diff --git a/.circleci/config.yml b/.circleci/config.yml
index 521cab953..8bc4334b9 100644
--- a/.circleci/config.yml
+++ b/.circleci/config.yml
@@ -1,39 +1,18 @@
version: 2
-references:
- restore_node_modules_cache: &restore_node_modules_cache
- restore_cache:
- keys:
- - deps-{{ .Branch }}-{{ checksum "yarn.lock" }}
- - deps-{{ .Branch }}-
- - deps-
- bootstrap: &bootstrap
- run:
- name: lerna bootstrap
- command: lerna bootstrap && lerna run prepare
- save_node_modules_cache: &save_node_modules_cache
- save_cache:
- key: deps-{{ .Branch }}-{{ checksum "yarn.lock" }}
- paths:
- - ./node_modules
- - ./packages/bemuse-indexer/node_modules
- - ./packages/bemuse-notechart/node_modules
- - ./packages/bemuse-tools/node_modules
- - ./packages/bms/node_modules
- - ./packages/bmson/node_modules
jobs:
build:
working_directory: ~/bemuse
environment:
FORCE_COLOR: '1'
docker:
- - image: circleci/node:16.3.0-browsers
+ - image: circleci/node:16.12.0-browsers
steps:
- - run: sudo npm i -g lerna
- checkout
- add_ssh_keys
- - *restore_node_modules_cache
- - *bootstrap
- - *save_node_modules_cache
+ - run:
+ name: install deps
+ command: |
+ node common/scripts/install-run-rush.js install
- run:
name: build
command: |
@@ -41,7 +20,8 @@ jobs:
node build-scripts build
- run:
name: checks
- command: yarn pre-deploy
+ command: |
+ node build-scripts pre-deploy
- run:
name: deploy
command: |
@@ -58,19 +38,21 @@ jobs:
root: .
paths:
- dist
- - node_modules
- - e2e/node_modules
e2e:
working_directory: ~/bemuse
environment:
FORCE_COLOR: '1'
SCREENSHOT_DIR: /tmp/bemuse-e2e-screenshot
docker:
- - image: circleci/node:16.3.0-browsers
+ - image: circleci/node:16.12.0-browsers
steps:
- checkout
- attach_workspace:
at: .
+ - run:
+ name: install deps
+ command: |
+ node common/scripts/install-run-rush.js install
- run:
name: Install HTTP server
command: |
@@ -85,7 +67,7 @@ jobs:
command: |
cd e2e
mkdir -p "$SCREENSHOT_DIR"
- env BEMUSE_PORT=8089 yarn prescript tests/Gameplay-test.js
+ env BEMUSE_PORT=8089 npx prescript tests/Gameplay-test.js
no_output_timeout: 1m
- store_artifacts:
path: /tmp/bemuse-e2e-screenshot
diff --git a/.eslintignore b/.eslintignore
index ea3e00179..b74f7444f 100644
--- a/.eslintignore
+++ b/.eslintignore
@@ -4,4 +4,7 @@
**/dist/**/*
**/build/**/*
**/coverage/**/*
+**/common/scripts/**/*
+**/temp/**/*
+**/tmp/**/*
**/.yarn/**/*
diff --git a/.gitattributes b/.gitattributes
index cfc04e101..88bf648a3 100644
--- a/.gitattributes
+++ b/.gitattributes
@@ -31,3 +31,18 @@
*.PDF diff=astextplain
*.rtf diff=astextplain
*.RTF diff=astextplain
+
+# Don't allow people to merge changes to these generated files, because the result
+# may be invalid. You need to run "rush update" again.
+pnpm-lock.yaml merge=binary
+shrinkwrap.yaml merge=binary
+npm-shrinkwrap.json merge=binary
+yarn.lock merge=binary
+
+# Rush's JSON config files use JavaScript-style code comments. The rule below prevents pedantic
+# syntax highlighters such as GitHub's from highlighting these comments as errors. Your text editor
+# may also require a special configuration to allow comments in JSON.
+#
+# For more information, see this issue: https://github.com/microsoft/rushstack/issues/1088
+#
+*.json linguist-language=JSON-with-Comments
diff --git a/.github/workflows/checks.yml b/.github/workflows/checks.yml
index 9c9ae8217..d63886ac3 100644
--- a/.github/workflows/checks.yml
+++ b/.github/workflows/checks.yml
@@ -22,13 +22,16 @@ jobs:
- name: Checkout
uses: actions/checkout@v2
- name: Install Deps
- run: yarn install && yarn lerna run prepare
+ run: node common/scripts/install-run-rush.js install
- name: Lint
- run: yarn danger ci
+ run: node common/scripts/install-run-rush.js danger-ci
env:
DANGER_GITHUB_API_TOKEN: ${{ secrets.GITHUB_TOKEN }}
- - name: Type Check
- run: yarn workspace bemuse tsc
+ - name: Build dependencies
+ run: node common/scripts/install-run-rush.js build --to-except bemuse
+ - name: Typecheck
+ run: node ../common/scripts/install-run-rushx.js typecheck
+ working-directory: bemuse
test:
runs-on: ubuntu-latest
steps:
@@ -38,9 +41,12 @@ jobs:
- name: Checkout
uses: actions/checkout@v2
- name: Install Deps
- run: yarn install && yarn lerna run prepare
+ run: node common/scripts/install-run-rush.js install
+ - name: Build
+ run: node common/scripts/install-run-rush.js build --to-except bemuse
- name: Test
- run: yarn test
+ run: node ../common/scripts/install-run-rushx.js test
+ working-directory: bemuse
- uses: codecov/codecov-action@v2
with:
token: ${{ secrets.CODECOV_TOKEN }}
@@ -53,9 +59,11 @@ jobs:
- name: Checkout
uses: actions/checkout@v2
- name: Install Deps
- run: yarn install && yarn lerna run prepare
+ run: node common/scripts/install-run-rush.js install
+ - name: Build
+ run: node common/scripts/install-run-rush.js build --to-except bemuse
- name: Test Packages
- run: yarn lerna run test
+ run: node common/scripts/install-run-rush.js test --to-except bemuse
- uses: codecov/codecov-action@v2
with:
token: ${{ secrets.CODECOV_TOKEN }}
diff --git a/.gitignore b/.gitignore
index 5fa897330..1644c46f1 100644
--- a/.gitignore
+++ b/.gitignore
@@ -54,3 +54,9 @@ Icon
/.otto/
/packages/*/lib/
.nyc_output
+
+# Rush temporary files
+common/deploy/
+common/temp/
+common/autoinstallers/*/.npmrc
+**/.rush/temp/
diff --git a/.gitpod.yml b/.gitpod.yml
index 761392fef..f4cfac031 100644
--- a/.gitpod.yml
+++ b/.gitpod.yml
@@ -1,3 +1,5 @@
tasks:
- - init: nvm i && yarn && yarn lerna run prepare
- command: nvm i && yarn start
+ - init: |
+ npm install --global @microsoft/rush && rush install && rush build --to-except bemuse
+ command: |
+ rush dev
diff --git a/.nvmrc b/.nvmrc
index d9a8a3578..58a4133d9 100644
--- a/.nvmrc
+++ b/.nvmrc
@@ -1 +1 @@
-16.3.0
+16.13.0
diff --git a/.prettierignore b/.prettierignore
index a3e6ff243..74e0df3ac 100644
--- a/.prettierignore
+++ b/.prettierignore
@@ -1,4 +1,5 @@
**/node_modules/**/*
+**/public/**/*
**/vendor/**/*
**/lib/**/*
**/dist/**/*
@@ -6,3 +7,12 @@
**/coverage/**/*
**/.nyc_output/**/*
**/.yarn/**/*
+common/changes/**/*
+common/temp/**/*
+common/scripts/**/*
+common/config/**/*
+pnpm-lock.yaml
+yarn.lock
+package-lock.json
+shrinkwrap.json
+**/*.md
\ No newline at end of file
diff --git a/.vscode/settings.json b/.vscode/settings.json
index 720e64d48..be12a2d4a 100644
--- a/.vscode/settings.json
+++ b/.vscode/settings.json
@@ -6,23 +6,19 @@
"editor.formatOnSave": true,
"cSpell.words": [
"AGPL",
- "BGAs",
- "Bemuse's",
- "Browserslist",
- "Bugfixes",
- "Cachier",
- "IIDX",
- "IPFS",
- "JKOC",
- "METTATUNES",
- "Pangsakulyanont",
+ "autoinstaller",
"autoplay",
"baconjs",
+ "Bemuse's",
"bemusegame",
"bemusic",
+ "BGAs",
"bmson",
"bmspec",
+ "Browserslist",
"bson",
+ "Bugfixes",
+ "Cachier",
"chardet",
"codebases",
"codecov",
@@ -39,7 +35,10 @@
"gameplay",
"gmail",
"hardcoded",
+ "IIDX",
"interop",
+ "IPFS",
+ "JKOC",
"joezeng",
"kbps",
"keycode",
@@ -50,12 +49,14 @@
"keytime",
"laggy",
"lerna",
+ "METTATUNES",
"module",
"monorepo",
"netlify",
"notechart",
"notecharts",
"objectid",
+ "Pangsakulyanont",
"pegjs",
"pixi",
"pixijs",
@@ -80,5 +81,8 @@
"updeep",
"workspaces"
],
- "eslint.enable": true
+ "eslint.enable": true,
+ "search.exclude": {
+ "**/.yarn": true
+ }
}
diff --git a/.vscode/tasks.json b/.vscode/tasks.json
index acf14fc4a..5de4d5f0c 100644
--- a/.vscode/tasks.json
+++ b/.vscode/tasks.json
@@ -7,6 +7,9 @@
"label": "Run Bemuse development server",
"type": "npm",
"script": "start",
+ "options": {
+ "cwd": "${workspaceFolder}/bemuse"
+ },
"group": {
"kind": "build",
"isDefault": true
diff --git a/.yarn/releases/yarn-1.22.10.js b/.yarn/releases/yarn-1.22.10.js
deleted file mode 100755
index 68b1990b1..000000000
--- a/.yarn/releases/yarn-1.22.10.js
+++ /dev/null
@@ -1,147392 +0,0 @@
-#!/usr/bin/env node
-module.exports =
-/******/ (function(modules) { // webpackBootstrap
-/******/ // The module cache
-/******/ var installedModules = {};
-/******/
-/******/ // The require function
-/******/ function __webpack_require__(moduleId) {
-/******/
-/******/ // Check if module is in cache
-/******/ if(installedModules[moduleId]) {
-/******/ return installedModules[moduleId].exports;
-/******/ }
-/******/ // Create a new module (and put it into the cache)
-/******/ var module = installedModules[moduleId] = {
-/******/ i: moduleId,
-/******/ l: false,
-/******/ exports: {}
-/******/ };
-/******/
-/******/ // Execute the module function
-/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
-/******/
-/******/ // Flag the module as loaded
-/******/ module.l = true;
-/******/
-/******/ // Return the exports of the module
-/******/ return module.exports;
-/******/ }
-/******/
-/******/
-/******/ // expose the modules object (__webpack_modules__)
-/******/ __webpack_require__.m = modules;
-/******/
-/******/ // expose the module cache
-/******/ __webpack_require__.c = installedModules;
-/******/
-/******/ // identity function for calling harmony imports with the correct context
-/******/ __webpack_require__.i = function(value) { return value; };
-/******/
-/******/ // define getter function for harmony exports
-/******/ __webpack_require__.d = function(exports, name, getter) {
-/******/ if(!__webpack_require__.o(exports, name)) {
-/******/ Object.defineProperty(exports, name, {
-/******/ configurable: false,
-/******/ enumerable: true,
-/******/ get: getter
-/******/ });
-/******/ }
-/******/ };
-/******/
-/******/ // getDefaultExport function for compatibility with non-harmony modules
-/******/ __webpack_require__.n = function(module) {
-/******/ var getter = module && module.__esModule ?
-/******/ function getDefault() { return module['default']; } :
-/******/ function getModuleExports() { return module; };
-/******/ __webpack_require__.d(getter, 'a', getter);
-/******/ return getter;
-/******/ };
-/******/
-/******/ // Object.prototype.hasOwnProperty.call
-/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
-/******/
-/******/ // __webpack_public_path__
-/******/ __webpack_require__.p = "";
-/******/
-/******/ // Load entry module and return exports
-/******/ return __webpack_require__(__webpack_require__.s = 549);
-/******/ })
-/************************************************************************/
-/******/ ([
-/* 0 */
-/***/ (function(module, exports) {
-
-module.exports = require("path");
-
-/***/ }),
-/* 1 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (immutable) */ __webpack_exports__["a"] = __extends;
-/* unused harmony export __assign */
-/* unused harmony export __rest */
-/* unused harmony export __decorate */
-/* unused harmony export __param */
-/* unused harmony export __metadata */
-/* unused harmony export __awaiter */
-/* unused harmony export __generator */
-/* unused harmony export __exportStar */
-/* unused harmony export __values */
-/* unused harmony export __read */
-/* unused harmony export __spread */
-/* unused harmony export __await */
-/* unused harmony export __asyncGenerator */
-/* unused harmony export __asyncDelegator */
-/* unused harmony export __asyncValues */
-/* unused harmony export __makeTemplateObject */
-/* unused harmony export __importStar */
-/* unused harmony export __importDefault */
-/*! *****************************************************************************
-Copyright (c) Microsoft Corporation. All rights reserved.
-Licensed under the Apache License, Version 2.0 (the "License"); you may not use
-this file except in compliance with the License. You may obtain a copy of the
-License at http://www.apache.org/licenses/LICENSE-2.0
-
-THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
-KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED
-WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE,
-MERCHANTABLITY OR NON-INFRINGEMENT.
-
-See the Apache Version 2.0 License for specific language governing permissions
-and limitations under the License.
-***************************************************************************** */
-/* global Reflect, Promise */
-
-var extendStatics = function(d, b) {
- extendStatics = Object.setPrototypeOf ||
- ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
- function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
- return extendStatics(d, b);
-};
-
-function __extends(d, b) {
- extendStatics(d, b);
- function __() { this.constructor = d; }
- d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
-}
-
-var __assign = function() {
- __assign = Object.assign || function __assign(t) {
- for (var s, i = 1, n = arguments.length; i < n; i++) {
- s = arguments[i];
- for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
- }
- return t;
- }
- return __assign.apply(this, arguments);
-}
-
-function __rest(s, e) {
- var t = {};
- for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
- t[p] = s[p];
- if (s != null && typeof Object.getOwnPropertySymbols === "function")
- for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0)
- t[p[i]] = s[p[i]];
- return t;
-}
-
-function __decorate(decorators, target, key, desc) {
- var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
- if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
- else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
- return c > 3 && r && Object.defineProperty(target, key, r), r;
-}
-
-function __param(paramIndex, decorator) {
- return function (target, key) { decorator(target, key, paramIndex); }
-}
-
-function __metadata(metadataKey, metadataValue) {
- if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
-}
-
-function __awaiter(thisArg, _arguments, P, generator) {
- return new (P || (P = Promise))(function (resolve, reject) {
- function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
- function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
- function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); }
- step((generator = generator.apply(thisArg, _arguments || [])).next());
- });
-}
-
-function __generator(thisArg, body) {
- var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
- return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
- function verb(n) { return function (v) { return step([n, v]); }; }
- function step(op) {
- if (f) throw new TypeError("Generator is already executing.");
- while (_) try {
- if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
- if (y = 0, t) op = [op[0] & 2, t.value];
- switch (op[0]) {
- case 0: case 1: t = op; break;
- case 4: _.label++; return { value: op[1], done: false };
- case 5: _.label++; y = op[1]; op = [0]; continue;
- case 7: op = _.ops.pop(); _.trys.pop(); continue;
- default:
- if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
- if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
- if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
- if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
- if (t[2]) _.ops.pop();
- _.trys.pop(); continue;
- }
- op = body.call(thisArg, _);
- } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
- if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
- }
-}
-
-function __exportStar(m, exports) {
- for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p];
-}
-
-function __values(o) {
- var m = typeof Symbol === "function" && o[Symbol.iterator], i = 0;
- if (m) return m.call(o);
- return {
- next: function () {
- if (o && i >= o.length) o = void 0;
- return { value: o && o[i++], done: !o };
- }
- };
-}
-
-function __read(o, n) {
- var m = typeof Symbol === "function" && o[Symbol.iterator];
- if (!m) return o;
- var i = m.call(o), r, ar = [], e;
- try {
- while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
- }
- catch (error) { e = { error: error }; }
- finally {
- try {
- if (r && !r.done && (m = i["return"])) m.call(i);
- }
- finally { if (e) throw e.error; }
- }
- return ar;
-}
-
-function __spread() {
- for (var ar = [], i = 0; i < arguments.length; i++)
- ar = ar.concat(__read(arguments[i]));
- return ar;
-}
-
-function __await(v) {
- return this instanceof __await ? (this.v = v, this) : new __await(v);
-}
-
-function __asyncGenerator(thisArg, _arguments, generator) {
- if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
- var g = generator.apply(thisArg, _arguments || []), i, q = [];
- return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
- function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
- function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
- function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
- function fulfill(value) { resume("next", value); }
- function reject(value) { resume("throw", value); }
- function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
-}
-
-function __asyncDelegator(o) {
- var i, p;
- return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
- function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
-}
-
-function __asyncValues(o) {
- if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
- var m = o[Symbol.asyncIterator], i;
- return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
- function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
- function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
-}
-
-function __makeTemplateObject(cooked, raw) {
- if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
- return cooked;
-};
-
-function __importStar(mod) {
- if (mod && mod.__esModule) return mod;
- var result = {};
- if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];
- result.default = mod;
- return result;
-}
-
-function __importDefault(mod) {
- return (mod && mod.__esModule) ? mod : { default: mod };
-}
-
-
-/***/ }),
-/* 2 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-exports.__esModule = true;
-
-var _promise = __webpack_require__(227);
-
-var _promise2 = _interopRequireDefault(_promise);
-
-function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
-
-exports.default = function (fn) {
- return function () {
- var gen = fn.apply(this, arguments);
- return new _promise2.default(function (resolve, reject) {
- function step(key, arg) {
- try {
- var info = gen[key](arg);
- var value = info.value;
- } catch (error) {
- reject(error);
- return;
- }
-
- if (info.done) {
- resolve(value);
- } else {
- return _promise2.default.resolve(value).then(function (value) {
- step("next", value);
- }, function (err) {
- step("throw", err);
- });
- }
- }
-
- return step("next");
- });
- };
-};
-
-/***/ }),
-/* 3 */
-/***/ (function(module, exports) {
-
-module.exports = require("util");
-
-/***/ }),
-/* 4 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.unlink = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.open = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined;
-
-var _asyncToGenerator2;
-
-function _load_asyncToGenerator() {
- return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2));
-}
-
-let buildActionsForCopy = (() => {
- var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) {
-
- //
- let build = (() => {
- var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
- const src = data.src,
- dest = data.dest,
- type = data.type;
-
- const onFresh = data.onFresh || noop;
- const onDone = data.onDone || noop;
-
- // TODO https://github.com/yarnpkg/yarn/issues/3751
- // related to bundled dependencies handling
- if (files.has(dest.toLowerCase())) {
- reporter.verbose(`The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`);
- } else {
- files.add(dest.toLowerCase());
- }
-
- if (type === 'symlink') {
- yield mkdirp((_path || _load_path()).default.dirname(dest));
- onFresh();
- actions.symlink.push({
- dest,
- linkname: src
- });
- onDone();
- return;
- }
-
- if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) {
- // ignored file
- return;
- }
-
- const srcStat = yield lstat(src);
- let srcFiles;
-
- if (srcStat.isDirectory()) {
- srcFiles = yield readdir(src);
- }
-
- let destStat;
- try {
- // try accessing the destination
- destStat = yield lstat(dest);
- } catch (e) {
- // proceed if destination doesn't exist, otherwise error
- if (e.code !== 'ENOENT') {
- throw e;
- }
- }
-
- // if destination exists
- if (destStat) {
- const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink();
- const bothFolders = srcStat.isDirectory() && destStat.isDirectory();
- const bothFiles = srcStat.isFile() && destStat.isFile();
-
- // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving
- // us modes that aren't valid. investigate this, it's generally safe to proceed.
-
- /* if (srcStat.mode !== destStat.mode) {
- try {
- await access(dest, srcStat.mode);
- } catch (err) {}
- } */
-
- if (bothFiles && artifactFiles.has(dest)) {
- // this file gets changed during build, likely by a custom install script. Don't bother checking it.
- onDone();
- reporter.verbose(reporter.lang('verboseFileSkipArtifact', src));
- return;
- }
-
- if (bothFiles && srcStat.size === destStat.size && (0, (_fsNormalized || _load_fsNormalized()).fileDatesEqual)(srcStat.mtime, destStat.mtime)) {
- // we can safely assume this is the same file
- onDone();
- reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.size, +srcStat.mtime));
- return;
- }
-
- if (bothSymlinks) {
- const srcReallink = yield readlink(src);
- if (srcReallink === (yield readlink(dest))) {
- // if both symlinks are the same then we can continue on
- onDone();
- reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink));
- return;
- }
- }
-
- if (bothFolders) {
- // mark files that aren't in this folder as possibly extraneous
- const destFiles = yield readdir(dest);
- invariant(srcFiles, 'src files not initialised');
-
- for (var _iterator4 = destFiles, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) {
- var _ref6;
-
- if (_isArray4) {
- if (_i4 >= _iterator4.length) break;
- _ref6 = _iterator4[_i4++];
- } else {
- _i4 = _iterator4.next();
- if (_i4.done) break;
- _ref6 = _i4.value;
- }
-
- const file = _ref6;
-
- if (srcFiles.indexOf(file) < 0) {
- const loc = (_path || _load_path()).default.join(dest, file);
- possibleExtraneous.add(loc);
-
- if ((yield lstat(loc)).isDirectory()) {
- for (var _iterator5 = yield readdir(loc), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) {
- var _ref7;
-
- if (_isArray5) {
- if (_i5 >= _iterator5.length) break;
- _ref7 = _iterator5[_i5++];
- } else {
- _i5 = _iterator5.next();
- if (_i5.done) break;
- _ref7 = _i5.value;
- }
-
- const file = _ref7;
-
- possibleExtraneous.add((_path || _load_path()).default.join(loc, file));
- }
- }
- }
- }
- }
- }
-
- if (destStat && destStat.isSymbolicLink()) {
- yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest);
- destStat = null;
- }
-
- if (srcStat.isSymbolicLink()) {
- onFresh();
- const linkname = yield readlink(src);
- actions.symlink.push({
- dest,
- linkname
- });
- onDone();
- } else if (srcStat.isDirectory()) {
- if (!destStat) {
- reporter.verbose(reporter.lang('verboseFileFolder', dest));
- yield mkdirp(dest);
- }
-
- const destParts = dest.split((_path || _load_path()).default.sep);
- while (destParts.length) {
- files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase());
- destParts.pop();
- }
-
- // push all files to queue
- invariant(srcFiles, 'src files not initialised');
- let remaining = srcFiles.length;
- if (!remaining) {
- onDone();
- }
- for (var _iterator6 = srcFiles, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) {
- var _ref8;
-
- if (_isArray6) {
- if (_i6 >= _iterator6.length) break;
- _ref8 = _iterator6[_i6++];
- } else {
- _i6 = _iterator6.next();
- if (_i6.done) break;
- _ref8 = _i6.value;
- }
-
- const file = _ref8;
-
- queue.push({
- dest: (_path || _load_path()).default.join(dest, file),
- onFresh,
- onDone: function (_onDone) {
- function onDone() {
- return _onDone.apply(this, arguments);
- }
-
- onDone.toString = function () {
- return _onDone.toString();
- };
-
- return onDone;
- }(function () {
- if (--remaining === 0) {
- onDone();
- }
- }),
- src: (_path || _load_path()).default.join(src, file)
- });
- }
- } else if (srcStat.isFile()) {
- onFresh();
- actions.file.push({
- src,
- dest,
- atime: srcStat.atime,
- mtime: srcStat.mtime,
- mode: srcStat.mode
- });
- onDone();
- } else {
- throw new Error(`unsure how to copy this: ${src}`);
- }
- });
-
- return function build(_x5) {
- return _ref5.apply(this, arguments);
- };
- })();
-
- const artifactFiles = new Set(events.artifactFiles || []);
- const files = new Set();
-
- // initialise events
- for (var _iterator = queue, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
- var _ref2;
-
- if (_isArray) {
- if (_i >= _iterator.length) break;
- _ref2 = _iterator[_i++];
- } else {
- _i = _iterator.next();
- if (_i.done) break;
- _ref2 = _i.value;
- }
-
- const item = _ref2;
-
- const onDone = item.onDone;
- item.onDone = function () {
- events.onProgress(item.dest);
- if (onDone) {
- onDone();
- }
- };
- }
- events.onStart(queue.length);
-
- // start building actions
- const actions = {
- file: [],
- symlink: [],
- link: []
- };
-
- // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items
- // at a time due to the requirement to push items onto the queue
- while (queue.length) {
- const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS);
- yield Promise.all(items.map(build));
- }
-
- // simulate the existence of some files to prevent considering them extraneous
- for (var _iterator2 = artifactFiles, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
- var _ref3;
-
- if (_isArray2) {
- if (_i2 >= _iterator2.length) break;
- _ref3 = _iterator2[_i2++];
- } else {
- _i2 = _iterator2.next();
- if (_i2.done) break;
- _ref3 = _i2.value;
- }
-
- const file = _ref3;
-
- if (possibleExtraneous.has(file)) {
- reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file));
- possibleExtraneous.delete(file);
- }
- }
-
- for (var _iterator3 = possibleExtraneous, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) {
- var _ref4;
-
- if (_isArray3) {
- if (_i3 >= _iterator3.length) break;
- _ref4 = _iterator3[_i3++];
- } else {
- _i3 = _iterator3.next();
- if (_i3.done) break;
- _ref4 = _i3.value;
- }
-
- const loc = _ref4;
-
- if (files.has(loc.toLowerCase())) {
- possibleExtraneous.delete(loc);
- }
- }
-
- return actions;
- });
-
- return function buildActionsForCopy(_x, _x2, _x3, _x4) {
- return _ref.apply(this, arguments);
- };
-})();
-
-let buildActionsForHardlink = (() => {
- var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) {
-
- //
- let build = (() => {
- var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
- const src = data.src,
- dest = data.dest;
-
- const onFresh = data.onFresh || noop;
- const onDone = data.onDone || noop;
- if (files.has(dest.toLowerCase())) {
- // Fixes issue https://github.com/yarnpkg/yarn/issues/2734
- // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1,
- // package-linker passes that modules A1 and B1 need to be hardlinked,
- // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case
- // an exception.
- onDone();
- return;
- }
- files.add(dest.toLowerCase());
-
- if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) {
- // ignored file
- return;
- }
-
- const srcStat = yield lstat(src);
- let srcFiles;
-
- if (srcStat.isDirectory()) {
- srcFiles = yield readdir(src);
- }
-
- const destExists = yield exists(dest);
- if (destExists) {
- const destStat = yield lstat(dest);
-
- const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink();
- const bothFolders = srcStat.isDirectory() && destStat.isDirectory();
- const bothFiles = srcStat.isFile() && destStat.isFile();
-
- if (srcStat.mode !== destStat.mode) {
- try {
- yield access(dest, srcStat.mode);
- } catch (err) {
- // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving
- // us modes that aren't valid. investigate this, it's generally safe to proceed.
- reporter.verbose(err);
- }
- }
-
- if (bothFiles && artifactFiles.has(dest)) {
- // this file gets changed during build, likely by a custom install script. Don't bother checking it.
- onDone();
- reporter.verbose(reporter.lang('verboseFileSkipArtifact', src));
- return;
- }
-
- // correct hardlink
- if (bothFiles && srcStat.ino !== null && srcStat.ino === destStat.ino) {
- onDone();
- reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.ino));
- return;
- }
-
- if (bothSymlinks) {
- const srcReallink = yield readlink(src);
- if (srcReallink === (yield readlink(dest))) {
- // if both symlinks are the same then we can continue on
- onDone();
- reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink));
- return;
- }
- }
-
- if (bothFolders) {
- // mark files that aren't in this folder as possibly extraneous
- const destFiles = yield readdir(dest);
- invariant(srcFiles, 'src files not initialised');
-
- for (var _iterator10 = destFiles, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) {
- var _ref14;
-
- if (_isArray10) {
- if (_i10 >= _iterator10.length) break;
- _ref14 = _iterator10[_i10++];
- } else {
- _i10 = _iterator10.next();
- if (_i10.done) break;
- _ref14 = _i10.value;
- }
-
- const file = _ref14;
-
- if (srcFiles.indexOf(file) < 0) {
- const loc = (_path || _load_path()).default.join(dest, file);
- possibleExtraneous.add(loc);
-
- if ((yield lstat(loc)).isDirectory()) {
- for (var _iterator11 = yield readdir(loc), _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) {
- var _ref15;
-
- if (_isArray11) {
- if (_i11 >= _iterator11.length) break;
- _ref15 = _iterator11[_i11++];
- } else {
- _i11 = _iterator11.next();
- if (_i11.done) break;
- _ref15 = _i11.value;
- }
-
- const file = _ref15;
-
- possibleExtraneous.add((_path || _load_path()).default.join(loc, file));
- }
- }
- }
- }
- }
- }
-
- if (srcStat.isSymbolicLink()) {
- onFresh();
- const linkname = yield readlink(src);
- actions.symlink.push({
- dest,
- linkname
- });
- onDone();
- } else if (srcStat.isDirectory()) {
- reporter.verbose(reporter.lang('verboseFileFolder', dest));
- yield mkdirp(dest);
-
- const destParts = dest.split((_path || _load_path()).default.sep);
- while (destParts.length) {
- files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase());
- destParts.pop();
- }
-
- // push all files to queue
- invariant(srcFiles, 'src files not initialised');
- let remaining = srcFiles.length;
- if (!remaining) {
- onDone();
- }
- for (var _iterator12 = srcFiles, _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) {
- var _ref16;
-
- if (_isArray12) {
- if (_i12 >= _iterator12.length) break;
- _ref16 = _iterator12[_i12++];
- } else {
- _i12 = _iterator12.next();
- if (_i12.done) break;
- _ref16 = _i12.value;
- }
-
- const file = _ref16;
-
- queue.push({
- onFresh,
- src: (_path || _load_path()).default.join(src, file),
- dest: (_path || _load_path()).default.join(dest, file),
- onDone: function (_onDone2) {
- function onDone() {
- return _onDone2.apply(this, arguments);
- }
-
- onDone.toString = function () {
- return _onDone2.toString();
- };
-
- return onDone;
- }(function () {
- if (--remaining === 0) {
- onDone();
- }
- })
- });
- }
- } else if (srcStat.isFile()) {
- onFresh();
- actions.link.push({
- src,
- dest,
- removeDest: destExists
- });
- onDone();
- } else {
- throw new Error(`unsure how to copy this: ${src}`);
- }
- });
-
- return function build(_x10) {
- return _ref13.apply(this, arguments);
- };
- })();
-
- const artifactFiles = new Set(events.artifactFiles || []);
- const files = new Set();
-
- // initialise events
- for (var _iterator7 = queue, _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) {
- var _ref10;
-
- if (_isArray7) {
- if (_i7 >= _iterator7.length) break;
- _ref10 = _iterator7[_i7++];
- } else {
- _i7 = _iterator7.next();
- if (_i7.done) break;
- _ref10 = _i7.value;
- }
-
- const item = _ref10;
-
- const onDone = item.onDone || noop;
- item.onDone = function () {
- events.onProgress(item.dest);
- onDone();
- };
- }
- events.onStart(queue.length);
-
- // start building actions
- const actions = {
- file: [],
- symlink: [],
- link: []
- };
-
- // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items
- // at a time due to the requirement to push items onto the queue
- while (queue.length) {
- const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS);
- yield Promise.all(items.map(build));
- }
-
- // simulate the existence of some files to prevent considering them extraneous
- for (var _iterator8 = artifactFiles, _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) {
- var _ref11;
-
- if (_isArray8) {
- if (_i8 >= _iterator8.length) break;
- _ref11 = _iterator8[_i8++];
- } else {
- _i8 = _iterator8.next();
- if (_i8.done) break;
- _ref11 = _i8.value;
- }
-
- const file = _ref11;
-
- if (possibleExtraneous.has(file)) {
- reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file));
- possibleExtraneous.delete(file);
- }
- }
-
- for (var _iterator9 = possibleExtraneous, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) {
- var _ref12;
-
- if (_isArray9) {
- if (_i9 >= _iterator9.length) break;
- _ref12 = _iterator9[_i9++];
- } else {
- _i9 = _iterator9.next();
- if (_i9.done) break;
- _ref12 = _i9.value;
- }
-
- const loc = _ref12;
-
- if (files.has(loc.toLowerCase())) {
- possibleExtraneous.delete(loc);
- }
- }
-
- return actions;
- });
-
- return function buildActionsForHardlink(_x6, _x7, _x8, _x9) {
- return _ref9.apply(this, arguments);
- };
-})();
-
-let copyBulk = exports.copyBulk = (() => {
- var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) {
- const events = {
- onStart: _events && _events.onStart || noop,
- onProgress: _events && _events.onProgress || noop,
- possibleExtraneous: _events ? _events.possibleExtraneous : new Set(),
- ignoreBasenames: _events && _events.ignoreBasenames || [],
- artifactFiles: _events && _events.artifactFiles || []
- };
-
- const actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter);
- events.onStart(actions.file.length + actions.symlink.length + actions.link.length);
-
- const fileActions = actions.file;
-
- const currentlyWriting = new Map();
-
- yield (_promise || _load_promise()).queue(fileActions, (() => {
- var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
- let writePromise;
- while (writePromise = currentlyWriting.get(data.dest)) {
- yield writePromise;
- }
-
- reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest));
- const copier = (0, (_fsNormalized || _load_fsNormalized()).copyFile)(data, function () {
- return currentlyWriting.delete(data.dest);
- });
- currentlyWriting.set(data.dest, copier);
- events.onProgress(data.dest);
- return copier;
- });
-
- return function (_x14) {
- return _ref18.apply(this, arguments);
- };
- })(), CONCURRENT_QUEUE_ITEMS);
-
- // we need to copy symlinks last as they could reference files we were copying
- const symlinkActions = actions.symlink;
- yield (_promise || _load_promise()).queue(symlinkActions, function (data) {
- const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname);
- reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname));
- return symlink(linkname, data.dest);
- });
- });
-
- return function copyBulk(_x11, _x12, _x13) {
- return _ref17.apply(this, arguments);
- };
-})();
-
-let hardlinkBulk = exports.hardlinkBulk = (() => {
- var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) {
- const events = {
- onStart: _events && _events.onStart || noop,
- onProgress: _events && _events.onProgress || noop,
- possibleExtraneous: _events ? _events.possibleExtraneous : new Set(),
- artifactFiles: _events && _events.artifactFiles || [],
- ignoreBasenames: []
- };
-
- const actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter);
- events.onStart(actions.file.length + actions.symlink.length + actions.link.length);
-
- const fileActions = actions.link;
-
- yield (_promise || _load_promise()).queue(fileActions, (() => {
- var _ref20 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) {
- reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest));
- if (data.removeDest) {
- yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(data.dest);
- }
- yield link(data.src, data.dest);
- });
-
- return function (_x18) {
- return _ref20.apply(this, arguments);
- };
- })(), CONCURRENT_QUEUE_ITEMS);
-
- // we need to copy symlinks last as they could reference files we were copying
- const symlinkActions = actions.symlink;
- yield (_promise || _load_promise()).queue(symlinkActions, function (data) {
- const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname);
- reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname));
- return symlink(linkname, data.dest);
- });
- });
-
- return function hardlinkBulk(_x15, _x16, _x17) {
- return _ref19.apply(this, arguments);
- };
-})();
-
-let readFileAny = exports.readFileAny = (() => {
- var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) {
- for (var _iterator13 = files, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) {
- var _ref22;
-
- if (_isArray13) {
- if (_i13 >= _iterator13.length) break;
- _ref22 = _iterator13[_i13++];
- } else {
- _i13 = _iterator13.next();
- if (_i13.done) break;
- _ref22 = _i13.value;
- }
-
- const file = _ref22;
-
- if (yield exists(file)) {
- return readFile(file);
- }
- }
- return null;
- });
-
- return function readFileAny(_x19) {
- return _ref21.apply(this, arguments);
- };
-})();
-
-let readJson = exports.readJson = (() => {
- var _ref23 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) {
- return (yield readJsonAndFile(loc)).object;
- });
-
- return function readJson(_x20) {
- return _ref23.apply(this, arguments);
- };
-})();
-
-let readJsonAndFile = exports.readJsonAndFile = (() => {
- var _ref24 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) {
- const file = yield readFile(loc);
- try {
- return {
- object: (0, (_map || _load_map()).default)(JSON.parse(stripBOM(file))),
- content: file
- };
- } catch (err) {
- err.message = `${loc}: ${err.message}`;
- throw err;
- }
- });
-
- return function readJsonAndFile(_x21) {
- return _ref24.apply(this, arguments);
- };
-})();
-
-let find = exports.find = (() => {
- var _ref25 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) {
- const parts = dir.split((_path || _load_path()).default.sep);
-
- while (parts.length) {
- const loc = parts.concat(filename).join((_path || _load_path()).default.sep);
-
- if (yield exists(loc)) {
- return loc;
- } else {
- parts.pop();
- }
- }
-
- return false;
- });
-
- return function find(_x22, _x23) {
- return _ref25.apply(this, arguments);
- };
-})();
-
-let symlink = exports.symlink = (() => {
- var _ref26 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) {
- if (process.platform !== 'win32') {
- // use relative paths otherwise which will be retained if the directory is moved
- src = (_path || _load_path()).default.relative((_path || _load_path()).default.dirname(dest), src);
- // When path.relative returns an empty string for the current directory, we should instead use
- // '.', which is a valid fs.symlink target.
- src = src || '.';
- }
-
- try {
- const stats = yield lstat(dest);
- if (stats.isSymbolicLink()) {
- const resolved = dest;
- if (resolved === src) {
- return;
- }
- }
- } catch (err) {
- if (err.code !== 'ENOENT') {
- throw err;
- }
- }
-
- // We use rimraf for unlink which never throws an ENOENT on missing target
- yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest);
-
- if (process.platform === 'win32') {
- // use directory junctions if possible on win32, this requires absolute paths
- yield fsSymlink(src, dest, 'junction');
- } else {
- yield fsSymlink(src, dest);
- }
- });
-
- return function symlink(_x24, _x25) {
- return _ref26.apply(this, arguments);
- };
-})();
-
-let walk = exports.walk = (() => {
- var _ref27 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir, ignoreBasenames = new Set()) {
- let files = [];
-
- let filenames = yield readdir(dir);
- if (ignoreBasenames.size) {
- filenames = filenames.filter(function (name) {
- return !ignoreBasenames.has(name);
- });
- }
-
- for (var _iterator14 = filenames, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) {
- var _ref28;
-
- if (_isArray14) {
- if (_i14 >= _iterator14.length) break;
- _ref28 = _iterator14[_i14++];
- } else {
- _i14 = _iterator14.next();
- if (_i14.done) break;
- _ref28 = _i14.value;
- }
-
- const name = _ref28;
-
- const relative = relativeDir ? (_path || _load_path()).default.join(relativeDir, name) : name;
- const loc = (_path || _load_path()).default.join(dir, name);
- const stat = yield lstat(loc);
-
- files.push({
- relative,
- basename: name,
- absolute: loc,
- mtime: +stat.mtime
- });
-
- if (stat.isDirectory()) {
- files = files.concat((yield walk(loc, relative, ignoreBasenames)));
- }
- }
-
- return files;
- });
-
- return function walk(_x26, _x27) {
- return _ref27.apply(this, arguments);
- };
-})();
-
-let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => {
- var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) {
- const stat = yield lstat(loc);
- const size = stat.size,
- blockSize = stat.blksize;
-
-
- return Math.ceil(size / blockSize) * blockSize;
- });
-
- return function getFileSizeOnDisk(_x28) {
- return _ref29.apply(this, arguments);
- };
-})();
-
-let getEolFromFile = (() => {
- var _ref30 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) {
- if (!(yield exists(path))) {
- return undefined;
- }
-
- const buffer = yield readFileBuffer(path);
-
- for (let i = 0; i < buffer.length; ++i) {
- if (buffer[i] === cr) {
- return '\r\n';
- }
- if (buffer[i] === lf) {
- return '\n';
- }
- }
- return undefined;
- });
-
- return function getEolFromFile(_x29) {
- return _ref30.apply(this, arguments);
- };
-})();
-
-let writeFilePreservingEol = exports.writeFilePreservingEol = (() => {
- var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) {
- const eol = (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL;
- if (eol !== '\n') {
- data = data.replace(/\n/g, eol);
- }
- yield writeFile(path, data);
- });
-
- return function writeFilePreservingEol(_x30, _x31) {
- return _ref31.apply(this, arguments);
- };
-})();
-
-let hardlinksWork = exports.hardlinksWork = (() => {
- var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) {
- const filename = 'test-file' + Math.random();
- const file = (_path || _load_path()).default.join(dir, filename);
- const fileLink = (_path || _load_path()).default.join(dir, filename + '-link');
- try {
- yield writeFile(file, 'test');
- yield link(file, fileLink);
- } catch (err) {
- return false;
- } finally {
- yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(file);
- yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(fileLink);
- }
- return true;
- });
-
- return function hardlinksWork(_x32) {
- return _ref32.apply(this, arguments);
- };
-})();
-
-// not a strict polyfill for Node's fs.mkdtemp
-
-
-let makeTempDir = exports.makeTempDir = (() => {
- var _ref33 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) {
- const dir = (_path || _load_path()).default.join((_os || _load_os()).default.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`);
- yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dir);
- yield mkdirp(dir);
- return dir;
- });
-
- return function makeTempDir(_x33) {
- return _ref33.apply(this, arguments);
- };
-})();
-
-let readFirstAvailableStream = exports.readFirstAvailableStream = (() => {
- var _ref34 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) {
- for (var _iterator15 = paths, _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) {
- var _ref35;
-
- if (_isArray15) {
- if (_i15 >= _iterator15.length) break;
- _ref35 = _iterator15[_i15++];
- } else {
- _i15 = _iterator15.next();
- if (_i15.done) break;
- _ref35 = _i15.value;
- }
-
- const path = _ref35;
-
- try {
- const fd = yield open(path, 'r');
- return (_fs || _load_fs()).default.createReadStream(path, { fd });
- } catch (err) {
- // Try the next one
- }
- }
- return null;
- });
-
- return function readFirstAvailableStream(_x34) {
- return _ref34.apply(this, arguments);
- };
-})();
-
-let getFirstSuitableFolder = exports.getFirstSuitableFolder = (() => {
- var _ref36 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths, mode = constants.W_OK | constants.X_OK) {
- const result = {
- skipped: [],
- folder: null
- };
-
- for (var _iterator16 = paths, _isArray16 = Array.isArray(_iterator16), _i16 = 0, _iterator16 = _isArray16 ? _iterator16 : _iterator16[Symbol.iterator]();;) {
- var _ref37;
-
- if (_isArray16) {
- if (_i16 >= _iterator16.length) break;
- _ref37 = _iterator16[_i16++];
- } else {
- _i16 = _iterator16.next();
- if (_i16.done) break;
- _ref37 = _i16.value;
- }
-
- const folder = _ref37;
-
- try {
- yield mkdirp(folder);
- yield access(folder, mode);
-
- result.folder = folder;
-
- return result;
- } catch (error) {
- result.skipped.push({
- error,
- folder
- });
- }
- }
- return result;
- });
-
- return function getFirstSuitableFolder(_x35) {
- return _ref36.apply(this, arguments);
- };
-})();
-
-exports.copy = copy;
-exports.readFile = readFile;
-exports.readFileRaw = readFileRaw;
-exports.normalizeOS = normalizeOS;
-
-var _fs;
-
-function _load_fs() {
- return _fs = _interopRequireDefault(__webpack_require__(5));
-}
-
-var _glob;
-
-function _load_glob() {
- return _glob = _interopRequireDefault(__webpack_require__(99));
-}
-
-var _os;
-
-function _load_os() {
- return _os = _interopRequireDefault(__webpack_require__(46));
-}
-
-var _path;
-
-function _load_path() {
- return _path = _interopRequireDefault(__webpack_require__(0));
-}
-
-var _blockingQueue;
-
-function _load_blockingQueue() {
- return _blockingQueue = _interopRequireDefault(__webpack_require__(110));
-}
-
-var _promise;
-
-function _load_promise() {
- return _promise = _interopRequireWildcard(__webpack_require__(50));
-}
-
-var _promise2;
-
-function _load_promise2() {
- return _promise2 = __webpack_require__(50);
-}
-
-var _map;
-
-function _load_map() {
- return _map = _interopRequireDefault(__webpack_require__(29));
-}
-
-var _fsNormalized;
-
-function _load_fsNormalized() {
- return _fsNormalized = __webpack_require__(218);
-}
-
-function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
-
-function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
-
-const constants = exports.constants = typeof (_fs || _load_fs()).default.constants !== 'undefined' ? (_fs || _load_fs()).default.constants : {
- R_OK: (_fs || _load_fs()).default.R_OK,
- W_OK: (_fs || _load_fs()).default.W_OK,
- X_OK: (_fs || _load_fs()).default.X_OK
-};
-
-const lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock');
-
-const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readFile);
-const open = exports.open = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.open);
-const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.writeFile);
-const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readlink);
-const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.realpath);
-const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readdir);
-const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.rename);
-const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.access);
-const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.stat);
-const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(145));
-const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.exists, true);
-const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.lstat);
-const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.chmod);
-const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.link);
-const glob = exports.glob = (0, (_promise2 || _load_promise2()).promisify)((_glob || _load_glob()).default);
-exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink;
-
-// fs.copyFile uses the native file copying instructions on the system, performing much better
-// than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the
-// concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD.
-
-const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4;
-
-const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.symlink);
-const invariant = __webpack_require__(9);
-const stripBOM = __webpack_require__(160);
-
-const noop = () => {};
-
-function copy(src, dest, reporter) {
- return copyBulk([{ src, dest }], reporter);
-}
-
-function _readFile(loc, encoding) {
- return new Promise((resolve, reject) => {
- (_fs || _load_fs()).default.readFile(loc, encoding, function (err, content) {
- if (err) {
- reject(err);
- } else {
- resolve(content);
- }
- });
- });
-}
-
-function readFile(loc) {
- return _readFile(loc, 'utf8').then(normalizeOS);
-}
-
-function readFileRaw(loc) {
- return _readFile(loc, 'binary');
-}
-
-function normalizeOS(body) {
- return body.replace(/\r\n/g, '\n');
-}
-
-const cr = '\r'.charCodeAt(0);
-const lf = '\n'.charCodeAt(0);
-
-/***/ }),
-/* 5 */
-/***/ (function(module, exports) {
-
-module.exports = require("fs");
-
-/***/ }),
-/* 6 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-class MessageError extends Error {
- constructor(msg, code) {
- super(msg);
- this.code = code;
- }
-
-}
-
-exports.MessageError = MessageError;
-class ProcessSpawnError extends MessageError {
- constructor(msg, code, process) {
- super(msg, code);
- this.process = process;
- }
-
-}
-
-exports.ProcessSpawnError = ProcessSpawnError;
-class SecurityError extends MessageError {}
-
-exports.SecurityError = SecurityError;
-class ProcessTermError extends MessageError {}
-
-exports.ProcessTermError = ProcessTermError;
-class ResponseError extends Error {
- constructor(msg, responseCode) {
- super(msg);
- this.responseCode = responseCode;
- }
-
-}
-
-exports.ResponseError = ResponseError;
-class OneTimePasswordError extends Error {}
-exports.OneTimePasswordError = OneTimePasswordError;
-
-/***/ }),
-/* 7 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscriber; });
-/* unused harmony export SafeSubscriber */
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(154);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(420);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(321);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(185);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(323);
-/** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */
-
-
-
-
-
-
-
-var Subscriber = /*@__PURE__*/ (function (_super) {
- __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subscriber, _super);
- function Subscriber(destinationOrNext, error, complete) {
- var _this = _super.call(this) || this;
- _this.syncErrorValue = null;
- _this.syncErrorThrown = false;
- _this.syncErrorThrowable = false;
- _this.isStopped = false;
- _this._parentSubscription = null;
- switch (arguments.length) {
- case 0:
- _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */];
- break;
- case 1:
- if (!destinationOrNext) {
- _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */];
- break;
- }
- if (typeof destinationOrNext === 'object') {
- if (destinationOrNext instanceof Subscriber) {
- _this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;
- _this.destination = destinationOrNext;
- destinationOrNext.add(_this);
- }
- else {
- _this.syncErrorThrowable = true;
- _this.destination = new SafeSubscriber(_this, destinationOrNext);
- }
- break;
- }
- default:
- _this.syncErrorThrowable = true;
- _this.destination = new SafeSubscriber(_this, destinationOrNext, error, complete);
- break;
- }
- return _this;
- }
- Subscriber.prototype[__WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { return this; };
- Subscriber.create = function (next, error, complete) {
- var subscriber = new Subscriber(next, error, complete);
- subscriber.syncErrorThrowable = false;
- return subscriber;
- };
- Subscriber.prototype.next = function (value) {
- if (!this.isStopped) {
- this._next(value);
- }
- };
- Subscriber.prototype.error = function (err) {
- if (!this.isStopped) {
- this.isStopped = true;
- this._error(err);
- }
- };
- Subscriber.prototype.complete = function () {
- if (!this.isStopped) {
- this.isStopped = true;
- this._complete();
- }
- };
- Subscriber.prototype.unsubscribe = function () {
- if (this.closed) {
- return;
- }
- this.isStopped = true;
- _super.prototype.unsubscribe.call(this);
- };
- Subscriber.prototype._next = function (value) {
- this.destination.next(value);
- };
- Subscriber.prototype._error = function (err) {
- this.destination.error(err);
- this.unsubscribe();
- };
- Subscriber.prototype._complete = function () {
- this.destination.complete();
- this.unsubscribe();
- };
- Subscriber.prototype._unsubscribeAndRecycle = function () {
- var _a = this, _parent = _a._parent, _parents = _a._parents;
- this._parent = null;
- this._parents = null;
- this.unsubscribe();
- this.closed = false;
- this.isStopped = false;
- this._parent = _parent;
- this._parents = _parents;
- this._parentSubscription = null;
- return this;
- };
- return Subscriber;
-}(__WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */]));
-
-var SafeSubscriber = /*@__PURE__*/ (function (_super) {
- __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SafeSubscriber, _super);
- function SafeSubscriber(_parentSubscriber, observerOrNext, error, complete) {
- var _this = _super.call(this) || this;
- _this._parentSubscriber = _parentSubscriber;
- var next;
- var context = _this;
- if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(observerOrNext)) {
- next = observerOrNext;
- }
- else if (observerOrNext) {
- next = observerOrNext.next;
- error = observerOrNext.error;
- complete = observerOrNext.complete;
- if (observerOrNext !== __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]) {
- context = Object.create(observerOrNext);
- if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(context.unsubscribe)) {
- _this.add(context.unsubscribe.bind(context));
- }
- context.unsubscribe = _this.unsubscribe.bind(_this);
- }
- }
- _this._context = context;
- _this._next = next;
- _this._error = error;
- _this._complete = complete;
- return _this;
- }
- SafeSubscriber.prototype.next = function (value) {
- if (!this.isStopped && this._next) {
- var _parentSubscriber = this._parentSubscriber;
- if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {
- this.__tryOrUnsub(this._next, value);
- }
- else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {
- this.unsubscribe();
- }
- }
- };
- SafeSubscriber.prototype.error = function (err) {
- if (!this.isStopped) {
- var _parentSubscriber = this._parentSubscriber;
- var useDeprecatedSynchronousErrorHandling = __WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling;
- if (this._error) {
- if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {
- this.__tryOrUnsub(this._error, err);
- this.unsubscribe();
- }
- else {
- this.__tryOrSetError(_parentSubscriber, this._error, err);
- this.unsubscribe();
- }
- }
- else if (!_parentSubscriber.syncErrorThrowable) {
- this.unsubscribe();
- if (useDeprecatedSynchronousErrorHandling) {
- throw err;
- }
- __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
- }
- else {
- if (useDeprecatedSynchronousErrorHandling) {
- _parentSubscriber.syncErrorValue = err;
- _parentSubscriber.syncErrorThrown = true;
- }
- else {
- __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
- }
- this.unsubscribe();
- }
- }
- };
- SafeSubscriber.prototype.complete = function () {
- var _this = this;
- if (!this.isStopped) {
- var _parentSubscriber = this._parentSubscriber;
- if (this._complete) {
- var wrappedComplete = function () { return _this._complete.call(_this._context); };
- if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {
- this.__tryOrUnsub(wrappedComplete);
- this.unsubscribe();
- }
- else {
- this.__tryOrSetError(_parentSubscriber, wrappedComplete);
- this.unsubscribe();
- }
- }
- else {
- this.unsubscribe();
- }
- }
- };
- SafeSubscriber.prototype.__tryOrUnsub = function (fn, value) {
- try {
- fn.call(this._context, value);
- }
- catch (err) {
- this.unsubscribe();
- if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
- throw err;
- }
- else {
- __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
- }
- }
- };
- SafeSubscriber.prototype.__tryOrSetError = function (parent, fn, value) {
- if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
- throw new Error('bad call');
- }
- try {
- fn.call(this._context, value);
- }
- catch (err) {
- if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
- parent.syncErrorValue = err;
- parent.syncErrorThrown = true;
- return true;
- }
- else {
- __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err);
- return true;
- }
- }
- return false;
- };
- SafeSubscriber.prototype._unsubscribe = function () {
- var _parentSubscriber = this._parentSubscriber;
- this._context = null;
- this._parentSubscriber = null;
- _parentSubscriber.unsubscribe();
- };
- return SafeSubscriber;
-}(Subscriber));
-
-//# sourceMappingURL=Subscriber.js.map
-
-
-/***/ }),
-/* 8 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.getPathKey = getPathKey;
-const os = __webpack_require__(46);
-const path = __webpack_require__(0);
-const userHome = __webpack_require__(67).default;
-
-var _require = __webpack_require__(225);
-
-const getCacheDir = _require.getCacheDir,
- getConfigDir = _require.getConfigDir,
- getDataDir = _require.getDataDir;
-
-const isWebpackBundle = __webpack_require__(278);
-
-const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies'];
-const OWNED_DEPENDENCY_TYPES = exports.OWNED_DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies'];
-
-const RESOLUTIONS = exports.RESOLUTIONS = 'resolutions';
-const MANIFEST_FIELDS = exports.MANIFEST_FIELDS = [RESOLUTIONS, ...DEPENDENCY_TYPES];
-
-const SUPPORTED_NODE_VERSIONS = exports.SUPPORTED_NODE_VERSIONS = '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0';
-
-const YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com';
-const NPM_REGISTRY_RE = exports.NPM_REGISTRY_RE = /https?:\/\/registry\.npmjs\.org/g;
-
-const YARN_DOCS = exports.YARN_DOCS = 'https://yarnpkg.com/en/docs/cli/';
-const YARN_INSTALLER_SH = exports.YARN_INSTALLER_SH = 'https://yarnpkg.com/install.sh';
-const YARN_INSTALLER_MSI = exports.YARN_INSTALLER_MSI = 'https://yarnpkg.com/latest.msi';
-
-const SELF_UPDATE_VERSION_URL = exports.SELF_UPDATE_VERSION_URL = 'https://yarnpkg.com/latest-version';
-
-// cache version, bump whenever we make backwards incompatible changes
-const CACHE_VERSION = exports.CACHE_VERSION = 6;
-
-// lockfile version, bump whenever we make backwards incompatible changes
-const LOCKFILE_VERSION = exports.LOCKFILE_VERSION = 1;
-
-// max amount of network requests to perform concurrently
-const NETWORK_CONCURRENCY = exports.NETWORK_CONCURRENCY = 8;
-
-// HTTP timeout used when downloading packages
-const NETWORK_TIMEOUT = exports.NETWORK_TIMEOUT = 30 * 1000; // in milliseconds
-
-// max amount of child processes to execute concurrently
-const CHILD_CONCURRENCY = exports.CHILD_CONCURRENCY = 5;
-
-const REQUIRED_PACKAGE_KEYS = exports.REQUIRED_PACKAGE_KEYS = ['name', 'version', '_uid'];
-
-function getPreferredCacheDirectories() {
- const preferredCacheDirectories = [getCacheDir()];
-
- if (process.getuid) {
- // $FlowFixMe: process.getuid exists, dammit
- preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`));
- }
-
- preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`));
-
- return preferredCacheDirectories;
-}
-
-const PREFERRED_MODULE_CACHE_DIRECTORIES = exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories();
-const CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getConfigDir();
-const DATA_DIRECTORY = exports.DATA_DIRECTORY = getDataDir();
-const LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(DATA_DIRECTORY, 'link');
-const GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(DATA_DIRECTORY, 'global');
-
-const NODE_BIN_PATH = exports.NODE_BIN_PATH = process.execPath;
-const YARN_BIN_PATH = exports.YARN_BIN_PATH = getYarnBinPath();
-
-// Webpack needs to be configured with node.__dirname/__filename = false
-function getYarnBinPath() {
- if (isWebpackBundle) {
- return __filename;
- } else {
- return path.join(__dirname, '..', 'bin', 'yarn.js');
- }
-}
-
-const NODE_MODULES_FOLDER = exports.NODE_MODULES_FOLDER = 'node_modules';
-const NODE_PACKAGE_JSON = exports.NODE_PACKAGE_JSON = 'package.json';
-
-const PNP_FILENAME = exports.PNP_FILENAME = '.pnp.js';
-
-const POSIX_GLOBAL_PREFIX = exports.POSIX_GLOBAL_PREFIX = `${process.env.DESTDIR || ''}/usr/local`;
-const FALLBACK_GLOBAL_PREFIX = exports.FALLBACK_GLOBAL_PREFIX = path.join(userHome, '.yarn');
-
-const META_FOLDER = exports.META_FOLDER = '.yarn-meta';
-const INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity';
-const LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock';
-const METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json';
-const TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz';
-const CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean';
-
-const NPM_LOCK_FILENAME = exports.NPM_LOCK_FILENAME = 'package-lock.json';
-const NPM_SHRINKWRAP_FILENAME = exports.NPM_SHRINKWRAP_FILENAME = 'npm-shrinkwrap.json';
-
-const DEFAULT_INDENT = exports.DEFAULT_INDENT = ' ';
-const SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997;
-const SINGLE_INSTANCE_FILENAME = exports.SINGLE_INSTANCE_FILENAME = '.yarn-single-instance';
-
-const ENV_PATH_KEY = exports.ENV_PATH_KEY = getPathKey(process.platform, process.env);
-
-function getPathKey(platform, env) {
- let pathKey = 'PATH';
-
- // windows calls its path "Path" usually, but this is not guaranteed.
- if (platform === 'win32') {
- pathKey = 'Path';
-
- for (const key in env) {
- if (key.toLowerCase() === 'path') {
- pathKey = key;
- }
- }
- }
-
- return pathKey;
-}
-
-const VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = {
- major: 'red',
- premajor: 'red',
- minor: 'yellow',
- preminor: 'yellow',
- patch: 'green',
- prepatch: 'green',
- prerelease: 'red',
- unchanged: 'white',
- unknown: 'red'
-};
-
-/***/ }),
-/* 9 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-/**
- * Copyright (c) 2013-present, Facebook, Inc.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-
-
-/**
- * Use invariant() to assert state which your program assumes to be true.
- *
- * Provide sprintf-style format (only %s is supported) and arguments
- * to provide information about what broke and what you were
- * expecting.
- *
- * The invariant message will be stripped in production, but the invariant
- * will remain to ensure logic does not differ in production.
- */
-
-var NODE_ENV = process.env.NODE_ENV;
-
-var invariant = function(condition, format, a, b, c, d, e, f) {
- if (NODE_ENV !== 'production') {
- if (format === undefined) {
- throw new Error('invariant requires an error message argument');
- }
- }
-
- if (!condition) {
- var error;
- if (format === undefined) {
- error = new Error(
- 'Minified exception occurred; use the non-minified dev environment ' +
- 'for the full error message and additional helpful warnings.'
- );
- } else {
- var args = [a, b, c, d, e, f];
- var argIndex = 0;
- error = new Error(
- format.replace(/%s/g, function() { return args[argIndex++]; })
- );
- error.name = 'Invariant Violation';
- }
-
- error.framesToPop = 1; // we don't care about invariant's own frame
- throw error;
- }
-};
-
-module.exports = invariant;
-
-
-/***/ }),
-/* 10 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-var YAMLException = __webpack_require__(54);
-
-var TYPE_CONSTRUCTOR_OPTIONS = [
- 'kind',
- 'resolve',
- 'construct',
- 'instanceOf',
- 'predicate',
- 'represent',
- 'defaultStyle',
- 'styleAliases'
-];
-
-var YAML_NODE_KINDS = [
- 'scalar',
- 'sequence',
- 'mapping'
-];
-
-function compileStyleAliases(map) {
- var result = {};
-
- if (map !== null) {
- Object.keys(map).forEach(function (style) {
- map[style].forEach(function (alias) {
- result[String(alias)] = style;
- });
- });
- }
-
- return result;
-}
-
-function Type(tag, options) {
- options = options || {};
-
- Object.keys(options).forEach(function (name) {
- if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) {
- throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.');
- }
- });
-
- // TODO: Add tag format check.
- this.tag = tag;
- this.kind = options['kind'] || null;
- this.resolve = options['resolve'] || function () { return true; };
- this.construct = options['construct'] || function (data) { return data; };
- this.instanceOf = options['instanceOf'] || null;
- this.predicate = options['predicate'] || null;
- this.represent = options['represent'] || null;
- this.defaultStyle = options['defaultStyle'] || null;
- this.styleAliases = compileStyleAliases(options['styleAliases'] || null);
-
- if (YAML_NODE_KINDS.indexOf(this.kind) === -1) {
- throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.');
- }
-}
-
-module.exports = Type;
-
-
-/***/ }),
-/* 11 */
-/***/ (function(module, exports) {
-
-module.exports = require("crypto");
-
-/***/ }),
-/* 12 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Observable; });
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(322);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(932);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(117);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(324);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(185);
-/** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */
-
-
-
-
-
-var Observable = /*@__PURE__*/ (function () {
- function Observable(subscribe) {
- this._isScalar = false;
- if (subscribe) {
- this._subscribe = subscribe;
- }
- }
- Observable.prototype.lift = function (operator) {
- var observable = new Observable();
- observable.source = this;
- observable.operator = operator;
- return observable;
- };
- Observable.prototype.subscribe = function (observerOrNext, error, complete) {
- var operator = this.operator;
- var sink = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__["a" /* toSubscriber */])(observerOrNext, error, complete);
- if (operator) {
- operator.call(sink, this.source);
- }
- else {
- sink.add(this.source || (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?
- this._subscribe(sink) :
- this._trySubscribe(sink));
- }
- if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
- if (sink.syncErrorThrowable) {
- sink.syncErrorThrowable = false;
- if (sink.syncErrorThrown) {
- throw sink.syncErrorValue;
- }
- }
- }
- return sink;
- };
- Observable.prototype._trySubscribe = function (sink) {
- try {
- return this._subscribe(sink);
- }
- catch (err) {
- if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) {
- sink.syncErrorThrown = true;
- sink.syncErrorValue = err;
- }
- if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_canReportError__["a" /* canReportError */])(sink)) {
- sink.error(err);
- }
- else {
- console.warn(err);
- }
- }
- };
- Observable.prototype.forEach = function (next, promiseCtor) {
- var _this = this;
- promiseCtor = getPromiseCtor(promiseCtor);
- return new promiseCtor(function (resolve, reject) {
- var subscription;
- subscription = _this.subscribe(function (value) {
- try {
- next(value);
- }
- catch (err) {
- reject(err);
- if (subscription) {
- subscription.unsubscribe();
- }
- }
- }, reject, resolve);
- });
- };
- Observable.prototype._subscribe = function (subscriber) {
- var source = this.source;
- return source && source.subscribe(subscriber);
- };
- Observable.prototype[__WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__["a" /* observable */]] = function () {
- return this;
- };
- Observable.prototype.pipe = function () {
- var operations = [];
- for (var _i = 0; _i < arguments.length; _i++) {
- operations[_i] = arguments[_i];
- }
- if (operations.length === 0) {
- return this;
- }
- return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_pipe__["b" /* pipeFromArray */])(operations)(this);
- };
- Observable.prototype.toPromise = function (promiseCtor) {
- var _this = this;
- promiseCtor = getPromiseCtor(promiseCtor);
- return new promiseCtor(function (resolve, reject) {
- var value;
- _this.subscribe(function (x) { return value = x; }, function (err) { return reject(err); }, function () { return resolve(value); });
- });
- };
- Observable.create = function (subscribe) {
- return new Observable(subscribe);
- };
- return Observable;
-}());
-
-function getPromiseCtor(promiseCtor) {
- if (!promiseCtor) {
- promiseCtor = __WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].Promise || Promise;
- }
- if (!promiseCtor) {
- throw new Error('no Promise impl found');
- }
- return promiseCtor;
-}
-//# sourceMappingURL=Observable.js.map
-
-
-/***/ }),
-/* 13 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return OuterSubscriber; });
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscriber__ = __webpack_require__(7);
-/** PURE_IMPORTS_START tslib,_Subscriber PURE_IMPORTS_END */
-
-
-var OuterSubscriber = /*@__PURE__*/ (function (_super) {
- __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](OuterSubscriber, _super);
- function OuterSubscriber() {
- return _super !== null && _super.apply(this, arguments) || this;
- }
- OuterSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) {
- this.destination.next(innerValue);
- };
- OuterSubscriber.prototype.notifyError = function (error, innerSub) {
- this.destination.error(error);
- };
- OuterSubscriber.prototype.notifyComplete = function (innerSub) {
- this.destination.complete();
- };
- return OuterSubscriber;
-}(__WEBPACK_IMPORTED_MODULE_1__Subscriber__["a" /* Subscriber */]));
-
-//# sourceMappingURL=OuterSubscriber.js.map
-
-
-/***/ }),
-/* 14 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (immutable) */ __webpack_exports__["a"] = subscribeToResult;
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(84);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(446);
-/** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */
-
-
-function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, destination) {
- if (destination === void 0) {
- destination = new __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__["a" /* InnerSubscriber */](outerSubscriber, outerValue, outerIndex);
- }
- if (destination.closed) {
- return;
- }
- return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__subscribeTo__["a" /* subscribeTo */])(result)(destination);
-}
-//# sourceMappingURL=subscribeToResult.js.map
-
-
-/***/ }),
-/* 15 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-/* eslint-disable node/no-deprecated-api */
-
-
-
-var buffer = __webpack_require__(64)
-var Buffer = buffer.Buffer
-
-var safer = {}
-
-var key
-
-for (key in buffer) {
- if (!buffer.hasOwnProperty(key)) continue
- if (key === 'SlowBuffer' || key === 'Buffer') continue
- safer[key] = buffer[key]
-}
-
-var Safer = safer.Buffer = {}
-for (key in Buffer) {
- if (!Buffer.hasOwnProperty(key)) continue
- if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue
- Safer[key] = Buffer[key]
-}
-
-safer.Buffer.prototype = Buffer.prototype
-
-if (!Safer.from || Safer.from === Uint8Array.from) {
- Safer.from = function (value, encodingOrOffset, length) {
- if (typeof value === 'number') {
- throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value)
- }
- if (value && typeof value.length === 'undefined') {
- throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value)
- }
- return Buffer(value, encodingOrOffset, length)
- }
-}
-
-if (!Safer.alloc) {
- Safer.alloc = function (size, fill, encoding) {
- if (typeof size !== 'number') {
- throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size)
- }
- if (size < 0 || size >= 2 * (1 << 30)) {
- throw new RangeError('The value "' + size + '" is invalid for option "size"')
- }
- var buf = Buffer(size)
- if (!fill || fill.length === 0) {
- buf.fill(0)
- } else if (typeof encoding === 'string') {
- buf.fill(fill, encoding)
- } else {
- buf.fill(fill)
- }
- return buf
- }
-}
-
-if (!safer.kStringMaxLength) {
- try {
- safer.kStringMaxLength = process.binding('buffer').kStringMaxLength
- } catch (e) {
- // we can't determine kStringMaxLength in environments where process.binding
- // is unsupported, so let's not set it
- }
-}
-
-if (!safer.constants) {
- safer.constants = {
- MAX_LENGTH: safer.kMaxLength
- }
- if (safer.kStringMaxLength) {
- safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength
- }
-}
-
-module.exports = safer
-
-
-/***/ }),
-/* 16 */
-/***/ (function(module, exports, __webpack_require__) {
-
-// Copyright (c) 2012, Mark Cavage. All rights reserved.
-// Copyright 2015 Joyent, Inc.
-
-var assert = __webpack_require__(28);
-var Stream = __webpack_require__(23).Stream;
-var util = __webpack_require__(3);
-
-
-///--- Globals
-
-/* JSSTYLED */
-var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/;
-
-
-///--- Internal
-
-function _capitalize(str) {
- return (str.charAt(0).toUpperCase() + str.slice(1));
-}
-
-function _toss(name, expected, oper, arg, actual) {
- throw new assert.AssertionError({
- message: util.format('%s (%s) is required', name, expected),
- actual: (actual === undefined) ? typeof (arg) : actual(arg),
- expected: expected,
- operator: oper || '===',
- stackStartFunction: _toss.caller
- });
-}
-
-function _getClass(arg) {
- return (Object.prototype.toString.call(arg).slice(8, -1));
-}
-
-function noop() {
- // Why even bother with asserts?
-}
-
-
-///--- Exports
-
-var types = {
- bool: {
- check: function (arg) { return typeof (arg) === 'boolean'; }
- },
- func: {
- check: function (arg) { return typeof (arg) === 'function'; }
- },
- string: {
- check: function (arg) { return typeof (arg) === 'string'; }
- },
- object: {
- check: function (arg) {
- return typeof (arg) === 'object' && arg !== null;
- }
- },
- number: {
- check: function (arg) {
- return typeof (arg) === 'number' && !isNaN(arg);
- }
- },
- finite: {
- check: function (arg) {
- return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg);
- }
- },
- buffer: {
- check: function (arg) { return Buffer.isBuffer(arg); },
- operator: 'Buffer.isBuffer'
- },
- array: {
- check: function (arg) { return Array.isArray(arg); },
- operator: 'Array.isArray'
- },
- stream: {
- check: function (arg) { return arg instanceof Stream; },
- operator: 'instanceof',
- actual: _getClass
- },
- date: {
- check: function (arg) { return arg instanceof Date; },
- operator: 'instanceof',
- actual: _getClass
- },
- regexp: {
- check: function (arg) { return arg instanceof RegExp; },
- operator: 'instanceof',
- actual: _getClass
- },
- uuid: {
- check: function (arg) {
- return typeof (arg) === 'string' && UUID_REGEXP.test(arg);
- },
- operator: 'isUUID'
- }
-};
-
-function _setExports(ndebug) {
- var keys = Object.keys(types);
- var out;
-
- /* re-export standard assert */
- if (process.env.NODE_NDEBUG) {
- out = noop;
- } else {
- out = function (arg, msg) {
- if (!arg) {
- _toss(msg, 'true', arg);
- }
- };
- }
-
- /* standard checks */
- keys.forEach(function (k) {
- if (ndebug) {
- out[k] = noop;
- return;
- }
- var type = types[k];
- out[k] = function (arg, msg) {
- if (!type.check(arg)) {
- _toss(msg, k, type.operator, arg, type.actual);
- }
- };
- });
-
- /* optional checks */
- keys.forEach(function (k) {
- var name = 'optional' + _capitalize(k);
- if (ndebug) {
- out[name] = noop;
- return;
- }
- var type = types[k];
- out[name] = function (arg, msg) {
- if (arg === undefined || arg === null) {
- return;
- }
- if (!type.check(arg)) {
- _toss(msg, k, type.operator, arg, type.actual);
- }
- };
- });
-
- /* arrayOf checks */
- keys.forEach(function (k) {
- var name = 'arrayOf' + _capitalize(k);
- if (ndebug) {
- out[name] = noop;
- return;
- }
- var type = types[k];
- var expected = '[' + k + ']';
- out[name] = function (arg, msg) {
- if (!Array.isArray(arg)) {
- _toss(msg, expected, type.operator, arg, type.actual);
- }
- var i;
- for (i = 0; i < arg.length; i++) {
- if (!type.check(arg[i])) {
- _toss(msg, expected, type.operator, arg, type.actual);
- }
- }
- };
- });
-
- /* optionalArrayOf checks */
- keys.forEach(function (k) {
- var name = 'optionalArrayOf' + _capitalize(k);
- if (ndebug) {
- out[name] = noop;
- return;
- }
- var type = types[k];
- var expected = '[' + k + ']';
- out[name] = function (arg, msg) {
- if (arg === undefined || arg === null) {
- return;
- }
- if (!Array.isArray(arg)) {
- _toss(msg, expected, type.operator, arg, type.actual);
- }
- var i;
- for (i = 0; i < arg.length; i++) {
- if (!type.check(arg[i])) {
- _toss(msg, expected, type.operator, arg, type.actual);
- }
- }
- };
- });
-
- /* re-export built-in assertions */
- Object.keys(assert).forEach(function (k) {
- if (k === 'AssertionError') {
- out[k] = assert[k];
- return;
- }
- if (ndebug) {
- out[k] = noop;
- return;
- }
- out[k] = assert[k];
- });
-
- /* export ourselves (for unit tests _only_) */
- out._setExports = _setExports;
-
- return out;
-}
-
-module.exports = _setExports(process.env.NODE_NDEBUG);
-
-
-/***/ }),
-/* 17 */
-/***/ (function(module, exports) {
-
-// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
-var global = module.exports = typeof window != 'undefined' && window.Math == Math
- ? window : typeof self != 'undefined' && self.Math == Math ? self
- // eslint-disable-next-line no-new-func
- : Function('return this')();
-if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef
-
-
-/***/ }),
-/* 18 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.sortAlpha = sortAlpha;
-exports.sortOptionsByFlags = sortOptionsByFlags;
-exports.entries = entries;
-exports.removePrefix = removePrefix;
-exports.removeSuffix = removeSuffix;
-exports.addSuffix = addSuffix;
-exports.hyphenate = hyphenate;
-exports.camelCase = camelCase;
-exports.compareSortedArrays = compareSortedArrays;
-exports.sleep = sleep;
-const _camelCase = __webpack_require__(230);
-
-function sortAlpha(a, b) {
- // sort alphabetically in a deterministic way
- const shortLen = Math.min(a.length, b.length);
- for (let i = 0; i < shortLen; i++) {
- const aChar = a.charCodeAt(i);
- const bChar = b.charCodeAt(i);
- if (aChar !== bChar) {
- return aChar - bChar;
- }
- }
- return a.length - b.length;
-}
-
-function sortOptionsByFlags(a, b) {
- const aOpt = a.flags.replace(/-/g, '');
- const bOpt = b.flags.replace(/-/g, '');
- return sortAlpha(aOpt, bOpt);
-}
-
-function entries(obj) {
- const entries = [];
- if (obj) {
- for (const key in obj) {
- entries.push([key, obj[key]]);
- }
- }
- return entries;
-}
-
-function removePrefix(pattern, prefix) {
- if (pattern.startsWith(prefix)) {
- pattern = pattern.slice(prefix.length);
- }
-
- return pattern;
-}
-
-function removeSuffix(pattern, suffix) {
- if (pattern.endsWith(suffix)) {
- return pattern.slice(0, -suffix.length);
- }
-
- return pattern;
-}
-
-function addSuffix(pattern, suffix) {
- if (!pattern.endsWith(suffix)) {
- return pattern + suffix;
- }
-
- return pattern;
-}
-
-function hyphenate(str) {
- return str.replace(/[A-Z]/g, match => {
- return '-' + match.charAt(0).toLowerCase();
- });
-}
-
-function camelCase(str) {
- if (/[A-Z]/.test(str)) {
- return null;
- } else {
- return _camelCase(str);
- }
-}
-
-function compareSortedArrays(array1, array2) {
- if (array1.length !== array2.length) {
- return false;
- }
- for (let i = 0, len = array1.length; i < len; i++) {
- if (array1[i] !== array2[i]) {
- return false;
- }
- }
- return true;
-}
-
-function sleep(ms) {
- return new Promise(resolve => {
- setTimeout(resolve, ms);
- });
-}
-
-/***/ }),
-/* 19 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.stringify = exports.parse = undefined;
-
-var _asyncToGenerator2;
-
-function _load_asyncToGenerator() {
- return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2));
-}
-
-var _parse;
-
-function _load_parse() {
- return _parse = __webpack_require__(105);
-}
-
-Object.defineProperty(exports, 'parse', {
- enumerable: true,
- get: function get() {
- return _interopRequireDefault(_parse || _load_parse()).default;
- }
-});
-
-var _stringify;
-
-function _load_stringify() {
- return _stringify = __webpack_require__(199);
-}
-
-Object.defineProperty(exports, 'stringify', {
- enumerable: true,
- get: function get() {
- return _interopRequireDefault(_stringify || _load_stringify()).default;
- }
-});
-exports.implodeEntry = implodeEntry;
-exports.explodeEntry = explodeEntry;
-
-var _misc;
-
-function _load_misc() {
- return _misc = __webpack_require__(18);
-}
-
-var _normalizePattern;
-
-function _load_normalizePattern() {
- return _normalizePattern = __webpack_require__(37);
-}
-
-var _parse2;
-
-function _load_parse2() {
- return _parse2 = _interopRequireDefault(__webpack_require__(105));
-}
-
-var _constants;
-
-function _load_constants() {
- return _constants = __webpack_require__(8);
-}
-
-var _fs;
-
-function _load_fs() {
- return _fs = _interopRequireWildcard(__webpack_require__(4));
-}
-
-function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
-
-function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
-
-const invariant = __webpack_require__(9);
-
-const path = __webpack_require__(0);
-const ssri = __webpack_require__(65);
-
-function getName(pattern) {
- return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name;
-}
-
-function blankObjectUndefined(obj) {
- return obj && Object.keys(obj).length ? obj : undefined;
-}
-
-function keyForRemote(remote) {
- return remote.resolved || (remote.reference && remote.hash ? `${remote.reference}#${remote.hash}` : null);
-}
-
-function serializeIntegrity(integrity) {
- // We need this because `Integrity.toString()` does not use sorting to ensure a stable string output
- // See https://git.io/vx2Hy
- return integrity.toString().split(' ').sort().join(' ');
-}
-
-function implodeEntry(pattern, obj) {
- const inferredName = getName(pattern);
- const integrity = obj.integrity ? serializeIntegrity(obj.integrity) : '';
- const imploded = {
- name: inferredName === obj.name ? undefined : obj.name,
- version: obj.version,
- uid: obj.uid === obj.version ? undefined : obj.uid,
- resolved: obj.resolved,
- registry: obj.registry === 'npm' ? undefined : obj.registry,
- dependencies: blankObjectUndefined(obj.dependencies),
- optionalDependencies: blankObjectUndefined(obj.optionalDependencies),
- permissions: blankObjectUndefined(obj.permissions),
- prebuiltVariants: blankObjectUndefined(obj.prebuiltVariants)
- };
- if (integrity) {
- imploded.integrity = integrity;
- }
- return imploded;
-}
-
-function explodeEntry(pattern, obj) {
- obj.optionalDependencies = obj.optionalDependencies || {};
- obj.dependencies = obj.dependencies || {};
- obj.uid = obj.uid || obj.version;
- obj.permissions = obj.permissions || {};
- obj.registry = obj.registry || 'npm';
- obj.name = obj.name || getName(pattern);
- const integrity = obj.integrity;
- if (integrity && integrity.isIntegrity) {
- obj.integrity = ssri.parse(integrity);
- }
- return obj;
-}
-
-class Lockfile {
- constructor({ cache, source, parseResultType } = {}) {
- this.source = source || '';
- this.cache = cache;
- this.parseResultType = parseResultType;
- }
-
- // source string if the `cache` was parsed
-
-
- // if true, we're parsing an old yarn file and need to update integrity fields
- hasEntriesExistWithoutIntegrity() {
- if (!this.cache) {
- return false;
- }
-
- for (const key in this.cache) {
- // $FlowFixMe - `this.cache` is clearly defined at this point
- if (!/^.*@(file:|http)/.test(key) && this.cache[key] && !this.cache[key].integrity) {
- return true;
- }
- }
-
- return false;
- }
-
- static fromDirectory(dir, reporter) {
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- // read the manifest in this directory
- const lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME);
-
- let lockfile;
- let rawLockfile = '';
- let parseResult;
-
- if (yield (_fs || _load_fs()).exists(lockfileLoc)) {
- rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc);
- parseResult = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc);
-
- if (reporter) {
- if (parseResult.type === 'merge') {
- reporter.info(reporter.lang('lockfileMerged'));
- } else if (parseResult.type === 'conflict') {
- reporter.warn(reporter.lang('lockfileConflict'));
- }
- }
-
- lockfile = parseResult.object;
- } else if (reporter) {
- reporter.info(reporter.lang('noLockfileFound'));
- }
-
- if (lockfile && lockfile.__metadata) {
- const lockfilev2 = lockfile;
- lockfile = {};
- }
-
- return new Lockfile({ cache: lockfile, source: rawLockfile, parseResultType: parseResult && parseResult.type });
- })();
- }
-
- getLocked(pattern) {
- const cache = this.cache;
- if (!cache) {
- return undefined;
- }
-
- const shrunk = pattern in cache && cache[pattern];
-
- if (typeof shrunk === 'string') {
- return this.getLocked(shrunk);
- } else if (shrunk) {
- explodeEntry(pattern, shrunk);
- return shrunk;
- }
-
- return undefined;
- }
-
- removePattern(pattern) {
- const cache = this.cache;
- if (!cache) {
- return;
- }
- delete cache[pattern];
- }
-
- getLockfile(patterns) {
- const lockfile = {};
- const seen = new Map();
-
- // order by name so that lockfile manifest is assigned to the first dependency with this manifest
- // the others that have the same remoteKey will just refer to the first
- // ordering allows for consistency in lockfile when it is serialized
- const sortedPatternsKeys = Object.keys(patterns).sort((_misc || _load_misc()).sortAlpha);
-
- for (var _iterator = sortedPatternsKeys, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
- var _ref;
-
- if (_isArray) {
- if (_i >= _iterator.length) break;
- _ref = _iterator[_i++];
- } else {
- _i = _iterator.next();
- if (_i.done) break;
- _ref = _i.value;
- }
-
- const pattern = _ref;
-
- const pkg = patterns[pattern];
- const remote = pkg._remote,
- ref = pkg._reference;
-
- invariant(ref, 'Package is missing a reference');
- invariant(remote, 'Package is missing a remote');
-
- const remoteKey = keyForRemote(remote);
- const seenPattern = remoteKey && seen.get(remoteKey);
- if (seenPattern) {
- // no point in duplicating it
- lockfile[pattern] = seenPattern;
-
- // if we're relying on our name being inferred and two of the patterns have
- // different inferred names then we need to set it
- if (!seenPattern.name && getName(pattern) !== pkg.name) {
- seenPattern.name = pkg.name;
- }
- continue;
- }
- const obj = implodeEntry(pattern, {
- name: pkg.name,
- version: pkg.version,
- uid: pkg._uid,
- resolved: remote.resolved,
- integrity: remote.integrity,
- registry: remote.registry,
- dependencies: pkg.dependencies,
- peerDependencies: pkg.peerDependencies,
- optionalDependencies: pkg.optionalDependencies,
- permissions: ref.permissions,
- prebuiltVariants: pkg.prebuiltVariants
- });
-
- lockfile[pattern] = obj;
-
- if (remoteKey) {
- seen.set(remoteKey, obj);
- }
- }
-
- return lockfile;
- }
-}
-exports.default = Lockfile;
-
-/***/ }),
-/* 20 */
-/***/ (function(module, exports, __webpack_require__) {
-
-var store = __webpack_require__(133)('wks');
-var uid = __webpack_require__(137);
-var Symbol = __webpack_require__(17).Symbol;
-var USE_SYMBOL = typeof Symbol == 'function';
-
-var $exports = module.exports = function (name) {
- return store[name] || (store[name] =
- USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name));
-};
-
-$exports.store = store;
-
-
-/***/ }),
-/* 21 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-exports.__esModule = true;
-
-var _assign = __webpack_require__(591);
-
-var _assign2 = _interopRequireDefault(_assign);
-
-function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
-
-exports.default = _assign2.default || function (target) {
- for (var i = 1; i < arguments.length; i++) {
- var source = arguments[i];
-
- for (var key in source) {
- if (Object.prototype.hasOwnProperty.call(source, key)) {
- target[key] = source[key];
- }
- }
- }
-
- return target;
-};
-
-/***/ }),
-/* 22 */
-/***/ (function(module, exports) {
-
-exports = module.exports = SemVer;
-
-// The debug function is excluded entirely from the minified version.
-/* nomin */ var debug;
-/* nomin */ if (typeof process === 'object' &&
- /* nomin */ process.env &&
- /* nomin */ process.env.NODE_DEBUG &&
- /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG))
- /* nomin */ debug = function() {
- /* nomin */ var args = Array.prototype.slice.call(arguments, 0);
- /* nomin */ args.unshift('SEMVER');
- /* nomin */ console.log.apply(console, args);
- /* nomin */ };
-/* nomin */ else
- /* nomin */ debug = function() {};
-
-// Note: this is the semver.org version of the spec that it implements
-// Not necessarily the package version of this code.
-exports.SEMVER_SPEC_VERSION = '2.0.0';
-
-var MAX_LENGTH = 256;
-var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991;
-
-// Max safe segment length for coercion.
-var MAX_SAFE_COMPONENT_LENGTH = 16;
-
-// The actual regexps go on exports.re
-var re = exports.re = [];
-var src = exports.src = [];
-var R = 0;
-
-// The following Regular Expressions can be used for tokenizing,
-// validating, and parsing SemVer version strings.
-
-// ## Numeric Identifier
-// A single `0`, or a non-zero digit followed by zero or more digits.
-
-var NUMERICIDENTIFIER = R++;
-src[NUMERICIDENTIFIER] = '0|[1-9]\\d*';
-var NUMERICIDENTIFIERLOOSE = R++;
-src[NUMERICIDENTIFIERLOOSE] = '[0-9]+';
-
-
-// ## Non-numeric Identifier
-// Zero or more digits, followed by a letter or hyphen, and then zero or
-// more letters, digits, or hyphens.
-
-var NONNUMERICIDENTIFIER = R++;
-src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*';
-
-
-// ## Main Version
-// Three dot-separated numeric identifiers.
-
-var MAINVERSION = R++;
-src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' +
- '(' + src[NUMERICIDENTIFIER] + ')\\.' +
- '(' + src[NUMERICIDENTIFIER] + ')';
-
-var MAINVERSIONLOOSE = R++;
-src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' +
- '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' +
- '(' + src[NUMERICIDENTIFIERLOOSE] + ')';
-
-// ## Pre-release Version Identifier
-// A numeric identifier, or a non-numeric identifier.
-
-var PRERELEASEIDENTIFIER = R++;
-src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] +
- '|' + src[NONNUMERICIDENTIFIER] + ')';
-
-var PRERELEASEIDENTIFIERLOOSE = R++;
-src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] +
- '|' + src[NONNUMERICIDENTIFIER] + ')';
-
-
-// ## Pre-release Version
-// Hyphen, followed by one or more dot-separated pre-release version
-// identifiers.
-
-var PRERELEASE = R++;
-src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] +
- '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))';
-
-var PRERELEASELOOSE = R++;
-src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] +
- '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))';
-
-// ## Build Metadata Identifier
-// Any combination of digits, letters, or hyphens.
-
-var BUILDIDENTIFIER = R++;
-src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+';
-
-// ## Build Metadata
-// Plus sign, followed by one or more period-separated build metadata
-// identifiers.
-
-var BUILD = R++;
-src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] +
- '(?:\\.' + src[BUILDIDENTIFIER] + ')*))';
-
-
-// ## Full Version String
-// A main version, followed optionally by a pre-release version and
-// build metadata.
-
-// Note that the only major, minor, patch, and pre-release sections of
-// the version string are capturing groups. The build metadata is not a
-// capturing group, because it should not ever be used in version
-// comparison.
-
-var FULL = R++;
-var FULLPLAIN = 'v?' + src[MAINVERSION] +
- src[PRERELEASE] + '?' +
- src[BUILD] + '?';
-
-src[FULL] = '^' + FULLPLAIN + '$';
-
-// like full, but allows v1.2.3 and =1.2.3, which people do sometimes.
-// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty
-// common in the npm registry.
-var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] +
- src[PRERELEASELOOSE] + '?' +
- src[BUILD] + '?';
-
-var LOOSE = R++;
-src[LOOSE] = '^' + LOOSEPLAIN + '$';
-
-var GTLT = R++;
-src[GTLT] = '((?:<|>)?=?)';
-
-// Something like "2.*" or "1.2.x".
-// Note that "x.x" is a valid xRange identifer, meaning "any version"
-// Only the first item is strictly required.
-var XRANGEIDENTIFIERLOOSE = R++;
-src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*';
-var XRANGEIDENTIFIER = R++;
-src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*';
-
-var XRANGEPLAIN = R++;
-src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' +
- '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' +
- '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' +
- '(?:' + src[PRERELEASE] + ')?' +
- src[BUILD] + '?' +
- ')?)?';
-
-var XRANGEPLAINLOOSE = R++;
-src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' +
- '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' +
- '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' +
- '(?:' + src[PRERELEASELOOSE] + ')?' +
- src[BUILD] + '?' +
- ')?)?';
-
-var XRANGE = R++;
-src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$';
-var XRANGELOOSE = R++;
-src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$';
-
-// Coercion.
-// Extract anything that could conceivably be a part of a valid semver
-var COERCE = R++;
-src[COERCE] = '(?:^|[^\\d])' +
- '(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '})' +
- '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' +
- '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' +
- '(?:$|[^\\d])';
-
-// Tilde ranges.
-// Meaning is "reasonably at or greater than"
-var LONETILDE = R++;
-src[LONETILDE] = '(?:~>?)';
-
-var TILDETRIM = R++;
-src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+';
-re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g');
-var tildeTrimReplace = '$1~';
-
-var TILDE = R++;
-src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$';
-var TILDELOOSE = R++;
-src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$';
-
-// Caret ranges.
-// Meaning is "at least and backwards compatible with"
-var LONECARET = R++;
-src[LONECARET] = '(?:\\^)';
-
-var CARETTRIM = R++;
-src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+';
-re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g');
-var caretTrimReplace = '$1^';
-
-var CARET = R++;
-src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$';
-var CARETLOOSE = R++;
-src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$';
-
-// A simple gt/lt/eq thing, or just "" to indicate "any version"
-var COMPARATORLOOSE = R++;
-src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$';
-var COMPARATOR = R++;
-src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$';
-
-
-// An expression to strip any whitespace between the gtlt and the thing
-// it modifies, so that `> 1.2.3` ==> `>1.2.3`
-var COMPARATORTRIM = R++;
-src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] +
- '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')';
-
-// this one has to use the /g flag
-re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g');
-var comparatorTrimReplace = '$1$2$3';
-
-
-// Something like `1.2.3 - 1.2.4`
-// Note that these all use the loose form, because they'll be
-// checked against either the strict or loose comparator form
-// later.
-var HYPHENRANGE = R++;
-src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' +
- '\\s+-\\s+' +
- '(' + src[XRANGEPLAIN] + ')' +
- '\\s*$';
-
-var HYPHENRANGELOOSE = R++;
-src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' +
- '\\s+-\\s+' +
- '(' + src[XRANGEPLAINLOOSE] + ')' +
- '\\s*$';
-
-// Star ranges basically just allow anything at all.
-var STAR = R++;
-src[STAR] = '(<|>)?=?\\s*\\*';
-
-// Compile to actual regexp objects.
-// All are flag-free, unless they were created above with a flag.
-for (var i = 0; i < R; i++) {
- debug(i, src[i]);
- if (!re[i])
- re[i] = new RegExp(src[i]);
-}
-
-exports.parse = parse;
-function parse(version, loose) {
- if (version instanceof SemVer)
- return version;
-
- if (typeof version !== 'string')
- return null;
-
- if (version.length > MAX_LENGTH)
- return null;
-
- var r = loose ? re[LOOSE] : re[FULL];
- if (!r.test(version))
- return null;
-
- try {
- return new SemVer(version, loose);
- } catch (er) {
- return null;
- }
-}
-
-exports.valid = valid;
-function valid(version, loose) {
- var v = parse(version, loose);
- return v ? v.version : null;
-}
-
-
-exports.clean = clean;
-function clean(version, loose) {
- var s = parse(version.trim().replace(/^[=v]+/, ''), loose);
- return s ? s.version : null;
-}
-
-exports.SemVer = SemVer;
-
-function SemVer(version, loose) {
- if (version instanceof SemVer) {
- if (version.loose === loose)
- return version;
- else
- version = version.version;
- } else if (typeof version !== 'string') {
- throw new TypeError('Invalid Version: ' + version);
- }
-
- if (version.length > MAX_LENGTH)
- throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters')
-
- if (!(this instanceof SemVer))
- return new SemVer(version, loose);
-
- debug('SemVer', version, loose);
- this.loose = loose;
- var m = version.trim().match(loose ? re[LOOSE] : re[FULL]);
-
- if (!m)
- throw new TypeError('Invalid Version: ' + version);
-
- this.raw = version;
-
- // these are actually numbers
- this.major = +m[1];
- this.minor = +m[2];
- this.patch = +m[3];
-
- if (this.major > MAX_SAFE_INTEGER || this.major < 0)
- throw new TypeError('Invalid major version')
-
- if (this.minor > MAX_SAFE_INTEGER || this.minor < 0)
- throw new TypeError('Invalid minor version')
-
- if (this.patch > MAX_SAFE_INTEGER || this.patch < 0)
- throw new TypeError('Invalid patch version')
-
- // numberify any prerelease numeric ids
- if (!m[4])
- this.prerelease = [];
- else
- this.prerelease = m[4].split('.').map(function(id) {
- if (/^[0-9]+$/.test(id)) {
- var num = +id;
- if (num >= 0 && num < MAX_SAFE_INTEGER)
- return num;
- }
- return id;
- });
-
- this.build = m[5] ? m[5].split('.') : [];
- this.format();
-}
-
-SemVer.prototype.format = function() {
- this.version = this.major + '.' + this.minor + '.' + this.patch;
- if (this.prerelease.length)
- this.version += '-' + this.prerelease.join('.');
- return this.version;
-};
-
-SemVer.prototype.toString = function() {
- return this.version;
-};
-
-SemVer.prototype.compare = function(other) {
- debug('SemVer.compare', this.version, this.loose, other);
- if (!(other instanceof SemVer))
- other = new SemVer(other, this.loose);
-
- return this.compareMain(other) || this.comparePre(other);
-};
-
-SemVer.prototype.compareMain = function(other) {
- if (!(other instanceof SemVer))
- other = new SemVer(other, this.loose);
-
- return compareIdentifiers(this.major, other.major) ||
- compareIdentifiers(this.minor, other.minor) ||
- compareIdentifiers(this.patch, other.patch);
-};
-
-SemVer.prototype.comparePre = function(other) {
- if (!(other instanceof SemVer))
- other = new SemVer(other, this.loose);
-
- // NOT having a prerelease is > having one
- if (this.prerelease.length && !other.prerelease.length)
- return -1;
- else if (!this.prerelease.length && other.prerelease.length)
- return 1;
- else if (!this.prerelease.length && !other.prerelease.length)
- return 0;
-
- var i = 0;
- do {
- var a = this.prerelease[i];
- var b = other.prerelease[i];
- debug('prerelease compare', i, a, b);
- if (a === undefined && b === undefined)
- return 0;
- else if (b === undefined)
- return 1;
- else if (a === undefined)
- return -1;
- else if (a === b)
- continue;
- else
- return compareIdentifiers(a, b);
- } while (++i);
-};
-
-// preminor will bump the version up to the next minor release, and immediately
-// down to pre-release. premajor and prepatch work the same way.
-SemVer.prototype.inc = function(release, identifier) {
- switch (release) {
- case 'premajor':
- this.prerelease.length = 0;
- this.patch = 0;
- this.minor = 0;
- this.major++;
- this.inc('pre', identifier);
- break;
- case 'preminor':
- this.prerelease.length = 0;
- this.patch = 0;
- this.minor++;
- this.inc('pre', identifier);
- break;
- case 'prepatch':
- // If this is already a prerelease, it will bump to the next version
- // drop any prereleases that might already exist, since they are not
- // relevant at this point.
- this.prerelease.length = 0;
- this.inc('patch', identifier);
- this.inc('pre', identifier);
- break;
- // If the input is a non-prerelease version, this acts the same as
- // prepatch.
- case 'prerelease':
- if (this.prerelease.length === 0)
- this.inc('patch', identifier);
- this.inc('pre', identifier);
- break;
-
- case 'major':
- // If this is a pre-major version, bump up to the same major version.
- // Otherwise increment major.
- // 1.0.0-5 bumps to 1.0.0
- // 1.1.0 bumps to 2.0.0
- if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0)
- this.major++;
- this.minor = 0;
- this.patch = 0;
- this.prerelease = [];
- break;
- case 'minor':
- // If this is a pre-minor version, bump up to the same minor version.
- // Otherwise increment minor.
- // 1.2.0-5 bumps to 1.2.0
- // 1.2.1 bumps to 1.3.0
- if (this.patch !== 0 || this.prerelease.length === 0)
- this.minor++;
- this.patch = 0;
- this.prerelease = [];
- break;
- case 'patch':
- // If this is not a pre-release version, it will increment the patch.
- // If it is a pre-release it will bump up to the same patch version.
- // 1.2.0-5 patches to 1.2.0
- // 1.2.0 patches to 1.2.1
- if (this.prerelease.length === 0)
- this.patch++;
- this.prerelease = [];
- break;
- // This probably shouldn't be used publicly.
- // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction.
- case 'pre':
- if (this.prerelease.length === 0)
- this.prerelease = [0];
- else {
- var i = this.prerelease.length;
- while (--i >= 0) {
- if (typeof this.prerelease[i] === 'number') {
- this.prerelease[i]++;
- i = -2;
- }
- }
- if (i === -1) // didn't increment anything
- this.prerelease.push(0);
- }
- if (identifier) {
- // 1.2.0-beta.1 bumps to 1.2.0-beta.2,
- // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0
- if (this.prerelease[0] === identifier) {
- if (isNaN(this.prerelease[1]))
- this.prerelease = [identifier, 0];
- } else
- this.prerelease = [identifier, 0];
- }
- break;
-
- default:
- throw new Error('invalid increment argument: ' + release);
- }
- this.format();
- this.raw = this.version;
- return this;
-};
-
-exports.inc = inc;
-function inc(version, release, loose, identifier) {
- if (typeof(loose) === 'string') {
- identifier = loose;
- loose = undefined;
- }
-
- try {
- return new SemVer(version, loose).inc(release, identifier).version;
- } catch (er) {
- return null;
- }
-}
-
-exports.diff = diff;
-function diff(version1, version2) {
- if (eq(version1, version2)) {
- return null;
- } else {
- var v1 = parse(version1);
- var v2 = parse(version2);
- if (v1.prerelease.length || v2.prerelease.length) {
- for (var key in v1) {
- if (key === 'major' || key === 'minor' || key === 'patch') {
- if (v1[key] !== v2[key]) {
- return 'pre'+key;
- }
- }
- }
- return 'prerelease';
- }
- for (var key in v1) {
- if (key === 'major' || key === 'minor' || key === 'patch') {
- if (v1[key] !== v2[key]) {
- return key;
- }
- }
- }
- }
-}
-
-exports.compareIdentifiers = compareIdentifiers;
-
-var numeric = /^[0-9]+$/;
-function compareIdentifiers(a, b) {
- var anum = numeric.test(a);
- var bnum = numeric.test(b);
-
- if (anum && bnum) {
- a = +a;
- b = +b;
- }
-
- return (anum && !bnum) ? -1 :
- (bnum && !anum) ? 1 :
- a < b ? -1 :
- a > b ? 1 :
- 0;
-}
-
-exports.rcompareIdentifiers = rcompareIdentifiers;
-function rcompareIdentifiers(a, b) {
- return compareIdentifiers(b, a);
-}
-
-exports.major = major;
-function major(a, loose) {
- return new SemVer(a, loose).major;
-}
-
-exports.minor = minor;
-function minor(a, loose) {
- return new SemVer(a, loose).minor;
-}
-
-exports.patch = patch;
-function patch(a, loose) {
- return new SemVer(a, loose).patch;
-}
-
-exports.compare = compare;
-function compare(a, b, loose) {
- return new SemVer(a, loose).compare(new SemVer(b, loose));
-}
-
-exports.compareLoose = compareLoose;
-function compareLoose(a, b) {
- return compare(a, b, true);
-}
-
-exports.rcompare = rcompare;
-function rcompare(a, b, loose) {
- return compare(b, a, loose);
-}
-
-exports.sort = sort;
-function sort(list, loose) {
- return list.sort(function(a, b) {
- return exports.compare(a, b, loose);
- });
-}
-
-exports.rsort = rsort;
-function rsort(list, loose) {
- return list.sort(function(a, b) {
- return exports.rcompare(a, b, loose);
- });
-}
-
-exports.gt = gt;
-function gt(a, b, loose) {
- return compare(a, b, loose) > 0;
-}
-
-exports.lt = lt;
-function lt(a, b, loose) {
- return compare(a, b, loose) < 0;
-}
-
-exports.eq = eq;
-function eq(a, b, loose) {
- return compare(a, b, loose) === 0;
-}
-
-exports.neq = neq;
-function neq(a, b, loose) {
- return compare(a, b, loose) !== 0;
-}
-
-exports.gte = gte;
-function gte(a, b, loose) {
- return compare(a, b, loose) >= 0;
-}
-
-exports.lte = lte;
-function lte(a, b, loose) {
- return compare(a, b, loose) <= 0;
-}
-
-exports.cmp = cmp;
-function cmp(a, op, b, loose) {
- var ret;
- switch (op) {
- case '===':
- if (typeof a === 'object') a = a.version;
- if (typeof b === 'object') b = b.version;
- ret = a === b;
- break;
- case '!==':
- if (typeof a === 'object') a = a.version;
- if (typeof b === 'object') b = b.version;
- ret = a !== b;
- break;
- case '': case '=': case '==': ret = eq(a, b, loose); break;
- case '!=': ret = neq(a, b, loose); break;
- case '>': ret = gt(a, b, loose); break;
- case '>=': ret = gte(a, b, loose); break;
- case '<': ret = lt(a, b, loose); break;
- case '<=': ret = lte(a, b, loose); break;
- default: throw new TypeError('Invalid operator: ' + op);
- }
- return ret;
-}
-
-exports.Comparator = Comparator;
-function Comparator(comp, loose) {
- if (comp instanceof Comparator) {
- if (comp.loose === loose)
- return comp;
- else
- comp = comp.value;
- }
-
- if (!(this instanceof Comparator))
- return new Comparator(comp, loose);
-
- debug('comparator', comp, loose);
- this.loose = loose;
- this.parse(comp);
-
- if (this.semver === ANY)
- this.value = '';
- else
- this.value = this.operator + this.semver.version;
-
- debug('comp', this);
-}
-
-var ANY = {};
-Comparator.prototype.parse = function(comp) {
- var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR];
- var m = comp.match(r);
-
- if (!m)
- throw new TypeError('Invalid comparator: ' + comp);
-
- this.operator = m[1];
- if (this.operator === '=')
- this.operator = '';
-
- // if it literally is just '>' or '' then allow anything.
- if (!m[2])
- this.semver = ANY;
- else
- this.semver = new SemVer(m[2], this.loose);
-};
-
-Comparator.prototype.toString = function() {
- return this.value;
-};
-
-Comparator.prototype.test = function(version) {
- debug('Comparator.test', version, this.loose);
-
- if (this.semver === ANY)
- return true;
-
- if (typeof version === 'string')
- version = new SemVer(version, this.loose);
-
- return cmp(version, this.operator, this.semver, this.loose);
-};
-
-Comparator.prototype.intersects = function(comp, loose) {
- if (!(comp instanceof Comparator)) {
- throw new TypeError('a Comparator is required');
- }
-
- var rangeTmp;
-
- if (this.operator === '') {
- rangeTmp = new Range(comp.value, loose);
- return satisfies(this.value, rangeTmp, loose);
- } else if (comp.operator === '') {
- rangeTmp = new Range(this.value, loose);
- return satisfies(comp.semver, rangeTmp, loose);
- }
-
- var sameDirectionIncreasing =
- (this.operator === '>=' || this.operator === '>') &&
- (comp.operator === '>=' || comp.operator === '>');
- var sameDirectionDecreasing =
- (this.operator === '<=' || this.operator === '<') &&
- (comp.operator === '<=' || comp.operator === '<');
- var sameSemVer = this.semver.version === comp.semver.version;
- var differentDirectionsInclusive =
- (this.operator === '>=' || this.operator === '<=') &&
- (comp.operator === '>=' || comp.operator === '<=');
- var oppositeDirectionsLessThan =
- cmp(this.semver, '<', comp.semver, loose) &&
- ((this.operator === '>=' || this.operator === '>') &&
- (comp.operator === '<=' || comp.operator === '<'));
- var oppositeDirectionsGreaterThan =
- cmp(this.semver, '>', comp.semver, loose) &&
- ((this.operator === '<=' || this.operator === '<') &&
- (comp.operator === '>=' || comp.operator === '>'));
-
- return sameDirectionIncreasing || sameDirectionDecreasing ||
- (sameSemVer && differentDirectionsInclusive) ||
- oppositeDirectionsLessThan || oppositeDirectionsGreaterThan;
-};
-
-
-exports.Range = Range;
-function Range(range, loose) {
- if (range instanceof Range) {
- if (range.loose === loose) {
- return range;
- } else {
- return new Range(range.raw, loose);
- }
- }
-
- if (range instanceof Comparator) {
- return new Range(range.value, loose);
- }
-
- if (!(this instanceof Range))
- return new Range(range, loose);
-
- this.loose = loose;
-
- // First, split based on boolean or ||
- this.raw = range;
- this.set = range.split(/\s*\|\|\s*/).map(function(range) {
- return this.parseRange(range.trim());
- }, this).filter(function(c) {
- // throw out any that are not relevant for whatever reason
- return c.length;
- });
-
- if (!this.set.length) {
- throw new TypeError('Invalid SemVer Range: ' + range);
- }
-
- this.format();
-}
-
-Range.prototype.format = function() {
- this.range = this.set.map(function(comps) {
- return comps.join(' ').trim();
- }).join('||').trim();
- return this.range;
-};
-
-Range.prototype.toString = function() {
- return this.range;
-};
-
-Range.prototype.parseRange = function(range) {
- var loose = this.loose;
- range = range.trim();
- debug('range', range, loose);
- // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4`
- var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE];
- range = range.replace(hr, hyphenReplace);
- debug('hyphen replace', range);
- // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5`
- range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace);
- debug('comparator trim', range, re[COMPARATORTRIM]);
-
- // `~ 1.2.3` => `~1.2.3`
- range = range.replace(re[TILDETRIM], tildeTrimReplace);
-
- // `^ 1.2.3` => `^1.2.3`
- range = range.replace(re[CARETTRIM], caretTrimReplace);
-
- // normalize spaces
- range = range.split(/\s+/).join(' ');
-
- // At this point, the range is completely trimmed and
- // ready to be split into comparators.
-
- var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR];
- var set = range.split(' ').map(function(comp) {
- return parseComparator(comp, loose);
- }).join(' ').split(/\s+/);
- if (this.loose) {
- // in loose mode, throw out any that are not valid comparators
- set = set.filter(function(comp) {
- return !!comp.match(compRe);
- });
- }
- set = set.map(function(comp) {
- return new Comparator(comp, loose);
- });
-
- return set;
-};
-
-Range.prototype.intersects = function(range, loose) {
- if (!(range instanceof Range)) {
- throw new TypeError('a Range is required');
- }
-
- return this.set.some(function(thisComparators) {
- return thisComparators.every(function(thisComparator) {
- return range.set.some(function(rangeComparators) {
- return rangeComparators.every(function(rangeComparator) {
- return thisComparator.intersects(rangeComparator, loose);
- });
- });
- });
- });
-};
-
-// Mostly just for testing and legacy API reasons
-exports.toComparators = toComparators;
-function toComparators(range, loose) {
- return new Range(range, loose).set.map(function(comp) {
- return comp.map(function(c) {
- return c.value;
- }).join(' ').trim().split(' ');
- });
-}
-
-// comprised of xranges, tildes, stars, and gtlt's at this point.
-// already replaced the hyphen ranges
-// turn into a set of JUST comparators.
-function parseComparator(comp, loose) {
- debug('comp', comp);
- comp = replaceCarets(comp, loose);
- debug('caret', comp);
- comp = replaceTildes(comp, loose);
- debug('tildes', comp);
- comp = replaceXRanges(comp, loose);
- debug('xrange', comp);
- comp = replaceStars(comp, loose);
- debug('stars', comp);
- return comp;
-}
-
-function isX(id) {
- return !id || id.toLowerCase() === 'x' || id === '*';
-}
-
-// ~, ~> --> * (any, kinda silly)
-// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0
-// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0
-// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0
-// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0
-// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0
-function replaceTildes(comp, loose) {
- return comp.trim().split(/\s+/).map(function(comp) {
- return replaceTilde(comp, loose);
- }).join(' ');
-}
-
-function replaceTilde(comp, loose) {
- var r = loose ? re[TILDELOOSE] : re[TILDE];
- return comp.replace(r, function(_, M, m, p, pr) {
- debug('tilde', comp, _, M, m, p, pr);
- var ret;
-
- if (isX(M))
- ret = '';
- else if (isX(m))
- ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0';
- else if (isX(p))
- // ~1.2 == >=1.2.0 <1.3.0
- ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0';
- else if (pr) {
- debug('replaceTilde pr', pr);
- if (pr.charAt(0) !== '-')
- pr = '-' + pr;
- ret = '>=' + M + '.' + m + '.' + p + pr +
- ' <' + M + '.' + (+m + 1) + '.0';
- } else
- // ~1.2.3 == >=1.2.3 <1.3.0
- ret = '>=' + M + '.' + m + '.' + p +
- ' <' + M + '.' + (+m + 1) + '.0';
-
- debug('tilde return', ret);
- return ret;
- });
-}
-
-// ^ --> * (any, kinda silly)
-// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0
-// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0
-// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0
-// ^1.2.3 --> >=1.2.3 <2.0.0
-// ^1.2.0 --> >=1.2.0 <2.0.0
-function replaceCarets(comp, loose) {
- return comp.trim().split(/\s+/).map(function(comp) {
- return replaceCaret(comp, loose);
- }).join(' ');
-}
-
-function replaceCaret(comp, loose) {
- debug('caret', comp, loose);
- var r = loose ? re[CARETLOOSE] : re[CARET];
- return comp.replace(r, function(_, M, m, p, pr) {
- debug('caret', comp, _, M, m, p, pr);
- var ret;
-
- if (isX(M))
- ret = '';
- else if (isX(m))
- ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0';
- else if (isX(p)) {
- if (M === '0')
- ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0';
- else
- ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0';
- } else if (pr) {
- debug('replaceCaret pr', pr);
- if (pr.charAt(0) !== '-')
- pr = '-' + pr;
- if (M === '0') {
- if (m === '0')
- ret = '>=' + M + '.' + m + '.' + p + pr +
- ' <' + M + '.' + m + '.' + (+p + 1);
- else
- ret = '>=' + M + '.' + m + '.' + p + pr +
- ' <' + M + '.' + (+m + 1) + '.0';
- } else
- ret = '>=' + M + '.' + m + '.' + p + pr +
- ' <' + (+M + 1) + '.0.0';
- } else {
- debug('no pr');
- if (M === '0') {
- if (m === '0')
- ret = '>=' + M + '.' + m + '.' + p +
- ' <' + M + '.' + m + '.' + (+p + 1);
- else
- ret = '>=' + M + '.' + m + '.' + p +
- ' <' + M + '.' + (+m + 1) + '.0';
- } else
- ret = '>=' + M + '.' + m + '.' + p +
- ' <' + (+M + 1) + '.0.0';
- }
-
- debug('caret return', ret);
- return ret;
- });
-}
-
-function replaceXRanges(comp, loose) {
- debug('replaceXRanges', comp, loose);
- return comp.split(/\s+/).map(function(comp) {
- return replaceXRange(comp, loose);
- }).join(' ');
-}
-
-function replaceXRange(comp, loose) {
- comp = comp.trim();
- var r = loose ? re[XRANGELOOSE] : re[XRANGE];
- return comp.replace(r, function(ret, gtlt, M, m, p, pr) {
- debug('xRange', comp, ret, gtlt, M, m, p, pr);
- var xM = isX(M);
- var xm = xM || isX(m);
- var xp = xm || isX(p);
- var anyX = xp;
-
- if (gtlt === '=' && anyX)
- gtlt = '';
-
- if (xM) {
- if (gtlt === '>' || gtlt === '<') {
- // nothing is allowed
- ret = '<0.0.0';
- } else {
- // nothing is forbidden
- ret = '*';
- }
- } else if (gtlt && anyX) {
- // replace X with 0
- if (xm)
- m = 0;
- if (xp)
- p = 0;
-
- if (gtlt === '>') {
- // >1 => >=2.0.0
- // >1.2 => >=1.3.0
- // >1.2.3 => >= 1.2.4
- gtlt = '>=';
- if (xm) {
- M = +M + 1;
- m = 0;
- p = 0;
- } else if (xp) {
- m = +m + 1;
- p = 0;
- }
- } else if (gtlt === '<=') {
- // <=0.7.x is actually <0.8.0, since any 0.7.x should
- // pass. Similarly, <=7.x is actually <8.0.0, etc.
- gtlt = '<';
- if (xm)
- M = +M + 1;
- else
- m = +m + 1;
- }
-
- ret = gtlt + M + '.' + m + '.' + p;
- } else if (xm) {
- ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0';
- } else if (xp) {
- ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0';
- }
-
- debug('xRange return', ret);
-
- return ret;
- });
-}
-
-// Because * is AND-ed with everything else in the comparator,
-// and '' means "any version", just remove the *s entirely.
-function replaceStars(comp, loose) {
- debug('replaceStars', comp, loose);
- // Looseness is ignored here. star is always as loose as it gets!
- return comp.trim().replace(re[STAR], '');
-}
-
-// This function is passed to string.replace(re[HYPHENRANGE])
-// M, m, patch, prerelease, build
-// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5
-// 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do
-// 1.2 - 3.4 => >=1.2.0 <3.5.0
-function hyphenReplace($0,
- from, fM, fm, fp, fpr, fb,
- to, tM, tm, tp, tpr, tb) {
-
- if (isX(fM))
- from = '';
- else if (isX(fm))
- from = '>=' + fM + '.0.0';
- else if (isX(fp))
- from = '>=' + fM + '.' + fm + '.0';
- else
- from = '>=' + from;
-
- if (isX(tM))
- to = '';
- else if (isX(tm))
- to = '<' + (+tM + 1) + '.0.0';
- else if (isX(tp))
- to = '<' + tM + '.' + (+tm + 1) + '.0';
- else if (tpr)
- to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr;
- else
- to = '<=' + to;
-
- return (from + ' ' + to).trim();
-}
-
-
-// if ANY of the sets match ALL of its comparators, then pass
-Range.prototype.test = function(version) {
- if (!version)
- return false;
-
- if (typeof version === 'string')
- version = new SemVer(version, this.loose);
-
- for (var i = 0; i < this.set.length; i++) {
- if (testSet(this.set[i], version))
- return true;
- }
- return false;
-};
-
-function testSet(set, version) {
- for (var i = 0; i < set.length; i++) {
- if (!set[i].test(version))
- return false;
- }
-
- if (version.prerelease.length) {
- // Find the set of versions that are allowed to have prereleases
- // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0
- // That should allow `1.2.3-pr.2` to pass.
- // However, `1.2.4-alpha.notready` should NOT be allowed,
- // even though it's within the range set by the comparators.
- for (var i = 0; i < set.length; i++) {
- debug(set[i].semver);
- if (set[i].semver === ANY)
- continue;
-
- if (set[i].semver.prerelease.length > 0) {
- var allowed = set[i].semver;
- if (allowed.major === version.major &&
- allowed.minor === version.minor &&
- allowed.patch === version.patch)
- return true;
- }
- }
-
- // Version has a -pre, but it's not one of the ones we like.
- return false;
- }
-
- return true;
-}
-
-exports.satisfies = satisfies;
-function satisfies(version, range, loose) {
- try {
- range = new Range(range, loose);
- } catch (er) {
- return false;
- }
- return range.test(version);
-}
-
-exports.maxSatisfying = maxSatisfying;
-function maxSatisfying(versions, range, loose) {
- var max = null;
- var maxSV = null;
- try {
- var rangeObj = new Range(range, loose);
- } catch (er) {
- return null;
- }
- versions.forEach(function (v) {
- if (rangeObj.test(v)) { // satisfies(v, range, loose)
- if (!max || maxSV.compare(v) === -1) { // compare(max, v, true)
- max = v;
- maxSV = new SemVer(max, loose);
- }
- }
- })
- return max;
-}
-
-exports.minSatisfying = minSatisfying;
-function minSatisfying(versions, range, loose) {
- var min = null;
- var minSV = null;
- try {
- var rangeObj = new Range(range, loose);
- } catch (er) {
- return null;
- }
- versions.forEach(function (v) {
- if (rangeObj.test(v)) { // satisfies(v, range, loose)
- if (!min || minSV.compare(v) === 1) { // compare(min, v, true)
- min = v;
- minSV = new SemVer(min, loose);
- }
- }
- })
- return min;
-}
-
-exports.validRange = validRange;
-function validRange(range, loose) {
- try {
- // Return '*' instead of '' so that truthiness works.
- // This will throw if it's invalid anyway
- return new Range(range, loose).range || '*';
- } catch (er) {
- return null;
- }
-}
-
-// Determine if version is less than all the versions possible in the range
-exports.ltr = ltr;
-function ltr(version, range, loose) {
- return outside(version, range, '<', loose);
-}
-
-// Determine if version is greater than all the versions possible in the range.
-exports.gtr = gtr;
-function gtr(version, range, loose) {
- return outside(version, range, '>', loose);
-}
-
-exports.outside = outside;
-function outside(version, range, hilo, loose) {
- version = new SemVer(version, loose);
- range = new Range(range, loose);
-
- var gtfn, ltefn, ltfn, comp, ecomp;
- switch (hilo) {
- case '>':
- gtfn = gt;
- ltefn = lte;
- ltfn = lt;
- comp = '>';
- ecomp = '>=';
- break;
- case '<':
- gtfn = lt;
- ltefn = gte;
- ltfn = gt;
- comp = '<';
- ecomp = '<=';
- break;
- default:
- throw new TypeError('Must provide a hilo val of "<" or ">"');
- }
-
- // If it satisifes the range it is not outside
- if (satisfies(version, range, loose)) {
- return false;
- }
-
- // From now on, variable terms are as if we're in "gtr" mode.
- // but note that everything is flipped for the "ltr" function.
-
- for (var i = 0; i < range.set.length; ++i) {
- var comparators = range.set[i];
-
- var high = null;
- var low = null;
-
- comparators.forEach(function(comparator) {
- if (comparator.semver === ANY) {
- comparator = new Comparator('>=0.0.0')
- }
- high = high || comparator;
- low = low || comparator;
- if (gtfn(comparator.semver, high.semver, loose)) {
- high = comparator;
- } else if (ltfn(comparator.semver, low.semver, loose)) {
- low = comparator;
- }
- });
-
- // If the edge version comparator has a operator then our version
- // isn't outside it
- if (high.operator === comp || high.operator === ecomp) {
- return false;
- }
-
- // If the lowest version comparator has an operator and our version
- // is less than it then it isn't higher than the range
- if ((!low.operator || low.operator === comp) &&
- ltefn(version, low.semver)) {
- return false;
- } else if (low.operator === ecomp && ltfn(version, low.semver)) {
- return false;
- }
- }
- return true;
-}
-
-exports.prerelease = prerelease;
-function prerelease(version, loose) {
- var parsed = parse(version, loose);
- return (parsed && parsed.prerelease.length) ? parsed.prerelease : null;
-}
-
-exports.intersects = intersects;
-function intersects(r1, r2, loose) {
- r1 = new Range(r1, loose)
- r2 = new Range(r2, loose)
- return r1.intersects(r2)
-}
-
-exports.coerce = coerce;
-function coerce(version) {
- if (version instanceof SemVer)
- return version;
-
- if (typeof version !== 'string')
- return null;
-
- var match = version.match(re[COERCE]);
-
- if (match == null)
- return null;
-
- return parse((match[1] || '0') + '.' + (match[2] || '0') + '.' + (match[3] || '0'));
-}
-
-
-/***/ }),
-/* 23 */
-/***/ (function(module, exports) {
-
-module.exports = require("stream");
-
-/***/ }),
-/* 24 */
-/***/ (function(module, exports) {
-
-module.exports = require("url");
-
-/***/ }),
-/* 25 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscription; });
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(41);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(444);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(154);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(56);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(48);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(441);
-/** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */
-
-
-
-
-
-
-var Subscription = /*@__PURE__*/ (function () {
- function Subscription(unsubscribe) {
- this.closed = false;
- this._parent = null;
- this._parents = null;
- this._subscriptions = null;
- if (unsubscribe) {
- this._unsubscribe = unsubscribe;
- }
- }
- Subscription.prototype.unsubscribe = function () {
- var hasErrors = false;
- var errors;
- if (this.closed) {
- return;
- }
- var _a = this, _parent = _a._parent, _parents = _a._parents, _unsubscribe = _a._unsubscribe, _subscriptions = _a._subscriptions;
- this.closed = true;
- this._parent = null;
- this._parents = null;
- this._subscriptions = null;
- var index = -1;
- var len = _parents ? _parents.length : 0;
- while (_parent) {
- _parent.remove(this);
- _parent = ++index < len && _parents[index] || null;
- }
- if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__util_isFunction__["a" /* isFunction */])(_unsubscribe)) {
- var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(_unsubscribe).call(this);
- if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) {
- hasErrors = true;
- errors = errors || (__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */] ?
- flattenUnsubscriptionErrors(__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e.errors) : [__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e]);
- }
- }
- if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_isArray__["a" /* isArray */])(_subscriptions)) {
- index = -1;
- len = _subscriptions.length;
- while (++index < len) {
- var sub = _subscriptions[index];
- if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isObject__["a" /* isObject */])(sub)) {
- var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(sub.unsubscribe).call(sub);
- if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) {
- hasErrors = true;
- errors = errors || [];
- var err = __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e;
- if (err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) {
- errors = errors.concat(flattenUnsubscriptionErrors(err.errors));
- }
- else {
- errors.push(err);
- }
- }
- }
- }
- }
- if (hasErrors) {
- throw new __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */](errors);
- }
- };
- Subscription.prototype.add = function (teardown) {
- if (!teardown || (teardown === Subscription.EMPTY)) {
- return Subscription.EMPTY;
- }
- if (teardown === this) {
- return this;
- }
- var subscription = teardown;
- switch (typeof teardown) {
- case 'function':
- subscription = new Subscription(teardown);
- case 'object':
- if (subscription.closed || typeof subscription.unsubscribe !== 'function') {
- return subscription;
- }
- else if (this.closed) {
- subscription.unsubscribe();
- return subscription;
- }
- else if (typeof subscription._addParent !== 'function') {
- var tmp = subscription;
- subscription = new Subscription();
- subscription._subscriptions = [tmp];
- }
- break;
- default:
- throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');
- }
- var subscriptions = this._subscriptions || (this._subscriptions = []);
- subscriptions.push(subscription);
- subscription._addParent(this);
- return subscription;
- };
- Subscription.prototype.remove = function (subscription) {
- var subscriptions = this._subscriptions;
- if (subscriptions) {
- var subscriptionIndex = subscriptions.indexOf(subscription);
- if (subscriptionIndex !== -1) {
- subscriptions.splice(subscriptionIndex, 1);
- }
- }
- };
- Subscription.prototype._addParent = function (parent) {
- var _a = this, _parent = _a._parent, _parents = _a._parents;
- if (!_parent || _parent === parent) {
- this._parent = parent;
- }
- else if (!_parents) {
- this._parents = [parent];
- }
- else if (_parents.indexOf(parent) === -1) {
- _parents.push(parent);
- }
- };
- Subscription.EMPTY = (function (empty) {
- empty.closed = true;
- return empty;
- }(new Subscription()));
- return Subscription;
-}());
-
-function flattenUnsubscriptionErrors(errors) {
- return errors.reduce(function (errs, err) { return errs.concat((err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) ? err.errors : err); }, []);
-}
-//# sourceMappingURL=Subscription.js.map
-
-
-/***/ }),
-/* 26 */
-/***/ (function(module, exports, __webpack_require__) {
-
-// Copyright 2015 Joyent, Inc.
-
-module.exports = {
- bufferSplit: bufferSplit,
- addRSAMissing: addRSAMissing,
- calculateDSAPublic: calculateDSAPublic,
- calculateED25519Public: calculateED25519Public,
- calculateX25519Public: calculateX25519Public,
- mpNormalize: mpNormalize,
- mpDenormalize: mpDenormalize,
- ecNormalize: ecNormalize,
- countZeros: countZeros,
- assertCompatible: assertCompatible,
- isCompatible: isCompatible,
- opensslKeyDeriv: opensslKeyDeriv,
- opensshCipherInfo: opensshCipherInfo,
- publicFromPrivateECDSA: publicFromPrivateECDSA,
- zeroPadToLength: zeroPadToLength,
- writeBitString: writeBitString,
- readBitString: readBitString
-};
-
-var assert = __webpack_require__(16);
-var Buffer = __webpack_require__(15).Buffer;
-var PrivateKey = __webpack_require__(33);
-var Key = __webpack_require__(27);
-var crypto = __webpack_require__(11);
-var algs = __webpack_require__(32);
-var asn1 = __webpack_require__(66);
-
-var ec, jsbn;
-var nacl;
-
-var MAX_CLASS_DEPTH = 3;
-
-function isCompatible(obj, klass, needVer) {
- if (obj === null || typeof (obj) !== 'object')
- return (false);
- if (needVer === undefined)
- needVer = klass.prototype._sshpkApiVersion;
- if (obj instanceof klass &&
- klass.prototype._sshpkApiVersion[0] == needVer[0])
- return (true);
- var proto = Object.getPrototypeOf(obj);
- var depth = 0;
- while (proto.constructor.name !== klass.name) {
- proto = Object.getPrototypeOf(proto);
- if (!proto || ++depth > MAX_CLASS_DEPTH)
- return (false);
- }
- if (proto.constructor.name !== klass.name)
- return (false);
- var ver = proto._sshpkApiVersion;
- if (ver === undefined)
- ver = klass._oldVersionDetect(obj);
- if (ver[0] != needVer[0] || ver[1] < needVer[1])
- return (false);
- return (true);
-}
-
-function assertCompatible(obj, klass, needVer, name) {
- if (name === undefined)
- name = 'object';
- assert.ok(obj, name + ' must not be null');
- assert.object(obj, name + ' must be an object');
- if (needVer === undefined)
- needVer = klass.prototype._sshpkApiVersion;
- if (obj instanceof klass &&
- klass.prototype._sshpkApiVersion[0] == needVer[0])
- return;
- var proto = Object.getPrototypeOf(obj);
- var depth = 0;
- while (proto.constructor.name !== klass.name) {
- proto = Object.getPrototypeOf(proto);
- assert.ok(proto && ++depth <= MAX_CLASS_DEPTH,
- name + ' must be a ' + klass.name + ' instance');
- }
- assert.strictEqual(proto.constructor.name, klass.name,
- name + ' must be a ' + klass.name + ' instance');
- var ver = proto._sshpkApiVersion;
- if (ver === undefined)
- ver = klass._oldVersionDetect(obj);
- assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1],
- name + ' must be compatible with ' + klass.name + ' klass ' +
- 'version ' + needVer[0] + '.' + needVer[1]);
-}
-
-var CIPHER_LEN = {
- 'des-ede3-cbc': { key: 7, iv: 8 },
- 'aes-128-cbc': { key: 16, iv: 16 }
-};
-var PKCS5_SALT_LEN = 8;
-
-function opensslKeyDeriv(cipher, salt, passphrase, count) {
- assert.buffer(salt, 'salt');
- assert.buffer(passphrase, 'passphrase');
- assert.number(count, 'iteration count');
-
- var clen = CIPHER_LEN[cipher];
- assert.object(clen, 'supported cipher');
-
- salt = salt.slice(0, PKCS5_SALT_LEN);
-
- var D, D_prev, bufs;
- var material = Buffer.alloc(0);
- while (material.length < clen.key + clen.iv) {
- bufs = [];
- if (D_prev)
- bufs.push(D_prev);
- bufs.push(passphrase);
- bufs.push(salt);
- D = Buffer.concat(bufs);
- for (var j = 0; j < count; ++j)
- D = crypto.createHash('md5').update(D).digest();
- material = Buffer.concat([material, D]);
- D_prev = D;
- }
-
- return ({
- key: material.slice(0, clen.key),
- iv: material.slice(clen.key, clen.key + clen.iv)
- });
-}
-
-/* Count leading zero bits on a buffer */
-function countZeros(buf) {
- var o = 0, obit = 8;
- while (o < buf.length) {
- var mask = (1 << obit);
- if ((buf[o] & mask) === mask)
- break;
- obit--;
- if (obit < 0) {
- o++;
- obit = 8;
- }
- }
- return (o*8 + (8 - obit) - 1);
-}
-
-function bufferSplit(buf, chr) {
- assert.buffer(buf);
- assert.string(chr);
-
- var parts = [];
- var lastPart = 0;
- var matches = 0;
- for (var i = 0; i < buf.length; ++i) {
- if (buf[i] === chr.charCodeAt(matches))
- ++matches;
- else if (buf[i] === chr.charCodeAt(0))
- matches = 1;
- else
- matches = 0;
-
- if (matches >= chr.length) {
- var newPart = i + 1;
- parts.push(buf.slice(lastPart, newPart - matches));
- lastPart = newPart;
- matches = 0;
- }
- }
- if (lastPart <= buf.length)
- parts.push(buf.slice(lastPart, buf.length));
-
- return (parts);
-}
-
-function ecNormalize(buf, addZero) {
- assert.buffer(buf);
- if (buf[0] === 0x00 && buf[1] === 0x04) {
- if (addZero)
- return (buf);
- return (buf.slice(1));
- } else if (buf[0] === 0x04) {
- if (!addZero)
- return (buf);
- } else {
- while (buf[0] === 0x00)
- buf = buf.slice(1);
- if (buf[0] === 0x02 || buf[0] === 0x03)
- throw (new Error('Compressed elliptic curve points ' +
- 'are not supported'));
- if (buf[0] !== 0x04)
- throw (new Error('Not a valid elliptic curve point'));
- if (!addZero)
- return (buf);
- }
- var b = Buffer.alloc(buf.length + 1);
- b[0] = 0x0;
- buf.copy(b, 1);
- return (b);
-}
-
-function readBitString(der, tag) {
- if (tag === undefined)
- tag = asn1.Ber.BitString;
- var buf = der.readString(tag, true);
- assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' +
- 'not supported (0x' + buf[0].toString(16) + ')');
- return (buf.slice(1));
-}
-
-function writeBitString(der, buf, tag) {
- if (tag === undefined)
- tag = asn1.Ber.BitString;
- var b = Buffer.alloc(buf.length + 1);
- b[0] = 0x00;
- buf.copy(b, 1);
- der.writeBuffer(b, tag);
-}
-
-function mpNormalize(buf) {
- assert.buffer(buf);
- while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00)
- buf = buf.slice(1);
- if ((buf[0] & 0x80) === 0x80) {
- var b = Buffer.alloc(buf.length + 1);
- b[0] = 0x00;
- buf.copy(b, 1);
- buf = b;
- }
- return (buf);
-}
-
-function mpDenormalize(buf) {
- assert.buffer(buf);
- while (buf.length > 1 && buf[0] === 0x00)
- buf = buf.slice(1);
- return (buf);
-}
-
-function zeroPadToLength(buf, len) {
- assert.buffer(buf);
- assert.number(len);
- while (buf.length > len) {
- assert.equal(buf[0], 0x00);
- buf = buf.slice(1);
- }
- while (buf.length < len) {
- var b = Buffer.alloc(buf.length + 1);
- b[0] = 0x00;
- buf.copy(b, 1);
- buf = b;
- }
- return (buf);
-}
-
-function bigintToMpBuf(bigint) {
- var buf = Buffer.from(bigint.toByteArray());
- buf = mpNormalize(buf);
- return (buf);
-}
-
-function calculateDSAPublic(g, p, x) {
- assert.buffer(g);
- assert.buffer(p);
- assert.buffer(x);
- try {
- var bigInt = __webpack_require__(81).BigInteger;
- } catch (e) {
- throw (new Error('To load a PKCS#8 format DSA private key, ' +
- 'the node jsbn library is required.'));
- }
- g = new bigInt(g);
- p = new bigInt(p);
- x = new bigInt(x);
- var y = g.modPow(x, p);
- var ybuf = bigintToMpBuf(y);
- return (ybuf);
-}
-
-function calculateED25519Public(k) {
- assert.buffer(k);
-
- if (nacl === undefined)
- nacl = __webpack_require__(76);
-
- var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k));
- return (Buffer.from(kp.publicKey));
-}
-
-function calculateX25519Public(k) {
- assert.buffer(k);
-
- if (nacl === undefined)
- nacl = __webpack_require__(76);
-
- var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k));
- return (Buffer.from(kp.publicKey));
-}
-
-function addRSAMissing(key) {
- assert.object(key);
- assertCompatible(key, PrivateKey, [1, 1]);
- try {
- var bigInt = __webpack_require__(81).BigInteger;
- } catch (e) {
- throw (new Error('To write a PEM private key from ' +
- 'this source, the node jsbn lib is required.'));
- }
-
- var d = new bigInt(key.part.d.data);
- var buf;
-
- if (!key.part.dmodp) {
- var p = new bigInt(key.part.p.data);
- var dmodp = d.mod(p.subtract(1));
-
- buf = bigintToMpBuf(dmodp);
- key.part.dmodp = {name: 'dmodp', data: buf};
- key.parts.push(key.part.dmodp);
- }
- if (!key.part.dmodq) {
- var q = new bigInt(key.part.q.data);
- var dmodq = d.mod(q.subtract(1));
-
- buf = bigintToMpBuf(dmodq);
- key.part.dmodq = {name: 'dmodq', data: buf};
- key.parts.push(key.part.dmodq);
- }
-}
-
-function publicFromPrivateECDSA(curveName, priv) {
- assert.string(curveName, 'curveName');
- assert.buffer(priv);
- if (ec === undefined)
- ec = __webpack_require__(139);
- if (jsbn === undefined)
- jsbn = __webpack_require__(81).BigInteger;
- var params = algs.curves[curveName];
- var p = new jsbn(params.p);
- var a = new jsbn(params.a);
- var b = new jsbn(params.b);
- var curve = new ec.ECCurveFp(p, a, b);
- var G = curve.decodePointHex(params.G.toString('hex'));
-
- var d = new jsbn(mpNormalize(priv));
- var pub = G.multiply(d);
- pub = Buffer.from(curve.encodePointHex(pub), 'hex');
-
- var parts = [];
- parts.push({name: 'curve', data: Buffer.from(curveName)});
- parts.push({name: 'Q', data: pub});
-
- var key = new Key({type: 'ecdsa', curve: curve, parts: parts});
- return (key);
-}
-
-function opensshCipherInfo(cipher) {
- var inf = {};
- switch (cipher) {
- case '3des-cbc':
- inf.keySize = 24;
- inf.blockSize = 8;
- inf.opensslName = 'des-ede3-cbc';
- break;
- case 'blowfish-cbc':
- inf.keySize = 16;
- inf.blockSize = 8;
- inf.opensslName = 'bf-cbc';
- break;
- case 'aes128-cbc':
- case 'aes128-ctr':
- case 'aes128-gcm@openssh.com':
- inf.keySize = 16;
- inf.blockSize = 16;
- inf.opensslName = 'aes-128-' + cipher.slice(7, 10);
- break;
- case 'aes192-cbc':
- case 'aes192-ctr':
- case 'aes192-gcm@openssh.com':
- inf.keySize = 24;
- inf.blockSize = 16;
- inf.opensslName = 'aes-192-' + cipher.slice(7, 10);
- break;
- case 'aes256-cbc':
- case 'aes256-ctr':
- case 'aes256-gcm@openssh.com':
- inf.keySize = 32;
- inf.blockSize = 16;
- inf.opensslName = 'aes-256-' + cipher.slice(7, 10);
- break;
- default:
- throw (new Error(
- 'Unsupported openssl cipher "' + cipher + '"'));
- }
- return (inf);
-}
-
-
-/***/ }),
-/* 27 */
-/***/ (function(module, exports, __webpack_require__) {
-
-// Copyright 2017 Joyent, Inc.
-
-module.exports = Key;
-
-var assert = __webpack_require__(16);
-var algs = __webpack_require__(32);
-var crypto = __webpack_require__(11);
-var Fingerprint = __webpack_require__(156);
-var Signature = __webpack_require__(75);
-var DiffieHellman = __webpack_require__(325).DiffieHellman;
-var errs = __webpack_require__(74);
-var utils = __webpack_require__(26);
-var PrivateKey = __webpack_require__(33);
-var edCompat;
-
-try {
- edCompat = __webpack_require__(454);
-} catch (e) {
- /* Just continue through, and bail out if we try to use it. */
-}
-
-var InvalidAlgorithmError = errs.InvalidAlgorithmError;
-var KeyParseError = errs.KeyParseError;
-
-var formats = {};
-formats['auto'] = __webpack_require__(455);
-formats['pem'] = __webpack_require__(86);
-formats['pkcs1'] = __webpack_require__(327);
-formats['pkcs8'] = __webpack_require__(157);
-formats['rfc4253'] = __webpack_require__(103);
-formats['ssh'] = __webpack_require__(456);
-formats['ssh-private'] = __webpack_require__(192);
-formats['openssh'] = formats['ssh-private'];
-formats['dnssec'] = __webpack_require__(326);
-
-function Key(opts) {
- assert.object(opts, 'options');
- assert.arrayOfObject(opts.parts, 'options.parts');
- assert.string(opts.type, 'options.type');
- assert.optionalString(opts.comment, 'options.comment');
-
- var algInfo = algs.info[opts.type];
- if (typeof (algInfo) !== 'object')
- throw (new InvalidAlgorithmError(opts.type));
-
- var partLookup = {};
- for (var i = 0; i < opts.parts.length; ++i) {
- var part = opts.parts[i];
- partLookup[part.name] = part;
- }
-
- this.type = opts.type;
- this.parts = opts.parts;
- this.part = partLookup;
- this.comment = undefined;
- this.source = opts.source;
-
- /* for speeding up hashing/fingerprint operations */
- this._rfc4253Cache = opts._rfc4253Cache;
- this._hashCache = {};
-
- var sz;
- this.curve = undefined;
- if (this.type === 'ecdsa') {
- var curve = this.part.curve.data.toString();
- this.curve = curve;
- sz = algs.curves[curve].size;
- } else if (this.type === 'ed25519' || this.type === 'curve25519') {
- sz = 256;
- this.curve = 'curve25519';
- } else {
- var szPart = this.part[algInfo.sizePart];
- sz = szPart.data.length;
- sz = sz * 8 - utils.countZeros(szPart.data);
- }
- this.size = sz;
-}
-
-Key.formats = formats;
-
-Key.prototype.toBuffer = function (format, options) {
- if (format === undefined)
- format = 'ssh';
- assert.string(format, 'format');
- assert.object(formats[format], 'formats[format]');
- assert.optionalObject(options, 'options');
-
- if (format === 'rfc4253') {
- if (this._rfc4253Cache === undefined)
- this._rfc4253Cache = formats['rfc4253'].write(this);
- return (this._rfc4253Cache);
- }
-
- return (formats[format].write(this, options));
-};
-
-Key.prototype.toString = function (format, options) {
- return (this.toBuffer(format, options).toString());
-};
-
-Key.prototype.hash = function (algo) {
- assert.string(algo, 'algorithm');
- algo = algo.toLowerCase();
- if (algs.hashAlgs[algo] === undefined)
- throw (new InvalidAlgorithmError(algo));
-
- if (this._hashCache[algo])
- return (this._hashCache[algo]);
- var hash = crypto.createHash(algo).
- update(this.toBuffer('rfc4253')).digest();
- this._hashCache[algo] = hash;
- return (hash);
-};
-
-Key.prototype.fingerprint = function (algo) {
- if (algo === undefined)
- algo = 'sha256';
- assert.string(algo, 'algorithm');
- var opts = {
- type: 'key',
- hash: this.hash(algo),
- algorithm: algo
- };
- return (new Fingerprint(opts));
-};
-
-Key.prototype.defaultHashAlgorithm = function () {
- var hashAlgo = 'sha1';
- if (this.type === 'rsa')
- hashAlgo = 'sha256';
- if (this.type === 'dsa' && this.size > 1024)
- hashAlgo = 'sha256';
- if (this.type === 'ed25519')
- hashAlgo = 'sha512';
- if (this.type === 'ecdsa') {
- if (this.size <= 256)
- hashAlgo = 'sha256';
- else if (this.size <= 384)
- hashAlgo = 'sha384';
- else
- hashAlgo = 'sha512';
- }
- return (hashAlgo);
-};
-
-Key.prototype.createVerify = function (hashAlgo) {
- if (hashAlgo === undefined)
- hashAlgo = this.defaultHashAlgorithm();
- assert.string(hashAlgo, 'hash algorithm');
-
- /* ED25519 is not supported by OpenSSL, use a javascript impl. */
- if (this.type === 'ed25519' && edCompat !== undefined)
- return (new edCompat.Verifier(this, hashAlgo));
- if (this.type === 'curve25519')
- throw (new Error('Curve25519 keys are not suitable for ' +
- 'signing or verification'));
-
- var v, nm, err;
- try {
- nm = hashAlgo.toUpperCase();
- v = crypto.createVerify(nm);
- } catch (e) {
- err = e;
- }
- if (v === undefined || (err instanceof Error &&
- err.message.match(/Unknown message digest/))) {
- nm = 'RSA-';
- nm += hashAlgo.toUpperCase();
- v = crypto.createVerify(nm);
- }
- assert.ok(v, 'failed to create verifier');
- var oldVerify = v.verify.bind(v);
- var key = this.toBuffer('pkcs8');
- var curve = this.curve;
- var self = this;
- v.verify = function (signature, fmt) {
- if (Signature.isSignature(signature, [2, 0])) {
- if (signature.type !== self.type)
- return (false);
- if (signature.hashAlgorithm &&
- signature.hashAlgorithm !== hashAlgo)
- return (false);
- if (signature.curve && self.type === 'ecdsa' &&
- signature.curve !== curve)
- return (false);
- return (oldVerify(key, signature.toBuffer('asn1')));
-
- } else if (typeof (signature) === 'string' ||
- Buffer.isBuffer(signature)) {
- return (oldVerify(key, signature, fmt));
-
- /*
- * Avoid doing this on valid arguments, walking the prototype
- * chain can be quite slow.
- */
- } else if (Signature.isSignature(signature, [1, 0])) {
- throw (new Error('signature was created by too old ' +
- 'a version of sshpk and cannot be verified'));
-
- } else {
- throw (new TypeError('signature must be a string, ' +
- 'Buffer, or Signature object'));
- }
- };
- return (v);
-};
-
-Key.prototype.createDiffieHellman = function () {
- if (this.type === 'rsa')
- throw (new Error('RSA keys do not support Diffie-Hellman'));
-
- return (new DiffieHellman(this));
-};
-Key.prototype.createDH = Key.prototype.createDiffieHellman;
-
-Key.parse = function (data, format, options) {
- if (typeof (data) !== 'string')
- assert.buffer(data, 'data');
- if (format === undefined)
- format = 'auto';
- assert.string(format, 'format');
- if (typeof (options) === 'string')
- options = { filename: options };
- assert.optionalObject(options, 'options');
- if (options === undefined)
- options = {};
- assert.optionalString(options.filename, 'options.filename');
- if (options.filename === undefined)
- options.filename = '(unnamed)';
-
- assert.object(formats[format], 'formats[format]');
-
- try {
- var k = formats[format].read(data, options);
- if (k instanceof PrivateKey)
- k = k.toPublic();
- if (!k.comment)
- k.comment = options.filename;
- return (k);
- } catch (e) {
- if (e.name === 'KeyEncryptedError')
- throw (e);
- throw (new KeyParseError(options.filename, format, e));
- }
-};
-
-Key.isKey = function (obj, ver) {
- return (utils.isCompatible(obj, Key, ver));
-};
-
-/*
- * API versions for Key:
- * [1,0] -- initial ver, may take Signature for createVerify or may not
- * [1,1] -- added pkcs1, pkcs8 formats
- * [1,2] -- added auto, ssh-private, openssh formats
- * [1,3] -- added defaultHashAlgorithm
- * [1,4] -- added ed support, createDH
- * [1,5] -- first explicitly tagged version
- * [1,6] -- changed ed25519 part names
- */
-Key.prototype._sshpkApiVersion = [1, 6];
-
-Key._oldVersionDetect = function (obj) {
- assert.func(obj.toBuffer);
- assert.func(obj.fingerprint);
- if (obj.createDH)
- return ([1, 4]);
- if (obj.defaultHashAlgorithm)
- return ([1, 3]);
- if (obj.formats['auto'])
- return ([1, 2]);
- if (obj.formats['pkcs1'])
- return ([1, 1]);
- return ([1, 0]);
-};
-
-
-/***/ }),
-/* 28 */
-/***/ (function(module, exports) {
-
-module.exports = require("assert");
-
-/***/ }),
-/* 29 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.default = nullify;
-function nullify(obj = {}) {
- if (Array.isArray(obj)) {
- for (var _iterator = obj, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
- var _ref;
-
- if (_isArray) {
- if (_i >= _iterator.length) break;
- _ref = _iterator[_i++];
- } else {
- _i = _iterator.next();
- if (_i.done) break;
- _ref = _i.value;
- }
-
- const item = _ref;
-
- nullify(item);
- }
- } else if (obj !== null && typeof obj === 'object' || typeof obj === 'function') {
- Object.setPrototypeOf(obj, null);
-
- // for..in can only be applied to 'object', not 'function'
- if (typeof obj === 'object') {
- for (const key in obj) {
- nullify(obj[key]);
- }
- }
- }
-
- return obj;
-}
-
-/***/ }),
-/* 30 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-const escapeStringRegexp = __webpack_require__(388);
-const ansiStyles = __webpack_require__(506);
-const stdoutColor = __webpack_require__(598).stdout;
-
-const template = __webpack_require__(599);
-
-const isSimpleWindowsTerm = process.platform === 'win32' && !(process.env.TERM || '').toLowerCase().startsWith('xterm');
-
-// `supportsColor.level` → `ansiStyles.color[name]` mapping
-const levelMapping = ['ansi', 'ansi', 'ansi256', 'ansi16m'];
-
-// `color-convert` models to exclude from the Chalk API due to conflicts and such
-const skipModels = new Set(['gray']);
-
-const styles = Object.create(null);
-
-function applyOptions(obj, options) {
- options = options || {};
-
- // Detect level if not set manually
- const scLevel = stdoutColor ? stdoutColor.level : 0;
- obj.level = options.level === undefined ? scLevel : options.level;
- obj.enabled = 'enabled' in options ? options.enabled : obj.level > 0;
-}
-
-function Chalk(options) {
- // We check for this.template here since calling `chalk.constructor()`
- // by itself will have a `this` of a previously constructed chalk object
- if (!this || !(this instanceof Chalk) || this.template) {
- const chalk = {};
- applyOptions(chalk, options);
-
- chalk.template = function () {
- const args = [].slice.call(arguments);
- return chalkTag.apply(null, [chalk.template].concat(args));
- };
-
- Object.setPrototypeOf(chalk, Chalk.prototype);
- Object.setPrototypeOf(chalk.template, chalk);
-
- chalk.template.constructor = Chalk;
-
- return chalk.template;
- }
-
- applyOptions(this, options);
-}
-
-// Use bright blue on Windows as the normal blue color is illegible
-if (isSimpleWindowsTerm) {
- ansiStyles.blue.open = '\u001B[94m';
-}
-
-for (const key of Object.keys(ansiStyles)) {
- ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g');
-
- styles[key] = {
- get() {
- const codes = ansiStyles[key];
- return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, key);
- }
- };
-}
-
-styles.visible = {
- get() {
- return build.call(this, this._styles || [], true, 'visible');
- }
-};
-
-ansiStyles.color.closeRe = new RegExp(escapeStringRegexp(ansiStyles.color.close), 'g');
-for (const model of Object.keys(ansiStyles.color.ansi)) {
- if (skipModels.has(model)) {
- continue;
- }
-
- styles[model] = {
- get() {
- const level = this.level;
- return function () {
- const open = ansiStyles.color[levelMapping[level]][model].apply(null, arguments);
- const codes = {
- open,
- close: ansiStyles.color.close,
- closeRe: ansiStyles.color.closeRe
- };
- return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model);
- };
- }
- };
-}
-
-ansiStyles.bgColor.closeRe = new RegExp(escapeStringRegexp(ansiStyles.bgColor.close), 'g');
-for (const model of Object.keys(ansiStyles.bgColor.ansi)) {
- if (skipModels.has(model)) {
- continue;
- }
-
- const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1);
- styles[bgModel] = {
- get() {
- const level = this.level;
- return function () {
- const open = ansiStyles.bgColor[levelMapping[level]][model].apply(null, arguments);
- const codes = {
- open,
- close: ansiStyles.bgColor.close,
- closeRe: ansiStyles.bgColor.closeRe
- };
- return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model);
- };
- }
- };
-}
-
-const proto = Object.defineProperties(() => {}, styles);
-
-function build(_styles, _empty, key) {
- const builder = function () {
- return applyStyle.apply(builder, arguments);
- };
-
- builder._styles = _styles;
- builder._empty = _empty;
-
- const self = this;
-
- Object.defineProperty(builder, 'level', {
- enumerable: true,
- get() {
- return self.level;
- },
- set(level) {
- self.level = level;
- }
- });
-
- Object.defineProperty(builder, 'enabled', {
- enumerable: true,
- get() {
- return self.enabled;
- },
- set(enabled) {
- self.enabled = enabled;
- }
- });
-
- // See below for fix regarding invisible grey/dim combination on Windows
- builder.hasGrey = this.hasGrey || key === 'gray' || key === 'grey';
-
- // `__proto__` is used because we must return a function, but there is
- // no way to create a function with a different prototype
- builder.__proto__ = proto; // eslint-disable-line no-proto
-
- return builder;
-}
-
-function applyStyle() {
- // Support varags, but simply cast to string in case there's only one arg
- const args = arguments;
- const argsLen = args.length;
- let str = String(arguments[0]);
-
- if (argsLen === 0) {
- return '';
- }
-
- if (argsLen > 1) {
- // Don't slice `arguments`, it prevents V8 optimizations
- for (let a = 1; a < argsLen; a++) {
- str += ' ' + args[a];
- }
- }
-
- if (!this.enabled || this.level <= 0 || !str) {
- return this._empty ? '' : str;
- }
-
- // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe,
- // see https://github.com/chalk/chalk/issues/58
- // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop.
- const originalDim = ansiStyles.dim.open;
- if (isSimpleWindowsTerm && this.hasGrey) {
- ansiStyles.dim.open = '';
- }
-
- for (const code of this._styles.slice().reverse()) {
- // Replace any instances already present with a re-opening code
- // otherwise only the part of the string until said closing code
- // will be colored, and the rest will simply be 'plain'.
- str = code.open + str.replace(code.closeRe, code.open) + code.close;
-
- // Close the styling before a linebreak and reopen
- // after next line to fix a bleed issue on macOS
- // https://github.com/chalk/chalk/pull/92
- str = str.replace(/\r?\n/g, `${code.close}$&${code.open}`);
- }
-
- // Reset the original `dim` if we changed it to work around the Windows dimmed gray issue
- ansiStyles.dim.open = originalDim;
-
- return str;
-}
-
-function chalkTag(chalk, strings) {
- if (!Array.isArray(strings)) {
- // If chalk() was called by itself or with a string,
- // return the string itself as a string.
- return [].slice.call(arguments, 1).join(' ');
- }
-
- const args = [].slice.call(arguments, 2);
- const parts = [strings.raw[0]];
-
- for (let i = 1; i < strings.length; i++) {
- parts.push(String(args[i - 1]).replace(/[{}\\]/g, '\\$&'));
- parts.push(String(strings.raw[i]));
- }
-
- return template(chalk, parts.join(''));
-}
-
-Object.defineProperties(Chalk.prototype, styles);
-
-module.exports = Chalk(); // eslint-disable-line new-cap
-module.exports.supportsColor = stdoutColor;
-module.exports.default = module.exports; // For TypeScript
-
-
-/***/ }),
-/* 31 */
-/***/ (function(module, exports) {
-
-var core = module.exports = { version: '2.5.7' };
-if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef
-
-
-/***/ }),
-/* 32 */
-/***/ (function(module, exports, __webpack_require__) {
-
-// Copyright 2015 Joyent, Inc.
-
-var Buffer = __webpack_require__(15).Buffer;
-
-var algInfo = {
- 'dsa': {
- parts: ['p', 'q', 'g', 'y'],
- sizePart: 'p'
- },
- 'rsa': {
- parts: ['e', 'n'],
- sizePart: 'n'
- },
- 'ecdsa': {
- parts: ['curve', 'Q'],
- sizePart: 'Q'
- },
- 'ed25519': {
- parts: ['A'],
- sizePart: 'A'
- }
-};
-algInfo['curve25519'] = algInfo['ed25519'];
-
-var algPrivInfo = {
- 'dsa': {
- parts: ['p', 'q', 'g', 'y', 'x']
- },
- 'rsa': {
- parts: ['n', 'e', 'd', 'iqmp', 'p', 'q']
- },
- 'ecdsa': {
- parts: ['curve', 'Q', 'd']
- },
- 'ed25519': {
- parts: ['A', 'k']
- }
-};
-algPrivInfo['curve25519'] = algPrivInfo['ed25519'];
-
-var hashAlgs = {
- 'md5': true,
- 'sha1': true,
- 'sha256': true,
- 'sha384': true,
- 'sha512': true
-};
-
-/*
- * Taken from
- * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf
- */
-var curves = {
- 'nistp256': {
- size: 256,
- pkcs8oid: '1.2.840.10045.3.1.7',
- p: Buffer.from(('00' +
- 'ffffffff 00000001 00000000 00000000' +
- '00000000 ffffffff ffffffff ffffffff').
- replace(/ /g, ''), 'hex'),
- a: Buffer.from(('00' +
- 'FFFFFFFF 00000001 00000000 00000000' +
- '00000000 FFFFFFFF FFFFFFFF FFFFFFFC').
- replace(/ /g, ''), 'hex'),
- b: Buffer.from((
- '5ac635d8 aa3a93e7 b3ebbd55 769886bc' +
- '651d06b0 cc53b0f6 3bce3c3e 27d2604b').
- replace(/ /g, ''), 'hex'),
- s: Buffer.from(('00' +
- 'c49d3608 86e70493 6a6678e1 139d26b7' +
- '819f7e90').
- replace(/ /g, ''), 'hex'),
- n: Buffer.from(('00' +
- 'ffffffff 00000000 ffffffff ffffffff' +
- 'bce6faad a7179e84 f3b9cac2 fc632551').
- replace(/ /g, ''), 'hex'),
- G: Buffer.from(('04' +
- '6b17d1f2 e12c4247 f8bce6e5 63a440f2' +
- '77037d81 2deb33a0 f4a13945 d898c296' +
- '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' +
- '2bce3357 6b315ece cbb64068 37bf51f5').
- replace(/ /g, ''), 'hex')
- },
- 'nistp384': {
- size: 384,
- pkcs8oid: '1.3.132.0.34',
- p: Buffer.from(('00' +
- 'ffffffff ffffffff ffffffff ffffffff' +
- 'ffffffff ffffffff ffffffff fffffffe' +
- 'ffffffff 00000000 00000000 ffffffff').
- replace(/ /g, ''), 'hex'),
- a: Buffer.from(('00' +
- 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
- 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' +
- 'FFFFFFFF 00000000 00000000 FFFFFFFC').
- replace(/ /g, ''), 'hex'),
- b: Buffer.from((
- 'b3312fa7 e23ee7e4 988e056b e3f82d19' +
- '181d9c6e fe814112 0314088f 5013875a' +
- 'c656398d 8a2ed19d 2a85c8ed d3ec2aef').
- replace(/ /g, ''), 'hex'),
- s: Buffer.from(('00' +
- 'a335926a a319a27a 1d00896a 6773a482' +
- '7acdac73').
- replace(/ /g, ''), 'hex'),
- n: Buffer.from(('00' +
- 'ffffffff ffffffff ffffffff ffffffff' +
- 'ffffffff ffffffff c7634d81 f4372ddf' +
- '581a0db2 48b0a77a ecec196a ccc52973').
- replace(/ /g, ''), 'hex'),
- G: Buffer.from(('04' +
- 'aa87ca22 be8b0537 8eb1c71e f320ad74' +
- '6e1d3b62 8ba79b98 59f741e0 82542a38' +
- '5502f25d bf55296c 3a545e38 72760ab7' +
- '3617de4a 96262c6f 5d9e98bf 9292dc29' +
- 'f8f41dbd 289a147c e9da3113 b5f0b8c0' +
- '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f').
- replace(/ /g, ''), 'hex')
- },
- 'nistp521': {
- size: 521,
- pkcs8oid: '1.3.132.0.35',
- p: Buffer.from((
- '01ffffff ffffffff ffffffff ffffffff' +
- 'ffffffff ffffffff ffffffff ffffffff' +
- 'ffffffff ffffffff ffffffff ffffffff' +
- 'ffffffff ffffffff ffffffff ffffffff' +
- 'ffff').replace(/ /g, ''), 'hex'),
- a: Buffer.from(('01FF' +
- 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
- 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
- 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
- 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC').
- replace(/ /g, ''), 'hex'),
- b: Buffer.from(('51' +
- '953eb961 8e1c9a1f 929a21a0 b68540ee' +
- 'a2da725b 99b315f3 b8b48991 8ef109e1' +
- '56193951 ec7e937b 1652c0bd 3bb1bf07' +
- '3573df88 3d2c34f1 ef451fd4 6b503f00').
- replace(/ /g, ''), 'hex'),
- s: Buffer.from(('00' +
- 'd09e8800 291cb853 96cc6717 393284aa' +
- 'a0da64ba').replace(/ /g, ''), 'hex'),
- n: Buffer.from(('01ff' +
- 'ffffffff ffffffff ffffffff ffffffff' +
- 'ffffffff ffffffff ffffffff fffffffa' +
- '51868783 bf2f966b 7fcc0148 f709a5d0' +
- '3bb5c9b8 899c47ae bb6fb71e 91386409').
- replace(/ /g, ''), 'hex'),
- G: Buffer.from(('04' +
- '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' +
- '9c648139 053fb521 f828af60 6b4d3dba' +
- 'a14b5e77 efe75928 fe1dc127 a2ffa8de' +
- '3348b3c1 856a429b f97e7e31 c2e5bd66' +
- '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' +
- '98f54449 579b4468 17afbd17 273e662c' +
- '97ee7299 5ef42640 c550b901 3fad0761' +
- '353c7086 a272c240 88be9476 9fd16650').
- replace(/ /g, ''), 'hex')
- }
-};
-
-module.exports = {
- info: algInfo,
- privInfo: algPrivInfo,
- hashAlgs: hashAlgs,
- curves: curves
-};
-
-
-/***/ }),
-/* 33 */
-/***/ (function(module, exports, __webpack_require__) {
-
-// Copyright 2017 Joyent, Inc.
-
-module.exports = PrivateKey;
-
-var assert = __webpack_require__(16);
-var Buffer = __webpack_require__(15).Buffer;
-var algs = __webpack_require__(32);
-var crypto = __webpack_require__(11);
-var Fingerprint = __webpack_require__(156);
-var Signature = __webpack_require__(75);
-var errs = __webpack_require__(74);
-var util = __webpack_require__(3);
-var utils = __webpack_require__(26);
-var dhe = __webpack_require__(325);
-var generateECDSA = dhe.generateECDSA;
-var generateED25519 = dhe.generateED25519;
-var edCompat;
-var nacl;
-
-try {
- edCompat = __webpack_require__(454);
-} catch (e) {
- /* Just continue through, and bail out if we try to use it. */
-}
-
-var Key = __webpack_require__(27);
-
-var InvalidAlgorithmError = errs.InvalidAlgorithmError;
-var KeyParseError = errs.KeyParseError;
-var KeyEncryptedError = errs.KeyEncryptedError;
-
-var formats = {};
-formats['auto'] = __webpack_require__(455);
-formats['pem'] = __webpack_require__(86);
-formats['pkcs1'] = __webpack_require__(327);
-formats['pkcs8'] = __webpack_require__(157);
-formats['rfc4253'] = __webpack_require__(103);
-formats['ssh-private'] = __webpack_require__(192);
-formats['openssh'] = formats['ssh-private'];
-formats['ssh'] = formats['ssh-private'];
-formats['dnssec'] = __webpack_require__(326);
-
-function PrivateKey(opts) {
- assert.object(opts, 'options');
- Key.call(this, opts);
-
- this._pubCache = undefined;
-}
-util.inherits(PrivateKey, Key);
-
-PrivateKey.formats = formats;
-
-PrivateKey.prototype.toBuffer = function (format, options) {
- if (format === undefined)
- format = 'pkcs1';
- assert.string(format, 'format');
- assert.object(formats[format], 'formats[format]');
- assert.optionalObject(options, 'options');
-
- return (formats[format].write(this, options));
-};
-
-PrivateKey.prototype.hash = function (algo) {
- return (this.toPublic().hash(algo));
-};
-
-PrivateKey.prototype.toPublic = function () {
- if (this._pubCache)
- return (this._pubCache);
-
- var algInfo = algs.info[this.type];
- var pubParts = [];
- for (var i = 0; i < algInfo.parts.length; ++i) {
- var p = algInfo.parts[i];
- pubParts.push(this.part[p]);
- }
-
- this._pubCache = new Key({
- type: this.type,
- source: this,
- parts: pubParts
- });
- if (this.comment)
- this._pubCache.comment = this.comment;
- return (this._pubCache);
-};
-
-PrivateKey.prototype.derive = function (newType) {
- assert.string(newType, 'type');
- var priv, pub, pair;
-
- if (this.type === 'ed25519' && newType === 'curve25519') {
- if (nacl === undefined)
- nacl = __webpack_require__(76);
-
- priv = this.part.k.data;
- if (priv[0] === 0x00)
- priv = priv.slice(1);
-
- pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv));
- pub = Buffer.from(pair.publicKey);
-
- return (new PrivateKey({
- type: 'curve25519',
- parts: [
- { name: 'A', data: utils.mpNormalize(pub) },
- { name: 'k', data: utils.mpNormalize(priv) }
- ]
- }));
- } else if (this.type === 'curve25519' && newType === 'ed25519') {
- if (nacl === undefined)
- nacl = __webpack_require__(76);
-
- priv = this.part.k.data;
- if (priv[0] === 0x00)
- priv = priv.slice(1);
-
- pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv));
- pub = Buffer.from(pair.publicKey);
-
- return (new PrivateKey({
- type: 'ed25519',
- parts: [
- { name: 'A', data: utils.mpNormalize(pub) },
- { name: 'k', data: utils.mpNormalize(priv) }
- ]
- }));
- }
- throw (new Error('Key derivation not supported from ' + this.type +
- ' to ' + newType));
-};
-
-PrivateKey.prototype.createVerify = function (hashAlgo) {
- return (this.toPublic().createVerify(hashAlgo));
-};
-
-PrivateKey.prototype.createSign = function (hashAlgo) {
- if (hashAlgo === undefined)
- hashAlgo = this.defaultHashAlgorithm();
- assert.string(hashAlgo, 'hash algorithm');
-
- /* ED25519 is not supported by OpenSSL, use a javascript impl. */
- if (this.type === 'ed25519' && edCompat !== undefined)
- return (new edCompat.Signer(this, hashAlgo));
- if (this.type === 'curve25519')
- throw (new Error('Curve25519 keys are not suitable for ' +
- 'signing or verification'));
-
- var v, nm, err;
- try {
- nm = hashAlgo.toUpperCase();
- v = crypto.createSign(nm);
- } catch (e) {
- err = e;
- }
- if (v === undefined || (err instanceof Error &&
- err.message.match(/Unknown message digest/))) {
- nm = 'RSA-';
- nm += hashAlgo.toUpperCase();
- v = crypto.createSign(nm);
- }
- assert.ok(v, 'failed to create verifier');
- var oldSign = v.sign.bind(v);
- var key = this.toBuffer('pkcs1');
- var type = this.type;
- var curve = this.curve;
- v.sign = function () {
- var sig = oldSign(key);
- if (typeof (sig) === 'string')
- sig = Buffer.from(sig, 'binary');
- sig = Signature.parse(sig, type, 'asn1');
- sig.hashAlgorithm = hashAlgo;
- sig.curve = curve;
- return (sig);
- };
- return (v);
-};
-
-PrivateKey.parse = function (data, format, options) {
- if (typeof (data) !== 'string')
- assert.buffer(data, 'data');
- if (format === undefined)
- format = 'auto';
- assert.string(format, 'format');
- if (typeof (options) === 'string')
- options = { filename: options };
- assert.optionalObject(options, 'options');
- if (options === undefined)
- options = {};
- assert.optionalString(options.filename, 'options.filename');
- if (options.filename === undefined)
- options.filename = '(unnamed)';
-
- assert.object(formats[format], 'formats[format]');
-
- try {
- var k = formats[format].read(data, options);
- assert.ok(k instanceof PrivateKey, 'key is not a private key');
- if (!k.comment)
- k.comment = options.filename;
- return (k);
- } catch (e) {
- if (e.name === 'KeyEncryptedError')
- throw (e);
- throw (new KeyParseError(options.filename, format, e));
- }
-};
-
-PrivateKey.isPrivateKey = function (obj, ver) {
- return (utils.isCompatible(obj, PrivateKey, ver));
-};
-
-PrivateKey.generate = function (type, options) {
- if (options === undefined)
- options = {};
- assert.object(options, 'options');
-
- switch (type) {
- case 'ecdsa':
- if (options.curve === undefined)
- options.curve = 'nistp256';
- assert.string(options.curve, 'options.curve');
- return (generateECDSA(options.curve));
- case 'ed25519':
- return (generateED25519());
- default:
- throw (new Error('Key generation not supported with key ' +
- 'type "' + type + '"'));
- }
-};
-
-/*
- * API versions for PrivateKey:
- * [1,0] -- initial ver
- * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats
- * [1,2] -- added defaultHashAlgorithm
- * [1,3] -- added derive, ed, createDH
- * [1,4] -- first tagged version
- * [1,5] -- changed ed25519 part names and format
- */
-PrivateKey.prototype._sshpkApiVersion = [1, 5];
-
-PrivateKey._oldVersionDetect = function (obj) {
- assert.func(obj.toPublic);
- assert.func(obj.createSign);
- if (obj.derive)
- return ([1, 3]);
- if (obj.defaultHashAlgorithm)
- return ([1, 2]);
- if (obj.formats['auto'])
- return ([1, 1]);
- return ([1, 0]);
-};
-
-
-/***/ }),
-/* 34 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefined;
-
-var _extends2;
-
-function _load_extends() {
- return _extends2 = _interopRequireDefault(__webpack_require__(21));
-}
-
-var _asyncToGenerator2;
-
-function _load_asyncToGenerator() {
- return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2));
-}
-
-let install = exports.install = (() => {
- var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, lockfile) {
- yield wrapLifecycle(config, flags, (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const install = new Install(flags, config, reporter, lockfile);
- yield install.init();
- }));
- });
-
- return function install(_x7, _x8, _x9, _x10) {
- return _ref29.apply(this, arguments);
- };
-})();
-
-let run = exports.run = (() => {
- var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, args) {
- let lockfile;
- let error = 'installCommandRenamed';
- if (flags.lockfile === false) {
- lockfile = new (_lockfile || _load_lockfile()).default();
- } else {
- lockfile = yield (_lockfile || _load_lockfile()).default.fromDirectory(config.lockfileFolder, reporter);
- }
-
- if (args.length) {
- const exampleArgs = args.slice();
-
- if (flags.saveDev) {
- exampleArgs.push('--dev');
- }
- if (flags.savePeer) {
- exampleArgs.push('--peer');
- }
- if (flags.saveOptional) {
- exampleArgs.push('--optional');
- }
- if (flags.saveExact) {
- exampleArgs.push('--exact');
- }
- if (flags.saveTilde) {
- exampleArgs.push('--tilde');
- }
- let command = 'add';
- if (flags.global) {
- error = 'globalFlagRemoved';
- command = 'global add';
- }
- throw new (_errors || _load_errors()).MessageError(reporter.lang(error, `yarn ${command} ${exampleArgs.join(' ')}`));
- }
-
- yield install(config, reporter, flags, lockfile);
- });
-
- return function run(_x11, _x12, _x13, _x14) {
- return _ref31.apply(this, arguments);
- };
-})();
-
-let wrapLifecycle = exports.wrapLifecycle = (() => {
- var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, flags, factory) {
- yield config.executeLifecycleScript('preinstall');
-
- yield factory();
-
- // npm behaviour, seems kinda funky but yay compatibility
- yield config.executeLifecycleScript('install');
- yield config.executeLifecycleScript('postinstall');
-
- if (!config.production) {
- if (!config.disablePrepublish) {
- yield config.executeLifecycleScript('prepublish');
- }
- yield config.executeLifecycleScript('prepare');
- }
- });
-
- return function wrapLifecycle(_x15, _x16, _x17) {
- return _ref32.apply(this, arguments);
- };
-})();
-
-exports.hasWrapper = hasWrapper;
-exports.setFlags = setFlags;
-
-var _objectPath;
-
-function _load_objectPath() {
- return _objectPath = _interopRequireDefault(__webpack_require__(304));
-}
-
-var _hooks;
-
-function _load_hooks() {
- return _hooks = __webpack_require__(374);
-}
-
-var _index;
-
-function _load_index() {
- return _index = _interopRequireDefault(__webpack_require__(220));
-}
-
-var _errors;
-
-function _load_errors() {
- return _errors = __webpack_require__(6);
-}
-
-var _integrityChecker;
-
-function _load_integrityChecker() {
- return _integrityChecker = _interopRequireDefault(__webpack_require__(208));
-}
-
-var _lockfile;
-
-function _load_lockfile() {
- return _lockfile = _interopRequireDefault(__webpack_require__(19));
-}
-
-var _lockfile2;
-
-function _load_lockfile2() {
- return _lockfile2 = __webpack_require__(19);
-}
-
-var _packageFetcher;
-
-function _load_packageFetcher() {
- return _packageFetcher = _interopRequireWildcard(__webpack_require__(210));
-}
-
-var _packageInstallScripts;
-
-function _load_packageInstallScripts() {
- return _packageInstallScripts = _interopRequireDefault(__webpack_require__(557));
-}
-
-var _packageCompatibility;
-
-function _load_packageCompatibility() {
- return _packageCompatibility = _interopRequireWildcard(__webpack_require__(209));
-}
-
-var _packageResolver;
-
-function _load_packageResolver() {
- return _packageResolver = _interopRequireDefault(__webpack_require__(366));
-}
-
-var _packageLinker;
-
-function _load_packageLinker() {
- return _packageLinker = _interopRequireDefault(__webpack_require__(211));
-}
-
-var _index2;
-
-function _load_index2() {
- return _index2 = __webpack_require__(57);
-}
-
-var _index3;
-
-function _load_index3() {
- return _index3 = __webpack_require__(78);
-}
-
-var _autoclean;
-
-function _load_autoclean() {
- return _autoclean = __webpack_require__(354);
-}
-
-var _constants;
-
-function _load_constants() {
- return _constants = _interopRequireWildcard(__webpack_require__(8));
-}
-
-var _normalizePattern;
-
-function _load_normalizePattern() {
- return _normalizePattern = __webpack_require__(37);
-}
-
-var _fs;
-
-function _load_fs() {
- return _fs = _interopRequireWildcard(__webpack_require__(4));
-}
-
-var _map;
-
-function _load_map() {
- return _map = _interopRequireDefault(__webpack_require__(29));
-}
-
-var _yarnVersion;
-
-function _load_yarnVersion() {
- return _yarnVersion = __webpack_require__(120);
-}
-
-var _generatePnpMap;
-
-function _load_generatePnpMap() {
- return _generatePnpMap = __webpack_require__(579);
-}
-
-var _workspaceLayout;
-
-function _load_workspaceLayout() {
- return _workspaceLayout = _interopRequireDefault(__webpack_require__(90));
-}
-
-var _resolutionMap;
-
-function _load_resolutionMap() {
- return _resolutionMap = _interopRequireDefault(__webpack_require__(214));
-}
-
-var _guessName;
-
-function _load_guessName() {
- return _guessName = _interopRequireDefault(__webpack_require__(169));
-}
-
-var _audit;
-
-function _load_audit() {
- return _audit = _interopRequireDefault(__webpack_require__(353));
-}
-
-function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } }
-
-function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
-
-const deepEqual = __webpack_require__(631);
-
-const emoji = __webpack_require__(302);
-const invariant = __webpack_require__(9);
-const path = __webpack_require__(0);
-const semver = __webpack_require__(22);
-const uuid = __webpack_require__(119);
-const ssri = __webpack_require__(65);
-
-const ONE_DAY = 1000 * 60 * 60 * 24;
-
-/**
- * Try and detect the installation method for Yarn and provide a command to update it with.
- */
-
-function getUpdateCommand(installationMethod) {
- if (installationMethod === 'tar') {
- return `curl --compressed -o- -L ${(_constants || _load_constants()).YARN_INSTALLER_SH} | bash`;
- }
-
- if (installationMethod === 'homebrew') {
- return 'brew upgrade yarn';
- }
-
- if (installationMethod === 'deb') {
- return 'sudo apt-get update && sudo apt-get install yarn';
- }
-
- if (installationMethod === 'rpm') {
- return 'sudo yum install yarn';
- }
-
- if (installationMethod === 'npm') {
- return 'npm install --global yarn';
- }
-
- if (installationMethod === 'chocolatey') {
- return 'choco upgrade yarn';
- }
-
- if (installationMethod === 'apk') {
- return 'apk update && apk add -u yarn';
- }
-
- if (installationMethod === 'portage') {
- return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn';
- }
-
- return null;
-}
-
-function getUpdateInstaller(installationMethod) {
- // Windows
- if (installationMethod === 'msi') {
- return (_constants || _load_constants()).YARN_INSTALLER_MSI;
- }
-
- return null;
-}
-
-function normalizeFlags(config, rawFlags) {
- const flags = {
- // install
- har: !!rawFlags.har,
- ignorePlatform: !!rawFlags.ignorePlatform,
- ignoreEngines: !!rawFlags.ignoreEngines,
- ignoreScripts: !!rawFlags.ignoreScripts,
- ignoreOptional: !!rawFlags.ignoreOptional,
- force: !!rawFlags.force,
- flat: !!rawFlags.flat,
- lockfile: rawFlags.lockfile !== false,
- pureLockfile: !!rawFlags.pureLockfile,
- updateChecksums: !!rawFlags.updateChecksums,
- skipIntegrityCheck: !!rawFlags.skipIntegrityCheck,
- frozenLockfile: !!rawFlags.frozenLockfile,
- linkDuplicates: !!rawFlags.linkDuplicates,
- checkFiles: !!rawFlags.checkFiles,
- audit: !!rawFlags.audit,
-
- // add
- peer: !!rawFlags.peer,
- dev: !!rawFlags.dev,
- optional: !!rawFlags.optional,
- exact: !!rawFlags.exact,
- tilde: !!rawFlags.tilde,
- ignoreWorkspaceRootCheck: !!rawFlags.ignoreWorkspaceRootCheck,
-
- // outdated, update-interactive
- includeWorkspaceDeps: !!rawFlags.includeWorkspaceDeps,
-
- // add, remove, update
- workspaceRootIsCwd: rawFlags.workspaceRootIsCwd !== false
- };
-
- if (config.getOption('ignore-scripts')) {
- flags.ignoreScripts = true;
- }
-
- if (config.getOption('ignore-platform')) {
- flags.ignorePlatform = true;
- }
-
- if (config.getOption('ignore-engines')) {
- flags.ignoreEngines = true;
- }
-
- if (config.getOption('ignore-optional')) {
- flags.ignoreOptional = true;
- }
-
- if (config.getOption('force')) {
- flags.force = true;
- }
-
- return flags;
-}
-
-class Install {
- constructor(flags, config, reporter, lockfile) {
- this.rootManifestRegistries = [];
- this.rootPatternsToOrigin = (0, (_map || _load_map()).default)();
- this.lockfile = lockfile;
- this.reporter = reporter;
- this.config = config;
- this.flags = normalizeFlags(config, flags);
- this.resolutions = (0, (_map || _load_map()).default)(); // Legacy resolutions field used for flat install mode
- this.resolutionMap = new (_resolutionMap || _load_resolutionMap()).default(config); // Selective resolutions for nested dependencies
- this.resolver = new (_packageResolver || _load_packageResolver()).default(config, lockfile, this.resolutionMap);
- this.integrityChecker = new (_integrityChecker || _load_integrityChecker()).default(config);
- this.linker = new (_packageLinker || _load_packageLinker()).default(config, this.resolver);
- this.scripts = new (_packageInstallScripts || _load_packageInstallScripts()).default(config, this.resolver, this.flags.force);
- }
-
- /**
- * Create a list of dependency requests from the current directories manifests.
- */
-
- fetchRequestFromCwd(excludePatterns = [], ignoreUnusedPatterns = false) {
- var _this = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const patterns = [];
- const deps = [];
- let resolutionDeps = [];
- const manifest = {};
-
- const ignorePatterns = [];
- const usedPatterns = [];
- let workspaceLayout;
-
- // some commands should always run in the context of the entire workspace
- const cwd = _this.flags.includeWorkspaceDeps || _this.flags.workspaceRootIsCwd ? _this.config.lockfileFolder : _this.config.cwd;
-
- // non-workspaces are always root, otherwise check for workspace root
- const cwdIsRoot = !_this.config.workspaceRootFolder || _this.config.lockfileFolder === cwd;
-
- // exclude package names that are in install args
- const excludeNames = [];
- for (var _iterator = excludePatterns, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
- var _ref;
-
- if (_isArray) {
- if (_i >= _iterator.length) break;
- _ref = _iterator[_i++];
- } else {
- _i = _iterator.next();
- if (_i.done) break;
- _ref = _i.value;
- }
-
- const pattern = _ref;
-
- if ((0, (_index3 || _load_index3()).getExoticResolver)(pattern)) {
- excludeNames.push((0, (_guessName || _load_guessName()).default)(pattern));
- } else {
- // extract the name
- const parts = (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern);
- excludeNames.push(parts.name);
- }
- }
-
- const stripExcluded = function stripExcluded(manifest) {
- for (var _iterator2 = excludeNames, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
- var _ref2;
-
- if (_isArray2) {
- if (_i2 >= _iterator2.length) break;
- _ref2 = _iterator2[_i2++];
- } else {
- _i2 = _iterator2.next();
- if (_i2.done) break;
- _ref2 = _i2.value;
- }
-
- const exclude = _ref2;
-
- if (manifest.dependencies && manifest.dependencies[exclude]) {
- delete manifest.dependencies[exclude];
- }
- if (manifest.devDependencies && manifest.devDependencies[exclude]) {
- delete manifest.devDependencies[exclude];
- }
- if (manifest.optionalDependencies && manifest.optionalDependencies[exclude]) {
- delete manifest.optionalDependencies[exclude];
- }
- }
- };
-
- for (var _iterator3 = Object.keys((_index2 || _load_index2()).registries), _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) {
- var _ref3;
-
- if (_isArray3) {
- if (_i3 >= _iterator3.length) break;
- _ref3 = _iterator3[_i3++];
- } else {
- _i3 = _iterator3.next();
- if (_i3.done) break;
- _ref3 = _i3.value;
- }
-
- const registry = _ref3;
-
- const filename = (_index2 || _load_index2()).registries[registry].filename;
-
- const loc = path.join(cwd, filename);
- if (!(yield (_fs || _load_fs()).exists(loc))) {
- continue;
- }
-
- _this.rootManifestRegistries.push(registry);
-
- const projectManifestJson = yield _this.config.readJson(loc);
- yield (0, (_index || _load_index()).default)(projectManifestJson, cwd, _this.config, cwdIsRoot);
-
- Object.assign(_this.resolutions, projectManifestJson.resolutions);
- Object.assign(manifest, projectManifestJson);
-
- _this.resolutionMap.init(_this.resolutions);
- for (var _iterator4 = Object.keys(_this.resolutionMap.resolutionsByPackage), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) {
- var _ref4;
-
- if (_isArray4) {
- if (_i4 >= _iterator4.length) break;
- _ref4 = _iterator4[_i4++];
- } else {
- _i4 = _iterator4.next();
- if (_i4.done) break;
- _ref4 = _i4.value;
- }
-
- const packageName = _ref4;
-
- const optional = (_objectPath || _load_objectPath()).default.has(manifest.optionalDependencies, packageName) && _this.flags.ignoreOptional;
- for (var _iterator8 = _this.resolutionMap.resolutionsByPackage[packageName], _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) {
- var _ref9;
-
- if (_isArray8) {
- if (_i8 >= _iterator8.length) break;
- _ref9 = _iterator8[_i8++];
- } else {
- _i8 = _iterator8.next();
- if (_i8.done) break;
- _ref9 = _i8.value;
- }
-
- const _ref8 = _ref9;
- const pattern = _ref8.pattern;
-
- resolutionDeps = [...resolutionDeps, { registry, pattern, optional, hint: 'resolution' }];
- }
- }
-
- const pushDeps = function pushDeps(depType, manifest, { hint, optional }, isUsed) {
- if (ignoreUnusedPatterns && !isUsed) {
- return;
- }
- // We only take unused dependencies into consideration to get deterministic hoisting.
- // Since flat mode doesn't care about hoisting and everything is top level and specified then we can safely
- // leave these out.
- if (_this.flags.flat && !isUsed) {
- return;
- }
- const depMap = manifest[depType];
- for (const name in depMap) {
- if (excludeNames.indexOf(name) >= 0) {
- continue;
- }
-
- let pattern = name;
- if (!_this.lockfile.getLocked(pattern)) {
- // when we use --save we save the dependency to the lockfile with just the name rather than the
- // version combo
- pattern += '@' + depMap[name];
- }
-
- // normalization made sure packages are mentioned only once
- if (isUsed) {
- usedPatterns.push(pattern);
- } else {
- ignorePatterns.push(pattern);
- }
-
- _this.rootPatternsToOrigin[pattern] = depType;
- patterns.push(pattern);
- deps.push({ pattern, registry, hint, optional, workspaceName: manifest.name, workspaceLoc: manifest._loc });
- }
- };
-
- if (cwdIsRoot) {
- pushDeps('dependencies', projectManifestJson, { hint: null, optional: false }, true);
- pushDeps('devDependencies', projectManifestJson, { hint: 'dev', optional: false }, !_this.config.production);
- pushDeps('optionalDependencies', projectManifestJson, { hint: 'optional', optional: true }, true);
- }
-
- if (_this.config.workspaceRootFolder) {
- const workspaceLoc = cwdIsRoot ? loc : path.join(_this.config.lockfileFolder, filename);
- const workspacesRoot = path.dirname(workspaceLoc);
-
- let workspaceManifestJson = projectManifestJson;
- if (!cwdIsRoot) {
- // the manifest we read before was a child workspace, so get the root
- workspaceManifestJson = yield _this.config.readJson(workspaceLoc);
- yield (0, (_index || _load_index()).default)(workspaceManifestJson, workspacesRoot, _this.config, true);
- }
-
- const workspaces = yield _this.config.resolveWorkspaces(workspacesRoot, workspaceManifestJson);
- workspaceLayout = new (_workspaceLayout || _load_workspaceLayout()).default(workspaces, _this.config);
-
- // add virtual manifest that depends on all workspaces, this way package hoisters and resolvers will work fine
- const workspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.dependencies);
- for (var _iterator5 = Object.keys(workspaces), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) {
- var _ref5;
-
- if (_isArray5) {
- if (_i5 >= _iterator5.length) break;
- _ref5 = _iterator5[_i5++];
- } else {
- _i5 = _iterator5.next();
- if (_i5.done) break;
- _ref5 = _i5.value;
- }
-
- const workspaceName = _ref5;
-
- const workspaceManifest = workspaces[workspaceName].manifest;
- workspaceDependencies[workspaceName] = workspaceManifest.version;
-
- // include dependencies from all workspaces
- if (_this.flags.includeWorkspaceDeps) {
- pushDeps('dependencies', workspaceManifest, { hint: null, optional: false }, true);
- pushDeps('devDependencies', workspaceManifest, { hint: 'dev', optional: false }, !_this.config.production);
- pushDeps('optionalDependencies', workspaceManifest, { hint: 'optional', optional: true }, true);
- }
- }
- const virtualDependencyManifest = {
- _uid: '',
- name: `workspace-aggregator-${uuid.v4()}`,
- version: '1.0.0',
- _registry: 'npm',
- _loc: workspacesRoot,
- dependencies: workspaceDependencies,
- devDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.devDependencies),
- optionalDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.optionalDependencies),
- private: workspaceManifestJson.private,
- workspaces: workspaceManifestJson.workspaces
- };
- workspaceLayout.virtualManifestName = virtualDependencyManifest.name;
- const virtualDep = {};
- virtualDep[virtualDependencyManifest.name] = virtualDependencyManifest.version;
- workspaces[virtualDependencyManifest.name] = { loc: workspacesRoot, manifest: virtualDependencyManifest };
-
- // ensure dependencies that should be excluded are stripped from the correct manifest
- stripExcluded(cwdIsRoot ? virtualDependencyManifest : workspaces[projectManifestJson.name].manifest);
-
- pushDeps('workspaces', { workspaces: virtualDep }, { hint: 'workspaces', optional: false }, true);
-
- const implicitWorkspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceDependencies);
-
- for (var _iterator6 = (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) {
- var _ref6;
-
- if (_isArray6) {
- if (_i6 >= _iterator6.length) break;
- _ref6 = _iterator6[_i6++];
- } else {
- _i6 = _iterator6.next();
- if (_i6.done) break;
- _ref6 = _i6.value;
- }
-
- const type = _ref6;
-
- for (var _iterator7 = Object.keys(projectManifestJson[type] || {}), _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) {
- var _ref7;
-
- if (_isArray7) {
- if (_i7 >= _iterator7.length) break;
- _ref7 = _iterator7[_i7++];
- } else {
- _i7 = _iterator7.next();
- if (_i7.done) break;
- _ref7 = _i7.value;
- }
-
- const dependencyName = _ref7;
-
- delete implicitWorkspaceDependencies[dependencyName];
- }
- }
-
- pushDeps('dependencies', { dependencies: implicitWorkspaceDependencies }, { hint: 'workspaces', optional: false }, true);
- }
-
- break;
- }
-
- // inherit root flat flag
- if (manifest.flat) {
- _this.flags.flat = true;
- }
-
- return {
- requests: [...resolutionDeps, ...deps],
- patterns,
- manifest,
- usedPatterns,
- ignorePatterns,
- workspaceLayout
- };
- })();
- }
-
- /**
- * TODO description
- */
-
- prepareRequests(requests) {
- return requests;
- }
-
- preparePatterns(patterns) {
- return patterns;
- }
- preparePatternsForLinking(patterns, cwdManifest, cwdIsRoot) {
- return patterns;
- }
-
- prepareManifests() {
- var _this2 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const manifests = yield _this2.config.getRootManifests();
- return manifests;
- })();
- }
-
- bailout(patterns, workspaceLayout) {
- var _this3 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- // We don't want to skip the audit - it could yield important errors
- if (_this3.flags.audit) {
- return false;
- }
- // PNP is so fast that the integrity check isn't pertinent
- if (_this3.config.plugnplayEnabled) {
- return false;
- }
- if (_this3.flags.skipIntegrityCheck || _this3.flags.force) {
- return false;
- }
- const lockfileCache = _this3.lockfile.cache;
- if (!lockfileCache) {
- return false;
- }
- const lockfileClean = _this3.lockfile.parseResultType === 'success';
- const match = yield _this3.integrityChecker.check(patterns, lockfileCache, _this3.flags, workspaceLayout);
- if (_this3.flags.frozenLockfile && (!lockfileClean || match.missingPatterns.length > 0)) {
- throw new (_errors || _load_errors()).MessageError(_this3.reporter.lang('frozenLockfileError'));
- }
-
- const haveLockfile = yield (_fs || _load_fs()).exists(path.join(_this3.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME));
-
- const lockfileIntegrityPresent = !_this3.lockfile.hasEntriesExistWithoutIntegrity();
- const integrityBailout = lockfileIntegrityPresent || !_this3.config.autoAddIntegrity;
-
- if (match.integrityMatches && haveLockfile && lockfileClean && integrityBailout) {
- _this3.reporter.success(_this3.reporter.lang('upToDate'));
- return true;
- }
-
- if (match.integrityFileMissing && haveLockfile) {
- // Integrity file missing, force script installations
- _this3.scripts.setForce(true);
- return false;
- }
-
- if (match.hardRefreshRequired) {
- // e.g. node version doesn't match, force script installations
- _this3.scripts.setForce(true);
- return false;
- }
-
- if (!patterns.length && !match.integrityFileMissing) {
- _this3.reporter.success(_this3.reporter.lang('nothingToInstall'));
- yield _this3.createEmptyManifestFolders();
- yield _this3.saveLockfileAndIntegrity(patterns, workspaceLayout);
- return true;
- }
-
- return false;
- })();
- }
-
- /**
- * Produce empty folders for all used root manifests.
- */
-
- createEmptyManifestFolders() {
- var _this4 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- if (_this4.config.modulesFolder) {
- // already created
- return;
- }
-
- for (var _iterator9 = _this4.rootManifestRegistries, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) {
- var _ref10;
-
- if (_isArray9) {
- if (_i9 >= _iterator9.length) break;
- _ref10 = _iterator9[_i9++];
- } else {
- _i9 = _iterator9.next();
- if (_i9.done) break;
- _ref10 = _i9.value;
- }
-
- const registryName = _ref10;
- const folder = _this4.config.registries[registryName].folder;
-
- yield (_fs || _load_fs()).mkdirp(path.join(_this4.config.lockfileFolder, folder));
- }
- })();
- }
-
- /**
- * TODO description
- */
-
- markIgnored(patterns) {
- for (var _iterator10 = patterns, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) {
- var _ref11;
-
- if (_isArray10) {
- if (_i10 >= _iterator10.length) break;
- _ref11 = _iterator10[_i10++];
- } else {
- _i10 = _iterator10.next();
- if (_i10.done) break;
- _ref11 = _i10.value;
- }
-
- const pattern = _ref11;
-
- const manifest = this.resolver.getStrictResolvedPattern(pattern);
- const ref = manifest._reference;
- invariant(ref, 'expected package reference');
-
- // just mark the package as ignored. if the package is used by a required package, the hoister
- // will take care of that.
- ref.ignore = true;
- }
- }
-
- /**
- * helper method that gets only recent manifests
- * used by global.ls command
- */
- getFlattenedDeps() {
- var _this5 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- var _ref12 = yield _this5.fetchRequestFromCwd();
-
- const depRequests = _ref12.requests,
- rawPatterns = _ref12.patterns;
-
-
- yield _this5.resolver.init(depRequests, {});
-
- const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this5.resolver.getManifests(), _this5.config);
- _this5.resolver.updateManifests(manifests);
-
- return _this5.flatten(rawPatterns);
- })();
- }
-
- /**
- * TODO description
- */
-
- init() {
- var _this6 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- _this6.checkUpdate();
-
- // warn if we have a shrinkwrap
- if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_SHRINKWRAP_FILENAME))) {
- _this6.reporter.warn(_this6.reporter.lang('shrinkwrapWarning'));
- }
-
- // warn if we have an npm lockfile
- if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_LOCK_FILENAME))) {
- _this6.reporter.warn(_this6.reporter.lang('npmLockfileWarning'));
- }
-
- if (_this6.config.plugnplayEnabled) {
- _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L1'));
- _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L2'));
- }
-
- let flattenedTopLevelPatterns = [];
- const steps = [];
-
- var _ref13 = yield _this6.fetchRequestFromCwd();
-
- const depRequests = _ref13.requests,
- rawPatterns = _ref13.patterns,
- ignorePatterns = _ref13.ignorePatterns,
- workspaceLayout = _ref13.workspaceLayout,
- manifest = _ref13.manifest;
-
- let topLevelPatterns = [];
-
- const artifacts = yield _this6.integrityChecker.getArtifacts();
- if (artifacts) {
- _this6.linker.setArtifacts(artifacts);
- _this6.scripts.setArtifacts(artifacts);
- }
-
- if ((_packageCompatibility || _load_packageCompatibility()).shouldCheck(manifest, _this6.flags)) {
- steps.push((() => {
- var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) {
- _this6.reporter.step(curr, total, _this6.reporter.lang('checkingManifest'), emoji.get('mag'));
- yield _this6.checkCompatibility();
- });
-
- return function (_x, _x2) {
- return _ref14.apply(this, arguments);
- };
- })());
- }
-
- const audit = new (_audit || _load_audit()).default(_this6.config, _this6.reporter, { groups: (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES });
- let auditFoundProblems = false;
-
- steps.push(function (curr, total) {
- return (0, (_hooks || _load_hooks()).callThroughHook)('resolveStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- _this6.reporter.step(curr, total, _this6.reporter.lang('resolvingPackages'), emoji.get('mag'));
- yield _this6.resolver.init(_this6.prepareRequests(depRequests), {
- isFlat: _this6.flags.flat,
- isFrozen: _this6.flags.frozenLockfile,
- workspaceLayout
- });
- topLevelPatterns = _this6.preparePatterns(rawPatterns);
- flattenedTopLevelPatterns = yield _this6.flatten(topLevelPatterns);
- return { bailout: !_this6.flags.audit && (yield _this6.bailout(topLevelPatterns, workspaceLayout)) };
- }));
- });
-
- if (_this6.flags.audit) {
- steps.push(function (curr, total) {
- return (0, (_hooks || _load_hooks()).callThroughHook)('auditStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- _this6.reporter.step(curr, total, _this6.reporter.lang('auditRunning'), emoji.get('mag'));
- if (_this6.flags.offline) {
- _this6.reporter.warn(_this6.reporter.lang('auditOffline'));
- return { bailout: false };
- }
- const preparedManifests = yield _this6.prepareManifests();
- // $FlowFixMe - Flow considers `m` in the map operation to be "mixed", so does not recognize `m.object`
- const mergedManifest = Object.assign({}, ...Object.values(preparedManifests).map(function (m) {
- return m.object;
- }));
- const auditVulnerabilityCounts = yield audit.performAudit(mergedManifest, _this6.lockfile, _this6.resolver, _this6.linker, topLevelPatterns);
- auditFoundProblems = auditVulnerabilityCounts.info || auditVulnerabilityCounts.low || auditVulnerabilityCounts.moderate || auditVulnerabilityCounts.high || auditVulnerabilityCounts.critical;
- return { bailout: yield _this6.bailout(topLevelPatterns, workspaceLayout) };
- }));
- });
- }
-
- steps.push(function (curr, total) {
- return (0, (_hooks || _load_hooks()).callThroughHook)('fetchStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- _this6.markIgnored(ignorePatterns);
- _this6.reporter.step(curr, total, _this6.reporter.lang('fetchingPackages'), emoji.get('truck'));
- const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this6.resolver.getManifests(), _this6.config);
- _this6.resolver.updateManifests(manifests);
- yield (_packageCompatibility || _load_packageCompatibility()).check(_this6.resolver.getManifests(), _this6.config, _this6.flags.ignoreEngines);
- }));
- });
-
- steps.push(function (curr, total) {
- return (0, (_hooks || _load_hooks()).callThroughHook)('linkStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- // remove integrity hash to make this operation atomic
- yield _this6.integrityChecker.removeIntegrityFile();
- _this6.reporter.step(curr, total, _this6.reporter.lang('linkingDependencies'), emoji.get('link'));
- flattenedTopLevelPatterns = _this6.preparePatternsForLinking(flattenedTopLevelPatterns, manifest, _this6.config.lockfileFolder === _this6.config.cwd);
- yield _this6.linker.init(flattenedTopLevelPatterns, workspaceLayout, {
- linkDuplicates: _this6.flags.linkDuplicates,
- ignoreOptional: _this6.flags.ignoreOptional
- });
- }));
- });
-
- if (_this6.config.plugnplayEnabled) {
- steps.push(function (curr, total) {
- return (0, (_hooks || _load_hooks()).callThroughHook)('pnpStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const pnpPath = `${_this6.config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`;
-
- const code = yield (0, (_generatePnpMap || _load_generatePnpMap()).generatePnpMap)(_this6.config, flattenedTopLevelPatterns, {
- resolver: _this6.resolver,
- reporter: _this6.reporter,
- targetPath: pnpPath,
- workspaceLayout
- });
-
- try {
- const file = yield (_fs || _load_fs()).readFile(pnpPath);
- if (file === code) {
- return;
- }
- } catch (error) {}
-
- yield (_fs || _load_fs()).writeFile(pnpPath, code);
- yield (_fs || _load_fs()).chmod(pnpPath, 0o755);
- }));
- });
- }
-
- steps.push(function (curr, total) {
- return (0, (_hooks || _load_hooks()).callThroughHook)('buildStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- _this6.reporter.step(curr, total, _this6.flags.force ? _this6.reporter.lang('rebuildingPackages') : _this6.reporter.lang('buildingFreshPackages'), emoji.get('hammer'));
-
- if (_this6.config.ignoreScripts) {
- _this6.reporter.warn(_this6.reporter.lang('ignoredScripts'));
- } else {
- yield _this6.scripts.init(flattenedTopLevelPatterns);
- }
- }));
- });
-
- if (_this6.flags.har) {
- steps.push((() => {
- var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) {
- const formattedDate = new Date().toISOString().replace(/:/g, '-');
- const filename = `yarn-install_${formattedDate}.har`;
- _this6.reporter.step(curr, total, _this6.reporter.lang('savingHar', filename), emoji.get('black_circle_for_record'));
- yield _this6.config.requestManager.saveHar(filename);
- });
-
- return function (_x3, _x4) {
- return _ref21.apply(this, arguments);
- };
- })());
- }
-
- if (yield _this6.shouldClean()) {
- steps.push((() => {
- var _ref22 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) {
- _this6.reporter.step(curr, total, _this6.reporter.lang('cleaningModules'), emoji.get('recycle'));
- yield (0, (_autoclean || _load_autoclean()).clean)(_this6.config, _this6.reporter);
- });
-
- return function (_x5, _x6) {
- return _ref22.apply(this, arguments);
- };
- })());
- }
-
- let currentStep = 0;
- for (var _iterator11 = steps, _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) {
- var _ref23;
-
- if (_isArray11) {
- if (_i11 >= _iterator11.length) break;
- _ref23 = _iterator11[_i11++];
- } else {
- _i11 = _iterator11.next();
- if (_i11.done) break;
- _ref23 = _i11.value;
- }
-
- const step = _ref23;
-
- const stepResult = yield step(++currentStep, steps.length);
- if (stepResult && stepResult.bailout) {
- if (_this6.flags.audit) {
- audit.summary();
- }
- if (auditFoundProblems) {
- _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails'));
- }
- _this6.maybeOutputUpdate();
- return flattenedTopLevelPatterns;
- }
- }
-
- // fin!
- if (_this6.flags.audit) {
- audit.summary();
- }
- if (auditFoundProblems) {
- _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails'));
- }
- yield _this6.saveLockfileAndIntegrity(topLevelPatterns, workspaceLayout);
- yield _this6.persistChanges();
- _this6.maybeOutputUpdate();
- _this6.config.requestManager.clearCache();
- return flattenedTopLevelPatterns;
- })();
- }
-
- checkCompatibility() {
- var _this7 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- var _ref24 = yield _this7.fetchRequestFromCwd();
-
- const manifest = _ref24.manifest;
-
- yield (_packageCompatibility || _load_packageCompatibility()).checkOne(manifest, _this7.config, _this7.flags.ignoreEngines);
- })();
- }
-
- persistChanges() {
- var _this8 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- // get all the different registry manifests in this folder
- const manifests = yield _this8.config.getRootManifests();
-
- if (yield _this8.applyChanges(manifests)) {
- yield _this8.config.saveRootManifests(manifests);
- }
- })();
- }
-
- applyChanges(manifests) {
- let hasChanged = false;
-
- if (this.config.plugnplayPersist) {
- const object = manifests.npm.object;
-
-
- if (typeof object.installConfig !== 'object') {
- object.installConfig = {};
- }
-
- if (this.config.plugnplayEnabled && object.installConfig.pnp !== true) {
- object.installConfig.pnp = true;
- hasChanged = true;
- } else if (!this.config.plugnplayEnabled && typeof object.installConfig.pnp !== 'undefined') {
- delete object.installConfig.pnp;
- hasChanged = true;
- }
-
- if (Object.keys(object.installConfig).length === 0) {
- delete object.installConfig;
- }
- }
-
- return Promise.resolve(hasChanged);
- }
-
- /**
- * Check if we should run the cleaning step.
- */
-
- shouldClean() {
- return (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).CLEAN_FILENAME));
- }
-
- /**
- * TODO
- */
-
- flatten(patterns) {
- var _this9 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- if (!_this9.flags.flat) {
- return patterns;
- }
-
- const flattenedPatterns = [];
-
- for (var _iterator12 = _this9.resolver.getAllDependencyNamesByLevelOrder(patterns), _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) {
- var _ref25;
-
- if (_isArray12) {
- if (_i12 >= _iterator12.length) break;
- _ref25 = _iterator12[_i12++];
- } else {
- _i12 = _iterator12.next();
- if (_i12.done) break;
- _ref25 = _i12.value;
- }
-
- const name = _ref25;
-
- const infos = _this9.resolver.getAllInfoForPackageName(name).filter(function (manifest) {
- const ref = manifest._reference;
- invariant(ref, 'expected package reference');
- return !ref.ignore;
- });
-
- if (infos.length === 0) {
- continue;
- }
-
- if (infos.length === 1) {
- // single version of this package
- // take out a single pattern as multiple patterns may have resolved to this package
- flattenedPatterns.push(_this9.resolver.patternsByPackage[name][0]);
- continue;
- }
-
- const options = infos.map(function (info) {
- const ref = info._reference;
- invariant(ref, 'expected reference');
- return {
- // TODO `and is required by {PARENT}`,
- name: _this9.reporter.lang('manualVersionResolutionOption', ref.patterns.join(', '), info.version),
-
- value: info.version
- };
- });
- const versions = infos.map(function (info) {
- return info.version;
- });
- let version;
-
- const resolutionVersion = _this9.resolutions[name];
- if (resolutionVersion && versions.indexOf(resolutionVersion) >= 0) {
- // use json `resolution` version
- version = resolutionVersion;
- } else {
- version = yield _this9.reporter.select(_this9.reporter.lang('manualVersionResolution', name), _this9.reporter.lang('answer'), options);
- _this9.resolutions[name] = version;
- }
-
- flattenedPatterns.push(_this9.resolver.collapseAllVersionsOfPackage(name, version));
- }
-
- // save resolutions to their appropriate root manifest
- if (Object.keys(_this9.resolutions).length) {
- const manifests = yield _this9.config.getRootManifests();
-
- for (const name in _this9.resolutions) {
- const version = _this9.resolutions[name];
-
- const patterns = _this9.resolver.patternsByPackage[name];
- if (!patterns) {
- continue;
- }
-
- let manifest;
- for (var _iterator13 = patterns, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) {
- var _ref26;
-
- if (_isArray13) {
- if (_i13 >= _iterator13.length) break;
- _ref26 = _iterator13[_i13++];
- } else {
- _i13 = _iterator13.next();
- if (_i13.done) break;
- _ref26 = _i13.value;
- }
-
- const pattern = _ref26;
-
- manifest = _this9.resolver.getResolvedPattern(pattern);
- if (manifest) {
- break;
- }
- }
- invariant(manifest, 'expected manifest');
-
- const ref = manifest._reference;
- invariant(ref, 'expected reference');
-
- const object = manifests[ref.registry].object;
- object.resolutions = object.resolutions || {};
- object.resolutions[name] = version;
- }
-
- yield _this9.config.saveRootManifests(manifests);
- }
-
- return flattenedPatterns;
- })();
- }
-
- /**
- * Remove offline tarballs that are no longer required
- */
-
- pruneOfflineMirror(lockfile) {
- var _this10 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const mirror = _this10.config.getOfflineMirrorPath();
- if (!mirror) {
- return;
- }
-
- const requiredTarballs = new Set();
- for (const dependency in lockfile) {
- const resolved = lockfile[dependency].resolved;
- if (resolved) {
- const basename = path.basename(resolved.split('#')[0]);
- if (dependency[0] === '@' && basename[0] !== '@') {
- requiredTarballs.add(`${dependency.split('/')[0]}-${basename}`);
- }
- requiredTarballs.add(basename);
- }
- }
-
- const mirrorFiles = yield (_fs || _load_fs()).walk(mirror);
- for (var _iterator14 = mirrorFiles, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) {
- var _ref27;
-
- if (_isArray14) {
- if (_i14 >= _iterator14.length) break;
- _ref27 = _iterator14[_i14++];
- } else {
- _i14 = _iterator14.next();
- if (_i14.done) break;
- _ref27 = _i14.value;
- }
-
- const file = _ref27;
-
- const isTarball = path.extname(file.basename) === '.tgz';
- // if using experimental-pack-script-packages-in-mirror flag, don't unlink prebuilt packages
- const hasPrebuiltPackage = file.relative.startsWith('prebuilt/');
- if (isTarball && !hasPrebuiltPackage && !requiredTarballs.has(file.basename)) {
- yield (_fs || _load_fs()).unlink(file.absolute);
- }
- }
- })();
- }
-
- /**
- * Save updated integrity and lockfiles.
- */
-
- saveLockfileAndIntegrity(patterns, workspaceLayout) {
- var _this11 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const resolvedPatterns = {};
- Object.keys(_this11.resolver.patterns).forEach(function (pattern) {
- if (!workspaceLayout || !workspaceLayout.getManifestByPattern(pattern)) {
- resolvedPatterns[pattern] = _this11.resolver.patterns[pattern];
- }
- });
-
- // TODO this code is duplicated in a few places, need a common way to filter out workspace patterns from lockfile
- patterns = patterns.filter(function (p) {
- return !workspaceLayout || !workspaceLayout.getManifestByPattern(p);
- });
-
- const lockfileBasedOnResolver = _this11.lockfile.getLockfile(resolvedPatterns);
-
- if (_this11.config.pruneOfflineMirror) {
- yield _this11.pruneOfflineMirror(lockfileBasedOnResolver);
- }
-
- // write integrity hash
- if (!_this11.config.plugnplayEnabled) {
- yield _this11.integrityChecker.save(patterns, lockfileBasedOnResolver, _this11.flags, workspaceLayout, _this11.scripts.getArtifacts());
- }
-
- // --no-lockfile or --pure-lockfile or --frozen-lockfile
- if (_this11.flags.lockfile === false || _this11.flags.pureLockfile || _this11.flags.frozenLockfile) {
- return;
- }
-
- const lockFileHasAllPatterns = patterns.every(function (p) {
- return _this11.lockfile.getLocked(p);
- });
- const lockfilePatternsMatch = Object.keys(_this11.lockfile.cache || {}).every(function (p) {
- return lockfileBasedOnResolver[p];
- });
- const resolverPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) {
- const manifest = _this11.lockfile.getLocked(pattern);
- return manifest && manifest.resolved === lockfileBasedOnResolver[pattern].resolved && deepEqual(manifest.prebuiltVariants, lockfileBasedOnResolver[pattern].prebuiltVariants);
- });
- const integrityPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) {
- const existingIntegrityInfo = lockfileBasedOnResolver[pattern].integrity;
- if (!existingIntegrityInfo) {
- // if this entry does not have an integrity, no need to re-write the lockfile because of it
- return true;
- }
- const manifest = _this11.lockfile.getLocked(pattern);
- if (manifest && manifest.integrity) {
- const manifestIntegrity = ssri.stringify(manifest.integrity);
- return manifestIntegrity === existingIntegrityInfo;
- }
- return false;
- });
-
- // remove command is followed by install with force, lockfile will be rewritten in any case then
- if (!_this11.flags.force && _this11.lockfile.parseResultType === 'success' && lockFileHasAllPatterns && lockfilePatternsMatch && resolverPatternsAreSameAsInLockfile && integrityPatternsAreSameAsInLockfile && patterns.length) {
- return;
- }
-
- // build lockfile location
- const loc = path.join(_this11.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME);
-
- // write lockfile
- const lockSource = (0, (_lockfile2 || _load_lockfile2()).stringify)(lockfileBasedOnResolver, false, _this11.config.enableLockfileVersions);
- yield (_fs || _load_fs()).writeFilePreservingEol(loc, lockSource);
-
- _this11._logSuccessSaveLockfile();
- })();
- }
-
- _logSuccessSaveLockfile() {
- this.reporter.success(this.reporter.lang('savedLockfile'));
- }
-
- /**
- * Load the dependency graph of the current install. Only does package resolving and wont write to the cwd.
- */
- hydrate(ignoreUnusedPatterns) {
- var _this12 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- const request = yield _this12.fetchRequestFromCwd([], ignoreUnusedPatterns);
- const depRequests = request.requests,
- rawPatterns = request.patterns,
- ignorePatterns = request.ignorePatterns,
- workspaceLayout = request.workspaceLayout;
-
-
- yield _this12.resolver.init(depRequests, {
- isFlat: _this12.flags.flat,
- isFrozen: _this12.flags.frozenLockfile,
- workspaceLayout
- });
- yield _this12.flatten(rawPatterns);
- _this12.markIgnored(ignorePatterns);
-
- // fetch packages, should hit cache most of the time
- const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this12.resolver.getManifests(), _this12.config);
- _this12.resolver.updateManifests(manifests);
- yield (_packageCompatibility || _load_packageCompatibility()).check(_this12.resolver.getManifests(), _this12.config, _this12.flags.ignoreEngines);
-
- // expand minimal manifests
- for (var _iterator15 = _this12.resolver.getManifests(), _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) {
- var _ref28;
-
- if (_isArray15) {
- if (_i15 >= _iterator15.length) break;
- _ref28 = _iterator15[_i15++];
- } else {
- _i15 = _iterator15.next();
- if (_i15.done) break;
- _ref28 = _i15.value;
- }
-
- const manifest = _ref28;
-
- const ref = manifest._reference;
- invariant(ref, 'expected reference');
- const type = ref.remote.type;
- // link specifier won't ever hit cache
-
- let loc = '';
- if (type === 'link') {
- continue;
- } else if (type === 'workspace') {
- if (!ref.remote.reference) {
- continue;
- }
- loc = ref.remote.reference;
- } else {
- loc = _this12.config.generateModuleCachePath(ref);
- }
- const newPkg = yield _this12.config.readManifest(loc);
- yield _this12.resolver.updateManifest(ref, newPkg);
- }
-
- return request;
- })();
- }
-
- /**
- * Check for updates every day and output a nag message if there's a newer version.
- */
-
- checkUpdate() {
- if (this.config.nonInteractive) {
- // don't show upgrade dialog on CI or non-TTY terminals
- return;
- }
-
- // don't check if disabled
- if (this.config.getOption('disable-self-update-check')) {
- return;
- }
-
- // only check for updates once a day
- const lastUpdateCheck = Number(this.config.getOption('lastUpdateCheck')) || 0;
- if (lastUpdateCheck && Date.now() - lastUpdateCheck < ONE_DAY) {
- return;
- }
-
- // don't bug for updates on tagged releases
- if ((_yarnVersion || _load_yarnVersion()).version.indexOf('-') >= 0) {
- return;
- }
-
- this._checkUpdate().catch(() => {
- // swallow errors
- });
- }
-
- _checkUpdate() {
- var _this13 = this;
-
- return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () {
- let latestVersion = yield _this13.config.requestManager.request({
- url: (_constants || _load_constants()).SELF_UPDATE_VERSION_URL
- });
- invariant(typeof latestVersion === 'string', 'expected string');
- latestVersion = latestVersion.trim();
- if (!semver.valid(latestVersion)) {
- return;
- }
-
- // ensure we only check for updates periodically
- _this13.config.registries.yarn.saveHomeConfig({
- lastUpdateCheck: Date.now()
- });
-
- if (semver.gt(latestVersion, (_yarnVersion || _load_yarnVersion()).version)) {
- const installationMethod = yield (0, (_yarnVersion || _load_yarnVersion()).getInstallationMethod)();
- _this13.maybeOutputUpdate = function () {
- _this13.reporter.warn(_this13.reporter.lang('yarnOutdated', latestVersion, (_yarnVersion || _load_yarnVersion()).version));
-
- const command = getUpdateCommand(installationMethod);
- if (command) {
- _this13.reporter.info(_this13.reporter.lang('yarnOutdatedCommand'));
- _this13.reporter.command(command);
- } else {
- const installer = getUpdateInstaller(installationMethod);
- if (installer) {
- _this13.reporter.info(_this13.reporter.lang('yarnOutdatedInstaller', installer));
- }
- }
- };
- }
- })();
- }
-
- /**
- * Method to override with a possible upgrade message.
- */
-
- maybeOutputUpdate() {}
-}
-
-exports.Install = Install;
-function hasWrapper(commander, args) {
- return true;
-}
-
-function setFlags(commander) {
- commander.description('Yarn install is used to install all dependencies for a project.');
- commander.usage('install [flags]');
- commander.option('-A, --audit', 'Run vulnerability audit on installed packages');
- commander.option('-g, --global', 'DEPRECATED');
- commander.option('-S, --save', 'DEPRECATED - save package to your `dependencies`');
- commander.option('-D, --save-dev', 'DEPRECATED - save package to your `devDependencies`');
- commander.option('-P, --save-peer', 'DEPRECATED - save package to your `peerDependencies`');
- commander.option('-O, --save-optional', 'DEPRECATED - save package to your `optionalDependencies`');
- commander.option('-E, --save-exact', 'DEPRECATED');
- commander.option('-T, --save-tilde', 'DEPRECATED');
-}
-
-/***/ }),
-/* 35 */
-/***/ (function(module, exports, __webpack_require__) {
-
-var isObject = __webpack_require__(52);
-module.exports = function (it) {
- if (!isObject(it)) throw TypeError(it + ' is not an object!');
- return it;
-};
-
-
-/***/ }),
-/* 36 */
-/***/ (function(module, __webpack_exports__, __webpack_require__) {
-
-"use strict";
-/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return SubjectSubscriber; });
-/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subject; });
-/* unused harmony export AnonymousSubject */
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(12);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__(7);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(189);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(422);
-/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(321);
-/** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */
-
-
-
-
-
-
-
-var SubjectSubscriber = /*@__PURE__*/ (function (_super) {
- __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SubjectSubscriber, _super);
- function SubjectSubscriber(destination) {
- var _this = _super.call(this, destination) || this;
- _this.destination = destination;
- return _this;
- }
- return SubjectSubscriber;
-}(__WEBPACK_IMPORTED_MODULE_2__Subscriber__["a" /* Subscriber */]));
-
-var Subject = /*@__PURE__*/ (function (_super) {
- __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subject, _super);
- function Subject() {
- var _this = _super.call(this) || this;
- _this.observers = [];
- _this.closed = false;
- _this.isStopped = false;
- _this.hasError = false;
- _this.thrownError = null;
- return _this;
- }
- Subject.prototype[__WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () {
- return new SubjectSubscriber(this);
- };
- Subject.prototype.lift = function (operator) {
- var subject = new AnonymousSubject(this, this);
- subject.operator = operator;
- return subject;
- };
- Subject.prototype.next = function (value) {
- if (this.closed) {
- throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
- }
- if (!this.isStopped) {
- var observers = this.observers;
- var len = observers.length;
- var copy = observers.slice();
- for (var i = 0; i < len; i++) {
- copy[i].next(value);
- }
- }
- };
- Subject.prototype.error = function (err) {
- if (this.closed) {
- throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
- }
- this.hasError = true;
- this.thrownError = err;
- this.isStopped = true;
- var observers = this.observers;
- var len = observers.length;
- var copy = observers.slice();
- for (var i = 0; i < len; i++) {
- copy[i].error(err);
- }
- this.observers.length = 0;
- };
- Subject.prototype.complete = function () {
- if (this.closed) {
- throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
- }
- this.isStopped = true;
- var observers = this.observers;
- var len = observers.length;
- var copy = observers.slice();
- for (var i = 0; i < len; i++) {
- copy[i].complete();
- }
- this.observers.length = 0;
- };
- Subject.prototype.unsubscribe = function () {
- this.isStopped = true;
- this.closed = true;
- this.observers = null;
- };
- Subject.prototype._trySubscribe = function (subscriber) {
- if (this.closed) {
- throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
- }
- else {
- return _super.prototype._trySubscribe.call(this, subscriber);
- }
- };
- Subject.prototype._subscribe = function (subscriber) {
- if (this.closed) {
- throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */]();
- }
- else if (this.hasError) {
- subscriber.error(this.thrownError);
- return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY;
- }
- else if (this.isStopped) {
- subscriber.complete();
- return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY;
- }
- else {
- this.observers.push(subscriber);
- return new __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__["a" /* SubjectSubscription */](this, subscriber);
- }
- };
- Subject.prototype.asObservable = function () {
- var observable = new __WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */]();
- observable.source = this;
- return observable;
- };
- Subject.create = function (destination, source) {
- return new AnonymousSubject(destination, source);
- };
- return Subject;
-}(__WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */]));
-
-var AnonymousSubject = /*@__PURE__*/ (function (_super) {
- __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](AnonymousSubject, _super);
- function AnonymousSubject(destination, source) {
- var _this = _super.call(this) || this;
- _this.destination = destination;
- _this.source = source;
- return _this;
- }
- AnonymousSubject.prototype.next = function (value) {
- var destination = this.destination;
- if (destination && destination.next) {
- destination.next(value);
- }
- };
- AnonymousSubject.prototype.error = function (err) {
- var destination = this.destination;
- if (destination && destination.error) {
- this.destination.error(err);
- }
- };
- AnonymousSubject.prototype.complete = function () {
- var destination = this.destination;
- if (destination && destination.complete) {
- this.destination.complete();
- }
- };
- AnonymousSubject.prototype._subscribe = function (subscriber) {
- var source = this.source;
- if (source) {
- return this.source.subscribe(subscriber);
- }
- else {
- return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY;
- }
- };
- return AnonymousSubject;
-}(Subject));
-
-//# sourceMappingURL=Subject.js.map
-
-
-/***/ }),
-/* 37 */
-/***/ (function(module, exports, __webpack_require__) {
-
-"use strict";
-
-
-Object.defineProperty(exports, "__esModule", {
- value: true
-});
-exports.normalizePattern = normalizePattern;
-
-/**
- * Explode and normalize a pattern into its name and range.
- */
-
-function normalizePattern(pattern) {
- let hasVersion = false;
- let range = 'latest';
- let name = pattern;
-
- // if we're a scope then remove the @ and add it back later
- let isScoped = false;
- if (name[0] === '@') {
- isScoped = true;
- name = name.slice(1);
- }
-
- // take first part as the name
- const parts = name.split('@');
- if (parts.length > 1) {
- name = parts.shift();
- range = parts.join('@');
-
- if (range) {
- hasVersion = true;
- } else {
- range = '*';
- }
- }
-
- // add back @ scope suffix
- if (isScoped) {
- name = `@${name}`;
- }
-
- return { name, range, hasVersion };
-}
-
-/***/ }),
-/* 38 */
-/***/ (function(module, exports, __webpack_require__) {
-
-/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**
- * @license
- * Lodash
- * Copyright JS Foundation and other contributors
- * Released under MIT license
- * Based on Underscore.js 1.8.3
- * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
- */
-;(function() {
-
- /** Used as a safe reference for `undefined` in pre-ES5 environments. */
- var undefined;
-
- /** Used as the semantic version number. */
- var VERSION = '4.17.10';
-
- /** Used as the size to enable large array optimizations. */
- var LARGE_ARRAY_SIZE = 200;
-
- /** Error message constants. */
- var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',
- FUNC_ERROR_TEXT = 'Expected a function';
-
- /** Used to stand-in for `undefined` hash values. */
- var HASH_UNDEFINED = '__lodash_hash_undefined__';
-
- /** Used as the maximum memoize cache size. */
- var MAX_MEMOIZE_SIZE = 500;
-
- /** Used as the internal argument placeholder. */
- var PLACEHOLDER = '__lodash_placeholder__';
-
- /** Used to compose bitmasks for cloning. */
- var CLONE_DEEP_FLAG = 1,
- CLONE_FLAT_FLAG = 2,
- CLONE_SYMBOLS_FLAG = 4;
-
- /** Used to compose bitmasks for value comparisons. */
- var COMPARE_PARTIAL_FLAG = 1,
- COMPARE_UNORDERED_FLAG = 2;
-
- /** Used to compose bitmasks for function metadata. */
- var WRAP_BIND_FLAG = 1,
- WRAP_BIND_KEY_FLAG = 2,
- WRAP_CURRY_BOUND_FLAG = 4,
- WRAP_CURRY_FLAG = 8,
- WRAP_CURRY_RIGHT_FLAG = 16,
- WRAP_PARTIAL_FLAG = 32,
- WRAP_PARTIAL_RIGHT_FLAG = 64,
- WRAP_ARY_FLAG = 128,
- WRAP_REARG_FLAG = 256,
- WRAP_FLIP_FLAG = 512;
-
- /** Used as default options for `_.truncate`. */
- var DEFAULT_TRUNC_LENGTH = 30,
- DEFAULT_TRUNC_OMISSION = '...';
-
- /** Used to detect hot functions by number of calls within a span of milliseconds. */
- var HOT_COUNT = 800,
- HOT_SPAN = 16;
-
- /** Used to indicate the type of lazy iteratees. */
- var LAZY_FILTER_FLAG = 1,
- LAZY_MAP_FLAG = 2,
- LAZY_WHILE_FLAG = 3;
-
- /** Used as references for various `Number` constants. */
- var INFINITY = 1 / 0,
- MAX_SAFE_INTEGER = 9007199254740991,
- MAX_INTEGER = 1.7976931348623157e+308,
- NAN = 0 / 0;
-
- /** Used as references for the maximum length and index of an array. */
- var MAX_ARRAY_LENGTH = 4294967295,
- MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,
- HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;
-
- /** Used to associate wrap methods with their bit flags. */
- var wrapFlags = [
- ['ary', WRAP_ARY_FLAG],
- ['bind', WRAP_BIND_FLAG],
- ['bindKey', WRAP_BIND_KEY_FLAG],
- ['curry', WRAP_CURRY_FLAG],
- ['curryRight', WRAP_CURRY_RIGHT_FLAG],
- ['flip', WRAP_FLIP_FLAG],
- ['partial', WRAP_PARTIAL_FLAG],
- ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],
- ['rearg', WRAP_REARG_FLAG]
- ];
-
- /** `Object#toString` result references. */
- var argsTag = '[object Arguments]',
- arrayTag = '[object Array]',
- asyncTag = '[object AsyncFunction]',
- boolTag = '[object Boolean]',
- dateTag = '[object Date]',
- domExcTag = '[object DOMException]',
- errorTag = '[object Error]',
- funcTag = '[object Function]',
- genTag = '[object GeneratorFunction]',
- mapTag = '[object Map]',
- numberTag = '[object Number]',
- nullTag = '[object Null]',
- objectTag = '[object Object]',
- promiseTag = '[object Promise]',
- proxyTag = '[object Proxy]',
- regexpTag = '[object RegExp]',
- setTag = '[object Set]',
- stringTag = '[object String]',
- symbolTag = '[object Symbol]',
- undefinedTag = '[object Undefined]',
- weakMapTag = '[object WeakMap]',
- weakSetTag = '[object WeakSet]';
-
- var arrayBufferTag = '[object ArrayBuffer]',
- dataViewTag = '[object DataView]',
- float32Tag = '[object Float32Array]',
- float64Tag = '[object Float64Array]',
- int8Tag = '[object Int8Array]',
- int16Tag = '[object Int16Array]',
- int32Tag = '[object Int32Array]',
- uint8Tag = '[object Uint8Array]',
- uint8ClampedTag = '[object Uint8ClampedArray]',
- uint16Tag = '[object Uint16Array]',
- uint32Tag = '[object Uint32Array]';
-
- /** Used to match empty string literals in compiled template source. */
- var reEmptyStringLeading = /\b__p \+= '';/g,
- reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
- reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
-
- /** Used to match HTML entities and HTML characters. */
- var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,
- reUnescapedHtml = /[&<>"']/g,
- reHasEscapedHtml = RegExp(reEscapedHtml.source),
- reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
-
- /** Used to match template delimiters. */
- var reEscape = /<%-([\s\S]+?)%>/g,
- reEvaluate = /<%([\s\S]+?)%>/g,
- reInterpolate = /<%=([\s\S]+?)%>/g;
-
- /** Used to match property names within property paths. */
- var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
- reIsPlainProp = /^\w*$/,
- rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
-
- /**
- * Used to match `RegExp`
- * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
- */
- var reRegExpChar = /[\\^$.*+?()[\]{}|]/g,
- reHasRegExpChar = RegExp(reRegExpChar.source);
-
- /** Used to match leading and trailing whitespace. */
- var reTrim = /^\s+|\s+$/g,
- reTrimStart = /^\s+/,
- reTrimEnd = /\s+$/;
-
- /** Used to match wrap detail comments. */
- var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,
- reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/,
- reSplitDetails = /,? & /;
-
- /** Used to match words composed of alphanumeric characters. */
- var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
-
- /** Used to match backslashes in property paths. */
- var reEscapeChar = /\\(\\)?/g;
-
- /**
- * Used to match
- * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).
- */
- var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
-
- /** Used to match `RegExp` flags from their coerced string values. */
- var reFlags = /\w*$/;
-
- /** Used to detect bad signed hexadecimal string values. */
- var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
-
- /** Used to detect binary string values. */
- var reIsBinary = /^0b[01]+$/i;
-
- /** Used to detect host constructors (Safari). */
- var reIsHostCtor = /^\[object .+?Constructor\]$/;
-
- /** Used to detect octal string values. */
- var reIsOctal = /^0o[0-7]+$/i;
-
- /** Used to detect unsigned integer values. */
- var reIsUint = /^(?:0|[1-9]\d*)$/;
-
- /** Used to match Latin Unicode letters (excluding mathematical operators). */
- var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
-
- /** Used to ensure capturing order of template delimiters. */
- var reNoMatch = /($^)/;
-
- /** Used to match unescaped characters in compiled string literals. */
- var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
-
- /** Used to compose unicode character classes. */
- var rsAstralRange = '\\ud800-\\udfff',
- rsComboMarksRange = '\\u0300-\\u036f',
- reComboHalfMarksRange = '\\ufe20-\\ufe2f',
- rsComboSymbolsRange = '\\u20d0-\\u20ff',
- rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,
- rsDingbatRange = '\\u2700-\\u27bf',
- rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff',
- rsMathOpRange = '\\xac\\xb1\\xd7\\xf7',
- rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf',
- rsPunctuationRange = '\\u2000-\\u206f',
- rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000',
- rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde',
- rsVarRange = '\\ufe0e\\ufe0f',
- rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
-
- /** Used to compose unicode capture groups. */
- var rsApos = "['\u2019]",
- rsAstral = '[' + rsAstralRange + ']',
- rsBreak = '[' + rsBreakRange + ']',
- rsCombo = '[' + rsComboRange + ']',
- rsDigits = '\\d+',
- rsDingbat = '[' + rsDingbatRange + ']',
- rsLower = '[' + rsLowerRange + ']',
- rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',
- rsFitz = '\\ud83c[\\udffb-\\udfff]',
- rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',
- rsNonAstral = '[^' + rsAstralRange + ']',
- rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}',
- rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]',
- rsUpper = '[' + rsUpperRange + ']',
- rsZWJ = '\\u200d';
-
- /** Used to compose unicode regexes. */
- var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',
- rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',
- rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',
- rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',
- reOptMod = rsModifier + '?',
- rsOptVar = '[' + rsVarRange + ']?',
- rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',
- rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])',
- rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])',
- rsSeq = rsOptVar + reOptMod + rsOptJoin,
- rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,
- rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';
-
- /** Used to match apostrophes. */
- var reApos = RegExp(rsApos, 'g');
-
- /**
- * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and
- * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).
- */
- var reComboMark = RegExp(rsCombo, 'g');
-
- /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */
- var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');
-
- /** Used to match complex or compound words. */
- var reUnicodeWord = RegExp([
- rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',
- rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',
- rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,
- rsUpper + '+' + rsOptContrUpper,
- rsOrdUpper,
- rsOrdLower,
- rsDigits,
- rsEmoji
- ].join('|'), 'g');
-
- /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */
- var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');
-
- /** Used to detect strings that need a more robust regexp to match words. */
- var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
-
- /** Used to assign default `context` object properties. */
- var contextProps = [
- 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',
- 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',
- 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',
- 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',
- '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'
- ];
-
- /** Used to make template sourceURLs easier to identify. */
- var templateCounter = -1;
-
- /** Used to identify `toStringTag` values of typed arrays. */
- var typedArrayTags = {};
- typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
- typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
- typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
- typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
- typedArrayTags[uint32Tag] = true;
- typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
- typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
- typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =
- typedArrayTags[errorTag] = typedArrayTags[funcTag] =
- typedArrayTags[mapTag] = typedArrayTags[numberTag] =
- typedArrayTags[objectTag] = typedArrayTags[regexpTag] =
- typedArrayTags[setTag] = typedArrayTags[stringTag] =
- typedArrayTags[weakMapTag] = false;
-
- /** Used to identify `toStringTag` values supported by `_.clone`. */
- var cloneableTags = {};
- cloneableTags[argsTag] = cloneableTags[arrayTag] =
- cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =
- cloneableTags[boolTag] = cloneableTags[dateTag] =
- cloneableTags[float32Tag] = cloneableTags[float64Tag] =
- cloneableTags[int8Tag] = cloneableTags[int16Tag] =
- cloneableTags[int32Tag] = cloneableTags[mapTag] =
- cloneableTags[numberTag] = cloneableTags[objectTag] =
- cloneableTags[regexpTag] = cloneableTags[setTag] =
- cloneableTags[stringTag] = cloneableTags[symbolTag] =
- cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =
- cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
- cloneableTags[errorTag] = cloneableTags[funcTag] =
- cloneableTags[weakMapTag] = false;
-
- /** Used to map Latin Unicode letters to basic Latin letters. */
- var deburredLetters = {
- // Latin-1 Supplement block.
- '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A',
- '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a',
- '\xc7': 'C', '\xe7': 'c',
- '\xd0': 'D', '\xf0': 'd',
- '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E',
- '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e',
- '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I',
- '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i',
- '\xd1': 'N', '\xf1': 'n',
- '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O',
- '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o',
- '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U',
- '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u',
- '\xdd': 'Y', '\xfd': 'y', '\xff': 'y',
- '\xc6': 'Ae', '\xe6': 'ae',
- '\xde': 'Th', '\xfe': 'th',
- '\xdf': 'ss',
- // Latin Extended-A block.
- '\u0100': 'A', '\u0102': 'A', '\u0104': 'A',
- '\u0101': 'a', '\u0103': 'a', '\u0105': 'a',
- '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C',
- '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c',
- '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd',
- '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E',
- '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e',
- '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G',
- '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g',
- '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h',
- '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I',
- '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i',
- '\u0134': 'J', '\u0135': 'j',
- '\u0136': 'K', '\u0137': 'k', '\u0138': 'k',
- '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L',
- '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l',
- '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N',
- '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n',
- '\u014c': 'O', '\u014e': 'O', '\u0150': 'O',
- '\u014d': 'o', '\u014f': 'o', '\u0151': 'o',
- '\u0154': 'R', '\u0156': 'R', '\u0158': 'R',
- '\u0155': 'r', '\u0157': 'r', '\u0159': 'r',
- '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S',
- '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's',
- '\u0162': 'T', '\u0164': 'T', '\u0166': 'T',
- '\u0163': 't', '\u0165': 't', '\u0167': 't',
- '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U',
- '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u',
- '\u0174': 'W', '\u0175': 'w',
- '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y',
- '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z',
- '\u017a': 'z', '\u017c': 'z', '\u017e': 'z',
- '\u0132': 'IJ', '\u0133': 'ij',
- '\u0152': 'Oe', '\u0153': 'oe',
- '\u0149': "'n", '\u017f': 's'
- };
-
- /** Used to map characters to HTML entities. */
- var htmlEscapes = {
- '&': '&',
- '<': '<',
- '>': '>',
- '"': '"',
- "'": '''
- };
-
- /** Used to map HTML entities to characters. */
- var htmlUnescapes = {
- '&': '&',
- '<': '<',
- '>': '>',
- '"': '"',
- ''': "'"
- };
-
- /** Used to escape characters for inclusion in compiled string literals. */
- var stringEscapes = {
- '\\': '\\',
- "'": "'",
- '\n': 'n',
- '\r': 'r',
- '\u2028': 'u2028',
- '\u2029': 'u2029'
- };
-
- /** Built-in method references without a dependency on `root`. */
- var freeParseFloat = parseFloat,
- freeParseInt = parseInt;
-
- /** Detect free variable `global` from Node.js. */
- var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;
-
- /** Detect free variable `self`. */
- var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
-
- /** Used as a reference to the global object. */
- var root = freeGlobal || freeSelf || Function('return this')();
-
- /** Detect free variable `exports`. */
- var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;
-
- /** Detect free variable `module`. */
- var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;
-
- /** Detect the popular CommonJS extension `module.exports`. */
- var moduleExports = freeModule && freeModule.exports === freeExports;
-
- /** Detect free variable `process` from Node.js. */
- var freeProcess = moduleExports && freeGlobal.process;
-
- /** Used to access faster Node.js helpers. */
- var nodeUtil = (function() {
- try {
- // Use `util.types` for Node.js 10+.
- var types = freeModule && freeModule.require && freeModule.require('util').types;
-
- if (types) {
- return types;
- }
-
- // Legacy `process.binding('util')` for Node.js < 10.
- return freeProcess && freeProcess.binding && freeProcess.binding('util');
- } catch (e) {}
- }());
-
- /* Node.js helper references. */
- var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,
- nodeIsDate = nodeUtil && nodeUtil.isDate,
- nodeIsMap = nodeUtil && nodeUtil.isMap,
- nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,
- nodeIsSet = nodeUtil && nodeUtil.isSet,
- nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
-
- /*--------------------------------------------------------------------------*/
-
- /**
- * A faster alternative to `Function#apply`, this function invokes `func`
- * with the `this` binding of `thisArg` and the arguments of `args`.
- *
- * @private
- * @param {Function} func The function to invoke.
- * @param {*} thisArg The `this` binding of `func`.
- * @param {Array} args The arguments to invoke `func` with.
- * @returns {*} Returns the result of `func`.
- */
- function apply(func, thisArg, args) {
- switch (args.length) {
- case 0: return func.call(thisArg);
- case 1: return func.call(thisArg, args[0]);
- case 2: return func.call(thisArg, args[0], args[1]);
- case 3: return func.call(thisArg, args[0], args[1], args[2]);
- }
- return func.apply(thisArg, args);
- }
-
- /**
- * A specialized version of `baseAggregator` for arrays.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} setter The function to set `accumulator` values.
- * @param {Function} iteratee The iteratee to transform keys.
- * @param {Object} accumulator The initial aggregated object.
- * @returns {Function} Returns `accumulator`.
- */
- function arrayAggregator(array, setter, iteratee, accumulator) {
- var index = -1,
- length = array == null ? 0 : array.length;
-
- while (++index < length) {
- var value = array[index];
- setter(accumulator, value, iteratee(value), array);
- }
- return accumulator;
- }
-
- /**
- * A specialized version of `_.forEach` for arrays without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array} Returns `array`.
- */
- function arrayEach(array, iteratee) {
- var index = -1,
- length = array == null ? 0 : array.length;
-
- while (++index < length) {
- if (iteratee(array[index], index, array) === false) {
- break;
- }
- }
- return array;
- }
-
- /**
- * A specialized version of `_.forEachRight` for arrays without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array} Returns `array`.
- */
- function arrayEachRight(array, iteratee) {
- var length = array == null ? 0 : array.length;
-
- while (length--) {
- if (iteratee(array[length], length, array) === false) {
- break;
- }
- }
- return array;
- }
-
- /**
- * A specialized version of `_.every` for arrays without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} predicate The function invoked per iteration.
- * @returns {boolean} Returns `true` if all elements pass the predicate check,
- * else `false`.
- */
- function arrayEvery(array, predicate) {
- var index = -1,
- length = array == null ? 0 : array.length;
-
- while (++index < length) {
- if (!predicate(array[index], index, array)) {
- return false;
- }
- }
- return true;
- }
-
- /**
- * A specialized version of `_.filter` for arrays without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} predicate The function invoked per iteration.
- * @returns {Array} Returns the new filtered array.
- */
- function arrayFilter(array, predicate) {
- var index = -1,
- length = array == null ? 0 : array.length,
- resIndex = 0,
- result = [];
-
- while (++index < length) {
- var value = array[index];
- if (predicate(value, index, array)) {
- result[resIndex++] = value;
- }
- }
- return result;
- }
-
- /**
- * A specialized version of `_.includes` for arrays without support for
- * specifying an index to search from.
- *
- * @private
- * @param {Array} [array] The array to inspect.
- * @param {*} target The value to search for.
- * @returns {boolean} Returns `true` if `target` is found, else `false`.
- */
- function arrayIncludes(array, value) {
- var length = array == null ? 0 : array.length;
- return !!length && baseIndexOf(array, value, 0) > -1;
- }
-
- /**
- * This function is like `arrayIncludes` except that it accepts a comparator.
- *
- * @private
- * @param {Array} [array] The array to inspect.
- * @param {*} target The value to search for.
- * @param {Function} comparator The comparator invoked per element.
- * @returns {boolean} Returns `true` if `target` is found, else `false`.
- */
- function arrayIncludesWith(array, value, comparator) {
- var index = -1,
- length = array == null ? 0 : array.length;
-
- while (++index < length) {
- if (comparator(value, array[index])) {
- return true;
- }
- }
- return false;
- }
-
- /**
- * A specialized version of `_.map` for arrays without support for iteratee
- * shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array} Returns the new mapped array.
- */
- function arrayMap(array, iteratee) {
- var index = -1,
- length = array == null ? 0 : array.length,
- result = Array(length);
-
- while (++index < length) {
- result[index] = iteratee(array[index], index, array);
- }
- return result;
- }
-
- /**
- * Appends the elements of `values` to `array`.
- *
- * @private
- * @param {Array} array The array to modify.
- * @param {Array} values The values to append.
- * @returns {Array} Returns `array`.
- */
- function arrayPush(array, values) {
- var index = -1,
- length = values.length,
- offset = array.length;
-
- while (++index < length) {
- array[offset + index] = values[index];
- }
- return array;
- }
-
- /**
- * A specialized version of `_.reduce` for arrays without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @param {*} [accumulator] The initial value.
- * @param {boolean} [initAccum] Specify using the first element of `array` as
- * the initial value.
- * @returns {*} Returns the accumulated value.
- */
- function arrayReduce(array, iteratee, accumulator, initAccum) {
- var index = -1,
- length = array == null ? 0 : array.length;
-
- if (initAccum && length) {
- accumulator = array[++index];
- }
- while (++index < length) {
- accumulator = iteratee(accumulator, array[index], index, array);
- }
- return accumulator;
- }
-
- /**
- * A specialized version of `_.reduceRight` for arrays without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @param {*} [accumulator] The initial value.
- * @param {boolean} [initAccum] Specify using the last element of `array` as
- * the initial value.
- * @returns {*} Returns the accumulated value.
- */
- function arrayReduceRight(array, iteratee, accumulator, initAccum) {
- var length = array == null ? 0 : array.length;
- if (initAccum && length) {
- accumulator = array[--length];
- }
- while (length--) {
- accumulator = iteratee(accumulator, array[length], length, array);
- }
- return accumulator;
- }
-
- /**
- * A specialized version of `_.some` for arrays without support for iteratee
- * shorthands.
- *
- * @private
- * @param {Array} [array] The array to iterate over.
- * @param {Function} predicate The function invoked per iteration.
- * @returns {boolean} Returns `true` if any element passes the predicate check,
- * else `false`.
- */
- function arraySome(array, predicate) {
- var index = -1,
- length = array == null ? 0 : array.length;
-
- while (++index < length) {
- if (predicate(array[index], index, array)) {
- return true;
- }
- }
- return false;
- }
-
- /**
- * Gets the size of an ASCII `string`.
- *
- * @private
- * @param {string} string The string inspect.
- * @returns {number} Returns the string size.
- */
- var asciiSize = baseProperty('length');
-
- /**
- * Converts an ASCII `string` to an array.
- *
- * @private
- * @param {string} string The string to convert.
- * @returns {Array} Returns the converted array.
- */
- function asciiToArray(string) {
- return string.split('');
- }
-
- /**
- * Splits an ASCII `string` into an array of its words.
- *
- * @private
- * @param {string} The string to inspect.
- * @returns {Array} Returns the words of `string`.
- */
- function asciiWords(string) {
- return string.match(reAsciiWord) || [];
- }
-
- /**
- * The base implementation of methods like `_.findKey` and `_.findLastKey`,
- * without support for iteratee shorthands, which iterates over `collection`
- * using `eachFunc`.
- *
- * @private
- * @param {Array|Object} collection The collection to inspect.
- * @param {Function} predicate The function invoked per iteration.
- * @param {Function} eachFunc The function to iterate over `collection`.
- * @returns {*} Returns the found element or its key, else `undefined`.
- */
- function baseFindKey(collection, predicate, eachFunc) {
- var result;
- eachFunc(collection, function(value, key, collection) {
- if (predicate(value, key, collection)) {
- result = key;
- return false;
- }
- });
- return result;
- }
-
- /**
- * The base implementation of `_.findIndex` and `_.findLastIndex` without
- * support for iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {Function} predicate The function invoked per iteration.
- * @param {number} fromIndex The index to search from.
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {number} Returns the index of the matched value, else `-1`.
- */
- function baseFindIndex(array, predicate, fromIndex, fromRight) {
- var length = array.length,
- index = fromIndex + (fromRight ? 1 : -1);
-
- while ((fromRight ? index-- : ++index < length)) {
- if (predicate(array[index], index, array)) {
- return index;
- }
- }
- return -1;
- }
-
- /**
- * The base implementation of `_.indexOf` without `fromIndex` bounds checks.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @param {number} fromIndex The index to search from.
- * @returns {number} Returns the index of the matched value, else `-1`.
- */
- function baseIndexOf(array, value, fromIndex) {
- return value === value
- ? strictIndexOf(array, value, fromIndex)
- : baseFindIndex(array, baseIsNaN, fromIndex);
- }
-
- /**
- * This function is like `baseIndexOf` except that it accepts a comparator.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @param {number} fromIndex The index to search from.
- * @param {Function} comparator The comparator invoked per element.
- * @returns {number} Returns the index of the matched value, else `-1`.
- */
- function baseIndexOfWith(array, value, fromIndex, comparator) {
- var index = fromIndex - 1,
- length = array.length;
-
- while (++index < length) {
- if (comparator(array[index], value)) {
- return index;
- }
- }
- return -1;
- }
-
- /**
- * The base implementation of `_.isNaN` without support for number objects.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
- */
- function baseIsNaN(value) {
- return value !== value;
- }
-
- /**
- * The base implementation of `_.mean` and `_.meanBy` without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {number} Returns the mean.
- */
- function baseMean(array, iteratee) {
- var length = array == null ? 0 : array.length;
- return length ? (baseSum(array, iteratee) / length) : NAN;
- }
-
- /**
- * The base implementation of `_.property` without support for deep paths.
- *
- * @private
- * @param {string} key The key of the property to get.
- * @returns {Function} Returns the new accessor function.
- */
- function baseProperty(key) {
- return function(object) {
- return object == null ? undefined : object[key];
- };
- }
-
- /**
- * The base implementation of `_.propertyOf` without support for deep paths.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Function} Returns the new accessor function.
- */
- function basePropertyOf(object) {
- return function(key) {
- return object == null ? undefined : object[key];
- };
- }
-
- /**
- * The base implementation of `_.reduce` and `_.reduceRight`, without support
- * for iteratee shorthands, which iterates over `collection` using `eachFunc`.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @param {*} accumulator The initial value.
- * @param {boolean} initAccum Specify using the first or last element of
- * `collection` as the initial value.
- * @param {Function} eachFunc The function to iterate over `collection`.
- * @returns {*} Returns the accumulated value.
- */
- function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {
- eachFunc(collection, function(value, index, collection) {
- accumulator = initAccum
- ? (initAccum = false, value)
- : iteratee(accumulator, value, index, collection);
- });
- return accumulator;
- }
-
- /**
- * The base implementation of `_.sortBy` which uses `comparer` to define the
- * sort order of `array` and replaces criteria objects with their corresponding
- * values.
- *
- * @private
- * @param {Array} array The array to sort.
- * @param {Function} comparer The function to define sort order.
- * @returns {Array} Returns `array`.
- */
- function baseSortBy(array, comparer) {
- var length = array.length;
-
- array.sort(comparer);
- while (length--) {
- array[length] = array[length].value;
- }
- return array;
- }
-
- /**
- * The base implementation of `_.sum` and `_.sumBy` without support for
- * iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {number} Returns the sum.
- */
- function baseSum(array, iteratee) {
- var result,
- index = -1,
- length = array.length;
-
- while (++index < length) {
- var current = iteratee(array[index]);
- if (current !== undefined) {
- result = result === undefined ? current : (result + current);
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.times` without support for iteratee shorthands
- * or max array length checks.
- *
- * @private
- * @param {number} n The number of times to invoke `iteratee`.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array} Returns the array of results.
- */
- function baseTimes(n, iteratee) {
- var index = -1,
- result = Array(n);
-
- while (++index < n) {
- result[index] = iteratee(index);
- }
- return result;
- }
-
- /**
- * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array
- * of key-value pairs for `object` corresponding to the property names of `props`.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Array} props The property names to get values for.
- * @returns {Object} Returns the key-value pairs.
- */
- function baseToPairs(object, props) {
- return arrayMap(props, function(key) {
- return [key, object[key]];
- });
- }
-
- /**
- * The base implementation of `_.unary` without support for storing metadata.
- *
- * @private
- * @param {Function} func The function to cap arguments for.
- * @returns {Function} Returns the new capped function.
- */
- function baseUnary(func) {
- return function(value) {
- return func(value);
- };
- }
-
- /**
- * The base implementation of `_.values` and `_.valuesIn` which creates an
- * array of `object` property values corresponding to the property names
- * of `props`.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Array} props The property names to get values for.
- * @returns {Object} Returns the array of property values.
- */
- function baseValues(object, props) {
- return arrayMap(props, function(key) {
- return object[key];
- });
- }
-
- /**
- * Checks if a `cache` value for `key` exists.
- *
- * @private
- * @param {Object} cache The cache to query.
- * @param {string} key The key of the entry to check.
- * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
- */
- function cacheHas(cache, key) {
- return cache.has(key);
- }
-
- /**
- * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol
- * that is not found in the character symbols.
- *
- * @private
- * @param {Array} strSymbols The string symbols to inspect.
- * @param {Array} chrSymbols The character symbols to find.
- * @returns {number} Returns the index of the first unmatched string symbol.
- */
- function charsStartIndex(strSymbols, chrSymbols) {
- var index = -1,
- length = strSymbols.length;
-
- while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
- return index;
- }
-
- /**
- * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol
- * that is not found in the character symbols.
- *
- * @private
- * @param {Array} strSymbols The string symbols to inspect.
- * @param {Array} chrSymbols The character symbols to find.
- * @returns {number} Returns the index of the last unmatched string symbol.
- */
- function charsEndIndex(strSymbols, chrSymbols) {
- var index = strSymbols.length;
-
- while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
- return index;
- }
-
- /**
- * Gets the number of `placeholder` occurrences in `array`.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {*} placeholder The placeholder to search for.
- * @returns {number} Returns the placeholder count.
- */
- function countHolders(array, placeholder) {
- var length = array.length,
- result = 0;
-
- while (length--) {
- if (array[length] === placeholder) {
- ++result;
- }
- }
- return result;
- }
-
- /**
- * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A
- * letters to basic Latin letters.
- *
- * @private
- * @param {string} letter The matched letter to deburr.
- * @returns {string} Returns the deburred letter.
- */
- var deburrLetter = basePropertyOf(deburredLetters);
-
- /**
- * Used by `_.escape` to convert characters to HTML entities.
- *
- * @private
- * @param {string} chr The matched character to escape.
- * @returns {string} Returns the escaped character.
- */
- var escapeHtmlChar = basePropertyOf(htmlEscapes);
-
- /**
- * Used by `_.template` to escape characters for inclusion in compiled string literals.
- *
- * @private
- * @param {string} chr The matched character to escape.
- * @returns {string} Returns the escaped character.
- */
- function escapeStringChar(chr) {
- return '\\' + stringEscapes[chr];
- }
-
- /**
- * Gets the value at `key` of `object`.
- *
- * @private
- * @param {Object} [object] The object to query.
- * @param {string} key The key of the property to get.
- * @returns {*} Returns the property value.
- */
- function getValue(object, key) {
- return object == null ? undefined : object[key];
- }
-
- /**
- * Checks if `string` contains Unicode symbols.
- *
- * @private
- * @param {string} string The string to inspect.
- * @returns {boolean} Returns `true` if a symbol is found, else `false`.
- */
- function hasUnicode(string) {
- return reHasUnicode.test(string);
- }
-
- /**
- * Checks if `string` contains a word composed of Unicode symbols.
- *
- * @private
- * @param {string} string The string to inspect.
- * @returns {boolean} Returns `true` if a word is found, else `false`.
- */
- function hasUnicodeWord(string) {
- return reHasUnicodeWord.test(string);
- }
-
- /**
- * Converts `iterator` to an array.
- *
- * @private
- * @param {Object} iterator The iterator to convert.
- * @returns {Array} Returns the converted array.
- */
- function iteratorToArray(iterator) {
- var data,
- result = [];
-
- while (!(data = iterator.next()).done) {
- result.push(data.value);
- }
- return result;
- }
-
- /**
- * Converts `map` to its key-value pairs.
- *
- * @private
- * @param {Object} map The map to convert.
- * @returns {Array} Returns the key-value pairs.
- */
- function mapToArray(map) {
- var index = -1,
- result = Array(map.size);
-
- map.forEach(function(value, key) {
- result[++index] = [key, value];
- });
- return result;
- }
-
- /**
- * Creates a unary function that invokes `func` with its argument transformed.
- *
- * @private
- * @param {Function} func The function to wrap.
- * @param {Function} transform The argument transform.
- * @returns {Function} Returns the new function.
- */
- function overArg(func, transform) {
- return function(arg) {
- return func(transform(arg));
- };
- }
-
- /**
- * Replaces all `placeholder` elements in `array` with an internal placeholder
- * and returns an array of their indexes.
- *
- * @private
- * @param {Array} array The array to modify.
- * @param {*} placeholder The placeholder to replace.
- * @returns {Array} Returns the new array of placeholder indexes.
- */
- function replaceHolders(array, placeholder) {
- var index = -1,
- length = array.length,
- resIndex = 0,
- result = [];
-
- while (++index < length) {
- var value = array[index];
- if (value === placeholder || value === PLACEHOLDER) {
- array[index] = PLACEHOLDER;
- result[resIndex++] = index;
- }
- }
- return result;
- }
-
- /**
- * Gets the value at `key`, unless `key` is "__proto__".
- *
- * @private
- * @param {Object} object The object to query.
- * @param {string} key The key of the property to get.
- * @returns {*} Returns the property value.
- */
- function safeGet(object, key) {
- return key == '__proto__'
- ? undefined
- : object[key];
- }
-
- /**
- * Converts `set` to an array of its values.
- *
- * @private
- * @param {Object} set The set to convert.
- * @returns {Array} Returns the values.
- */
- function setToArray(set) {
- var index = -1,
- result = Array(set.size);
-
- set.forEach(function(value) {
- result[++index] = value;
- });
- return result;
- }
-
- /**
- * Converts `set` to its value-value pairs.
- *
- * @private
- * @param {Object} set The set to convert.
- * @returns {Array} Returns the value-value pairs.
- */
- function setToPairs(set) {
- var index = -1,
- result = Array(set.size);
-
- set.forEach(function(value) {
- result[++index] = [value, value];
- });
- return result;
- }
-
- /**
- * A specialized version of `_.indexOf` which performs strict equality
- * comparisons of values, i.e. `===`.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @param {number} fromIndex The index to search from.
- * @returns {number} Returns the index of the matched value, else `-1`.
- */
- function strictIndexOf(array, value, fromIndex) {
- var index = fromIndex - 1,
- length = array.length;
-
- while (++index < length) {
- if (array[index] === value) {
- return index;
- }
- }
- return -1;
- }
-
- /**
- * A specialized version of `_.lastIndexOf` which performs strict equality
- * comparisons of values, i.e. `===`.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @param {number} fromIndex The index to search from.
- * @returns {number} Returns the index of the matched value, else `-1`.
- */
- function strictLastIndexOf(array, value, fromIndex) {
- var index = fromIndex + 1;
- while (index--) {
- if (array[index] === value) {
- return index;
- }
- }
- return index;
- }
-
- /**
- * Gets the number of symbols in `string`.
- *
- * @private
- * @param {string} string The string to inspect.
- * @returns {number} Returns the string size.
- */
- function stringSize(string) {
- return hasUnicode(string)
- ? unicodeSize(string)
- : asciiSize(string);
- }
-
- /**
- * Converts `string` to an array.
- *
- * @private
- * @param {string} string The string to convert.
- * @returns {Array} Returns the converted array.
- */
- function stringToArray(string) {
- return hasUnicode(string)
- ? unicodeToArray(string)
- : asciiToArray(string);
- }
-
- /**
- * Used by `_.unescape` to convert HTML entities to characters.
- *
- * @private
- * @param {string} chr The matched character to unescape.
- * @returns {string} Returns the unescaped character.
- */
- var unescapeHtmlChar = basePropertyOf(htmlUnescapes);
-
- /**
- * Gets the size of a Unicode `string`.
- *
- * @private
- * @param {string} string The string inspect.
- * @returns {number} Returns the string size.
- */
- function unicodeSize(string) {
- var result = reUnicode.lastIndex = 0;
- while (reUnicode.test(string)) {
- ++result;
- }
- return result;
- }
-
- /**
- * Converts a Unicode `string` to an array.
- *
- * @private
- * @param {string} string The string to convert.
- * @returns {Array} Returns the converted array.
- */
- function unicodeToArray(string) {
- return string.match(reUnicode) || [];
- }
-
- /**
- * Splits a Unicode `string` into an array of its words.
- *
- * @private
- * @param {string} The string to inspect.
- * @returns {Array} Returns the words of `string`.
- */
- function unicodeWords(string) {
- return string.match(reUnicodeWord) || [];
- }
-
- /*--------------------------------------------------------------------------*/
-
- /**
- * Create a new pristine `lodash` function using the `context` object.
- *
- * @static
- * @memberOf _
- * @since 1.1.0
- * @category Util
- * @param {Object} [context=root] The context object.
- * @returns {Function} Returns a new `lodash` function.
- * @example
- *
- * _.mixin({ 'foo': _.constant('foo') });
- *
- * var lodash = _.runInContext();
- * lodash.mixin({ 'bar': lodash.constant('bar') });
- *
- * _.isFunction(_.foo);
- * // => true
- * _.isFunction(_.bar);
- * // => false
- *
- * lodash.isFunction(lodash.foo);
- * // => false
- * lodash.isFunction(lodash.bar);
- * // => true
- *
- * // Create a suped-up `defer` in Node.js.
- * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;
- */
- var runInContext = (function runInContext(context) {
- context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));
-
- /** Built-in constructor references. */
- var Array = context.Array,
- Date = context.Date,
- Error = context.Error,
- Function = context.Function,
- Math = context.Math,
- Object = context.Object,
- RegExp = context.RegExp,
- String = context.String,
- TypeError = context.TypeError;
-
- /** Used for built-in method references. */
- var arrayProto = Array.prototype,
- funcProto = Function.prototype,
- objectProto = Object.prototype;
-
- /** Used to detect overreaching core-js shims. */
- var coreJsData = context['__core-js_shared__'];
-
- /** Used to resolve the decompiled source of functions. */
- var funcToString = funcProto.toString;
-
- /** Used to check objects for own properties. */
- var hasOwnProperty = objectProto.hasOwnProperty;
-
- /** Used to generate unique IDs. */
- var idCounter = 0;
-
- /** Used to detect methods masquerading as native. */
- var maskSrcKey = (function() {
- var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
- return uid ? ('Symbol(src)_1.' + uid) : '';
- }());
-
- /**
- * Used to resolve the
- * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
- * of values.
- */
- var nativeObjectToString = objectProto.toString;
-
- /** Used to infer the `Object` constructor. */
- var objectCtorString = funcToString.call(Object);
-
- /** Used to restore the original `_` reference in `_.noConflict`. */
- var oldDash = root._;
-
- /** Used to detect if a method is native. */
- var reIsNative = RegExp('^' +
- funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
- .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
- );
-
- /** Built-in value references. */
- var Buffer = moduleExports ? context.Buffer : undefined,
- Symbol = context.Symbol,
- Uint8Array = context.Uint8Array,
- allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,
- getPrototype = overArg(Object.getPrototypeOf, Object),
- objectCreate = Object.create,
- propertyIsEnumerable = objectProto.propertyIsEnumerable,
- splice = arrayProto.splice,
- spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,
- symIterator = Symbol ? Symbol.iterator : undefined,
- symToStringTag = Symbol ? Symbol.toStringTag : undefined;
-
- var defineProperty = (function() {
- try {
- var func = getNative(Object, 'defineProperty');
- func({}, '', {});
- return func;
- } catch (e) {}
- }());
-
- /** Mocked built-ins. */
- var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,
- ctxNow = Date && Date.now !== root.Date.now && Date.now,
- ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;
-
- /* Built-in method references for those with the same name as other `lodash` methods. */
- var nativeCeil = Math.ceil,
- nativeFloor = Math.floor,
- nativeGetSymbols = Object.getOwnPropertySymbols,
- nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
- nativeIsFinite = context.isFinite,
- nativeJoin = arrayProto.join,
- nativeKeys = overArg(Object.keys, Object),
- nativeMax = Math.max,
- nativeMin = Math.min,
- nativeNow = Date.now,
- nativeParseInt = context.parseInt,
- nativeRandom = Math.random,
- nativeReverse = arrayProto.reverse;
-
- /* Built-in method references that are verified to be native. */
- var DataView = getNative(context, 'DataView'),
- Map = getNative(context, 'Map'),
- Promise = getNative(context, 'Promise'),
- Set = getNative(context, 'Set'),
- WeakMap = getNative(context, 'WeakMap'),
- nativeCreate = getNative(Object, 'create');
-
- /** Used to store function metadata. */
- var metaMap = WeakMap && new WeakMap;
-
- /** Used to lookup unminified function names. */
- var realNames = {};
-
- /** Used to detect maps, sets, and weakmaps. */
- var dataViewCtorString = toSource(DataView),
- mapCtorString = toSource(Map),
- promiseCtorString = toSource(Promise),
- setCtorString = toSource(Set),
- weakMapCtorString = toSource(WeakMap);
-
- /** Used to convert symbols to primitives and strings. */
- var symbolProto = Symbol ? Symbol.prototype : undefined,
- symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,
- symbolToString = symbolProto ? symbolProto.toString : undefined;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates a `lodash` object which wraps `value` to enable implicit method
- * chain sequences. Methods that operate on and return arrays, collections,
- * and functions can be chained together. Methods that retrieve a single value
- * or may return a primitive value will automatically end the chain sequence
- * and return the unwrapped value. Otherwise, the value must be unwrapped
- * with `_#value`.
- *
- * Explicit chain sequences, which must be unwrapped with `_#value`, may be
- * enabled using `_.chain`.
- *
- * The execution of chained methods is lazy, that is, it's deferred until
- * `_#value` is implicitly or explicitly called.
- *
- * Lazy evaluation allows several methods to support shortcut fusion.
- * Shortcut fusion is an optimization to merge iteratee calls; this avoids
- * the creation of intermediate arrays and can greatly reduce the number of
- * iteratee executions. Sections of a chain sequence qualify for shortcut
- * fusion if the section is applied to an array and iteratees accept only
- * one argument. The heuristic for whether a section qualifies for shortcut
- * fusion is subject to change.
- *
- * Chaining is supported in custom builds as long as the `_#value` method is
- * directly or indirectly included in the build.
- *
- * In addition to lodash methods, wrappers have `Array` and `String` methods.
- *
- * The wrapper `Array` methods are:
- * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`
- *
- * The wrapper `String` methods are:
- * `replace` and `split`
- *
- * The wrapper methods that support shortcut fusion are:
- * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,
- * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,
- * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`
- *
- * The chainable wrapper methods are:
- * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,
- * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,
- * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,
- * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,
- * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,
- * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,
- * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,
- * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,
- * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,
- * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,
- * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,
- * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,
- * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,
- * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,
- * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,
- * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,
- * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,
- * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,
- * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,
- * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,
- * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,
- * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,
- * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,
- * `zipObject`, `zipObjectDeep`, and `zipWith`
- *
- * The wrapper methods that are **not** chainable by default are:
- * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,
- * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,
- * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,
- * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,
- * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,
- * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,
- * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,
- * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,
- * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,
- * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,
- * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,
- * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,
- * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,
- * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,
- * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,
- * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,
- * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,
- * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,
- * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,
- * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,
- * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,
- * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,
- * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,
- * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,
- * `upperFirst`, `value`, and `words`
- *
- * @name _
- * @constructor
- * @category Seq
- * @param {*} value The value to wrap in a `lodash` instance.
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * function square(n) {
- * return n * n;
- * }
- *
- * var wrapped = _([1, 2, 3]);
- *
- * // Returns an unwrapped value.
- * wrapped.reduce(_.add);
- * // => 6
- *
- * // Returns a wrapped value.
- * var squares = wrapped.map(square);
- *
- * _.isArray(squares);
- * // => false
- *
- * _.isArray(squares.value());
- * // => true
- */
- function lodash(value) {
- if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {
- if (value instanceof LodashWrapper) {
- return value;
- }
- if (hasOwnProperty.call(value, '__wrapped__')) {
- return wrapperClone(value);
- }
- }
- return new LodashWrapper(value);
- }
-
- /**
- * The base implementation of `_.create` without support for assigning
- * properties to the created object.
- *
- * @private
- * @param {Object} proto The object to inherit from.
- * @returns {Object} Returns the new object.
- */
- var baseCreate = (function() {
- function object() {}
- return function(proto) {
- if (!isObject(proto)) {
- return {};
- }
- if (objectCreate) {
- return objectCreate(proto);
- }
- object.prototype = proto;
- var result = new object;
- object.prototype = undefined;
- return result;
- };
- }());
-
- /**
- * The function whose prototype chain sequence wrappers inherit from.
- *
- * @private
- */
- function baseLodash() {
- // No operation performed.
- }
-
- /**
- * The base constructor for creating `lodash` wrapper objects.
- *
- * @private
- * @param {*} value The value to wrap.
- * @param {boolean} [chainAll] Enable explicit method chain sequences.
- */
- function LodashWrapper(value, chainAll) {
- this.__wrapped__ = value;
- this.__actions__ = [];
- this.__chain__ = !!chainAll;
- this.__index__ = 0;
- this.__values__ = undefined;
- }
-
- /**
- * By default, the template delimiters used by lodash are like those in
- * embedded Ruby (ERB) as well as ES2015 template strings. Change the
- * following template settings to use alternative delimiters.
- *
- * @static
- * @memberOf _
- * @type {Object}
- */
- lodash.templateSettings = {
-
- /**
- * Used to detect `data` property values to be HTML-escaped.
- *
- * @memberOf _.templateSettings
- * @type {RegExp}
- */
- 'escape': reEscape,
-
- /**
- * Used to detect code to be evaluated.
- *
- * @memberOf _.templateSettings
- * @type {RegExp}
- */
- 'evaluate': reEvaluate,
-
- /**
- * Used to detect `data` property values to inject.
- *
- * @memberOf _.templateSettings
- * @type {RegExp}
- */
- 'interpolate': reInterpolate,
-
- /**
- * Used to reference the data object in the template text.
- *
- * @memberOf _.templateSettings
- * @type {string}
- */
- 'variable': '',
-
- /**
- * Used to import variables into the compiled template.
- *
- * @memberOf _.templateSettings
- * @type {Object}
- */
- 'imports': {
-
- /**
- * A reference to the `lodash` function.
- *
- * @memberOf _.templateSettings.imports
- * @type {Function}
- */
- '_': lodash
- }
- };
-
- // Ensure wrappers are instances of `baseLodash`.
- lodash.prototype = baseLodash.prototype;
- lodash.prototype.constructor = lodash;
-
- LodashWrapper.prototype = baseCreate(baseLodash.prototype);
- LodashWrapper.prototype.constructor = LodashWrapper;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.
- *
- * @private
- * @constructor
- * @param {*} value The value to wrap.
- */
- function LazyWrapper(value) {
- this.__wrapped__ = value;
- this.__actions__ = [];
- this.__dir__ = 1;
- this.__filtered__ = false;
- this.__iteratees__ = [];
- this.__takeCount__ = MAX_ARRAY_LENGTH;
- this.__views__ = [];
- }
-
- /**
- * Creates a clone of the lazy wrapper object.
- *
- * @private
- * @name clone
- * @memberOf LazyWrapper
- * @returns {Object} Returns the cloned `LazyWrapper` object.
- */
- function lazyClone() {
- var result = new LazyWrapper(this.__wrapped__);
- result.__actions__ = copyArray(this.__actions__);
- result.__dir__ = this.__dir__;
- result.__filtered__ = this.__filtered__;
- result.__iteratees__ = copyArray(this.__iteratees__);
- result.__takeCount__ = this.__takeCount__;
- result.__views__ = copyArray(this.__views__);
- return result;
- }
-
- /**
- * Reverses the direction of lazy iteration.
- *
- * @private
- * @name reverse
- * @memberOf LazyWrapper
- * @returns {Object} Returns the new reversed `LazyWrapper` object.
- */
- function lazyReverse() {
- if (this.__filtered__) {
- var result = new LazyWrapper(this);
- result.__dir__ = -1;
- result.__filtered__ = true;
- } else {
- result = this.clone();
- result.__dir__ *= -1;
- }
- return result;
- }
-
- /**
- * Extracts the unwrapped value from its lazy wrapper.
- *
- * @private
- * @name value
- * @memberOf LazyWrapper
- * @returns {*} Returns the unwrapped value.
- */
- function lazyValue() {
- var array = this.__wrapped__.value(),
- dir = this.__dir__,
- isArr = isArray(array),
- isRight = dir < 0,
- arrLength = isArr ? array.length : 0,
- view = getView(0, arrLength, this.__views__),
- start = view.start,
- end = view.end,
- length = end - start,
- index = isRight ? end : (start - 1),
- iteratees = this.__iteratees__,
- iterLength = iteratees.length,
- resIndex = 0,
- takeCount = nativeMin(length, this.__takeCount__);
-
- if (!isArr || (!isRight && arrLength == length && takeCount == length)) {
- return baseWrapperValue(array, this.__actions__);
- }
- var result = [];
-
- outer:
- while (length-- && resIndex < takeCount) {
- index += dir;
-
- var iterIndex = -1,
- value = array[index];
-
- while (++iterIndex < iterLength) {
- var data = iteratees[iterIndex],
- iteratee = data.iteratee,
- type = data.type,
- computed = iteratee(value);
-
- if (type == LAZY_MAP_FLAG) {
- value = computed;
- } else if (!computed) {
- if (type == LAZY_FILTER_FLAG) {
- continue outer;
- } else {
- break outer;
- }
- }
- }
- result[resIndex++] = value;
- }
- return result;
- }
-
- // Ensure `LazyWrapper` is an instance of `baseLodash`.
- LazyWrapper.prototype = baseCreate(baseLodash.prototype);
- LazyWrapper.prototype.constructor = LazyWrapper;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates a hash object.
- *
- * @private
- * @constructor
- * @param {Array} [entries] The key-value pairs to cache.
- */
- function Hash(entries) {
- var index = -1,
- length = entries == null ? 0 : entries.length;
-
- this.clear();
- while (++index < length) {
- var entry = entries[index];
- this.set(entry[0], entry[1]);
- }
- }
-
- /**
- * Removes all key-value entries from the hash.
- *
- * @private
- * @name clear
- * @memberOf Hash
- */
- function hashClear() {
- this.__data__ = nativeCreate ? nativeCreate(null) : {};
- this.size = 0;
- }
-
- /**
- * Removes `key` and its value from the hash.
- *
- * @private
- * @name delete
- * @memberOf Hash
- * @param {Object} hash The hash to modify.
- * @param {string} key The key of the value to remove.
- * @returns {boolean} Returns `true` if the entry was removed, else `false`.
- */
- function hashDelete(key) {
- var result = this.has(key) && delete this.__data__[key];
- this.size -= result ? 1 : 0;
- return result;
- }
-
- /**
- * Gets the hash value for `key`.
- *
- * @private
- * @name get
- * @memberOf Hash
- * @param {string} key The key of the value to get.
- * @returns {*} Returns the entry value.
- */
- function hashGet(key) {
- var data = this.__data__;
- if (nativeCreate) {
- var result = data[key];
- return result === HASH_UNDEFINED ? undefined : result;
- }
- return hasOwnProperty.call(data, key) ? data[key] : undefined;
- }
-
- /**
- * Checks if a hash value for `key` exists.
- *
- * @private
- * @name has
- * @memberOf Hash
- * @param {string} key The key of the entry to check.
- * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
- */
- function hashHas(key) {
- var data = this.__data__;
- return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);
- }
-
- /**
- * Sets the hash `key` to `value`.
- *
- * @private
- * @name set
- * @memberOf Hash
- * @param {string} key The key of the value to set.
- * @param {*} value The value to set.
- * @returns {Object} Returns the hash instance.
- */
- function hashSet(key, value) {
- var data = this.__data__;
- this.size += this.has(key) ? 0 : 1;
- data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
- return this;
- }
-
- // Add methods to `Hash`.
- Hash.prototype.clear = hashClear;
- Hash.prototype['delete'] = hashDelete;
- Hash.prototype.get = hashGet;
- Hash.prototype.has = hashHas;
- Hash.prototype.set = hashSet;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates an list cache object.
- *
- * @private
- * @constructor
- * @param {Array} [entries] The key-value pairs to cache.
- */
- function ListCache(entries) {
- var index = -1,
- length = entries == null ? 0 : entries.length;
-
- this.clear();
- while (++index < length) {
- var entry = entries[index];
- this.set(entry[0], entry[1]);
- }
- }
-
- /**
- * Removes all key-value entries from the list cache.
- *
- * @private
- * @name clear
- * @memberOf ListCache
- */
- function listCacheClear() {
- this.__data__ = [];
- this.size = 0;
- }
-
- /**
- * Removes `key` and its value from the list cache.
- *
- * @private
- * @name delete
- * @memberOf ListCache
- * @param {string} key The key of the value to remove.
- * @returns {boolean} Returns `true` if the entry was removed, else `false`.
- */
- function listCacheDelete(key) {
- var data = this.__data__,
- index = assocIndexOf(data, key);
-
- if (index < 0) {
- return false;
- }
- var lastIndex = data.length - 1;
- if (index == lastIndex) {
- data.pop();
- } else {
- splice.call(data, index, 1);
- }
- --this.size;
- return true;
- }
-
- /**
- * Gets the list cache value for `key`.
- *
- * @private
- * @name get
- * @memberOf ListCache
- * @param {string} key The key of the value to get.
- * @returns {*} Returns the entry value.
- */
- function listCacheGet(key) {
- var data = this.__data__,
- index = assocIndexOf(data, key);
-
- return index < 0 ? undefined : data[index][1];
- }
-
- /**
- * Checks if a list cache value for `key` exists.
- *
- * @private
- * @name has
- * @memberOf ListCache
- * @param {string} key The key of the entry to check.
- * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
- */
- function listCacheHas(key) {
- return assocIndexOf(this.__data__, key) > -1;
- }
-
- /**
- * Sets the list cache `key` to `value`.
- *
- * @private
- * @name set
- * @memberOf ListCache
- * @param {string} key The key of the value to set.
- * @param {*} value The value to set.
- * @returns {Object} Returns the list cache instance.
- */
- function listCacheSet(key, value) {
- var data = this.__data__,
- index = assocIndexOf(data, key);
-
- if (index < 0) {
- ++this.size;
- data.push([key, value]);
- } else {
- data[index][1] = value;
- }
- return this;
- }
-
- // Add methods to `ListCache`.
- ListCache.prototype.clear = listCacheClear;
- ListCache.prototype['delete'] = listCacheDelete;
- ListCache.prototype.get = listCacheGet;
- ListCache.prototype.has = listCacheHas;
- ListCache.prototype.set = listCacheSet;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates a map cache object to store key-value pairs.
- *
- * @private
- * @constructor
- * @param {Array} [entries] The key-value pairs to cache.
- */
- function MapCache(entries) {
- var index = -1,
- length = entries == null ? 0 : entries.length;
-
- this.clear();
- while (++index < length) {
- var entry = entries[index];
- this.set(entry[0], entry[1]);
- }
- }
-
- /**
- * Removes all key-value entries from the map.
- *
- * @private
- * @name clear
- * @memberOf MapCache
- */
- function mapCacheClear() {
- this.size = 0;
- this.__data__ = {
- 'hash': new Hash,
- 'map': new (Map || ListCache),
- 'string': new Hash
- };
- }
-
- /**
- * Removes `key` and its value from the map.
- *
- * @private
- * @name delete
- * @memberOf MapCache
- * @param {string} key The key of the value to remove.
- * @returns {boolean} Returns `true` if the entry was removed, else `false`.
- */
- function mapCacheDelete(key) {
- var result = getMapData(this, key)['delete'](key);
- this.size -= result ? 1 : 0;
- return result;
- }
-
- /**
- * Gets the map value for `key`.
- *
- * @private
- * @name get
- * @memberOf MapCache
- * @param {string} key The key of the value to get.
- * @returns {*} Returns the entry value.
- */
- function mapCacheGet(key) {
- return getMapData(this, key).get(key);
- }
-
- /**
- * Checks if a map value for `key` exists.
- *
- * @private
- * @name has
- * @memberOf MapCache
- * @param {string} key The key of the entry to check.
- * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
- */
- function mapCacheHas(key) {
- return getMapData(this, key).has(key);
- }
-
- /**
- * Sets the map `key` to `value`.
- *
- * @private
- * @name set
- * @memberOf MapCache
- * @param {string} key The key of the value to set.
- * @param {*} value The value to set.
- * @returns {Object} Returns the map cache instance.
- */
- function mapCacheSet(key, value) {
- var data = getMapData(this, key),
- size = data.size;
-
- data.set(key, value);
- this.size += data.size == size ? 0 : 1;
- return this;
- }
-
- // Add methods to `MapCache`.
- MapCache.prototype.clear = mapCacheClear;
- MapCache.prototype['delete'] = mapCacheDelete;
- MapCache.prototype.get = mapCacheGet;
- MapCache.prototype.has = mapCacheHas;
- MapCache.prototype.set = mapCacheSet;
-
- /*------------------------------------------------------------------------*/
-
- /**
- *
- * Creates an array cache object to store unique values.
- *
- * @private
- * @constructor
- * @param {Array} [values] The values to cache.
- */
- function SetCache(values) {
- var index = -1,
- length = values == null ? 0 : values.length;
-
- this.__data__ = new MapCache;
- while (++index < length) {
- this.add(values[index]);
- }
- }
-
- /**
- * Adds `value` to the array cache.
- *
- * @private
- * @name add
- * @memberOf SetCache
- * @alias push
- * @param {*} value The value to cache.
- * @returns {Object} Returns the cache instance.
- */
- function setCacheAdd(value) {
- this.__data__.set(value, HASH_UNDEFINED);
- return this;
- }
-
- /**
- * Checks if `value` is in the array cache.
- *
- * @private
- * @name has
- * @memberOf SetCache
- * @param {*} value The value to search for.
- * @returns {number} Returns `true` if `value` is found, else `false`.
- */
- function setCacheHas(value) {
- return this.__data__.has(value);
- }
-
- // Add methods to `SetCache`.
- SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
- SetCache.prototype.has = setCacheHas;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates a stack cache object to store key-value pairs.
- *
- * @private
- * @constructor
- * @param {Array} [entries] The key-value pairs to cache.
- */
- function Stack(entries) {
- var data = this.__data__ = new ListCache(entries);
- this.size = data.size;
- }
-
- /**
- * Removes all key-value entries from the stack.
- *
- * @private
- * @name clear
- * @memberOf Stack
- */
- function stackClear() {
- this.__data__ = new ListCache;
- this.size = 0;
- }
-
- /**
- * Removes `key` and its value from the stack.
- *
- * @private
- * @name delete
- * @memberOf Stack
- * @param {string} key The key of the value to remove.
- * @returns {boolean} Returns `true` if the entry was removed, else `false`.
- */
- function stackDelete(key) {
- var data = this.__data__,
- result = data['delete'](key);
-
- this.size = data.size;
- return result;
- }
-
- /**
- * Gets the stack value for `key`.
- *
- * @private
- * @name get
- * @memberOf Stack
- * @param {string} key The key of the value to get.
- * @returns {*} Returns the entry value.
- */
- function stackGet(key) {
- return this.__data__.get(key);
- }
-
- /**
- * Checks if a stack value for `key` exists.
- *
- * @private
- * @name has
- * @memberOf Stack
- * @param {string} key The key of the entry to check.
- * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
- */
- function stackHas(key) {
- return this.__data__.has(key);
- }
-
- /**
- * Sets the stack `key` to `value`.
- *
- * @private
- * @name set
- * @memberOf Stack
- * @param {string} key The key of the value to set.
- * @param {*} value The value to set.
- * @returns {Object} Returns the stack cache instance.
- */
- function stackSet(key, value) {
- var data = this.__data__;
- if (data instanceof ListCache) {
- var pairs = data.__data__;
- if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {
- pairs.push([key, value]);
- this.size = ++data.size;
- return this;
- }
- data = this.__data__ = new MapCache(pairs);
- }
- data.set(key, value);
- this.size = data.size;
- return this;
- }
-
- // Add methods to `Stack`.
- Stack.prototype.clear = stackClear;
- Stack.prototype['delete'] = stackDelete;
- Stack.prototype.get = stackGet;
- Stack.prototype.has = stackHas;
- Stack.prototype.set = stackSet;
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates an array of the enumerable property names of the array-like `value`.
- *
- * @private
- * @param {*} value The value to query.
- * @param {boolean} inherited Specify returning inherited property names.
- * @returns {Array} Returns the array of property names.
- */
- function arrayLikeKeys(value, inherited) {
- var isArr = isArray(value),
- isArg = !isArr && isArguments(value),
- isBuff = !isArr && !isArg && isBuffer(value),
- isType = !isArr && !isArg && !isBuff && isTypedArray(value),
- skipIndexes = isArr || isArg || isBuff || isType,
- result = skipIndexes ? baseTimes(value.length, String) : [],
- length = result.length;
-
- for (var key in value) {
- if ((inherited || hasOwnProperty.call(value, key)) &&
- !(skipIndexes && (
- // Safari 9 has enumerable `arguments.length` in strict mode.
- key == 'length' ||
- // Node.js 0.10 has enumerable non-index properties on buffers.
- (isBuff && (key == 'offset' || key == 'parent')) ||
- // PhantomJS 2 has enumerable non-index properties on typed arrays.
- (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||
- // Skip index properties.
- isIndex(key, length)
- ))) {
- result.push(key);
- }
- }
- return result;
- }
-
- /**
- * A specialized version of `_.sample` for arrays.
- *
- * @private
- * @param {Array} array The array to sample.
- * @returns {*} Returns the random element.
- */
- function arraySample(array) {
- var length = array.length;
- return length ? array[baseRandom(0, length - 1)] : undefined;
- }
-
- /**
- * A specialized version of `_.sampleSize` for arrays.
- *
- * @private
- * @param {Array} array The array to sample.
- * @param {number} n The number of elements to sample.
- * @returns {Array} Returns the random elements.
- */
- function arraySampleSize(array, n) {
- return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));
- }
-
- /**
- * A specialized version of `_.shuffle` for arrays.
- *
- * @private
- * @param {Array} array The array to shuffle.
- * @returns {Array} Returns the new shuffled array.
- */
- function arrayShuffle(array) {
- return shuffleSelf(copyArray(array));
- }
-
- /**
- * This function is like `assignValue` except that it doesn't assign
- * `undefined` values.
- *
- * @private
- * @param {Object} object The object to modify.
- * @param {string} key The key of the property to assign.
- * @param {*} value The value to assign.
- */
- function assignMergeValue(object, key, value) {
- if ((value !== undefined && !eq(object[key], value)) ||
- (value === undefined && !(key in object))) {
- baseAssignValue(object, key, value);
- }
- }
-
- /**
- * Assigns `value` to `key` of `object` if the existing value is not equivalent
- * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons.
- *
- * @private
- * @param {Object} object The object to modify.
- * @param {string} key The key of the property to assign.
- * @param {*} value The value to assign.
- */
- function assignValue(object, key, value) {
- var objValue = object[key];
- if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||
- (value === undefined && !(key in object))) {
- baseAssignValue(object, key, value);
- }
- }
-
- /**
- * Gets the index at which the `key` is found in `array` of key-value pairs.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {*} key The key to search for.
- * @returns {number} Returns the index of the matched value, else `-1`.
- */
- function assocIndexOf(array, key) {
- var length = array.length;
- while (length--) {
- if (eq(array[length][0], key)) {
- return length;
- }
- }
- return -1;
- }
-
- /**
- * Aggregates elements of `collection` on `accumulator` with keys transformed
- * by `iteratee` and values set by `setter`.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} setter The function to set `accumulator` values.
- * @param {Function} iteratee The iteratee to transform keys.
- * @param {Object} accumulator The initial aggregated object.
- * @returns {Function} Returns `accumulator`.
- */
- function baseAggregator(collection, setter, iteratee, accumulator) {
- baseEach(collection, function(value, key, collection) {
- setter(accumulator, value, iteratee(value), collection);
- });
- return accumulator;
- }
-
- /**
- * The base implementation of `_.assign` without support for multiple sources
- * or `customizer` functions.
- *
- * @private
- * @param {Object} object The destination object.
- * @param {Object} source The source object.
- * @returns {Object} Returns `object`.
- */
- function baseAssign(object, source) {
- return object && copyObject(source, keys(source), object);
- }
-
- /**
- * The base implementation of `_.assignIn` without support for multiple sources
- * or `customizer` functions.
- *
- * @private
- * @param {Object} object The destination object.
- * @param {Object} source The source object.
- * @returns {Object} Returns `object`.
- */
- function baseAssignIn(object, source) {
- return object && copyObject(source, keysIn(source), object);
- }
-
- /**
- * The base implementation of `assignValue` and `assignMergeValue` without
- * value checks.
- *
- * @private
- * @param {Object} object The object to modify.
- * @param {string} key The key of the property to assign.
- * @param {*} value The value to assign.
- */
- function baseAssignValue(object, key, value) {
- if (key == '__proto__' && defineProperty) {
- defineProperty(object, key, {
- 'configurable': true,
- 'enumerable': true,
- 'value': value,
- 'writable': true
- });
- } else {
- object[key] = value;
- }
- }
-
- /**
- * The base implementation of `_.at` without support for individual paths.
- *
- * @private
- * @param {Object} object The object to iterate over.
- * @param {string[]} paths The property paths to pick.
- * @returns {Array} Returns the picked elements.
- */
- function baseAt(object, paths) {
- var index = -1,
- length = paths.length,
- result = Array(length),
- skip = object == null;
-
- while (++index < length) {
- result[index] = skip ? undefined : get(object, paths[index]);
- }
- return result;
- }
-
- /**
- * The base implementation of `_.clamp` which doesn't coerce arguments.
- *
- * @private
- * @param {number} number The number to clamp.
- * @param {number} [lower] The lower bound.
- * @param {number} upper The upper bound.
- * @returns {number} Returns the clamped number.
- */
- function baseClamp(number, lower, upper) {
- if (number === number) {
- if (upper !== undefined) {
- number = number <= upper ? number : upper;
- }
- if (lower !== undefined) {
- number = number >= lower ? number : lower;
- }
- }
- return number;
- }
-
- /**
- * The base implementation of `_.clone` and `_.cloneDeep` which tracks
- * traversed objects.
- *
- * @private
- * @param {*} value The value to clone.
- * @param {boolean} bitmask The bitmask flags.
- * 1 - Deep clone
- * 2 - Flatten inherited properties
- * 4 - Clone symbols
- * @param {Function} [customizer] The function to customize cloning.
- * @param {string} [key] The key of `value`.
- * @param {Object} [object] The parent object of `value`.
- * @param {Object} [stack] Tracks traversed objects and their clone counterparts.
- * @returns {*} Returns the cloned value.
- */
- function baseClone(value, bitmask, customizer, key, object, stack) {
- var result,
- isDeep = bitmask & CLONE_DEEP_FLAG,
- isFlat = bitmask & CLONE_FLAT_FLAG,
- isFull = bitmask & CLONE_SYMBOLS_FLAG;
-
- if (customizer) {
- result = object ? customizer(value, key, object, stack) : customizer(value);
- }
- if (result !== undefined) {
- return result;
- }
- if (!isObject(value)) {
- return value;
- }
- var isArr = isArray(value);
- if (isArr) {
- result = initCloneArray(value);
- if (!isDeep) {
- return copyArray(value, result);
- }
- } else {
- var tag = getTag(value),
- isFunc = tag == funcTag || tag == genTag;
-
- if (isBuffer(value)) {
- return cloneBuffer(value, isDeep);
- }
- if (tag == objectTag || tag == argsTag || (isFunc && !object)) {
- result = (isFlat || isFunc) ? {} : initCloneObject(value);
- if (!isDeep) {
- return isFlat
- ? copySymbolsIn(value, baseAssignIn(result, value))
- : copySymbols(value, baseAssign(result, value));
- }
- } else {
- if (!cloneableTags[tag]) {
- return object ? value : {};
- }
- result = initCloneByTag(value, tag, isDeep);
- }
- }
- // Check for circular references and return its corresponding clone.
- stack || (stack = new Stack);
- var stacked = stack.get(value);
- if (stacked) {
- return stacked;
- }
- stack.set(value, result);
-
- if (isSet(value)) {
- value.forEach(function(subValue) {
- result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
- });
-
- return result;
- }
-
- if (isMap(value)) {
- value.forEach(function(subValue, key) {
- result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));
- });
-
- return result;
- }
-
- var keysFunc = isFull
- ? (isFlat ? getAllKeysIn : getAllKeys)
- : (isFlat ? keysIn : keys);
-
- var props = isArr ? undefined : keysFunc(value);
- arrayEach(props || value, function(subValue, key) {
- if (props) {
- key = subValue;
- subValue = value[key];
- }
- // Recursively populate clone (susceptible to call stack limits).
- assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
- });
- return result;
- }
-
- /**
- * The base implementation of `_.conforms` which doesn't clone `source`.
- *
- * @private
- * @param {Object} source The object of property predicates to conform to.
- * @returns {Function} Returns the new spec function.
- */
- function baseConforms(source) {
- var props = keys(source);
- return function(object) {
- return baseConformsTo(object, source, props);
- };
- }
-
- /**
- * The base implementation of `_.conformsTo` which accepts `props` to check.
- *
- * @private
- * @param {Object} object The object to inspect.
- * @param {Object} source The object of property predicates to conform to.
- * @returns {boolean} Returns `true` if `object` conforms, else `false`.
- */
- function baseConformsTo(object, source, props) {
- var length = props.length;
- if (object == null) {
- return !length;
- }
- object = Object(object);
- while (length--) {
- var key = props[length],
- predicate = source[key],
- value = object[key];
-
- if ((value === undefined && !(key in object)) || !predicate(value)) {
- return false;
- }
- }
- return true;
- }
-
- /**
- * The base implementation of `_.delay` and `_.defer` which accepts `args`
- * to provide to `func`.
- *
- * @private
- * @param {Function} func The function to delay.
- * @param {number} wait The number of milliseconds to delay invocation.
- * @param {Array} args The arguments to provide to `func`.
- * @returns {number|Object} Returns the timer id or timeout object.
- */
- function baseDelay(func, wait, args) {
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- return setTimeout(function() { func.apply(undefined, args); }, wait);
- }
-
- /**
- * The base implementation of methods like `_.difference` without support
- * for excluding multiple arrays or iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {Array} values The values to exclude.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of filtered values.
- */
- function baseDifference(array, values, iteratee, comparator) {
- var index = -1,
- includes = arrayIncludes,
- isCommon = true,
- length = array.length,
- result = [],
- valuesLength = values.length;
-
- if (!length) {
- return result;
- }
- if (iteratee) {
- values = arrayMap(values, baseUnary(iteratee));
- }
- if (comparator) {
- includes = arrayIncludesWith;
- isCommon = false;
- }
- else if (values.length >= LARGE_ARRAY_SIZE) {
- includes = cacheHas;
- isCommon = false;
- values = new SetCache(values);
- }
- outer:
- while (++index < length) {
- var value = array[index],
- computed = iteratee == null ? value : iteratee(value);
-
- value = (comparator || value !== 0) ? value : 0;
- if (isCommon && computed === computed) {
- var valuesIndex = valuesLength;
- while (valuesIndex--) {
- if (values[valuesIndex] === computed) {
- continue outer;
- }
- }
- result.push(value);
- }
- else if (!includes(values, computed, comparator)) {
- result.push(value);
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.forEach` without support for iteratee shorthands.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array|Object} Returns `collection`.
- */
- var baseEach = createBaseEach(baseForOwn);
-
- /**
- * The base implementation of `_.forEachRight` without support for iteratee shorthands.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array|Object} Returns `collection`.
- */
- var baseEachRight = createBaseEach(baseForOwnRight, true);
-
- /**
- * The base implementation of `_.every` without support for iteratee shorthands.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} predicate The function invoked per iteration.
- * @returns {boolean} Returns `true` if all elements pass the predicate check,
- * else `false`
- */
- function baseEvery(collection, predicate) {
- var result = true;
- baseEach(collection, function(value, index, collection) {
- result = !!predicate(value, index, collection);
- return result;
- });
- return result;
- }
-
- /**
- * The base implementation of methods like `_.max` and `_.min` which accepts a
- * `comparator` to determine the extremum value.
- *
- * @private
- * @param {Array} array The array to iterate over.
- * @param {Function} iteratee The iteratee invoked per iteration.
- * @param {Function} comparator The comparator used to compare values.
- * @returns {*} Returns the extremum value.
- */
- function baseExtremum(array, iteratee, comparator) {
- var index = -1,
- length = array.length;
-
- while (++index < length) {
- var value = array[index],
- current = iteratee(value);
-
- if (current != null && (computed === undefined
- ? (current === current && !isSymbol(current))
- : comparator(current, computed)
- )) {
- var computed = current,
- result = value;
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.fill` without an iteratee call guard.
- *
- * @private
- * @param {Array} array The array to fill.
- * @param {*} value The value to fill `array` with.
- * @param {number} [start=0] The start position.
- * @param {number} [end=array.length] The end position.
- * @returns {Array} Returns `array`.
- */
- function baseFill(array, value, start, end) {
- var length = array.length;
-
- start = toInteger(start);
- if (start < 0) {
- start = -start > length ? 0 : (length + start);
- }
- end = (end === undefined || end > length) ? length : toInteger(end);
- if (end < 0) {
- end += length;
- }
- end = start > end ? 0 : toLength(end);
- while (start < end) {
- array[start++] = value;
- }
- return array;
- }
-
- /**
- * The base implementation of `_.filter` without support for iteratee shorthands.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} predicate The function invoked per iteration.
- * @returns {Array} Returns the new filtered array.
- */
- function baseFilter(collection, predicate) {
- var result = [];
- baseEach(collection, function(value, index, collection) {
- if (predicate(value, index, collection)) {
- result.push(value);
- }
- });
- return result;
- }
-
- /**
- * The base implementation of `_.flatten` with support for restricting flattening.
- *
- * @private
- * @param {Array} array The array to flatten.
- * @param {number} depth The maximum recursion depth.
- * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
- * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
- * @param {Array} [result=[]] The initial result value.
- * @returns {Array} Returns the new flattened array.
- */
- function baseFlatten(array, depth, predicate, isStrict, result) {
- var index = -1,
- length = array.length;
-
- predicate || (predicate = isFlattenable);
- result || (result = []);
-
- while (++index < length) {
- var value = array[index];
- if (depth > 0 && predicate(value)) {
- if (depth > 1) {
- // Recursively flatten arrays (susceptible to call stack limits).
- baseFlatten(value, depth - 1, predicate, isStrict, result);
- } else {
- arrayPush(result, value);
- }
- } else if (!isStrict) {
- result[result.length] = value;
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `baseForOwn` which iterates over `object`
- * properties returned by `keysFunc` and invokes `iteratee` for each property.
- * Iteratee functions may exit iteration early by explicitly returning `false`.
- *
- * @private
- * @param {Object} object The object to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @param {Function} keysFunc The function to get the keys of `object`.
- * @returns {Object} Returns `object`.
- */
- var baseFor = createBaseFor();
-
- /**
- * This function is like `baseFor` except that it iterates over properties
- * in the opposite order.
- *
- * @private
- * @param {Object} object The object to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @param {Function} keysFunc The function to get the keys of `object`.
- * @returns {Object} Returns `object`.
- */
- var baseForRight = createBaseFor(true);
-
- /**
- * The base implementation of `_.forOwn` without support for iteratee shorthands.
- *
- * @private
- * @param {Object} object The object to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Object} Returns `object`.
- */
- function baseForOwn(object, iteratee) {
- return object && baseFor(object, iteratee, keys);
- }
-
- /**
- * The base implementation of `_.forOwnRight` without support for iteratee shorthands.
- *
- * @private
- * @param {Object} object The object to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Object} Returns `object`.
- */
- function baseForOwnRight(object, iteratee) {
- return object && baseForRight(object, iteratee, keys);
- }
-
- /**
- * The base implementation of `_.functions` which creates an array of
- * `object` function property names filtered from `props`.
- *
- * @private
- * @param {Object} object The object to inspect.
- * @param {Array} props The property names to filter.
- * @returns {Array} Returns the function names.
- */
- function baseFunctions(object, props) {
- return arrayFilter(props, function(key) {
- return isFunction(object[key]);
- });
- }
-
- /**
- * The base implementation of `_.get` without support for default values.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Array|string} path The path of the property to get.
- * @returns {*} Returns the resolved value.
- */
- function baseGet(object, path) {
- path = castPath(path, object);
-
- var index = 0,
- length = path.length;
-
- while (object != null && index < length) {
- object = object[toKey(path[index++])];
- }
- return (index && index == length) ? object : undefined;
- }
-
- /**
- * The base implementation of `getAllKeys` and `getAllKeysIn` which uses
- * `keysFunc` and `symbolsFunc` to get the enumerable property names and
- * symbols of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Function} keysFunc The function to get the keys of `object`.
- * @param {Function} symbolsFunc The function to get the symbols of `object`.
- * @returns {Array} Returns the array of property names and symbols.
- */
- function baseGetAllKeys(object, keysFunc, symbolsFunc) {
- var result = keysFunc(object);
- return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
- }
-
- /**
- * The base implementation of `getTag` without fallbacks for buggy environments.
- *
- * @private
- * @param {*} value The value to query.
- * @returns {string} Returns the `toStringTag`.
- */
- function baseGetTag(value) {
- if (value == null) {
- return value === undefined ? undefinedTag : nullTag;
- }
- return (symToStringTag && symToStringTag in Object(value))
- ? getRawTag(value)
- : objectToString(value);
- }
-
- /**
- * The base implementation of `_.gt` which doesn't coerce arguments.
- *
- * @private
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if `value` is greater than `other`,
- * else `false`.
- */
- function baseGt(value, other) {
- return value > other;
- }
-
- /**
- * The base implementation of `_.has` without support for deep paths.
- *
- * @private
- * @param {Object} [object] The object to query.
- * @param {Array|string} key The key to check.
- * @returns {boolean} Returns `true` if `key` exists, else `false`.
- */
- function baseHas(object, key) {
- return object != null && hasOwnProperty.call(object, key);
- }
-
- /**
- * The base implementation of `_.hasIn` without support for deep paths.
- *
- * @private
- * @param {Object} [object] The object to query.
- * @param {Array|string} key The key to check.
- * @returns {boolean} Returns `true` if `key` exists, else `false`.
- */
- function baseHasIn(object, key) {
- return object != null && key in Object(object);
- }
-
- /**
- * The base implementation of `_.inRange` which doesn't coerce arguments.
- *
- * @private
- * @param {number} number The number to check.
- * @param {number} start The start of the range.
- * @param {number} end The end of the range.
- * @returns {boolean} Returns `true` if `number` is in the range, else `false`.
- */
- function baseInRange(number, start, end) {
- return number >= nativeMin(start, end) && number < nativeMax(start, end);
- }
-
- /**
- * The base implementation of methods like `_.intersection`, without support
- * for iteratee shorthands, that accepts an array of arrays to inspect.
- *
- * @private
- * @param {Array} arrays The arrays to inspect.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of shared values.
- */
- function baseIntersection(arrays, iteratee, comparator) {
- var includes = comparator ? arrayIncludesWith : arrayIncludes,
- length = arrays[0].length,
- othLength = arrays.length,
- othIndex = othLength,
- caches = Array(othLength),
- maxLength = Infinity,
- result = [];
-
- while (othIndex--) {
- var array = arrays[othIndex];
- if (othIndex && iteratee) {
- array = arrayMap(array, baseUnary(iteratee));
- }
- maxLength = nativeMin(array.length, maxLength);
- caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))
- ? new SetCache(othIndex && array)
- : undefined;
- }
- array = arrays[0];
-
- var index = -1,
- seen = caches[0];
-
- outer:
- while (++index < length && result.length < maxLength) {
- var value = array[index],
- computed = iteratee ? iteratee(value) : value;
-
- value = (comparator || value !== 0) ? value : 0;
- if (!(seen
- ? cacheHas(seen, computed)
- : includes(result, computed, comparator)
- )) {
- othIndex = othLength;
- while (--othIndex) {
- var cache = caches[othIndex];
- if (!(cache
- ? cacheHas(cache, computed)
- : includes(arrays[othIndex], computed, comparator))
- ) {
- continue outer;
- }
- }
- if (seen) {
- seen.push(computed);
- }
- result.push(value);
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.invert` and `_.invertBy` which inverts
- * `object` with values transformed by `iteratee` and set by `setter`.
- *
- * @private
- * @param {Object} object The object to iterate over.
- * @param {Function} setter The function to set `accumulator` values.
- * @param {Function} iteratee The iteratee to transform values.
- * @param {Object} accumulator The initial inverted object.
- * @returns {Function} Returns `accumulator`.
- */
- function baseInverter(object, setter, iteratee, accumulator) {
- baseForOwn(object, function(value, key, object) {
- setter(accumulator, iteratee(value), key, object);
- });
- return accumulator;
- }
-
- /**
- * The base implementation of `_.invoke` without support for individual
- * method arguments.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Array|string} path The path of the method to invoke.
- * @param {Array} args The arguments to invoke the method with.
- * @returns {*} Returns the result of the invoked method.
- */
- function baseInvoke(object, path, args) {
- path = castPath(path, object);
- object = parent(object, path);
- var func = object == null ? object : object[toKey(last(path))];
- return func == null ? undefined : apply(func, object, args);
- }
-
- /**
- * The base implementation of `_.isArguments`.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an `arguments` object,
- */
- function baseIsArguments(value) {
- return isObjectLike(value) && baseGetTag(value) == argsTag;
- }
-
- /**
- * The base implementation of `_.isArrayBuffer` without Node.js optimizations.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
- */
- function baseIsArrayBuffer(value) {
- return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;
- }
-
- /**
- * The base implementation of `_.isDate` without Node.js optimizations.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a date object, else `false`.
- */
- function baseIsDate(value) {
- return isObjectLike(value) && baseGetTag(value) == dateTag;
- }
-
- /**
- * The base implementation of `_.isEqual` which supports partial comparisons
- * and tracks traversed objects.
- *
- * @private
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @param {boolean} bitmask The bitmask flags.
- * 1 - Unordered comparison
- * 2 - Partial comparison
- * @param {Function} [customizer] The function to customize comparisons.
- * @param {Object} [stack] Tracks traversed `value` and `other` objects.
- * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
- */
- function baseIsEqual(value, other, bitmask, customizer, stack) {
- if (value === other) {
- return true;
- }
- if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {
- return value !== value && other !== other;
- }
- return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
- }
-
- /**
- * A specialized version of `baseIsEqual` for arrays and objects which performs
- * deep comparisons and tracks traversed objects enabling objects with circular
- * references to be compared.
- *
- * @private
- * @param {Object} object The object to compare.
- * @param {Object} other The other object to compare.
- * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
- * @param {Function} customizer The function to customize comparisons.
- * @param {Function} equalFunc The function to determine equivalents of values.
- * @param {Object} [stack] Tracks traversed `object` and `other` objects.
- * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
- */
- function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
- var objIsArr = isArray(object),
- othIsArr = isArray(other),
- objTag = objIsArr ? arrayTag : getTag(object),
- othTag = othIsArr ? arrayTag : getTag(other);
-
- objTag = objTag == argsTag ? objectTag : objTag;
- othTag = othTag == argsTag ? objectTag : othTag;
-
- var objIsObj = objTag == objectTag,
- othIsObj = othTag == objectTag,
- isSameTag = objTag == othTag;
-
- if (isSameTag && isBuffer(object)) {
- if (!isBuffer(other)) {
- return false;
- }
- objIsArr = true;
- objIsObj = false;
- }
- if (isSameTag && !objIsObj) {
- stack || (stack = new Stack);
- return (objIsArr || isTypedArray(object))
- ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)
- : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
- }
- if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
- var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
- othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
-
- if (objIsWrapped || othIsWrapped) {
- var objUnwrapped = objIsWrapped ? object.value() : object,
- othUnwrapped = othIsWrapped ? other.value() : other;
-
- stack || (stack = new Stack);
- return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
- }
- }
- if (!isSameTag) {
- return false;
- }
- stack || (stack = new Stack);
- return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
- }
-
- /**
- * The base implementation of `_.isMap` without Node.js optimizations.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a map, else `false`.
- */
- function baseIsMap(value) {
- return isObjectLike(value) && getTag(value) == mapTag;
- }
-
- /**
- * The base implementation of `_.isMatch` without support for iteratee shorthands.
- *
- * @private
- * @param {Object} object The object to inspect.
- * @param {Object} source The object of property values to match.
- * @param {Array} matchData The property names, values, and compare flags to match.
- * @param {Function} [customizer] The function to customize comparisons.
- * @returns {boolean} Returns `true` if `object` is a match, else `false`.
- */
- function baseIsMatch(object, source, matchData, customizer) {
- var index = matchData.length,
- length = index,
- noCustomizer = !customizer;
-
- if (object == null) {
- return !length;
- }
- object = Object(object);
- while (index--) {
- var data = matchData[index];
- if ((noCustomizer && data[2])
- ? data[1] !== object[data[0]]
- : !(data[0] in object)
- ) {
- return false;
- }
- }
- while (++index < length) {
- data = matchData[index];
- var key = data[0],
- objValue = object[key],
- srcValue = data[1];
-
- if (noCustomizer && data[2]) {
- if (objValue === undefined && !(key in object)) {
- return false;
- }
- } else {
- var stack = new Stack;
- if (customizer) {
- var result = customizer(objValue, srcValue, key, object, source, stack);
- }
- if (!(result === undefined
- ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)
- : result
- )) {
- return false;
- }
- }
- }
- return true;
- }
-
- /**
- * The base implementation of `_.isNative` without bad shim checks.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a native function,
- * else `false`.
- */
- function baseIsNative(value) {
- if (!isObject(value) || isMasked(value)) {
- return false;
- }
- var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
- return pattern.test(toSource(value));
- }
-
- /**
- * The base implementation of `_.isRegExp` without Node.js optimizations.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
- */
- function baseIsRegExp(value) {
- return isObjectLike(value) && baseGetTag(value) == regexpTag;
- }
-
- /**
- * The base implementation of `_.isSet` without Node.js optimizations.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a set, else `false`.
- */
- function baseIsSet(value) {
- return isObjectLike(value) && getTag(value) == setTag;
- }
-
- /**
- * The base implementation of `_.isTypedArray` without Node.js optimizations.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
- */
- function baseIsTypedArray(value) {
- return isObjectLike(value) &&
- isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
- }
-
- /**
- * The base implementation of `_.iteratee`.
- *
- * @private
- * @param {*} [value=_.identity] The value to convert to an iteratee.
- * @returns {Function} Returns the iteratee.
- */
- function baseIteratee(value) {
- // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.
- // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.
- if (typeof value == 'function') {
- return value;
- }
- if (value == null) {
- return identity;
- }
- if (typeof value == 'object') {
- return isArray(value)
- ? baseMatchesProperty(value[0], value[1])
- : baseMatches(value);
- }
- return property(value);
- }
-
- /**
- * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names.
- */
- function baseKeys(object) {
- if (!isPrototype(object)) {
- return nativeKeys(object);
- }
- var result = [];
- for (var key in Object(object)) {
- if (hasOwnProperty.call(object, key) && key != 'constructor') {
- result.push(key);
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names.
- */
- function baseKeysIn(object) {
- if (!isObject(object)) {
- return nativeKeysIn(object);
- }
- var isProto = isPrototype(object),
- result = [];
-
- for (var key in object) {
- if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
- result.push(key);
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.lt` which doesn't coerce arguments.
- *
- * @private
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if `value` is less than `other`,
- * else `false`.
- */
- function baseLt(value, other) {
- return value < other;
- }
-
- /**
- * The base implementation of `_.map` without support for iteratee shorthands.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} iteratee The function invoked per iteration.
- * @returns {Array} Returns the new mapped array.
- */
- function baseMap(collection, iteratee) {
- var index = -1,
- result = isArrayLike(collection) ? Array(collection.length) : [];
-
- baseEach(collection, function(value, key, collection) {
- result[++index] = iteratee(value, key, collection);
- });
- return result;
- }
-
- /**
- * The base implementation of `_.matches` which doesn't clone `source`.
- *
- * @private
- * @param {Object} source The object of property values to match.
- * @returns {Function} Returns the new spec function.
- */
- function baseMatches(source) {
- var matchData = getMatchData(source);
- if (matchData.length == 1 && matchData[0][2]) {
- return matchesStrictComparable(matchData[0][0], matchData[0][1]);
- }
- return function(object) {
- return object === source || baseIsMatch(object, source, matchData);
- };
- }
-
- /**
- * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.
- *
- * @private
- * @param {string} path The path of the property to get.
- * @param {*} srcValue The value to match.
- * @returns {Function} Returns the new spec function.
- */
- function baseMatchesProperty(path, srcValue) {
- if (isKey(path) && isStrictComparable(srcValue)) {
- return matchesStrictComparable(toKey(path), srcValue);
- }
- return function(object) {
- var objValue = get(object, path);
- return (objValue === undefined && objValue === srcValue)
- ? hasIn(object, path)
- : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
- };
- }
-
- /**
- * The base implementation of `_.merge` without support for multiple sources.
- *
- * @private
- * @param {Object} object The destination object.
- * @param {Object} source The source object.
- * @param {number} srcIndex The index of `source`.
- * @param {Function} [customizer] The function to customize merged values.
- * @param {Object} [stack] Tracks traversed source values and their merged
- * counterparts.
- */
- function baseMerge(object, source, srcIndex, customizer, stack) {
- if (object === source) {
- return;
- }
- baseFor(source, function(srcValue, key) {
- if (isObject(srcValue)) {
- stack || (stack = new Stack);
- baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);
- }
- else {
- var newValue = customizer
- ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)
- : undefined;
-
- if (newValue === undefined) {
- newValue = srcValue;
- }
- assignMergeValue(object, key, newValue);
- }
- }, keysIn);
- }
-
- /**
- * A specialized version of `baseMerge` for arrays and objects which performs
- * deep merges and tracks traversed objects enabling objects with circular
- * references to be merged.
- *
- * @private
- * @param {Object} object The destination object.
- * @param {Object} source The source object.
- * @param {string} key The key of the value to merge.
- * @param {number} srcIndex The index of `source`.
- * @param {Function} mergeFunc The function to merge values.
- * @param {Function} [customizer] The function to customize assigned values.
- * @param {Object} [stack] Tracks traversed source values and their merged
- * counterparts.
- */
- function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {
- var objValue = safeGet(object, key),
- srcValue = safeGet(source, key),
- stacked = stack.get(srcValue);
-
- if (stacked) {
- assignMergeValue(object, key, stacked);
- return;
- }
- var newValue = customizer
- ? customizer(objValue, srcValue, (key + ''), object, source, stack)
- : undefined;
-
- var isCommon = newValue === undefined;
-
- if (isCommon) {
- var isArr = isArray(srcValue),
- isBuff = !isArr && isBuffer(srcValue),
- isTyped = !isArr && !isBuff && isTypedArray(srcValue);
-
- newValue = srcValue;
- if (isArr || isBuff || isTyped) {
- if (isArray(objValue)) {
- newValue = objValue;
- }
- else if (isArrayLikeObject(objValue)) {
- newValue = copyArray(objValue);
- }
- else if (isBuff) {
- isCommon = false;
- newValue = cloneBuffer(srcValue, true);
- }
- else if (isTyped) {
- isCommon = false;
- newValue = cloneTypedArray(srcValue, true);
- }
- else {
- newValue = [];
- }
- }
- else if (isPlainObject(srcValue) || isArguments(srcValue)) {
- newValue = objValue;
- if (isArguments(objValue)) {
- newValue = toPlainObject(objValue);
- }
- else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) {
- newValue = initCloneObject(srcValue);
- }
- }
- else {
- isCommon = false;
- }
- }
- if (isCommon) {
- // Recursively merge objects and arrays (susceptible to call stack limits).
- stack.set(srcValue, newValue);
- mergeFunc(newValue, srcValue, srcIndex, customizer, stack);
- stack['delete'](srcValue);
- }
- assignMergeValue(object, key, newValue);
- }
-
- /**
- * The base implementation of `_.nth` which doesn't coerce arguments.
- *
- * @private
- * @param {Array} array The array to query.
- * @param {number} n The index of the element to return.
- * @returns {*} Returns the nth element of `array`.
- */
- function baseNth(array, n) {
- var length = array.length;
- if (!length) {
- return;
- }
- n += n < 0 ? length : 0;
- return isIndex(n, length) ? array[n] : undefined;
- }
-
- /**
- * The base implementation of `_.orderBy` without param guards.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.
- * @param {string[]} orders The sort orders of `iteratees`.
- * @returns {Array} Returns the new sorted array.
- */
- function baseOrderBy(collection, iteratees, orders) {
- var index = -1;
- iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));
-
- var result = baseMap(collection, function(value, key, collection) {
- var criteria = arrayMap(iteratees, function(iteratee) {
- return iteratee(value);
- });
- return { 'criteria': criteria, 'index': ++index, 'value': value };
- });
-
- return baseSortBy(result, function(object, other) {
- return compareMultiple(object, other, orders);
- });
- }
-
- /**
- * The base implementation of `_.pick` without support for individual
- * property identifiers.
- *
- * @private
- * @param {Object} object The source object.
- * @param {string[]} paths The property paths to pick.
- * @returns {Object} Returns the new object.
- */
- function basePick(object, paths) {
- return basePickBy(object, paths, function(value, path) {
- return hasIn(object, path);
- });
- }
-
- /**
- * The base implementation of `_.pickBy` without support for iteratee shorthands.
- *
- * @private
- * @param {Object} object The source object.
- * @param {string[]} paths The property paths to pick.
- * @param {Function} predicate The function invoked per property.
- * @returns {Object} Returns the new object.
- */
- function basePickBy(object, paths, predicate) {
- var index = -1,
- length = paths.length,
- result = {};
-
- while (++index < length) {
- var path = paths[index],
- value = baseGet(object, path);
-
- if (predicate(value, path)) {
- baseSet(result, castPath(path, object), value);
- }
- }
- return result;
- }
-
- /**
- * A specialized version of `baseProperty` which supports deep paths.
- *
- * @private
- * @param {Array|string} path The path of the property to get.
- * @returns {Function} Returns the new accessor function.
- */
- function basePropertyDeep(path) {
- return function(object) {
- return baseGet(object, path);
- };
- }
-
- /**
- * The base implementation of `_.pullAllBy` without support for iteratee
- * shorthands.
- *
- * @private
- * @param {Array} array The array to modify.
- * @param {Array} values The values to remove.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns `array`.
- */
- function basePullAll(array, values, iteratee, comparator) {
- var indexOf = comparator ? baseIndexOfWith : baseIndexOf,
- index = -1,
- length = values.length,
- seen = array;
-
- if (array === values) {
- values = copyArray(values);
- }
- if (iteratee) {
- seen = arrayMap(array, baseUnary(iteratee));
- }
- while (++index < length) {
- var fromIndex = 0,
- value = values[index],
- computed = iteratee ? iteratee(value) : value;
-
- while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {
- if (seen !== array) {
- splice.call(seen, fromIndex, 1);
- }
- splice.call(array, fromIndex, 1);
- }
- }
- return array;
- }
-
- /**
- * The base implementation of `_.pullAt` without support for individual
- * indexes or capturing the removed elements.
- *
- * @private
- * @param {Array} array The array to modify.
- * @param {number[]} indexes The indexes of elements to remove.
- * @returns {Array} Returns `array`.
- */
- function basePullAt(array, indexes) {
- var length = array ? indexes.length : 0,
- lastIndex = length - 1;
-
- while (length--) {
- var index = indexes[length];
- if (length == lastIndex || index !== previous) {
- var previous = index;
- if (isIndex(index)) {
- splice.call(array, index, 1);
- } else {
- baseUnset(array, index);
- }
- }
- }
- return array;
- }
-
- /**
- * The base implementation of `_.random` without support for returning
- * floating-point numbers.
- *
- * @private
- * @param {number} lower The lower bound.
- * @param {number} upper The upper bound.
- * @returns {number} Returns the random number.
- */
- function baseRandom(lower, upper) {
- return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
- }
-
- /**
- * The base implementation of `_.range` and `_.rangeRight` which doesn't
- * coerce arguments.
- *
- * @private
- * @param {number} start The start of the range.
- * @param {number} end The end of the range.
- * @param {number} step The value to increment or decrement by.
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {Array} Returns the range of numbers.
- */
- function baseRange(start, end, step, fromRight) {
- var index = -1,
- length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),
- result = Array(length);
-
- while (length--) {
- result[fromRight ? length : ++index] = start;
- start += step;
- }
- return result;
- }
-
- /**
- * The base implementation of `_.repeat` which doesn't coerce arguments.
- *
- * @private
- * @param {string} string The string to repeat.
- * @param {number} n The number of times to repeat the string.
- * @returns {string} Returns the repeated string.
- */
- function baseRepeat(string, n) {
- var result = '';
- if (!string || n < 1 || n > MAX_SAFE_INTEGER) {
- return result;
- }
- // Leverage the exponentiation by squaring algorithm for a faster repeat.
- // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.
- do {
- if (n % 2) {
- result += string;
- }
- n = nativeFloor(n / 2);
- if (n) {
- string += string;
- }
- } while (n);
-
- return result;
- }
-
- /**
- * The base implementation of `_.rest` which doesn't validate or coerce arguments.
- *
- * @private
- * @param {Function} func The function to apply a rest parameter to.
- * @param {number} [start=func.length-1] The start position of the rest parameter.
- * @returns {Function} Returns the new function.
- */
- function baseRest(func, start) {
- return setToString(overRest(func, start, identity), func + '');
- }
-
- /**
- * The base implementation of `_.sample`.
- *
- * @private
- * @param {Array|Object} collection The collection to sample.
- * @returns {*} Returns the random element.
- */
- function baseSample(collection) {
- return arraySample(values(collection));
- }
-
- /**
- * The base implementation of `_.sampleSize` without param guards.
- *
- * @private
- * @param {Array|Object} collection The collection to sample.
- * @param {number} n The number of elements to sample.
- * @returns {Array} Returns the random elements.
- */
- function baseSampleSize(collection, n) {
- var array = values(collection);
- return shuffleSelf(array, baseClamp(n, 0, array.length));
- }
-
- /**
- * The base implementation of `_.set`.
- *
- * @private
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to set.
- * @param {*} value The value to set.
- * @param {Function} [customizer] The function to customize path creation.
- * @returns {Object} Returns `object`.
- */
- function baseSet(object, path, value, customizer) {
- if (!isObject(object)) {
- return object;
- }
- path = castPath(path, object);
-
- var index = -1,
- length = path.length,
- lastIndex = length - 1,
- nested = object;
-
- while (nested != null && ++index < length) {
- var key = toKey(path[index]),
- newValue = value;
-
- if (index != lastIndex) {
- var objValue = nested[key];
- newValue = customizer ? customizer(objValue, key, nested) : undefined;
- if (newValue === undefined) {
- newValue = isObject(objValue)
- ? objValue
- : (isIndex(path[index + 1]) ? [] : {});
- }
- }
- assignValue(nested, key, newValue);
- nested = nested[key];
- }
- return object;
- }
-
- /**
- * The base implementation of `setData` without support for hot loop shorting.
- *
- * @private
- * @param {Function} func The function to associate metadata with.
- * @param {*} data The metadata.
- * @returns {Function} Returns `func`.
- */
- var baseSetData = !metaMap ? identity : function(func, data) {
- metaMap.set(func, data);
- return func;
- };
-
- /**
- * The base implementation of `setToString` without support for hot loop shorting.
- *
- * @private
- * @param {Function} func The function to modify.
- * @param {Function} string The `toString` result.
- * @returns {Function} Returns `func`.
- */
- var baseSetToString = !defineProperty ? identity : function(func, string) {
- return defineProperty(func, 'toString', {
- 'configurable': true,
- 'enumerable': false,
- 'value': constant(string),
- 'writable': true
- });
- };
-
- /**
- * The base implementation of `_.shuffle`.
- *
- * @private
- * @param {Array|Object} collection The collection to shuffle.
- * @returns {Array} Returns the new shuffled array.
- */
- function baseShuffle(collection) {
- return shuffleSelf(values(collection));
- }
-
- /**
- * The base implementation of `_.slice` without an iteratee call guard.
- *
- * @private
- * @param {Array} array The array to slice.
- * @param {number} [start=0] The start position.
- * @param {number} [end=array.length] The end position.
- * @returns {Array} Returns the slice of `array`.
- */
- function baseSlice(array, start, end) {
- var index = -1,
- length = array.length;
-
- if (start < 0) {
- start = -start > length ? 0 : (length + start);
- }
- end = end > length ? length : end;
- if (end < 0) {
- end += length;
- }
- length = start > end ? 0 : ((end - start) >>> 0);
- start >>>= 0;
-
- var result = Array(length);
- while (++index < length) {
- result[index] = array[index + start];
- }
- return result;
- }
-
- /**
- * The base implementation of `_.some` without support for iteratee shorthands.
- *
- * @private
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} predicate The function invoked per iteration.
- * @returns {boolean} Returns `true` if any element passes the predicate check,
- * else `false`.
- */
- function baseSome(collection, predicate) {
- var result;
-
- baseEach(collection, function(value, index, collection) {
- result = predicate(value, index, collection);
- return !result;
- });
- return !!result;
- }
-
- /**
- * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which
- * performs a binary search of `array` to determine the index at which `value`
- * should be inserted into `array` in order to maintain its sort order.
- *
- * @private
- * @param {Array} array The sorted array to inspect.
- * @param {*} value The value to evaluate.
- * @param {boolean} [retHighest] Specify returning the highest qualified index.
- * @returns {number} Returns the index at which `value` should be inserted
- * into `array`.
- */
- function baseSortedIndex(array, value, retHighest) {
- var low = 0,
- high = array == null ? low : array.length;
-
- if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {
- while (low < high) {
- var mid = (low + high) >>> 1,
- computed = array[mid];
-
- if (computed !== null && !isSymbol(computed) &&
- (retHighest ? (computed <= value) : (computed < value))) {
- low = mid + 1;
- } else {
- high = mid;
- }
- }
- return high;
- }
- return baseSortedIndexBy(array, value, identity, retHighest);
- }
-
- /**
- * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`
- * which invokes `iteratee` for `value` and each element of `array` to compute
- * their sort ranking. The iteratee is invoked with one argument; (value).
- *
- * @private
- * @param {Array} array The sorted array to inspect.
- * @param {*} value The value to evaluate.
- * @param {Function} iteratee The iteratee invoked per element.
- * @param {boolean} [retHighest] Specify returning the highest qualified index.
- * @returns {number} Returns the index at which `value` should be inserted
- * into `array`.
- */
- function baseSortedIndexBy(array, value, iteratee, retHighest) {
- value = iteratee(value);
-
- var low = 0,
- high = array == null ? 0 : array.length,
- valIsNaN = value !== value,
- valIsNull = value === null,
- valIsSymbol = isSymbol(value),
- valIsUndefined = value === undefined;
-
- while (low < high) {
- var mid = nativeFloor((low + high) / 2),
- computed = iteratee(array[mid]),
- othIsDefined = computed !== undefined,
- othIsNull = computed === null,
- othIsReflexive = computed === computed,
- othIsSymbol = isSymbol(computed);
-
- if (valIsNaN) {
- var setLow = retHighest || othIsReflexive;
- } else if (valIsUndefined) {
- setLow = othIsReflexive && (retHighest || othIsDefined);
- } else if (valIsNull) {
- setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);
- } else if (valIsSymbol) {
- setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);
- } else if (othIsNull || othIsSymbol) {
- setLow = false;
- } else {
- setLow = retHighest ? (computed <= value) : (computed < value);
- }
- if (setLow) {
- low = mid + 1;
- } else {
- high = mid;
- }
- }
- return nativeMin(high, MAX_ARRAY_INDEX);
- }
-
- /**
- * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without
- * support for iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @returns {Array} Returns the new duplicate free array.
- */
- function baseSortedUniq(array, iteratee) {
- var index = -1,
- length = array.length,
- resIndex = 0,
- result = [];
-
- while (++index < length) {
- var value = array[index],
- computed = iteratee ? iteratee(value) : value;
-
- if (!index || !eq(computed, seen)) {
- var seen = computed;
- result[resIndex++] = value === 0 ? 0 : value;
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.toNumber` which doesn't ensure correct
- * conversions of binary, hexadecimal, or octal string values.
- *
- * @private
- * @param {*} value The value to process.
- * @returns {number} Returns the number.
- */
- function baseToNumber(value) {
- if (typeof value == 'number') {
- return value;
- }
- if (isSymbol(value)) {
- return NAN;
- }
- return +value;
- }
-
- /**
- * The base implementation of `_.toString` which doesn't convert nullish
- * values to empty strings.
- *
- * @private
- * @param {*} value The value to process.
- * @returns {string} Returns the string.
- */
- function baseToString(value) {
- // Exit early for strings to avoid a performance hit in some environments.
- if (typeof value == 'string') {
- return value;
- }
- if (isArray(value)) {
- // Recursively convert values (susceptible to call stack limits).
- return arrayMap(value, baseToString) + '';
- }
- if (isSymbol(value)) {
- return symbolToString ? symbolToString.call(value) : '';
- }
- var result = (value + '');
- return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
- }
-
- /**
- * The base implementation of `_.uniqBy` without support for iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new duplicate free array.
- */
- function baseUniq(array, iteratee, comparator) {
- var index = -1,
- includes = arrayIncludes,
- length = array.length,
- isCommon = true,
- result = [],
- seen = result;
-
- if (comparator) {
- isCommon = false;
- includes = arrayIncludesWith;
- }
- else if (length >= LARGE_ARRAY_SIZE) {
- var set = iteratee ? null : createSet(array);
- if (set) {
- return setToArray(set);
- }
- isCommon = false;
- includes = cacheHas;
- seen = new SetCache;
- }
- else {
- seen = iteratee ? [] : result;
- }
- outer:
- while (++index < length) {
- var value = array[index],
- computed = iteratee ? iteratee(value) : value;
-
- value = (comparator || value !== 0) ? value : 0;
- if (isCommon && computed === computed) {
- var seenIndex = seen.length;
- while (seenIndex--) {
- if (seen[seenIndex] === computed) {
- continue outer;
- }
- }
- if (iteratee) {
- seen.push(computed);
- }
- result.push(value);
- }
- else if (!includes(seen, computed, comparator)) {
- if (seen !== result) {
- seen.push(computed);
- }
- result.push(value);
- }
- }
- return result;
- }
-
- /**
- * The base implementation of `_.unset`.
- *
- * @private
- * @param {Object} object The object to modify.
- * @param {Array|string} path The property path to unset.
- * @returns {boolean} Returns `true` if the property is deleted, else `false`.
- */
- function baseUnset(object, path) {
- path = castPath(path, object);
- object = parent(object, path);
- return object == null || delete object[toKey(last(path))];
- }
-
- /**
- * The base implementation of `_.update`.
- *
- * @private
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to update.
- * @param {Function} updater The function to produce the updated value.
- * @param {Function} [customizer] The function to customize path creation.
- * @returns {Object} Returns `object`.
- */
- function baseUpdate(object, path, updater, customizer) {
- return baseSet(object, path, updater(baseGet(object, path)), customizer);
- }
-
- /**
- * The base implementation of methods like `_.dropWhile` and `_.takeWhile`
- * without support for iteratee shorthands.
- *
- * @private
- * @param {Array} array The array to query.
- * @param {Function} predicate The function invoked per iteration.
- * @param {boolean} [isDrop] Specify dropping elements instead of taking them.
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {Array} Returns the slice of `array`.
- */
- function baseWhile(array, predicate, isDrop, fromRight) {
- var length = array.length,
- index = fromRight ? length : -1;
-
- while ((fromRight ? index-- : ++index < length) &&
- predicate(array[index], index, array)) {}
-
- return isDrop
- ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))
- : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));
- }
-
- /**
- * The base implementation of `wrapperValue` which returns the result of
- * performing a sequence of actions on the unwrapped `value`, where each
- * successive action is supplied the return value of the previous.
- *
- * @private
- * @param {*} value The unwrapped value.
- * @param {Array} actions Actions to perform to resolve the unwrapped value.
- * @returns {*} Returns the resolved value.
- */
- function baseWrapperValue(value, actions) {
- var result = value;
- if (result instanceof LazyWrapper) {
- result = result.value();
- }
- return arrayReduce(actions, function(result, action) {
- return action.func.apply(action.thisArg, arrayPush([result], action.args));
- }, result);
- }
-
- /**
- * The base implementation of methods like `_.xor`, without support for
- * iteratee shorthands, that accepts an array of arrays to inspect.
- *
- * @private
- * @param {Array} arrays The arrays to inspect.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of values.
- */
- function baseXor(arrays, iteratee, comparator) {
- var length = arrays.length;
- if (length < 2) {
- return length ? baseUniq(arrays[0]) : [];
- }
- var index = -1,
- result = Array(length);
-
- while (++index < length) {
- var array = arrays[index],
- othIndex = -1;
-
- while (++othIndex < length) {
- if (othIndex != index) {
- result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);
- }
- }
- }
- return baseUniq(baseFlatten(result, 1), iteratee, comparator);
- }
-
- /**
- * This base implementation of `_.zipObject` which assigns values using `assignFunc`.
- *
- * @private
- * @param {Array} props The property identifiers.
- * @param {Array} values The property values.
- * @param {Function} assignFunc The function to assign values.
- * @returns {Object} Returns the new object.
- */
- function baseZipObject(props, values, assignFunc) {
- var index = -1,
- length = props.length,
- valsLength = values.length,
- result = {};
-
- while (++index < length) {
- var value = index < valsLength ? values[index] : undefined;
- assignFunc(result, props[index], value);
- }
- return result;
- }
-
- /**
- * Casts `value` to an empty array if it's not an array like object.
- *
- * @private
- * @param {*} value The value to inspect.
- * @returns {Array|Object} Returns the cast array-like object.
- */
- function castArrayLikeObject(value) {
- return isArrayLikeObject(value) ? value : [];
- }
-
- /**
- * Casts `value` to `identity` if it's not a function.
- *
- * @private
- * @param {*} value The value to inspect.
- * @returns {Function} Returns cast function.
- */
- function castFunction(value) {
- return typeof value == 'function' ? value : identity;
- }
-
- /**
- * Casts `value` to a path array if it's not one.
- *
- * @private
- * @param {*} value The value to inspect.
- * @param {Object} [object] The object to query keys on.
- * @returns {Array} Returns the cast property path array.
- */
- function castPath(value, object) {
- if (isArray(value)) {
- return value;
- }
- return isKey(value, object) ? [value] : stringToPath(toString(value));
- }
-
- /**
- * A `baseRest` alias which can be replaced with `identity` by module
- * replacement plugins.
- *
- * @private
- * @type {Function}
- * @param {Function} func The function to apply a rest parameter to.
- * @returns {Function} Returns the new function.
- */
- var castRest = baseRest;
-
- /**
- * Casts `array` to a slice if it's needed.
- *
- * @private
- * @param {Array} array The array to inspect.
- * @param {number} start The start position.
- * @param {number} [end=array.length] The end position.
- * @returns {Array} Returns the cast slice.
- */
- function castSlice(array, start, end) {
- var length = array.length;
- end = end === undefined ? length : end;
- return (!start && end >= length) ? array : baseSlice(array, start, end);
- }
-
- /**
- * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).
- *
- * @private
- * @param {number|Object} id The timer id or timeout object of the timer to clear.
- */
- var clearTimeout = ctxClearTimeout || function(id) {
- return root.clearTimeout(id);
- };
-
- /**
- * Creates a clone of `buffer`.
- *
- * @private
- * @param {Buffer} buffer The buffer to clone.
- * @param {boolean} [isDeep] Specify a deep clone.
- * @returns {Buffer} Returns the cloned buffer.
- */
- function cloneBuffer(buffer, isDeep) {
- if (isDeep) {
- return buffer.slice();
- }
- var length = buffer.length,
- result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
-
- buffer.copy(result);
- return result;
- }
-
- /**
- * Creates a clone of `arrayBuffer`.
- *
- * @private
- * @param {ArrayBuffer} arrayBuffer The array buffer to clone.
- * @returns {ArrayBuffer} Returns the cloned array buffer.
- */
- function cloneArrayBuffer(arrayBuffer) {
- var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
- new Uint8Array(result).set(new Uint8Array(arrayBuffer));
- return result;
- }
-
- /**
- * Creates a clone of `dataView`.
- *
- * @private
- * @param {Object} dataView The data view to clone.
- * @param {boolean} [isDeep] Specify a deep clone.
- * @returns {Object} Returns the cloned data view.
- */
- function cloneDataView(dataView, isDeep) {
- var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
- return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
- }
-
- /**
- * Creates a clone of `regexp`.
- *
- * @private
- * @param {Object} regexp The regexp to clone.
- * @returns {Object} Returns the cloned regexp.
- */
- function cloneRegExp(regexp) {
- var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
- result.lastIndex = regexp.lastIndex;
- return result;
- }
-
- /**
- * Creates a clone of the `symbol` object.
- *
- * @private
- * @param {Object} symbol The symbol object to clone.
- * @returns {Object} Returns the cloned symbol object.
- */
- function cloneSymbol(symbol) {
- return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
- }
-
- /**
- * Creates a clone of `typedArray`.
- *
- * @private
- * @param {Object} typedArray The typed array to clone.
- * @param {boolean} [isDeep] Specify a deep clone.
- * @returns {Object} Returns the cloned typed array.
- */
- function cloneTypedArray(typedArray, isDeep) {
- var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
- return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
- }
-
- /**
- * Compares values to sort them in ascending order.
- *
- * @private
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {number} Returns the sort order indicator for `value`.
- */
- function compareAscending(value, other) {
- if (value !== other) {
- var valIsDefined = value !== undefined,
- valIsNull = value === null,
- valIsReflexive = value === value,
- valIsSymbol = isSymbol(value);
-
- var othIsDefined = other !== undefined,
- othIsNull = other === null,
- othIsReflexive = other === other,
- othIsSymbol = isSymbol(other);
-
- if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||
- (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||
- (valIsNull && othIsDefined && othIsReflexive) ||
- (!valIsDefined && othIsReflexive) ||
- !valIsReflexive) {
- return 1;
- }
- if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||
- (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||
- (othIsNull && valIsDefined && valIsReflexive) ||
- (!othIsDefined && valIsReflexive) ||
- !othIsReflexive) {
- return -1;
- }
- }
- return 0;
- }
-
- /**
- * Used by `_.orderBy` to compare multiple properties of a value to another
- * and stable sort them.
- *
- * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,
- * specify an order of "desc" for descending or "asc" for ascending sort order
- * of corresponding values.
- *
- * @private
- * @param {Object} object The object to compare.
- * @param {Object} other The other object to compare.
- * @param {boolean[]|string[]} orders The order to sort by for each property.
- * @returns {number} Returns the sort order indicator for `object`.
- */
- function compareMultiple(object, other, orders) {
- var index = -1,
- objCriteria = object.criteria,
- othCriteria = other.criteria,
- length = objCriteria.length,
- ordersLength = orders.length;
-
- while (++index < length) {
- var result = compareAscending(objCriteria[index], othCriteria[index]);
- if (result) {
- if (index >= ordersLength) {
- return result;
- }
- var order = orders[index];
- return result * (order == 'desc' ? -1 : 1);
- }
- }
- // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications
- // that causes it, under certain circumstances, to provide the same value for
- // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247
- // for more details.
- //
- // This also ensures a stable sort in V8 and other engines.
- // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.
- return object.index - other.index;
- }
-
- /**
- * Creates an array that is the composition of partially applied arguments,
- * placeholders, and provided arguments into a single array of arguments.
- *
- * @private
- * @param {Array} args The provided arguments.
- * @param {Array} partials The arguments to prepend to those provided.
- * @param {Array} holders The `partials` placeholder indexes.
- * @params {boolean} [isCurried] Specify composing for a curried function.
- * @returns {Array} Returns the new array of composed arguments.
- */
- function composeArgs(args, partials, holders, isCurried) {
- var argsIndex = -1,
- argsLength = args.length,
- holdersLength = holders.length,
- leftIndex = -1,
- leftLength = partials.length,
- rangeLength = nativeMax(argsLength - holdersLength, 0),
- result = Array(leftLength + rangeLength),
- isUncurried = !isCurried;
-
- while (++leftIndex < leftLength) {
- result[leftIndex] = partials[leftIndex];
- }
- while (++argsIndex < holdersLength) {
- if (isUncurried || argsIndex < argsLength) {
- result[holders[argsIndex]] = args[argsIndex];
- }
- }
- while (rangeLength--) {
- result[leftIndex++] = args[argsIndex++];
- }
- return result;
- }
-
- /**
- * This function is like `composeArgs` except that the arguments composition
- * is tailored for `_.partialRight`.
- *
- * @private
- * @param {Array} args The provided arguments.
- * @param {Array} partials The arguments to append to those provided.
- * @param {Array} holders The `partials` placeholder indexes.
- * @params {boolean} [isCurried] Specify composing for a curried function.
- * @returns {Array} Returns the new array of composed arguments.
- */
- function composeArgsRight(args, partials, holders, isCurried) {
- var argsIndex = -1,
- argsLength = args.length,
- holdersIndex = -1,
- holdersLength = holders.length,
- rightIndex = -1,
- rightLength = partials.length,
- rangeLength = nativeMax(argsLength - holdersLength, 0),
- result = Array(rangeLength + rightLength),
- isUncurried = !isCurried;
-
- while (++argsIndex < rangeLength) {
- result[argsIndex] = args[argsIndex];
- }
- var offset = argsIndex;
- while (++rightIndex < rightLength) {
- result[offset + rightIndex] = partials[rightIndex];
- }
- while (++holdersIndex < holdersLength) {
- if (isUncurried || argsIndex < argsLength) {
- result[offset + holders[holdersIndex]] = args[argsIndex++];
- }
- }
- return result;
- }
-
- /**
- * Copies the values of `source` to `array`.
- *
- * @private
- * @param {Array} source The array to copy values from.
- * @param {Array} [array=[]] The array to copy values to.
- * @returns {Array} Returns `array`.
- */
- function copyArray(source, array) {
- var index = -1,
- length = source.length;
-
- array || (array = Array(length));
- while (++index < length) {
- array[index] = source[index];
- }
- return array;
- }
-
- /**
- * Copies properties of `source` to `object`.
- *
- * @private
- * @param {Object} source The object to copy properties from.
- * @param {Array} props The property identifiers to copy.
- * @param {Object} [object={}] The object to copy properties to.
- * @param {Function} [customizer] The function to customize copied values.
- * @returns {Object} Returns `object`.
- */
- function copyObject(source, props, object, customizer) {
- var isNew = !object;
- object || (object = {});
-
- var index = -1,
- length = props.length;
-
- while (++index < length) {
- var key = props[index];
-
- var newValue = customizer
- ? customizer(object[key], source[key], key, object, source)
- : undefined;
-
- if (newValue === undefined) {
- newValue = source[key];
- }
- if (isNew) {
- baseAssignValue(object, key, newValue);
- } else {
- assignValue(object, key, newValue);
- }
- }
- return object;
- }
-
- /**
- * Copies own symbols of `source` to `object`.
- *
- * @private
- * @param {Object} source The object to copy symbols from.
- * @param {Object} [object={}] The object to copy symbols to.
- * @returns {Object} Returns `object`.
- */
- function copySymbols(source, object) {
- return copyObject(source, getSymbols(source), object);
- }
-
- /**
- * Copies own and inherited symbols of `source` to `object`.
- *
- * @private
- * @param {Object} source The object to copy symbols from.
- * @param {Object} [object={}] The object to copy symbols to.
- * @returns {Object} Returns `object`.
- */
- function copySymbolsIn(source, object) {
- return copyObject(source, getSymbolsIn(source), object);
- }
-
- /**
- * Creates a function like `_.groupBy`.
- *
- * @private
- * @param {Function} setter The function to set accumulator values.
- * @param {Function} [initializer] The accumulator object initializer.
- * @returns {Function} Returns the new aggregator function.
- */
- function createAggregator(setter, initializer) {
- return function(collection, iteratee) {
- var func = isArray(collection) ? arrayAggregator : baseAggregator,
- accumulator = initializer ? initializer() : {};
-
- return func(collection, setter, getIteratee(iteratee, 2), accumulator);
- };
- }
-
- /**
- * Creates a function like `_.assign`.
- *
- * @private
- * @param {Function} assigner The function to assign values.
- * @returns {Function} Returns the new assigner function.
- */
- function createAssigner(assigner) {
- return baseRest(function(object, sources) {
- var index = -1,
- length = sources.length,
- customizer = length > 1 ? sources[length - 1] : undefined,
- guard = length > 2 ? sources[2] : undefined;
-
- customizer = (assigner.length > 3 && typeof customizer == 'function')
- ? (length--, customizer)
- : undefined;
-
- if (guard && isIterateeCall(sources[0], sources[1], guard)) {
- customizer = length < 3 ? undefined : customizer;
- length = 1;
- }
- object = Object(object);
- while (++index < length) {
- var source = sources[index];
- if (source) {
- assigner(object, source, index, customizer);
- }
- }
- return object;
- });
- }
-
- /**
- * Creates a `baseEach` or `baseEachRight` function.
- *
- * @private
- * @param {Function} eachFunc The function to iterate over a collection.
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {Function} Returns the new base function.
- */
- function createBaseEach(eachFunc, fromRight) {
- return function(collection, iteratee) {
- if (collection == null) {
- return collection;
- }
- if (!isArrayLike(collection)) {
- return eachFunc(collection, iteratee);
- }
- var length = collection.length,
- index = fromRight ? length : -1,
- iterable = Object(collection);
-
- while ((fromRight ? index-- : ++index < length)) {
- if (iteratee(iterable[index], index, iterable) === false) {
- break;
- }
- }
- return collection;
- };
- }
-
- /**
- * Creates a base function for methods like `_.forIn` and `_.forOwn`.
- *
- * @private
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {Function} Returns the new base function.
- */
- function createBaseFor(fromRight) {
- return function(object, iteratee, keysFunc) {
- var index = -1,
- iterable = Object(object),
- props = keysFunc(object),
- length = props.length;
-
- while (length--) {
- var key = props[fromRight ? length : ++index];
- if (iteratee(iterable[key], key, iterable) === false) {
- break;
- }
- }
- return object;
- };
- }
-
- /**
- * Creates a function that wraps `func` to invoke it with the optional `this`
- * binding of `thisArg`.
- *
- * @private
- * @param {Function} func The function to wrap.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @param {*} [thisArg] The `this` binding of `func`.
- * @returns {Function} Returns the new wrapped function.
- */
- function createBind(func, bitmask, thisArg) {
- var isBind = bitmask & WRAP_BIND_FLAG,
- Ctor = createCtor(func);
-
- function wrapper() {
- var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
- return fn.apply(isBind ? thisArg : this, arguments);
- }
- return wrapper;
- }
-
- /**
- * Creates a function like `_.lowerFirst`.
- *
- * @private
- * @param {string} methodName The name of the `String` case method to use.
- * @returns {Function} Returns the new case function.
- */
- function createCaseFirst(methodName) {
- return function(string) {
- string = toString(string);
-
- var strSymbols = hasUnicode(string)
- ? stringToArray(string)
- : undefined;
-
- var chr = strSymbols
- ? strSymbols[0]
- : string.charAt(0);
-
- var trailing = strSymbols
- ? castSlice(strSymbols, 1).join('')
- : string.slice(1);
-
- return chr[methodName]() + trailing;
- };
- }
-
- /**
- * Creates a function like `_.camelCase`.
- *
- * @private
- * @param {Function} callback The function to combine each word.
- * @returns {Function} Returns the new compounder function.
- */
- function createCompounder(callback) {
- return function(string) {
- return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');
- };
- }
-
- /**
- * Creates a function that produces an instance of `Ctor` regardless of
- * whether it was invoked as part of a `new` expression or by `call` or `apply`.
- *
- * @private
- * @param {Function} Ctor The constructor to wrap.
- * @returns {Function} Returns the new wrapped function.
- */
- function createCtor(Ctor) {
- return function() {
- // Use a `switch` statement to work with class constructors. See
- // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist
- // for more details.
- var args = arguments;
- switch (args.length) {
- case 0: return new Ctor;
- case 1: return new Ctor(args[0]);
- case 2: return new Ctor(args[0], args[1]);
- case 3: return new Ctor(args[0], args[1], args[2]);
- case 4: return new Ctor(args[0], args[1], args[2], args[3]);
- case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);
- case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);
- case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);
- }
- var thisBinding = baseCreate(Ctor.prototype),
- result = Ctor.apply(thisBinding, args);
-
- // Mimic the constructor's `return` behavior.
- // See https://es5.github.io/#x13.2.2 for more details.
- return isObject(result) ? result : thisBinding;
- };
- }
-
- /**
- * Creates a function that wraps `func` to enable currying.
- *
- * @private
- * @param {Function} func The function to wrap.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @param {number} arity The arity of `func`.
- * @returns {Function} Returns the new wrapped function.
- */
- function createCurry(func, bitmask, arity) {
- var Ctor = createCtor(func);
-
- function wrapper() {
- var length = arguments.length,
- args = Array(length),
- index = length,
- placeholder = getHolder(wrapper);
-
- while (index--) {
- args[index] = arguments[index];
- }
- var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)
- ? []
- : replaceHolders(args, placeholder);
-
- length -= holders.length;
- if (length < arity) {
- return createRecurry(
- func, bitmask, createHybrid, wrapper.placeholder, undefined,
- args, holders, undefined, undefined, arity - length);
- }
- var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
- return apply(fn, this, args);
- }
- return wrapper;
- }
-
- /**
- * Creates a `_.find` or `_.findLast` function.
- *
- * @private
- * @param {Function} findIndexFunc The function to find the collection index.
- * @returns {Function} Returns the new find function.
- */
- function createFind(findIndexFunc) {
- return function(collection, predicate, fromIndex) {
- var iterable = Object(collection);
- if (!isArrayLike(collection)) {
- var iteratee = getIteratee(predicate, 3);
- collection = keys(collection);
- predicate = function(key) { return iteratee(iterable[key], key, iterable); };
- }
- var index = findIndexFunc(collection, predicate, fromIndex);
- return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;
- };
- }
-
- /**
- * Creates a `_.flow` or `_.flowRight` function.
- *
- * @private
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {Function} Returns the new flow function.
- */
- function createFlow(fromRight) {
- return flatRest(function(funcs) {
- var length = funcs.length,
- index = length,
- prereq = LodashWrapper.prototype.thru;
-
- if (fromRight) {
- funcs.reverse();
- }
- while (index--) {
- var func = funcs[index];
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- if (prereq && !wrapper && getFuncName(func) == 'wrapper') {
- var wrapper = new LodashWrapper([], true);
- }
- }
- index = wrapper ? index : length;
- while (++index < length) {
- func = funcs[index];
-
- var funcName = getFuncName(func),
- data = funcName == 'wrapper' ? getData(func) : undefined;
-
- if (data && isLaziable(data[0]) &&
- data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&
- !data[4].length && data[9] == 1
- ) {
- wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);
- } else {
- wrapper = (func.length == 1 && isLaziable(func))
- ? wrapper[funcName]()
- : wrapper.thru(func);
- }
- }
- return function() {
- var args = arguments,
- value = args[0];
-
- if (wrapper && args.length == 1 && isArray(value)) {
- return wrapper.plant(value).value();
- }
- var index = 0,
- result = length ? funcs[index].apply(this, args) : value;
-
- while (++index < length) {
- result = funcs[index].call(this, result);
- }
- return result;
- };
- });
- }
-
- /**
- * Creates a function that wraps `func` to invoke it with optional `this`
- * binding of `thisArg`, partial application, and currying.
- *
- * @private
- * @param {Function|string} func The function or method name to wrap.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @param {*} [thisArg] The `this` binding of `func`.
- * @param {Array} [partials] The arguments to prepend to those provided to
- * the new function.
- * @param {Array} [holders] The `partials` placeholder indexes.
- * @param {Array} [partialsRight] The arguments to append to those provided
- * to the new function.
- * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.
- * @param {Array} [argPos] The argument positions of the new function.
- * @param {number} [ary] The arity cap of `func`.
- * @param {number} [arity] The arity of `func`.
- * @returns {Function} Returns the new wrapped function.
- */
- function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {
- var isAry = bitmask & WRAP_ARY_FLAG,
- isBind = bitmask & WRAP_BIND_FLAG,
- isBindKey = bitmask & WRAP_BIND_KEY_FLAG,
- isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),
- isFlip = bitmask & WRAP_FLIP_FLAG,
- Ctor = isBindKey ? undefined : createCtor(func);
-
- function wrapper() {
- var length = arguments.length,
- args = Array(length),
- index = length;
-
- while (index--) {
- args[index] = arguments[index];
- }
- if (isCurried) {
- var placeholder = getHolder(wrapper),
- holdersCount = countHolders(args, placeholder);
- }
- if (partials) {
- args = composeArgs(args, partials, holders, isCurried);
- }
- if (partialsRight) {
- args = composeArgsRight(args, partialsRight, holdersRight, isCurried);
- }
- length -= holdersCount;
- if (isCurried && length < arity) {
- var newHolders = replaceHolders(args, placeholder);
- return createRecurry(
- func, bitmask, createHybrid, wrapper.placeholder, thisArg,
- args, newHolders, argPos, ary, arity - length
- );
- }
- var thisBinding = isBind ? thisArg : this,
- fn = isBindKey ? thisBinding[func] : func;
-
- length = args.length;
- if (argPos) {
- args = reorder(args, argPos);
- } else if (isFlip && length > 1) {
- args.reverse();
- }
- if (isAry && ary < length) {
- args.length = ary;
- }
- if (this && this !== root && this instanceof wrapper) {
- fn = Ctor || createCtor(fn);
- }
- return fn.apply(thisBinding, args);
- }
- return wrapper;
- }
-
- /**
- * Creates a function like `_.invertBy`.
- *
- * @private
- * @param {Function} setter The function to set accumulator values.
- * @param {Function} toIteratee The function to resolve iteratees.
- * @returns {Function} Returns the new inverter function.
- */
- function createInverter(setter, toIteratee) {
- return function(object, iteratee) {
- return baseInverter(object, setter, toIteratee(iteratee), {});
- };
- }
-
- /**
- * Creates a function that performs a mathematical operation on two values.
- *
- * @private
- * @param {Function} operator The function to perform the operation.
- * @param {number} [defaultValue] The value used for `undefined` arguments.
- * @returns {Function} Returns the new mathematical operation function.
- */
- function createMathOperation(operator, defaultValue) {
- return function(value, other) {
- var result;
- if (value === undefined && other === undefined) {
- return defaultValue;
- }
- if (value !== undefined) {
- result = value;
- }
- if (other !== undefined) {
- if (result === undefined) {
- return other;
- }
- if (typeof value == 'string' || typeof other == 'string') {
- value = baseToString(value);
- other = baseToString(other);
- } else {
- value = baseToNumber(value);
- other = baseToNumber(other);
- }
- result = operator(value, other);
- }
- return result;
- };
- }
-
- /**
- * Creates a function like `_.over`.
- *
- * @private
- * @param {Function} arrayFunc The function to iterate over iteratees.
- * @returns {Function} Returns the new over function.
- */
- function createOver(arrayFunc) {
- return flatRest(function(iteratees) {
- iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
- return baseRest(function(args) {
- var thisArg = this;
- return arrayFunc(iteratees, function(iteratee) {
- return apply(iteratee, thisArg, args);
- });
- });
- });
- }
-
- /**
- * Creates the padding for `string` based on `length`. The `chars` string
- * is truncated if the number of characters exceeds `length`.
- *
- * @private
- * @param {number} length The padding length.
- * @param {string} [chars=' '] The string used as padding.
- * @returns {string} Returns the padding for `string`.
- */
- function createPadding(length, chars) {
- chars = chars === undefined ? ' ' : baseToString(chars);
-
- var charsLength = chars.length;
- if (charsLength < 2) {
- return charsLength ? baseRepeat(chars, length) : chars;
- }
- var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));
- return hasUnicode(chars)
- ? castSlice(stringToArray(result), 0, length).join('')
- : result.slice(0, length);
- }
-
- /**
- * Creates a function that wraps `func` to invoke it with the `this` binding
- * of `thisArg` and `partials` prepended to the arguments it receives.
- *
- * @private
- * @param {Function} func The function to wrap.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @param {*} thisArg The `this` binding of `func`.
- * @param {Array} partials The arguments to prepend to those provided to
- * the new function.
- * @returns {Function} Returns the new wrapped function.
- */
- function createPartial(func, bitmask, thisArg, partials) {
- var isBind = bitmask & WRAP_BIND_FLAG,
- Ctor = createCtor(func);
-
- function wrapper() {
- var argsIndex = -1,
- argsLength = arguments.length,
- leftIndex = -1,
- leftLength = partials.length,
- args = Array(leftLength + argsLength),
- fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
-
- while (++leftIndex < leftLength) {
- args[leftIndex] = partials[leftIndex];
- }
- while (argsLength--) {
- args[leftIndex++] = arguments[++argsIndex];
- }
- return apply(fn, isBind ? thisArg : this, args);
- }
- return wrapper;
- }
-
- /**
- * Creates a `_.range` or `_.rangeRight` function.
- *
- * @private
- * @param {boolean} [fromRight] Specify iterating from right to left.
- * @returns {Function} Returns the new range function.
- */
- function createRange(fromRight) {
- return function(start, end, step) {
- if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {
- end = step = undefined;
- }
- // Ensure the sign of `-0` is preserved.
- start = toFinite(start);
- if (end === undefined) {
- end = start;
- start = 0;
- } else {
- end = toFinite(end);
- }
- step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);
- return baseRange(start, end, step, fromRight);
- };
- }
-
- /**
- * Creates a function that performs a relational operation on two values.
- *
- * @private
- * @param {Function} operator The function to perform the operation.
- * @returns {Function} Returns the new relational operation function.
- */
- function createRelationalOperation(operator) {
- return function(value, other) {
- if (!(typeof value == 'string' && typeof other == 'string')) {
- value = toNumber(value);
- other = toNumber(other);
- }
- return operator(value, other);
- };
- }
-
- /**
- * Creates a function that wraps `func` to continue currying.
- *
- * @private
- * @param {Function} func The function to wrap.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @param {Function} wrapFunc The function to create the `func` wrapper.
- * @param {*} placeholder The placeholder value.
- * @param {*} [thisArg] The `this` binding of `func`.
- * @param {Array} [partials] The arguments to prepend to those provided to
- * the new function.
- * @param {Array} [holders] The `partials` placeholder indexes.
- * @param {Array} [argPos] The argument positions of the new function.
- * @param {number} [ary] The arity cap of `func`.
- * @param {number} [arity] The arity of `func`.
- * @returns {Function} Returns the new wrapped function.
- */
- function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {
- var isCurry = bitmask & WRAP_CURRY_FLAG,
- newHolders = isCurry ? holders : undefined,
- newHoldersRight = isCurry ? undefined : holders,
- newPartials = isCurry ? partials : undefined,
- newPartialsRight = isCurry ? undefined : partials;
-
- bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);
- bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);
-
- if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {
- bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);
- }
- var newData = [
- func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,
- newHoldersRight, argPos, ary, arity
- ];
-
- var result = wrapFunc.apply(undefined, newData);
- if (isLaziable(func)) {
- setData(result, newData);
- }
- result.placeholder = placeholder;
- return setWrapToString(result, func, bitmask);
- }
-
- /**
- * Creates a function like `_.round`.
- *
- * @private
- * @param {string} methodName The name of the `Math` method to use when rounding.
- * @returns {Function} Returns the new round function.
- */
- function createRound(methodName) {
- var func = Math[methodName];
- return function(number, precision) {
- number = toNumber(number);
- precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);
- if (precision) {
- // Shift with exponential notation to avoid floating-point issues.
- // See [MDN](https://mdn.io/round#Examples) for more details.
- var pair = (toString(number) + 'e').split('e'),
- value = func(pair[0] + 'e' + (+pair[1] + precision));
-
- pair = (toString(value) + 'e').split('e');
- return +(pair[0] + 'e' + (+pair[1] - precision));
- }
- return func(number);
- };
- }
-
- /**
- * Creates a set object of `values`.
- *
- * @private
- * @param {Array} values The values to add to the set.
- * @returns {Object} Returns the new set.
- */
- var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {
- return new Set(values);
- };
-
- /**
- * Creates a `_.toPairs` or `_.toPairsIn` function.
- *
- * @private
- * @param {Function} keysFunc The function to get the keys of a given object.
- * @returns {Function} Returns the new pairs function.
- */
- function createToPairs(keysFunc) {
- return function(object) {
- var tag = getTag(object);
- if (tag == mapTag) {
- return mapToArray(object);
- }
- if (tag == setTag) {
- return setToPairs(object);
- }
- return baseToPairs(object, keysFunc(object));
- };
- }
-
- /**
- * Creates a function that either curries or invokes `func` with optional
- * `this` binding and partially applied arguments.
- *
- * @private
- * @param {Function|string} func The function or method name to wrap.
- * @param {number} bitmask The bitmask flags.
- * 1 - `_.bind`
- * 2 - `_.bindKey`
- * 4 - `_.curry` or `_.curryRight` of a bound function
- * 8 - `_.curry`
- * 16 - `_.curryRight`
- * 32 - `_.partial`
- * 64 - `_.partialRight`
- * 128 - `_.rearg`
- * 256 - `_.ary`
- * 512 - `_.flip`
- * @param {*} [thisArg] The `this` binding of `func`.
- * @param {Array} [partials] The arguments to be partially applied.
- * @param {Array} [holders] The `partials` placeholder indexes.
- * @param {Array} [argPos] The argument positions of the new function.
- * @param {number} [ary] The arity cap of `func`.
- * @param {number} [arity] The arity of `func`.
- * @returns {Function} Returns the new wrapped function.
- */
- function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {
- var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;
- if (!isBindKey && typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- var length = partials ? partials.length : 0;
- if (!length) {
- bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);
- partials = holders = undefined;
- }
- ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);
- arity = arity === undefined ? arity : toInteger(arity);
- length -= holders ? holders.length : 0;
-
- if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {
- var partialsRight = partials,
- holdersRight = holders;
-
- partials = holders = undefined;
- }
- var data = isBindKey ? undefined : getData(func);
-
- var newData = [
- func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,
- argPos, ary, arity
- ];
-
- if (data) {
- mergeData(newData, data);
- }
- func = newData[0];
- bitmask = newData[1];
- thisArg = newData[2];
- partials = newData[3];
- holders = newData[4];
- arity = newData[9] = newData[9] === undefined
- ? (isBindKey ? 0 : func.length)
- : nativeMax(newData[9] - length, 0);
-
- if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {
- bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);
- }
- if (!bitmask || bitmask == WRAP_BIND_FLAG) {
- var result = createBind(func, bitmask, thisArg);
- } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {
- result = createCurry(func, bitmask, arity);
- } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {
- result = createPartial(func, bitmask, thisArg, partials);
- } else {
- result = createHybrid.apply(undefined, newData);
- }
- var setter = data ? baseSetData : setData;
- return setWrapToString(setter(result, newData), func, bitmask);
- }
-
- /**
- * Used by `_.defaults` to customize its `_.assignIn` use to assign properties
- * of source objects to the destination object for all destination properties
- * that resolve to `undefined`.
- *
- * @private
- * @param {*} objValue The destination value.
- * @param {*} srcValue The source value.
- * @param {string} key The key of the property to assign.
- * @param {Object} object The parent object of `objValue`.
- * @returns {*} Returns the value to assign.
- */
- function customDefaultsAssignIn(objValue, srcValue, key, object) {
- if (objValue === undefined ||
- (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {
- return srcValue;
- }
- return objValue;
- }
-
- /**
- * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source
- * objects into destination objects that are passed thru.
- *
- * @private
- * @param {*} objValue The destination value.
- * @param {*} srcValue The source value.
- * @param {string} key The key of the property to merge.
- * @param {Object} object The parent object of `objValue`.
- * @param {Object} source The parent object of `srcValue`.
- * @param {Object} [stack] Tracks traversed source values and their merged
- * counterparts.
- * @returns {*} Returns the value to assign.
- */
- function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {
- if (isObject(objValue) && isObject(srcValue)) {
- // Recursively merge objects and arrays (susceptible to call stack limits).
- stack.set(srcValue, objValue);
- baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);
- stack['delete'](srcValue);
- }
- return objValue;
- }
-
- /**
- * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain
- * objects.
- *
- * @private
- * @param {*} value The value to inspect.
- * @param {string} key The key of the property to inspect.
- * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.
- */
- function customOmitClone(value) {
- return isPlainObject(value) ? undefined : value;
- }
-
- /**
- * A specialized version of `baseIsEqualDeep` for arrays with support for
- * partial deep comparisons.
- *
- * @private
- * @param {Array} array The array to compare.
- * @param {Array} other The other array to compare.
- * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
- * @param {Function} customizer The function to customize comparisons.
- * @param {Function} equalFunc The function to determine equivalents of values.
- * @param {Object} stack Tracks traversed `array` and `other` objects.
- * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
- */
- function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
- var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
- arrLength = array.length,
- othLength = other.length;
-
- if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
- return false;
- }
- // Assume cyclic values are equal.
- var stacked = stack.get(array);
- if (stacked && stack.get(other)) {
- return stacked == other;
- }
- var index = -1,
- result = true,
- seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;
-
- stack.set(array, other);
- stack.set(other, array);
-
- // Ignore non-index properties.
- while (++index < arrLength) {
- var arrValue = array[index],
- othValue = other[index];
-
- if (customizer) {
- var compared = isPartial
- ? customizer(othValue, arrValue, index, other, array, stack)
- : customizer(arrValue, othValue, index, array, other, stack);
- }
- if (compared !== undefined) {
- if (compared) {
- continue;
- }
- result = false;
- break;
- }
- // Recursively compare arrays (susceptible to call stack limits).
- if (seen) {
- if (!arraySome(other, function(othValue, othIndex) {
- if (!cacheHas(seen, othIndex) &&
- (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
- return seen.push(othIndex);
- }
- })) {
- result = false;
- break;
- }
- } else if (!(
- arrValue === othValue ||
- equalFunc(arrValue, othValue, bitmask, customizer, stack)
- )) {
- result = false;
- break;
- }
- }
- stack['delete'](array);
- stack['delete'](other);
- return result;
- }
-
- /**
- * A specialized version of `baseIsEqualDeep` for comparing objects of
- * the same `toStringTag`.
- *
- * **Note:** This function only supports comparing values with tags of
- * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
- *
- * @private
- * @param {Object} object The object to compare.
- * @param {Object} other The other object to compare.
- * @param {string} tag The `toStringTag` of the objects to compare.
- * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
- * @param {Function} customizer The function to customize comparisons.
- * @param {Function} equalFunc The function to determine equivalents of values.
- * @param {Object} stack Tracks traversed `object` and `other` objects.
- * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
- */
- function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
- switch (tag) {
- case dataViewTag:
- if ((object.byteLength != other.byteLength) ||
- (object.byteOffset != other.byteOffset)) {
- return false;
- }
- object = object.buffer;
- other = other.buffer;
-
- case arrayBufferTag:
- if ((object.byteLength != other.byteLength) ||
- !equalFunc(new Uint8Array(object), new Uint8Array(other))) {
- return false;
- }
- return true;
-
- case boolTag:
- case dateTag:
- case numberTag:
- // Coerce booleans to `1` or `0` and dates to milliseconds.
- // Invalid dates are coerced to `NaN`.
- return eq(+object, +other);
-
- case errorTag:
- return object.name == other.name && object.message == other.message;
-
- case regexpTag:
- case stringTag:
- // Coerce regexes to strings and treat strings, primitives and objects,
- // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
- // for more details.
- return object == (other + '');
-
- case mapTag:
- var convert = mapToArray;
-
- case setTag:
- var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
- convert || (convert = setToArray);
-
- if (object.size != other.size && !isPartial) {
- return false;
- }
- // Assume cyclic values are equal.
- var stacked = stack.get(object);
- if (stacked) {
- return stacked == other;
- }
- bitmask |= COMPARE_UNORDERED_FLAG;
-
- // Recursively compare objects (susceptible to call stack limits).
- stack.set(object, other);
- var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
- stack['delete'](object);
- return result;
-
- case symbolTag:
- if (symbolValueOf) {
- return symbolValueOf.call(object) == symbolValueOf.call(other);
- }
- }
- return false;
- }
-
- /**
- * A specialized version of `baseIsEqualDeep` for objects with support for
- * partial deep comparisons.
- *
- * @private
- * @param {Object} object The object to compare.
- * @param {Object} other The other object to compare.
- * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
- * @param {Function} customizer The function to customize comparisons.
- * @param {Function} equalFunc The function to determine equivalents of values.
- * @param {Object} stack Tracks traversed `object` and `other` objects.
- * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
- */
- function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
- var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
- objProps = getAllKeys(object),
- objLength = objProps.length,
- othProps = getAllKeys(other),
- othLength = othProps.length;
-
- if (objLength != othLength && !isPartial) {
- return false;
- }
- var index = objLength;
- while (index--) {
- var key = objProps[index];
- if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
- return false;
- }
- }
- // Assume cyclic values are equal.
- var stacked = stack.get(object);
- if (stacked && stack.get(other)) {
- return stacked == other;
- }
- var result = true;
- stack.set(object, other);
- stack.set(other, object);
-
- var skipCtor = isPartial;
- while (++index < objLength) {
- key = objProps[index];
- var objValue = object[key],
- othValue = other[key];
-
- if (customizer) {
- var compared = isPartial
- ? customizer(othValue, objValue, key, other, object, stack)
- : customizer(objValue, othValue, key, object, other, stack);
- }
- // Recursively compare objects (susceptible to call stack limits).
- if (!(compared === undefined
- ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))
- : compared
- )) {
- result = false;
- break;
- }
- skipCtor || (skipCtor = key == 'constructor');
- }
- if (result && !skipCtor) {
- var objCtor = object.constructor,
- othCtor = other.constructor;
-
- // Non `Object` object instances with different constructors are not equal.
- if (objCtor != othCtor &&
- ('constructor' in object && 'constructor' in other) &&
- !(typeof objCtor == 'function' && objCtor instanceof objCtor &&
- typeof othCtor == 'function' && othCtor instanceof othCtor)) {
- result = false;
- }
- }
- stack['delete'](object);
- stack['delete'](other);
- return result;
- }
-
- /**
- * A specialized version of `baseRest` which flattens the rest array.
- *
- * @private
- * @param {Function} func The function to apply a rest parameter to.
- * @returns {Function} Returns the new function.
- */
- function flatRest(func) {
- return setToString(overRest(func, undefined, flatten), func + '');
- }
-
- /**
- * Creates an array of own enumerable property names and symbols of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names and symbols.
- */
- function getAllKeys(object) {
- return baseGetAllKeys(object, keys, getSymbols);
- }
-
- /**
- * Creates an array of own and inherited enumerable property names and
- * symbols of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names and symbols.
- */
- function getAllKeysIn(object) {
- return baseGetAllKeys(object, keysIn, getSymbolsIn);
- }
-
- /**
- * Gets metadata for `func`.
- *
- * @private
- * @param {Function} func The function to query.
- * @returns {*} Returns the metadata for `func`.
- */
- var getData = !metaMap ? noop : function(func) {
- return metaMap.get(func);
- };
-
- /**
- * Gets the name of `func`.
- *
- * @private
- * @param {Function} func The function to query.
- * @returns {string} Returns the function name.
- */
- function getFuncName(func) {
- var result = (func.name + ''),
- array = realNames[result],
- length = hasOwnProperty.call(realNames, result) ? array.length : 0;
-
- while (length--) {
- var data = array[length],
- otherFunc = data.func;
- if (otherFunc == null || otherFunc == func) {
- return data.name;
- }
- }
- return result;
- }
-
- /**
- * Gets the argument placeholder value for `func`.
- *
- * @private
- * @param {Function} func The function to inspect.
- * @returns {*} Returns the placeholder value.
- */
- function getHolder(func) {
- var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;
- return object.placeholder;
- }
-
- /**
- * Gets the appropriate "iteratee" function. If `_.iteratee` is customized,
- * this function returns the custom method, otherwise it returns `baseIteratee`.
- * If arguments are provided, the chosen function is invoked with them and
- * its result is returned.
- *
- * @private
- * @param {*} [value] The value to convert to an iteratee.
- * @param {number} [arity] The arity of the created iteratee.
- * @returns {Function} Returns the chosen function or its result.
- */
- function getIteratee() {
- var result = lodash.iteratee || iteratee;
- result = result === iteratee ? baseIteratee : result;
- return arguments.length ? result(arguments[0], arguments[1]) : result;
- }
-
- /**
- * Gets the data for `map`.
- *
- * @private
- * @param {Object} map The map to query.
- * @param {string} key The reference key.
- * @returns {*} Returns the map data.
- */
- function getMapData(map, key) {
- var data = map.__data__;
- return isKeyable(key)
- ? data[typeof key == 'string' ? 'string' : 'hash']
- : data.map;
- }
-
- /**
- * Gets the property names, values, and compare flags of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the match data of `object`.
- */
- function getMatchData(object) {
- var result = keys(object),
- length = result.length;
-
- while (length--) {
- var key = result[length],
- value = object[key];
-
- result[length] = [key, value, isStrictComparable(value)];
- }
- return result;
- }
-
- /**
- * Gets the native function at `key` of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {string} key The key of the method to get.
- * @returns {*} Returns the function if it's native, else `undefined`.
- */
- function getNative(object, key) {
- var value = getValue(object, key);
- return baseIsNative(value) ? value : undefined;
- }
-
- /**
- * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
- *
- * @private
- * @param {*} value The value to query.
- * @returns {string} Returns the raw `toStringTag`.
- */
- function getRawTag(value) {
- var isOwn = hasOwnProperty.call(value, symToStringTag),
- tag = value[symToStringTag];
-
- try {
- value[symToStringTag] = undefined;
- var unmasked = true;
- } catch (e) {}
-
- var result = nativeObjectToString.call(value);
- if (unmasked) {
- if (isOwn) {
- value[symToStringTag] = tag;
- } else {
- delete value[symToStringTag];
- }
- }
- return result;
- }
-
- /**
- * Creates an array of the own enumerable symbols of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of symbols.
- */
- var getSymbols = !nativeGetSymbols ? stubArray : function(object) {
- if (object == null) {
- return [];
- }
- object = Object(object);
- return arrayFilter(nativeGetSymbols(object), function(symbol) {
- return propertyIsEnumerable.call(object, symbol);
- });
- };
-
- /**
- * Creates an array of the own and inherited enumerable symbols of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of symbols.
- */
- var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {
- var result = [];
- while (object) {
- arrayPush(result, getSymbols(object));
- object = getPrototype(object);
- }
- return result;
- };
-
- /**
- * Gets the `toStringTag` of `value`.
- *
- * @private
- * @param {*} value The value to query.
- * @returns {string} Returns the `toStringTag`.
- */
- var getTag = baseGetTag;
-
- // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.
- if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||
- (Map && getTag(new Map) != mapTag) ||
- (Promise && getTag(Promise.resolve()) != promiseTag) ||
- (Set && getTag(new Set) != setTag) ||
- (WeakMap && getTag(new WeakMap) != weakMapTag)) {
- getTag = function(value) {
- var result = baseGetTag(value),
- Ctor = result == objectTag ? value.constructor : undefined,
- ctorString = Ctor ? toSource(Ctor) : '';
-
- if (ctorString) {
- switch (ctorString) {
- case dataViewCtorString: return dataViewTag;
- case mapCtorString: return mapTag;
- case promiseCtorString: return promiseTag;
- case setCtorString: return setTag;
- case weakMapCtorString: return weakMapTag;
- }
- }
- return result;
- };
- }
-
- /**
- * Gets the view, applying any `transforms` to the `start` and `end` positions.
- *
- * @private
- * @param {number} start The start of the view.
- * @param {number} end The end of the view.
- * @param {Array} transforms The transformations to apply to the view.
- * @returns {Object} Returns an object containing the `start` and `end`
- * positions of the view.
- */
- function getView(start, end, transforms) {
- var index = -1,
- length = transforms.length;
-
- while (++index < length) {
- var data = transforms[index],
- size = data.size;
-
- switch (data.type) {
- case 'drop': start += size; break;
- case 'dropRight': end -= size; break;
- case 'take': end = nativeMin(end, start + size); break;
- case 'takeRight': start = nativeMax(start, end - size); break;
- }
- }
- return { 'start': start, 'end': end };
- }
-
- /**
- * Extracts wrapper details from the `source` body comment.
- *
- * @private
- * @param {string} source The source to inspect.
- * @returns {Array} Returns the wrapper details.
- */
- function getWrapDetails(source) {
- var match = source.match(reWrapDetails);
- return match ? match[1].split(reSplitDetails) : [];
- }
-
- /**
- * Checks if `path` exists on `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Array|string} path The path to check.
- * @param {Function} hasFunc The function to check properties.
- * @returns {boolean} Returns `true` if `path` exists, else `false`.
- */
- function hasPath(object, path, hasFunc) {
- path = castPath(path, object);
-
- var index = -1,
- length = path.length,
- result = false;
-
- while (++index < length) {
- var key = toKey(path[index]);
- if (!(result = object != null && hasFunc(object, key))) {
- break;
- }
- object = object[key];
- }
- if (result || ++index != length) {
- return result;
- }
- length = object == null ? 0 : object.length;
- return !!length && isLength(length) && isIndex(key, length) &&
- (isArray(object) || isArguments(object));
- }
-
- /**
- * Initializes an array clone.
- *
- * @private
- * @param {Array} array The array to clone.
- * @returns {Array} Returns the initialized clone.
- */
- function initCloneArray(array) {
- var length = array.length,
- result = new array.constructor(length);
-
- // Add properties assigned by `RegExp#exec`.
- if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
- result.index = array.index;
- result.input = array.input;
- }
- return result;
- }
-
- /**
- * Initializes an object clone.
- *
- * @private
- * @param {Object} object The object to clone.
- * @returns {Object} Returns the initialized clone.
- */
- function initCloneObject(object) {
- return (typeof object.constructor == 'function' && !isPrototype(object))
- ? baseCreate(getPrototype(object))
- : {};
- }
-
- /**
- * Initializes an object clone based on its `toStringTag`.
- *
- * **Note:** This function only supports cloning values with tags of
- * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.
- *
- * @private
- * @param {Object} object The object to clone.
- * @param {string} tag The `toStringTag` of the object to clone.
- * @param {boolean} [isDeep] Specify a deep clone.
- * @returns {Object} Returns the initialized clone.
- */
- function initCloneByTag(object, tag, isDeep) {
- var Ctor = object.constructor;
- switch (tag) {
- case arrayBufferTag:
- return cloneArrayBuffer(object);
-
- case boolTag:
- case dateTag:
- return new Ctor(+object);
-
- case dataViewTag:
- return cloneDataView(object, isDeep);
-
- case float32Tag: case float64Tag:
- case int8Tag: case int16Tag: case int32Tag:
- case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:
- return cloneTypedArray(object, isDeep);
-
- case mapTag:
- return new Ctor;
-
- case numberTag:
- case stringTag:
- return new Ctor(object);
-
- case regexpTag:
- return cloneRegExp(object);
-
- case setTag:
- return new Ctor;
-
- case symbolTag:
- return cloneSymbol(object);
- }
- }
-
- /**
- * Inserts wrapper `details` in a comment at the top of the `source` body.
- *
- * @private
- * @param {string} source The source to modify.
- * @returns {Array} details The details to insert.
- * @returns {string} Returns the modified source.
- */
- function insertWrapDetails(source, details) {
- var length = details.length;
- if (!length) {
- return source;
- }
- var lastIndex = length - 1;
- details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];
- details = details.join(length > 2 ? ', ' : ' ');
- return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n');
- }
-
- /**
- * Checks if `value` is a flattenable `arguments` object or array.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.
- */
- function isFlattenable(value) {
- return isArray(value) || isArguments(value) ||
- !!(spreadableSymbol && value && value[spreadableSymbol]);
- }
-
- /**
- * Checks if `value` is a valid array-like index.
- *
- * @private
- * @param {*} value The value to check.
- * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
- * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
- */
- function isIndex(value, length) {
- var type = typeof value;
- length = length == null ? MAX_SAFE_INTEGER : length;
-
- return !!length &&
- (type == 'number' ||
- (type != 'symbol' && reIsUint.test(value))) &&
- (value > -1 && value % 1 == 0 && value < length);
- }
-
- /**
- * Checks if the given arguments are from an iteratee call.
- *
- * @private
- * @param {*} value The potential iteratee value argument.
- * @param {*} index The potential iteratee index or key argument.
- * @param {*} object The potential iteratee object argument.
- * @returns {boolean} Returns `true` if the arguments are from an iteratee call,
- * else `false`.
- */
- function isIterateeCall(value, index, object) {
- if (!isObject(object)) {
- return false;
- }
- var type = typeof index;
- if (type == 'number'
- ? (isArrayLike(object) && isIndex(index, object.length))
- : (type == 'string' && index in object)
- ) {
- return eq(object[index], value);
- }
- return false;
- }
-
- /**
- * Checks if `value` is a property name and not a property path.
- *
- * @private
- * @param {*} value The value to check.
- * @param {Object} [object] The object to query keys on.
- * @returns {boolean} Returns `true` if `value` is a property name, else `false`.
- */
- function isKey(value, object) {
- if (isArray(value)) {
- return false;
- }
- var type = typeof value;
- if (type == 'number' || type == 'symbol' || type == 'boolean' ||
- value == null || isSymbol(value)) {
- return true;
- }
- return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
- (object != null && value in Object(object));
- }
-
- /**
- * Checks if `value` is suitable for use as unique object key.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is suitable, else `false`.
- */
- function isKeyable(value) {
- var type = typeof value;
- return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
- ? (value !== '__proto__')
- : (value === null);
- }
-
- /**
- * Checks if `func` has a lazy counterpart.
- *
- * @private
- * @param {Function} func The function to check.
- * @returns {boolean} Returns `true` if `func` has a lazy counterpart,
- * else `false`.
- */
- function isLaziable(func) {
- var funcName = getFuncName(func),
- other = lodash[funcName];
-
- if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {
- return false;
- }
- if (func === other) {
- return true;
- }
- var data = getData(other);
- return !!data && func === data[0];
- }
-
- /**
- * Checks if `func` has its source masked.
- *
- * @private
- * @param {Function} func The function to check.
- * @returns {boolean} Returns `true` if `func` is masked, else `false`.
- */
- function isMasked(func) {
- return !!maskSrcKey && (maskSrcKey in func);
- }
-
- /**
- * Checks if `func` is capable of being masked.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `func` is maskable, else `false`.
- */
- var isMaskable = coreJsData ? isFunction : stubFalse;
-
- /**
- * Checks if `value` is likely a prototype object.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
- */
- function isPrototype(value) {
- var Ctor = value && value.constructor,
- proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;
-
- return value === proto;
- }
-
- /**
- * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.
- *
- * @private
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` if suitable for strict
- * equality comparisons, else `false`.
- */
- function isStrictComparable(value) {
- return value === value && !isObject(value);
- }
-
- /**
- * A specialized version of `matchesProperty` for source values suitable
- * for strict equality comparisons, i.e. `===`.
- *
- * @private
- * @param {string} key The key of the property to get.
- * @param {*} srcValue The value to match.
- * @returns {Function} Returns the new spec function.
- */
- function matchesStrictComparable(key, srcValue) {
- return function(object) {
- if (object == null) {
- return false;
- }
- return object[key] === srcValue &&
- (srcValue !== undefined || (key in Object(object)));
- };
- }
-
- /**
- * A specialized version of `_.memoize` which clears the memoized function's
- * cache when it exceeds `MAX_MEMOIZE_SIZE`.
- *
- * @private
- * @param {Function} func The function to have its output memoized.
- * @returns {Function} Returns the new memoized function.
- */
- function memoizeCapped(func) {
- var result = memoize(func, function(key) {
- if (cache.size === MAX_MEMOIZE_SIZE) {
- cache.clear();
- }
- return key;
- });
-
- var cache = result.cache;
- return result;
- }
-
- /**
- * Merges the function metadata of `source` into `data`.
- *
- * Merging metadata reduces the number of wrappers used to invoke a function.
- * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`
- * may be applied regardless of execution order. Methods like `_.ary` and
- * `_.rearg` modify function arguments, making the order in which they are
- * executed important, preventing the merging of metadata. However, we make
- * an exception for a safe combined case where curried functions have `_.ary`
- * and or `_.rearg` applied.
- *
- * @private
- * @param {Array} data The destination metadata.
- * @param {Array} source The source metadata.
- * @returns {Array} Returns `data`.
- */
- function mergeData(data, source) {
- var bitmask = data[1],
- srcBitmask = source[1],
- newBitmask = bitmask | srcBitmask,
- isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);
-
- var isCombo =
- ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||
- ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||
- ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));
-
- // Exit early if metadata can't be merged.
- if (!(isCommon || isCombo)) {
- return data;
- }
- // Use source `thisArg` if available.
- if (srcBitmask & WRAP_BIND_FLAG) {
- data[2] = source[2];
- // Set when currying a bound function.
- newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;
- }
- // Compose partial arguments.
- var value = source[3];
- if (value) {
- var partials = data[3];
- data[3] = partials ? composeArgs(partials, value, source[4]) : value;
- data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];
- }
- // Compose partial right arguments.
- value = source[5];
- if (value) {
- partials = data[5];
- data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;
- data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];
- }
- // Use source `argPos` if available.
- value = source[7];
- if (value) {
- data[7] = value;
- }
- // Use source `ary` if it's smaller.
- if (srcBitmask & WRAP_ARY_FLAG) {
- data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);
- }
- // Use source `arity` if one is not provided.
- if (data[9] == null) {
- data[9] = source[9];
- }
- // Use source `func` and merge bitmasks.
- data[0] = source[0];
- data[1] = newBitmask;
-
- return data;
- }
-
- /**
- * This function is like
- * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
- * except that it includes inherited enumerable properties.
- *
- * @private
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names.
- */
- function nativeKeysIn(object) {
- var result = [];
- if (object != null) {
- for (var key in Object(object)) {
- result.push(key);
- }
- }
- return result;
- }
-
- /**
- * Converts `value` to a string using `Object.prototype.toString`.
- *
- * @private
- * @param {*} value The value to convert.
- * @returns {string} Returns the converted string.
- */
- function objectToString(value) {
- return nativeObjectToString.call(value);
- }
-
- /**
- * A specialized version of `baseRest` which transforms the rest array.
- *
- * @private
- * @param {Function} func The function to apply a rest parameter to.
- * @param {number} [start=func.length-1] The start position of the rest parameter.
- * @param {Function} transform The rest array transform.
- * @returns {Function} Returns the new function.
- */
- function overRest(func, start, transform) {
- start = nativeMax(start === undefined ? (func.length - 1) : start, 0);
- return function() {
- var args = arguments,
- index = -1,
- length = nativeMax(args.length - start, 0),
- array = Array(length);
-
- while (++index < length) {
- array[index] = args[start + index];
- }
- index = -1;
- var otherArgs = Array(start + 1);
- while (++index < start) {
- otherArgs[index] = args[index];
- }
- otherArgs[start] = transform(array);
- return apply(func, this, otherArgs);
- };
- }
-
- /**
- * Gets the parent value at `path` of `object`.
- *
- * @private
- * @param {Object} object The object to query.
- * @param {Array} path The path to get the parent value of.
- * @returns {*} Returns the parent value.
- */
- function parent(object, path) {
- return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));
- }
-
- /**
- * Reorder `array` according to the specified indexes where the element at
- * the first index is assigned as the first element, the element at
- * the second index is assigned as the second element, and so on.
- *
- * @private
- * @param {Array} array The array to reorder.
- * @param {Array} indexes The arranged array indexes.
- * @returns {Array} Returns `array`.
- */
- function reorder(array, indexes) {
- var arrLength = array.length,
- length = nativeMin(indexes.length, arrLength),
- oldArray = copyArray(array);
-
- while (length--) {
- var index = indexes[length];
- array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;
- }
- return array;
- }
-
- /**
- * Sets metadata for `func`.
- *
- * **Note:** If this function becomes hot, i.e. is invoked a lot in a short
- * period of time, it will trip its breaker and transition to an identity
- * function to avoid garbage collection pauses in V8. See
- * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)
- * for more details.
- *
- * @private
- * @param {Function} func The function to associate metadata with.
- * @param {*} data The metadata.
- * @returns {Function} Returns `func`.
- */
- var setData = shortOut(baseSetData);
-
- /**
- * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).
- *
- * @private
- * @param {Function} func The function to delay.
- * @param {number} wait The number of milliseconds to delay invocation.
- * @returns {number|Object} Returns the timer id or timeout object.
- */
- var setTimeout = ctxSetTimeout || function(func, wait) {
- return root.setTimeout(func, wait);
- };
-
- /**
- * Sets the `toString` method of `func` to return `string`.
- *
- * @private
- * @param {Function} func The function to modify.
- * @param {Function} string The `toString` result.
- * @returns {Function} Returns `func`.
- */
- var setToString = shortOut(baseSetToString);
-
- /**
- * Sets the `toString` method of `wrapper` to mimic the source of `reference`
- * with wrapper details in a comment at the top of the source body.
- *
- * @private
- * @param {Function} wrapper The function to modify.
- * @param {Function} reference The reference function.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @returns {Function} Returns `wrapper`.
- */
- function setWrapToString(wrapper, reference, bitmask) {
- var source = (reference + '');
- return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));
- }
-
- /**
- * Creates a function that'll short out and invoke `identity` instead
- * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`
- * milliseconds.
- *
- * @private
- * @param {Function} func The function to restrict.
- * @returns {Function} Returns the new shortable function.
- */
- function shortOut(func) {
- var count = 0,
- lastCalled = 0;
-
- return function() {
- var stamp = nativeNow(),
- remaining = HOT_SPAN - (stamp - lastCalled);
-
- lastCalled = stamp;
- if (remaining > 0) {
- if (++count >= HOT_COUNT) {
- return arguments[0];
- }
- } else {
- count = 0;
- }
- return func.apply(undefined, arguments);
- };
- }
-
- /**
- * A specialized version of `_.shuffle` which mutates and sets the size of `array`.
- *
- * @private
- * @param {Array} array The array to shuffle.
- * @param {number} [size=array.length] The size of `array`.
- * @returns {Array} Returns `array`.
- */
- function shuffleSelf(array, size) {
- var index = -1,
- length = array.length,
- lastIndex = length - 1;
-
- size = size === undefined ? length : size;
- while (++index < size) {
- var rand = baseRandom(index, lastIndex),
- value = array[rand];
-
- array[rand] = array[index];
- array[index] = value;
- }
- array.length = size;
- return array;
- }
-
- /**
- * Converts `string` to a property path array.
- *
- * @private
- * @param {string} string The string to convert.
- * @returns {Array} Returns the property path array.
- */
- var stringToPath = memoizeCapped(function(string) {
- var result = [];
- if (string.charCodeAt(0) === 46 /* . */) {
- result.push('');
- }
- string.replace(rePropName, function(match, number, quote, subString) {
- result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));
- });
- return result;
- });
-
- /**
- * Converts `value` to a string key if it's not a string or symbol.
- *
- * @private
- * @param {*} value The value to inspect.
- * @returns {string|symbol} Returns the key.
- */
- function toKey(value) {
- if (typeof value == 'string' || isSymbol(value)) {
- return value;
- }
- var result = (value + '');
- return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
- }
-
- /**
- * Converts `func` to its source code.
- *
- * @private
- * @param {Function} func The function to convert.
- * @returns {string} Returns the source code.
- */
- function toSource(func) {
- if (func != null) {
- try {
- return funcToString.call(func);
- } catch (e) {}
- try {
- return (func + '');
- } catch (e) {}
- }
- return '';
- }
-
- /**
- * Updates wrapper `details` based on `bitmask` flags.
- *
- * @private
- * @returns {Array} details The details to modify.
- * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
- * @returns {Array} Returns `details`.
- */
- function updateWrapDetails(details, bitmask) {
- arrayEach(wrapFlags, function(pair) {
- var value = '_.' + pair[0];
- if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {
- details.push(value);
- }
- });
- return details.sort();
- }
-
- /**
- * Creates a clone of `wrapper`.
- *
- * @private
- * @param {Object} wrapper The wrapper to clone.
- * @returns {Object} Returns the cloned wrapper.
- */
- function wrapperClone(wrapper) {
- if (wrapper instanceof LazyWrapper) {
- return wrapper.clone();
- }
- var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);
- result.__actions__ = copyArray(wrapper.__actions__);
- result.__index__ = wrapper.__index__;
- result.__values__ = wrapper.__values__;
- return result;
- }
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates an array of elements split into groups the length of `size`.
- * If `array` can't be split evenly, the final chunk will be the remaining
- * elements.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to process.
- * @param {number} [size=1] The length of each chunk
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Array} Returns the new array of chunks.
- * @example
- *
- * _.chunk(['a', 'b', 'c', 'd'], 2);
- * // => [['a', 'b'], ['c', 'd']]
- *
- * _.chunk(['a', 'b', 'c', 'd'], 3);
- * // => [['a', 'b', 'c'], ['d']]
- */
- function chunk(array, size, guard) {
- if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {
- size = 1;
- } else {
- size = nativeMax(toInteger(size), 0);
- }
- var length = array == null ? 0 : array.length;
- if (!length || size < 1) {
- return [];
- }
- var index = 0,
- resIndex = 0,
- result = Array(nativeCeil(length / size));
-
- while (index < length) {
- result[resIndex++] = baseSlice(array, index, (index += size));
- }
- return result;
- }
-
- /**
- * Creates an array with all falsey values removed. The values `false`, `null`,
- * `0`, `""`, `undefined`, and `NaN` are falsey.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to compact.
- * @returns {Array} Returns the new array of filtered values.
- * @example
- *
- * _.compact([0, 1, false, 2, '', 3]);
- * // => [1, 2, 3]
- */
- function compact(array) {
- var index = -1,
- length = array == null ? 0 : array.length,
- resIndex = 0,
- result = [];
-
- while (++index < length) {
- var value = array[index];
- if (value) {
- result[resIndex++] = value;
- }
- }
- return result;
- }
-
- /**
- * Creates a new array concatenating `array` with any additional arrays
- * and/or values.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to concatenate.
- * @param {...*} [values] The values to concatenate.
- * @returns {Array} Returns the new concatenated array.
- * @example
- *
- * var array = [1];
- * var other = _.concat(array, 2, [3], [[4]]);
- *
- * console.log(other);
- * // => [1, 2, 3, [4]]
- *
- * console.log(array);
- * // => [1]
- */
- function concat() {
- var length = arguments.length;
- if (!length) {
- return [];
- }
- var args = Array(length - 1),
- array = arguments[0],
- index = length;
-
- while (index--) {
- args[index - 1] = arguments[index];
- }
- return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));
- }
-
- /**
- * Creates an array of `array` values not included in the other given arrays
- * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons. The order and references of result values are
- * determined by the first array.
- *
- * **Note:** Unlike `_.pullAll`, this method returns a new array.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {...Array} [values] The values to exclude.
- * @returns {Array} Returns the new array of filtered values.
- * @see _.without, _.xor
- * @example
- *
- * _.difference([2, 1], [2, 3]);
- * // => [1]
- */
- var difference = baseRest(function(array, values) {
- return isArrayLikeObject(array)
- ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))
- : [];
- });
-
- /**
- * This method is like `_.difference` except that it accepts `iteratee` which
- * is invoked for each element of `array` and `values` to generate the criterion
- * by which they're compared. The order and references of result values are
- * determined by the first array. The iteratee is invoked with one argument:
- * (value).
- *
- * **Note:** Unlike `_.pullAllBy`, this method returns a new array.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {...Array} [values] The values to exclude.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Array} Returns the new array of filtered values.
- * @example
- *
- * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);
- * // => [1.2]
- *
- * // The `_.property` iteratee shorthand.
- * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');
- * // => [{ 'x': 2 }]
- */
- var differenceBy = baseRest(function(array, values) {
- var iteratee = last(values);
- if (isArrayLikeObject(iteratee)) {
- iteratee = undefined;
- }
- return isArrayLikeObject(array)
- ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))
- : [];
- });
-
- /**
- * This method is like `_.difference` except that it accepts `comparator`
- * which is invoked to compare elements of `array` to `values`. The order and
- * references of result values are determined by the first array. The comparator
- * is invoked with two arguments: (arrVal, othVal).
- *
- * **Note:** Unlike `_.pullAllWith`, this method returns a new array.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {...Array} [values] The values to exclude.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of filtered values.
- * @example
- *
- * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
- *
- * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);
- * // => [{ 'x': 2, 'y': 1 }]
- */
- var differenceWith = baseRest(function(array, values) {
- var comparator = last(values);
- if (isArrayLikeObject(comparator)) {
- comparator = undefined;
- }
- return isArrayLikeObject(array)
- ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)
- : [];
- });
-
- /**
- * Creates a slice of `array` with `n` elements dropped from the beginning.
- *
- * @static
- * @memberOf _
- * @since 0.5.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {number} [n=1] The number of elements to drop.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * _.drop([1, 2, 3]);
- * // => [2, 3]
- *
- * _.drop([1, 2, 3], 2);
- * // => [3]
- *
- * _.drop([1, 2, 3], 5);
- * // => []
- *
- * _.drop([1, 2, 3], 0);
- * // => [1, 2, 3]
- */
- function drop(array, n, guard) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return [];
- }
- n = (guard || n === undefined) ? 1 : toInteger(n);
- return baseSlice(array, n < 0 ? 0 : n, length);
- }
-
- /**
- * Creates a slice of `array` with `n` elements dropped from the end.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {number} [n=1] The number of elements to drop.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * _.dropRight([1, 2, 3]);
- * // => [1, 2]
- *
- * _.dropRight([1, 2, 3], 2);
- * // => [1]
- *
- * _.dropRight([1, 2, 3], 5);
- * // => []
- *
- * _.dropRight([1, 2, 3], 0);
- * // => [1, 2, 3]
- */
- function dropRight(array, n, guard) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return [];
- }
- n = (guard || n === undefined) ? 1 : toInteger(n);
- n = length - n;
- return baseSlice(array, 0, n < 0 ? 0 : n);
- }
-
- /**
- * Creates a slice of `array` excluding elements dropped from the end.
- * Elements are dropped until `predicate` returns falsey. The predicate is
- * invoked with three arguments: (value, index, array).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'active': true },
- * { 'user': 'fred', 'active': false },
- * { 'user': 'pebbles', 'active': false }
- * ];
- *
- * _.dropRightWhile(users, function(o) { return !o.active; });
- * // => objects for ['barney']
- *
- * // The `_.matches` iteratee shorthand.
- * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });
- * // => objects for ['barney', 'fred']
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.dropRightWhile(users, ['active', false]);
- * // => objects for ['barney']
- *
- * // The `_.property` iteratee shorthand.
- * _.dropRightWhile(users, 'active');
- * // => objects for ['barney', 'fred', 'pebbles']
- */
- function dropRightWhile(array, predicate) {
- return (array && array.length)
- ? baseWhile(array, getIteratee(predicate, 3), true, true)
- : [];
- }
-
- /**
- * Creates a slice of `array` excluding elements dropped from the beginning.
- * Elements are dropped until `predicate` returns falsey. The predicate is
- * invoked with three arguments: (value, index, array).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'active': false },
- * { 'user': 'fred', 'active': false },
- * { 'user': 'pebbles', 'active': true }
- * ];
- *
- * _.dropWhile(users, function(o) { return !o.active; });
- * // => objects for ['pebbles']
- *
- * // The `_.matches` iteratee shorthand.
- * _.dropWhile(users, { 'user': 'barney', 'active': false });
- * // => objects for ['fred', 'pebbles']
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.dropWhile(users, ['active', false]);
- * // => objects for ['pebbles']
- *
- * // The `_.property` iteratee shorthand.
- * _.dropWhile(users, 'active');
- * // => objects for ['barney', 'fred', 'pebbles']
- */
- function dropWhile(array, predicate) {
- return (array && array.length)
- ? baseWhile(array, getIteratee(predicate, 3), true)
- : [];
- }
-
- /**
- * Fills elements of `array` with `value` from `start` up to, but not
- * including, `end`.
- *
- * **Note:** This method mutates `array`.
- *
- * @static
- * @memberOf _
- * @since 3.2.0
- * @category Array
- * @param {Array} array The array to fill.
- * @param {*} value The value to fill `array` with.
- * @param {number} [start=0] The start position.
- * @param {number} [end=array.length] The end position.
- * @returns {Array} Returns `array`.
- * @example
- *
- * var array = [1, 2, 3];
- *
- * _.fill(array, 'a');
- * console.log(array);
- * // => ['a', 'a', 'a']
- *
- * _.fill(Array(3), 2);
- * // => [2, 2, 2]
- *
- * _.fill([4, 6, 8, 10], '*', 1, 3);
- * // => [4, '*', '*', 10]
- */
- function fill(array, value, start, end) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return [];
- }
- if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {
- start = 0;
- end = length;
- }
- return baseFill(array, value, start, end);
- }
-
- /**
- * This method is like `_.find` except that it returns the index of the first
- * element `predicate` returns truthy for instead of the element itself.
- *
- * @static
- * @memberOf _
- * @since 1.1.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @param {number} [fromIndex=0] The index to search from.
- * @returns {number} Returns the index of the found element, else `-1`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'active': false },
- * { 'user': 'fred', 'active': false },
- * { 'user': 'pebbles', 'active': true }
- * ];
- *
- * _.findIndex(users, function(o) { return o.user == 'barney'; });
- * // => 0
- *
- * // The `_.matches` iteratee shorthand.
- * _.findIndex(users, { 'user': 'fred', 'active': false });
- * // => 1
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.findIndex(users, ['active', false]);
- * // => 0
- *
- * // The `_.property` iteratee shorthand.
- * _.findIndex(users, 'active');
- * // => 2
- */
- function findIndex(array, predicate, fromIndex) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return -1;
- }
- var index = fromIndex == null ? 0 : toInteger(fromIndex);
- if (index < 0) {
- index = nativeMax(length + index, 0);
- }
- return baseFindIndex(array, getIteratee(predicate, 3), index);
- }
-
- /**
- * This method is like `_.findIndex` except that it iterates over elements
- * of `collection` from right to left.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @param {number} [fromIndex=array.length-1] The index to search from.
- * @returns {number} Returns the index of the found element, else `-1`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'active': true },
- * { 'user': 'fred', 'active': false },
- * { 'user': 'pebbles', 'active': false }
- * ];
- *
- * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });
- * // => 2
- *
- * // The `_.matches` iteratee shorthand.
- * _.findLastIndex(users, { 'user': 'barney', 'active': true });
- * // => 0
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.findLastIndex(users, ['active', false]);
- * // => 2
- *
- * // The `_.property` iteratee shorthand.
- * _.findLastIndex(users, 'active');
- * // => 0
- */
- function findLastIndex(array, predicate, fromIndex) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return -1;
- }
- var index = length - 1;
- if (fromIndex !== undefined) {
- index = toInteger(fromIndex);
- index = fromIndex < 0
- ? nativeMax(length + index, 0)
- : nativeMin(index, length - 1);
- }
- return baseFindIndex(array, getIteratee(predicate, 3), index, true);
- }
-
- /**
- * Flattens `array` a single level deep.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to flatten.
- * @returns {Array} Returns the new flattened array.
- * @example
- *
- * _.flatten([1, [2, [3, [4]], 5]]);
- * // => [1, 2, [3, [4]], 5]
- */
- function flatten(array) {
- var length = array == null ? 0 : array.length;
- return length ? baseFlatten(array, 1) : [];
- }
-
- /**
- * Recursively flattens `array`.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to flatten.
- * @returns {Array} Returns the new flattened array.
- * @example
- *
- * _.flattenDeep([1, [2, [3, [4]], 5]]);
- * // => [1, 2, 3, 4, 5]
- */
- function flattenDeep(array) {
- var length = array == null ? 0 : array.length;
- return length ? baseFlatten(array, INFINITY) : [];
- }
-
- /**
- * Recursively flatten `array` up to `depth` times.
- *
- * @static
- * @memberOf _
- * @since 4.4.0
- * @category Array
- * @param {Array} array The array to flatten.
- * @param {number} [depth=1] The maximum recursion depth.
- * @returns {Array} Returns the new flattened array.
- * @example
- *
- * var array = [1, [2, [3, [4]], 5]];
- *
- * _.flattenDepth(array, 1);
- * // => [1, 2, [3, [4]], 5]
- *
- * _.flattenDepth(array, 2);
- * // => [1, 2, 3, [4], 5]
- */
- function flattenDepth(array, depth) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return [];
- }
- depth = depth === undefined ? 1 : toInteger(depth);
- return baseFlatten(array, depth);
- }
-
- /**
- * The inverse of `_.toPairs`; this method returns an object composed
- * from key-value `pairs`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} pairs The key-value pairs.
- * @returns {Object} Returns the new object.
- * @example
- *
- * _.fromPairs([['a', 1], ['b', 2]]);
- * // => { 'a': 1, 'b': 2 }
- */
- function fromPairs(pairs) {
- var index = -1,
- length = pairs == null ? 0 : pairs.length,
- result = {};
-
- while (++index < length) {
- var pair = pairs[index];
- result[pair[0]] = pair[1];
- }
- return result;
- }
-
- /**
- * Gets the first element of `array`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @alias first
- * @category Array
- * @param {Array} array The array to query.
- * @returns {*} Returns the first element of `array`.
- * @example
- *
- * _.head([1, 2, 3]);
- * // => 1
- *
- * _.head([]);
- * // => undefined
- */
- function head(array) {
- return (array && array.length) ? array[0] : undefined;
- }
-
- /**
- * Gets the index at which the first occurrence of `value` is found in `array`
- * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons. If `fromIndex` is negative, it's used as the
- * offset from the end of `array`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @param {number} [fromIndex=0] The index to search from.
- * @returns {number} Returns the index of the matched value, else `-1`.
- * @example
- *
- * _.indexOf([1, 2, 1, 2], 2);
- * // => 1
- *
- * // Search from the `fromIndex`.
- * _.indexOf([1, 2, 1, 2], 2, 2);
- * // => 3
- */
- function indexOf(array, value, fromIndex) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return -1;
- }
- var index = fromIndex == null ? 0 : toInteger(fromIndex);
- if (index < 0) {
- index = nativeMax(length + index, 0);
- }
- return baseIndexOf(array, value, index);
- }
-
- /**
- * Gets all but the last element of `array`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to query.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * _.initial([1, 2, 3]);
- * // => [1, 2]
- */
- function initial(array) {
- var length = array == null ? 0 : array.length;
- return length ? baseSlice(array, 0, -1) : [];
- }
-
- /**
- * Creates an array of unique values that are included in all given arrays
- * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons. The order and references of result values are
- * determined by the first array.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @returns {Array} Returns the new array of intersecting values.
- * @example
- *
- * _.intersection([2, 1], [2, 3]);
- * // => [2]
- */
- var intersection = baseRest(function(arrays) {
- var mapped = arrayMap(arrays, castArrayLikeObject);
- return (mapped.length && mapped[0] === arrays[0])
- ? baseIntersection(mapped)
- : [];
- });
-
- /**
- * This method is like `_.intersection` except that it accepts `iteratee`
- * which is invoked for each element of each `arrays` to generate the criterion
- * by which they're compared. The order and references of result values are
- * determined by the first array. The iteratee is invoked with one argument:
- * (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Array} Returns the new array of intersecting values.
- * @example
- *
- * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);
- * // => [2.1]
- *
- * // The `_.property` iteratee shorthand.
- * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
- * // => [{ 'x': 1 }]
- */
- var intersectionBy = baseRest(function(arrays) {
- var iteratee = last(arrays),
- mapped = arrayMap(arrays, castArrayLikeObject);
-
- if (iteratee === last(mapped)) {
- iteratee = undefined;
- } else {
- mapped.pop();
- }
- return (mapped.length && mapped[0] === arrays[0])
- ? baseIntersection(mapped, getIteratee(iteratee, 2))
- : [];
- });
-
- /**
- * This method is like `_.intersection` except that it accepts `comparator`
- * which is invoked to compare elements of `arrays`. The order and references
- * of result values are determined by the first array. The comparator is
- * invoked with two arguments: (arrVal, othVal).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of intersecting values.
- * @example
- *
- * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
- * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
- *
- * _.intersectionWith(objects, others, _.isEqual);
- * // => [{ 'x': 1, 'y': 2 }]
- */
- var intersectionWith = baseRest(function(arrays) {
- var comparator = last(arrays),
- mapped = arrayMap(arrays, castArrayLikeObject);
-
- comparator = typeof comparator == 'function' ? comparator : undefined;
- if (comparator) {
- mapped.pop();
- }
- return (mapped.length && mapped[0] === arrays[0])
- ? baseIntersection(mapped, undefined, comparator)
- : [];
- });
-
- /**
- * Converts all elements in `array` into a string separated by `separator`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to convert.
- * @param {string} [separator=','] The element separator.
- * @returns {string} Returns the joined string.
- * @example
- *
- * _.join(['a', 'b', 'c'], '~');
- * // => 'a~b~c'
- */
- function join(array, separator) {
- return array == null ? '' : nativeJoin.call(array, separator);
- }
-
- /**
- * Gets the last element of `array`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to query.
- * @returns {*} Returns the last element of `array`.
- * @example
- *
- * _.last([1, 2, 3]);
- * // => 3
- */
- function last(array) {
- var length = array == null ? 0 : array.length;
- return length ? array[length - 1] : undefined;
- }
-
- /**
- * This method is like `_.indexOf` except that it iterates over elements of
- * `array` from right to left.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @param {number} [fromIndex=array.length-1] The index to search from.
- * @returns {number} Returns the index of the matched value, else `-1`.
- * @example
- *
- * _.lastIndexOf([1, 2, 1, 2], 2);
- * // => 3
- *
- * // Search from the `fromIndex`.
- * _.lastIndexOf([1, 2, 1, 2], 2, 2);
- * // => 1
- */
- function lastIndexOf(array, value, fromIndex) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return -1;
- }
- var index = length;
- if (fromIndex !== undefined) {
- index = toInteger(fromIndex);
- index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);
- }
- return value === value
- ? strictLastIndexOf(array, value, index)
- : baseFindIndex(array, baseIsNaN, index, true);
- }
-
- /**
- * Gets the element at index `n` of `array`. If `n` is negative, the nth
- * element from the end is returned.
- *
- * @static
- * @memberOf _
- * @since 4.11.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {number} [n=0] The index of the element to return.
- * @returns {*} Returns the nth element of `array`.
- * @example
- *
- * var array = ['a', 'b', 'c', 'd'];
- *
- * _.nth(array, 1);
- * // => 'b'
- *
- * _.nth(array, -2);
- * // => 'c';
- */
- function nth(array, n) {
- return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;
- }
-
- /**
- * Removes all given values from `array` using
- * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons.
- *
- * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`
- * to remove elements from an array by predicate.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Array
- * @param {Array} array The array to modify.
- * @param {...*} [values] The values to remove.
- * @returns {Array} Returns `array`.
- * @example
- *
- * var array = ['a', 'b', 'c', 'a', 'b', 'c'];
- *
- * _.pull(array, 'a', 'c');
- * console.log(array);
- * // => ['b', 'b']
- */
- var pull = baseRest(pullAll);
-
- /**
- * This method is like `_.pull` except that it accepts an array of values to remove.
- *
- * **Note:** Unlike `_.difference`, this method mutates `array`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to modify.
- * @param {Array} values The values to remove.
- * @returns {Array} Returns `array`.
- * @example
- *
- * var array = ['a', 'b', 'c', 'a', 'b', 'c'];
- *
- * _.pullAll(array, ['a', 'c']);
- * console.log(array);
- * // => ['b', 'b']
- */
- function pullAll(array, values) {
- return (array && array.length && values && values.length)
- ? basePullAll(array, values)
- : array;
- }
-
- /**
- * This method is like `_.pullAll` except that it accepts `iteratee` which is
- * invoked for each element of `array` and `values` to generate the criterion
- * by which they're compared. The iteratee is invoked with one argument: (value).
- *
- * **Note:** Unlike `_.differenceBy`, this method mutates `array`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to modify.
- * @param {Array} values The values to remove.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Array} Returns `array`.
- * @example
- *
- * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];
- *
- * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');
- * console.log(array);
- * // => [{ 'x': 2 }]
- */
- function pullAllBy(array, values, iteratee) {
- return (array && array.length && values && values.length)
- ? basePullAll(array, values, getIteratee(iteratee, 2))
- : array;
- }
-
- /**
- * This method is like `_.pullAll` except that it accepts `comparator` which
- * is invoked to compare elements of `array` to `values`. The comparator is
- * invoked with two arguments: (arrVal, othVal).
- *
- * **Note:** Unlike `_.differenceWith`, this method mutates `array`.
- *
- * @static
- * @memberOf _
- * @since 4.6.0
- * @category Array
- * @param {Array} array The array to modify.
- * @param {Array} values The values to remove.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns `array`.
- * @example
- *
- * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];
- *
- * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);
- * console.log(array);
- * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]
- */
- function pullAllWith(array, values, comparator) {
- return (array && array.length && values && values.length)
- ? basePullAll(array, values, undefined, comparator)
- : array;
- }
-
- /**
- * Removes elements from `array` corresponding to `indexes` and returns an
- * array of removed elements.
- *
- * **Note:** Unlike `_.at`, this method mutates `array`.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to modify.
- * @param {...(number|number[])} [indexes] The indexes of elements to remove.
- * @returns {Array} Returns the new array of removed elements.
- * @example
- *
- * var array = ['a', 'b', 'c', 'd'];
- * var pulled = _.pullAt(array, [1, 3]);
- *
- * console.log(array);
- * // => ['a', 'c']
- *
- * console.log(pulled);
- * // => ['b', 'd']
- */
- var pullAt = flatRest(function(array, indexes) {
- var length = array == null ? 0 : array.length,
- result = baseAt(array, indexes);
-
- basePullAt(array, arrayMap(indexes, function(index) {
- return isIndex(index, length) ? +index : index;
- }).sort(compareAscending));
-
- return result;
- });
-
- /**
- * Removes all elements from `array` that `predicate` returns truthy for
- * and returns an array of the removed elements. The predicate is invoked
- * with three arguments: (value, index, array).
- *
- * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`
- * to pull elements from an array by value.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Array
- * @param {Array} array The array to modify.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the new array of removed elements.
- * @example
- *
- * var array = [1, 2, 3, 4];
- * var evens = _.remove(array, function(n) {
- * return n % 2 == 0;
- * });
- *
- * console.log(array);
- * // => [1, 3]
- *
- * console.log(evens);
- * // => [2, 4]
- */
- function remove(array, predicate) {
- var result = [];
- if (!(array && array.length)) {
- return result;
- }
- var index = -1,
- indexes = [],
- length = array.length;
-
- predicate = getIteratee(predicate, 3);
- while (++index < length) {
- var value = array[index];
- if (predicate(value, index, array)) {
- result.push(value);
- indexes.push(index);
- }
- }
- basePullAt(array, indexes);
- return result;
- }
-
- /**
- * Reverses `array` so that the first element becomes the last, the second
- * element becomes the second to last, and so on.
- *
- * **Note:** This method mutates `array` and is based on
- * [`Array#reverse`](https://mdn.io/Array/reverse).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to modify.
- * @returns {Array} Returns `array`.
- * @example
- *
- * var array = [1, 2, 3];
- *
- * _.reverse(array);
- * // => [3, 2, 1]
- *
- * console.log(array);
- * // => [3, 2, 1]
- */
- function reverse(array) {
- return array == null ? array : nativeReverse.call(array);
- }
-
- /**
- * Creates a slice of `array` from `start` up to, but not including, `end`.
- *
- * **Note:** This method is used instead of
- * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are
- * returned.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to slice.
- * @param {number} [start=0] The start position.
- * @param {number} [end=array.length] The end position.
- * @returns {Array} Returns the slice of `array`.
- */
- function slice(array, start, end) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return [];
- }
- if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {
- start = 0;
- end = length;
- }
- else {
- start = start == null ? 0 : toInteger(start);
- end = end === undefined ? length : toInteger(end);
- }
- return baseSlice(array, start, end);
- }
-
- /**
- * Uses a binary search to determine the lowest index at which `value`
- * should be inserted into `array` in order to maintain its sort order.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The sorted array to inspect.
- * @param {*} value The value to evaluate.
- * @returns {number} Returns the index at which `value` should be inserted
- * into `array`.
- * @example
- *
- * _.sortedIndex([30, 50], 40);
- * // => 1
- */
- function sortedIndex(array, value) {
- return baseSortedIndex(array, value);
- }
-
- /**
- * This method is like `_.sortedIndex` except that it accepts `iteratee`
- * which is invoked for `value` and each element of `array` to compute their
- * sort ranking. The iteratee is invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The sorted array to inspect.
- * @param {*} value The value to evaluate.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {number} Returns the index at which `value` should be inserted
- * into `array`.
- * @example
- *
- * var objects = [{ 'x': 4 }, { 'x': 5 }];
- *
- * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
- * // => 0
- *
- * // The `_.property` iteratee shorthand.
- * _.sortedIndexBy(objects, { 'x': 4 }, 'x');
- * // => 0
- */
- function sortedIndexBy(array, value, iteratee) {
- return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));
- }
-
- /**
- * This method is like `_.indexOf` except that it performs a binary
- * search on a sorted `array`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @returns {number} Returns the index of the matched value, else `-1`.
- * @example
- *
- * _.sortedIndexOf([4, 5, 5, 5, 6], 5);
- * // => 1
- */
- function sortedIndexOf(array, value) {
- var length = array == null ? 0 : array.length;
- if (length) {
- var index = baseSortedIndex(array, value);
- if (index < length && eq(array[index], value)) {
- return index;
- }
- }
- return -1;
- }
-
- /**
- * This method is like `_.sortedIndex` except that it returns the highest
- * index at which `value` should be inserted into `array` in order to
- * maintain its sort order.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The sorted array to inspect.
- * @param {*} value The value to evaluate.
- * @returns {number} Returns the index at which `value` should be inserted
- * into `array`.
- * @example
- *
- * _.sortedLastIndex([4, 5, 5, 5, 6], 5);
- * // => 4
- */
- function sortedLastIndex(array, value) {
- return baseSortedIndex(array, value, true);
- }
-
- /**
- * This method is like `_.sortedLastIndex` except that it accepts `iteratee`
- * which is invoked for `value` and each element of `array` to compute their
- * sort ranking. The iteratee is invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The sorted array to inspect.
- * @param {*} value The value to evaluate.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {number} Returns the index at which `value` should be inserted
- * into `array`.
- * @example
- *
- * var objects = [{ 'x': 4 }, { 'x': 5 }];
- *
- * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
- * // => 1
- *
- * // The `_.property` iteratee shorthand.
- * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');
- * // => 1
- */
- function sortedLastIndexBy(array, value, iteratee) {
- return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);
- }
-
- /**
- * This method is like `_.lastIndexOf` except that it performs a binary
- * search on a sorted `array`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {*} value The value to search for.
- * @returns {number} Returns the index of the matched value, else `-1`.
- * @example
- *
- * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);
- * // => 3
- */
- function sortedLastIndexOf(array, value) {
- var length = array == null ? 0 : array.length;
- if (length) {
- var index = baseSortedIndex(array, value, true) - 1;
- if (eq(array[index], value)) {
- return index;
- }
- }
- return -1;
- }
-
- /**
- * This method is like `_.uniq` except that it's designed and optimized
- * for sorted arrays.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @returns {Array} Returns the new duplicate free array.
- * @example
- *
- * _.sortedUniq([1, 1, 2]);
- * // => [1, 2]
- */
- function sortedUniq(array) {
- return (array && array.length)
- ? baseSortedUniq(array)
- : [];
- }
-
- /**
- * This method is like `_.uniqBy` except that it's designed and optimized
- * for sorted arrays.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {Function} [iteratee] The iteratee invoked per element.
- * @returns {Array} Returns the new duplicate free array.
- * @example
- *
- * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);
- * // => [1.1, 2.3]
- */
- function sortedUniqBy(array, iteratee) {
- return (array && array.length)
- ? baseSortedUniq(array, getIteratee(iteratee, 2))
- : [];
- }
-
- /**
- * Gets all but the first element of `array`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * _.tail([1, 2, 3]);
- * // => [2, 3]
- */
- function tail(array) {
- var length = array == null ? 0 : array.length;
- return length ? baseSlice(array, 1, length) : [];
- }
-
- /**
- * Creates a slice of `array` with `n` elements taken from the beginning.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {number} [n=1] The number of elements to take.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * _.take([1, 2, 3]);
- * // => [1]
- *
- * _.take([1, 2, 3], 2);
- * // => [1, 2]
- *
- * _.take([1, 2, 3], 5);
- * // => [1, 2, 3]
- *
- * _.take([1, 2, 3], 0);
- * // => []
- */
- function take(array, n, guard) {
- if (!(array && array.length)) {
- return [];
- }
- n = (guard || n === undefined) ? 1 : toInteger(n);
- return baseSlice(array, 0, n < 0 ? 0 : n);
- }
-
- /**
- * Creates a slice of `array` with `n` elements taken from the end.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {number} [n=1] The number of elements to take.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * _.takeRight([1, 2, 3]);
- * // => [3]
- *
- * _.takeRight([1, 2, 3], 2);
- * // => [2, 3]
- *
- * _.takeRight([1, 2, 3], 5);
- * // => [1, 2, 3]
- *
- * _.takeRight([1, 2, 3], 0);
- * // => []
- */
- function takeRight(array, n, guard) {
- var length = array == null ? 0 : array.length;
- if (!length) {
- return [];
- }
- n = (guard || n === undefined) ? 1 : toInteger(n);
- n = length - n;
- return baseSlice(array, n < 0 ? 0 : n, length);
- }
-
- /**
- * Creates a slice of `array` with elements taken from the end. Elements are
- * taken until `predicate` returns falsey. The predicate is invoked with
- * three arguments: (value, index, array).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'active': true },
- * { 'user': 'fred', 'active': false },
- * { 'user': 'pebbles', 'active': false }
- * ];
- *
- * _.takeRightWhile(users, function(o) { return !o.active; });
- * // => objects for ['fred', 'pebbles']
- *
- * // The `_.matches` iteratee shorthand.
- * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });
- * // => objects for ['pebbles']
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.takeRightWhile(users, ['active', false]);
- * // => objects for ['fred', 'pebbles']
- *
- * // The `_.property` iteratee shorthand.
- * _.takeRightWhile(users, 'active');
- * // => []
- */
- function takeRightWhile(array, predicate) {
- return (array && array.length)
- ? baseWhile(array, getIteratee(predicate, 3), false, true)
- : [];
- }
-
- /**
- * Creates a slice of `array` with elements taken from the beginning. Elements
- * are taken until `predicate` returns falsey. The predicate is invoked with
- * three arguments: (value, index, array).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Array
- * @param {Array} array The array to query.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the slice of `array`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'active': false },
- * { 'user': 'fred', 'active': false },
- * { 'user': 'pebbles', 'active': true }
- * ];
- *
- * _.takeWhile(users, function(o) { return !o.active; });
- * // => objects for ['barney', 'fred']
- *
- * // The `_.matches` iteratee shorthand.
- * _.takeWhile(users, { 'user': 'barney', 'active': false });
- * // => objects for ['barney']
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.takeWhile(users, ['active', false]);
- * // => objects for ['barney', 'fred']
- *
- * // The `_.property` iteratee shorthand.
- * _.takeWhile(users, 'active');
- * // => []
- */
- function takeWhile(array, predicate) {
- return (array && array.length)
- ? baseWhile(array, getIteratee(predicate, 3))
- : [];
- }
-
- /**
- * Creates an array of unique values, in order, from all given arrays using
- * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @returns {Array} Returns the new array of combined values.
- * @example
- *
- * _.union([2], [1, 2]);
- * // => [2, 1]
- */
- var union = baseRest(function(arrays) {
- return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));
- });
-
- /**
- * This method is like `_.union` except that it accepts `iteratee` which is
- * invoked for each element of each `arrays` to generate the criterion by
- * which uniqueness is computed. Result values are chosen from the first
- * array in which the value occurs. The iteratee is invoked with one argument:
- * (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Array} Returns the new array of combined values.
- * @example
- *
- * _.unionBy([2.1], [1.2, 2.3], Math.floor);
- * // => [2.1, 1.2]
- *
- * // The `_.property` iteratee shorthand.
- * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
- * // => [{ 'x': 1 }, { 'x': 2 }]
- */
- var unionBy = baseRest(function(arrays) {
- var iteratee = last(arrays);
- if (isArrayLikeObject(iteratee)) {
- iteratee = undefined;
- }
- return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));
- });
-
- /**
- * This method is like `_.union` except that it accepts `comparator` which
- * is invoked to compare elements of `arrays`. Result values are chosen from
- * the first array in which the value occurs. The comparator is invoked
- * with two arguments: (arrVal, othVal).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of combined values.
- * @example
- *
- * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
- * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
- *
- * _.unionWith(objects, others, _.isEqual);
- * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
- */
- var unionWith = baseRest(function(arrays) {
- var comparator = last(arrays);
- comparator = typeof comparator == 'function' ? comparator : undefined;
- return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);
- });
-
- /**
- * Creates a duplicate-free version of an array, using
- * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons, in which only the first occurrence of each element
- * is kept. The order of result values is determined by the order they occur
- * in the array.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @returns {Array} Returns the new duplicate free array.
- * @example
- *
- * _.uniq([2, 1, 2]);
- * // => [2, 1]
- */
- function uniq(array) {
- return (array && array.length) ? baseUniq(array) : [];
- }
-
- /**
- * This method is like `_.uniq` except that it accepts `iteratee` which is
- * invoked for each element in `array` to generate the criterion by which
- * uniqueness is computed. The order of result values is determined by the
- * order they occur in the array. The iteratee is invoked with one argument:
- * (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Array} Returns the new duplicate free array.
- * @example
- *
- * _.uniqBy([2.1, 1.2, 2.3], Math.floor);
- * // => [2.1, 1.2]
- *
- * // The `_.property` iteratee shorthand.
- * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');
- * // => [{ 'x': 1 }, { 'x': 2 }]
- */
- function uniqBy(array, iteratee) {
- return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];
- }
-
- /**
- * This method is like `_.uniq` except that it accepts `comparator` which
- * is invoked to compare elements of `array`. The order of result values is
- * determined by the order they occur in the array.The comparator is invoked
- * with two arguments: (arrVal, othVal).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new duplicate free array.
- * @example
- *
- * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];
- *
- * _.uniqWith(objects, _.isEqual);
- * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]
- */
- function uniqWith(array, comparator) {
- comparator = typeof comparator == 'function' ? comparator : undefined;
- return (array && array.length) ? baseUniq(array, undefined, comparator) : [];
- }
-
- /**
- * This method is like `_.zip` except that it accepts an array of grouped
- * elements and creates an array regrouping the elements to their pre-zip
- * configuration.
- *
- * @static
- * @memberOf _
- * @since 1.2.0
- * @category Array
- * @param {Array} array The array of grouped elements to process.
- * @returns {Array} Returns the new array of regrouped elements.
- * @example
- *
- * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);
- * // => [['a', 1, true], ['b', 2, false]]
- *
- * _.unzip(zipped);
- * // => [['a', 'b'], [1, 2], [true, false]]
- */
- function unzip(array) {
- if (!(array && array.length)) {
- return [];
- }
- var length = 0;
- array = arrayFilter(array, function(group) {
- if (isArrayLikeObject(group)) {
- length = nativeMax(group.length, length);
- return true;
- }
- });
- return baseTimes(length, function(index) {
- return arrayMap(array, baseProperty(index));
- });
- }
-
- /**
- * This method is like `_.unzip` except that it accepts `iteratee` to specify
- * how regrouped values should be combined. The iteratee is invoked with the
- * elements of each group: (...group).
- *
- * @static
- * @memberOf _
- * @since 3.8.0
- * @category Array
- * @param {Array} array The array of grouped elements to process.
- * @param {Function} [iteratee=_.identity] The function to combine
- * regrouped values.
- * @returns {Array} Returns the new array of regrouped elements.
- * @example
- *
- * var zipped = _.zip([1, 2], [10, 20], [100, 200]);
- * // => [[1, 10, 100], [2, 20, 200]]
- *
- * _.unzipWith(zipped, _.add);
- * // => [3, 30, 300]
- */
- function unzipWith(array, iteratee) {
- if (!(array && array.length)) {
- return [];
- }
- var result = unzip(array);
- if (iteratee == null) {
- return result;
- }
- return arrayMap(result, function(group) {
- return apply(iteratee, undefined, group);
- });
- }
-
- /**
- * Creates an array excluding all given values using
- * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * for equality comparisons.
- *
- * **Note:** Unlike `_.pull`, this method returns a new array.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {Array} array The array to inspect.
- * @param {...*} [values] The values to exclude.
- * @returns {Array} Returns the new array of filtered values.
- * @see _.difference, _.xor
- * @example
- *
- * _.without([2, 1, 2, 3], 1, 2);
- * // => [3]
- */
- var without = baseRest(function(array, values) {
- return isArrayLikeObject(array)
- ? baseDifference(array, values)
- : [];
- });
-
- /**
- * Creates an array of unique values that is the
- * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)
- * of the given arrays. The order of result values is determined by the order
- * they occur in the arrays.
- *
- * @static
- * @memberOf _
- * @since 2.4.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @returns {Array} Returns the new array of filtered values.
- * @see _.difference, _.without
- * @example
- *
- * _.xor([2, 1], [2, 3]);
- * // => [1, 3]
- */
- var xor = baseRest(function(arrays) {
- return baseXor(arrayFilter(arrays, isArrayLikeObject));
- });
-
- /**
- * This method is like `_.xor` except that it accepts `iteratee` which is
- * invoked for each element of each `arrays` to generate the criterion by
- * which by which they're compared. The order of result values is determined
- * by the order they occur in the arrays. The iteratee is invoked with one
- * argument: (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Array} Returns the new array of filtered values.
- * @example
- *
- * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);
- * // => [1.2, 3.4]
- *
- * // The `_.property` iteratee shorthand.
- * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
- * // => [{ 'x': 2 }]
- */
- var xorBy = baseRest(function(arrays) {
- var iteratee = last(arrays);
- if (isArrayLikeObject(iteratee)) {
- iteratee = undefined;
- }
- return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));
- });
-
- /**
- * This method is like `_.xor` except that it accepts `comparator` which is
- * invoked to compare elements of `arrays`. The order of result values is
- * determined by the order they occur in the arrays. The comparator is invoked
- * with two arguments: (arrVal, othVal).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Array
- * @param {...Array} [arrays] The arrays to inspect.
- * @param {Function} [comparator] The comparator invoked per element.
- * @returns {Array} Returns the new array of filtered values.
- * @example
- *
- * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
- * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
- *
- * _.xorWith(objects, others, _.isEqual);
- * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
- */
- var xorWith = baseRest(function(arrays) {
- var comparator = last(arrays);
- comparator = typeof comparator == 'function' ? comparator : undefined;
- return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);
- });
-
- /**
- * Creates an array of grouped elements, the first of which contains the
- * first elements of the given arrays, the second of which contains the
- * second elements of the given arrays, and so on.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Array
- * @param {...Array} [arrays] The arrays to process.
- * @returns {Array} Returns the new array of grouped elements.
- * @example
- *
- * _.zip(['a', 'b'], [1, 2], [true, false]);
- * // => [['a', 1, true], ['b', 2, false]]
- */
- var zip = baseRest(unzip);
-
- /**
- * This method is like `_.fromPairs` except that it accepts two arrays,
- * one of property identifiers and one of corresponding values.
- *
- * @static
- * @memberOf _
- * @since 0.4.0
- * @category Array
- * @param {Array} [props=[]] The property identifiers.
- * @param {Array} [values=[]] The property values.
- * @returns {Object} Returns the new object.
- * @example
- *
- * _.zipObject(['a', 'b'], [1, 2]);
- * // => { 'a': 1, 'b': 2 }
- */
- function zipObject(props, values) {
- return baseZipObject(props || [], values || [], assignValue);
- }
-
- /**
- * This method is like `_.zipObject` except that it supports property paths.
- *
- * @static
- * @memberOf _
- * @since 4.1.0
- * @category Array
- * @param {Array} [props=[]] The property identifiers.
- * @param {Array} [values=[]] The property values.
- * @returns {Object} Returns the new object.
- * @example
- *
- * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);
- * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }
- */
- function zipObjectDeep(props, values) {
- return baseZipObject(props || [], values || [], baseSet);
- }
-
- /**
- * This method is like `_.zip` except that it accepts `iteratee` to specify
- * how grouped values should be combined. The iteratee is invoked with the
- * elements of each group: (...group).
- *
- * @static
- * @memberOf _
- * @since 3.8.0
- * @category Array
- * @param {...Array} [arrays] The arrays to process.
- * @param {Function} [iteratee=_.identity] The function to combine
- * grouped values.
- * @returns {Array} Returns the new array of grouped elements.
- * @example
- *
- * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {
- * return a + b + c;
- * });
- * // => [111, 222]
- */
- var zipWith = baseRest(function(arrays) {
- var length = arrays.length,
- iteratee = length > 1 ? arrays[length - 1] : undefined;
-
- iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;
- return unzipWith(arrays, iteratee);
- });
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates a `lodash` wrapper instance that wraps `value` with explicit method
- * chain sequences enabled. The result of such sequences must be unwrapped
- * with `_#value`.
- *
- * @static
- * @memberOf _
- * @since 1.3.0
- * @category Seq
- * @param {*} value The value to wrap.
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'age': 36 },
- * { 'user': 'fred', 'age': 40 },
- * { 'user': 'pebbles', 'age': 1 }
- * ];
- *
- * var youngest = _
- * .chain(users)
- * .sortBy('age')
- * .map(function(o) {
- * return o.user + ' is ' + o.age;
- * })
- * .head()
- * .value();
- * // => 'pebbles is 1'
- */
- function chain(value) {
- var result = lodash(value);
- result.__chain__ = true;
- return result;
- }
-
- /**
- * This method invokes `interceptor` and returns `value`. The interceptor
- * is invoked with one argument; (value). The purpose of this method is to
- * "tap into" a method chain sequence in order to modify intermediate results.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Seq
- * @param {*} value The value to provide to `interceptor`.
- * @param {Function} interceptor The function to invoke.
- * @returns {*} Returns `value`.
- * @example
- *
- * _([1, 2, 3])
- * .tap(function(array) {
- * // Mutate input array.
- * array.pop();
- * })
- * .reverse()
- * .value();
- * // => [2, 1]
- */
- function tap(value, interceptor) {
- interceptor(value);
- return value;
- }
-
- /**
- * This method is like `_.tap` except that it returns the result of `interceptor`.
- * The purpose of this method is to "pass thru" values replacing intermediate
- * results in a method chain sequence.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Seq
- * @param {*} value The value to provide to `interceptor`.
- * @param {Function} interceptor The function to invoke.
- * @returns {*} Returns the result of `interceptor`.
- * @example
- *
- * _(' abc ')
- * .chain()
- * .trim()
- * .thru(function(value) {
- * return [value];
- * })
- * .value();
- * // => ['abc']
- */
- function thru(value, interceptor) {
- return interceptor(value);
- }
-
- /**
- * This method is the wrapper version of `_.at`.
- *
- * @name at
- * @memberOf _
- * @since 1.0.0
- * @category Seq
- * @param {...(string|string[])} [paths] The property paths to pick.
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
- *
- * _(object).at(['a[0].b.c', 'a[1]']).value();
- * // => [3, 4]
- */
- var wrapperAt = flatRest(function(paths) {
- var length = paths.length,
- start = length ? paths[0] : 0,
- value = this.__wrapped__,
- interceptor = function(object) { return baseAt(object, paths); };
-
- if (length > 1 || this.__actions__.length ||
- !(value instanceof LazyWrapper) || !isIndex(start)) {
- return this.thru(interceptor);
- }
- value = value.slice(start, +start + (length ? 1 : 0));
- value.__actions__.push({
- 'func': thru,
- 'args': [interceptor],
- 'thisArg': undefined
- });
- return new LodashWrapper(value, this.__chain__).thru(function(array) {
- if (length && !array.length) {
- array.push(undefined);
- }
- return array;
- });
- });
-
- /**
- * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.
- *
- * @name chain
- * @memberOf _
- * @since 0.1.0
- * @category Seq
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'age': 36 },
- * { 'user': 'fred', 'age': 40 }
- * ];
- *
- * // A sequence without explicit chaining.
- * _(users).head();
- * // => { 'user': 'barney', 'age': 36 }
- *
- * // A sequence with explicit chaining.
- * _(users)
- * .chain()
- * .head()
- * .pick('user')
- * .value();
- * // => { 'user': 'barney' }
- */
- function wrapperChain() {
- return chain(this);
- }
-
- /**
- * Executes the chain sequence and returns the wrapped result.
- *
- * @name commit
- * @memberOf _
- * @since 3.2.0
- * @category Seq
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * var array = [1, 2];
- * var wrapped = _(array).push(3);
- *
- * console.log(array);
- * // => [1, 2]
- *
- * wrapped = wrapped.commit();
- * console.log(array);
- * // => [1, 2, 3]
- *
- * wrapped.last();
- * // => 3
- *
- * console.log(array);
- * // => [1, 2, 3]
- */
- function wrapperCommit() {
- return new LodashWrapper(this.value(), this.__chain__);
- }
-
- /**
- * Gets the next value on a wrapped object following the
- * [iterator protocol](https://mdn.io/iteration_protocols#iterator).
- *
- * @name next
- * @memberOf _
- * @since 4.0.0
- * @category Seq
- * @returns {Object} Returns the next iterator value.
- * @example
- *
- * var wrapped = _([1, 2]);
- *
- * wrapped.next();
- * // => { 'done': false, 'value': 1 }
- *
- * wrapped.next();
- * // => { 'done': false, 'value': 2 }
- *
- * wrapped.next();
- * // => { 'done': true, 'value': undefined }
- */
- function wrapperNext() {
- if (this.__values__ === undefined) {
- this.__values__ = toArray(this.value());
- }
- var done = this.__index__ >= this.__values__.length,
- value = done ? undefined : this.__values__[this.__index__++];
-
- return { 'done': done, 'value': value };
- }
-
- /**
- * Enables the wrapper to be iterable.
- *
- * @name Symbol.iterator
- * @memberOf _
- * @since 4.0.0
- * @category Seq
- * @returns {Object} Returns the wrapper object.
- * @example
- *
- * var wrapped = _([1, 2]);
- *
- * wrapped[Symbol.iterator]() === wrapped;
- * // => true
- *
- * Array.from(wrapped);
- * // => [1, 2]
- */
- function wrapperToIterator() {
- return this;
- }
-
- /**
- * Creates a clone of the chain sequence planting `value` as the wrapped value.
- *
- * @name plant
- * @memberOf _
- * @since 3.2.0
- * @category Seq
- * @param {*} value The value to plant.
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * function square(n) {
- * return n * n;
- * }
- *
- * var wrapped = _([1, 2]).map(square);
- * var other = wrapped.plant([3, 4]);
- *
- * other.value();
- * // => [9, 16]
- *
- * wrapped.value();
- * // => [1, 4]
- */
- function wrapperPlant(value) {
- var result,
- parent = this;
-
- while (parent instanceof baseLodash) {
- var clone = wrapperClone(parent);
- clone.__index__ = 0;
- clone.__values__ = undefined;
- if (result) {
- previous.__wrapped__ = clone;
- } else {
- result = clone;
- }
- var previous = clone;
- parent = parent.__wrapped__;
- }
- previous.__wrapped__ = value;
- return result;
- }
-
- /**
- * This method is the wrapper version of `_.reverse`.
- *
- * **Note:** This method mutates the wrapped array.
- *
- * @name reverse
- * @memberOf _
- * @since 0.1.0
- * @category Seq
- * @returns {Object} Returns the new `lodash` wrapper instance.
- * @example
- *
- * var array = [1, 2, 3];
- *
- * _(array).reverse().value()
- * // => [3, 2, 1]
- *
- * console.log(array);
- * // => [3, 2, 1]
- */
- function wrapperReverse() {
- var value = this.__wrapped__;
- if (value instanceof LazyWrapper) {
- var wrapped = value;
- if (this.__actions__.length) {
- wrapped = new LazyWrapper(this);
- }
- wrapped = wrapped.reverse();
- wrapped.__actions__.push({
- 'func': thru,
- 'args': [reverse],
- 'thisArg': undefined
- });
- return new LodashWrapper(wrapped, this.__chain__);
- }
- return this.thru(reverse);
- }
-
- /**
- * Executes the chain sequence to resolve the unwrapped value.
- *
- * @name value
- * @memberOf _
- * @since 0.1.0
- * @alias toJSON, valueOf
- * @category Seq
- * @returns {*} Returns the resolved unwrapped value.
- * @example
- *
- * _([1, 2, 3]).value();
- * // => [1, 2, 3]
- */
- function wrapperValue() {
- return baseWrapperValue(this.__wrapped__, this.__actions__);
- }
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Creates an object composed of keys generated from the results of running
- * each element of `collection` thru `iteratee`. The corresponding value of
- * each key is the number of times the key was returned by `iteratee`. The
- * iteratee is invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 0.5.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
- * @returns {Object} Returns the composed aggregate object.
- * @example
- *
- * _.countBy([6.1, 4.2, 6.3], Math.floor);
- * // => { '4': 1, '6': 2 }
- *
- * // The `_.property` iteratee shorthand.
- * _.countBy(['one', 'two', 'three'], 'length');
- * // => { '3': 2, '5': 1 }
- */
- var countBy = createAggregator(function(result, value, key) {
- if (hasOwnProperty.call(result, key)) {
- ++result[key];
- } else {
- baseAssignValue(result, key, 1);
- }
- });
-
- /**
- * Checks if `predicate` returns truthy for **all** elements of `collection`.
- * Iteration is stopped once `predicate` returns falsey. The predicate is
- * invoked with three arguments: (value, index|key, collection).
- *
- * **Note:** This method returns `true` for
- * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because
- * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of
- * elements of empty collections.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {boolean} Returns `true` if all elements pass the predicate check,
- * else `false`.
- * @example
- *
- * _.every([true, 1, null, 'yes'], Boolean);
- * // => false
- *
- * var users = [
- * { 'user': 'barney', 'age': 36, 'active': false },
- * { 'user': 'fred', 'age': 40, 'active': false }
- * ];
- *
- * // The `_.matches` iteratee shorthand.
- * _.every(users, { 'user': 'barney', 'active': false });
- * // => false
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.every(users, ['active', false]);
- * // => true
- *
- * // The `_.property` iteratee shorthand.
- * _.every(users, 'active');
- * // => false
- */
- function every(collection, predicate, guard) {
- var func = isArray(collection) ? arrayEvery : baseEvery;
- if (guard && isIterateeCall(collection, predicate, guard)) {
- predicate = undefined;
- }
- return func(collection, getIteratee(predicate, 3));
- }
-
- /**
- * Iterates over elements of `collection`, returning an array of all elements
- * `predicate` returns truthy for. The predicate is invoked with three
- * arguments: (value, index|key, collection).
- *
- * **Note:** Unlike `_.remove`, this method returns a new array.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the new filtered array.
- * @see _.reject
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'age': 36, 'active': true },
- * { 'user': 'fred', 'age': 40, 'active': false }
- * ];
- *
- * _.filter(users, function(o) { return !o.active; });
- * // => objects for ['fred']
- *
- * // The `_.matches` iteratee shorthand.
- * _.filter(users, { 'age': 36, 'active': true });
- * // => objects for ['barney']
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.filter(users, ['active', false]);
- * // => objects for ['fred']
- *
- * // The `_.property` iteratee shorthand.
- * _.filter(users, 'active');
- * // => objects for ['barney']
- */
- function filter(collection, predicate) {
- var func = isArray(collection) ? arrayFilter : baseFilter;
- return func(collection, getIteratee(predicate, 3));
- }
-
- /**
- * Iterates over elements of `collection`, returning the first element
- * `predicate` returns truthy for. The predicate is invoked with three
- * arguments: (value, index|key, collection).
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to inspect.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @param {number} [fromIndex=0] The index to search from.
- * @returns {*} Returns the matched element, else `undefined`.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'age': 36, 'active': true },
- * { 'user': 'fred', 'age': 40, 'active': false },
- * { 'user': 'pebbles', 'age': 1, 'active': true }
- * ];
- *
- * _.find(users, function(o) { return o.age < 40; });
- * // => object for 'barney'
- *
- * // The `_.matches` iteratee shorthand.
- * _.find(users, { 'age': 1, 'active': true });
- * // => object for 'pebbles'
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.find(users, ['active', false]);
- * // => object for 'fred'
- *
- * // The `_.property` iteratee shorthand.
- * _.find(users, 'active');
- * // => object for 'barney'
- */
- var find = createFind(findIndex);
-
- /**
- * This method is like `_.find` except that it iterates over elements of
- * `collection` from right to left.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to inspect.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @param {number} [fromIndex=collection.length-1] The index to search from.
- * @returns {*} Returns the matched element, else `undefined`.
- * @example
- *
- * _.findLast([1, 2, 3, 4], function(n) {
- * return n % 2 == 1;
- * });
- * // => 3
- */
- var findLast = createFind(findLastIndex);
-
- /**
- * Creates a flattened array of values by running each element in `collection`
- * thru `iteratee` and flattening the mapped results. The iteratee is invoked
- * with three arguments: (value, index|key, collection).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the new flattened array.
- * @example
- *
- * function duplicate(n) {
- * return [n, n];
- * }
- *
- * _.flatMap([1, 2], duplicate);
- * // => [1, 1, 2, 2]
- */
- function flatMap(collection, iteratee) {
- return baseFlatten(map(collection, iteratee), 1);
- }
-
- /**
- * This method is like `_.flatMap` except that it recursively flattens the
- * mapped results.
- *
- * @static
- * @memberOf _
- * @since 4.7.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the new flattened array.
- * @example
- *
- * function duplicate(n) {
- * return [[[n, n]]];
- * }
- *
- * _.flatMapDeep([1, 2], duplicate);
- * // => [1, 1, 2, 2]
- */
- function flatMapDeep(collection, iteratee) {
- return baseFlatten(map(collection, iteratee), INFINITY);
- }
-
- /**
- * This method is like `_.flatMap` except that it recursively flattens the
- * mapped results up to `depth` times.
- *
- * @static
- * @memberOf _
- * @since 4.7.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @param {number} [depth=1] The maximum recursion depth.
- * @returns {Array} Returns the new flattened array.
- * @example
- *
- * function duplicate(n) {
- * return [[[n, n]]];
- * }
- *
- * _.flatMapDepth([1, 2], duplicate, 2);
- * // => [[1, 1], [2, 2]]
- */
- function flatMapDepth(collection, iteratee, depth) {
- depth = depth === undefined ? 1 : toInteger(depth);
- return baseFlatten(map(collection, iteratee), depth);
- }
-
- /**
- * Iterates over elements of `collection` and invokes `iteratee` for each element.
- * The iteratee is invoked with three arguments: (value, index|key, collection).
- * Iteratee functions may exit iteration early by explicitly returning `false`.
- *
- * **Note:** As with other "Collections" methods, objects with a "length"
- * property are iterated like arrays. To avoid this behavior use `_.forIn`
- * or `_.forOwn` for object iteration.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @alias each
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Array|Object} Returns `collection`.
- * @see _.forEachRight
- * @example
- *
- * _.forEach([1, 2], function(value) {
- * console.log(value);
- * });
- * // => Logs `1` then `2`.
- *
- * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {
- * console.log(key);
- * });
- * // => Logs 'a' then 'b' (iteration order is not guaranteed).
- */
- function forEach(collection, iteratee) {
- var func = isArray(collection) ? arrayEach : baseEach;
- return func(collection, getIteratee(iteratee, 3));
- }
-
- /**
- * This method is like `_.forEach` except that it iterates over elements of
- * `collection` from right to left.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @alias eachRight
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Array|Object} Returns `collection`.
- * @see _.forEach
- * @example
- *
- * _.forEachRight([1, 2], function(value) {
- * console.log(value);
- * });
- * // => Logs `2` then `1`.
- */
- function forEachRight(collection, iteratee) {
- var func = isArray(collection) ? arrayEachRight : baseEachRight;
- return func(collection, getIteratee(iteratee, 3));
- }
-
- /**
- * Creates an object composed of keys generated from the results of running
- * each element of `collection` thru `iteratee`. The order of grouped values
- * is determined by the order they occur in `collection`. The corresponding
- * value of each key is an array of elements responsible for generating the
- * key. The iteratee is invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
- * @returns {Object} Returns the composed aggregate object.
- * @example
- *
- * _.groupBy([6.1, 4.2, 6.3], Math.floor);
- * // => { '4': [4.2], '6': [6.1, 6.3] }
- *
- * // The `_.property` iteratee shorthand.
- * _.groupBy(['one', 'two', 'three'], 'length');
- * // => { '3': ['one', 'two'], '5': ['three'] }
- */
- var groupBy = createAggregator(function(result, value, key) {
- if (hasOwnProperty.call(result, key)) {
- result[key].push(value);
- } else {
- baseAssignValue(result, key, [value]);
- }
- });
-
- /**
- * Checks if `value` is in `collection`. If `collection` is a string, it's
- * checked for a substring of `value`, otherwise
- * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * is used for equality comparisons. If `fromIndex` is negative, it's used as
- * the offset from the end of `collection`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object|string} collection The collection to inspect.
- * @param {*} value The value to search for.
- * @param {number} [fromIndex=0] The index to search from.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
- * @returns {boolean} Returns `true` if `value` is found, else `false`.
- * @example
- *
- * _.includes([1, 2, 3], 1);
- * // => true
- *
- * _.includes([1, 2, 3], 1, 2);
- * // => false
- *
- * _.includes({ 'a': 1, 'b': 2 }, 1);
- * // => true
- *
- * _.includes('abcd', 'bc');
- * // => true
- */
- function includes(collection, value, fromIndex, guard) {
- collection = isArrayLike(collection) ? collection : values(collection);
- fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;
-
- var length = collection.length;
- if (fromIndex < 0) {
- fromIndex = nativeMax(length + fromIndex, 0);
- }
- return isString(collection)
- ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)
- : (!!length && baseIndexOf(collection, value, fromIndex) > -1);
- }
-
- /**
- * Invokes the method at `path` of each element in `collection`, returning
- * an array of the results of each invoked method. Any additional arguments
- * are provided to each invoked method. If `path` is a function, it's invoked
- * for, and `this` bound to, each element in `collection`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Array|Function|string} path The path of the method to invoke or
- * the function invoked per iteration.
- * @param {...*} [args] The arguments to invoke each method with.
- * @returns {Array} Returns the array of results.
- * @example
- *
- * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');
- * // => [[1, 5, 7], [1, 2, 3]]
- *
- * _.invokeMap([123, 456], String.prototype.split, '');
- * // => [['1', '2', '3'], ['4', '5', '6']]
- */
- var invokeMap = baseRest(function(collection, path, args) {
- var index = -1,
- isFunc = typeof path == 'function',
- result = isArrayLike(collection) ? Array(collection.length) : [];
-
- baseEach(collection, function(value) {
- result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);
- });
- return result;
- });
-
- /**
- * Creates an object composed of keys generated from the results of running
- * each element of `collection` thru `iteratee`. The corresponding value of
- * each key is the last element responsible for generating the key. The
- * iteratee is invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
- * @returns {Object} Returns the composed aggregate object.
- * @example
- *
- * var array = [
- * { 'dir': 'left', 'code': 97 },
- * { 'dir': 'right', 'code': 100 }
- * ];
- *
- * _.keyBy(array, function(o) {
- * return String.fromCharCode(o.code);
- * });
- * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }
- *
- * _.keyBy(array, 'dir');
- * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }
- */
- var keyBy = createAggregator(function(result, value, key) {
- baseAssignValue(result, key, value);
- });
-
- /**
- * Creates an array of values by running each element in `collection` thru
- * `iteratee`. The iteratee is invoked with three arguments:
- * (value, index|key, collection).
- *
- * Many lodash methods are guarded to work as iteratees for methods like
- * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.
- *
- * The guarded methods are:
- * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,
- * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,
- * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,
- * `template`, `trim`, `trimEnd`, `trimStart`, and `words`
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the new mapped array.
- * @example
- *
- * function square(n) {
- * return n * n;
- * }
- *
- * _.map([4, 8], square);
- * // => [16, 64]
- *
- * _.map({ 'a': 4, 'b': 8 }, square);
- * // => [16, 64] (iteration order is not guaranteed)
- *
- * var users = [
- * { 'user': 'barney' },
- * { 'user': 'fred' }
- * ];
- *
- * // The `_.property` iteratee shorthand.
- * _.map(users, 'user');
- * // => ['barney', 'fred']
- */
- function map(collection, iteratee) {
- var func = isArray(collection) ? arrayMap : baseMap;
- return func(collection, getIteratee(iteratee, 3));
- }
-
- /**
- * This method is like `_.sortBy` except that it allows specifying the sort
- * orders of the iteratees to sort by. If `orders` is unspecified, all values
- * are sorted in ascending order. Otherwise, specify an order of "desc" for
- * descending or "asc" for ascending sort order of corresponding values.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]
- * The iteratees to sort by.
- * @param {string[]} [orders] The sort orders of `iteratees`.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
- * @returns {Array} Returns the new sorted array.
- * @example
- *
- * var users = [
- * { 'user': 'fred', 'age': 48 },
- * { 'user': 'barney', 'age': 34 },
- * { 'user': 'fred', 'age': 40 },
- * { 'user': 'barney', 'age': 36 }
- * ];
- *
- * // Sort by `user` in ascending order and by `age` in descending order.
- * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);
- * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
- */
- function orderBy(collection, iteratees, orders, guard) {
- if (collection == null) {
- return [];
- }
- if (!isArray(iteratees)) {
- iteratees = iteratees == null ? [] : [iteratees];
- }
- orders = guard ? undefined : orders;
- if (!isArray(orders)) {
- orders = orders == null ? [] : [orders];
- }
- return baseOrderBy(collection, iteratees, orders);
- }
-
- /**
- * Creates an array of elements split into two groups, the first of which
- * contains elements `predicate` returns truthy for, the second of which
- * contains elements `predicate` returns falsey for. The predicate is
- * invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the array of grouped elements.
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'age': 36, 'active': false },
- * { 'user': 'fred', 'age': 40, 'active': true },
- * { 'user': 'pebbles', 'age': 1, 'active': false }
- * ];
- *
- * _.partition(users, function(o) { return o.active; });
- * // => objects for [['fred'], ['barney', 'pebbles']]
- *
- * // The `_.matches` iteratee shorthand.
- * _.partition(users, { 'age': 1, 'active': false });
- * // => objects for [['pebbles'], ['barney', 'fred']]
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.partition(users, ['active', false]);
- * // => objects for [['barney', 'pebbles'], ['fred']]
- *
- * // The `_.property` iteratee shorthand.
- * _.partition(users, 'active');
- * // => objects for [['fred'], ['barney', 'pebbles']]
- */
- var partition = createAggregator(function(result, value, key) {
- result[key ? 0 : 1].push(value);
- }, function() { return [[], []]; });
-
- /**
- * Reduces `collection` to a value which is the accumulated result of running
- * each element in `collection` thru `iteratee`, where each successive
- * invocation is supplied the return value of the previous. If `accumulator`
- * is not given, the first element of `collection` is used as the initial
- * value. The iteratee is invoked with four arguments:
- * (accumulator, value, index|key, collection).
- *
- * Many lodash methods are guarded to work as iteratees for methods like
- * `_.reduce`, `_.reduceRight`, and `_.transform`.
- *
- * The guarded methods are:
- * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,
- * and `sortBy`
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @param {*} [accumulator] The initial value.
- * @returns {*} Returns the accumulated value.
- * @see _.reduceRight
- * @example
- *
- * _.reduce([1, 2], function(sum, n) {
- * return sum + n;
- * }, 0);
- * // => 3
- *
- * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
- * (result[value] || (result[value] = [])).push(key);
- * return result;
- * }, {});
- * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)
- */
- function reduce(collection, iteratee, accumulator) {
- var func = isArray(collection) ? arrayReduce : baseReduce,
- initAccum = arguments.length < 3;
-
- return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);
- }
-
- /**
- * This method is like `_.reduce` except that it iterates over elements of
- * `collection` from right to left.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @param {*} [accumulator] The initial value.
- * @returns {*} Returns the accumulated value.
- * @see _.reduce
- * @example
- *
- * var array = [[0, 1], [2, 3], [4, 5]];
- *
- * _.reduceRight(array, function(flattened, other) {
- * return flattened.concat(other);
- * }, []);
- * // => [4, 5, 2, 3, 0, 1]
- */
- function reduceRight(collection, iteratee, accumulator) {
- var func = isArray(collection) ? arrayReduceRight : baseReduce,
- initAccum = arguments.length < 3;
-
- return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);
- }
-
- /**
- * The opposite of `_.filter`; this method returns the elements of `collection`
- * that `predicate` does **not** return truthy for.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {Array} Returns the new filtered array.
- * @see _.filter
- * @example
- *
- * var users = [
- * { 'user': 'barney', 'age': 36, 'active': false },
- * { 'user': 'fred', 'age': 40, 'active': true }
- * ];
- *
- * _.reject(users, function(o) { return !o.active; });
- * // => objects for ['fred']
- *
- * // The `_.matches` iteratee shorthand.
- * _.reject(users, { 'age': 40, 'active': true });
- * // => objects for ['barney']
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.reject(users, ['active', false]);
- * // => objects for ['fred']
- *
- * // The `_.property` iteratee shorthand.
- * _.reject(users, 'active');
- * // => objects for ['barney']
- */
- function reject(collection, predicate) {
- var func = isArray(collection) ? arrayFilter : baseFilter;
- return func(collection, negate(getIteratee(predicate, 3)));
- }
-
- /**
- * Gets a random element from `collection`.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to sample.
- * @returns {*} Returns the random element.
- * @example
- *
- * _.sample([1, 2, 3, 4]);
- * // => 2
- */
- function sample(collection) {
- var func = isArray(collection) ? arraySample : baseSample;
- return func(collection);
- }
-
- /**
- * Gets `n` random elements at unique keys from `collection` up to the
- * size of `collection`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Collection
- * @param {Array|Object} collection The collection to sample.
- * @param {number} [n=1] The number of elements to sample.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Array} Returns the random elements.
- * @example
- *
- * _.sampleSize([1, 2, 3], 2);
- * // => [3, 1]
- *
- * _.sampleSize([1, 2, 3], 4);
- * // => [2, 3, 1]
- */
- function sampleSize(collection, n, guard) {
- if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {
- n = 1;
- } else {
- n = toInteger(n);
- }
- var func = isArray(collection) ? arraySampleSize : baseSampleSize;
- return func(collection, n);
- }
-
- /**
- * Creates an array of shuffled values, using a version of the
- * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to shuffle.
- * @returns {Array} Returns the new shuffled array.
- * @example
- *
- * _.shuffle([1, 2, 3, 4]);
- * // => [4, 1, 3, 2]
- */
- function shuffle(collection) {
- var func = isArray(collection) ? arrayShuffle : baseShuffle;
- return func(collection);
- }
-
- /**
- * Gets the size of `collection` by returning its length for array-like
- * values or the number of own enumerable string keyed properties for objects.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object|string} collection The collection to inspect.
- * @returns {number} Returns the collection size.
- * @example
- *
- * _.size([1, 2, 3]);
- * // => 3
- *
- * _.size({ 'a': 1, 'b': 2 });
- * // => 2
- *
- * _.size('pebbles');
- * // => 7
- */
- function size(collection) {
- if (collection == null) {
- return 0;
- }
- if (isArrayLike(collection)) {
- return isString(collection) ? stringSize(collection) : collection.length;
- }
- var tag = getTag(collection);
- if (tag == mapTag || tag == setTag) {
- return collection.size;
- }
- return baseKeys(collection).length;
- }
-
- /**
- * Checks if `predicate` returns truthy for **any** element of `collection`.
- * Iteration is stopped once `predicate` returns truthy. The predicate is
- * invoked with three arguments: (value, index|key, collection).
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {boolean} Returns `true` if any element passes the predicate check,
- * else `false`.
- * @example
- *
- * _.some([null, 0, 'yes', false], Boolean);
- * // => true
- *
- * var users = [
- * { 'user': 'barney', 'active': true },
- * { 'user': 'fred', 'active': false }
- * ];
- *
- * // The `_.matches` iteratee shorthand.
- * _.some(users, { 'user': 'barney', 'active': false });
- * // => false
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.some(users, ['active', false]);
- * // => true
- *
- * // The `_.property` iteratee shorthand.
- * _.some(users, 'active');
- * // => true
- */
- function some(collection, predicate, guard) {
- var func = isArray(collection) ? arraySome : baseSome;
- if (guard && isIterateeCall(collection, predicate, guard)) {
- predicate = undefined;
- }
- return func(collection, getIteratee(predicate, 3));
- }
-
- /**
- * Creates an array of elements, sorted in ascending order by the results of
- * running each element in a collection thru each iteratee. This method
- * performs a stable sort, that is, it preserves the original sort order of
- * equal elements. The iteratees are invoked with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Collection
- * @param {Array|Object} collection The collection to iterate over.
- * @param {...(Function|Function[])} [iteratees=[_.identity]]
- * The iteratees to sort by.
- * @returns {Array} Returns the new sorted array.
- * @example
- *
- * var users = [
- * { 'user': 'fred', 'age': 48 },
- * { 'user': 'barney', 'age': 36 },
- * { 'user': 'fred', 'age': 40 },
- * { 'user': 'barney', 'age': 34 }
- * ];
- *
- * _.sortBy(users, [function(o) { return o.user; }]);
- * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
- *
- * _.sortBy(users, ['user', 'age']);
- * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]
- */
- var sortBy = baseRest(function(collection, iteratees) {
- if (collection == null) {
- return [];
- }
- var length = iteratees.length;
- if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {
- iteratees = [];
- } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {
- iteratees = [iteratees[0]];
- }
- return baseOrderBy(collection, baseFlatten(iteratees, 1), []);
- });
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Gets the timestamp of the number of milliseconds that have elapsed since
- * the Unix epoch (1 January 1970 00:00:00 UTC).
- *
- * @static
- * @memberOf _
- * @since 2.4.0
- * @category Date
- * @returns {number} Returns the timestamp.
- * @example
- *
- * _.defer(function(stamp) {
- * console.log(_.now() - stamp);
- * }, _.now());
- * // => Logs the number of milliseconds it took for the deferred invocation.
- */
- var now = ctxNow || function() {
- return root.Date.now();
- };
-
- /*------------------------------------------------------------------------*/
-
- /**
- * The opposite of `_.before`; this method creates a function that invokes
- * `func` once it's called `n` or more times.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {number} n The number of calls before `func` is invoked.
- * @param {Function} func The function to restrict.
- * @returns {Function} Returns the new restricted function.
- * @example
- *
- * var saves = ['profile', 'settings'];
- *
- * var done = _.after(saves.length, function() {
- * console.log('done saving!');
- * });
- *
- * _.forEach(saves, function(type) {
- * asyncSave({ 'type': type, 'complete': done });
- * });
- * // => Logs 'done saving!' after the two async saves have completed.
- */
- function after(n, func) {
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- n = toInteger(n);
- return function() {
- if (--n < 1) {
- return func.apply(this, arguments);
- }
- };
- }
-
- /**
- * Creates a function that invokes `func`, with up to `n` arguments,
- * ignoring any additional arguments.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Function
- * @param {Function} func The function to cap arguments for.
- * @param {number} [n=func.length] The arity cap.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Function} Returns the new capped function.
- * @example
- *
- * _.map(['6', '8', '10'], _.ary(parseInt, 1));
- * // => [6, 8, 10]
- */
- function ary(func, n, guard) {
- n = guard ? undefined : n;
- n = (func && n == null) ? func.length : n;
- return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);
- }
-
- /**
- * Creates a function that invokes `func`, with the `this` binding and arguments
- * of the created function, while it's called less than `n` times. Subsequent
- * calls to the created function return the result of the last `func` invocation.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Function
- * @param {number} n The number of calls at which `func` is no longer invoked.
- * @param {Function} func The function to restrict.
- * @returns {Function} Returns the new restricted function.
- * @example
- *
- * jQuery(element).on('click', _.before(5, addContactToList));
- * // => Allows adding up to 4 contacts to the list.
- */
- function before(n, func) {
- var result;
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- n = toInteger(n);
- return function() {
- if (--n > 0) {
- result = func.apply(this, arguments);
- }
- if (n <= 1) {
- func = undefined;
- }
- return result;
- };
- }
-
- /**
- * Creates a function that invokes `func` with the `this` binding of `thisArg`
- * and `partials` prepended to the arguments it receives.
- *
- * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,
- * may be used as a placeholder for partially applied arguments.
- *
- * **Note:** Unlike native `Function#bind`, this method doesn't set the "length"
- * property of bound functions.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to bind.
- * @param {*} thisArg The `this` binding of `func`.
- * @param {...*} [partials] The arguments to be partially applied.
- * @returns {Function} Returns the new bound function.
- * @example
- *
- * function greet(greeting, punctuation) {
- * return greeting + ' ' + this.user + punctuation;
- * }
- *
- * var object = { 'user': 'fred' };
- *
- * var bound = _.bind(greet, object, 'hi');
- * bound('!');
- * // => 'hi fred!'
- *
- * // Bound with placeholders.
- * var bound = _.bind(greet, object, _, '!');
- * bound('hi');
- * // => 'hi fred!'
- */
- var bind = baseRest(function(func, thisArg, partials) {
- var bitmask = WRAP_BIND_FLAG;
- if (partials.length) {
- var holders = replaceHolders(partials, getHolder(bind));
- bitmask |= WRAP_PARTIAL_FLAG;
- }
- return createWrap(func, bitmask, thisArg, partials, holders);
- });
-
- /**
- * Creates a function that invokes the method at `object[key]` with `partials`
- * prepended to the arguments it receives.
- *
- * This method differs from `_.bind` by allowing bound functions to reference
- * methods that may be redefined or don't yet exist. See
- * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)
- * for more details.
- *
- * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic
- * builds, may be used as a placeholder for partially applied arguments.
- *
- * @static
- * @memberOf _
- * @since 0.10.0
- * @category Function
- * @param {Object} object The object to invoke the method on.
- * @param {string} key The key of the method.
- * @param {...*} [partials] The arguments to be partially applied.
- * @returns {Function} Returns the new bound function.
- * @example
- *
- * var object = {
- * 'user': 'fred',
- * 'greet': function(greeting, punctuation) {
- * return greeting + ' ' + this.user + punctuation;
- * }
- * };
- *
- * var bound = _.bindKey(object, 'greet', 'hi');
- * bound('!');
- * // => 'hi fred!'
- *
- * object.greet = function(greeting, punctuation) {
- * return greeting + 'ya ' + this.user + punctuation;
- * };
- *
- * bound('!');
- * // => 'hiya fred!'
- *
- * // Bound with placeholders.
- * var bound = _.bindKey(object, 'greet', _, '!');
- * bound('hi');
- * // => 'hiya fred!'
- */
- var bindKey = baseRest(function(object, key, partials) {
- var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;
- if (partials.length) {
- var holders = replaceHolders(partials, getHolder(bindKey));
- bitmask |= WRAP_PARTIAL_FLAG;
- }
- return createWrap(key, bitmask, object, partials, holders);
- });
-
- /**
- * Creates a function that accepts arguments of `func` and either invokes
- * `func` returning its result, if at least `arity` number of arguments have
- * been provided, or returns a function that accepts the remaining `func`
- * arguments, and so on. The arity of `func` may be specified if `func.length`
- * is not sufficient.
- *
- * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,
- * may be used as a placeholder for provided arguments.
- *
- * **Note:** This method doesn't set the "length" property of curried functions.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Function
- * @param {Function} func The function to curry.
- * @param {number} [arity=func.length] The arity of `func`.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Function} Returns the new curried function.
- * @example
- *
- * var abc = function(a, b, c) {
- * return [a, b, c];
- * };
- *
- * var curried = _.curry(abc);
- *
- * curried(1)(2)(3);
- * // => [1, 2, 3]
- *
- * curried(1, 2)(3);
- * // => [1, 2, 3]
- *
- * curried(1, 2, 3);
- * // => [1, 2, 3]
- *
- * // Curried with placeholders.
- * curried(1)(_, 3)(2);
- * // => [1, 2, 3]
- */
- function curry(func, arity, guard) {
- arity = guard ? undefined : arity;
- var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
- result.placeholder = curry.placeholder;
- return result;
- }
-
- /**
- * This method is like `_.curry` except that arguments are applied to `func`
- * in the manner of `_.partialRight` instead of `_.partial`.
- *
- * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic
- * builds, may be used as a placeholder for provided arguments.
- *
- * **Note:** This method doesn't set the "length" property of curried functions.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Function
- * @param {Function} func The function to curry.
- * @param {number} [arity=func.length] The arity of `func`.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Function} Returns the new curried function.
- * @example
- *
- * var abc = function(a, b, c) {
- * return [a, b, c];
- * };
- *
- * var curried = _.curryRight(abc);
- *
- * curried(3)(2)(1);
- * // => [1, 2, 3]
- *
- * curried(2, 3)(1);
- * // => [1, 2, 3]
- *
- * curried(1, 2, 3);
- * // => [1, 2, 3]
- *
- * // Curried with placeholders.
- * curried(3)(1, _)(2);
- * // => [1, 2, 3]
- */
- function curryRight(func, arity, guard) {
- arity = guard ? undefined : arity;
- var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
- result.placeholder = curryRight.placeholder;
- return result;
- }
-
- /**
- * Creates a debounced function that delays invoking `func` until after `wait`
- * milliseconds have elapsed since the last time the debounced function was
- * invoked. The debounced function comes with a `cancel` method to cancel
- * delayed `func` invocations and a `flush` method to immediately invoke them.
- * Provide `options` to indicate whether `func` should be invoked on the
- * leading and/or trailing edge of the `wait` timeout. The `func` is invoked
- * with the last arguments provided to the debounced function. Subsequent
- * calls to the debounced function return the result of the last `func`
- * invocation.
- *
- * **Note:** If `leading` and `trailing` options are `true`, `func` is
- * invoked on the trailing edge of the timeout only if the debounced function
- * is invoked more than once during the `wait` timeout.
- *
- * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
- * until to the next tick, similar to `setTimeout` with a timeout of `0`.
- *
- * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
- * for details over the differences between `_.debounce` and `_.throttle`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to debounce.
- * @param {number} [wait=0] The number of milliseconds to delay.
- * @param {Object} [options={}] The options object.
- * @param {boolean} [options.leading=false]
- * Specify invoking on the leading edge of the timeout.
- * @param {number} [options.maxWait]
- * The maximum time `func` is allowed to be delayed before it's invoked.
- * @param {boolean} [options.trailing=true]
- * Specify invoking on the trailing edge of the timeout.
- * @returns {Function} Returns the new debounced function.
- * @example
- *
- * // Avoid costly calculations while the window size is in flux.
- * jQuery(window).on('resize', _.debounce(calculateLayout, 150));
- *
- * // Invoke `sendMail` when clicked, debouncing subsequent calls.
- * jQuery(element).on('click', _.debounce(sendMail, 300, {
- * 'leading': true,
- * 'trailing': false
- * }));
- *
- * // Ensure `batchLog` is invoked once after 1 second of debounced calls.
- * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
- * var source = new EventSource('/stream');
- * jQuery(source).on('message', debounced);
- *
- * // Cancel the trailing debounced invocation.
- * jQuery(window).on('popstate', debounced.cancel);
- */
- function debounce(func, wait, options) {
- var lastArgs,
- lastThis,
- maxWait,
- result,
- timerId,
- lastCallTime,
- lastInvokeTime = 0,
- leading = false,
- maxing = false,
- trailing = true;
-
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- wait = toNumber(wait) || 0;
- if (isObject(options)) {
- leading = !!options.leading;
- maxing = 'maxWait' in options;
- maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
- trailing = 'trailing' in options ? !!options.trailing : trailing;
- }
-
- function invokeFunc(time) {
- var args = lastArgs,
- thisArg = lastThis;
-
- lastArgs = lastThis = undefined;
- lastInvokeTime = time;
- result = func.apply(thisArg, args);
- return result;
- }
-
- function leadingEdge(time) {
- // Reset any `maxWait` timer.
- lastInvokeTime = time;
- // Start the timer for the trailing edge.
- timerId = setTimeout(timerExpired, wait);
- // Invoke the leading edge.
- return leading ? invokeFunc(time) : result;
- }
-
- function remainingWait(time) {
- var timeSinceLastCall = time - lastCallTime,
- timeSinceLastInvoke = time - lastInvokeTime,
- timeWaiting = wait - timeSinceLastCall;
-
- return maxing
- ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)
- : timeWaiting;
- }
-
- function shouldInvoke(time) {
- var timeSinceLastCall = time - lastCallTime,
- timeSinceLastInvoke = time - lastInvokeTime;
-
- // Either this is the first call, activity has stopped and we're at the
- // trailing edge, the system time has gone backwards and we're treating
- // it as the trailing edge, or we've hit the `maxWait` limit.
- return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
- (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
- }
-
- function timerExpired() {
- var time = now();
- if (shouldInvoke(time)) {
- return trailingEdge(time);
- }
- // Restart the timer.
- timerId = setTimeout(timerExpired, remainingWait(time));
- }
-
- function trailingEdge(time) {
- timerId = undefined;
-
- // Only invoke if we have `lastArgs` which means `func` has been
- // debounced at least once.
- if (trailing && lastArgs) {
- return invokeFunc(time);
- }
- lastArgs = lastThis = undefined;
- return result;
- }
-
- function cancel() {
- if (timerId !== undefined) {
- clearTimeout(timerId);
- }
- lastInvokeTime = 0;
- lastArgs = lastCallTime = lastThis = timerId = undefined;
- }
-
- function flush() {
- return timerId === undefined ? result : trailingEdge(now());
- }
-
- function debounced() {
- var time = now(),
- isInvoking = shouldInvoke(time);
-
- lastArgs = arguments;
- lastThis = this;
- lastCallTime = time;
-
- if (isInvoking) {
- if (timerId === undefined) {
- return leadingEdge(lastCallTime);
- }
- if (maxing) {
- // Handle invocations in a tight loop.
- timerId = setTimeout(timerExpired, wait);
- return invokeFunc(lastCallTime);
- }
- }
- if (timerId === undefined) {
- timerId = setTimeout(timerExpired, wait);
- }
- return result;
- }
- debounced.cancel = cancel;
- debounced.flush = flush;
- return debounced;
- }
-
- /**
- * Defers invoking the `func` until the current call stack has cleared. Any
- * additional arguments are provided to `func` when it's invoked.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to defer.
- * @param {...*} [args] The arguments to invoke `func` with.
- * @returns {number} Returns the timer id.
- * @example
- *
- * _.defer(function(text) {
- * console.log(text);
- * }, 'deferred');
- * // => Logs 'deferred' after one millisecond.
- */
- var defer = baseRest(function(func, args) {
- return baseDelay(func, 1, args);
- });
-
- /**
- * Invokes `func` after `wait` milliseconds. Any additional arguments are
- * provided to `func` when it's invoked.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to delay.
- * @param {number} wait The number of milliseconds to delay invocation.
- * @param {...*} [args] The arguments to invoke `func` with.
- * @returns {number} Returns the timer id.
- * @example
- *
- * _.delay(function(text) {
- * console.log(text);
- * }, 1000, 'later');
- * // => Logs 'later' after one second.
- */
- var delay = baseRest(function(func, wait, args) {
- return baseDelay(func, toNumber(wait) || 0, args);
- });
-
- /**
- * Creates a function that invokes `func` with arguments reversed.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Function
- * @param {Function} func The function to flip arguments for.
- * @returns {Function} Returns the new flipped function.
- * @example
- *
- * var flipped = _.flip(function() {
- * return _.toArray(arguments);
- * });
- *
- * flipped('a', 'b', 'c', 'd');
- * // => ['d', 'c', 'b', 'a']
- */
- function flip(func) {
- return createWrap(func, WRAP_FLIP_FLAG);
- }
-
- /**
- * Creates a function that memoizes the result of `func`. If `resolver` is
- * provided, it determines the cache key for storing the result based on the
- * arguments provided to the memoized function. By default, the first argument
- * provided to the memoized function is used as the map cache key. The `func`
- * is invoked with the `this` binding of the memoized function.
- *
- * **Note:** The cache is exposed as the `cache` property on the memoized
- * function. Its creation may be customized by replacing the `_.memoize.Cache`
- * constructor with one whose instances implement the
- * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
- * method interface of `clear`, `delete`, `get`, `has`, and `set`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to have its output memoized.
- * @param {Function} [resolver] The function to resolve the cache key.
- * @returns {Function} Returns the new memoized function.
- * @example
- *
- * var object = { 'a': 1, 'b': 2 };
- * var other = { 'c': 3, 'd': 4 };
- *
- * var values = _.memoize(_.values);
- * values(object);
- * // => [1, 2]
- *
- * values(other);
- * // => [3, 4]
- *
- * object.a = 2;
- * values(object);
- * // => [1, 2]
- *
- * // Modify the result cache.
- * values.cache.set(object, ['a', 'b']);
- * values(object);
- * // => ['a', 'b']
- *
- * // Replace `_.memoize.Cache`.
- * _.memoize.Cache = WeakMap;
- */
- function memoize(func, resolver) {
- if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- var memoized = function() {
- var args = arguments,
- key = resolver ? resolver.apply(this, args) : args[0],
- cache = memoized.cache;
-
- if (cache.has(key)) {
- return cache.get(key);
- }
- var result = func.apply(this, args);
- memoized.cache = cache.set(key, result) || cache;
- return result;
- };
- memoized.cache = new (memoize.Cache || MapCache);
- return memoized;
- }
-
- // Expose `MapCache`.
- memoize.Cache = MapCache;
-
- /**
- * Creates a function that negates the result of the predicate `func`. The
- * `func` predicate is invoked with the `this` binding and arguments of the
- * created function.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Function
- * @param {Function} predicate The predicate to negate.
- * @returns {Function} Returns the new negated function.
- * @example
- *
- * function isEven(n) {
- * return n % 2 == 0;
- * }
- *
- * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));
- * // => [1, 3, 5]
- */
- function negate(predicate) {
- if (typeof predicate != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- return function() {
- var args = arguments;
- switch (args.length) {
- case 0: return !predicate.call(this);
- case 1: return !predicate.call(this, args[0]);
- case 2: return !predicate.call(this, args[0], args[1]);
- case 3: return !predicate.call(this, args[0], args[1], args[2]);
- }
- return !predicate.apply(this, args);
- };
- }
-
- /**
- * Creates a function that is restricted to invoking `func` once. Repeat calls
- * to the function return the value of the first invocation. The `func` is
- * invoked with the `this` binding and arguments of the created function.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to restrict.
- * @returns {Function} Returns the new restricted function.
- * @example
- *
- * var initialize = _.once(createApplication);
- * initialize();
- * initialize();
- * // => `createApplication` is invoked once
- */
- function once(func) {
- return before(2, func);
- }
-
- /**
- * Creates a function that invokes `func` with its arguments transformed.
- *
- * @static
- * @since 4.0.0
- * @memberOf _
- * @category Function
- * @param {Function} func The function to wrap.
- * @param {...(Function|Function[])} [transforms=[_.identity]]
- * The argument transforms.
- * @returns {Function} Returns the new function.
- * @example
- *
- * function doubled(n) {
- * return n * 2;
- * }
- *
- * function square(n) {
- * return n * n;
- * }
- *
- * var func = _.overArgs(function(x, y) {
- * return [x, y];
- * }, [square, doubled]);
- *
- * func(9, 3);
- * // => [81, 6]
- *
- * func(10, 5);
- * // => [100, 10]
- */
- var overArgs = castRest(function(func, transforms) {
- transforms = (transforms.length == 1 && isArray(transforms[0]))
- ? arrayMap(transforms[0], baseUnary(getIteratee()))
- : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));
-
- var funcsLength = transforms.length;
- return baseRest(function(args) {
- var index = -1,
- length = nativeMin(args.length, funcsLength);
-
- while (++index < length) {
- args[index] = transforms[index].call(this, args[index]);
- }
- return apply(func, this, args);
- });
- });
-
- /**
- * Creates a function that invokes `func` with `partials` prepended to the
- * arguments it receives. This method is like `_.bind` except it does **not**
- * alter the `this` binding.
- *
- * The `_.partial.placeholder` value, which defaults to `_` in monolithic
- * builds, may be used as a placeholder for partially applied arguments.
- *
- * **Note:** This method doesn't set the "length" property of partially
- * applied functions.
- *
- * @static
- * @memberOf _
- * @since 0.2.0
- * @category Function
- * @param {Function} func The function to partially apply arguments to.
- * @param {...*} [partials] The arguments to be partially applied.
- * @returns {Function} Returns the new partially applied function.
- * @example
- *
- * function greet(greeting, name) {
- * return greeting + ' ' + name;
- * }
- *
- * var sayHelloTo = _.partial(greet, 'hello');
- * sayHelloTo('fred');
- * // => 'hello fred'
- *
- * // Partially applied with placeholders.
- * var greetFred = _.partial(greet, _, 'fred');
- * greetFred('hi');
- * // => 'hi fred'
- */
- var partial = baseRest(function(func, partials) {
- var holders = replaceHolders(partials, getHolder(partial));
- return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);
- });
-
- /**
- * This method is like `_.partial` except that partially applied arguments
- * are appended to the arguments it receives.
- *
- * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic
- * builds, may be used as a placeholder for partially applied arguments.
- *
- * **Note:** This method doesn't set the "length" property of partially
- * applied functions.
- *
- * @static
- * @memberOf _
- * @since 1.0.0
- * @category Function
- * @param {Function} func The function to partially apply arguments to.
- * @param {...*} [partials] The arguments to be partially applied.
- * @returns {Function} Returns the new partially applied function.
- * @example
- *
- * function greet(greeting, name) {
- * return greeting + ' ' + name;
- * }
- *
- * var greetFred = _.partialRight(greet, 'fred');
- * greetFred('hi');
- * // => 'hi fred'
- *
- * // Partially applied with placeholders.
- * var sayHelloTo = _.partialRight(greet, 'hello', _);
- * sayHelloTo('fred');
- * // => 'hello fred'
- */
- var partialRight = baseRest(function(func, partials) {
- var holders = replaceHolders(partials, getHolder(partialRight));
- return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);
- });
-
- /**
- * Creates a function that invokes `func` with arguments arranged according
- * to the specified `indexes` where the argument value at the first index is
- * provided as the first argument, the argument value at the second index is
- * provided as the second argument, and so on.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Function
- * @param {Function} func The function to rearrange arguments for.
- * @param {...(number|number[])} indexes The arranged argument indexes.
- * @returns {Function} Returns the new function.
- * @example
- *
- * var rearged = _.rearg(function(a, b, c) {
- * return [a, b, c];
- * }, [2, 0, 1]);
- *
- * rearged('b', 'c', 'a')
- * // => ['a', 'b', 'c']
- */
- var rearg = flatRest(function(func, indexes) {
- return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);
- });
-
- /**
- * Creates a function that invokes `func` with the `this` binding of the
- * created function and arguments from `start` and beyond provided as
- * an array.
- *
- * **Note:** This method is based on the
- * [rest parameter](https://mdn.io/rest_parameters).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Function
- * @param {Function} func The function to apply a rest parameter to.
- * @param {number} [start=func.length-1] The start position of the rest parameter.
- * @returns {Function} Returns the new function.
- * @example
- *
- * var say = _.rest(function(what, names) {
- * return what + ' ' + _.initial(names).join(', ') +
- * (_.size(names) > 1 ? ', & ' : '') + _.last(names);
- * });
- *
- * say('hello', 'fred', 'barney', 'pebbles');
- * // => 'hello fred, barney, & pebbles'
- */
- function rest(func, start) {
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- start = start === undefined ? start : toInteger(start);
- return baseRest(func, start);
- }
-
- /**
- * Creates a function that invokes `func` with the `this` binding of the
- * create function and an array of arguments much like
- * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).
- *
- * **Note:** This method is based on the
- * [spread operator](https://mdn.io/spread_operator).
- *
- * @static
- * @memberOf _
- * @since 3.2.0
- * @category Function
- * @param {Function} func The function to spread arguments over.
- * @param {number} [start=0] The start position of the spread.
- * @returns {Function} Returns the new function.
- * @example
- *
- * var say = _.spread(function(who, what) {
- * return who + ' says ' + what;
- * });
- *
- * say(['fred', 'hello']);
- * // => 'fred says hello'
- *
- * var numbers = Promise.all([
- * Promise.resolve(40),
- * Promise.resolve(36)
- * ]);
- *
- * numbers.then(_.spread(function(x, y) {
- * return x + y;
- * }));
- * // => a Promise of 76
- */
- function spread(func, start) {
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- start = start == null ? 0 : nativeMax(toInteger(start), 0);
- return baseRest(function(args) {
- var array = args[start],
- otherArgs = castSlice(args, 0, start);
-
- if (array) {
- arrayPush(otherArgs, array);
- }
- return apply(func, this, otherArgs);
- });
- }
-
- /**
- * Creates a throttled function that only invokes `func` at most once per
- * every `wait` milliseconds. The throttled function comes with a `cancel`
- * method to cancel delayed `func` invocations and a `flush` method to
- * immediately invoke them. Provide `options` to indicate whether `func`
- * should be invoked on the leading and/or trailing edge of the `wait`
- * timeout. The `func` is invoked with the last arguments provided to the
- * throttled function. Subsequent calls to the throttled function return the
- * result of the last `func` invocation.
- *
- * **Note:** If `leading` and `trailing` options are `true`, `func` is
- * invoked on the trailing edge of the timeout only if the throttled function
- * is invoked more than once during the `wait` timeout.
- *
- * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
- * until to the next tick, similar to `setTimeout` with a timeout of `0`.
- *
- * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
- * for details over the differences between `_.throttle` and `_.debounce`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {Function} func The function to throttle.
- * @param {number} [wait=0] The number of milliseconds to throttle invocations to.
- * @param {Object} [options={}] The options object.
- * @param {boolean} [options.leading=true]
- * Specify invoking on the leading edge of the timeout.
- * @param {boolean} [options.trailing=true]
- * Specify invoking on the trailing edge of the timeout.
- * @returns {Function} Returns the new throttled function.
- * @example
- *
- * // Avoid excessively updating the position while scrolling.
- * jQuery(window).on('scroll', _.throttle(updatePosition, 100));
- *
- * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.
- * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });
- * jQuery(element).on('click', throttled);
- *
- * // Cancel the trailing throttled invocation.
- * jQuery(window).on('popstate', throttled.cancel);
- */
- function throttle(func, wait, options) {
- var leading = true,
- trailing = true;
-
- if (typeof func != 'function') {
- throw new TypeError(FUNC_ERROR_TEXT);
- }
- if (isObject(options)) {
- leading = 'leading' in options ? !!options.leading : leading;
- trailing = 'trailing' in options ? !!options.trailing : trailing;
- }
- return debounce(func, wait, {
- 'leading': leading,
- 'maxWait': wait,
- 'trailing': trailing
- });
- }
-
- /**
- * Creates a function that accepts up to one argument, ignoring any
- * additional arguments.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Function
- * @param {Function} func The function to cap arguments for.
- * @returns {Function} Returns the new capped function.
- * @example
- *
- * _.map(['6', '8', '10'], _.unary(parseInt));
- * // => [6, 8, 10]
- */
- function unary(func) {
- return ary(func, 1);
- }
-
- /**
- * Creates a function that provides `value` to `wrapper` as its first
- * argument. Any additional arguments provided to the function are appended
- * to those provided to the `wrapper`. The wrapper is invoked with the `this`
- * binding of the created function.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Function
- * @param {*} value The value to wrap.
- * @param {Function} [wrapper=identity] The wrapper function.
- * @returns {Function} Returns the new function.
- * @example
- *
- * var p = _.wrap(_.escape, function(func, text) {
- * return '' + func(text) + '
';
- * });
- *
- * p('fred, barney, & pebbles');
- * // => 'fred, barney, & pebbles
'
- */
- function wrap(value, wrapper) {
- return partial(castFunction(wrapper), value);
- }
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Casts `value` as an array if it's not one.
- *
- * @static
- * @memberOf _
- * @since 4.4.0
- * @category Lang
- * @param {*} value The value to inspect.
- * @returns {Array} Returns the cast array.
- * @example
- *
- * _.castArray(1);
- * // => [1]
- *
- * _.castArray({ 'a': 1 });
- * // => [{ 'a': 1 }]
- *
- * _.castArray('abc');
- * // => ['abc']
- *
- * _.castArray(null);
- * // => [null]
- *
- * _.castArray(undefined);
- * // => [undefined]
- *
- * _.castArray();
- * // => []
- *
- * var array = [1, 2, 3];
- * console.log(_.castArray(array) === array);
- * // => true
- */
- function castArray() {
- if (!arguments.length) {
- return [];
- }
- var value = arguments[0];
- return isArray(value) ? value : [value];
- }
-
- /**
- * Creates a shallow clone of `value`.
- *
- * **Note:** This method is loosely based on the
- * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)
- * and supports cloning arrays, array buffers, booleans, date objects, maps,
- * numbers, `Object` objects, regexes, sets, strings, symbols, and typed
- * arrays. The own enumerable properties of `arguments` objects are cloned
- * as plain objects. An empty object is returned for uncloneable values such
- * as error objects, functions, DOM nodes, and WeakMaps.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to clone.
- * @returns {*} Returns the cloned value.
- * @see _.cloneDeep
- * @example
- *
- * var objects = [{ 'a': 1 }, { 'b': 2 }];
- *
- * var shallow = _.clone(objects);
- * console.log(shallow[0] === objects[0]);
- * // => true
- */
- function clone(value) {
- return baseClone(value, CLONE_SYMBOLS_FLAG);
- }
-
- /**
- * This method is like `_.clone` except that it accepts `customizer` which
- * is invoked to produce the cloned value. If `customizer` returns `undefined`,
- * cloning is handled by the method instead. The `customizer` is invoked with
- * up to four arguments; (value [, index|key, object, stack]).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to clone.
- * @param {Function} [customizer] The function to customize cloning.
- * @returns {*} Returns the cloned value.
- * @see _.cloneDeepWith
- * @example
- *
- * function customizer(value) {
- * if (_.isElement(value)) {
- * return value.cloneNode(false);
- * }
- * }
- *
- * var el = _.cloneWith(document.body, customizer);
- *
- * console.log(el === document.body);
- * // => false
- * console.log(el.nodeName);
- * // => 'BODY'
- * console.log(el.childNodes.length);
- * // => 0
- */
- function cloneWith(value, customizer) {
- customizer = typeof customizer == 'function' ? customizer : undefined;
- return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);
- }
-
- /**
- * This method is like `_.clone` except that it recursively clones `value`.
- *
- * @static
- * @memberOf _
- * @since 1.0.0
- * @category Lang
- * @param {*} value The value to recursively clone.
- * @returns {*} Returns the deep cloned value.
- * @see _.clone
- * @example
- *
- * var objects = [{ 'a': 1 }, { 'b': 2 }];
- *
- * var deep = _.cloneDeep(objects);
- * console.log(deep[0] === objects[0]);
- * // => false
- */
- function cloneDeep(value) {
- return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
- }
-
- /**
- * This method is like `_.cloneWith` except that it recursively clones `value`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to recursively clone.
- * @param {Function} [customizer] The function to customize cloning.
- * @returns {*} Returns the deep cloned value.
- * @see _.cloneWith
- * @example
- *
- * function customizer(value) {
- * if (_.isElement(value)) {
- * return value.cloneNode(true);
- * }
- * }
- *
- * var el = _.cloneDeepWith(document.body, customizer);
- *
- * console.log(el === document.body);
- * // => false
- * console.log(el.nodeName);
- * // => 'BODY'
- * console.log(el.childNodes.length);
- * // => 20
- */
- function cloneDeepWith(value, customizer) {
- customizer = typeof customizer == 'function' ? customizer : undefined;
- return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);
- }
-
- /**
- * Checks if `object` conforms to `source` by invoking the predicate
- * properties of `source` with the corresponding property values of `object`.
- *
- * **Note:** This method is equivalent to `_.conforms` when `source` is
- * partially applied.
- *
- * @static
- * @memberOf _
- * @since 4.14.0
- * @category Lang
- * @param {Object} object The object to inspect.
- * @param {Object} source The object of property predicates to conform to.
- * @returns {boolean} Returns `true` if `object` conforms, else `false`.
- * @example
- *
- * var object = { 'a': 1, 'b': 2 };
- *
- * _.conformsTo(object, { 'b': function(n) { return n > 1; } });
- * // => true
- *
- * _.conformsTo(object, { 'b': function(n) { return n > 2; } });
- * // => false
- */
- function conformsTo(object, source) {
- return source == null || baseConformsTo(object, source, keys(source));
- }
-
- /**
- * Performs a
- * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
- * comparison between two values to determine if they are equivalent.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
- * @example
- *
- * var object = { 'a': 1 };
- * var other = { 'a': 1 };
- *
- * _.eq(object, object);
- * // => true
- *
- * _.eq(object, other);
- * // => false
- *
- * _.eq('a', 'a');
- * // => true
- *
- * _.eq('a', Object('a'));
- * // => false
- *
- * _.eq(NaN, NaN);
- * // => true
- */
- function eq(value, other) {
- return value === other || (value !== value && other !== other);
- }
-
- /**
- * Checks if `value` is greater than `other`.
- *
- * @static
- * @memberOf _
- * @since 3.9.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if `value` is greater than `other`,
- * else `false`.
- * @see _.lt
- * @example
- *
- * _.gt(3, 1);
- * // => true
- *
- * _.gt(3, 3);
- * // => false
- *
- * _.gt(1, 3);
- * // => false
- */
- var gt = createRelationalOperation(baseGt);
-
- /**
- * Checks if `value` is greater than or equal to `other`.
- *
- * @static
- * @memberOf _
- * @since 3.9.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if `value` is greater than or equal to
- * `other`, else `false`.
- * @see _.lte
- * @example
- *
- * _.gte(3, 1);
- * // => true
- *
- * _.gte(3, 3);
- * // => true
- *
- * _.gte(1, 3);
- * // => false
- */
- var gte = createRelationalOperation(function(value, other) {
- return value >= other;
- });
-
- /**
- * Checks if `value` is likely an `arguments` object.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an `arguments` object,
- * else `false`.
- * @example
- *
- * _.isArguments(function() { return arguments; }());
- * // => true
- *
- * _.isArguments([1, 2, 3]);
- * // => false
- */
- var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
- return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
- !propertyIsEnumerable.call(value, 'callee');
- };
-
- /**
- * Checks if `value` is classified as an `Array` object.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an array, else `false`.
- * @example
- *
- * _.isArray([1, 2, 3]);
- * // => true
- *
- * _.isArray(document.body.children);
- * // => false
- *
- * _.isArray('abc');
- * // => false
- *
- * _.isArray(_.noop);
- * // => false
- */
- var isArray = Array.isArray;
-
- /**
- * Checks if `value` is classified as an `ArrayBuffer` object.
- *
- * @static
- * @memberOf _
- * @since 4.3.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
- * @example
- *
- * _.isArrayBuffer(new ArrayBuffer(2));
- * // => true
- *
- * _.isArrayBuffer(new Array(2));
- * // => false
- */
- var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;
-
- /**
- * Checks if `value` is array-like. A value is considered array-like if it's
- * not a function and has a `value.length` that's an integer greater than or
- * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
- * @example
- *
- * _.isArrayLike([1, 2, 3]);
- * // => true
- *
- * _.isArrayLike(document.body.children);
- * // => true
- *
- * _.isArrayLike('abc');
- * // => true
- *
- * _.isArrayLike(_.noop);
- * // => false
- */
- function isArrayLike(value) {
- return value != null && isLength(value.length) && !isFunction(value);
- }
-
- /**
- * This method is like `_.isArrayLike` except that it also checks if `value`
- * is an object.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an array-like object,
- * else `false`.
- * @example
- *
- * _.isArrayLikeObject([1, 2, 3]);
- * // => true
- *
- * _.isArrayLikeObject(document.body.children);
- * // => true
- *
- * _.isArrayLikeObject('abc');
- * // => false
- *
- * _.isArrayLikeObject(_.noop);
- * // => false
- */
- function isArrayLikeObject(value) {
- return isObjectLike(value) && isArrayLike(value);
- }
-
- /**
- * Checks if `value` is classified as a boolean primitive or object.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.
- * @example
- *
- * _.isBoolean(false);
- * // => true
- *
- * _.isBoolean(null);
- * // => false
- */
- function isBoolean(value) {
- return value === true || value === false ||
- (isObjectLike(value) && baseGetTag(value) == boolTag);
- }
-
- /**
- * Checks if `value` is a buffer.
- *
- * @static
- * @memberOf _
- * @since 4.3.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
- * @example
- *
- * _.isBuffer(new Buffer(2));
- * // => true
- *
- * _.isBuffer(new Uint8Array(2));
- * // => false
- */
- var isBuffer = nativeIsBuffer || stubFalse;
-
- /**
- * Checks if `value` is classified as a `Date` object.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a date object, else `false`.
- * @example
- *
- * _.isDate(new Date);
- * // => true
- *
- * _.isDate('Mon April 23 2012');
- * // => false
- */
- var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;
-
- /**
- * Checks if `value` is likely a DOM element.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.
- * @example
- *
- * _.isElement(document.body);
- * // => true
- *
- * _.isElement('');
- * // => false
- */
- function isElement(value) {
- return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);
- }
-
- /**
- * Checks if `value` is an empty object, collection, map, or set.
- *
- * Objects are considered empty if they have no own enumerable string keyed
- * properties.
- *
- * Array-like values such as `arguments` objects, arrays, buffers, strings, or
- * jQuery-like collections are considered empty if they have a `length` of `0`.
- * Similarly, maps and sets are considered empty if they have a `size` of `0`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is empty, else `false`.
- * @example
- *
- * _.isEmpty(null);
- * // => true
- *
- * _.isEmpty(true);
- * // => true
- *
- * _.isEmpty(1);
- * // => true
- *
- * _.isEmpty([1, 2, 3]);
- * // => false
- *
- * _.isEmpty({ 'a': 1 });
- * // => false
- */
- function isEmpty(value) {
- if (value == null) {
- return true;
- }
- if (isArrayLike(value) &&
- (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||
- isBuffer(value) || isTypedArray(value) || isArguments(value))) {
- return !value.length;
- }
- var tag = getTag(value);
- if (tag == mapTag || tag == setTag) {
- return !value.size;
- }
- if (isPrototype(value)) {
- return !baseKeys(value).length;
- }
- for (var key in value) {
- if (hasOwnProperty.call(value, key)) {
- return false;
- }
- }
- return true;
- }
-
- /**
- * Performs a deep comparison between two values to determine if they are
- * equivalent.
- *
- * **Note:** This method supports comparing arrays, array buffers, booleans,
- * date objects, error objects, maps, numbers, `Object` objects, regexes,
- * sets, strings, symbols, and typed arrays. `Object` objects are compared
- * by their own, not inherited, enumerable properties. Functions and DOM
- * nodes are compared by strict equality, i.e. `===`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
- * @example
- *
- * var object = { 'a': 1 };
- * var other = { 'a': 1 };
- *
- * _.isEqual(object, other);
- * // => true
- *
- * object === other;
- * // => false
- */
- function isEqual(value, other) {
- return baseIsEqual(value, other);
- }
-
- /**
- * This method is like `_.isEqual` except that it accepts `customizer` which
- * is invoked to compare values. If `customizer` returns `undefined`, comparisons
- * are handled by the method instead. The `customizer` is invoked with up to
- * six arguments: (objValue, othValue [, index|key, object, other, stack]).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @param {Function} [customizer] The function to customize comparisons.
- * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
- * @example
- *
- * function isGreeting(value) {
- * return /^h(?:i|ello)$/.test(value);
- * }
- *
- * function customizer(objValue, othValue) {
- * if (isGreeting(objValue) && isGreeting(othValue)) {
- * return true;
- * }
- * }
- *
- * var array = ['hello', 'goodbye'];
- * var other = ['hi', 'goodbye'];
- *
- * _.isEqualWith(array, other, customizer);
- * // => true
- */
- function isEqualWith(value, other, customizer) {
- customizer = typeof customizer == 'function' ? customizer : undefined;
- var result = customizer ? customizer(value, other) : undefined;
- return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
- }
-
- /**
- * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,
- * `SyntaxError`, `TypeError`, or `URIError` object.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an error object, else `false`.
- * @example
- *
- * _.isError(new Error);
- * // => true
- *
- * _.isError(Error);
- * // => false
- */
- function isError(value) {
- if (!isObjectLike(value)) {
- return false;
- }
- var tag = baseGetTag(value);
- return tag == errorTag || tag == domExcTag ||
- (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));
- }
-
- /**
- * Checks if `value` is a finite primitive number.
- *
- * **Note:** This method is based on
- * [`Number.isFinite`](https://mdn.io/Number/isFinite).
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.
- * @example
- *
- * _.isFinite(3);
- * // => true
- *
- * _.isFinite(Number.MIN_VALUE);
- * // => true
- *
- * _.isFinite(Infinity);
- * // => false
- *
- * _.isFinite('3');
- * // => false
- */
- function isFinite(value) {
- return typeof value == 'number' && nativeIsFinite(value);
- }
-
- /**
- * Checks if `value` is classified as a `Function` object.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a function, else `false`.
- * @example
- *
- * _.isFunction(_);
- * // => true
- *
- * _.isFunction(/abc/);
- * // => false
- */
- function isFunction(value) {
- if (!isObject(value)) {
- return false;
- }
- // The use of `Object#toString` avoids issues with the `typeof` operator
- // in Safari 9 which returns 'object' for typed arrays and other constructors.
- var tag = baseGetTag(value);
- return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
- }
-
- /**
- * Checks if `value` is an integer.
- *
- * **Note:** This method is based on
- * [`Number.isInteger`](https://mdn.io/Number/isInteger).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an integer, else `false`.
- * @example
- *
- * _.isInteger(3);
- * // => true
- *
- * _.isInteger(Number.MIN_VALUE);
- * // => false
- *
- * _.isInteger(Infinity);
- * // => false
- *
- * _.isInteger('3');
- * // => false
- */
- function isInteger(value) {
- return typeof value == 'number' && value == toInteger(value);
- }
-
- /**
- * Checks if `value` is a valid array-like length.
- *
- * **Note:** This method is loosely based on
- * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
- * @example
- *
- * _.isLength(3);
- * // => true
- *
- * _.isLength(Number.MIN_VALUE);
- * // => false
- *
- * _.isLength(Infinity);
- * // => false
- *
- * _.isLength('3');
- * // => false
- */
- function isLength(value) {
- return typeof value == 'number' &&
- value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
- }
-
- /**
- * Checks if `value` is the
- * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
- * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is an object, else `false`.
- * @example
- *
- * _.isObject({});
- * // => true
- *
- * _.isObject([1, 2, 3]);
- * // => true
- *
- * _.isObject(_.noop);
- * // => true
- *
- * _.isObject(null);
- * // => false
- */
- function isObject(value) {
- var type = typeof value;
- return value != null && (type == 'object' || type == 'function');
- }
-
- /**
- * Checks if `value` is object-like. A value is object-like if it's not `null`
- * and has a `typeof` result of "object".
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
- * @example
- *
- * _.isObjectLike({});
- * // => true
- *
- * _.isObjectLike([1, 2, 3]);
- * // => true
- *
- * _.isObjectLike(_.noop);
- * // => false
- *
- * _.isObjectLike(null);
- * // => false
- */
- function isObjectLike(value) {
- return value != null && typeof value == 'object';
- }
-
- /**
- * Checks if `value` is classified as a `Map` object.
- *
- * @static
- * @memberOf _
- * @since 4.3.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a map, else `false`.
- * @example
- *
- * _.isMap(new Map);
- * // => true
- *
- * _.isMap(new WeakMap);
- * // => false
- */
- var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
-
- /**
- * Performs a partial deep comparison between `object` and `source` to
- * determine if `object` contains equivalent property values.
- *
- * **Note:** This method is equivalent to `_.matches` when `source` is
- * partially applied.
- *
- * Partial comparisons will match empty array and empty object `source`
- * values against any array or object value, respectively. See `_.isEqual`
- * for a list of supported value comparisons.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Lang
- * @param {Object} object The object to inspect.
- * @param {Object} source The object of property values to match.
- * @returns {boolean} Returns `true` if `object` is a match, else `false`.
- * @example
- *
- * var object = { 'a': 1, 'b': 2 };
- *
- * _.isMatch(object, { 'b': 2 });
- * // => true
- *
- * _.isMatch(object, { 'b': 1 });
- * // => false
- */
- function isMatch(object, source) {
- return object === source || baseIsMatch(object, source, getMatchData(source));
- }
-
- /**
- * This method is like `_.isMatch` except that it accepts `customizer` which
- * is invoked to compare values. If `customizer` returns `undefined`, comparisons
- * are handled by the method instead. The `customizer` is invoked with five
- * arguments: (objValue, srcValue, index|key, object, source).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {Object} object The object to inspect.
- * @param {Object} source The object of property values to match.
- * @param {Function} [customizer] The function to customize comparisons.
- * @returns {boolean} Returns `true` if `object` is a match, else `false`.
- * @example
- *
- * function isGreeting(value) {
- * return /^h(?:i|ello)$/.test(value);
- * }
- *
- * function customizer(objValue, srcValue) {
- * if (isGreeting(objValue) && isGreeting(srcValue)) {
- * return true;
- * }
- * }
- *
- * var object = { 'greeting': 'hello' };
- * var source = { 'greeting': 'hi' };
- *
- * _.isMatchWith(object, source, customizer);
- * // => true
- */
- function isMatchWith(object, source, customizer) {
- customizer = typeof customizer == 'function' ? customizer : undefined;
- return baseIsMatch(object, source, getMatchData(source), customizer);
- }
-
- /**
- * Checks if `value` is `NaN`.
- *
- * **Note:** This method is based on
- * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as
- * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for
- * `undefined` and other non-number values.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
- * @example
- *
- * _.isNaN(NaN);
- * // => true
- *
- * _.isNaN(new Number(NaN));
- * // => true
- *
- * isNaN(undefined);
- * // => true
- *
- * _.isNaN(undefined);
- * // => false
- */
- function isNaN(value) {
- // An `NaN` primitive is the only value that is not equal to itself.
- // Perform the `toStringTag` check first to avoid errors with some
- // ActiveX objects in IE.
- return isNumber(value) && value != +value;
- }
-
- /**
- * Checks if `value` is a pristine native function.
- *
- * **Note:** This method can't reliably detect native functions in the presence
- * of the core-js package because core-js circumvents this kind of detection.
- * Despite multiple requests, the core-js maintainer has made it clear: any
- * attempt to fix the detection will be obstructed. As a result, we're left
- * with little choice but to throw an error. Unfortunately, this also affects
- * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),
- * which rely on core-js.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a native function,
- * else `false`.
- * @example
- *
- * _.isNative(Array.prototype.push);
- * // => true
- *
- * _.isNative(_);
- * // => false
- */
- function isNative(value) {
- if (isMaskable(value)) {
- throw new Error(CORE_ERROR_TEXT);
- }
- return baseIsNative(value);
- }
-
- /**
- * Checks if `value` is `null`.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is `null`, else `false`.
- * @example
- *
- * _.isNull(null);
- * // => true
- *
- * _.isNull(void 0);
- * // => false
- */
- function isNull(value) {
- return value === null;
- }
-
- /**
- * Checks if `value` is `null` or `undefined`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is nullish, else `false`.
- * @example
- *
- * _.isNil(null);
- * // => true
- *
- * _.isNil(void 0);
- * // => true
- *
- * _.isNil(NaN);
- * // => false
- */
- function isNil(value) {
- return value == null;
- }
-
- /**
- * Checks if `value` is classified as a `Number` primitive or object.
- *
- * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are
- * classified as numbers, use the `_.isFinite` method.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a number, else `false`.
- * @example
- *
- * _.isNumber(3);
- * // => true
- *
- * _.isNumber(Number.MIN_VALUE);
- * // => true
- *
- * _.isNumber(Infinity);
- * // => true
- *
- * _.isNumber('3');
- * // => false
- */
- function isNumber(value) {
- return typeof value == 'number' ||
- (isObjectLike(value) && baseGetTag(value) == numberTag);
- }
-
- /**
- * Checks if `value` is a plain object, that is, an object created by the
- * `Object` constructor or one with a `[[Prototype]]` of `null`.
- *
- * @static
- * @memberOf _
- * @since 0.8.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * }
- *
- * _.isPlainObject(new Foo);
- * // => false
- *
- * _.isPlainObject([1, 2, 3]);
- * // => false
- *
- * _.isPlainObject({ 'x': 0, 'y': 0 });
- * // => true
- *
- * _.isPlainObject(Object.create(null));
- * // => true
- */
- function isPlainObject(value) {
- if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
- return false;
- }
- var proto = getPrototype(value);
- if (proto === null) {
- return true;
- }
- var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
- return typeof Ctor == 'function' && Ctor instanceof Ctor &&
- funcToString.call(Ctor) == objectCtorString;
- }
-
- /**
- * Checks if `value` is classified as a `RegExp` object.
- *
- * @static
- * @memberOf _
- * @since 0.1.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
- * @example
- *
- * _.isRegExp(/abc/);
- * // => true
- *
- * _.isRegExp('/abc/');
- * // => false
- */
- var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;
-
- /**
- * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754
- * double precision number which isn't the result of a rounded unsafe integer.
- *
- * **Note:** This method is based on
- * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.
- * @example
- *
- * _.isSafeInteger(3);
- * // => true
- *
- * _.isSafeInteger(Number.MIN_VALUE);
- * // => false
- *
- * _.isSafeInteger(Infinity);
- * // => false
- *
- * _.isSafeInteger('3');
- * // => false
- */
- function isSafeInteger(value) {
- return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;
- }
-
- /**
- * Checks if `value` is classified as a `Set` object.
- *
- * @static
- * @memberOf _
- * @since 4.3.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a set, else `false`.
- * @example
- *
- * _.isSet(new Set);
- * // => true
- *
- * _.isSet(new WeakSet);
- * // => false
- */
- var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
-
- /**
- * Checks if `value` is classified as a `String` primitive or object.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a string, else `false`.
- * @example
- *
- * _.isString('abc');
- * // => true
- *
- * _.isString(1);
- * // => false
- */
- function isString(value) {
- return typeof value == 'string' ||
- (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);
- }
-
- /**
- * Checks if `value` is classified as a `Symbol` primitive or object.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
- * @example
- *
- * _.isSymbol(Symbol.iterator);
- * // => true
- *
- * _.isSymbol('abc');
- * // => false
- */
- function isSymbol(value) {
- return typeof value == 'symbol' ||
- (isObjectLike(value) && baseGetTag(value) == symbolTag);
- }
-
- /**
- * Checks if `value` is classified as a typed array.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
- * @example
- *
- * _.isTypedArray(new Uint8Array);
- * // => true
- *
- * _.isTypedArray([]);
- * // => false
- */
- var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
-
- /**
- * Checks if `value` is `undefined`.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.
- * @example
- *
- * _.isUndefined(void 0);
- * // => true
- *
- * _.isUndefined(null);
- * // => false
- */
- function isUndefined(value) {
- return value === undefined;
- }
-
- /**
- * Checks if `value` is classified as a `WeakMap` object.
- *
- * @static
- * @memberOf _
- * @since 4.3.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.
- * @example
- *
- * _.isWeakMap(new WeakMap);
- * // => true
- *
- * _.isWeakMap(new Map);
- * // => false
- */
- function isWeakMap(value) {
- return isObjectLike(value) && getTag(value) == weakMapTag;
- }
-
- /**
- * Checks if `value` is classified as a `WeakSet` object.
- *
- * @static
- * @memberOf _
- * @since 4.3.0
- * @category Lang
- * @param {*} value The value to check.
- * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.
- * @example
- *
- * _.isWeakSet(new WeakSet);
- * // => true
- *
- * _.isWeakSet(new Set);
- * // => false
- */
- function isWeakSet(value) {
- return isObjectLike(value) && baseGetTag(value) == weakSetTag;
- }
-
- /**
- * Checks if `value` is less than `other`.
- *
- * @static
- * @memberOf _
- * @since 3.9.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if `value` is less than `other`,
- * else `false`.
- * @see _.gt
- * @example
- *
- * _.lt(1, 3);
- * // => true
- *
- * _.lt(3, 3);
- * // => false
- *
- * _.lt(3, 1);
- * // => false
- */
- var lt = createRelationalOperation(baseLt);
-
- /**
- * Checks if `value` is less than or equal to `other`.
- *
- * @static
- * @memberOf _
- * @since 3.9.0
- * @category Lang
- * @param {*} value The value to compare.
- * @param {*} other The other value to compare.
- * @returns {boolean} Returns `true` if `value` is less than or equal to
- * `other`, else `false`.
- * @see _.gte
- * @example
- *
- * _.lte(1, 3);
- * // => true
- *
- * _.lte(3, 3);
- * // => true
- *
- * _.lte(3, 1);
- * // => false
- */
- var lte = createRelationalOperation(function(value, other) {
- return value <= other;
- });
-
- /**
- * Converts `value` to an array.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {Array} Returns the converted array.
- * @example
- *
- * _.toArray({ 'a': 1, 'b': 2 });
- * // => [1, 2]
- *
- * _.toArray('abc');
- * // => ['a', 'b', 'c']
- *
- * _.toArray(1);
- * // => []
- *
- * _.toArray(null);
- * // => []
- */
- function toArray(value) {
- if (!value) {
- return [];
- }
- if (isArrayLike(value)) {
- return isString(value) ? stringToArray(value) : copyArray(value);
- }
- if (symIterator && value[symIterator]) {
- return iteratorToArray(value[symIterator]());
- }
- var tag = getTag(value),
- func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);
-
- return func(value);
- }
-
- /**
- * Converts `value` to a finite number.
- *
- * @static
- * @memberOf _
- * @since 4.12.0
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {number} Returns the converted number.
- * @example
- *
- * _.toFinite(3.2);
- * // => 3.2
- *
- * _.toFinite(Number.MIN_VALUE);
- * // => 5e-324
- *
- * _.toFinite(Infinity);
- * // => 1.7976931348623157e+308
- *
- * _.toFinite('3.2');
- * // => 3.2
- */
- function toFinite(value) {
- if (!value) {
- return value === 0 ? value : 0;
- }
- value = toNumber(value);
- if (value === INFINITY || value === -INFINITY) {
- var sign = (value < 0 ? -1 : 1);
- return sign * MAX_INTEGER;
- }
- return value === value ? value : 0;
- }
-
- /**
- * Converts `value` to an integer.
- *
- * **Note:** This method is loosely based on
- * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {number} Returns the converted integer.
- * @example
- *
- * _.toInteger(3.2);
- * // => 3
- *
- * _.toInteger(Number.MIN_VALUE);
- * // => 0
- *
- * _.toInteger(Infinity);
- * // => 1.7976931348623157e+308
- *
- * _.toInteger('3.2');
- * // => 3
- */
- function toInteger(value) {
- var result = toFinite(value),
- remainder = result % 1;
-
- return result === result ? (remainder ? result - remainder : result) : 0;
- }
-
- /**
- * Converts `value` to an integer suitable for use as the length of an
- * array-like object.
- *
- * **Note:** This method is based on
- * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {number} Returns the converted integer.
- * @example
- *
- * _.toLength(3.2);
- * // => 3
- *
- * _.toLength(Number.MIN_VALUE);
- * // => 0
- *
- * _.toLength(Infinity);
- * // => 4294967295
- *
- * _.toLength('3.2');
- * // => 3
- */
- function toLength(value) {
- return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;
- }
-
- /**
- * Converts `value` to a number.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to process.
- * @returns {number} Returns the number.
- * @example
- *
- * _.toNumber(3.2);
- * // => 3.2
- *
- * _.toNumber(Number.MIN_VALUE);
- * // => 5e-324
- *
- * _.toNumber(Infinity);
- * // => Infinity
- *
- * _.toNumber('3.2');
- * // => 3.2
- */
- function toNumber(value) {
- if (typeof value == 'number') {
- return value;
- }
- if (isSymbol(value)) {
- return NAN;
- }
- if (isObject(value)) {
- var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
- value = isObject(other) ? (other + '') : other;
- }
- if (typeof value != 'string') {
- return value === 0 ? value : +value;
- }
- value = value.replace(reTrim, '');
- var isBinary = reIsBinary.test(value);
- return (isBinary || reIsOctal.test(value))
- ? freeParseInt(value.slice(2), isBinary ? 2 : 8)
- : (reIsBadHex.test(value) ? NAN : +value);
- }
-
- /**
- * Converts `value` to a plain object flattening inherited enumerable string
- * keyed properties of `value` to own properties of the plain object.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {Object} Returns the converted plain object.
- * @example
- *
- * function Foo() {
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.assign({ 'a': 1 }, new Foo);
- * // => { 'a': 1, 'b': 2 }
- *
- * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));
- * // => { 'a': 1, 'b': 2, 'c': 3 }
- */
- function toPlainObject(value) {
- return copyObject(value, keysIn(value));
- }
-
- /**
- * Converts `value` to a safe integer. A safe integer can be compared and
- * represented correctly.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {number} Returns the converted integer.
- * @example
- *
- * _.toSafeInteger(3.2);
- * // => 3
- *
- * _.toSafeInteger(Number.MIN_VALUE);
- * // => 0
- *
- * _.toSafeInteger(Infinity);
- * // => 9007199254740991
- *
- * _.toSafeInteger('3.2');
- * // => 3
- */
- function toSafeInteger(value) {
- return value
- ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)
- : (value === 0 ? value : 0);
- }
-
- /**
- * Converts `value` to a string. An empty string is returned for `null`
- * and `undefined` values. The sign of `-0` is preserved.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Lang
- * @param {*} value The value to convert.
- * @returns {string} Returns the converted string.
- * @example
- *
- * _.toString(null);
- * // => ''
- *
- * _.toString(-0);
- * // => '-0'
- *
- * _.toString([1, 2, 3]);
- * // => '1,2,3'
- */
- function toString(value) {
- return value == null ? '' : baseToString(value);
- }
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Assigns own enumerable string keyed properties of source objects to the
- * destination object. Source objects are applied from left to right.
- * Subsequent sources overwrite property assignments of previous sources.
- *
- * **Note:** This method mutates `object` and is loosely based on
- * [`Object.assign`](https://mdn.io/Object/assign).
- *
- * @static
- * @memberOf _
- * @since 0.10.0
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} [sources] The source objects.
- * @returns {Object} Returns `object`.
- * @see _.assignIn
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * }
- *
- * function Bar() {
- * this.c = 3;
- * }
- *
- * Foo.prototype.b = 2;
- * Bar.prototype.d = 4;
- *
- * _.assign({ 'a': 0 }, new Foo, new Bar);
- * // => { 'a': 1, 'c': 3 }
- */
- var assign = createAssigner(function(object, source) {
- if (isPrototype(source) || isArrayLike(source)) {
- copyObject(source, keys(source), object);
- return;
- }
- for (var key in source) {
- if (hasOwnProperty.call(source, key)) {
- assignValue(object, key, source[key]);
- }
- }
- });
-
- /**
- * This method is like `_.assign` except that it iterates over own and
- * inherited source properties.
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @alias extend
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} [sources] The source objects.
- * @returns {Object} Returns `object`.
- * @see _.assign
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * }
- *
- * function Bar() {
- * this.c = 3;
- * }
- *
- * Foo.prototype.b = 2;
- * Bar.prototype.d = 4;
- *
- * _.assignIn({ 'a': 0 }, new Foo, new Bar);
- * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }
- */
- var assignIn = createAssigner(function(object, source) {
- copyObject(source, keysIn(source), object);
- });
-
- /**
- * This method is like `_.assignIn` except that it accepts `customizer`
- * which is invoked to produce the assigned values. If `customizer` returns
- * `undefined`, assignment is handled by the method instead. The `customizer`
- * is invoked with five arguments: (objValue, srcValue, key, object, source).
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @alias extendWith
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} sources The source objects.
- * @param {Function} [customizer] The function to customize assigned values.
- * @returns {Object} Returns `object`.
- * @see _.assignWith
- * @example
- *
- * function customizer(objValue, srcValue) {
- * return _.isUndefined(objValue) ? srcValue : objValue;
- * }
- *
- * var defaults = _.partialRight(_.assignInWith, customizer);
- *
- * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
- * // => { 'a': 1, 'b': 2 }
- */
- var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {
- copyObject(source, keysIn(source), object, customizer);
- });
-
- /**
- * This method is like `_.assign` except that it accepts `customizer`
- * which is invoked to produce the assigned values. If `customizer` returns
- * `undefined`, assignment is handled by the method instead. The `customizer`
- * is invoked with five arguments: (objValue, srcValue, key, object, source).
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} sources The source objects.
- * @param {Function} [customizer] The function to customize assigned values.
- * @returns {Object} Returns `object`.
- * @see _.assignInWith
- * @example
- *
- * function customizer(objValue, srcValue) {
- * return _.isUndefined(objValue) ? srcValue : objValue;
- * }
- *
- * var defaults = _.partialRight(_.assignWith, customizer);
- *
- * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
- * // => { 'a': 1, 'b': 2 }
- */
- var assignWith = createAssigner(function(object, source, srcIndex, customizer) {
- copyObject(source, keys(source), object, customizer);
- });
-
- /**
- * Creates an array of values corresponding to `paths` of `object`.
- *
- * @static
- * @memberOf _
- * @since 1.0.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {...(string|string[])} [paths] The property paths to pick.
- * @returns {Array} Returns the picked values.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
- *
- * _.at(object, ['a[0].b.c', 'a[1]']);
- * // => [3, 4]
- */
- var at = flatRest(baseAt);
-
- /**
- * Creates an object that inherits from the `prototype` object. If a
- * `properties` object is given, its own enumerable string keyed properties
- * are assigned to the created object.
- *
- * @static
- * @memberOf _
- * @since 2.3.0
- * @category Object
- * @param {Object} prototype The object to inherit from.
- * @param {Object} [properties] The properties to assign to the object.
- * @returns {Object} Returns the new object.
- * @example
- *
- * function Shape() {
- * this.x = 0;
- * this.y = 0;
- * }
- *
- * function Circle() {
- * Shape.call(this);
- * }
- *
- * Circle.prototype = _.create(Shape.prototype, {
- * 'constructor': Circle
- * });
- *
- * var circle = new Circle;
- * circle instanceof Circle;
- * // => true
- *
- * circle instanceof Shape;
- * // => true
- */
- function create(prototype, properties) {
- var result = baseCreate(prototype);
- return properties == null ? result : baseAssign(result, properties);
- }
-
- /**
- * Assigns own and inherited enumerable string keyed properties of source
- * objects to the destination object for all destination properties that
- * resolve to `undefined`. Source objects are applied from left to right.
- * Once a property is set, additional values of the same property are ignored.
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} [sources] The source objects.
- * @returns {Object} Returns `object`.
- * @see _.defaultsDeep
- * @example
- *
- * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
- * // => { 'a': 1, 'b': 2 }
- */
- var defaults = baseRest(function(object, sources) {
- object = Object(object);
-
- var index = -1;
- var length = sources.length;
- var guard = length > 2 ? sources[2] : undefined;
-
- if (guard && isIterateeCall(sources[0], sources[1], guard)) {
- length = 1;
- }
-
- while (++index < length) {
- var source = sources[index];
- var props = keysIn(source);
- var propsIndex = -1;
- var propsLength = props.length;
-
- while (++propsIndex < propsLength) {
- var key = props[propsIndex];
- var value = object[key];
-
- if (value === undefined ||
- (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {
- object[key] = source[key];
- }
- }
- }
-
- return object;
- });
-
- /**
- * This method is like `_.defaults` except that it recursively assigns
- * default properties.
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 3.10.0
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} [sources] The source objects.
- * @returns {Object} Returns `object`.
- * @see _.defaults
- * @example
- *
- * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });
- * // => { 'a': { 'b': 2, 'c': 3 } }
- */
- var defaultsDeep = baseRest(function(args) {
- args.push(undefined, customDefaultsMerge);
- return apply(mergeWith, undefined, args);
- });
-
- /**
- * This method is like `_.find` except that it returns the key of the first
- * element `predicate` returns truthy for instead of the element itself.
- *
- * @static
- * @memberOf _
- * @since 1.1.0
- * @category Object
- * @param {Object} object The object to inspect.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {string|undefined} Returns the key of the matched element,
- * else `undefined`.
- * @example
- *
- * var users = {
- * 'barney': { 'age': 36, 'active': true },
- * 'fred': { 'age': 40, 'active': false },
- * 'pebbles': { 'age': 1, 'active': true }
- * };
- *
- * _.findKey(users, function(o) { return o.age < 40; });
- * // => 'barney' (iteration order is not guaranteed)
- *
- * // The `_.matches` iteratee shorthand.
- * _.findKey(users, { 'age': 1, 'active': true });
- * // => 'pebbles'
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.findKey(users, ['active', false]);
- * // => 'fred'
- *
- * // The `_.property` iteratee shorthand.
- * _.findKey(users, 'active');
- * // => 'barney'
- */
- function findKey(object, predicate) {
- return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);
- }
-
- /**
- * This method is like `_.findKey` except that it iterates over elements of
- * a collection in the opposite order.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Object
- * @param {Object} object The object to inspect.
- * @param {Function} [predicate=_.identity] The function invoked per iteration.
- * @returns {string|undefined} Returns the key of the matched element,
- * else `undefined`.
- * @example
- *
- * var users = {
- * 'barney': { 'age': 36, 'active': true },
- * 'fred': { 'age': 40, 'active': false },
- * 'pebbles': { 'age': 1, 'active': true }
- * };
- *
- * _.findLastKey(users, function(o) { return o.age < 40; });
- * // => returns 'pebbles' assuming `_.findKey` returns 'barney'
- *
- * // The `_.matches` iteratee shorthand.
- * _.findLastKey(users, { 'age': 36, 'active': true });
- * // => 'barney'
- *
- * // The `_.matchesProperty` iteratee shorthand.
- * _.findLastKey(users, ['active', false]);
- * // => 'fred'
- *
- * // The `_.property` iteratee shorthand.
- * _.findLastKey(users, 'active');
- * // => 'pebbles'
- */
- function findLastKey(object, predicate) {
- return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);
- }
-
- /**
- * Iterates over own and inherited enumerable string keyed properties of an
- * object and invokes `iteratee` for each property. The iteratee is invoked
- * with three arguments: (value, key, object). Iteratee functions may exit
- * iteration early by explicitly returning `false`.
- *
- * @static
- * @memberOf _
- * @since 0.3.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Object} Returns `object`.
- * @see _.forInRight
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.forIn(new Foo, function(value, key) {
- * console.log(key);
- * });
- * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).
- */
- function forIn(object, iteratee) {
- return object == null
- ? object
- : baseFor(object, getIteratee(iteratee, 3), keysIn);
- }
-
- /**
- * This method is like `_.forIn` except that it iterates over properties of
- * `object` in the opposite order.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Object} Returns `object`.
- * @see _.forIn
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.forInRight(new Foo, function(value, key) {
- * console.log(key);
- * });
- * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.
- */
- function forInRight(object, iteratee) {
- return object == null
- ? object
- : baseForRight(object, getIteratee(iteratee, 3), keysIn);
- }
-
- /**
- * Iterates over own enumerable string keyed properties of an object and
- * invokes `iteratee` for each property. The iteratee is invoked with three
- * arguments: (value, key, object). Iteratee functions may exit iteration
- * early by explicitly returning `false`.
- *
- * @static
- * @memberOf _
- * @since 0.3.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Object} Returns `object`.
- * @see _.forOwnRight
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.forOwn(new Foo, function(value, key) {
- * console.log(key);
- * });
- * // => Logs 'a' then 'b' (iteration order is not guaranteed).
- */
- function forOwn(object, iteratee) {
- return object && baseForOwn(object, getIteratee(iteratee, 3));
- }
-
- /**
- * This method is like `_.forOwn` except that it iterates over properties of
- * `object` in the opposite order.
- *
- * @static
- * @memberOf _
- * @since 2.0.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Object} Returns `object`.
- * @see _.forOwn
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.forOwnRight(new Foo, function(value, key) {
- * console.log(key);
- * });
- * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.
- */
- function forOwnRight(object, iteratee) {
- return object && baseForOwnRight(object, getIteratee(iteratee, 3));
- }
-
- /**
- * Creates an array of function property names from own enumerable properties
- * of `object`.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The object to inspect.
- * @returns {Array} Returns the function names.
- * @see _.functionsIn
- * @example
- *
- * function Foo() {
- * this.a = _.constant('a');
- * this.b = _.constant('b');
- * }
- *
- * Foo.prototype.c = _.constant('c');
- *
- * _.functions(new Foo);
- * // => ['a', 'b']
- */
- function functions(object) {
- return object == null ? [] : baseFunctions(object, keys(object));
- }
-
- /**
- * Creates an array of function property names from own and inherited
- * enumerable properties of `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The object to inspect.
- * @returns {Array} Returns the function names.
- * @see _.functions
- * @example
- *
- * function Foo() {
- * this.a = _.constant('a');
- * this.b = _.constant('b');
- * }
- *
- * Foo.prototype.c = _.constant('c');
- *
- * _.functionsIn(new Foo);
- * // => ['a', 'b', 'c']
- */
- function functionsIn(object) {
- return object == null ? [] : baseFunctions(object, keysIn(object));
- }
-
- /**
- * Gets the value at `path` of `object`. If the resolved value is
- * `undefined`, the `defaultValue` is returned in its place.
- *
- * @static
- * @memberOf _
- * @since 3.7.0
- * @category Object
- * @param {Object} object The object to query.
- * @param {Array|string} path The path of the property to get.
- * @param {*} [defaultValue] The value returned for `undefined` resolved values.
- * @returns {*} Returns the resolved value.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': 3 } }] };
- *
- * _.get(object, 'a[0].b.c');
- * // => 3
- *
- * _.get(object, ['a', '0', 'b', 'c']);
- * // => 3
- *
- * _.get(object, 'a.b.c', 'default');
- * // => 'default'
- */
- function get(object, path, defaultValue) {
- var result = object == null ? undefined : baseGet(object, path);
- return result === undefined ? defaultValue : result;
- }
-
- /**
- * Checks if `path` is a direct property of `object`.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The object to query.
- * @param {Array|string} path The path to check.
- * @returns {boolean} Returns `true` if `path` exists, else `false`.
- * @example
- *
- * var object = { 'a': { 'b': 2 } };
- * var other = _.create({ 'a': _.create({ 'b': 2 }) });
- *
- * _.has(object, 'a');
- * // => true
- *
- * _.has(object, 'a.b');
- * // => true
- *
- * _.has(object, ['a', 'b']);
- * // => true
- *
- * _.has(other, 'a');
- * // => false
- */
- function has(object, path) {
- return object != null && hasPath(object, path, baseHas);
- }
-
- /**
- * Checks if `path` is a direct or inherited property of `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The object to query.
- * @param {Array|string} path The path to check.
- * @returns {boolean} Returns `true` if `path` exists, else `false`.
- * @example
- *
- * var object = _.create({ 'a': _.create({ 'b': 2 }) });
- *
- * _.hasIn(object, 'a');
- * // => true
- *
- * _.hasIn(object, 'a.b');
- * // => true
- *
- * _.hasIn(object, ['a', 'b']);
- * // => true
- *
- * _.hasIn(object, 'b');
- * // => false
- */
- function hasIn(object, path) {
- return object != null && hasPath(object, path, baseHasIn);
- }
-
- /**
- * Creates an object composed of the inverted keys and values of `object`.
- * If `object` contains duplicate values, subsequent values overwrite
- * property assignments of previous values.
- *
- * @static
- * @memberOf _
- * @since 0.7.0
- * @category Object
- * @param {Object} object The object to invert.
- * @returns {Object} Returns the new inverted object.
- * @example
- *
- * var object = { 'a': 1, 'b': 2, 'c': 1 };
- *
- * _.invert(object);
- * // => { '1': 'c', '2': 'b' }
- */
- var invert = createInverter(function(result, value, key) {
- if (value != null &&
- typeof value.toString != 'function') {
- value = nativeObjectToString.call(value);
- }
-
- result[value] = key;
- }, constant(identity));
-
- /**
- * This method is like `_.invert` except that the inverted object is generated
- * from the results of running each element of `object` thru `iteratee`. The
- * corresponding inverted value of each inverted key is an array of keys
- * responsible for generating the inverted value. The iteratee is invoked
- * with one argument: (value).
- *
- * @static
- * @memberOf _
- * @since 4.1.0
- * @category Object
- * @param {Object} object The object to invert.
- * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
- * @returns {Object} Returns the new inverted object.
- * @example
- *
- * var object = { 'a': 1, 'b': 2, 'c': 1 };
- *
- * _.invertBy(object);
- * // => { '1': ['a', 'c'], '2': ['b'] }
- *
- * _.invertBy(object, function(value) {
- * return 'group' + value;
- * });
- * // => { 'group1': ['a', 'c'], 'group2': ['b'] }
- */
- var invertBy = createInverter(function(result, value, key) {
- if (value != null &&
- typeof value.toString != 'function') {
- value = nativeObjectToString.call(value);
- }
-
- if (hasOwnProperty.call(result, value)) {
- result[value].push(key);
- } else {
- result[value] = [key];
- }
- }, getIteratee);
-
- /**
- * Invokes the method at `path` of `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The object to query.
- * @param {Array|string} path The path of the method to invoke.
- * @param {...*} [args] The arguments to invoke the method with.
- * @returns {*} Returns the result of the invoked method.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };
- *
- * _.invoke(object, 'a[0].b.c.slice', 1, 3);
- * // => [2, 3]
- */
- var invoke = baseRest(baseInvoke);
-
- /**
- * Creates an array of the own enumerable property names of `object`.
- *
- * **Note:** Non-object values are coerced to objects. See the
- * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
- * for more details.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.keys(new Foo);
- * // => ['a', 'b'] (iteration order is not guaranteed)
- *
- * _.keys('hi');
- * // => ['0', '1']
- */
- function keys(object) {
- return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
- }
-
- /**
- * Creates an array of the own and inherited enumerable property names of `object`.
- *
- * **Note:** Non-object values are coerced to objects.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Object
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property names.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.keysIn(new Foo);
- * // => ['a', 'b', 'c'] (iteration order is not guaranteed)
- */
- function keysIn(object) {
- return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
- }
-
- /**
- * The opposite of `_.mapValues`; this method creates an object with the
- * same values as `object` and keys generated by running each own enumerable
- * string keyed property of `object` thru `iteratee`. The iteratee is invoked
- * with three arguments: (value, key, object).
- *
- * @static
- * @memberOf _
- * @since 3.8.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Object} Returns the new mapped object.
- * @see _.mapValues
- * @example
- *
- * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {
- * return key + value;
- * });
- * // => { 'a1': 1, 'b2': 2 }
- */
- function mapKeys(object, iteratee) {
- var result = {};
- iteratee = getIteratee(iteratee, 3);
-
- baseForOwn(object, function(value, key, object) {
- baseAssignValue(result, iteratee(value, key, object), value);
- });
- return result;
- }
-
- /**
- * Creates an object with the same keys as `object` and values generated
- * by running each own enumerable string keyed property of `object` thru
- * `iteratee`. The iteratee is invoked with three arguments:
- * (value, key, object).
- *
- * @static
- * @memberOf _
- * @since 2.4.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @returns {Object} Returns the new mapped object.
- * @see _.mapKeys
- * @example
- *
- * var users = {
- * 'fred': { 'user': 'fred', 'age': 40 },
- * 'pebbles': { 'user': 'pebbles', 'age': 1 }
- * };
- *
- * _.mapValues(users, function(o) { return o.age; });
- * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
- *
- * // The `_.property` iteratee shorthand.
- * _.mapValues(users, 'age');
- * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
- */
- function mapValues(object, iteratee) {
- var result = {};
- iteratee = getIteratee(iteratee, 3);
-
- baseForOwn(object, function(value, key, object) {
- baseAssignValue(result, key, iteratee(value, key, object));
- });
- return result;
- }
-
- /**
- * This method is like `_.assign` except that it recursively merges own and
- * inherited enumerable string keyed properties of source objects into the
- * destination object. Source properties that resolve to `undefined` are
- * skipped if a destination value exists. Array and plain object properties
- * are merged recursively. Other objects and value types are overridden by
- * assignment. Source objects are applied from left to right. Subsequent
- * sources overwrite property assignments of previous sources.
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 0.5.0
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} [sources] The source objects.
- * @returns {Object} Returns `object`.
- * @example
- *
- * var object = {
- * 'a': [{ 'b': 2 }, { 'd': 4 }]
- * };
- *
- * var other = {
- * 'a': [{ 'c': 3 }, { 'e': 5 }]
- * };
- *
- * _.merge(object, other);
- * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }
- */
- var merge = createAssigner(function(object, source, srcIndex) {
- baseMerge(object, source, srcIndex);
- });
-
- /**
- * This method is like `_.merge` except that it accepts `customizer` which
- * is invoked to produce the merged values of the destination and source
- * properties. If `customizer` returns `undefined`, merging is handled by the
- * method instead. The `customizer` is invoked with six arguments:
- * (objValue, srcValue, key, object, source, stack).
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The destination object.
- * @param {...Object} sources The source objects.
- * @param {Function} customizer The function to customize assigned values.
- * @returns {Object} Returns `object`.
- * @example
- *
- * function customizer(objValue, srcValue) {
- * if (_.isArray(objValue)) {
- * return objValue.concat(srcValue);
- * }
- * }
- *
- * var object = { 'a': [1], 'b': [2] };
- * var other = { 'a': [3], 'b': [4] };
- *
- * _.mergeWith(object, other, customizer);
- * // => { 'a': [1, 3], 'b': [2, 4] }
- */
- var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {
- baseMerge(object, source, srcIndex, customizer);
- });
-
- /**
- * The opposite of `_.pick`; this method creates an object composed of the
- * own and inherited enumerable property paths of `object` that are not omitted.
- *
- * **Note:** This method is considerably slower than `_.pick`.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The source object.
- * @param {...(string|string[])} [paths] The property paths to omit.
- * @returns {Object} Returns the new object.
- * @example
- *
- * var object = { 'a': 1, 'b': '2', 'c': 3 };
- *
- * _.omit(object, ['a', 'c']);
- * // => { 'b': '2' }
- */
- var omit = flatRest(function(object, paths) {
- var result = {};
- if (object == null) {
- return result;
- }
- var isDeep = false;
- paths = arrayMap(paths, function(path) {
- path = castPath(path, object);
- isDeep || (isDeep = path.length > 1);
- return path;
- });
- copyObject(object, getAllKeysIn(object), result);
- if (isDeep) {
- result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);
- }
- var length = paths.length;
- while (length--) {
- baseUnset(result, paths[length]);
- }
- return result;
- });
-
- /**
- * The opposite of `_.pickBy`; this method creates an object composed of
- * the own and inherited enumerable string keyed properties of `object` that
- * `predicate` doesn't return truthy for. The predicate is invoked with two
- * arguments: (value, key).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The source object.
- * @param {Function} [predicate=_.identity] The function invoked per property.
- * @returns {Object} Returns the new object.
- * @example
- *
- * var object = { 'a': 1, 'b': '2', 'c': 3 };
- *
- * _.omitBy(object, _.isNumber);
- * // => { 'b': '2' }
- */
- function omitBy(object, predicate) {
- return pickBy(object, negate(getIteratee(predicate)));
- }
-
- /**
- * Creates an object composed of the picked `object` properties.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The source object.
- * @param {...(string|string[])} [paths] The property paths to pick.
- * @returns {Object} Returns the new object.
- * @example
- *
- * var object = { 'a': 1, 'b': '2', 'c': 3 };
- *
- * _.pick(object, ['a', 'c']);
- * // => { 'a': 1, 'c': 3 }
- */
- var pick = flatRest(function(object, paths) {
- return object == null ? {} : basePick(object, paths);
- });
-
- /**
- * Creates an object composed of the `object` properties `predicate` returns
- * truthy for. The predicate is invoked with two arguments: (value, key).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The source object.
- * @param {Function} [predicate=_.identity] The function invoked per property.
- * @returns {Object} Returns the new object.
- * @example
- *
- * var object = { 'a': 1, 'b': '2', 'c': 3 };
- *
- * _.pickBy(object, _.isNumber);
- * // => { 'a': 1, 'c': 3 }
- */
- function pickBy(object, predicate) {
- if (object == null) {
- return {};
- }
- var props = arrayMap(getAllKeysIn(object), function(prop) {
- return [prop];
- });
- predicate = getIteratee(predicate);
- return basePickBy(object, props, function(value, path) {
- return predicate(value, path[0]);
- });
- }
-
- /**
- * This method is like `_.get` except that if the resolved value is a
- * function it's invoked with the `this` binding of its parent object and
- * its result is returned.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The object to query.
- * @param {Array|string} path The path of the property to resolve.
- * @param {*} [defaultValue] The value returned for `undefined` resolved values.
- * @returns {*} Returns the resolved value.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };
- *
- * _.result(object, 'a[0].b.c1');
- * // => 3
- *
- * _.result(object, 'a[0].b.c2');
- * // => 4
- *
- * _.result(object, 'a[0].b.c3', 'default');
- * // => 'default'
- *
- * _.result(object, 'a[0].b.c3', _.constant('default'));
- * // => 'default'
- */
- function result(object, path, defaultValue) {
- path = castPath(path, object);
-
- var index = -1,
- length = path.length;
-
- // Ensure the loop is entered when path is empty.
- if (!length) {
- length = 1;
- object = undefined;
- }
- while (++index < length) {
- var value = object == null ? undefined : object[toKey(path[index])];
- if (value === undefined) {
- index = length;
- value = defaultValue;
- }
- object = isFunction(value) ? value.call(object) : value;
- }
- return object;
- }
-
- /**
- * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
- * it's created. Arrays are created for missing index properties while objects
- * are created for all other missing properties. Use `_.setWith` to customize
- * `path` creation.
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 3.7.0
- * @category Object
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to set.
- * @param {*} value The value to set.
- * @returns {Object} Returns `object`.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': 3 } }] };
- *
- * _.set(object, 'a[0].b.c', 4);
- * console.log(object.a[0].b.c);
- * // => 4
- *
- * _.set(object, ['x', '0', 'y', 'z'], 5);
- * console.log(object.x[0].y.z);
- * // => 5
- */
- function set(object, path, value) {
- return object == null ? object : baseSet(object, path, value);
- }
-
- /**
- * This method is like `_.set` except that it accepts `customizer` which is
- * invoked to produce the objects of `path`. If `customizer` returns `undefined`
- * path creation is handled by the method instead. The `customizer` is invoked
- * with three arguments: (nsValue, key, nsObject).
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to set.
- * @param {*} value The value to set.
- * @param {Function} [customizer] The function to customize assigned values.
- * @returns {Object} Returns `object`.
- * @example
- *
- * var object = {};
- *
- * _.setWith(object, '[0][1]', 'a', Object);
- * // => { '0': { '1': 'a' } }
- */
- function setWith(object, path, value, customizer) {
- customizer = typeof customizer == 'function' ? customizer : undefined;
- return object == null ? object : baseSet(object, path, value, customizer);
- }
-
- /**
- * Creates an array of own enumerable string keyed-value pairs for `object`
- * which can be consumed by `_.fromPairs`. If `object` is a map or set, its
- * entries are returned.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @alias entries
- * @category Object
- * @param {Object} object The object to query.
- * @returns {Array} Returns the key-value pairs.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.toPairs(new Foo);
- * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)
- */
- var toPairs = createToPairs(keys);
-
- /**
- * Creates an array of own and inherited enumerable string keyed-value pairs
- * for `object` which can be consumed by `_.fromPairs`. If `object` is a map
- * or set, its entries are returned.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @alias entriesIn
- * @category Object
- * @param {Object} object The object to query.
- * @returns {Array} Returns the key-value pairs.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.toPairsIn(new Foo);
- * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)
- */
- var toPairsIn = createToPairs(keysIn);
-
- /**
- * An alternative to `_.reduce`; this method transforms `object` to a new
- * `accumulator` object which is the result of running each of its own
- * enumerable string keyed properties thru `iteratee`, with each invocation
- * potentially mutating the `accumulator` object. If `accumulator` is not
- * provided, a new object with the same `[[Prototype]]` will be used. The
- * iteratee is invoked with four arguments: (accumulator, value, key, object).
- * Iteratee functions may exit iteration early by explicitly returning `false`.
- *
- * @static
- * @memberOf _
- * @since 1.3.0
- * @category Object
- * @param {Object} object The object to iterate over.
- * @param {Function} [iteratee=_.identity] The function invoked per iteration.
- * @param {*} [accumulator] The custom accumulator value.
- * @returns {*} Returns the accumulated value.
- * @example
- *
- * _.transform([2, 3, 4], function(result, n) {
- * result.push(n *= n);
- * return n % 2 == 0;
- * }, []);
- * // => [4, 9]
- *
- * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
- * (result[value] || (result[value] = [])).push(key);
- * }, {});
- * // => { '1': ['a', 'c'], '2': ['b'] }
- */
- function transform(object, iteratee, accumulator) {
- var isArr = isArray(object),
- isArrLike = isArr || isBuffer(object) || isTypedArray(object);
-
- iteratee = getIteratee(iteratee, 4);
- if (accumulator == null) {
- var Ctor = object && object.constructor;
- if (isArrLike) {
- accumulator = isArr ? new Ctor : [];
- }
- else if (isObject(object)) {
- accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};
- }
- else {
- accumulator = {};
- }
- }
- (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {
- return iteratee(accumulator, value, index, object);
- });
- return accumulator;
- }
-
- /**
- * Removes the property at `path` of `object`.
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Object
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to unset.
- * @returns {boolean} Returns `true` if the property is deleted, else `false`.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': 7 } }] };
- * _.unset(object, 'a[0].b.c');
- * // => true
- *
- * console.log(object);
- * // => { 'a': [{ 'b': {} }] };
- *
- * _.unset(object, ['a', '0', 'b', 'c']);
- * // => true
- *
- * console.log(object);
- * // => { 'a': [{ 'b': {} }] };
- */
- function unset(object, path) {
- return object == null ? true : baseUnset(object, path);
- }
-
- /**
- * This method is like `_.set` except that accepts `updater` to produce the
- * value to set. Use `_.updateWith` to customize `path` creation. The `updater`
- * is invoked with one argument: (value).
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.6.0
- * @category Object
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to set.
- * @param {Function} updater The function to produce the updated value.
- * @returns {Object} Returns `object`.
- * @example
- *
- * var object = { 'a': [{ 'b': { 'c': 3 } }] };
- *
- * _.update(object, 'a[0].b.c', function(n) { return n * n; });
- * console.log(object.a[0].b.c);
- * // => 9
- *
- * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });
- * console.log(object.x[0].y.z);
- * // => 0
- */
- function update(object, path, updater) {
- return object == null ? object : baseUpdate(object, path, castFunction(updater));
- }
-
- /**
- * This method is like `_.update` except that it accepts `customizer` which is
- * invoked to produce the objects of `path`. If `customizer` returns `undefined`
- * path creation is handled by the method instead. The `customizer` is invoked
- * with three arguments: (nsValue, key, nsObject).
- *
- * **Note:** This method mutates `object`.
- *
- * @static
- * @memberOf _
- * @since 4.6.0
- * @category Object
- * @param {Object} object The object to modify.
- * @param {Array|string} path The path of the property to set.
- * @param {Function} updater The function to produce the updated value.
- * @param {Function} [customizer] The function to customize assigned values.
- * @returns {Object} Returns `object`.
- * @example
- *
- * var object = {};
- *
- * _.updateWith(object, '[0][1]', _.constant('a'), Object);
- * // => { '0': { '1': 'a' } }
- */
- function updateWith(object, path, updater, customizer) {
- customizer = typeof customizer == 'function' ? customizer : undefined;
- return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);
- }
-
- /**
- * Creates an array of the own enumerable string keyed property values of `object`.
- *
- * **Note:** Non-object values are coerced to objects.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category Object
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property values.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.values(new Foo);
- * // => [1, 2] (iteration order is not guaranteed)
- *
- * _.values('hi');
- * // => ['h', 'i']
- */
- function values(object) {
- return object == null ? [] : baseValues(object, keys(object));
- }
-
- /**
- * Creates an array of the own and inherited enumerable string keyed property
- * values of `object`.
- *
- * **Note:** Non-object values are coerced to objects.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category Object
- * @param {Object} object The object to query.
- * @returns {Array} Returns the array of property values.
- * @example
- *
- * function Foo() {
- * this.a = 1;
- * this.b = 2;
- * }
- *
- * Foo.prototype.c = 3;
- *
- * _.valuesIn(new Foo);
- * // => [1, 2, 3] (iteration order is not guaranteed)
- */
- function valuesIn(object) {
- return object == null ? [] : baseValues(object, keysIn(object));
- }
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Clamps `number` within the inclusive `lower` and `upper` bounds.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category Number
- * @param {number} number The number to clamp.
- * @param {number} [lower] The lower bound.
- * @param {number} upper The upper bound.
- * @returns {number} Returns the clamped number.
- * @example
- *
- * _.clamp(-10, -5, 5);
- * // => -5
- *
- * _.clamp(10, -5, 5);
- * // => 5
- */
- function clamp(number, lower, upper) {
- if (upper === undefined) {
- upper = lower;
- lower = undefined;
- }
- if (upper !== undefined) {
- upper = toNumber(upper);
- upper = upper === upper ? upper : 0;
- }
- if (lower !== undefined) {
- lower = toNumber(lower);
- lower = lower === lower ? lower : 0;
- }
- return baseClamp(toNumber(number), lower, upper);
- }
-
- /**
- * Checks if `n` is between `start` and up to, but not including, `end`. If
- * `end` is not specified, it's set to `start` with `start` then set to `0`.
- * If `start` is greater than `end` the params are swapped to support
- * negative ranges.
- *
- * @static
- * @memberOf _
- * @since 3.3.0
- * @category Number
- * @param {number} number The number to check.
- * @param {number} [start=0] The start of the range.
- * @param {number} end The end of the range.
- * @returns {boolean} Returns `true` if `number` is in the range, else `false`.
- * @see _.range, _.rangeRight
- * @example
- *
- * _.inRange(3, 2, 4);
- * // => true
- *
- * _.inRange(4, 8);
- * // => true
- *
- * _.inRange(4, 2);
- * // => false
- *
- * _.inRange(2, 2);
- * // => false
- *
- * _.inRange(1.2, 2);
- * // => true
- *
- * _.inRange(5.2, 4);
- * // => false
- *
- * _.inRange(-3, -2, -6);
- * // => true
- */
- function inRange(number, start, end) {
- start = toFinite(start);
- if (end === undefined) {
- end = start;
- start = 0;
- } else {
- end = toFinite(end);
- }
- number = toNumber(number);
- return baseInRange(number, start, end);
- }
-
- /**
- * Produces a random number between the inclusive `lower` and `upper` bounds.
- * If only one argument is provided a number between `0` and the given number
- * is returned. If `floating` is `true`, or either `lower` or `upper` are
- * floats, a floating-point number is returned instead of an integer.
- *
- * **Note:** JavaScript follows the IEEE-754 standard for resolving
- * floating-point values which can produce unexpected results.
- *
- * @static
- * @memberOf _
- * @since 0.7.0
- * @category Number
- * @param {number} [lower=0] The lower bound.
- * @param {number} [upper=1] The upper bound.
- * @param {boolean} [floating] Specify returning a floating-point number.
- * @returns {number} Returns the random number.
- * @example
- *
- * _.random(0, 5);
- * // => an integer between 0 and 5
- *
- * _.random(5);
- * // => also an integer between 0 and 5
- *
- * _.random(5, true);
- * // => a floating-point number between 0 and 5
- *
- * _.random(1.2, 5.2);
- * // => a floating-point number between 1.2 and 5.2
- */
- function random(lower, upper, floating) {
- if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {
- upper = floating = undefined;
- }
- if (floating === undefined) {
- if (typeof upper == 'boolean') {
- floating = upper;
- upper = undefined;
- }
- else if (typeof lower == 'boolean') {
- floating = lower;
- lower = undefined;
- }
- }
- if (lower === undefined && upper === undefined) {
- lower = 0;
- upper = 1;
- }
- else {
- lower = toFinite(lower);
- if (upper === undefined) {
- upper = lower;
- lower = 0;
- } else {
- upper = toFinite(upper);
- }
- }
- if (lower > upper) {
- var temp = lower;
- lower = upper;
- upper = temp;
- }
- if (floating || lower % 1 || upper % 1) {
- var rand = nativeRandom();
- return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);
- }
- return baseRandom(lower, upper);
- }
-
- /*------------------------------------------------------------------------*/
-
- /**
- * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to convert.
- * @returns {string} Returns the camel cased string.
- * @example
- *
- * _.camelCase('Foo Bar');
- * // => 'fooBar'
- *
- * _.camelCase('--foo-bar--');
- * // => 'fooBar'
- *
- * _.camelCase('__FOO_BAR__');
- * // => 'fooBar'
- */
- var camelCase = createCompounder(function(result, word, index) {
- word = word.toLowerCase();
- return result + (index ? capitalize(word) : word);
- });
-
- /**
- * Converts the first character of `string` to upper case and the remaining
- * to lower case.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to capitalize.
- * @returns {string} Returns the capitalized string.
- * @example
- *
- * _.capitalize('FRED');
- * // => 'Fred'
- */
- function capitalize(string) {
- return upperFirst(toString(string).toLowerCase());
- }
-
- /**
- * Deburrs `string` by converting
- * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)
- * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)
- * letters to basic Latin letters and removing
- * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to deburr.
- * @returns {string} Returns the deburred string.
- * @example
- *
- * _.deburr('déjà vu');
- * // => 'deja vu'
- */
- function deburr(string) {
- string = toString(string);
- return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');
- }
-
- /**
- * Checks if `string` ends with the given target string.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to inspect.
- * @param {string} [target] The string to search for.
- * @param {number} [position=string.length] The position to search up to.
- * @returns {boolean} Returns `true` if `string` ends with `target`,
- * else `false`.
- * @example
- *
- * _.endsWith('abc', 'c');
- * // => true
- *
- * _.endsWith('abc', 'b');
- * // => false
- *
- * _.endsWith('abc', 'b', 2);
- * // => true
- */
- function endsWith(string, target, position) {
- string = toString(string);
- target = baseToString(target);
-
- var length = string.length;
- position = position === undefined
- ? length
- : baseClamp(toInteger(position), 0, length);
-
- var end = position;
- position -= target.length;
- return position >= 0 && string.slice(position, end) == target;
- }
-
- /**
- * Converts the characters "&", "<", ">", '"', and "'" in `string` to their
- * corresponding HTML entities.
- *
- * **Note:** No other characters are escaped. To escape additional
- * characters use a third-party library like [_he_](https://mths.be/he).
- *
- * Though the ">" character is escaped for symmetry, characters like
- * ">" and "/" don't need escaping in HTML and have no special meaning
- * unless they're part of a tag or unquoted attribute value. See
- * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)
- * (under "semi-related fun fact") for more details.
- *
- * When working with HTML you should always
- * [quote attribute values](http://wonko.com/post/html-escaping) to reduce
- * XSS vectors.
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category String
- * @param {string} [string=''] The string to escape.
- * @returns {string} Returns the escaped string.
- * @example
- *
- * _.escape('fred, barney, & pebbles');
- * // => 'fred, barney, & pebbles'
- */
- function escape(string) {
- string = toString(string);
- return (string && reHasUnescapedHtml.test(string))
- ? string.replace(reUnescapedHtml, escapeHtmlChar)
- : string;
- }
-
- /**
- * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+",
- * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to escape.
- * @returns {string} Returns the escaped string.
- * @example
- *
- * _.escapeRegExp('[lodash](https://lodash.com/)');
- * // => '\[lodash\]\(https://lodash\.com/\)'
- */
- function escapeRegExp(string) {
- string = toString(string);
- return (string && reHasRegExpChar.test(string))
- ? string.replace(reRegExpChar, '\\$&')
- : string;
- }
-
- /**
- * Converts `string` to
- * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to convert.
- * @returns {string} Returns the kebab cased string.
- * @example
- *
- * _.kebabCase('Foo Bar');
- * // => 'foo-bar'
- *
- * _.kebabCase('fooBar');
- * // => 'foo-bar'
- *
- * _.kebabCase('__FOO_BAR__');
- * // => 'foo-bar'
- */
- var kebabCase = createCompounder(function(result, word, index) {
- return result + (index ? '-' : '') + word.toLowerCase();
- });
-
- /**
- * Converts `string`, as space separated words, to lower case.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category String
- * @param {string} [string=''] The string to convert.
- * @returns {string} Returns the lower cased string.
- * @example
- *
- * _.lowerCase('--Foo-Bar--');
- * // => 'foo bar'
- *
- * _.lowerCase('fooBar');
- * // => 'foo bar'
- *
- * _.lowerCase('__FOO_BAR__');
- * // => 'foo bar'
- */
- var lowerCase = createCompounder(function(result, word, index) {
- return result + (index ? ' ' : '') + word.toLowerCase();
- });
-
- /**
- * Converts the first character of `string` to lower case.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category String
- * @param {string} [string=''] The string to convert.
- * @returns {string} Returns the converted string.
- * @example
- *
- * _.lowerFirst('Fred');
- * // => 'fred'
- *
- * _.lowerFirst('FRED');
- * // => 'fRED'
- */
- var lowerFirst = createCaseFirst('toLowerCase');
-
- /**
- * Pads `string` on the left and right sides if it's shorter than `length`.
- * Padding characters are truncated if they can't be evenly divided by `length`.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to pad.
- * @param {number} [length=0] The padding length.
- * @param {string} [chars=' '] The string used as padding.
- * @returns {string} Returns the padded string.
- * @example
- *
- * _.pad('abc', 8);
- * // => ' abc '
- *
- * _.pad('abc', 8, '_-');
- * // => '_-abc_-_'
- *
- * _.pad('abc', 3);
- * // => 'abc'
- */
- function pad(string, length, chars) {
- string = toString(string);
- length = toInteger(length);
-
- var strLength = length ? stringSize(string) : 0;
- if (!length || strLength >= length) {
- return string;
- }
- var mid = (length - strLength) / 2;
- return (
- createPadding(nativeFloor(mid), chars) +
- string +
- createPadding(nativeCeil(mid), chars)
- );
- }
-
- /**
- * Pads `string` on the right side if it's shorter than `length`. Padding
- * characters are truncated if they exceed `length`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category String
- * @param {string} [string=''] The string to pad.
- * @param {number} [length=0] The padding length.
- * @param {string} [chars=' '] The string used as padding.
- * @returns {string} Returns the padded string.
- * @example
- *
- * _.padEnd('abc', 6);
- * // => 'abc '
- *
- * _.padEnd('abc', 6, '_-');
- * // => 'abc_-_'
- *
- * _.padEnd('abc', 3);
- * // => 'abc'
- */
- function padEnd(string, length, chars) {
- string = toString(string);
- length = toInteger(length);
-
- var strLength = length ? stringSize(string) : 0;
- return (length && strLength < length)
- ? (string + createPadding(length - strLength, chars))
- : string;
- }
-
- /**
- * Pads `string` on the left side if it's shorter than `length`. Padding
- * characters are truncated if they exceed `length`.
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category String
- * @param {string} [string=''] The string to pad.
- * @param {number} [length=0] The padding length.
- * @param {string} [chars=' '] The string used as padding.
- * @returns {string} Returns the padded string.
- * @example
- *
- * _.padStart('abc', 6);
- * // => ' abc'
- *
- * _.padStart('abc', 6, '_-');
- * // => '_-_abc'
- *
- * _.padStart('abc', 3);
- * // => 'abc'
- */
- function padStart(string, length, chars) {
- string = toString(string);
- length = toInteger(length);
-
- var strLength = length ? stringSize(string) : 0;
- return (length && strLength < length)
- ? (createPadding(length - strLength, chars) + string)
- : string;
- }
-
- /**
- * Converts `string` to an integer of the specified radix. If `radix` is
- * `undefined` or `0`, a `radix` of `10` is used unless `value` is a
- * hexadecimal, in which case a `radix` of `16` is used.
- *
- * **Note:** This method aligns with the
- * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.
- *
- * @static
- * @memberOf _
- * @since 1.1.0
- * @category String
- * @param {string} string The string to convert.
- * @param {number} [radix=10] The radix to interpret `value` by.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {number} Returns the converted integer.
- * @example
- *
- * _.parseInt('08');
- * // => 8
- *
- * _.map(['6', '08', '10'], _.parseInt);
- * // => [6, 8, 10]
- */
- function parseInt(string, radix, guard) {
- if (guard || radix == null) {
- radix = 0;
- } else if (radix) {
- radix = +radix;
- }
- return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);
- }
-
- /**
- * Repeats the given string `n` times.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to repeat.
- * @param {number} [n=1] The number of times to repeat the string.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {string} Returns the repeated string.
- * @example
- *
- * _.repeat('*', 3);
- * // => '***'
- *
- * _.repeat('abc', 2);
- * // => 'abcabc'
- *
- * _.repeat('abc', 0);
- * // => ''
- */
- function repeat(string, n, guard) {
- if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {
- n = 1;
- } else {
- n = toInteger(n);
- }
- return baseRepeat(toString(string), n);
- }
-
- /**
- * Replaces matches for `pattern` in `string` with `replacement`.
- *
- * **Note:** This method is based on
- * [`String#replace`](https://mdn.io/String/replace).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category String
- * @param {string} [string=''] The string to modify.
- * @param {RegExp|string} pattern The pattern to replace.
- * @param {Function|string} replacement The match replacement.
- * @returns {string} Returns the modified string.
- * @example
- *
- * _.replace('Hi Fred', 'Fred', 'Barney');
- * // => 'Hi Barney'
- */
- function replace() {
- var args = arguments,
- string = toString(args[0]);
-
- return args.length < 3 ? string : string.replace(args[1], args[2]);
- }
-
- /**
- * Converts `string` to
- * [snake case](https://en.wikipedia.org/wiki/Snake_case).
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to convert.
- * @returns {string} Returns the snake cased string.
- * @example
- *
- * _.snakeCase('Foo Bar');
- * // => 'foo_bar'
- *
- * _.snakeCase('fooBar');
- * // => 'foo_bar'
- *
- * _.snakeCase('--FOO-BAR--');
- * // => 'foo_bar'
- */
- var snakeCase = createCompounder(function(result, word, index) {
- return result + (index ? '_' : '') + word.toLowerCase();
- });
-
- /**
- * Splits `string` by `separator`.
- *
- * **Note:** This method is based on
- * [`String#split`](https://mdn.io/String/split).
- *
- * @static
- * @memberOf _
- * @since 4.0.0
- * @category String
- * @param {string} [string=''] The string to split.
- * @param {RegExp|string} separator The separator pattern to split by.
- * @param {number} [limit] The length to truncate results to.
- * @returns {Array} Returns the string segments.
- * @example
- *
- * _.split('a-b-c', '-', 2);
- * // => ['a', 'b']
- */
- function split(string, separator, limit) {
- if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {
- separator = limit = undefined;
- }
- limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;
- if (!limit) {
- return [];
- }
- string = toString(string);
- if (string && (
- typeof separator == 'string' ||
- (separator != null && !isRegExp(separator))
- )) {
- separator = baseToString(separator);
- if (!separator && hasUnicode(string)) {
- return castSlice(stringToArray(string), 0, limit);
- }
- }
- return string.split(separator, limit);
- }
-
- /**
- * Converts `string` to
- * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).
- *
- * @static
- * @memberOf _
- * @since 3.1.0
- * @category String
- * @param {string} [string=''] The string to convert.
- * @returns {string} Returns the start cased string.
- * @example
- *
- * _.startCase('--foo-bar--');
- * // => 'Foo Bar'
- *
- * _.startCase('fooBar');
- * // => 'Foo Bar'
- *
- * _.startCase('__FOO_BAR__');
- * // => 'FOO BAR'
- */
- var startCase = createCompounder(function(result, word, index) {
- return result + (index ? ' ' : '') + upperFirst(word);
- });
-
- /**
- * Checks if `string` starts with the given target string.
- *
- * @static
- * @memberOf _
- * @since 3.0.0
- * @category String
- * @param {string} [string=''] The string to inspect.
- * @param {string} [target] The string to search for.
- * @param {number} [position=0] The position to search from.
- * @returns {boolean} Returns `true` if `string` starts with `target`,
- * else `false`.
- * @example
- *
- * _.startsWith('abc', 'a');
- * // => true
- *
- * _.startsWith('abc', 'b');
- * // => false
- *
- * _.startsWith('abc', 'b', 1);
- * // => true
- */
- function startsWith(string, target, position) {
- string = toString(string);
- position = position == null
- ? 0
- : baseClamp(toInteger(position), 0, string.length);
-
- target = baseToString(target);
- return string.slice(position, position + target.length) == target;
- }
-
- /**
- * Creates a compiled template function that can interpolate data properties
- * in "interpolate" delimiters, HTML-escape interpolated data properties in
- * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data
- * properties may be accessed as free variables in the template. If a setting
- * object is given, it takes precedence over `_.templateSettings` values.
- *
- * **Note:** In the development build `_.template` utilizes
- * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)
- * for easier debugging.
- *
- * For more information on precompiling templates see
- * [lodash's custom builds documentation](https://lodash.com/custom-builds).
- *
- * For more information on Chrome extension sandboxes see
- * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).
- *
- * @static
- * @since 0.1.0
- * @memberOf _
- * @category String
- * @param {string} [string=''] The template string.
- * @param {Object} [options={}] The options object.
- * @param {RegExp} [options.escape=_.templateSettings.escape]
- * The HTML "escape" delimiter.
- * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]
- * The "evaluate" delimiter.
- * @param {Object} [options.imports=_.templateSettings.imports]
- * An object to import into the template as free variables.
- * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]
- * The "interpolate" delimiter.
- * @param {string} [options.sourceURL='lodash.templateSources[n]']
- * The sourceURL of the compiled template.
- * @param {string} [options.variable='obj']
- * The data object variable name.
- * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
- * @returns {Function} Returns the compiled template function.
- * @example
- *
- * // Use the "interpolate" delimiter to create a compiled template.
- * var compiled = _.template('hello <%= user %>!');
- * compiled({ 'user': 'fred' });
- * // => 'hello fred!'
- *
- * // Use the HTML "escape" delimiter to escape data property values.
- * var compiled = _.template('<%- value %>');
- * compiled({ 'value': '