + if (typeof setTimeout === 'function') { + cachedSetTimeout = setTimeout; + } else { + cachedSetTimeout = defaultSetTimout; + } + } catch (e) { + cachedSetTimeout = defaultSetTimout; + } + try { + if (typeof clearTimeout === 'function') { + cachedClearTimeout = clearTimeout; + } else { + cachedClearTimeout = defaultClearTimeout; + } + } catch (e) { + cachedClearTimeout = defaultClearTimeout; + } + } ()) + function runTimeout(fun) { + if (cachedSetTimeout === setTimeout) { + //normal enviroments in sane situations + return setTimeout(fun, 0); + } + // if setTimeout wasn't available but was latter defined + if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) { + cachedSetTimeout = setTimeout; + return setTimeout(fun, 0); + } + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedSetTimeout(fun, 0); + } catch(e){ + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedSetTimeout.call(null, fun, 0); + } catch(e){ + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error + return cachedSetTimeout.call(this, fun, 0); + } + } + + + } + function runClearTimeout(marker) { + if (cachedClearTimeout === clearTimeout) { + //normal enviroments in sane situations + return clearTimeout(marker); + } + // if clearTimeout wasn't available but was latter defined + if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) { + cachedClearTimeout = clearTimeout; + return clearTimeout(marker); + } + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedClearTimeout(marker); + } catch (e){ + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedClearTimeout.call(null, marker); + } catch (e){ + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error. + // Some versions of I.E. have different rules for clearTimeout vs setTimeout + return cachedClearTimeout.call(this, marker); + } + } + + + + } + var queue = []; + var draining = false; + var currentQueue; + var queueIndex = -1; + + function cleanUpNextTick() { + if (!draining || !currentQueue) { + return; + } + draining = false; + if (currentQueue.length) { + queue = currentQueue.concat(queue); + } else { + queueIndex = -1; + } + if (queue.length) { + drainQueue(); + } + } + + function drainQueue() { + if (draining) { + return; + } + var timeout = runTimeout(cleanUpNextTick); + draining = true; + + var len = queue.length; + while(len) { + currentQueue = queue; + queue = []; + while (++queueIndex < len) { + if (currentQueue) { + currentQueue[queueIndex].run(); + } + } + queueIndex = -1; + len = queue.length; + } + currentQueue = null; + draining = false; + runClearTimeout(timeout); + } + + process.nextTick = function (fun) { + var args = new Array(arguments.length - 1); + if (arguments.length > 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + queue.push(new Item(fun, args)); + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } + }; + + // v8 likes predictible objects + function Item(fun, array) { + this.fun = fun; + this.array = array; + } + Item.prototype.run = function () { + this.fun.apply(null, this.array); + }; + process.title = 'browser'; + process.browser = true; + process.env = {}; + process.argv = []; + process.version = ''; // empty string to avoid regexp issues + process.versions = {}; + + function noop() {} + + process.on = noop; + process.addListener = noop; + process.once = noop; + process.off = noop; + process.removeListener = noop; + process.removeAllListeners = noop; + process.emit = noop; + process.prependListener = noop; + process.prependOnceListener = noop; + + process.listeners = function (name) { return [] } + + process.binding = function (name) { + throw new Error('process.binding is not supported'); + }; + + process.cwd = function () { return '/' }; + process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); + }; + process.umask = function() { return 0; }; + + +/***/ }, +/* 23 */ +/***/ function(module, exports, __webpack_require__) { + + + /** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + + exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; + exports.coerce = coerce; + exports.disable = disable; + exports.enable = enable; + exports.enabled = enabled; + exports.humanize = __webpack_require__(24); + + /** + * Active `debug` instances. + */ + exports.instances = []; + + /** + * The currently active debug mode names, and names to skip. + */ + + exports.names = []; + exports.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + + exports.formatters = {}; + + /** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + + function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; + } + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + + function createDebug(namespace) { + + var prevTime; + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + exports.instances.push(debug); + + return debug; + } + + function destroy () { + var index = exports.instances.indexOf(this); + if (index !== -1) { + exports.instances.splice(index, 1); + return true; + } else { + return false; + } + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + + function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < exports.instances.length; i++) { + var instance = exports.instances[i]; + instance.enabled = exports.enabled(instance.namespace); + } + } + + /** + * Disable debug output. + * + * @api public + */ + + function disable() { + exports.enable(''); + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + + function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; + } + + +/***/ }, +/* 24 */ +/***/ function(module, exports) { + + /** + * Helpers. + */ + + var s = 1000; + var m = s * 60; + var h = m * 60; + var d = h * 24; + var y = d * 365.25; + + /** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + + module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); + }; + + /** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + + function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } + } + + /** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + + function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; + } + + /** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + + function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; + } + + /** + * Pluralization helper. + */ + + function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; + } + + +/***/ }, +/* 25 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(global) {'use strict'; + + /** + * Module requirements. + */ + + var Polling = __webpack_require__(6); + var inherit = __webpack_require__(19); + + /** + * Module exports. + */ + + module.exports = JSONPPolling; + + /** + * Cached regular expressions. + */ + + var rNewline = /\n/g; + var rEscapedNewline = /\\n/g; + + /** + * Global JSONP callbacks. + */ + + var callbacks; + + /** + * Noop. + */ + + function empty() {} + + /** + * Until https://github.com/tc39/proposal-global is shipped. + */ + function glob() { + return typeof self !== 'undefined' ? self : typeof window !== 'undefined' ? window : typeof global !== 'undefined' ? global : {}; + } + + /** + * JSONP Polling constructor. + * + * @param {Object} opts. + * @api public + */ + + function JSONPPolling(opts) { + Polling.call(this, opts); + + this.query = this.query || {}; + + // define global callbacks array if not present + // we do this here (lazily) to avoid unneeded global pollution + if (!callbacks) { + // we need to consider multiple engines in the same page + var global = glob(); + callbacks = global.___eio = global.___eio || []; + } + + // callback identifier + this.index = callbacks.length; + + // add callback to jsonp global + var self = this; + callbacks.push(function (msg) { + self.onData(msg); + }); + + // append to query string + this.query.j = this.index; + + // prevent spurious errors from being emitted when the window is unloaded + if (typeof addEventListener === 'function') { + addEventListener('beforeunload', function () { + if (self.script) self.script.onerror = empty; + }, false); + } + } + + /** + * Inherits from Polling. + */ + + inherit(JSONPPolling, Polling); + + /* + * JSONP only supports binary as base64 encoded strings + */ + + JSONPPolling.prototype.supportsBinary = false; + + /** + * Closes the socket. + * + * @api private + */ + + JSONPPolling.prototype.doClose = function () { + if (this.script) { + this.script.parentNode.removeChild(this.script); + this.script = null; + } + + if (this.form) { + this.form.parentNode.removeChild(this.form); + this.form = null; + this.iframe = null; + } + + Polling.prototype.doClose.call(this); + }; + + /** + * Starts a poll cycle. + * + * @api private + */ + + JSONPPolling.prototype.doPoll = function () { + var self = this; + var script = document.createElement('script'); + + if (this.script) { + this.script.parentNode.removeChild(this.script); + this.script = null; + } + + script.async = true; + script.src = this.uri(); + script.onerror = function (e) { + self.onError('jsonp poll error', e); + }; + + var insertAt = document.getElementsByTagName('script')[0]; + if (insertAt) { + insertAt.parentNode.insertBefore(script, insertAt); + } else { + (document.head || document.body).appendChild(script); + } + this.script = script; + + var isUAgecko = 'undefined' !== typeof navigator && /gecko/i.test(navigator.userAgent); + + if (isUAgecko) { + setTimeout(function () { + var iframe = document.createElement('iframe'); + document.body.appendChild(iframe); + document.body.removeChild(iframe); + }, 100); + } + }; + + /** + * Writes with a hidden iframe. + * + * @param {String} data to send + * @param {Function} called upon flush. + * @api private + */ + + JSONPPolling.prototype.doWrite = function (data, fn) { + var self = this; + + if (!this.form) { + var form = document.createElement('form'); + var area = document.createElement('textarea'); + var id = this.iframeId = 'eio_iframe_' + this.index; + var iframe; + + form.className = 'socketio'; + form.style.position = 'absolute'; + form.style.top = '-1000px'; + form.style.left = '-1000px'; + form.target = id; + form.method = 'POST'; + form.setAttribute('accept-charset', 'utf-8'); + area.name = 'd'; + form.appendChild(area); + document.body.appendChild(form); + + this.form = form; + this.area = area; + } + + this.form.action = this.uri(); + + function complete() { + initIframe(); + fn(); + } + + function initIframe() { + if (self.iframe) { + try { + self.form.removeChild(self.iframe); + } catch (e) { + self.onError('jsonp polling iframe removal error', e); + } + } + + try { + // ie6 dynamic iframes with target="" support (thanks Chris Lambacher) + var html = '