Skip to content

HTTPS clone URL

Subversion checkout URL

You can clone with
or
.
Download ZIP
337 lines (290 sloc) 9.993 kB
/**************************************************************************
*
* Copyright 2010 VMware, Inc.
* All Rights Reserved.
*
* Permission is hereby granted, free of charge, to any person obtaining a copy
* of this software and associated documentation files (the "Software"), to deal
* in the Software without restriction, including without limitation the rights
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
* copies of the Software, and to permit persons to whom the Software is
* furnished to do so, subject to the following conditions:
*
* The above copyright notice and this permission notice shall be included in
* all copies or substantial portions of the Software.
*
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
* THE SOFTWARE.
*
**************************************************************************/
#include <limits>
#include <assert.h>
#include <string.h>
#include "highlight.hpp"
#include "trace_dump.hpp"
#include "guids.hpp"
namespace trace {
class Dumper : public Visitor
{
protected:
std::ostream &os;
DumpFlags dumpFlags;
const highlight::Highlighter & highlighter;
const highlight::Attribute & normal;
const highlight::Attribute & bold;
const highlight::Attribute & italic;
const highlight::Attribute & strike;
const highlight::Attribute & red;
const highlight::Attribute & pointer;
const highlight::Attribute & literal;
public:
Dumper(std::ostream &_os, DumpFlags _flags) :
os(_os),
dumpFlags(_flags),
highlighter(highlight::defaultHighlighter(!(dumpFlags & DUMP_FLAG_NO_COLOR))),
normal(highlighter.normal()),
bold(highlighter.bold()),
italic(highlighter.italic()),
strike(highlighter.strike()),
red(highlighter.color(highlight::RED)),
pointer(highlighter.color(highlight::GREEN)),
literal(highlighter.color(highlight::BLUE))
{
}
~Dumper() {
}
void visit(Null *) {
os << literal << "NULL" << normal;
}
void visit(Bool *node) {
os << literal << (node->value ? "true" : "false") << normal;
}
void visit(SInt *node) {
os << literal << node->value << normal;
}
void visit(UInt *node) {
os << literal << node->value << normal;
}
void visit(Float *node) {
std::streamsize oldPrecision = os.precision(std::numeric_limits<float>::digits10 + 1);
os << literal << node->value << normal;
os.precision(oldPrecision);
}
void visit(Double *node) {
std::streamsize oldPrecision = os.precision(std::numeric_limits<double>::digits10 + 1);
os << literal << node->value << normal;
os.precision(oldPrecision);
}
template< typename C >
void visitString(const C *value) {
os << literal << "\"";
for (const C *it = value; *it; ++it) {
unsigned c = (unsigned) *it;
if (c == '\"')
os << "\\\"";
else if (c == '\\')
os << "\\\\";
else if (c >= 0x20 && c <= 0x7e)
os << (char)c;
else if (c == '\t') {
os << "\t";
} else if (c == '\r') {
// Ignore carriage-return
} else if (c == '\n') {
// Reset formatting so that it looks correct with 'less -R'
os << normal << '\n' << literal;
} else {
// FIXME: handle wchar_t octals properly
unsigned octal0 = c & 0x7;
unsigned octal1 = (c >> 3) & 0x7;
unsigned octal2 = (c >> 3) & 0x7;
os << "\\";
if (octal2)
os << octal2;
if (octal1)
os << octal1;
os << octal0;
}
}
os << "\"" << normal;
}
void visit(String *node) {
visitString(node->value);
}
void visit(WString *node) {
os << literal << "L";
visitString(node->value);
}
void visit(Enum *node) {
const EnumValue *it = node->lookup();
if (it) {
os << literal << it->name << normal;
return;
}
os << literal << node->value << normal;
}
void visit(Bitmask *bitmask) {
unsigned long long value = bitmask->value;
const BitmaskSig *sig = bitmask->sig;
bool first = true;
for (const BitmaskFlag *it = sig->flags; it != sig->flags + sig->num_flags; ++it) {
assert(it->value || first);
if ((it->value && (value & it->value) == it->value) ||
(!it->value && value == 0)) {
if (!first) {
os << " | ";
}
os << literal << it->name << normal;
value &= ~it->value;
first = false;
}
if (value == 0) {
break;
}
}
if (value || first) {
if (!first) {
os << " | ";
}
os << literal << "0x" << std::hex << value << std::dec << normal;
}
}
const char *
visitMembers(Struct *s, const char *sep = "") {
for (unsigned i = 0; i < s->members.size(); ++i) {
const char *memberName = s->sig->member_names[i];
Value *memberValue = s->members[i];
if (!memberName || !*memberName) {
// Anonymous structure
Struct *memberStruct = memberValue->toStruct();
assert(memberStruct);
if (memberStruct) {
sep = visitMembers(memberStruct, sep);
continue;
}
}
os << sep << italic << memberName << normal << " = ",
_visit(memberValue);
sep = ", ";
}
return sep;
}
void visit(Struct *s) {
// Replace GUIDs with their symbolic name
// TODO: Move this to parsing, so it can be shared everywhere
if (s->members.size() == 4 &&
strcmp(s->sig->name, "GUID") == 0) {
GUID guid;
guid.Data1 = s->members[0]->toUInt();
guid.Data2 = s->members[1]->toUInt();
guid.Data3 = s->members[2]->toUInt();
Array *data4 = s->members[3]->toArray();
assert(data4);
assert(data4->values.size() == 8);
for (int i = 0; i < sizeof guid.Data4; ++i) {
guid.Data4[i] = data4->values[i]->toUInt();
}
const char *name = getGuidName(guid);
os << literal << name << normal;
return;
}
os << "{";
visitMembers(s);
os << "}";
}
void visit(Array *array) {
if (array->values.size() == 1) {
os << "&";
_visit(array->values[0]);
}
else {
const char *sep = "";
os << "{";
for (std::vector<Value *>::iterator it = array->values.begin(); it != array->values.end(); ++it) {
os << sep;
_visit(*it);
sep = ", ";
}
os << "}";
}
}
void visit(Blob *blob) {
os << pointer << "blob(" << blob->size << ")" << normal;
}
void visit(Pointer *p) {
os << pointer << "0x" << std::hex << p->value << std::dec << normal;
}
void visit(Repr *r) {
_visit(r->humanValue);
}
void visit(StackFrame *frame) {
frame->dump(os);
}
void visit(Backtrace & backtrace) {
for (int i = 0; i < backtrace.size(); i ++) {
visit(backtrace[i]);
os << "\n";
}
}
void visit(Call *call) {
CallFlags callFlags = call->flags;
if (!(dumpFlags & DUMP_FLAG_NO_CALL_NO)) {
os << call->no << " ";
}
if (dumpFlags & DUMP_FLAG_THREAD_IDS) {
os << "@" << std::hex << call->thread_id << std::dec << " ";
}
if (callFlags & CALL_FLAG_NON_REPRODUCIBLE) {
os << strike;
} else if (callFlags & (CALL_FLAG_FAKE | CALL_FLAG_NO_SIDE_EFFECTS)) {
os << normal;
} else {
os << bold;
}
os << call->sig->name << normal;
os << "(";
const char *sep = "";
for (unsigned i = 0; i < call->args.size(); ++i) {
os << sep;
if (!(dumpFlags & DUMP_FLAG_NO_ARG_NAMES)) {
os << italic << call->sig->arg_names[i] << normal << " = ";
}
if (call->args[i].value) {
_visit(call->args[i].value);
} else {
os << "?";
}
sep = ", ";
}
os << ")";
if (call->ret) {
os << " = ";
_visit(call->ret);
}
if (callFlags & CALL_FLAG_INCOMPLETE) {
os << " // " << red << "incomplete" << normal;
}
os << "\n";
if (call->backtrace != NULL) {
os << bold << red << "Backtrace:\n" << normal;
visit(*call->backtrace);
}
if (callFlags & CALL_FLAG_END_FRAME) {
os << "\n";
}
}
};
void dump(Value *value, std::ostream &os, DumpFlags flags) {
Dumper d(os, flags);
value->visit(d);
}
void dump(Call &call, std::ostream &os, DumpFlags flags) {
Dumper d(os, flags);
d.visit(&call);
}
} /* namespace trace */
Jump to Line
Something went wrong with that request. Please try again.