diff --git a/.github/workflows/main.yml b/.github/workflows/main.yml index ce20badc5..d6b5331f2 100644 --- a/.github/workflows/main.yml +++ b/.github/workflows/main.yml @@ -1,5 +1,5 @@ name: Example workflow for Codecov -on: [push] +on: [push, pull_request] jobs: run: runs-on: ubuntu-latest diff --git a/dist/index.js b/dist/index.js index 04c8f1456..d6049baa2 100644 --- a/dist/index.js +++ b/dist/index.js @@ -34,7 +34,7 @@ module.exports = /******/ // the startup function /******/ function startup() { /******/ // Load entry module and return exports -/******/ return __webpack_require__(34); +/******/ return __webpack_require__(104); /******/ }; /******/ /******/ // run startup @@ -43,4169 +43,2555 @@ module.exports = /************************************************************************/ /******/ ({ -/***/ 4: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_pattern(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; - } - out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; - if ($isData) { - out += '' + ($schemaValue); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should match pattern "'; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + (it.util.escapeQuotes($schema)); - } - out += '"\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 16: -/***/ (function(module) { - -module.exports = require("tls"); - -/***/ }), - -/***/ 26: -/***/ (function(module) { +/***/ 9: +/***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; - -var hasOwn = Object.prototype.hasOwnProperty; -var toStr = Object.prototype.toString; -var defineProperty = Object.defineProperty; -var gOPD = Object.getOwnPropertyDescriptor; - -var isArray = function isArray(arr) { - if (typeof Array.isArray === 'function') { - return Array.isArray(arr); - } - - return toStr.call(arr) === '[object Array]'; -}; - -var isPlainObject = function isPlainObject(obj) { - if (!obj || toStr.call(obj) !== '[object Object]') { - return false; - } - - var hasOwnConstructor = hasOwn.call(obj, 'constructor'); - var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); - // Not own constructor property must be Object - if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { - return false; - } - - // Own properties are enumerated firstly, so to speed up, - // if last one is own, then all properties are own. - var key; - for (key in obj) { /**/ } - - return typeof key === 'undefined' || hasOwn.call(obj, key); -}; - -// If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target -var setProperty = function setProperty(target, options) { - if (defineProperty && options.name === '__proto__') { - defineProperty(target, options.name, { - enumerable: true, - configurable: true, - value: options.newValue, - writable: true - }); - } else { - target[options.name] = options.newValue; - } -}; - -// Return undefined instead of __proto__ if '__proto__' is not an own property -var getProperty = function getProperty(obj, name) { - if (name === '__proto__') { - if (!hasOwn.call(obj, name)) { - return void 0; - } else if (gOPD) { - // In early versions of node, obj['__proto__'] is buggy when obj has - // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. - return gOPD(obj, name).value; - } - } - - return obj[name]; -}; - -module.exports = function extend() { - var options, name, src, copy, copyIsArray, clone; - var target = arguments[0]; - var i = 1; - var length = arguments.length; - var deep = false; - - // Handle a deep copy situation - if (typeof target === 'boolean') { - deep = target; - target = arguments[1] || {}; - // skip the boolean and the target - i = 2; - } - if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { - target = {}; - } - - for (; i < length; ++i) { - options = arguments[i]; - // Only deal with non-null/undefined values - if (options != null) { - // Extend the base object - for (name in options) { - src = getProperty(target, name); - copy = getProperty(options, name); - - // Prevent never-ending loop - if (target !== copy) { - // Recurse if we're merging plain objects or arrays - if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { - if (copyIsArray) { - copyIsArray = false; - clone = src && isArray(src) ? src : []; - } else { - clone = src && isPlainObject(src) ? src : {}; - } - - // Never move original objects, clone them - setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); - - // Don't bring in undefined values - } else if (typeof copy !== 'undefined') { - setProperty(target, { name: name, newValue: copy }); - } - } - } - } - } - - // Return the modified object - return target; +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); }; - - -/***/ }), - -/***/ 34: -/***/ (function(__unusedmodule, __unusedexports, __webpack_require__) { - -const core = __webpack_require__(310); -const exec = __webpack_require__(230); -const request = __webpack_require__(958); -const fs = __webpack_require__(747); - -let fail_ci; -try { - const name = core.getInput("name"); - const token = core.getInput("token"); - const flags = core.getInput("flags"); - const file = core.getInput("file"); - const yml = core.getInput("yml"); - fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); - - if ( - fail_ci === "yes" || - fail_ci === "y" || - fail_ci === "true" || - fail_ci === "t" || - fail_ci === "1" - ) { - fail_ci = true; - } else { - fail_ci = false; - } - - request("https://codecov.io/bash", (error, response, body) => { - if (error && fail_ci) { - throw error; - } else if (error) { - core.warning(`Codecov warning: ${error.message}`); +Object.defineProperty(exports, "__esModule", { value: true }); +const os = __webpack_require__(87); +const events = __webpack_require__(614); +const child = __webpack_require__(129); +/* eslint-disable @typescript-eslint/unbound-method */ +const IS_WINDOWS = process.platform === 'win32'; +/* + * Class for running command line tools. Handles quoting and arg parsing in a platform agnostic way. + */ +class ToolRunner extends events.EventEmitter { + constructor(toolPath, args, options) { + super(); + if (!toolPath) { + throw new Error("Parameter 'toolPath' cannot be null or empty."); + } + this.toolPath = toolPath; + this.args = args || []; + this.options = options || {}; } - - fs.writeFile("codecov.sh", body, err => { - if (err && fail_ci) { - throw err; - } else if (err) { - core.warning(`Codecov warning: ${err.message}`); - } - - let output = ""; - let execError = ""; - const options = {}; - options.listeners = { - stdout: data => { - output += data.toString(); - }, - stderr: data => { - execError += data.toString(); + _debug(message) { + if (this.options.listeners && this.options.listeners.debug) { + this.options.listeners.debug(message); } - }; - - options.env = { - CODECOV_TOKEN: `${token}`, - GITHUB_ACTION: process.env.GITHUB_ACTION, - GITHUB_REF: process.env.GITHUB_REF, - GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, - GITHUB_SHA: process.env.GITHUB_SHA - }; - - if (file) { - if (fail_ci) { - exec - .exec( - "bash", - [ - "codecov.sh", - "-f", - `${file}`, - "-n", - `${name}`, - "-F", - `${flags}`, - "-y", - `${yml}`, - "-Z" - ], - options - ) - .catch(err => { - core.setFailed( - `Codecov failed with the following error: ${err.message}` - ); - }) - .then(() => { - unlinkFile(); - }); - } else { - exec - .exec( - "bash", - [ - "codecov.sh", - "-f", - `${file}`, - "-n", - `${name}`, - "-F", - `${flags}`, - "-y", - `${yml}` - ], - options - ) - .catch(err => { - core.warning(`Codecov warning: ${err.message}`); - }) - .then(() => { - unlinkFile(); - }); + } + _getCommandString(options, noPrefix) { + const toolPath = this._getSpawnFileName(); + const args = this._getSpawnArgs(options); + let cmd = noPrefix ? '' : '[command]'; // omit prefix when piped to a second tool + if (IS_WINDOWS) { + // Windows + cmd file + if (this._isCmdFile()) { + cmd += toolPath; + for (const a of args) { + cmd += ` ${a}`; + } + } + // Windows + verbatim + else if (options.windowsVerbatimArguments) { + cmd += `"${toolPath}"`; + for (const a of args) { + cmd += ` ${a}`; + } + } + // Windows (regular) + else { + cmd += this._windowsQuoteCmdArg(toolPath); + for (const a of args) { + cmd += ` ${this._windowsQuoteCmdArg(a)}`; + } + } } - } else { - if (fail_ci) { - exec - .exec( - "bash", - [ - "codecov.sh", - "-n", - `${name}`, - "-F", - `${flags}`, - "-y", - `${yml}`, - "-Z" - ], - options - ) - .catch(err => { - core.setFailed( - `Codecov failed with the following error: ${err.message}` - ); - }) - .then(() => { - unlinkFile(); - }); - } else { - exec - .exec( - "bash", - ["codecov.sh", "-n", `${name}`, "-F", `${flags}`, "-y", `${yml}`], - options - ) - .catch(err => { - core.warning(`Codecov warning: ${err.message}`); - }) - .then(() => { - unlinkFile(); - }); + else { + // OSX/Linux - this can likely be improved with some form of quoting. + // creating processes on Unix is fundamentally different than Windows. + // on Unix, execvp() takes an arg array. + cmd += toolPath; + for (const a of args) { + cmd += ` ${a}`; + } } - } - - const unlinkFile = () => { - fs.unlink("codecov.sh", err => { - if (err && fail_ci) { - throw err; - } else if (err) { - core.warning(`Codecov warning: ${err.message}`); - } - }); - }; - }); - }); -} catch (error) { - if (fail_ci) { - core.setFailed(`Codecov failed with the following error: ${error.message}`); - } else { - core.warning(`Codecov warning: ${error.message}`); - } -} - - -/***/ }), - -/***/ 36: -/***/ (function(module, exports) { - -(function(){ - - // Copyright (c) 2005 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Basic JavaScript BN library - subset useful for RSA encryption. - - // Bits per digit - var dbits; - - // JavaScript engine analysis - var canary = 0xdeadbeefcafe; - var j_lm = ((canary&0xffffff)==0xefcafe); - - // (public) Constructor - function BigInteger(a,b,c) { - if(a != null) - if("number" == typeof a) this.fromNumber(a,b,c); - else if(b == null && "string" != typeof a) this.fromString(a,256); - else this.fromString(a,b); - } - - // return new, unset BigInteger - function nbi() { return new BigInteger(null); } - - // am: Compute w_j += (x*this_i), propagate carries, - // c is initial carry, returns final carry. - // c < 3*dvalue, x < 2*dvalue, this_i < dvalue - // We need to select the fastest one that works in this environment. - - // am1: use a single mult and divide to get the high bits, - // max digit bits should be 26 because - // max internal value = 2*dvalue^2-2*dvalue (< 2^53) - function am1(i,x,w,j,c,n) { - while(--n >= 0) { - var v = x*this[i++]+w[j]+c; - c = Math.floor(v/0x4000000); - w[j++] = v&0x3ffffff; - } - return c; + return cmd; } - // am2 avoids a big mult-and-extract completely. - // Max digit bits should be <= 30 because we do bitwise ops - // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) - function am2(i,x,w,j,c,n) { - var xl = x&0x7fff, xh = x>>15; - while(--n >= 0) { - var l = this[i]&0x7fff; - var h = this[i++]>>15; - var m = xh*l+h*xl; - l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); - c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); - w[j++] = l&0x3fffffff; - } - return c; + _processLineBuffer(data, strBuffer, onLine) { + try { + let s = strBuffer + data.toString(); + let n = s.indexOf(os.EOL); + while (n > -1) { + const line = s.substring(0, n); + onLine(line); + // the rest of the string ... + s = s.substring(n + os.EOL.length); + n = s.indexOf(os.EOL); + } + strBuffer = s; + } + catch (err) { + // streaming lines to console is best effort. Don't fail a build. + this._debug(`error processing line. Failed with error ${err}`); + } } - // Alternately, set max digit bits to 28 since some - // browsers slow down when dealing with 32-bit numbers. - function am3(i,x,w,j,c,n) { - var xl = x&0x3fff, xh = x>>14; - while(--n >= 0) { - var l = this[i]&0x3fff; - var h = this[i++]>>14; - var m = xh*l+h*xl; - l = xl*l+((m&0x3fff)<<14)+w[j]+c; - c = (l>>28)+(m>>14)+xh*h; - w[j++] = l&0xfffffff; - } - return c; + _getSpawnFileName() { + if (IS_WINDOWS) { + if (this._isCmdFile()) { + return process.env['COMSPEC'] || 'cmd.exe'; + } + } + return this.toolPath; } - var inBrowser = typeof navigator !== "undefined"; - if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { - BigInteger.prototype.am = am2; - dbits = 30; + _getSpawnArgs(options) { + if (IS_WINDOWS) { + if (this._isCmdFile()) { + let argline = `/D /S /C "${this._windowsQuoteCmdArg(this.toolPath)}`; + for (const a of this.args) { + argline += ' '; + argline += options.windowsVerbatimArguments + ? a + : this._windowsQuoteCmdArg(a); + } + argline += '"'; + return [argline]; + } + } + return this.args; } - else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { - BigInteger.prototype.am = am1; - dbits = 26; + _endsWith(str, end) { + return str.endsWith(end); } - else { // Mozilla/Netscape seems to prefer am3 - BigInteger.prototype.am = am3; - dbits = 28; + _isCmdFile() { + const upperToolPath = this.toolPath.toUpperCase(); + return (this._endsWith(upperToolPath, '.CMD') || + this._endsWith(upperToolPath, '.BAT')); } - - BigInteger.prototype.DB = dbits; - BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; - r.t = this.t; - r.s = this.s; - } - - // (protected) set from integer value x, -DV <= x < DV - function bnpFromInt(x) { - this.t = 1; - this.s = (x<0)?-1:0; - if(x > 0) this[0] = x; - else if(x < -1) this[0] = x+this.DV; - else this.t = 0; + _windowsQuoteCmdArg(arg) { + // for .exe, apply the normal quoting rules that libuv applies + if (!this._isCmdFile()) { + return this._uvQuoteCmdArg(arg); + } + // otherwise apply quoting rules specific to the cmd.exe command line parser. + // the libuv rules are generic and are not designed specifically for cmd.exe + // command line parser. + // + // for a detailed description of the cmd.exe command line parser, refer to + // http://stackoverflow.com/questions/4094699/how-does-the-windows-command-interpreter-cmd-exe-parse-scripts/7970912#7970912 + // need quotes for empty arg + if (!arg) { + return '""'; + } + // determine whether the arg needs to be quoted + const cmdSpecialChars = [ + ' ', + '\t', + '&', + '(', + ')', + '[', + ']', + '{', + '}', + '^', + '=', + ';', + '!', + "'", + '+', + ',', + '`', + '~', + '|', + '<', + '>', + '"' + ]; + let needsQuotes = false; + for (const char of arg) { + if (cmdSpecialChars.some(x => x === char)) { + needsQuotes = true; + break; + } + } + // short-circuit if quotes not needed + if (!needsQuotes) { + return arg; + } + // the following quoting rules are very similar to the rules that by libuv applies. + // + // 1) wrap the string in quotes + // + // 2) double-up quotes - i.e. " => "" + // + // this is different from the libuv quoting rules. libuv replaces " with \", which unfortunately + // doesn't work well with a cmd.exe command line. + // + // note, replacing " with "" also works well if the arg is passed to a downstream .NET console app. + // for example, the command line: + // foo.exe "myarg:""my val""" + // is parsed by a .NET console app into an arg array: + // [ "myarg:\"my val\"" ] + // which is the same end result when applying libuv quoting rules. although the actual + // command line from libuv quoting rules would look like: + // foo.exe "myarg:\"my val\"" + // + // 3) double-up slashes that precede a quote, + // e.g. hello \world => "hello \world" + // hello\"world => "hello\\""world" + // hello\\"world => "hello\\\\""world" + // hello world\ => "hello world\\" + // + // technically this is not required for a cmd.exe command line, or the batch argument parser. + // the reasons for including this as a .cmd quoting rule are: + // + // a) this is optimized for the scenario where the argument is passed from the .cmd file to an + // external program. many programs (e.g. .NET console apps) rely on the slash-doubling rule. + // + // b) it's what we've been doing previously (by deferring to node default behavior) and we + // haven't heard any complaints about that aspect. + // + // note, a weakness of the quoting rules chosen here, is that % is not escaped. in fact, % cannot be + // escaped when used on the command line directly - even though within a .cmd file % can be escaped + // by using %%. + // + // the saving grace is, on the command line, %var% is left as-is if var is not defined. this contrasts + // the line parsing rules within a .cmd file, where if var is not defined it is replaced with nothing. + // + // one option that was explored was replacing % with ^% - i.e. %var% => ^%var^%. this hack would + // often work, since it is unlikely that var^ would exist, and the ^ character is removed when the + // variable is used. the problem, however, is that ^ is not removed when %* is used to pass the args + // to an external program. + // + // an unexplored potential solution for the % escaping problem, is to create a wrapper .cmd file. + // % can be escaped within a .cmd file. + let reverse = '"'; + let quoteHit = true; + for (let i = arg.length; i > 0; i--) { + // walk the string in reverse + reverse += arg[i - 1]; + if (quoteHit && arg[i - 1] === '\\') { + reverse += '\\'; // double the slash + } + else if (arg[i - 1] === '"') { + quoteHit = true; + reverse += '"'; // double the quote + } + else { + quoteHit = false; + } + } + reverse += '"'; + return reverse + .split('') + .reverse() + .join(''); } - - // return bigint initialized to value - function nbv(i) { var r = nbi(); r.fromInt(i); return r; } - - // (protected) set from string and radix - function bnpFromString(s,b) { - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 256) k = 8; // byte array - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else { this.fromRadix(s,b); return; } - this.t = 0; - this.s = 0; - var i = s.length, mi = false, sh = 0; - while(--i >= 0) { - var x = (k==8)?s[i]&0xff:intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-") mi = true; - continue; + _uvQuoteCmdArg(arg) { + // Tool runner wraps child_process.spawn() and needs to apply the same quoting as + // Node in certain cases where the undocumented spawn option windowsVerbatimArguments + // is used. + // + // Since this function is a port of quote_cmd_arg from Node 4.x (technically, lib UV, + // see https://github.com/nodejs/node/blob/v4.x/deps/uv/src/win/process.c for details), + // pasting copyright notice from Node within this function: + // + // Copyright Joyent, Inc. and other Node contributors. All rights reserved. + // + // Permission is hereby granted, free of charge, to any person obtaining a copy + // of this software and associated documentation files (the "Software"), to + // deal in the Software without restriction, including without limitation the + // rights to use, copy, modify, merge, publish, distribute, sublicense, and/or + // sell copies of the Software, and to permit persons to whom the Software is + // furnished to do so, subject to the following conditions: + // + // The above copyright notice and this permission notice shall be included in + // all copies or substantial portions of the Software. + // + // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + // IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + // FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + // AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + // LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + // FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS + // IN THE SOFTWARE. + if (!arg) { + // Need double quotation for empty argument + return '""'; } - mi = false; - if(sh == 0) - this[this.t++] = x; - else if(sh+k > this.DB) { - this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); + if (!arg.includes(' ') && !arg.includes('\t') && !arg.includes('"')) { + // No quotation needed + return arg; } - else - this[this.t-1] |= x<= this.DB) sh -= this.DB; - } - if(k == 8 && (s[0]&0x80) != 0) { - this.s = -1; - if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0; i--) { + // walk the string in reverse + reverse += arg[i - 1]; + if (quoteHit && arg[i - 1] === '\\') { + reverse += '\\'; + } + else if (arg[i - 1] === '"') { + quoteHit = true; + reverse += '\\'; + } + else { + quoteHit = false; + } + } + reverse += '"'; + return reverse + .split('') + .reverse() + .join(''); } - - // (protected) clamp off excess high words - function bnpClamp() { - var c = this.s&this.DM; - while(this.t > 0 && this[this.t-1] == c) --this.t; + _cloneExecOptions(options) { + options = options || {}; + const result = { + cwd: options.cwd || process.cwd(), + env: options.env || process.env, + silent: options.silent || false, + windowsVerbatimArguments: options.windowsVerbatimArguments || false, + failOnStdErr: options.failOnStdErr || false, + ignoreReturnCode: options.ignoreReturnCode || false, + delay: options.delay || 10000 + }; + result.outStream = options.outStream || process.stdout; + result.errStream = options.errStream || process.stderr; + return result; } - - // (public) return string representation in given radix - function bnToString(b) { - if(this.s < 0) return "-"+this.negate().toString(b); - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else return this.toRadix(b); - var km = (1< 0) { - if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } - while(i >= 0) { - if(p < k) { - d = (this[i]&((1<>(p+=this.DB-k); - } - else { - d = (this[i]>>(p-=k))&km; - if(p <= 0) { p += this.DB; --i; } - } - if(d > 0) m = true; - if(m) r += int2char(d); + _getSpawnOptions(options, toolPath) { + options = options || {}; + const result = {}; + result.cwd = options.cwd; + result.env = options.env; + result['windowsVerbatimArguments'] = + options.windowsVerbatimArguments || this._isCmdFile(); + if (options.windowsVerbatimArguments) { + result.argv0 = `"${toolPath}"`; } - } - return m?r:"0"; - } - - // (public) -this - function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } - - // (public) |this| - function bnAbs() { return (this.s<0)?this.negate():this; } - - // (public) return + if this > a, - if this < a, 0 if equal - function bnCompareTo(a) { - var r = this.s-a.s; - if(r != 0) return r; - var i = this.t; - r = i-a.t; - if(r != 0) return (this.s<0)?-r:r; - while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; - return 0; + return result; } - - // returns bit length of the integer x - function nbits(x) { - var r = 1, t; - if((t=x>>>16) != 0) { x = t; r += 16; } - if((t=x>>8) != 0) { x = t; r += 8; } - if((t=x>>4) != 0) { x = t; r += 4; } - if((t=x>>2) != 0) { x = t; r += 2; } - if((t=x>>1) != 0) { x = t; r += 1; } - return r; + /** + * Exec a tool. + * Output will be streamed to the live console. + * Returns promise with return code + * + * @param tool path to tool to exec + * @param options optional exec options. See ExecOptions + * @returns number + */ + exec() { + return __awaiter(this, void 0, void 0, function* () { + return new Promise((resolve, reject) => { + this._debug(`exec tool: ${this.toolPath}`); + this._debug('arguments:'); + for (const arg of this.args) { + this._debug(` ${arg}`); + } + const optionsNonNull = this._cloneExecOptions(this.options); + if (!optionsNonNull.silent && optionsNonNull.outStream) { + optionsNonNull.outStream.write(this._getCommandString(optionsNonNull) + os.EOL); + } + const state = new ExecState(optionsNonNull, this.toolPath); + state.on('debug', (message) => { + this._debug(message); + }); + const fileName = this._getSpawnFileName(); + const cp = child.spawn(fileName, this._getSpawnArgs(optionsNonNull), this._getSpawnOptions(this.options, fileName)); + const stdbuffer = ''; + if (cp.stdout) { + cp.stdout.on('data', (data) => { + if (this.options.listeners && this.options.listeners.stdout) { + this.options.listeners.stdout(data); + } + if (!optionsNonNull.silent && optionsNonNull.outStream) { + optionsNonNull.outStream.write(data); + } + this._processLineBuffer(data, stdbuffer, (line) => { + if (this.options.listeners && this.options.listeners.stdline) { + this.options.listeners.stdline(line); + } + }); + }); + } + const errbuffer = ''; + if (cp.stderr) { + cp.stderr.on('data', (data) => { + state.processStderr = true; + if (this.options.listeners && this.options.listeners.stderr) { + this.options.listeners.stderr(data); + } + if (!optionsNonNull.silent && + optionsNonNull.errStream && + optionsNonNull.outStream) { + const s = optionsNonNull.failOnStdErr + ? optionsNonNull.errStream + : optionsNonNull.outStream; + s.write(data); + } + this._processLineBuffer(data, errbuffer, (line) => { + if (this.options.listeners && this.options.listeners.errline) { + this.options.listeners.errline(line); + } + }); + }); + } + cp.on('error', (err) => { + state.processError = err.message; + state.processExited = true; + state.processClosed = true; + state.CheckComplete(); + }); + cp.on('exit', (code) => { + state.processExitCode = code; + state.processExited = true; + this._debug(`Exit code ${code} received from tool '${this.toolPath}'`); + state.CheckComplete(); + }); + cp.on('close', (code) => { + state.processExitCode = code; + state.processExited = true; + state.processClosed = true; + this._debug(`STDIO streams have closed for tool '${this.toolPath}'`); + state.CheckComplete(); + }); + state.on('done', (error, exitCode) => { + if (stdbuffer.length > 0) { + this.emit('stdline', stdbuffer); + } + if (errbuffer.length > 0) { + this.emit('errline', errbuffer); + } + cp.removeAllListeners(); + if (error) { + reject(error); + } + else { + resolve(exitCode); + } + }); + }); + }); } - - // (public) return the number of bits in "this" - function bnBitLength() { - if(this.t <= 0) return 0; - return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); +} +exports.ToolRunner = ToolRunner; +/** + * Convert an arg string to an array of args. Handles escaping + * + * @param argString string of arguments + * @returns string[] array of arguments + */ +function argStringToArray(argString) { + const args = []; + let inQuotes = false; + let escaped = false; + let arg = ''; + function append(c) { + // we only escape double quotes. + if (escaped && c !== '"') { + arg += '\\'; + } + arg += c; + escaped = false; } - - // (protected) r = this << n*DB - function bnpDLShiftTo(n,r) { - var i; - for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; - for(i = n-1; i >= 0; --i) r[i] = 0; - r.t = this.t+n; - r.s = this.s; + for (let i = 0; i < argString.length; i++) { + const c = argString.charAt(i); + if (c === '"') { + if (!escaped) { + inQuotes = !inQuotes; + } + else { + append(c); + } + continue; + } + if (c === '\\' && escaped) { + append(c); + continue; + } + if (c === '\\' && inQuotes) { + escaped = true; + continue; + } + if (c === ' ' && !inQuotes) { + if (arg.length > 0) { + args.push(arg); + arg = ''; + } + continue; + } + append(c); } - - // (protected) r = this >> n*DB - function bnpDRShiftTo(n,r) { - for(var i = n; i < this.t; ++i) r[i-n] = this[i]; - r.t = Math.max(this.t-n,0); - r.s = this.s; + if (arg.length > 0) { + args.push(arg.trim()); } - - // (protected) r = this << n - function bnpLShiftTo(n,r) { - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<= 0; --i) { - r[i+ds+1] = (this[i]>>cbs)|c; - c = (this[i]&bm)<= 0; --i) r[i] = 0; - r[ds] = c; - r.t = this.t+ds+1; - r.s = this.s; - r.clamp(); - } - - // (protected) r = this >> n - function bnpRShiftTo(n,r) { - r.s = this.s; - var ds = Math.floor(n/this.DB); - if(ds >= this.t) { r.t = 0; return; } - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<>bs; - for(var i = ds+1; i < this.t; ++i) { - r[i-ds-1] |= (this[i]&bm)<>bs; - } - if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; - } - if(a.t < this.t) { - c -= a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c -= a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c -= a.s; - } - r.s = (c<0)?-1:0; - if(c < -1) r[i++] = this.DV+c; - else if(c > 0) r[i++] = c; - r.t = i; - r.clamp(); - } - - // (protected) r = this * a, r != this,a (HAC 14.12) - // "this" should be the larger one if appropriate. - function bnpMultiplyTo(a,r) { - var x = this.abs(), y = a.abs(); - var i = x.t; - r.t = i+y.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); - r.s = 0; - r.clamp(); - if(this.s != a.s) BigInteger.ZERO.subTo(r,r); - } - - // (protected) r = this^2, r != this (HAC 14.16) - function bnpSquareTo(r) { - var x = this.abs(); - var i = r.t = 2*x.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < x.t-1; ++i) { - var c = x.am(i,x[i],r,2*i,0,1); - if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { - r[i+x.t] -= x.DV; - r[i+x.t+1] = 1; + return args; +} +exports.argStringToArray = argStringToArray; +class ExecState extends events.EventEmitter { + constructor(options, toolPath) { + super(); + this.processClosed = false; // tracks whether the process has exited and stdio is closed + this.processError = ''; + this.processExitCode = 0; + this.processExited = false; // tracks whether the process has exited + this.processStderr = false; // tracks whether stderr was written to + this.delay = 10000; // 10 seconds + this.done = false; + this.timeout = null; + if (!toolPath) { + throw new Error('toolPath must not be empty'); } - } - if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); - r.s = 0; - r.clamp(); - } - - // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) - // r != q, this != m. q or r may be null. - function bnpDivRemTo(m,q,r) { - var pm = m.abs(); - if(pm.t <= 0) return; - var pt = this.abs(); - if(pt.t < pm.t) { - if(q != null) q.fromInt(0); - if(r != null) this.copyTo(r); - return; - } - if(r == null) r = nbi(); - var y = nbi(), ts = this.s, ms = m.s; - var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus - if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } - else { pm.copyTo(y); pt.copyTo(r); } - var ys = y.t; - var y0 = y[ys-1]; - if(y0 == 0) return; - var yt = y0*(1<1)?y[ys-2]>>this.F2:0); - var d1 = this.FV/yt, d2 = (1<= 0) { - r[r.t++] = 1; - r.subTo(t,r); - } - BigInteger.ONE.dlShiftTo(ys,t); - t.subTo(y,y); // "negative" y so we can replace sub with am later - while(y.t < ys) y[y.t++] = 0; - while(--j >= 0) { - // Estimate quotient digit - var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); - if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out - y.dlShiftTo(j,t); - r.subTo(t,r); - while(r[i] < --qd) r.subTo(t,r); + this.options = options; + this.toolPath = toolPath; + if (options.delay) { + this.delay = options.delay; } - } - if(q != null) { - r.drShiftTo(ys,q); - if(ts != ms) BigInteger.ZERO.subTo(q,q); - } - r.t = ys; - r.clamp(); - if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder - if(ts < 0) BigInteger.ZERO.subTo(r,r); - } - - // (public) this mod a - function bnMod(a) { - var r = nbi(); - this.abs().divRemTo(a,null,r); - if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); - return r; - } - - // Modular reduction using "classic" algorithm - function Classic(m) { this.m = m; } - function cConvert(x) { - if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); - else return x; - } - function cRevert(x) { return x; } - function cReduce(x) { x.divRemTo(this.m,null,x); } - function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - Classic.prototype.convert = cConvert; - Classic.prototype.revert = cRevert; - Classic.prototype.reduce = cReduce; - Classic.prototype.mulTo = cMulTo; - Classic.prototype.sqrTo = cSqrTo; - - // (protected) return "-1/this % 2^DB"; useful for Mont. reduction - // justification: - // xy == 1 (mod m) - // xy = 1+km - // xy(2-xy) = (1+km)(1-km) - // x[y(2-xy)] = 1-k^2m^2 - // x[y(2-xy)] == 1 (mod m^2) - // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 - // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. - // JS multiply "overflows" differently from C/C++, so care is needed here. - function bnpInvDigit() { - if(this.t < 1) return 0; - var x = this[0]; - if((x&1) == 0) return 0; - var y = x&3; // y == 1/x mod 2^2 - y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 - y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 - y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 - // last step - calculate inverse mod DV directly; - // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints - y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits - // we really want the negative inverse, and -DV < y < DV - return (y>0)?this.DV-y:-y; - } - - // Montgomery reduction - function Montgomery(m) { - this.m = m; - this.mp = m.invDigit(); - this.mpl = this.mp&0x7fff; - this.mph = this.mp>>15; - this.um = (1<<(m.DB-15))-1; - this.mt2 = 2*m.t; - } - - // xR mod m - function montConvert(x) { - var r = nbi(); - x.abs().dlShiftTo(this.m.t,r); - r.divRemTo(this.m,null,r); - if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); - return r; - } - - // x/R mod m - function montRevert(x) { - var r = nbi(); - x.copyTo(r); - this.reduce(r); - return r; - } - - // x = x/R mod m (HAC 14.32) - function montReduce(x) { - while(x.t <= this.mt2) // pad x so am has enough room later - x[x.t++] = 0; - for(var i = 0; i < this.m.t; ++i) { - // faster way of calculating u0 = x[i]*mp mod DV - var j = x[i]&0x7fff; - var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; - // use am to combine the multiply-shift-add into one call - j = i+this.m.t; - x[j] += this.m.am(0,u0,x,i,0,this.m.t); - // propagate carry - while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } - } - x.clamp(); - x.drShiftTo(this.m.t,x); - if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } - - // r = "x^2/R mod m"; x != r - function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = "xy/R mod m"; x,y != r - function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Montgomery.prototype.convert = montConvert; - Montgomery.prototype.revert = montRevert; - Montgomery.prototype.reduce = montReduce; - Montgomery.prototype.mulTo = montMulTo; - Montgomery.prototype.sqrTo = montSqrTo; - - // (protected) true iff this is even - function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } - - // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) - function bnpExp(e,z) { - if(e > 0xffffffff || e < 1) return BigInteger.ONE; - var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; - g.copyTo(r); - while(--i >= 0) { - z.sqrTo(r,r2); - if((e&(1< 0) z.mulTo(r2,g,r); - else { var t = r; r = r2; r2 = t; } - } - return z.revert(r); - } - - // (public) this^e % m, 0 <= e < 2^32 - function bnModPowInt(e,m) { - var z; - if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); - return this.exp(e,z); - } - - // protected - BigInteger.prototype.copyTo = bnpCopyTo; - BigInteger.prototype.fromInt = bnpFromInt; - BigInteger.prototype.fromString = bnpFromString; - BigInteger.prototype.clamp = bnpClamp; - BigInteger.prototype.dlShiftTo = bnpDLShiftTo; - BigInteger.prototype.drShiftTo = bnpDRShiftTo; - BigInteger.prototype.lShiftTo = bnpLShiftTo; - BigInteger.prototype.rShiftTo = bnpRShiftTo; - BigInteger.prototype.subTo = bnpSubTo; - BigInteger.prototype.multiplyTo = bnpMultiplyTo; - BigInteger.prototype.squareTo = bnpSquareTo; - BigInteger.prototype.divRemTo = bnpDivRemTo; - BigInteger.prototype.invDigit = bnpInvDigit; - BigInteger.prototype.isEven = bnpIsEven; - BigInteger.prototype.exp = bnpExp; - - // public - BigInteger.prototype.toString = bnToString; - BigInteger.prototype.negate = bnNegate; - BigInteger.prototype.abs = bnAbs; - BigInteger.prototype.compareTo = bnCompareTo; - BigInteger.prototype.bitLength = bnBitLength; - BigInteger.prototype.mod = bnMod; - BigInteger.prototype.modPowInt = bnModPowInt; - - // "constants" - BigInteger.ZERO = nbv(0); - BigInteger.ONE = nbv(1); - - // Copyright (c) 2005-2009 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Extended JavaScript BN functions, required for RSA private ops. - - // Version 1.1: new BigInteger("0", 10) returns "proper" zero - // Version 1.2: square() API, isProbablePrime fix - - // (public) - function bnClone() { var r = nbi(); this.copyTo(r); return r; } - - // (public) return value as integer - function bnIntValue() { - if(this.s < 0) { - if(this.t == 1) return this[0]-this.DV; - else if(this.t == 0) return -1; - } - else if(this.t == 1) return this[0]; - else if(this.t == 0) return 0; - // assumes 16 < DB < 32 - return ((this[1]&((1<<(32-this.DB))-1))<>24; } - - // (public) return value as short (assumes DB>=16) - function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } - - // (protected) return x s.t. r^x < DV - function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } - - // (public) 0 if this == 0, 1 if this > 0 - function bnSigNum() { - if(this.s < 0) return -1; - else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; - else return 1; - } - - // (protected) convert to radix string - function bnpToRadix(b) { - if(b == null) b = 10; - if(this.signum() == 0 || b < 2 || b > 36) return "0"; - var cs = this.chunkSize(b); - var a = Math.pow(b,cs); - var d = nbv(a), y = nbi(), z = nbi(), r = ""; - this.divRemTo(d,y,z); - while(y.signum() > 0) { - r = (a+z.intValue()).toString(b).substr(1) + r; - y.divRemTo(d,y,z); - } - return z.intValue().toString(b) + r; - } - - // (protected) convert from radix string - function bnpFromRadix(s,b) { - this.fromInt(0); - if(b == null) b = 10; - var cs = this.chunkSize(b); - var d = Math.pow(b,cs), mi = false, j = 0, w = 0; - for(var i = 0; i < s.length; ++i) { - var x = intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-" && this.signum() == 0) mi = true; - continue; - } - w = b*w+x; - if(++j >= cs) { - this.dMultiply(d); - this.dAddOffset(w,0); - j = 0; - w = 0; + CheckComplete() { + if (this.done) { + return; } - } - if(j > 0) { - this.dMultiply(Math.pow(b,j)); - this.dAddOffset(w,0); - } - if(mi) BigInteger.ZERO.subTo(this,this); - } - - // (protected) alternate constructor - function bnpFromNumber(a,b,c) { - if("number" == typeof b) { - // new BigInteger(int,int,RNG) - if(a < 2) this.fromInt(1); - else { - this.fromNumber(a,c); - if(!this.testBit(a-1)) // force MSB set - this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); - if(this.isEven()) this.dAddOffset(1,0); // force odd - while(!this.isProbablePrime(b)) { - this.dAddOffset(2,0); - if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); - } + if (this.processClosed) { + this._setResult(); } - } - else { - // new BigInteger(int,RNG) - var x = new Array(), t = a&7; - x.length = (a>>3)+1; - b.nextBytes(x); - if(t > 0) x[0] &= ((1< 0) { - if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) - r[k++] = d|(this.s<<(this.DB-p)); - while(i >= 0) { - if(p < 8) { - d = (this[i]&((1<>(p+=this.DB-8); - } - else { - d = (this[i]>>(p-=8))&0xff; - if(p <= 0) { p += this.DB; --i; } - } - if((d&0x80) != 0) d |= -256; - if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; - if(k > 0 || d != this.s) r[k++] = d; + else if (this.processExited) { + this.timeout = setTimeout(ExecState.HandleTimeout, this.delay, this); } - } - return r; - } - - function bnEquals(a) { return(this.compareTo(a)==0); } - function bnMin(a) { return(this.compareTo(a)<0)?this:a; } - function bnMax(a) { return(this.compareTo(a)>0)?this:a; } - - // (protected) r = this op a (bitwise) - function bnpBitwiseTo(a,op,r) { - var i, f, m = Math.min(a.t,this.t); - for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); - if(a.t < this.t) { - f = a.s&this.DM; - for(i = m; i < this.t; ++i) r[i] = op(this[i],f); - r.t = this.t; - } - else { - f = this.s&this.DM; - for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); - r.t = a.t; - } - r.s = op(this.s,a.s); - r.clamp(); - } - - // (public) this & a - function op_and(x,y) { return x&y; } - function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } - - // (public) this | a - function op_or(x,y) { return x|y; } - function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } - - // (public) this ^ a - function op_xor(x,y) { return x^y; } - function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } - - // (public) this & ~a - function op_andnot(x,y) { return x&~y; } - function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } - - // (public) ~this - function bnNot() { - var r = nbi(); - for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; - r.t = this.t; - r.s = ~this.s; - return r; } - - // (public) this << n - function bnShiftLeft(n) { - var r = nbi(); - if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); - return r; + _debug(message) { + this.emit('debug', message); + } + _setResult() { + // determine whether there is an error + let error; + if (this.processExited) { + if (this.processError) { + error = new Error(`There was an error when attempting to execute the process '${this.toolPath}'. This may indicate the process failed to start. Error: ${this.processError}`); + } + else if (this.processExitCode !== 0 && !this.options.ignoreReturnCode) { + error = new Error(`The process '${this.toolPath}' failed with exit code ${this.processExitCode}`); + } + else if (this.processStderr && this.options.failOnStdErr) { + error = new Error(`The process '${this.toolPath}' failed because one or more lines were written to the STDERR stream`); + } + } + // clear the timeout + if (this.timeout) { + clearTimeout(this.timeout); + this.timeout = null; + } + this.done = true; + this.emit('done', error, this.processExitCode); + } + static HandleTimeout(state) { + if (state.done) { + return; + } + if (!state.processClosed && state.processExited) { + const message = `The STDIO streams did not close within ${state.delay / + 1000} seconds of the exit event from process '${state.toolPath}'. This may indicate a child process inherited the STDIO streams and has not yet exited.`; + state._debug(message); + } + state._setResult(); } - - // (public) this >> n - function bnShiftRight(n) { - var r = nbi(); - if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); - return r; - } - - // return index of lowest 1-bit in x, x < 2^31 - function lbit(x) { - if(x == 0) return -1; - var r = 0; - if((x&0xffff) == 0) { x >>= 16; r += 16; } - if((x&0xff) == 0) { x >>= 8; r += 8; } - if((x&0xf) == 0) { x >>= 4; r += 4; } - if((x&3) == 0) { x >>= 2; r += 2; } - if((x&1) == 0) ++r; - return r; - } - - // (public) returns index of lowest 1-bit (or -1 if none) - function bnGetLowestSetBit() { - for(var i = 0; i < this.t; ++i) - if(this[i] != 0) return i*this.DB+lbit(this[i]); - if(this.s < 0) return this.t*this.DB; - return -1; - } - - // return number of 1 bits in x - function cbit(x) { - var r = 0; - while(x != 0) { x &= x-1; ++r; } - return r; - } - - // (public) return number of set bits - function bnBitCount() { - var r = 0, x = this.s&this.DM; - for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); - return r; - } - - // (public) true iff nth bit is set - function bnTestBit(n) { - var j = Math.floor(n/this.DB); - if(j >= this.t) return(this.s!=0); - return((this[j]&(1<<(n%this.DB)))!=0); - } - - // (protected) this op (1<>= this.DB; - } - if(a.t < this.t) { - c += a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c += a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += a.s; - } - r.s = (c<0)?-1:0; - if(c > 0) r[i++] = c; - else if(c < -1) r[i++] = this.DV+c; - r.t = i; - r.clamp(); - } - - // (public) this + a - function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } - - // (public) this - a - function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } - - // (public) this * a - function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } - - // (public) this^2 - function bnSquare() { var r = nbi(); this.squareTo(r); return r; } - - // (public) this / a - function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } - - // (public) this % a - function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } - - // (public) [this/a,this%a] - function bnDivideAndRemainder(a) { - var q = nbi(), r = nbi(); - this.divRemTo(a,q,r); - return new Array(q,r); - } - - // (protected) this *= n, this >= 0, 1 < n < DV - function bnpDMultiply(n) { - this[this.t] = this.am(0,n-1,this,0,0,this.t); - ++this.t; - this.clamp(); - } - - // (protected) this += n << w words, this >= 0 - function bnpDAddOffset(n,w) { - if(n == 0) return; - while(this.t <= w) this[this.t++] = 0; - this[w] += n; - while(this[w] >= this.DV) { - this[w] -= this.DV; - if(++w >= this.t) this[this.t++] = 0; - ++this[w]; - } - } - - // A "null" reducer - function NullExp() {} - function nNop(x) { return x; } - function nMulTo(x,y,r) { x.multiplyTo(y,r); } - function nSqrTo(x,r) { x.squareTo(r); } - - NullExp.prototype.convert = nNop; - NullExp.prototype.revert = nNop; - NullExp.prototype.mulTo = nMulTo; - NullExp.prototype.sqrTo = nSqrTo; - - // (public) this^e - function bnPow(e) { return this.exp(e,new NullExp()); } - - // (protected) r = lower n words of "this * a", a.t <= n - // "this" should be the larger one if appropriate. - function bnpMultiplyLowerTo(a,n,r) { - var i = Math.min(this.t+a.t,n); - r.s = 0; // assumes a,this >= 0 - r.t = i; - while(i > 0) r[--i] = 0; - var j; - for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); - for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); - r.clamp(); - } - - // (protected) r = "this * a" without lower n words, n > 0 - // "this" should be the larger one if appropriate. - function bnpMultiplyUpperTo(a,n,r) { - --n; - var i = r.t = this.t+a.t-n; - r.s = 0; // assumes a,this >= 0 - while(--i >= 0) r[i] = 0; - for(i = Math.max(n-this.t,0); i < a.t; ++i) - r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); - r.clamp(); - r.drShiftTo(1,r); - } - - // Barrett modular reduction - function Barrett(m) { - // setup Barrett - this.r2 = nbi(); - this.q3 = nbi(); - BigInteger.ONE.dlShiftTo(2*m.t,this.r2); - this.mu = this.r2.divide(m); - this.m = m; - } - - function barrettConvert(x) { - if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); - else if(x.compareTo(this.m) < 0) return x; - else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } - } - - function barrettRevert(x) { return x; } - - // x = x mod m (HAC 14.42) - function barrettReduce(x) { - x.drShiftTo(this.m.t-1,this.r2); - if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } - this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); - this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); - while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); - x.subTo(this.r2,x); - while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); - } - - // r = x^2 mod m; x != r - function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = x*y mod m; x,y != r - function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Barrett.prototype.convert = barrettConvert; - Barrett.prototype.revert = barrettRevert; - Barrett.prototype.reduce = barrettReduce; - Barrett.prototype.mulTo = barrettMulTo; - Barrett.prototype.sqrTo = barrettSqrTo; - - // (public) this^e % m (HAC 14.85) - function bnModPow(e,m) { - var i = e.bitLength(), k, r = nbv(1), z; - if(i <= 0) return r; - else if(i < 18) k = 1; - else if(i < 48) k = 3; - else if(i < 144) k = 4; - else if(i < 768) k = 5; - else k = 6; - if(i < 8) - z = new Classic(m); - else if(m.isEven()) - z = new Barrett(m); - else - z = new Montgomery(m); - - // precomputation - var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { - var g2 = nbi(); - z.sqrTo(g[1],g2); - while(n <= km) { - g[n] = nbi(); - z.mulTo(g2,g[n-2],g[n]); - n += 2; - } - } - - var j = e.t-1, w, is1 = true, r2 = nbi(), t; - i = nbits(e[j])-1; - while(j >= 0) { - if(i >= k1) w = (e[j]>>(i-k1))&km; - else { - w = (e[j]&((1<<(i+1))-1))<<(k1-i); - if(j > 0) w |= e[j-1]>>(this.DB+i-k1); - } - - n = k; - while((w&1) == 0) { w >>= 1; --n; } - if((i -= n) < 0) { i += this.DB; --j; } - if(is1) { // ret == 1, don't bother squaring or multiplying it - g[w].copyTo(r); - is1 = false; - } - else { - while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } - if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } - z.mulTo(r2,g[w],r); - } - - while(j >= 0 && (e[j]&(1< 0) { - x.rShiftTo(g,x); - y.rShiftTo(g,y); - } - while(x.signum() > 0) { - if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); - if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); - if(x.compareTo(y) >= 0) { - x.subTo(y,x); - x.rShiftTo(1,x); - } - else { - y.subTo(x,y); - y.rShiftTo(1,y); - } - } - if(g > 0) y.lShiftTo(g,y); - return y; - } - - // (protected) this % n, n < 2^26 - function bnpModInt(n) { - if(n <= 0) return 0; - var d = this.DV%n, r = (this.s<0)?n-1:0; - if(this.t > 0) - if(d == 0) r = this[0]%n; - else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; - return r; - } - - // (public) 1/this % m (HAC 14.61) - function bnModInverse(m) { - var ac = m.isEven(); - if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; - var u = m.clone(), v = this.clone(); - var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); - while(u.signum() != 0) { - while(u.isEven()) { - u.rShiftTo(1,u); - if(ac) { - if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } - a.rShiftTo(1,a); - } - else if(!b.isEven()) b.subTo(m,b); - b.rShiftTo(1,b); - } - while(v.isEven()) { - v.rShiftTo(1,v); - if(ac) { - if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } - c.rShiftTo(1,c); - } - else if(!d.isEven()) d.subTo(m,d); - d.rShiftTo(1,d); - } - if(u.compareTo(v) >= 0) { - u.subTo(v,u); - if(ac) a.subTo(c,a); - b.subTo(d,b); - } - else { - v.subTo(u,v); - if(ac) c.subTo(a,c); - d.subTo(b,d); - } - } - if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; - if(d.compareTo(m) >= 0) return d.subtract(m); - if(d.signum() < 0) d.addTo(m,d); else return d; - if(d.signum() < 0) return d.add(m); else return d; - } - - var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; - var lplim = (1<<26)/lowprimes[lowprimes.length-1]; - - // (public) test primality with certainty >= 1-.5^t - function bnIsProbablePrime(t) { - var i, x = this.abs(); - if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { - for(i = 0; i < lowprimes.length; ++i) - if(x[0] == lowprimes[i]) return true; - return false; - } - if(x.isEven()) return false; - i = 1; - while(i < lowprimes.length) { - var m = lowprimes[i], j = i+1; - while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; - m = x.modInt(m); - while(i < j) if(m%lowprimes[i++] == 0) return false; - } - return x.millerRabin(t); - } - - // (protected) true if probably prime (HAC 4.24, Miller-Rabin) - function bnpMillerRabin(t) { - var n1 = this.subtract(BigInteger.ONE); - var k = n1.getLowestSetBit(); - if(k <= 0) return false; - var r = n1.shiftRight(k); - t = (t+1)>>1; - if(t > lowprimes.length) t = lowprimes.length; - var a = nbi(); - for(var i = 0; i < t; ++i) { - //Pick bases at random, instead of starting at 2 - a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); - var y = a.modPow(r,this); - if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { - var j = 1; - while(j++ < k && y.compareTo(n1) != 0) { - y = y.modPowInt(2,this); - if(y.compareTo(BigInteger.ONE) == 0) return false; - } - if(y.compareTo(n1) != 0) return false; - } - } - return true; - } - - // protected - BigInteger.prototype.chunkSize = bnpChunkSize; - BigInteger.prototype.toRadix = bnpToRadix; - BigInteger.prototype.fromRadix = bnpFromRadix; - BigInteger.prototype.fromNumber = bnpFromNumber; - BigInteger.prototype.bitwiseTo = bnpBitwiseTo; - BigInteger.prototype.changeBit = bnpChangeBit; - BigInteger.prototype.addTo = bnpAddTo; - BigInteger.prototype.dMultiply = bnpDMultiply; - BigInteger.prototype.dAddOffset = bnpDAddOffset; - BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; - BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; - BigInteger.prototype.modInt = bnpModInt; - BigInteger.prototype.millerRabin = bnpMillerRabin; - - // public - BigInteger.prototype.clone = bnClone; - BigInteger.prototype.intValue = bnIntValue; - BigInteger.prototype.byteValue = bnByteValue; - BigInteger.prototype.shortValue = bnShortValue; - BigInteger.prototype.signum = bnSigNum; - BigInteger.prototype.toByteArray = bnToByteArray; - BigInteger.prototype.equals = bnEquals; - BigInteger.prototype.min = bnMin; - BigInteger.prototype.max = bnMax; - BigInteger.prototype.and = bnAnd; - BigInteger.prototype.or = bnOr; - BigInteger.prototype.xor = bnXor; - BigInteger.prototype.andNot = bnAndNot; - BigInteger.prototype.not = bnNot; - BigInteger.prototype.shiftLeft = bnShiftLeft; - BigInteger.prototype.shiftRight = bnShiftRight; - BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; - BigInteger.prototype.bitCount = bnBitCount; - BigInteger.prototype.testBit = bnTestBit; - BigInteger.prototype.setBit = bnSetBit; - BigInteger.prototype.clearBit = bnClearBit; - BigInteger.prototype.flipBit = bnFlipBit; - BigInteger.prototype.add = bnAdd; - BigInteger.prototype.subtract = bnSubtract; - BigInteger.prototype.multiply = bnMultiply; - BigInteger.prototype.divide = bnDivide; - BigInteger.prototype.remainder = bnRemainder; - BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; - BigInteger.prototype.modPow = bnModPow; - BigInteger.prototype.modInverse = bnModInverse; - BigInteger.prototype.pow = bnPow; - BigInteger.prototype.gcd = bnGCD; - BigInteger.prototype.isProbablePrime = bnIsProbablePrime; - - // JSBN-specific extension - BigInteger.prototype.square = bnSquare; - - // Expose the Barrett function - BigInteger.prototype.Barrett = Barrett - - // BigInteger interfaces not implemented in jsbn: - - // BigInteger(int signum, byte[] magnitude) - // double doubleValue() - // float floatValue() - // int hashCode() - // long longValue() - // static BigInteger valueOf(long val) - - // Random number generator - requires a PRNG backend, e.g. prng4.js - - // For best results, put code like - // - // in your main HTML document. - - var rng_state; - var rng_pool; - var rng_pptr; - - // Mix in a 32-bit integer into the pool - function rng_seed_int(x) { - rng_pool[rng_pptr++] ^= x & 255; - rng_pool[rng_pptr++] ^= (x >> 8) & 255; - rng_pool[rng_pptr++] ^= (x >> 16) & 255; - rng_pool[rng_pptr++] ^= (x >> 24) & 255; - if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; - } - - // Mix in the current time (w/milliseconds) into the pool - function rng_seed_time() { - rng_seed_int(new Date().getTime()); - } - - // Initialize the pool with junk if needed. - if(rng_pool == null) { - rng_pool = new Array(); - rng_pptr = 0; - var t; - if(typeof window !== "undefined" && window.crypto) { - if (window.crypto.getRandomValues) { - // Use webcrypto if available - var ua = new Uint8Array(32); - window.crypto.getRandomValues(ua); - for(t = 0; t < 32; ++t) - rng_pool[rng_pptr++] = ua[t]; - } - else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { - // Extract entropy (256 bits) from NS4 RNG if available - var z = window.crypto.random(32); - for(t = 0; t < z.length; ++t) - rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; - } - } - while(rng_pptr < rng_psize) { // extract some randomness from Math.random() - t = Math.floor(65536 * Math.random()); - rng_pool[rng_pptr++] = t >>> 8; - rng_pool[rng_pptr++] = t & 255; - } - rng_pptr = 0; - rng_seed_time(); - //rng_seed_int(window.screenX); - //rng_seed_int(window.screenY); - } - - function rng_get_byte() { - if(rng_state == null) { - rng_seed_time(); - rng_state = prng_newstate(); - rng_state.init(rng_pool); - for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) - rng_pool[rng_pptr] = 0; - rng_pptr = 0; - //rng_pool = null; - } - // TODO: allow reseeding after first request - return rng_state.next(); - } - - function rng_get_bytes(ba) { - var i; - for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); - } - - function SecureRandom() {} - - SecureRandom.prototype.nextBytes = rng_get_bytes; - - // prng4.js - uses Arcfour as a PRNG - - function Arcfour() { - this.i = 0; - this.j = 0; - this.S = new Array(); - } - - // Initialize arcfour context from key, an array of ints, each from [0..255] - function ARC4init(key) { - var i, j, t; - for(i = 0; i < 256; ++i) - this.S[i] = i; - j = 0; - for(i = 0; i < 256; ++i) { - j = (j + this.S[i] + key[i % key.length]) & 255; - t = this.S[i]; - this.S[i] = this.S[j]; - this.S[j] = t; - } - this.i = 0; - this.j = 0; - } - - function ARC4next() { - var t; - this.i = (this.i + 1) & 255; - this.j = (this.j + this.S[this.i]) & 255; - t = this.S[this.i]; - this.S[this.i] = this.S[this.j]; - this.S[this.j] = t; - return this.S[(t + this.S[this.i]) & 255]; - } - - Arcfour.prototype.init = ARC4init; - Arcfour.prototype.next = ARC4next; - - // Plug in your RNG constructor here - function prng_newstate() { - return new Arcfour(); - } - - // Pool size must be a multiple of 4 and greater than 32. - // An array of bytes the size of the pool will be passed to init() - var rng_psize = 256; - - BigInteger.SecureRandom = SecureRandom; - BigInteger.BigInteger = BigInteger; - if (true) { - exports = module.exports = BigInteger; - } else {} - -}).call(this); - - -/***/ }), - -/***/ 37: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -//all requires must be explicit because browserify won't work with dynamic requires -module.exports = { - '$ref': __webpack_require__(449), - allOf: __webpack_require__(503), - anyOf: __webpack_require__(801), - '$comment': __webpack_require__(339), - const: __webpack_require__(652), - contains: __webpack_require__(159), - dependencies: __webpack_require__(703), - 'enum': __webpack_require__(562), - format: __webpack_require__(664), - 'if': __webpack_require__(515), - items: __webpack_require__(785), - maximum: __webpack_require__(739), - minimum: __webpack_require__(739), - maxItems: __webpack_require__(166), - minItems: __webpack_require__(166), - maxLength: __webpack_require__(765), - minLength: __webpack_require__(765), - maxProperties: __webpack_require__(949), - minProperties: __webpack_require__(949), - multipleOf: __webpack_require__(269), - not: __webpack_require__(380), - oneOf: __webpack_require__(676), - pattern: __webpack_require__(4), - properties: __webpack_require__(672), - propertyNames: __webpack_require__(438), - required: __webpack_require__(302), - uniqueItems: __webpack_require__(141), - validate: __webpack_require__(779) -}; - - -/***/ }), - -/***/ 48: -/***/ (function(module) { - -function Caseless (dict) { - this.dict = dict || {} -} -Caseless.prototype.set = function (name, value, clobber) { - if (typeof name === 'object') { - for (var i in name) { - this.set(i, name[i], value) - } - } else { - if (typeof clobber === 'undefined') clobber = true - var has = this.has(name) - - if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value - else this.dict[has || name] = value - return has - } -} -Caseless.prototype.has = function (name) { - var keys = Object.keys(this.dict) - , name = name.toLowerCase() - ; - for (var i=0;i MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} - -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} - -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 24, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 }, - 'aes-256-cbc': { key: 32, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; - -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); - - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); - - salt = salt.slice(0, PKCS5_SALT_LEN); - - var D, D_prev, bufs; - var material = Buffer.alloc(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } - - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} - -/* See: RFC2898 */ -function pbkdf2(hashAlg, salt, iterations, size, passphrase) { - var hkey = Buffer.alloc(salt.length + 4); - salt.copy(hkey); - - var gen = 0, ts = []; - var i = 1; - while (gen < size) { - var t = T(i++); - gen += t.length; - ts.push(t); - } - return (Buffer.concat(ts).slice(0, size)); - - function T(I) { - hkey.writeUInt32BE(I, hkey.length - 4); - - var hmac = crypto.createHmac(hashAlg, passphrase); - hmac.update(hkey); - - var Ti = hmac.digest(); - var Uc = Ti; - var c = 1; - while (c++ < iterations) { - hmac = crypto.createHmac(hashAlg, passphrase); - hmac.update(Uc); - Uc = hmac.digest(); - for (var x = 0; x < Ti.length; ++x) - Ti[x] ^= Uc[x]; - } - return (Ti); - } -} - -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} - -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); - - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; - - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); - - return (parts); -} - -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} - -function readBitString(der, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var buf = der.readString(tag, true); - assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + - 'not supported (0x' + buf[0].toString(16) + ')'); - return (buf.slice(1)); -} - -function writeBitString(der, buf, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - der.writeBuffer(b, tag); -} - -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function mpDenormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00) - buf = buf.slice(1); - return (buf); -} - -function zeroPadToLength(buf, len) { - assert.buffer(buf); - assert.number(len); - while (buf.length > len) { - assert.equal(buf[0], 0x00); - buf = buf.slice(1); - } - while (buf.length < len) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function bigintToMpBuf(bigint) { - var buf = Buffer.from(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} - -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - g = new jsbn(g); - p = new jsbn(p); - x = new jsbn(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} - -function calculateED25519Public(k) { - assert.buffer(k); - - var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function calculateX25519Public(k) { - assert.buffer(k); - - var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - - var d = new jsbn(key.part.d.data); - var buf; - - if (!key.part.dmodp) { - var p = new jsbn(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); - - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new jsbn(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); - - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} - -function publicFromPrivateECDSA(curveName, priv) { - assert.string(curveName, 'curveName'); - assert.buffer(priv); - var params = algs.curves[curveName]; - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - var d = new jsbn(mpNormalize(priv)); - var pub = G.multiply(d); - pub = Buffer.from(curve.encodePointHex(pub), 'hex'); - - var parts = []; - parts.push({name: 'curve', data: Buffer.from(curveName)}); - parts.push({name: 'Q', data: pub}); - - var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); - return (key); -} - -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); } - +//# sourceMappingURL=toolrunner.js.map /***/ }), -/***/ 62: -/***/ (function(module, __unusedexports, __webpack_require__) { +/***/ 13: +/***/ (function(module) { -// Copyright 2015 Joyent, Inc. +"use strict"; + + +var replace = String.prototype.replace; +var percentTwenties = /%20/g; module.exports = { - read: read, - readSSHPrivate: readSSHPrivate, - write: write + 'default': 'RFC3986', + formatters: { + RFC1738: function (value) { + return replace.call(value, percentTwenties, '+'); + }, + RFC3986: function (value) { + return value; + } + }, + RFC1738: 'RFC1738', + RFC3986: 'RFC3986' }; -var assert = __webpack_require__(976); -var asn1 = __webpack_require__(856); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); -var crypto = __webpack_require__(417); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var pem = __webpack_require__(207); -var rfc4253 = __webpack_require__(563); -var SSHBuffer = __webpack_require__(981); -var errors = __webpack_require__(481); +/***/ }), -var bcrypt; +/***/ 16: +/***/ (function(module) { -function read(buf, options) { - return (pem.read(buf, options)); +module.exports = require("tls"); + +/***/ }), + +/***/ 28: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_comment(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $comment = it.util.toQuotedString($schema); + if (it.opts.$comment === true) { + out += ' console.log(' + ($comment) + ');'; + } else if (typeof it.opts.$comment == 'function') { + out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; + } + return out; } -var MAGIC = 'openssh-key-v1'; -function readSSHPrivate(type, buf, options) { - buf = new SSHBuffer({buffer: buf}); +/***/ }), - var magic = buf.readCString(); - assert.strictEqual(magic, MAGIC, 'bad magic string'); +/***/ 35: +/***/ (function(module) { - var cipher = buf.readString(); - var kdf = buf.readString(); - var kdfOpts = buf.readBuffer(); +"use strict"; - var nkeys = buf.readInt(); - if (nkeys !== 1) { - throw (new Error('OpenSSH-format key file contains ' + - 'multiple keys: this is unsupported.')); - } +module.exports = function generate_propertyNames(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + out += 'var ' + ($errs) + ' = errors;'; + if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $i = 'i' + $lvl, + $invalidName = '\' + ' + $key + ' + \'', + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined; '; + } + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' var startErrs' + ($lvl) + ' = errors; '; + var $passData = $key; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); +/** + * Remove keyword + * @this Ajv + * @param {String} keyword pre-defined or custom keyword. + * @return {Ajv} this for method chaining + */ +function removeKeyword(keyword) { + /* jshint validthis: true */ + var RULES = this.RULES; + delete RULES.keywords[keyword]; + delete RULES.all[keyword]; + delete RULES.custom[keyword]; + for (var i=0; i All rights reserved. +// If you have no idea what ASN.1 or BER is, see this: +// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc -var Cache = module.exports = function Cache() { - this._cache = {}; -}; +var Ber = __webpack_require__(249); -Cache.prototype.put = function Cache_put(key, value) { - this._cache[key] = value; -}; +// --- Exported API -Cache.prototype.get = function Cache_get(key) { - return this._cache[key]; -}; +module.exports = { + Ber: Ber, -Cache.prototype.del = function Cache_del(key) { - delete this._cache[key]; -}; + BerReader: Ber.Reader, + BerWriter: Ber.Writer -Cache.prototype.clear = function Cache_clear() { - this._cache = {}; }; /***/ }), -/***/ 69: +/***/ 64: /***/ (function(module, __unusedexports, __webpack_require__) { -var defer = __webpack_require__(698); - -// API -module.exports = async; - -/** - * Runs provided callback asynchronously - * even if callback itself is not - * - * @param {function} callback - callback to invoke - * @returns {function} - augmented callback - */ -function async(callback) -{ - var isAsync = false; - - // check if async happened - defer(function() { isAsync = true; }); - - return function async_callback(err, result) - { - if (isAsync) - { - callback(err, result); - } - else - { - defer(function nextTick_callback() - { - callback(err, result); - }); - } - }; -} +// Copyright 2012 Joyent, Inc. All rights reserved. +var assert = __webpack_require__(477); +var crypto = __webpack_require__(417); +var http = __webpack_require__(605); +var util = __webpack_require__(669); +var sshpk = __webpack_require__(650); +var jsprim = __webpack_require__(348); +var utils = __webpack_require__(909); -/***/ }), +var sprintf = __webpack_require__(669).format; -/***/ 74: -/***/ (function(module, __unusedexports, __webpack_require__) { +var HASH_ALGOS = utils.HASH_ALGOS; +var PK_ALGOS = utils.PK_ALGOS; +var InvalidAlgorithmError = utils.InvalidAlgorithmError; +var HttpSignatureError = utils.HttpSignatureError; +var validateAlgorithm = utils.validateAlgorithm; -module.exports = -{ - parallel : __webpack_require__(825), - serial : __webpack_require__(995), - serialOrdered : __webpack_require__(375) -}; +///--- Globals +var AUTHZ_FMT = + 'Signature keyId="%s",algorithm="%s",headers="%s",signature="%s"'; -/***/ }), +///--- Specific Errors -/***/ 86: -/***/ (function(module) { +function MissingHeaderError(message) { + HttpSignatureError.call(this, message, MissingHeaderError); +} +util.inherits(MissingHeaderError, HttpSignatureError); -"use strict"; +function StrictParsingError(message) { + HttpSignatureError.call(this, message, StrictParsingError); +} +util.inherits(StrictParsingError, HttpSignatureError); +/* See createSigner() */ +function RequestSigner(options) { + assert.object(options, 'options'); -// https://mathiasbynens.be/notes/javascript-encoding -// https://github.com/bestiejs/punycode.js - punycode.ucs2.decode -module.exports = function ucs2length(str) { - var length = 0 - , len = str.length - , pos = 0 - , value; - while (pos < len) { - length++; - value = str.charCodeAt(pos++); - if (value >= 0xD800 && value <= 0xDBFF && pos < len) { - // high surrogate, and there is a next character - value = str.charCodeAt(pos); - if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate - } + var alg = []; + if (options.algorithm !== undefined) { + assert.string(options.algorithm, 'options.algorithm'); + alg = validateAlgorithm(options.algorithm); } - return length; -}; - - -/***/ }), - -/***/ 87: -/***/ (function(module) { + this.rs_alg = alg; -module.exports = require("os"); + /* + * RequestSigners come in two varieties: ones with an rs_signFunc, and ones + * with an rs_signer. + * + * rs_signFunc-based RequestSigners have to build up their entire signing + * string within the rs_lines array and give it to rs_signFunc as a single + * concat'd blob. rs_signer-based RequestSigners can add a line at a time to + * their signing state by using rs_signer.update(), thus only needing to + * buffer the hash function state and one line at a time. + */ + if (options.sign !== undefined) { + assert.func(options.sign, 'options.sign'); + this.rs_signFunc = options.sign; -/***/ }), + } else if (alg[0] === 'hmac' && options.key !== undefined) { + assert.string(options.keyId, 'options.keyId'); + this.rs_keyId = options.keyId; -/***/ 94: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) + throw (new TypeError('options.key for HMAC must be a string or Buffer')); -"use strict"; + /* + * Make an rs_signer for HMACs, not a rs_signFunc -- HMACs digest their + * data in chunks rather than requiring it all to be given in one go + * at the end, so they are more similar to signers than signFuncs. + */ + this.rs_signer = crypto.createHmac(alg[1].toUpperCase(), options.key); + this.rs_signer.sign = function () { + var digest = this.digest('base64'); + return ({ + hashAlgorithm: alg[1], + toString: function () { return (digest); } + }); + }; + } else if (options.key !== undefined) { + var key = options.key; + if (typeof (key) === 'string' || Buffer.isBuffer(key)) + key = sshpk.parsePrivateKey(key); -var net = __webpack_require__(631) - , tls = __webpack_require__(16) - , http = __webpack_require__(605) - , https = __webpack_require__(211) - , events = __webpack_require__(614) - , assert = __webpack_require__(357) - , util = __webpack_require__(669) - , Buffer = __webpack_require__(612).Buffer - ; + assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), + 'options.key must be a sshpk.PrivateKey'); + this.rs_key = key; -exports.httpOverHttp = httpOverHttp -exports.httpsOverHttp = httpsOverHttp -exports.httpOverHttps = httpOverHttps -exports.httpsOverHttps = httpsOverHttps + assert.string(options.keyId, 'options.keyId'); + this.rs_keyId = options.keyId; + if (!PK_ALGOS[key.type]) { + throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + + 'keys are not supported')); + } -function httpOverHttp(options) { - var agent = new TunnelingAgent(options) - agent.request = http.request - return agent -} + if (alg[0] !== undefined && key.type !== alg[0]) { + throw (new InvalidAlgorithmError('options.key must be a ' + + alg[0].toUpperCase() + ' key, was given a ' + + key.type.toUpperCase() + ' key instead')); + } -function httpsOverHttp(options) { - var agent = new TunnelingAgent(options) - agent.request = http.request - agent.createSocket = createSecureSocket - agent.defaultPort = 443 - return agent -} + this.rs_signer = key.createSign(alg[1]); -function httpOverHttps(options) { - var agent = new TunnelingAgent(options) - agent.request = https.request - return agent -} + } else { + throw (new TypeError('options.sign (func) or options.key is required')); + } -function httpsOverHttps(options) { - var agent = new TunnelingAgent(options) - agent.request = https.request - agent.createSocket = createSecureSocket - agent.defaultPort = 443 - return agent + this.rs_headers = []; + this.rs_lines = []; } +/** + * Adds a header to be signed, with its value, into this signer. + * + * @param {String} header + * @param {String} value + * @return {String} value written + */ +RequestSigner.prototype.writeHeader = function (header, value) { + assert.string(header, 'header'); + header = header.toLowerCase(); + assert.string(value, 'value'); -function TunnelingAgent(options) { - var self = this - self.options = options || {} - self.proxyOptions = self.options.proxy || {} - self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets - self.requests = [] - self.sockets = [] - - self.on('free', function onFree(socket, host, port) { - for (var i = 0, len = self.requests.length; i < len; ++i) { - var pending = self.requests[i] - if (pending.host === host && pending.port === port) { - // Detect the request to connect same origin server, - // reuse the connection. - self.requests.splice(i, 1) - pending.request.onSocket(socket) - return - } - } - socket.destroy() - self.removeSocket(socket) - }) -} -util.inherits(TunnelingAgent, events.EventEmitter) + this.rs_headers.push(header); -TunnelingAgent.prototype.addRequest = function addRequest(req, options) { - var self = this + if (this.rs_signFunc) { + this.rs_lines.push(header + ': ' + value); - // Legacy API: addRequest(req, host, port, path) - if (typeof options === 'string') { - options = { - host: options, - port: arguments[2], - path: arguments[3] - }; + } else { + var line = header + ': ' + value; + if (this.rs_headers.length > 0) + line = '\n' + line; + this.rs_signer.update(line); } - if (self.sockets.length >= this.maxSockets) { - // We are over limit so we'll add it to the queue. - self.requests.push({host: options.host, port: options.port, request: req}) - return - } + return (value); +}; - // If we are under maxSockets create a new one. - self.createConnection({host: options.host, port: options.port, request: req}) -} +/** + * Adds a default Date header, returning its value. + * + * @return {String} + */ +RequestSigner.prototype.writeDateHeader = function () { + return (this.writeHeader('date', jsprim.rfc1123(new Date()))); +}; -TunnelingAgent.prototype.createConnection = function createConnection(pending) { - var self = this +/** + * Adds the request target line to be signed. + * + * @param {String} method, HTTP method (e.g. 'get', 'post', 'put') + * @param {String} path + */ +RequestSigner.prototype.writeTarget = function (method, path) { + assert.string(method, 'method'); + assert.string(path, 'path'); + method = method.toLowerCase(); + this.writeHeader('(request-target)', method + ' ' + path); +}; - self.createSocket(pending, function(socket) { - socket.on('free', onFree) - socket.on('close', onCloseOrRemove) - socket.on('agentRemove', onCloseOrRemove) - pending.request.onSocket(socket) +/** + * Calculate the value for the Authorization header on this request + * asynchronously. + * + * @param {Func} callback (err, authz) + */ +RequestSigner.prototype.sign = function (cb) { + assert.func(cb, 'callback'); - function onFree() { - self.emit('free', socket, pending.host, pending.port) - } + if (this.rs_headers.length < 1) + throw (new Error('At least one header must be signed')); - function onCloseOrRemove(err) { - self.removeSocket(socket) - socket.removeListener('free', onFree) - socket.removeListener('close', onCloseOrRemove) - socket.removeListener('agentRemove', onCloseOrRemove) - } - }) -} + var alg, authz; + if (this.rs_signFunc) { + var data = this.rs_lines.join('\n'); + var self = this; + this.rs_signFunc(data, function (err, sig) { + if (err) { + cb(err); + return; + } + try { + assert.object(sig, 'signature'); + assert.string(sig.keyId, 'signature.keyId'); + assert.string(sig.algorithm, 'signature.algorithm'); + assert.string(sig.signature, 'signature.signature'); + alg = validateAlgorithm(sig.algorithm); -TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { - var self = this - var placeholder = {} - self.sockets.push(placeholder) + authz = sprintf(AUTHZ_FMT, + sig.keyId, + sig.algorithm, + self.rs_headers.join(' '), + sig.signature); + } catch (e) { + cb(e); + return; + } + cb(null, authz); + }); - var connectOptions = mergeOptions({}, self.proxyOptions, - { method: 'CONNECT' - , path: options.host + ':' + options.port - , agent: false + } else { + try { + var sigObj = this.rs_signer.sign(); + } catch (e) { + cb(e); + return; } - ) - if (connectOptions.proxyAuth) { - connectOptions.headers = connectOptions.headers || {} - connectOptions.headers['Proxy-Authorization'] = 'Basic ' + - Buffer.from(connectOptions.proxyAuth).toString('base64') + alg = (this.rs_alg[0] || this.rs_key.type) + '-' + sigObj.hashAlgorithm; + var signature = sigObj.toString(); + authz = sprintf(AUTHZ_FMT, + this.rs_keyId, + alg, + this.rs_headers.join(' '), + signature); + cb(null, authz); } +}; - debug('making CONNECT request') - var connectReq = self.request(connectOptions) - connectReq.useChunkedEncodingByDefault = false // for v0.6 - connectReq.once('response', onResponse) // for v0.6 - connectReq.once('upgrade', onUpgrade) // for v0.6 - connectReq.once('connect', onConnect) // for v0.7 or later - connectReq.once('error', onError) - connectReq.end() +///--- Exported API - function onResponse(res) { - // Very hacky. This is necessary to avoid http-parser leaks. - res.upgrade = true - } +module.exports = { + /** + * Identifies whether a given object is a request signer or not. + * + * @param {Object} object, the object to identify + * @returns {Boolean} + */ + isSigner: function (obj) { + if (typeof (obj) === 'object' && obj instanceof RequestSigner) + return (true); + return (false); + }, - function onUpgrade(res, socket, head) { - // Hacky. - process.nextTick(function() { - onConnect(res, socket, head) - }) - } + /** + * Creates a request signer, used to asynchronously build a signature + * for a request (does not have to be an http.ClientRequest). + * + * @param {Object} options, either: + * - {String} keyId + * - {String|Buffer} key + * - {String} algorithm (optional, required for HMAC) + * or: + * - {Func} sign (data, cb) + * @return {RequestSigner} + */ + createSigner: function createSigner(options) { + return (new RequestSigner(options)); + }, + + /** + * Adds an 'Authorization' header to an http.ClientRequest object. + * + * Note that this API will add a Date header if it's not already set. Any + * other headers in the options.headers array MUST be present, or this + * will throw. + * + * You shouldn't need to check the return type; it's just there if you want + * to be pedantic. + * + * The optional flag indicates whether parsing should use strict enforcement + * of the version draft-cavage-http-signatures-04 of the spec or beyond. + * The default is to be loose and support + * older versions for compatibility. + * + * @param {Object} request an instance of http.ClientRequest. + * @param {Object} options signing parameters object: + * - {String} keyId required. + * - {String} key required (either a PEM or HMAC key). + * - {Array} headers optional; defaults to ['date']. + * - {String} algorithm optional (unless key is HMAC); + * default is the same as the sshpk default + * signing algorithm for the type of key given + * - {String} httpVersion optional; defaults to '1.1'. + * - {Boolean} strict optional; defaults to 'false'. + * @return {Boolean} true if Authorization (and optionally Date) were added. + * @throws {TypeError} on bad parameter types (input). + * @throws {InvalidAlgorithmError} if algorithm was bad or incompatible with + * the given key. + * @throws {sshpk.KeyParseError} if key was bad. + * @throws {MissingHeaderError} if a header to be signed was specified but + * was not present. + */ + signRequest: function signRequest(request, options) { + assert.object(request, 'request'); + assert.object(options, 'options'); + assert.optionalString(options.algorithm, 'options.algorithm'); + assert.string(options.keyId, 'options.keyId'); + assert.optionalArrayOfString(options.headers, 'options.headers'); + assert.optionalString(options.httpVersion, 'options.httpVersion'); - function onConnect(res, socket, head) { - connectReq.removeAllListeners() - socket.removeAllListeners() + if (!request.getHeader('Date')) + request.setHeader('Date', jsprim.rfc1123(new Date())); + if (!options.headers) + options.headers = ['date']; + if (!options.httpVersion) + options.httpVersion = '1.1'; - if (res.statusCode === 200) { - assert.equal(head.length, 0) - debug('tunneling connection has established') - self.sockets[self.sockets.indexOf(placeholder)] = socket - cb(socket) - } else { - debug('tunneling socket could not be established, statusCode=%d', res.statusCode) - var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) - error.code = 'ECONNRESET' - options.request.emit('error', error) - self.removeSocket(placeholder) + var alg = []; + if (options.algorithm) { + options.algorithm = options.algorithm.toLowerCase(); + alg = validateAlgorithm(options.algorithm); } - } - - function onError(cause) { - connectReq.removeAllListeners() - - debug('tunneling socket could not be established, cause=%s\n', cause.message, cause.stack) - var error = new Error('tunneling socket could not be established, ' + 'cause=' + cause.message) - error.code = 'ECONNRESET' - options.request.emit('error', error) - self.removeSocket(placeholder) - } -} - -TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { - var pos = this.sockets.indexOf(socket) - if (pos === -1) return - this.sockets.splice(pos, 1) + var i; + var stringToSign = ''; + for (i = 0; i < options.headers.length; i++) { + if (typeof (options.headers[i]) !== 'string') + throw new TypeError('options.headers must be an array of Strings'); - var pending = this.requests.shift() - if (pending) { - // If we have pending requests and a socket gets closed a new one - // needs to be created to take over in the pool for the one that closed. - this.createConnection(pending) - } -} + var h = options.headers[i].toLowerCase(); -function createSecureSocket(options, cb) { - var self = this - TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { - // 0 is dummy port for v0.6 - var secureSocket = tls.connect(0, mergeOptions({}, self.options, - { servername: options.host - , socket: socket + if (h === 'request-line') { + if (!options.strict) { + /** + * We allow headers from the older spec drafts if strict parsing isn't + * specified in options. + */ + stringToSign += + request.method + ' ' + request.path + ' HTTP/' + + options.httpVersion; + } else { + /* Strict parsing doesn't allow older draft headers. */ + throw (new StrictParsingError('request-line is not a valid header ' + + 'with strict parsing enabled.')); + } + } else if (h === '(request-target)') { + stringToSign += + '(request-target): ' + request.method.toLowerCase() + ' ' + + request.path; + } else { + var value = request.getHeader(h); + if (value === undefined || value === '') { + throw new MissingHeaderError(h + ' was not in the request'); + } + stringToSign += h + ': ' + value; } - )) - self.sockets[self.sockets.indexOf(socket)] = secureSocket - cb(secureSocket) - }) -} + if ((i + 1) < options.headers.length) + stringToSign += '\n'; + } -function mergeOptions(target) { - for (var i = 1, len = arguments.length; i < len; ++i) { - var overrides = arguments[i] - if (typeof overrides === 'object') { - var keys = Object.keys(overrides) - for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { - var k = keys[j] - if (overrides[k] !== undefined) { - target[k] = overrides[k] - } - } + /* This is just for unit tests. */ + if (request.hasOwnProperty('_stringToSign')) { + request._stringToSign = stringToSign; } - } - return target -} + var signature; + if (alg[0] === 'hmac') { + if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) + throw (new TypeError('options.key must be a string or Buffer')); + + var hmac = crypto.createHmac(alg[1].toUpperCase(), options.key); + hmac.update(stringToSign); + signature = hmac.digest('base64'); -var debug -if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { - debug = function() { - var args = Array.prototype.slice.call(arguments) - if (typeof args[0] === 'string') { - args[0] = 'TUNNEL: ' + args[0] } else { - args.unshift('TUNNEL:') - } - console.error.apply(console, args) - } -} else { - debug = function() {} -} -exports.debug = debug // for test + var key = options.key; + if (typeof (key) === 'string' || Buffer.isBuffer(key)) + key = sshpk.parsePrivateKey(options.key); + assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), + 'options.key must be a sshpk.PrivateKey'); -/***/ }), + if (!PK_ALGOS[key.type]) { + throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + + 'keys are not supported')); + } -/***/ 97: -/***/ (function(__unusedmodule, exports) { + if (alg[0] !== undefined && key.type !== alg[0]) { + throw (new InvalidAlgorithmError('options.key must be a ' + + alg[0].toUpperCase() + ' key, was given a ' + + key.type.toUpperCase() + ' key instead')); + } -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. + var signer = key.createSign(alg[1]); + signer.update(stringToSign); + var sigObj = signer.sign(); + if (!HASH_ALGOS[sigObj.hashAlgorithm]) { + throw (new InvalidAlgorithmError(sigObj.hashAlgorithm.toUpperCase() + + ' is not a supported hash algorithm')); + } + options.algorithm = key.type + '-' + sigObj.hashAlgorithm; + signature = sigObj.toString(); + assert.notStrictEqual(signature, '', 'empty signature produced'); + } -// NOTE: These type checking functions intentionally don't use `instanceof` -// because it is fragile and can be easily faked with `Object.create()`. + var authzHeaderName = options.authorizationHeaderName || 'Authorization'; -function isArray(arg) { - if (Array.isArray) { - return Array.isArray(arg); - } - return objectToString(arg) === '[object Array]'; -} -exports.isArray = isArray; + request.setHeader(authzHeaderName, sprintf(AUTHZ_FMT, + options.keyId, + options.algorithm, + options.headers.join(' '), + signature)); -function isBoolean(arg) { - return typeof arg === 'boolean'; -} -exports.isBoolean = isBoolean; + return true; + } -function isNull(arg) { - return arg === null; -} -exports.isNull = isNull; +}; -function isNullOrUndefined(arg) { - return arg == null; -} -exports.isNullOrUndefined = isNullOrUndefined; -function isNumber(arg) { - return typeof arg === 'number'; -} -exports.isNumber = isNumber; +/***/ }), -function isString(arg) { - return typeof arg === 'string'; -} -exports.isString = isString; +/***/ 69: +/***/ (function(module) { -function isSymbol(arg) { - return typeof arg === 'symbol'; -} -exports.isSymbol = isSymbol; +// populates missing values +module.exports = function(dst, src) { -function isUndefined(arg) { - return arg === void 0; -} -exports.isUndefined = isUndefined; + Object.keys(src).forEach(function(prop) + { + dst[prop] = dst[prop] || src[prop]; + }); -function isRegExp(re) { - return objectToString(re) === '[object RegExp]'; -} -exports.isRegExp = isRegExp; + return dst; +}; -function isObject(arg) { - return typeof arg === 'object' && arg !== null; -} -exports.isObject = isObject; -function isDate(d) { - return objectToString(d) === '[object Date]'; -} -exports.isDate = isDate; +/***/ }), -function isError(e) { - return (objectToString(e) === '[object Error]' || e instanceof Error); -} -exports.isError = isError; +/***/ 78: +/***/ (function(module, __unusedexports, __webpack_require__) { -function isFunction(arg) { - return typeof arg === 'function'; -} -exports.isFunction = isFunction; +// Copyright 2015 Joyent, Inc. -function isPrimitive(arg) { - return arg === null || - typeof arg === 'boolean' || - typeof arg === 'number' || - typeof arg === 'string' || - typeof arg === 'symbol' || // ES6 symbol - typeof arg === 'undefined'; -} -exports.isPrimitive = isPrimitive; +module.exports = { + read: read, + readSSHPrivate: readSSHPrivate, + write: write +}; -exports.isBuffer = Buffer.isBuffer; +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var crypto = __webpack_require__(417); -function objectToString(o) { - return Object.prototype.toString.call(o); -} +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); +var rfc4253 = __webpack_require__(538); +var SSHBuffer = __webpack_require__(940); +var errors = __webpack_require__(753); +var bcrypt; -/***/ }), +function read(buf, options) { + return (pem.read(buf, options)); +} -/***/ 98: -/***/ (function(module, __unusedexports, __webpack_require__) { +var MAGIC = 'openssh-key-v1'; -// Copyright 2018 Joyent, Inc. +function readSSHPrivate(type, buf, options) { + buf = new SSHBuffer({buffer: buf}); -module.exports = Fingerprint; + var magic = buf.readCString(); + assert.strictEqual(magic, MAGIC, 'bad magic string'); -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var crypto = __webpack_require__(417); -var errs = __webpack_require__(481); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var Certificate = __webpack_require__(646); -var utils = __webpack_require__(57); + var cipher = buf.readString(); + var kdf = buf.readString(); + var kdfOpts = buf.readBuffer(); -var FingerprintFormatError = errs.FingerprintFormatError; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; + var nkeys = buf.readInt(); + if (nkeys !== 1) { + throw (new Error('OpenSSH-format key file contains ' + + 'multiple keys: this is unsupported.')); + } -function Fingerprint(opts) { - assert.object(opts, 'options'); - assert.string(opts.type, 'options.type'); - assert.buffer(opts.hash, 'options.hash'); - assert.string(opts.algorithm, 'options.algorithm'); + var pubKey = buf.readBuffer(); - this.algorithm = opts.algorithm.toLowerCase(); - if (algs.hashAlgs[this.algorithm] !== true) - throw (new InvalidAlgorithmError(this.algorithm)); + if (type === 'public') { + assert.ok(buf.atEnd(), 'excess bytes left after key'); + return (rfc4253.read(pubKey)); + } - this.hash = opts.hash; - this.type = opts.type; - this.hashType = opts.hashType; -} + var privKeyBlob = buf.readBuffer(); + assert.ok(buf.atEnd(), 'excess bytes left after key'); -Fingerprint.prototype.toString = function (format) { - if (format === undefined) { - if (this.algorithm === 'md5' || this.hashType === 'spki') - format = 'hex'; - else - format = 'base64'; - } - assert.string(format); + var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); + switch (kdf) { + case 'none': + if (cipher !== 'none') { + throw (new Error('OpenSSH-format key uses KDF "none" ' + + 'but specifies a cipher other than "none"')); + } + break; + case 'bcrypt': + var salt = kdfOptsBuf.readBuffer(); + var rounds = kdfOptsBuf.readInt(); + var cinf = utils.opensshCipherInfo(cipher); + if (bcrypt === undefined) { + bcrypt = __webpack_require__(641); + } - switch (format) { - case 'hex': - if (this.hashType === 'spki') - return (this.hash.toString('hex')); - return (addColons(this.hash.toString('hex'))); - case 'base64': - if (this.hashType === 'spki') - return (this.hash.toString('base64')); - return (sshBase64Format(this.algorithm, - this.hash.toString('base64'))); - default: - throw (new FingerprintFormatError(undefined, format)); - } -}; + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from(options.passphrase, + 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'OpenSSH')); + } -Fingerprint.prototype.matches = function (other) { - assert.object(other, 'key or certificate'); - if (this.type === 'key' && this.hashType !== 'ssh') { - utils.assertCompatible(other, Key, [1, 7], 'key with spki'); - if (PrivateKey.isPrivateKey(other)) { - utils.assertCompatible(other, PrivateKey, [1, 6], - 'privatekey with spki support'); + var pass = new Uint8Array(options.passphrase); + var salti = new Uint8Array(salt); + /* Use the pbkdf to derive both the key and the IV. */ + var out = new Uint8Array(cinf.keySize + cinf.blockSize); + var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, + out, out.length, rounds); + if (res !== 0) { + throw (new Error('bcrypt_pbkdf function returned ' + + 'failure, parameters invalid')); } - } else if (this.type === 'key') { - utils.assertCompatible(other, Key, [1, 0], 'key'); - } else { - utils.assertCompatible(other, Certificate, [1, 0], - 'certificate'); + out = Buffer.from(out); + var ckey = out.slice(0, cinf.keySize); + var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); + var cipherStream = crypto.createDecipheriv(cinf.opensslName, + ckey, iv); + cipherStream.setAutoPadding(false); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + if (e.toString().indexOf('bad decrypt') !== -1) { + throw (new Error('Incorrect passphrase ' + + 'supplied, could not decrypt key')); + } + throw (e); + }); + cipherStream.write(privKeyBlob); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + privKeyBlob = Buffer.concat(chunks); + break; + default: + throw (new Error( + 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); } - var theirHash = other.hash(this.algorithm, this.hashType); - var theirHash2 = crypto.createHash(this.algorithm). - update(theirHash).digest('base64'); + buf = new SSHBuffer({buffer: privKeyBlob}); - if (this.hash2 === undefined) - this.hash2 = crypto.createHash(this.algorithm). - update(this.hash).digest('base64'); + var checkInt1 = buf.readInt(); + var checkInt2 = buf.readInt(); + if (checkInt1 !== checkInt2) { + throw (new Error('Incorrect passphrase supplied, could not ' + + 'decrypt key')); + } - return (this.hash2 === theirHash2); -}; + var ret = {}; + var key = rfc4253.readInternal(ret, 'private', buf.remainder()); -/*JSSTYLED*/ -var base64RE = /^[A-Za-z0-9+\/=]+$/; -/*JSSTYLED*/ -var hexRE = /^[a-fA-F0-9]+$/; + buf.skip(ret.consumed); -Fingerprint.parse = function (fp, options) { - assert.string(fp, 'fingerprint'); + var comment = buf.readString(); + key.comment = comment; - var alg, hash, enAlgs; - if (Array.isArray(options)) { - enAlgs = options; - options = {}; - } - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - if (options.enAlgs !== undefined) - enAlgs = options.enAlgs; - if (options.algorithms !== undefined) - enAlgs = options.algorithms; - assert.optionalArrayOfString(enAlgs, 'algorithms'); + return (key); +} - var hashType = 'ssh'; - if (options.hashType !== undefined) - hashType = options.hashType; - assert.string(hashType, 'options.hashType'); +function write(key, options) { + var pubKey; + if (PrivateKey.isPrivateKey(key)) + pubKey = key.toPublic(); + else + pubKey = key; - var parts = fp.split(':'); - if (parts.length == 2) { - alg = parts[0].toLowerCase(); - if (!base64RE.test(parts[1])) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts[1], 'base64'); - } catch (e) { - throw (new FingerprintFormatError(fp)); - } - } else if (parts.length > 2) { - alg = 'md5'; - if (parts[0].toLowerCase() === 'md5') - parts = parts.slice(1); - parts = parts.map(function (p) { - while (p.length < 2) - p = '0' + p; - if (p.length > 2) - throw (new FingerprintFormatError(fp)); - return (p); - }); - parts = parts.join(''); - if (!hexRE.test(parts) || parts.length % 2 !== 0) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts, 'hex'); - } catch (e) { - throw (new FingerprintFormatError(fp)); - } - } else { - if (hexRE.test(fp)) { - hash = Buffer.from(fp, 'hex'); - } else if (base64RE.test(fp)) { - hash = Buffer.from(fp, 'base64'); - } else { - throw (new FingerprintFormatError(fp)); + var cipher = 'none'; + var kdf = 'none'; + var kdfopts = Buffer.alloc(0); + var cinf = { blockSize: 8 }; + var passphrase; + if (options !== undefined) { + passphrase = options.passphrase; + if (typeof (passphrase) === 'string') + passphrase = Buffer.from(passphrase, 'utf-8'); + if (passphrase !== undefined) { + assert.buffer(passphrase, 'options.passphrase'); + assert.optionalString(options.cipher, 'options.cipher'); + cipher = options.cipher; + if (cipher === undefined) + cipher = 'aes128-ctr'; + cinf = utils.opensshCipherInfo(cipher); + kdf = 'bcrypt'; } + } - switch (hash.length) { - case 32: - alg = 'sha256'; - break; - case 16: - alg = 'md5'; - break; - case 20: - alg = 'sha1'; - break; - case 64: - alg = 'sha512'; - break; - default: - throw (new FingerprintFormatError(fp)); - } + var privBuf; + if (PrivateKey.isPrivateKey(key)) { + privBuf = new SSHBuffer({}); + var checkInt = crypto.randomBytes(4).readUInt32BE(0); + privBuf.writeInt(checkInt); + privBuf.writeInt(checkInt); + privBuf.write(key.toBuffer('rfc4253')); + privBuf.writeString(key.comment || ''); - /* Plain hex/base64: guess it's probably SPKI unless told. */ - if (options.hashType === undefined) - hashType = 'spki'; + var n = 1; + while (privBuf._offset % cinf.blockSize !== 0) + privBuf.writeChar(n++); + privBuf = privBuf.toBuffer(); } - if (alg === undefined) - throw (new FingerprintFormatError(fp)); + switch (kdf) { + case 'none': + break; + case 'bcrypt': + var salt = crypto.randomBytes(16); + var rounds = 16; + var kdfssh = new SSHBuffer({}); + kdfssh.writeBuffer(salt); + kdfssh.writeInt(rounds); + kdfopts = kdfssh.toBuffer(); - if (algs.hashAlgs[alg] === undefined) - throw (new InvalidAlgorithmError(alg)); + if (bcrypt === undefined) { + bcrypt = __webpack_require__(641); + } + var pass = new Uint8Array(passphrase); + var salti = new Uint8Array(salt); + /* Use the pbkdf to derive both the key and the IV. */ + var out = new Uint8Array(cinf.keySize + cinf.blockSize); + var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, + out, out.length, rounds); + if (res !== 0) { + throw (new Error('bcrypt_pbkdf function returned ' + + 'failure, parameters invalid')); + } + out = Buffer.from(out); + var ckey = out.slice(0, cinf.keySize); + var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); - if (enAlgs !== undefined) { - enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); - if (enAlgs.indexOf(alg) === -1) - throw (new InvalidAlgorithmError(alg)); + var cipherStream = crypto.createCipheriv(cinf.opensslName, + ckey, iv); + cipherStream.setAutoPadding(false); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + throw (e); + }); + cipherStream.write(privBuf); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + privBuf = Buffer.concat(chunks); + break; + default: + throw (new Error('Unsupported kdf ' + kdf)); } - return (new Fingerprint({ - algorithm: alg, - hash: hash, - type: options.type || 'key', - hashType: hashType - })); -}; + var buf = new SSHBuffer({}); -function addColons(s) { - /*JSSTYLED*/ - return (s.replace(/(.{2})(?=.)/g, '$1:')); -} + buf.writeCString(MAGIC); + buf.writeString(cipher); /* cipher */ + buf.writeString(kdf); /* kdf */ + buf.writeBuffer(kdfopts); /* kdfoptions */ -function base64Strip(s) { - /*JSSTYLED*/ - return (s.replace(/=*$/, '')); -} + buf.writeInt(1); /* nkeys */ + buf.writeBuffer(pubKey.toBuffer('rfc4253')); -function sshBase64Format(alg, h) { - return (alg.toUpperCase() + ':' + base64Strip(h)); -} + if (privBuf) + buf.writeBuffer(privBuf); -Fingerprint.isFingerprint = function (obj, ver) { - return (utils.isCompatible(obj, Fingerprint, ver)); -}; + buf = buf.toBuffer(); -/* - * API versions for Fingerprint: - * [1,0] -- initial ver - * [1,1] -- first tagged ver - * [1,2] -- hashType and spki support - */ -Fingerprint.prototype._sshpkApiVersion = [1, 2]; + var header; + if (PrivateKey.isPrivateKey(key)) + header = 'OPENSSH PRIVATE KEY'; + else + header = 'OPENSSH PUBLIC KEY'; -Fingerprint._oldVersionDetect = function (obj) { - assert.func(obj.toString); - assert.func(obj.matches); - return ([1, 0]); -}; + var tmp = buf.toString('base64'); + var len = tmp.length + (tmp.length / 70) + + 18 + 16 + header.length*2 + 10; + buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 70; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); + return (buf.slice(0, o)); +} -/***/ }), -/***/ 99: -/***/ (function(module, __unusedexports, __webpack_require__) { +/***/ }), -// Copyright 2017 Joyent, Inc. +/***/ 85: +/***/ (function(module) { -module.exports = { - DiffieHellman: DiffieHellman, - generateECDSA: generateECDSA, - generateED25519: generateED25519 -}; +"use strict"; -var assert = __webpack_require__(976); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); -var nacl = __webpack_require__(162); +module.exports = function generate__limitItems(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $op = $keyword == 'maxItems' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have '; + if ($keyword == 'maxItems') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); +/***/ }), -var ecdh = __webpack_require__(477); -var ec = __webpack_require__(396); -var jsbn = __webpack_require__(36).BigInteger; +/***/ 87: +/***/ (function(module) { -function DiffieHellman(key) { - utils.assertCompatible(key, Key, [1, 4], 'key'); - this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); - this._algo = key.type; - this._curve = key.curve; - this._key = key; - if (key.type === 'dsa') { - if (!CRYPTO_HAVE_ECDH) { - throw (new Error('Due to bugs in the node 0.10 ' + - 'crypto API, node 0.12.x or later is required ' + - 'to use DH')); - } - this._dh = crypto.createDiffieHellman( - key.part.p.data, undefined, - key.part.g.data, undefined); - this._p = key.part.p; - this._g = key.part.g; - if (this._isPriv) - this._dh.setPrivateKey(key.part.x.data); - this._dh.setPublicKey(key.part.y.data); +module.exports = require("os"); - } else if (key.type === 'ecdsa') { - if (!CRYPTO_HAVE_ECDH) { - this._ecParams = new X9ECParameters(this._curve); +/***/ }), - if (this._isPriv) { - this._priv = new ECPrivate( - this._ecParams, key.part.d.data); - } - return; - } +/***/ 91: +/***/ (function(module, __unusedexports, __webpack_require__) { - var curve = { - 'nistp256': 'prime256v1', - 'nistp384': 'secp384r1', - 'nistp521': 'secp521r1' - }[key.curve]; - this._dh = crypto.createECDH(curve); - if (typeof (this._dh) !== 'object' || - typeof (this._dh.setPrivateKey) !== 'function') { - CRYPTO_HAVE_ECDH = false; - DiffieHellman.call(this, key); - return; - } - if (this._isPriv) - this._dh.setPrivateKey(key.part.d.data); - this._dh.setPublicKey(key.part.Q.data); +var serialOrdered = __webpack_require__(892); - } else if (key.type === 'curve25519') { - if (this._isPriv) { - utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); - this._priv = key.part.k.data; - } +// Public API +module.exports = serial; - } else { - throw (new Error('DH not supported for ' + key.type + ' keys')); - } +/** + * Runs iterator over provided array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serial(list, iterator, callback) +{ + return serialOrdered(list, iterator, null, callback); } -DiffieHellman.prototype.getPublicKey = function () { - if (this._isPriv) - return (this._key.toPublic()); - return (this._key); -}; -DiffieHellman.prototype.getPrivateKey = function () { - if (this._isPriv) - return (this._key); - else - return (undefined); -}; -DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; +/***/ }), -DiffieHellman.prototype._keyCheck = function (pk, isPub) { - assert.object(pk, 'key'); - if (!isPub) - utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); - utils.assertCompatible(pk, Key, [1, 4], 'key'); +/***/ 98: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (pk.type !== this._algo) { - throw (new Error('A ' + pk.type + ' key cannot be used in ' + - this._algo + ' Diffie-Hellman')); - } +// Copyright 2015 Joyent, Inc. - if (pk.curve !== this._curve) { - throw (new Error('A key from the ' + pk.curve + ' curve ' + - 'cannot be used with a ' + this._curve + - ' Diffie-Hellman')); - } +var Buffer = __webpack_require__(215).Buffer; - if (pk.type === 'dsa') { - assert.deepEqual(pk.part.p, this._p, - 'DSA key prime does not match'); - assert.deepEqual(pk.part.g, this._g, - 'DSA key generator does not match'); +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['A'], + sizePart: 'A' } }; +algInfo['curve25519'] = algInfo['ed25519']; -DiffieHellman.prototype.setKey = function (pk) { - this._keyCheck(pk); - - if (pk.type === 'dsa') { - this._dh.setPrivateKey(pk.part.x.data); - this._dh.setPublicKey(pk.part.y.data); +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['A', 'k'] + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - } else if (pk.type === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - this._dh.setPrivateKey(pk.part.d.data); - this._dh.setPublicKey(pk.part.Q.data); - } else { - this._priv = new ECPrivate( - this._ecParams, pk.part.d.data); - } +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true +}; - } else if (pk.type === 'curve25519') { - var k = pk.part.k; - if (!pk.part.k) - k = pk.part.r; - this._priv = k.data; - if (this._priv[0] === 0x00) - this._priv = this._priv.slice(1); - this._priv = this._priv.slice(0, 32); +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: Buffer.from(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: Buffer.from(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: Buffer.from(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: Buffer.from(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') } - this._key = pk; - this._isPriv = true; }; -DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; - -DiffieHellman.prototype.computeSecret = function (otherpk) { - this._keyCheck(otherpk, true); - if (!this._isPriv) - throw (new Error('DH exchange has not been initialized with ' + - 'a private key yet')); - - var pub; - if (this._algo === 'dsa') { - return (this._dh.computeSecret( - otherpk.part.y.data)); - - } else if (this._algo === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - return (this._dh.computeSecret( - otherpk.part.Q.data)); - } else { - pub = new ECPublic( - this._ecParams, otherpk.part.Q.data); - return (this._priv.deriveSharedSecret(pub)); - } - - } else if (this._algo === 'curve25519') { - pub = otherpk.part.A.data; - while (pub[0] === 0x00 && pub.length > 32) - pub = pub.slice(1); - var priv = this._priv; - assert.strictEqual(pub.length, 32); - assert.strictEqual(priv.length, 32); - var secret = nacl.box.before(new Uint8Array(pub), - new Uint8Array(priv)); +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves +}; - return (Buffer.from(secret)); - } - throw (new Error('Invalid algorithm: ' + this._algo)); -}; +/***/ }), -DiffieHellman.prototype.generateKey = function () { - var parts = []; - var priv, pub; - if (this._algo === 'dsa') { - this._dh.generateKeys(); +/***/ 104: +/***/ (function(__unusedmodule, __unusedexports, __webpack_require__) { - parts.push({name: 'p', data: this._p.data}); - parts.push({name: 'q', data: this._key.part.q.data}); - parts.push({name: 'g', data: this._g.data}); - parts.push({name: 'y', data: this._dh.getPublicKey()}); - parts.push({name: 'x', data: this._dh.getPrivateKey()}); - this._key = new PrivateKey({ - type: 'dsa', - parts: parts - }); - this._isPriv = true; - return (this._key); +const core = __webpack_require__(470); +const exec = __webpack_require__(986); +const request = __webpack_require__(830); +const fs = __webpack_require__(747); - } else if (this._algo === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - this._dh.generateKeys(); +let fail_ci; +try { + const name = core.getInput("name"); + const token = core.getInput("token"); + const flags = core.getInput("flags"); + const file = core.getInput("file"); + const yml = core.getInput("yml"); + fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); - parts.push({name: 'curve', - data: Buffer.from(this._curve)}); - parts.push({name: 'Q', data: this._dh.getPublicKey()}); - parts.push({name: 'd', data: this._dh.getPrivateKey()}); - this._key = new PrivateKey({ - type: 'ecdsa', - curve: this._curve, - parts: parts - }); - this._isPriv = true; - return (this._key); + if ( + fail_ci === "yes" || + fail_ci === "y" || + fail_ci === "true" || + fail_ci === "t" || + fail_ci === "1" + ) { + fail_ci = true; + } else { + fail_ci = false; + } - } else { - var n = this._ecParams.getN(); - var r = new jsbn(crypto.randomBytes(n.bitLength())); - var n1 = n.subtract(jsbn.ONE); - priv = r.mod(n1).add(jsbn.ONE); - pub = this._ecParams.getG().multiply(priv); + request("https://codecov.io/bash", (error, response, body) => { + if (error && fail_ci) { + throw error; + } else if (error) { + core.warning(`Codecov warning: ${error.message}`); + } - priv = Buffer.from(priv.toByteArray()); - pub = Buffer.from(this._ecParams.getCurve(). - encodePointHex(pub), 'hex'); + fs.writeFile("codecov.sh", body, err => { + if (err && fail_ci) { + throw err; + } else if (err) { + core.warning(`Codecov warning: ${err.message}`); + } - this._priv = new ECPrivate(this._ecParams, priv); + let output = ""; + let execError = ""; + const options = {}; + options.listeners = { + stdout: data => { + output += data.toString(); + }, + stderr: data => { + execError += data.toString(); + } + }; - parts.push({name: 'curve', - data: Buffer.from(this._curve)}); - parts.push({name: 'Q', data: pub}); - parts.push({name: 'd', data: priv}); + options.env = { + CODECOV_TOKEN: `${token}`, + GITHUB_ACTION: process.env.GITHUB_ACTION, + GITHUB_REF: process.env.GITHUB_REF, + GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, + GITHUB_SHA: process.env.GITHUB_SHA, + GITHUB_HEAD_REF: process.env.GITHUB_HEAD_REF + }; - this._key = new PrivateKey({ - type: 'ecdsa', - curve: this._curve, - parts: parts - }); - this._isPriv = true; - return (this._key); - } + const execArgs = ["codecov.sh"]; + if (file) { + execArgs.push( + "-f", `${file}` + ); + } - } else if (this._algo === 'curve25519') { - var pair = nacl.box.keyPair(); - priv = Buffer.from(pair.secretKey); - pub = Buffer.from(pair.publicKey); - priv = Buffer.concat([priv, pub]); - assert.strictEqual(priv.length, 64); - assert.strictEqual(pub.length, 32); + execArgs.push( + "-n", `${name}`, + "-F", `${flags}`, + "-y", `${yml}` + ); - parts.push({name: 'A', data: pub}); - parts.push({name: 'k', data: priv}); - this._key = new PrivateKey({ - type: 'curve25519', - parts: parts - }); - this._isPriv = true; - return (this._key); - } + if (fail_ci) { + execArgs.push( + "-Z" + ); + } - throw (new Error('Invalid algorithm: ' + this._algo)); -}; -DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; + exec.exec("bash", execArgs, options) + .catch(err => { + if (fail_ci) { + core.setFailed( + `Codecov failed with the following error: ${err.message}` + ); + } else { + core.warning(`Codecov warning: ${err.message}`); + } + }) + .then(() => { + unlinkFile(); + });; -/* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ + const unlinkFile = () => { + fs.unlink("codecov.sh", err => { + if (err && fail_ci) { + throw err; + } else if (err) { + core.warning(`Codecov warning: ${err.message}`); + } + }); + }; + }); + }); +} catch (error) { + if (fail_ci) { + core.setFailed(`Codecov failed with the following error: ${error.message}`); + } else { + core.warning(`Codecov warning: ${error.message}`); + } +} -function X9ECParameters(name) { - var params = algs.curves[name]; - assert.object(params); - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var n = new jsbn(params.n); - var h = jsbn.ONE; - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); +/***/ }), - this.curve = curve; - this.g = G; - this.n = n; - this.h = h; -} -X9ECParameters.prototype.getCurve = function () { return (this.curve); }; -X9ECParameters.prototype.getG = function () { return (this.g); }; -X9ECParameters.prototype.getN = function () { return (this.n); }; -X9ECParameters.prototype.getH = function () { return (this.h); }; +/***/ 107: +/***/ (function(module) { -function ECPublic(params, buffer) { - this._params = params; - if (buffer[0] === 0x00) - buffer = buffer.slice(1); - this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); -} +"use strict"; -function ECPrivate(params, buffer) { - this._params = params; - this._priv = new jsbn(utils.mpNormalize(buffer)); +module.exports = function generate_allOf(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $allSchemasEmpty = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + $allSchemasEmpty = false; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($breakOnError) { + if ($allSchemasEmpty) { + out += ' if (true) { '; + } else { + out += ' ' + ($closingBraces.slice(0, -1)) + ' '; + } + } + out = it.util.cleanUpCode(out); + return out; } -ECPrivate.prototype.deriveSharedSecret = function (pubKey) { - assert.ok(pubKey instanceof ECPublic); - var S = pubKey._pub.multiply(this._priv); - return (Buffer.from(S.getX().toBigInteger().toByteArray())); -}; -function generateED25519() { - var pair = nacl.sign.keyPair(); - var priv = Buffer.from(pair.secretKey); - var pub = Buffer.from(pair.publicKey); - assert.strictEqual(priv.length, 64); - assert.strictEqual(pub.length, 32); - var parts = []; - parts.push({name: 'A', data: pub}); - parts.push({name: 'k', data: priv.slice(0, 32)}); - var key = new PrivateKey({ - type: 'ed25519', - parts: parts - }); - return (key); -} +/***/ }), -/* Generates a new ECDSA private key on a given curve. */ -function generateECDSA(curve) { - var parts = []; - var key; +/***/ 113: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - if (CRYPTO_HAVE_ECDH) { - /* - * Node crypto doesn't expose key generation directly, but the - * ECDH instances can generate keys. It turns out this just - * calls into the OpenSSL generic key generator, and we can - * read its output happily without doing an actual DH. So we - * use that here. - */ - var osCurve = { - 'nistp256': 'prime256v1', - 'nistp384': 'secp384r1', - 'nistp521': 'secp521r1' - }[curve]; +var crypto = __webpack_require__(417) - var dh = crypto.createECDH(osCurve); - dh.generateKeys(); +function sha (key, body, algorithm) { + return crypto.createHmac(algorithm, key).update(body).digest('base64') +} - parts.push({name: 'curve', - data: Buffer.from(curve)}); - parts.push({name: 'Q', data: dh.getPublicKey()}); - parts.push({name: 'd', data: dh.getPrivateKey()}); +function rsa (key, body) { + return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') +} - key = new PrivateKey({ - type: 'ecdsa', - curve: curve, - parts: parts - }); - return (key); - } else { +function rfc3986 (str) { + return encodeURIComponent(str) + .replace(/!/g,'%21') + .replace(/\*/g,'%2A') + .replace(/\(/g,'%28') + .replace(/\)/g,'%29') + .replace(/'/g,'%27') +} - var ecParams = new X9ECParameters(curve); +// Maps object to bi-dimensional array +// Converts { foo: 'A', bar: [ 'b', 'B' ]} to +// [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] +function map (obj) { + var key, val, arr = [] + for (key in obj) { + val = obj[key] + if (Array.isArray(val)) + for (var i = 0; i < val.length; i++) + arr.push([key, val[i]]) + else if (typeof val === 'object') + for (var prop in val) + arr.push([key + '[' + prop + ']', val[prop]]) + else + arr.push([key, val]) + } + return arr +} - /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ - var n = ecParams.getN(); - /* - * The crypto.randomBytes() function can only give us whole - * bytes, so taking a nod from X9.62, we round up. - */ - var cByteLen = Math.ceil((n.bitLength() + 64) / 8); - var c = new jsbn(crypto.randomBytes(cByteLen)); +// Compare function for sort +function compare (a, b) { + return a > b ? 1 : a < b ? -1 : 0 +} - var n1 = n.subtract(jsbn.ONE); - var priv = c.mod(n1).add(jsbn.ONE); - var pub = ecParams.getG().multiply(priv); +function generateBase (httpMethod, base_uri, params) { + // adapted from https://dev.twitter.com/docs/auth/oauth and + // https://dev.twitter.com/docs/auth/creating-signature - priv = Buffer.from(priv.toByteArray()); - pub = Buffer.from(ecParams.getCurve(). - encodePointHex(pub), 'hex'); + // Parameter normalization + // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 + var normalized = map(params) + // 1. First, the name and value of each parameter are encoded + .map(function (p) { + return [ rfc3986(p[0]), rfc3986(p[1] || '') ] + }) + // 2. The parameters are sorted by name, using ascending byte value + // ordering. If two or more parameters share the same name, they + // are sorted by their value. + .sort(function (a, b) { + return compare(a[0], b[0]) || compare(a[1], b[1]) + }) + // 3. The name of each parameter is concatenated to its corresponding + // value using an "=" character (ASCII code 61) as a separator, even + // if the value is empty. + .map(function (p) { return p.join('=') }) + // 4. The sorted name/value pairs are concatenated together into a + // single string by using an "&" character (ASCII code 38) as + // separator. + .join('&') - parts.push({name: 'curve', data: Buffer.from(curve)}); - parts.push({name: 'Q', data: pub}); - parts.push({name: 'd', data: priv}); + var base = [ + rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), + rfc3986(base_uri), + rfc3986(normalized) + ].join('&') - key = new PrivateKey({ - type: 'ecdsa', - curve: curve, - parts: parts - }); - return (key); - } + return base } +function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { + var base = generateBase(httpMethod, base_uri, params) + var key = [ + consumer_secret || '', + token_secret || '' + ].map(rfc3986).join('&') -/***/ }), - -/***/ 112: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + return sha(key, base, 'sha1') +} -"use strict"; +function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { + var base = generateBase(httpMethod, base_uri, params) + var key = [ + consumer_secret || '', + token_secret || '' + ].map(rfc3986).join('&') + return sha(key, base, 'sha256') +} -var qs = __webpack_require__(208) -var querystring = __webpack_require__(191) +function rsasign (httpMethod, base_uri, params, private_key, token_secret) { + var base = generateBase(httpMethod, base_uri, params) + var key = private_key || '' -function Querystring (request) { - this.request = request - this.lib = null - this.useQuerystring = null - this.parseOptions = null - this.stringifyOptions = null + return rsa(key, base) } -Querystring.prototype.init = function (options) { - if (this.lib) { return } - - this.useQuerystring = options.useQuerystring - this.lib = (this.useQuerystring ? querystring : qs) +function plaintext (consumer_secret, token_secret) { + var key = [ + consumer_secret || '', + token_secret || '' + ].map(rfc3986).join('&') - this.parseOptions = options.qsParseOptions || {} - this.stringifyOptions = options.qsStringifyOptions || {} + return key } -Querystring.prototype.stringify = function (obj) { - return (this.useQuerystring) - ? this.rfc3986(this.lib.stringify(obj, - this.stringifyOptions.sep || null, - this.stringifyOptions.eq || null, - this.stringifyOptions)) - : this.lib.stringify(obj, this.stringifyOptions) -} +function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { + var method + var skipArgs = 1 -Querystring.prototype.parse = function (str) { - return (this.useQuerystring) - ? this.lib.parse(str, - this.parseOptions.sep || null, - this.parseOptions.eq || null, - this.parseOptions) - : this.lib.parse(str, this.parseOptions) -} + switch (signMethod) { + case 'RSA-SHA1': + method = rsasign + break + case 'HMAC-SHA1': + method = hmacsign + break + case 'HMAC-SHA256': + method = hmacsign256 + break + case 'PLAINTEXT': + method = plaintext + skipArgs = 4 + break + default: + throw new Error('Signature method not supported: ' + signMethod) + } -Querystring.prototype.rfc3986 = function (str) { - return str.replace(/[!'()*]/g, function (c) { - return '%' + c.charCodeAt(0).toString(16).toUpperCase() - }) + return method.apply(null, [].slice.call(arguments, skipArgs)) } -Querystring.prototype.unescape = querystring.unescape +exports.hmacsign = hmacsign +exports.hmacsign256 = hmacsign256 +exports.rsasign = rsasign +exports.plaintext = plaintext +exports.sign = sign +exports.rfc3986 = rfc3986 +exports.generateBase = generateBase + +/***/ }), -exports.Querystring = Querystring +/***/ 129: +/***/ (function(module) { +module.exports = require("child_process"); /***/ }), -/***/ 115: +/***/ 139: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2015 Joyent, Inc. - -var parser = __webpack_require__(490); -var signer = __webpack_require__(443); -var verify = __webpack_require__(772); -var utils = __webpack_require__(329); - - - -///--- API - -module.exports = { - - parse: parser.parseRequest, - parseRequest: parser.parseRequest, - - sign: signer.signRequest, - signRequest: signer.signRequest, - createSigner: signer.createSigner, - isSigner: signer.isSigner, +// Unique ID creation requires a high quality random # generator. In node.js +// this is pretty straight-forward - we use the crypto API. - sshKeyToPEM: utils.sshKeyToPEM, - sshKeyFingerprint: utils.fingerprint, - pemToRsaSSHKey: utils.pemToRsaSSHKey, +var crypto = __webpack_require__(417); - verify: verify.verifySignature, - verifySignature: verify.verifySignature, - verifyHMAC: verify.verifyHMAC +module.exports = function nodeRNG() { + return crypto.randomBytes(16); }; /***/ }), -/***/ 127: +/***/ 147: /***/ (function(module) { -module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 128: -/***/ (function(module) { +// API +module.exports = state; -module.exports = {"$id":"page.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","id","title","pageTimings"],"properties":{"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"id":{"type":"string","unique":true},"title":{"type":"string"},"pageTimings":{"$ref":"pageTimings.json#"},"comment":{"type":"string"}}}; +/** + * Creates initial state object + * for iteration over list + * + * @param {array|object} list - list to iterate over + * @param {function|null} sortMethod - function to use for keys sort, + * or `null` to keep them as is + * @returns {object} - initial state object + */ +function state(list, sortMethod) +{ + var isNamedList = !Array.isArray(list) + , initState = + { + index : 0, + keyedList: isNamedList || sortMethod ? Object.keys(list) : null, + jobs : {}, + results : isNamedList ? {} : [], + size : isNamedList ? Object.keys(list).length : list.length + } + ; -/***/ }), + if (sortMethod) + { + // sort array keys based on it's values + // sort object's keys just on own merit + initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) + { + return sortMethod(list[a], list[b]); + }); + } -/***/ 129: -/***/ (function(module) { + return initState; +} -module.exports = require("child_process"); /***/ }), -/***/ 133: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var Key = __webpack_require__(501); -var Fingerprint = __webpack_require__(98); -var Signature = __webpack_require__(437); -var PrivateKey = __webpack_require__(172); -var Certificate = __webpack_require__(646); -var Identity = __webpack_require__(183); -var errs = __webpack_require__(481); +/***/ 149: +/***/ (function(module, exports, __webpack_require__) { -module.exports = { - /* top-level classes */ - Key: Key, - parseKey: Key.parse, - Fingerprint: Fingerprint, - parseFingerprint: Fingerprint.parse, - Signature: Signature, - parseSignature: Signature.parse, - PrivateKey: PrivateKey, - parsePrivateKey: PrivateKey.parse, - generatePrivateKey: PrivateKey.generate, - Certificate: Certificate, - parseCertificate: Certificate.parse, - createSelfSignedCertificate: Certificate.createSelfSigned, - createCertificate: Certificate.create, - Identity: Identity, - identityFromDN: Identity.parseDN, - identityForHost: Identity.forHost, - identityForUser: Identity.forUser, - identityForEmail: Identity.forEmail, - identityFromArray: Identity.fromArray, +/* eslint-disable node/no-deprecated-api */ +var buffer = __webpack_require__(293) +var Buffer = buffer.Buffer - /* errors */ - FingerprintFormatError: errs.FingerprintFormatError, - InvalidAlgorithmError: errs.InvalidAlgorithmError, - KeyParseError: errs.KeyParseError, - SignatureParseError: errs.SignatureParseError, - KeyEncryptedError: errs.KeyEncryptedError, - CertificateParseError: errs.CertificateParseError -}; +// alternative to using Object.keys for old browsers +function copyProps (src, dst) { + for (var key in src) { + dst[key] = src[key] + } +} +if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { + module.exports = buffer +} else { + // Copy properties from require('buffer') + copyProps(buffer, exports) + exports.Buffer = SafeBuffer +} +function SafeBuffer (arg, encodingOrOffset, length) { + return Buffer(arg, encodingOrOffset, length) +} -/***/ }), +SafeBuffer.prototype = Object.create(Buffer.prototype) -/***/ 141: -/***/ (function(module) { +// Copy static methods from Buffer +copyProps(Buffer, SafeBuffer) -"use strict"; +SafeBuffer.from = function (arg, encodingOrOffset, length) { + if (typeof arg === 'number') { + throw new TypeError('Argument must not be a number') + } + return Buffer(arg, encodingOrOffset, length) +} -module.exports = function generate_uniqueItems(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; +SafeBuffer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') } - if (($schema || $isData) && it.opts.uniqueItems !== false) { - if ($isData) { - out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { '; - } - out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { '; - var $itemType = it.schema.items && it.schema.items.type, - $typeIsArray = Array.isArray($itemType); - if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { - out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; - } else { - out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; - var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); - out += ' if (' + (it.util[$method]($itemType, 'item', true)) + ') continue; '; - if ($typeIsArray) { - out += ' if (typeof item == \'string\') item = \'"\' + item; '; - } - out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; - } - out += ' } '; - if ($isData) { - out += ' } '; - } - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } + var buf = Buffer(size) + if (fill !== undefined) { + if (typeof encoding === 'string') { + buf.fill(fill, encoding) } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else { '; + buf.fill(fill) } } else { - if ($breakOnError) { - out += ' if (true) { '; - } + buf.fill(0) } - return out; + return buf } +SafeBuffer.allocUnsafe = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return Buffer(size) +} -/***/ }), - -/***/ 152: -/***/ (function(module) { +SafeBuffer.allocUnsafeSlow = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return buffer.SlowBuffer(size) +} -module.exports = {"$id":"har.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["log"],"properties":{"log":{"$ref":"log.json#"}}}; /***/ }), -/***/ 153: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -var Ajv = __webpack_require__(788) -var HARError = __webpack_require__(261) -var schemas = __webpack_require__(385) +/***/ 152: +/***/ (function(module, __unusedexports, __webpack_require__) { -var ajv +var Stream = __webpack_require__(413).Stream; +var util = __webpack_require__(669); -function createAjvInstance () { - var ajv = new Ajv({ - allErrors: true - }) - ajv.addMetaSchema(__webpack_require__(663)) - ajv.addSchema(schemas) +module.exports = DelayedStream; +function DelayedStream() { + this.source = null; + this.dataSize = 0; + this.maxDataSize = 1024 * 1024; + this.pauseStream = true; - return ajv + this._maxDataSizeExceeded = false; + this._released = false; + this._bufferedEvents = []; } +util.inherits(DelayedStream, Stream); -function validate (name, data) { - data = data || {} - - // validator config - ajv = ajv || createAjvInstance() - - var validate = ajv.getSchema(name + '.json') - - return new Promise(function (resolve, reject) { - var valid = validate(data) +DelayedStream.create = function(source, options) { + var delayedStream = new this(); - !valid ? reject(new HARError(validate.errors)) : resolve(data) - }) -} + options = options || {}; + for (var option in options) { + delayedStream[option] = options[option]; + } -exports.afterRequest = function (data) { - return validate('afterRequest', data) -} + delayedStream.source = source; -exports.beforeRequest = function (data) { - return validate('beforeRequest', data) -} + var realEmit = source.emit; + source.emit = function() { + delayedStream._handleEmit(arguments); + return realEmit.apply(source, arguments); + }; -exports.browser = function (data) { - return validate('browser', data) -} + source.on('error', function() {}); + if (delayedStream.pauseStream) { + source.pause(); + } -exports.cache = function (data) { - return validate('cache', data) -} + return delayedStream; +}; -exports.content = function (data) { - return validate('content', data) -} +Object.defineProperty(DelayedStream.prototype, 'readable', { + configurable: true, + enumerable: true, + get: function() { + return this.source.readable; + } +}); -exports.cookie = function (data) { - return validate('cookie', data) -} +DelayedStream.prototype.setEncoding = function() { + return this.source.setEncoding.apply(this.source, arguments); +}; -exports.creator = function (data) { - return validate('creator', data) -} +DelayedStream.prototype.resume = function() { + if (!this._released) { + this.release(); + } -exports.entry = function (data) { - return validate('entry', data) -} + this.source.resume(); +}; -exports.har = function (data) { - return validate('har', data) -} +DelayedStream.prototype.pause = function() { + this.source.pause(); +}; -exports.header = function (data) { - return validate('header', data) -} +DelayedStream.prototype.release = function() { + this._released = true; -exports.log = function (data) { - return validate('log', data) -} + this._bufferedEvents.forEach(function(args) { + this.emit.apply(this, args); + }.bind(this)); + this._bufferedEvents = []; +}; -exports.page = function (data) { - return validate('page', data) -} +DelayedStream.prototype.pipe = function() { + var r = Stream.prototype.pipe.apply(this, arguments); + this.resume(); + return r; +}; -exports.pageTimings = function (data) { - return validate('pageTimings', data) -} +DelayedStream.prototype._handleEmit = function(args) { + if (this._released) { + this.emit.apply(this, args); + return; + } -exports.postData = function (data) { - return validate('postData', data) -} + if (args[0] === 'data') { + this.dataSize += args[1].length; + this._checkIfMaxDataSizeExceeded(); + } -exports.query = function (data) { - return validate('query', data) -} + this._bufferedEvents.push(args); +}; -exports.request = function (data) { - return validate('request', data) -} +DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { + if (this._maxDataSizeExceeded) { + return; + } -exports.response = function (data) { - return validate('response', data) -} + if (this.dataSize <= this.maxDataSize) { + return; + } -exports.timings = function (data) { - return validate('timings', data) -} + this._maxDataSizeExceeded = true; + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' + this.emit('error', new Error(message)); +}; /***/ }), -/***/ 159: +/***/ 154: /***/ (function(module) { "use strict"; @@ -4293,9 +2679,119 @@ module.exports = function generate_contains(it, $keyword, $ruleType) { } +/***/ }), + +/***/ 157: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var async = __webpack_require__(751) + , abort = __webpack_require__(566) + ; + +// API +module.exports = iterate; + +/** + * Iterates over each job object + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {object} state - current job status + * @param {function} callback - invoked when all elements processed + */ +function iterate(list, iterator, state, callback) +{ + // store current index + var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; + + state.jobs[key] = runJob(iterator, key, list[key], function(error, output) + { + // don't repeat yourself + // skip secondary callbacks + if (!(key in state.jobs)) + { + return; + } + + // clean up jobs + delete state.jobs[key]; + + if (error) + { + // don't process rest of the results + // stop still active jobs + // and reset the list + abort(state); + } + else + { + state.results[key] = output; + } + + // return salvaged results + callback(error, state.results); + }); +} + +/** + * Runs iterator over provided job element + * + * @param {function} iterator - iterator to invoke + * @param {string|number} key - key/index of the element in the list of jobs + * @param {mixed} item - job description + * @param {function} callback - invoked after iterator is done with the job + * @returns {function|mixed} - job abort function or something else + */ +function runJob(iterator, key, item, callback) +{ + var aborter; + + // allow shortcut if iterator expects only two arguments + if (iterator.length == 2) + { + aborter = iterator(item, async(callback)); + } + // otherwise go with full three arguments + else + { + aborter = iterator(item, key, async(callback)); + } + + return aborter; +} + + +/***/ }), + +/***/ 158: +/***/ (function(module) { + +module.exports = {"_args":[["tough-cookie@2.4.3","C:\\Projects\\codecov-action"]],"_from":"tough-cookie@2.4.3","_id":"tough-cookie@2.4.3","_inBundle":false,"_integrity":"sha512-Q5srk/4vDM54WJsJio3XNn6K2sCG+CQ8G5Wz6bZhRZoAe/+TxjWB/GlFAnYEbkYVlON9FMk/fE3h2RLpPXo4lQ==","_location":"/tough-cookie","_phantomChildren":{},"_requested":{"type":"version","registry":true,"raw":"tough-cookie@2.4.3","name":"tough-cookie","escapedName":"tough-cookie","rawSpec":"2.4.3","saveSpec":null,"fetchSpec":"2.4.3"},"_requiredBy":["/request"],"_resolved":"https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.4.3.tgz","_spec":"2.4.3","_where":"C:\\Projects\\codecov-action","author":{"name":"Jeremy Stashewsky","email":"jstash@gmail.com"},"bugs":{"url":"https://github.com/salesforce/tough-cookie/issues"},"contributors":[{"name":"Alexander Savin"},{"name":"Ian Livingstone"},{"name":"Ivan Nikulin"},{"name":"Lalit Kapoor"},{"name":"Sam Thompson"},{"name":"Sebastian Mayr"}],"dependencies":{"psl":"^1.1.24","punycode":"^1.4.1"},"description":"RFC6265 Cookies and Cookie Jar for node.js","devDependencies":{"async":"^1.4.2","nyc":"^11.6.0","string.prototype.repeat":"^0.2.0","vows":"^0.8.1"},"engines":{"node":">=0.8"},"files":["lib"],"homepage":"https://github.com/salesforce/tough-cookie","keywords":["HTTP","cookie","cookies","set-cookie","cookiejar","jar","RFC6265","RFC2965"],"license":"BSD-3-Clause","main":"./lib/cookie","name":"tough-cookie","repository":{"type":"git","url":"git://github.com/salesforce/tough-cookie.git"},"scripts":{"cover":"nyc --reporter=lcov --reporter=html vows test/*_test.js","test":"vows test/*_test.js"},"version":"2.4.3"}; + /***/ }), /***/ 162: +/***/ (function(module) { + +module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 181: +/***/ (function(module) { + +module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 191: +/***/ (function(module) { + +module.exports = require("querystring"); + +/***/ }), + +/***/ 196: /***/ (function(module, __unusedexports, __webpack_require__) { (function(nacl) { @@ -6616,3098 +5112,4196 @@ nacl.sign.keyPair.fromSecretKey = function(secretKey) { if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; - return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; -}; - -nacl.sign.keyPair.fromSeed = function(seed) { - checkArrayTypes(seed); - if (seed.length !== crypto_sign_SEEDBYTES) - throw new Error('bad seed size'); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - for (var i = 0; i < 32; i++) sk[i] = seed[i]; - crypto_sign_keypair(pk, sk, true); - return {publicKey: pk, secretKey: sk}; -}; - -nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; -nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; -nacl.sign.seedLength = crypto_sign_SEEDBYTES; -nacl.sign.signatureLength = crypto_sign_BYTES; - -nacl.hash = function(msg) { - checkArrayTypes(msg); - var h = new Uint8Array(crypto_hash_BYTES); - crypto_hash(h, msg, msg.length); - return h; -}; - -nacl.hash.hashLength = crypto_hash_BYTES; - -nacl.verify = function(x, y) { - checkArrayTypes(x, y); - // Zero length arguments are considered not equal. - if (x.length === 0 || y.length === 0) return false; - if (x.length !== y.length) return false; - return (vn(x, 0, y, 0, x.length) === 0) ? true : false; -}; - -nacl.setPRNG = function(fn) { - randombytes = fn; -}; - -(function() { - // Initialize PRNG if environment provides CSPRNG. - // If not, methods calling randombytes will throw. - var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; - if (crypto && crypto.getRandomValues) { - // Browsers. - var QUOTA = 65536; - nacl.setPRNG(function(x, n) { - var i, v = new Uint8Array(n); - for (i = 0; i < n; i += QUOTA) { - crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); - } - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } else if (true) { - // Node.js. - crypto = __webpack_require__(417); - if (crypto && crypto.randomBytes) { - nacl.setPRNG(function(x, n) { - var i, v = crypto.randomBytes(n); - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } - } -})(); - -})( true && module.exports ? module.exports : (self.nacl = self.nacl || {})); - - -/***/ }), - -/***/ 166: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate__limitItems(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $op = $keyword == 'maxItems' ? '>' : '<'; - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have '; - if ($keyword == 'maxItems') { - out += 'more'; - } else { - out += 'fewer'; - } - out += ' than '; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + ($schema); - } - out += ' items\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 172: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = PrivateKey; - -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(98); -var Signature = __webpack_require__(437); -var errs = __webpack_require__(481); -var util = __webpack_require__(669); -var utils = __webpack_require__(57); -var dhe = __webpack_require__(99); -var generateECDSA = dhe.generateECDSA; -var generateED25519 = dhe.generateED25519; -var edCompat = __webpack_require__(198); -var nacl = __webpack_require__(162); - -var Key = __webpack_require__(501); - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; -var KeyEncryptedError = errs.KeyEncryptedError; - -var formats = {}; -formats['auto'] = __webpack_require__(466); -formats['pem'] = __webpack_require__(207); -formats['pkcs1'] = __webpack_require__(867); -formats['pkcs8'] = __webpack_require__(603); -formats['rfc4253'] = __webpack_require__(563); -formats['ssh-private'] = __webpack_require__(62); -formats['openssh'] = formats['ssh-private']; -formats['ssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(962); - -function PrivateKey(opts) { - assert.object(opts, 'options'); - Key.call(this, opts); - - this._pubCache = undefined; -} -util.inherits(PrivateKey, Key); - -PrivateKey.formats = formats; - -PrivateKey.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'pkcs1'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - return (formats[format].write(this, options)); -}; - -PrivateKey.prototype.hash = function (algo, type) { - return (this.toPublic().hash(algo, type)); -}; - -PrivateKey.prototype.fingerprint = function (algo, type) { - return (this.toPublic().fingerprint(algo, type)); -}; - -PrivateKey.prototype.toPublic = function () { - if (this._pubCache) - return (this._pubCache); - - var algInfo = algs.info[this.type]; - var pubParts = []; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = algInfo.parts[i]; - pubParts.push(this.part[p]); - } - - this._pubCache = new Key({ - type: this.type, - source: this, - parts: pubParts - }); - if (this.comment) - this._pubCache.comment = this.comment; - return (this._pubCache); -}; - -PrivateKey.prototype.derive = function (newType) { - assert.string(newType, 'type'); - var priv, pub, pair; - - if (this.type === 'ed25519' && newType === 'curve25519') { - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'curve25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } else if (this.type === 'curve25519' && newType === 'ed25519') { - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'ed25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } - throw (new Error('Key derivation not supported from ' + this.type + - ' to ' + newType)); -}; - -PrivateKey.prototype.createVerify = function (hashAlgo) { - return (this.toPublic().createVerify(hashAlgo)); -}; - -PrivateKey.prototype.createSign = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Signer(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldSign = v.sign.bind(v); - var key = this.toBuffer('pkcs1'); - var type = this.type; - var curve = this.curve; - v.sign = function () { - var sig = oldSign(key); - if (typeof (sig) === 'string') - sig = Buffer.from(sig, 'binary'); - sig = Signature.parse(sig, type, 'asn1'); - sig.hashAlgorithm = hashAlgo; - sig.curve = curve; - return (sig); - }; - return (v); -}; - -PrivateKey.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - assert.ok(k instanceof PrivateKey, 'key is not a private key'); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } + for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; + return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; -PrivateKey.isPrivateKey = function (obj, ver) { - return (utils.isCompatible(obj, PrivateKey, ver)); +nacl.sign.keyPair.fromSeed = function(seed) { + checkArrayTypes(seed); + if (seed.length !== crypto_sign_SEEDBYTES) + throw new Error('bad seed size'); + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); + for (var i = 0; i < 32; i++) sk[i] = seed[i]; + crypto_sign_keypair(pk, sk, true); + return {publicKey: pk, secretKey: sk}; }; -PrivateKey.generate = function (type, options) { - if (options === undefined) - options = {}; - assert.object(options, 'options'); +nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; +nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; +nacl.sign.seedLength = crypto_sign_SEEDBYTES; +nacl.sign.signatureLength = crypto_sign_BYTES; - switch (type) { - case 'ecdsa': - if (options.curve === undefined) - options.curve = 'nistp256'; - assert.string(options.curve, 'options.curve'); - return (generateECDSA(options.curve)); - case 'ed25519': - return (generateED25519()); - default: - throw (new Error('Key generation not supported with key ' + - 'type "' + type + '"')); - } +nacl.hash = function(msg) { + checkArrayTypes(msg); + var h = new Uint8Array(crypto_hash_BYTES); + crypto_hash(h, msg, msg.length); + return h; }; -/* - * API versions for PrivateKey: - * [1,0] -- initial ver - * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats - * [1,2] -- added defaultHashAlgorithm - * [1,3] -- added derive, ed, createDH - * [1,4] -- first tagged version - * [1,5] -- changed ed25519 part names and format - * [1,6] -- type arguments for hash() and fingerprint() - */ -PrivateKey.prototype._sshpkApiVersion = [1, 6]; +nacl.hash.hashLength = crypto_hash_BYTES; -PrivateKey._oldVersionDetect = function (obj) { - assert.func(obj.toPublic); - assert.func(obj.createSign); - if (obj.derive) - return ([1, 3]); - if (obj.defaultHashAlgorithm) - return ([1, 2]); - if (obj.formats['auto']) - return ([1, 1]); - return ([1, 0]); +nacl.verify = function(x, y) { + checkArrayTypes(x, y); + // Zero length arguments are considered not equal. + if (x.length === 0 || y.length === 0) return false; + if (x.length !== y.length) return false; + return (vn(x, 0, y, 0, x.length) === 0) ? true : false; +}; + +nacl.setPRNG = function(fn) { + randombytes = fn; }; +(function() { + // Initialize PRNG if environment provides CSPRNG. + // If not, methods calling randombytes will throw. + var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; + if (crypto && crypto.getRandomValues) { + // Browsers. + var QUOTA = 65536; + nacl.setPRNG(function(x, n) { + var i, v = new Uint8Array(n); + for (i = 0; i < n; i += QUOTA) { + crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); + } + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); + } else if (true) { + // Node.js. + crypto = __webpack_require__(417); + if (crypto && crypto.randomBytes) { + nacl.setPRNG(function(x, n) { + var i, v = crypto.randomBytes(n); + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); + } + } +})(); + +})( true && module.exports ? module.exports : (self.nacl = self.nacl || {})); + /***/ }), -/***/ 183: -/***/ (function(module, __unusedexports, __webpack_require__) { +/***/ 211: +/***/ (function(module) { -// Copyright 2017 Joyent, Inc. +module.exports = require("https"); -module.exports = Identity; +/***/ }), -var assert = __webpack_require__(976); -var algs = __webpack_require__(778); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(98); -var Signature = __webpack_require__(437); -var errs = __webpack_require__(481); -var util = __webpack_require__(669); -var utils = __webpack_require__(57); -var asn1 = __webpack_require__(856); -var Buffer = __webpack_require__(601).Buffer; +/***/ 213: +/***/ (function(module) { -/*JSSTYLED*/ -var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; +module.exports = require("punycode"); -var oids = {}; -oids.cn = '2.5.4.3'; -oids.o = '2.5.4.10'; -oids.ou = '2.5.4.11'; -oids.l = '2.5.4.7'; -oids.s = '2.5.4.8'; -oids.c = '2.5.4.6'; -oids.sn = '2.5.4.4'; -oids.postalCode = '2.5.4.17'; -oids.serialNumber = '2.5.4.5'; -oids.street = '2.5.4.9'; -oids.x500UniqueIdentifier = '2.5.4.45'; -oids.role = '2.5.4.72'; -oids.telephoneNumber = '2.5.4.20'; -oids.description = '2.5.4.13'; -oids.dc = '0.9.2342.19200300.100.1.25'; -oids.uid = '0.9.2342.19200300.100.1.1'; -oids.mail = '0.9.2342.19200300.100.1.3'; -oids.title = '2.5.4.12'; -oids.gn = '2.5.4.42'; -oids.initials = '2.5.4.43'; -oids.pseudonym = '2.5.4.65'; -oids.emailAddress = '1.2.840.113549.1.9.1'; +/***/ }), -var unoids = {}; -Object.keys(oids).forEach(function (k) { - unoids[oids[k]] = k; -}); +/***/ 215: +/***/ (function(module, __unusedexports, __webpack_require__) { -function Identity(opts) { - var self = this; - assert.object(opts, 'options'); - assert.arrayOfObject(opts.components, 'options.components'); - this.components = opts.components; - this.componentLookup = {}; - this.components.forEach(function (c) { - if (c.name && !c.oid) - c.oid = oids[c.name]; - if (c.oid && !c.name) - c.name = unoids[c.oid]; - if (self.componentLookup[c.name] === undefined) - self.componentLookup[c.name] = []; - self.componentLookup[c.name].push(c); - }); - if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { - this.cn = this.componentLookup.cn[0].value; - } - assert.optionalString(opts.type, 'options.type'); - if (opts.type === undefined) { - if (this.components.length === 1 && - this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; +"use strict"; +/* eslint-disable node/no-deprecated-api */ - } else if (this.componentLookup.dc && - this.components.length === this.componentLookup.dc.length) { - this.type = 'host'; - this.hostname = this.componentLookup.dc.map( - function (c) { - return (c.value); - }).join('.'); - } else if (this.componentLookup.uid && - this.components.length === - this.componentLookup.uid.length) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; +var buffer = __webpack_require__(293) +var Buffer = buffer.Buffer - } else if (this.componentLookup.uid && - this.componentLookup.uid.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; +var safer = {} - } else if (this.componentLookup.mail && - this.componentLookup.mail.length === 1) { - this.type = 'email'; - this.email = this.componentLookup.mail[0].value; +var key - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.cn[0].value; +for (key in buffer) { + if (!buffer.hasOwnProperty(key)) continue + if (key === 'SlowBuffer' || key === 'Buffer') continue + safer[key] = buffer[key] +} - } else { - this.type = 'unknown'; - } - } else { - this.type = opts.type; - if (this.type === 'host') - this.hostname = opts.hostname; - else if (this.type === 'user') - this.uid = opts.uid; - else if (this.type === 'email') - this.email = opts.email; - else - throw (new Error('Unknown type ' + this.type)); - } +var Safer = safer.Buffer = {} +for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue + if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue + Safer[key] = Buffer[key] } -Identity.prototype.toString = function () { - return (this.components.map(function (c) { - var n = c.name.toUpperCase(); - /*JSSTYLED*/ - n = n.replace(/=/g, '\\='); - var v = c.value; - /*JSSTYLED*/ - v = v.replace(/,/g, '\\,'); - return (n + '=' + v); - }).join(', ')); -}; +safer.Buffer.prototype = Buffer.prototype -Identity.prototype.get = function (name, asArray) { - assert.string(name, 'name'); - var arr = this.componentLookup[name]; - if (arr === undefined || arr.length === 0) - return (undefined); - if (!asArray && arr.length > 1) - throw (new Error('Multiple values for attribute ' + name)); - if (!asArray) - return (arr[0].value); - return (arr.map(function (c) { - return (c.value); - })); -}; +if (!Safer.from || Safer.from === Uint8Array.from) { + Safer.from = function (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) + } + if (value && typeof value.length === 'undefined') { + throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) + } + return Buffer(value, encodingOrOffset, length) + } +} -Identity.prototype.toArray = function (idx) { - return (this.components.map(function (c) { - return ({ - name: c.name, - value: c.value - }); - })); -}; +if (!Safer.alloc) { + Safer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + var buf = Buffer(size) + if (!fill || fill.length === 0) { + buf.fill(0) + } else if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + return buf + } +} -/* - * These are from X.680 -- PrintableString allowed chars are in section 37.4 - * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to - * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 - * (the basic ASCII character set). - */ -/* JSSTYLED */ -var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; -/* JSSTYLED */ -var NOT_IA5 = /[^\x00-\x7f]/; +if (!safer.kStringMaxLength) { + try { + safer.kStringMaxLength = process.binding('buffer').kStringMaxLength + } catch (e) { + // we can't determine kStringMaxLength in environments where process.binding + // is unsupported, so let's not set it + } +} -Identity.prototype.toAsn1 = function (der, tag) { - der.startSequence(tag); - this.components.forEach(function (c) { - der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); - der.startSequence(); - der.writeOID(c.oid); - /* - * If we fit in a PrintableString, use that. Otherwise use an - * IA5String or UTF8String. - * - * If this identity was parsed from a DN, use the ASN.1 types - * from the original representation (otherwise this might not - * be a full match for the original in some validators). - */ - if (c.asn1type === asn1.Ber.Utf8String || - c.value.match(NOT_IA5)) { - var v = Buffer.from(c.value, 'utf8'); - der.writeBuffer(v, asn1.Ber.Utf8String); +if (!safer.constants) { + safer.constants = { + MAX_LENGTH: safer.kMaxLength + } + if (safer.kStringMaxLength) { + safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength + } +} - } else if (c.asn1type === asn1.Ber.IA5String || - c.value.match(NOT_PRINTABLE)) { - der.writeString(c.value, asn1.Ber.IA5String); +module.exports = safer + + +/***/ }), + +/***/ 222: +/***/ (function(module) { + +module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 226: +/***/ (function(module) { + +module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 233: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_dependencies(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $schemaDeps = {}, + $propertyDeps = {}, + $ownProperties = it.opts.ownProperties; + for ($property in $schema) { + var $sch = $schema[$property]; + var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps; + $deps[$property] = $sch; + } + out += 'var ' + ($errs) + ' = errors;'; + var $currentErrorPath = it.errorPath; + out += 'var missing' + ($lvl) + ';'; + for (var $property in $propertyDeps) { + $deps = $propertyDeps[$property]; + if ($deps.length) { + out += ' if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; + } + if ($breakOnError) { + out += ' && ( '; + var arr1 = $deps; + if (arr1) { + var $propertyKey, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $propertyKey = arr1[$i += 1]; + if ($i) { + out += ' || '; + } + var $prop = it.util.getProperty($propertyKey), + $useData = $data + $prop; + out += ' ( ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; + } + } + out += ')) { '; + var $propertyPath = 'missing' + $lvl, + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should have '; + if ($deps.length == 1) { + out += 'property ' + (it.util.escapeQuotes($deps[0])); + } else { + out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); + } + out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } else { + out += ' ) { '; + var arr2 = $deps; + if (arr2) { + var $propertyKey, i2 = -1, + l2 = arr2.length - 1; + while (i2 < l2) { + $propertyKey = arr2[i2 += 1]; + var $prop = it.util.getProperty($propertyKey), + $missingProperty = it.util.escapeQuotes($propertyKey), + $useData = $data + $prop; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should have '; + if ($deps.length == 1) { + out += 'property ' + (it.util.escapeQuotes($deps[0])); + } else { + out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); + } + out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; + } + } + } + out += ' } '; + if ($breakOnError) { + $closingBraces += '}'; + out += ' else { '; + } + } + } + it.errorPath = $currentErrorPath; + var $currentBaseId = $it.baseId; + for (var $property in $schemaDeps) { + var $sch = $schemaDeps[$property]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; + } + out += ') { '; + $it.schema = $sch; + $it.schemaPath = $schemaPath + it.util.getProperty($property); + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + out = it.util.cleanUpCode(out); + return out; +} - } else { - var type = asn1.Ber.PrintableString; - if (c.asn1type !== undefined) - type = c.asn1type; - der.writeString(c.value, type); - } - der.endSequence(); - der.endSequence(); - }); - der.endSequence(); -}; -function globMatch(a, b) { - if (a === '**' || b === '**') - return (true); - var aParts = a.split('.'); - var bParts = b.split('.'); - if (aParts.length !== bParts.length) - return (false); - for (var i = 0; i < aParts.length; ++i) { - if (aParts[i] === '*' || bParts[i] === '*') - continue; - if (aParts[i] !== bParts[i]) - return (false); - } - return (true); -} +/***/ }), -Identity.prototype.equals = function (other) { - if (!Identity.isIdentity(other, [1, 0])) - return (false); - if (other.components.length !== this.components.length) - return (false); - for (var i = 0; i < this.components.length; ++i) { - if (this.components[i].oid !== other.components[i].oid) - return (false); - if (!globMatch(this.components[i].value, - other.components[i].value)) { - return (false); - } - } - return (true); -}; +/***/ 241: +/***/ (function(module, __unusedexports, __webpack_require__) { -Identity.forHost = function (hostname) { - assert.string(hostname, 'hostname'); - return (new Identity({ - type: 'host', - hostname: hostname, - components: [ { name: 'cn', value: hostname } ] - })); -}; +// Copyright 2018 Joyent, Inc. -Identity.forUser = function (uid) { - assert.string(uid, 'uid'); - return (new Identity({ - type: 'user', - uid: uid, - components: [ { name: 'uid', value: uid } ] - })); +module.exports = { + read: read, + write: write }; -Identity.forEmail = function (email) { - assert.string(email, 'email'); - return (new Identity({ - type: 'email', - email: email, - components: [ { name: 'mail', value: email } ] - })); -}; +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); -Identity.parseDN = function (dn) { - assert.string(dn, 'dn'); - var parts = ['']; - var idx = 0; - var rem = dn; - while (rem.length > 0) { - var m; - /*JSSTYLED*/ - if ((m = /^,/.exec(rem)) !== null) { - parts[++idx] = ''; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^\\,/.exec(rem)) !== null) { - parts[idx] += ','; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^\\./.exec(rem)) !== null) { - parts[idx] += m[0]; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { - parts[idx] += m[0]; - rem = rem.slice(m[0].length); - } else { - throw (new Error('Failed to parse DN')); - } - } - var cmps = parts.map(function (c) { - c = c.trim(); - var eqPos = c.indexOf('='); - while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') - eqPos = c.indexOf('=', eqPos + 1); - if (eqPos === -1) { - throw (new Error('Failed to parse DN')); - } - /*JSSTYLED*/ - var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); - var value = c.slice(eqPos + 1); - return ({ name: name, value: value }); - }); - return (new Identity({ components: cmps })); -}; +var pem = __webpack_require__(268); +var ssh = __webpack_require__(603); +var rfc4253 = __webpack_require__(538); +var dnssec = __webpack_require__(982); +var putty = __webpack_require__(624); -Identity.fromArray = function (components) { - assert.arrayOfObject(components, 'components'); - components.forEach(function (cmp) { - assert.object(cmp, 'component'); - assert.string(cmp.name, 'component.name'); - if (!Buffer.isBuffer(cmp.value) && - !(typeof (cmp.value) === 'string')) { - throw (new Error('Invalid component value')); - } - }); - return (new Identity({ components: components })); -}; +var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; -Identity.parseAsn1 = function (der, top) { - var components = []; - der.readSequence(top); - var end = der.offset + der.length; - while (der.offset < end) { - der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); - var after = der.offset + der.length; - der.readSequence(); - var oid = der.readOID(); - var type = der.peek(); - var value; - switch (type) { - case asn1.Ber.PrintableString: - case asn1.Ber.IA5String: - case asn1.Ber.OctetString: - case asn1.Ber.T61String: - value = der.readString(type); - break; - case asn1.Ber.Utf8String: - value = der.readString(type, true); - value = value.toString('utf8'); - break; - case asn1.Ber.CharacterString: - case asn1.Ber.BMPString: - value = der.readString(type, true); - value = value.toString('utf16le'); - break; - default: - throw (new Error('Unknown asn1 type ' + type)); - } - components.push({ oid: oid, asn1type: type, value: value }); - der._offset = after; +function read(buf, options) { + if (typeof (buf) === 'string') { + if (buf.trim().match(/^[-]+[ ]*BEGIN/)) + return (pem.read(buf, options)); + if (buf.match(/^\s*ssh-[a-z]/)) + return (ssh.read(buf, options)); + if (buf.match(/^\s*ecdsa-/)) + return (ssh.read(buf, options)); + if (buf.match(/^putty-user-key-file-2:/i)) + return (putty.read(buf, options)); + if (findDNSSECHeader(buf)) + return (dnssec.read(buf, options)); + buf = Buffer.from(buf, 'binary'); + } else { + assert.buffer(buf); + if (findPEMHeader(buf)) + return (pem.read(buf, options)); + if (findSSHHeader(buf)) + return (ssh.read(buf, options)); + if (findPuTTYHeader(buf)) + return (putty.read(buf, options)); + if (findDNSSECHeader(buf)) + return (dnssec.read(buf, options)); } - der._offset = end; - return (new Identity({ - components: components - })); -}; + if (buf.readUInt32BE(0) < buf.length) + return (rfc4253.read(buf, options)); + throw (new Error('Failed to auto-detect format of key')); +} -Identity.isIdentity = function (obj, ver) { - return (utils.isCompatible(obj, Identity, ver)); -}; +function findPuTTYHeader(buf) { + var offset = 0; + while (offset < buf.length && + (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) + ++offset; + if (offset + 22 <= buf.length && + buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === + 'putty-user-key-file-2:') + return (true); + return (false); +} -/* - * API versions for Identity: - * [1,0] -- initial ver - */ -Identity.prototype._sshpkApiVersion = [1, 0]; +function findSSHHeader(buf) { + var offset = 0; + while (offset < buf.length && + (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) + ++offset; + if (offset + 4 <= buf.length && + buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') + return (true); + if (offset + 6 <= buf.length && + buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') + return (true); + return (false); +} -Identity._oldVersionDetect = function (obj) { - return ([1, 0]); -}; +function findPEMHeader(buf) { + var offset = 0; + while (offset < buf.length && + (buf[offset] === 32 || buf[offset] === 10)) + ++offset; + if (buf[offset] !== 45) + return (false); + while (offset < buf.length && + (buf[offset] === 45)) + ++offset; + while (offset < buf.length && + (buf[offset] === 32)) + ++offset; + if (offset + 5 > buf.length || + buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') + return (false); + return (true); +} +function findDNSSECHeader(buf) { + // private case first + if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) + return (false); + var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); + if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) + return (true); -/***/ }), + // public-key RFC3110 ? + // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' + // skip any comment-lines + if (typeof (buf) !== 'string') { + buf = buf.toString('ascii'); + } + var lines = buf.split('\n'); + var line = 0; + /* JSSTYLED */ + while (lines[line].match(/^\;/)) + line++; + if (lines[line].toString('ascii').match(/\. IN KEY /)) + return (true); + if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) + return (true); + return (false); +} -/***/ 187: -/***/ (function(module) { +function write(key, options) { + throw (new Error('"auto" format cannot be used for writing')); +} -module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), -/***/ 191: -/***/ (function(module) { +/***/ 242: +/***/ (function(module, exports) { -module.exports = require("querystring"); +(function(){ -/***/ }), + // Copyright (c) 2005 Tom Wu + // All Rights Reserved. + // See "LICENSE" for details. -/***/ 198: -/***/ (function(module, __unusedexports, __webpack_require__) { + // Basic JavaScript BN library - subset useful for RSA encryption. -// Copyright 2015 Joyent, Inc. + // Bits per digit + var dbits; -module.exports = { - Verifier: Verifier, - Signer: Signer -}; + // JavaScript engine analysis + var canary = 0xdeadbeefcafe; + var j_lm = ((canary&0xffffff)==0xefcafe); -var nacl = __webpack_require__(162); -var stream = __webpack_require__(413); -var util = __webpack_require__(669); -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var Signature = __webpack_require__(437); + // (public) Constructor + function BigInteger(a,b,c) { + if(a != null) + if("number" == typeof a) this.fromNumber(a,b,c); + else if(b == null && "string" != typeof a) this.fromString(a,256); + else this.fromString(a,b); + } -function Verifier(key, hashAlgo) { - if (hashAlgo.toLowerCase() !== 'sha512') - throw (new Error('ED25519 only supports the use of ' + - 'SHA-512 hashes')); + // return new, unset BigInteger + function nbi() { return new BigInteger(null); } - this.key = key; - this.chunks = []; + // am: Compute w_j += (x*this_i), propagate carries, + // c is initial carry, returns final carry. + // c < 3*dvalue, x < 2*dvalue, this_i < dvalue + // We need to select the fastest one that works in this environment. - stream.Writable.call(this, {}); -} -util.inherits(Verifier, stream.Writable); + // am1: use a single mult and divide to get the high bits, + // max digit bits should be 26 because + // max internal value = 2*dvalue^2-2*dvalue (< 2^53) + function am1(i,x,w,j,c,n) { + while(--n >= 0) { + var v = x*this[i++]+w[j]+c; + c = Math.floor(v/0x4000000); + w[j++] = v&0x3ffffff; + } + return c; + } + // am2 avoids a big mult-and-extract completely. + // Max digit bits should be <= 30 because we do bitwise ops + // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) + function am2(i,x,w,j,c,n) { + var xl = x&0x7fff, xh = x>>15; + while(--n >= 0) { + var l = this[i]&0x7fff; + var h = this[i++]>>15; + var m = xh*l+h*xl; + l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); + c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); + w[j++] = l&0x3fffffff; + } + return c; + } + // Alternately, set max digit bits to 28 since some + // browsers slow down when dealing with 32-bit numbers. + function am3(i,x,w,j,c,n) { + var xl = x&0x3fff, xh = x>>14; + while(--n >= 0) { + var l = this[i]&0x3fff; + var h = this[i++]>>14; + var m = xh*l+h*xl; + l = xl*l+((m&0x3fff)<<14)+w[j]+c; + c = (l>>28)+(m>>14)+xh*h; + w[j++] = l&0xfffffff; + } + return c; + } + var inBrowser = typeof navigator !== "undefined"; + if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { + BigInteger.prototype.am = am2; + dbits = 30; + } + else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { + BigInteger.prototype.am = am1; + dbits = 26; + } + else { // Mozilla/Netscape seems to prefer am3 + BigInteger.prototype.am = am3; + dbits = 28; + } -Verifier.prototype._write = function (chunk, enc, cb) { - this.chunks.push(chunk); - cb(); -}; + BigInteger.prototype.DB = dbits; + BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; + r.t = this.t; + r.s = this.s; + } - assert.buffer(sig); - return (nacl.sign.detached.verify( - new Uint8Array(Buffer.concat(this.chunks)), - new Uint8Array(sig), - new Uint8Array(this.key.part.A.data))); -}; + // (protected) set from integer value x, -DV <= x < DV + function bnpFromInt(x) { + this.t = 1; + this.s = (x<0)?-1:0; + if(x > 0) this[0] = x; + else if(x < -1) this[0] = x+this.DV; + else this.t = 0; + } -function Signer(key, hashAlgo) { - if (hashAlgo.toLowerCase() !== 'sha512') - throw (new Error('ED25519 only supports the use of ' + - 'SHA-512 hashes')); + // return bigint initialized to value + function nbv(i) { var r = nbi(); r.fromInt(i); return r; } - this.key = key; - this.chunks = []; + // (protected) set from string and radix + function bnpFromString(s,b) { + var k; + if(b == 16) k = 4; + else if(b == 8) k = 3; + else if(b == 256) k = 8; // byte array + else if(b == 2) k = 1; + else if(b == 32) k = 5; + else if(b == 4) k = 2; + else { this.fromRadix(s,b); return; } + this.t = 0; + this.s = 0; + var i = s.length, mi = false, sh = 0; + while(--i >= 0) { + var x = (k==8)?s[i]&0xff:intAt(s,i); + if(x < 0) { + if(s.charAt(i) == "-") mi = true; + continue; + } + mi = false; + if(sh == 0) + this[this.t++] = x; + else if(sh+k > this.DB) { + this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); + } + else + this[this.t-1] |= x<= this.DB) sh -= this.DB; + } + if(k == 8 && (s[0]&0x80) != 0) { + this.s = -1; + if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; + } -Signer.prototype._write = function (chunk, enc, cb) { - this.chunks.push(chunk); - cb(); -}; + // (public) return string representation in given radix + function bnToString(b) { + if(this.s < 0) return "-"+this.negate().toString(b); + var k; + if(b == 16) k = 4; + else if(b == 8) k = 3; + else if(b == 2) k = 1; + else if(b == 32) k = 5; + else if(b == 4) k = 2; + else return this.toRadix(b); + var km = (1< 0) { + if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } + while(i >= 0) { + if(p < k) { + d = (this[i]&((1<>(p+=this.DB-k); + } + else { + d = (this[i]>>(p-=k))&km; + if(p <= 0) { p += this.DB; --i; } + } + if(d > 0) m = true; + if(m) r += int2char(d); + } + } + return m?r:"0"; + } -Signer.prototype.update = function (chunk) { - if (typeof (chunk) === 'string') - chunk = Buffer.from(chunk, 'binary'); - this.chunks.push(chunk); -}; + // (public) -this + function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } -Signer.prototype.sign = function () { - var sig = nacl.sign.detached( - new Uint8Array(Buffer.concat(this.chunks)), - new Uint8Array(Buffer.concat([ - this.key.part.k.data, this.key.part.A.data]))); - var sigBuf = Buffer.from(sig); - var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); - sigObj.hashAlgorithm = 'sha512'; - return (sigObj); -}; + // (public) |this| + function bnAbs() { return (this.s<0)?this.negate():this; } + // (public) return + if this > a, - if this < a, 0 if equal + function bnCompareTo(a) { + var r = this.s-a.s; + if(r != 0) return r; + var i = this.t; + r = i-a.t; + if(r != 0) return (this.s<0)?-r:r; + while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; + return 0; + } -/***/ }), + // returns bit length of the integer x + function nbits(x) { + var r = 1, t; + if((t=x>>>16) != 0) { x = t; r += 16; } + if((t=x>>8) != 0) { x = t; r += 8; } + if((t=x>>4) != 0) { x = t; r += 4; } + if((t=x>>2) != 0) { x = t; r += 2; } + if((t=x>>1) != 0) { x = t; r += 1; } + return r; + } -/***/ 207: -/***/ (function(module, __unusedexports, __webpack_require__) { + // (public) return the number of bits in "this" + function bnBitLength() { + if(this.t <= 0) return 0; + return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); + } -// Copyright 2018 Joyent, Inc. + // (protected) r = this << n*DB + function bnpDLShiftTo(n,r) { + var i; + for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; + for(i = n-1; i >= 0; --i) r[i] = 0; + r.t = this.t+n; + r.s = this.s; + } -module.exports = { - read: read, - write: write -}; + // (protected) r = this >> n*DB + function bnpDRShiftTo(n,r) { + for(var i = n; i < this.t; ++i) r[i-n] = this[i]; + r.t = Math.max(this.t-n,0); + r.s = this.s; + } -var assert = __webpack_require__(976); -var asn1 = __webpack_require__(856); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); + // (protected) r = this << n + function bnpLShiftTo(n,r) { + var bs = n%this.DB; + var cbs = this.DB-bs; + var bm = (1<= 0; --i) { + r[i+ds+1] = (this[i]>>cbs)|c; + c = (this[i]&bm)<= 0; --i) r[i] = 0; + r[ds] = c; + r.t = this.t+ds+1; + r.s = this.s; + r.clamp(); + } -var pkcs1 = __webpack_require__(867); -var pkcs8 = __webpack_require__(603); -var sshpriv = __webpack_require__(62); -var rfc4253 = __webpack_require__(563); + // (protected) r = this >> n + function bnpRShiftTo(n,r) { + r.s = this.s; + var ds = Math.floor(n/this.DB); + if(ds >= this.t) { r.t = 0; return; } + var bs = n%this.DB; + var cbs = this.DB-bs; + var bm = (1<>bs; + for(var i = ds+1; i < this.t; ++i) { + r[i-ds-1] |= (this[i]&bm)<>bs; + } + if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; + } + if(a.t < this.t) { + c -= a.s; + while(i < this.t) { + c += this[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += this.s; + } + else { + c += this.s; + while(i < a.t) { + c -= a[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c -= a.s; + } + r.s = (c<0)?-1:0; + if(c < -1) r[i++] = this.DV+c; + else if(c > 0) r[i++] = c; + r.t = i; + r.clamp(); + } -var OID_PBES2 = '1.2.840.113549.1.5.13'; -var OID_PBKDF2 = '1.2.840.113549.1.5.12'; + // (protected) r = this * a, r != this,a (HAC 14.12) + // "this" should be the larger one if appropriate. + function bnpMultiplyTo(a,r) { + var x = this.abs(), y = a.abs(); + var i = x.t; + r.t = i+y.t; + while(--i >= 0) r[i] = 0; + for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); + r.s = 0; + r.clamp(); + if(this.s != a.s) BigInteger.ZERO.subTo(r,r); + } -var OID_TO_CIPHER = { - '1.2.840.113549.3.7': '3des-cbc', - '2.16.840.1.101.3.4.1.2': 'aes128-cbc', - '2.16.840.1.101.3.4.1.42': 'aes256-cbc' -}; -var CIPHER_TO_OID = {}; -Object.keys(OID_TO_CIPHER).forEach(function (k) { - CIPHER_TO_OID[OID_TO_CIPHER[k]] = k; -}); + // (protected) r = this^2, r != this (HAC 14.16) + function bnpSquareTo(r) { + var x = this.abs(); + var i = r.t = 2*x.t; + while(--i >= 0) r[i] = 0; + for(i = 0; i < x.t-1; ++i) { + var c = x.am(i,x[i],r,2*i,0,1); + if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { + r[i+x.t] -= x.DV; + r[i+x.t+1] = 1; + } + } + if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); + r.s = 0; + r.clamp(); + } -var OID_TO_HASH = { - '1.2.840.113549.2.7': 'sha1', - '1.2.840.113549.2.9': 'sha256', - '1.2.840.113549.2.11': 'sha512' -}; -var HASH_TO_OID = {}; -Object.keys(OID_TO_HASH).forEach(function (k) { - HASH_TO_OID[OID_TO_HASH[k]] = k; -}); + // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) + // r != q, this != m. q or r may be null. + function bnpDivRemTo(m,q,r) { + var pm = m.abs(); + if(pm.t <= 0) return; + var pt = this.abs(); + if(pt.t < pm.t) { + if(q != null) q.fromInt(0); + if(r != null) this.copyTo(r); + return; + } + if(r == null) r = nbi(); + var y = nbi(), ts = this.s, ms = m.s; + var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus + if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } + else { pm.copyTo(y); pt.copyTo(r); } + var ys = y.t; + var y0 = y[ys-1]; + if(y0 == 0) return; + var yt = y0*(1<1)?y[ys-2]>>this.F2:0); + var d1 = this.FV/yt, d2 = (1<= 0) { + r[r.t++] = 1; + r.subTo(t,r); + } + BigInteger.ONE.dlShiftTo(ys,t); + t.subTo(y,y); // "negative" y so we can replace sub with am later + while(y.t < ys) y[y.t++] = 0; + while(--j >= 0) { + // Estimate quotient digit + var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); + if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out + y.dlShiftTo(j,t); + r.subTo(t,r); + while(r[i] < --qd) r.subTo(t,r); + } + } + if(q != null) { + r.drShiftTo(ys,q); + if(ts != ms) BigInteger.ZERO.subTo(q,q); + } + r.t = ys; + r.clamp(); + if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder + if(ts < 0) BigInteger.ZERO.subTo(r,r); + } -/* - * For reading we support both PKCS#1 and PKCS#8. If we find a private key, - * we just take the public component of it and use that. - */ -function read(buf, options, forceType) { - var input = buf; - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); - } + // (public) this mod a + function bnMod(a) { + var r = nbi(); + this.abs().divRemTo(a,null,r); + if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); + return r; + } - var lines = buf.trim().split(/[\r\n]+/g); + // Modular reduction using "classic" algorithm + function Classic(m) { this.m = m; } + function cConvert(x) { + if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); + else return x; + } + function cRevert(x) { return x; } + function cReduce(x) { x.divRemTo(this.m,null,x); } + function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - var m; - var si = -1; - while (!m && si < lines.length) { - m = lines[++si].match(/*JSSTYLED*/ - /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - } - assert.ok(m, 'invalid PEM header'); + Classic.prototype.convert = cConvert; + Classic.prototype.revert = cRevert; + Classic.prototype.reduce = cReduce; + Classic.prototype.mulTo = cMulTo; + Classic.prototype.sqrTo = cSqrTo; - var m2; - var ei = lines.length; - while (!m2 && ei > 0) { - m2 = lines[--ei].match(/*JSSTYLED*/ - /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - } - assert.ok(m2, 'invalid PEM footer'); + // (protected) return "-1/this % 2^DB"; useful for Mont. reduction + // justification: + // xy == 1 (mod m) + // xy = 1+km + // xy(2-xy) = (1+km)(1-km) + // x[y(2-xy)] = 1-k^2m^2 + // x[y(2-xy)] == 1 (mod m^2) + // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 + // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. + // JS multiply "overflows" differently from C/C++, so care is needed here. + function bnpInvDigit() { + if(this.t < 1) return 0; + var x = this[0]; + if((x&1) == 0) return 0; + var y = x&3; // y == 1/x mod 2^2 + y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 + y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 + y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 + // last step - calculate inverse mod DV directly; + // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints + y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits + // we really want the negative inverse, and -DV < y < DV + return (y>0)?this.DV-y:-y; + } - /* Begin and end banners must match key type */ - assert.equal(m[2], m2[2]); - var type = m[2].toLowerCase(); + // Montgomery reduction + function Montgomery(m) { + this.m = m; + this.mp = m.invDigit(); + this.mpl = this.mp&0x7fff; + this.mph = this.mp>>15; + this.um = (1<<(m.DB-15))-1; + this.mt2 = 2*m.t; + } - var alg; - if (m[1]) { - /* They also must match algorithms, if given */ - assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); - alg = m[1].trim(); - } + // xR mod m + function montConvert(x) { + var r = nbi(); + x.abs().dlShiftTo(this.m.t,r); + r.divRemTo(this.m,null,r); + if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); + return r; + } - lines = lines.slice(si, ei + 1); + // x/R mod m + function montRevert(x) { + var r = nbi(); + x.copyTo(r); + this.reduce(r); + return r; + } - var headers = {}; - while (true) { - lines = lines.slice(1); - m = lines[0].match(/*JSSTYLED*/ - /^([A-Za-z0-9-]+): (.+)$/); - if (!m) - break; - headers[m[1].toLowerCase()] = m[2]; - } + // x = x/R mod m (HAC 14.32) + function montReduce(x) { + while(x.t <= this.mt2) // pad x so am has enough room later + x[x.t++] = 0; + for(var i = 0; i < this.m.t; ++i) { + // faster way of calculating u0 = x[i]*mp mod DV + var j = x[i]&0x7fff; + var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; + // use am to combine the multiply-shift-add into one call + j = i+this.m.t; + x[j] += this.m.am(0,u0,x,i,0,this.m.t); + // propagate carry + while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } + } + x.clamp(); + x.drShiftTo(this.m.t,x); + if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); + } - /* Chop off the first and last lines */ - lines = lines.slice(0, -1).join(''); - buf = Buffer.from(lines, 'base64'); + // r = "x^2/R mod m"; x != r + function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - var cipher, key, iv; - if (headers['proc-type']) { - var parts = headers['proc-type'].split(','); - if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } else { - parts = headers['dek-info'].split(','); - assert.ok(parts.length === 2); - cipher = parts[0].toLowerCase(); - iv = Buffer.from(parts[1], 'hex'); - key = utils.opensslKeyDeriv(cipher, iv, - options.passphrase, 1).key; - } - } - } + // r = "xy/R mod m"; x,y != r + function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - if (alg && alg.toLowerCase() === 'encrypted') { - var eder = new asn1.BerReader(buf); - var pbesEnd; - eder.readSequence(); + Montgomery.prototype.convert = montConvert; + Montgomery.prototype.revert = montRevert; + Montgomery.prototype.reduce = montReduce; + Montgomery.prototype.mulTo = montMulTo; + Montgomery.prototype.sqrTo = montSqrTo; - eder.readSequence(); - pbesEnd = eder.offset + eder.length; + // (protected) true iff this is even + function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } - var method = eder.readOID(); - if (method !== OID_PBES2) { - throw (new Error('Unsupported PEM/PKCS8 encryption ' + - 'scheme: ' + method)); - } + // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) + function bnpExp(e,z) { + if(e > 0xffffffff || e < 1) return BigInteger.ONE; + var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; + g.copyTo(r); + while(--i >= 0) { + z.sqrTo(r,r2); + if((e&(1< 0) z.mulTo(r2,g,r); + else { var t = r; r = r2; r2 = t; } + } + return z.revert(r); + } - eder.readSequence(); /* PBES2-params */ + // (public) this^e % m, 0 <= e < 2^32 + function bnModPowInt(e,m) { + var z; + if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); + return this.exp(e,z); + } - eder.readSequence(); /* keyDerivationFunc */ - var kdfEnd = eder.offset + eder.length; - var kdfOid = eder.readOID(); - if (kdfOid !== OID_PBKDF2) - throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); - eder.readSequence(); - var salt = eder.readString(asn1.Ber.OctetString, true); - var iterations = eder.readInt(); - var hashAlg = 'sha1'; - if (eder.offset < kdfEnd) { - eder.readSequence(); - var hashAlgOid = eder.readOID(); - hashAlg = OID_TO_HASH[hashAlgOid]; - if (hashAlg === undefined) { - throw (new Error('Unsupported PBKDF2 hash: ' + - hashAlgOid)); - } - } - eder._offset = kdfEnd; + // protected + BigInteger.prototype.copyTo = bnpCopyTo; + BigInteger.prototype.fromInt = bnpFromInt; + BigInteger.prototype.fromString = bnpFromString; + BigInteger.prototype.clamp = bnpClamp; + BigInteger.prototype.dlShiftTo = bnpDLShiftTo; + BigInteger.prototype.drShiftTo = bnpDRShiftTo; + BigInteger.prototype.lShiftTo = bnpLShiftTo; + BigInteger.prototype.rShiftTo = bnpRShiftTo; + BigInteger.prototype.subTo = bnpSubTo; + BigInteger.prototype.multiplyTo = bnpMultiplyTo; + BigInteger.prototype.squareTo = bnpSquareTo; + BigInteger.prototype.divRemTo = bnpDivRemTo; + BigInteger.prototype.invDigit = bnpInvDigit; + BigInteger.prototype.isEven = bnpIsEven; + BigInteger.prototype.exp = bnpExp; - eder.readSequence(); /* encryptionScheme */ - var cipherOid = eder.readOID(); - cipher = OID_TO_CIPHER[cipherOid]; - if (cipher === undefined) { - throw (new Error('Unsupported PBES2 cipher: ' + - cipherOid)); - } - iv = eder.readString(asn1.Ber.OctetString, true); + // public + BigInteger.prototype.toString = bnToString; + BigInteger.prototype.negate = bnNegate; + BigInteger.prototype.abs = bnAbs; + BigInteger.prototype.compareTo = bnCompareTo; + BigInteger.prototype.bitLength = bnBitLength; + BigInteger.prototype.mod = bnMod; + BigInteger.prototype.modPowInt = bnModPowInt; - eder._offset = pbesEnd; - buf = eder.readString(asn1.Ber.OctetString, true); + // "constants" + BigInteger.ZERO = nbv(0); + BigInteger.ONE = nbv(1); - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } + // Copyright (c) 2005-2009 Tom Wu + // All Rights Reserved. + // See "LICENSE" for details. - var cinfo = utils.opensshCipherInfo(cipher); + // Extended JavaScript BN functions, required for RSA private ops. - cipher = cinfo.opensslName; - key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, - options.passphrase); - alg = undefined; - } + // Version 1.1: new BigInteger("0", 10) returns "proper" zero + // Version 1.2: square() API, isProbablePrime fix - if (cipher && key && iv) { - var cipherStream = crypto.createDecipheriv(cipher, key, iv); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - if (e.toString().indexOf('bad decrypt') !== -1) { - throw (new Error('Incorrect passphrase ' + - 'supplied, could not decrypt key')); - } - throw (e); - }); - cipherStream.write(buf); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - buf = Buffer.concat(chunks); - } + // (public) + function bnClone() { var r = nbi(); this.copyTo(r); return r; } - /* The new OpenSSH internal format abuses PEM headers */ - if (alg && alg.toLowerCase() === 'openssh') - return (sshpriv.readSSHPrivate(type, buf, options)); - if (alg && alg.toLowerCase() === 'ssh2') - return (rfc4253.readType(type, buf, options)); + // (public) return value as integer + function bnIntValue() { + if(this.s < 0) { + if(this.t == 1) return this[0]-this.DV; + else if(this.t == 0) return -1; + } + else if(this.t == 1) return this[0]; + else if(this.t == 0) return 0; + // assumes 16 < DB < 32 + return ((this[1]&((1<<(32-this.DB))-1))<>24; } - /* - * All of the PEM file types start with a sequence tag, so chop it - * off here - */ - der.readSequence(); + // (public) return value as short (assumes DB>=16) + function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } - /* PKCS#1 type keys name an algorithm in the banner explicitly */ - if (alg) { - if (forceType) - assert.strictEqual(forceType, 'pkcs1'); - return (pkcs1.readPkcs1(alg, type, der)); - } else { - if (forceType) - assert.strictEqual(forceType, 'pkcs8'); - return (pkcs8.readPkcs8(alg, type, der)); - } -} + // (protected) return x s.t. r^x < DV + function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } -function write(key, options, type) { - assert.object(key); + // (public) 0 if this == 0, 1 if this > 0 + function bnSigNum() { + if(this.s < 0) return -1; + else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; + else return 1; + } - var alg = { - 'ecdsa': 'EC', - 'rsa': 'RSA', - 'dsa': 'DSA', - 'ed25519': 'EdDSA' - }[key.type]; - var header; + // (protected) convert to radix string + function bnpToRadix(b) { + if(b == null) b = 10; + if(this.signum() == 0 || b < 2 || b > 36) return "0"; + var cs = this.chunkSize(b); + var a = Math.pow(b,cs); + var d = nbv(a), y = nbi(), z = nbi(), r = ""; + this.divRemTo(d,y,z); + while(y.signum() > 0) { + r = (a+z.intValue()).toString(b).substr(1) + r; + y.divRemTo(d,y,z); + } + return z.intValue().toString(b) + r; + } - var der = new asn1.BerWriter(); + // (protected) convert from radix string + function bnpFromRadix(s,b) { + this.fromInt(0); + if(b == null) b = 10; + var cs = this.chunkSize(b); + var d = Math.pow(b,cs), mi = false, j = 0, w = 0; + for(var i = 0; i < s.length; ++i) { + var x = intAt(s,i); + if(x < 0) { + if(s.charAt(i) == "-" && this.signum() == 0) mi = true; + continue; + } + w = b*w+x; + if(++j >= cs) { + this.dMultiply(d); + this.dAddOffset(w,0); + j = 0; + w = 0; + } + } + if(j > 0) { + this.dMultiply(Math.pow(b,j)); + this.dAddOffset(w,0); + } + if(mi) BigInteger.ZERO.subTo(this,this); + } - if (PrivateKey.isPrivateKey(key)) { - if (type && type === 'pkcs8') { - header = 'PRIVATE KEY'; - pkcs8.writePkcs8(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs1'); - header = alg + ' PRIVATE KEY'; - pkcs1.writePkcs1(der, key); - } + // (protected) alternate constructor + function bnpFromNumber(a,b,c) { + if("number" == typeof b) { + // new BigInteger(int,int,RNG) + if(a < 2) this.fromInt(1); + else { + this.fromNumber(a,c); + if(!this.testBit(a-1)) // force MSB set + this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); + if(this.isEven()) this.dAddOffset(1,0); // force odd + while(!this.isProbablePrime(b)) { + this.dAddOffset(2,0); + if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); + } + } + } + else { + // new BigInteger(int,RNG) + var x = new Array(), t = a&7; + x.length = (a>>3)+1; + b.nextBytes(x); + if(t > 0) x[0] &= ((1< 0) { + if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) + r[k++] = d|(this.s<<(this.DB-p)); + while(i >= 0) { + if(p < 8) { + d = (this[i]&((1<>(p+=this.DB-8); + } + else { + d = (this[i]>>(p-=8))&0xff; + if(p <= 0) { p += this.DB; --i; } + } + if((d&0x80) != 0) d |= -256; + if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; + if(k > 0 || d != this.s) r[k++] = d; + } + } + return r; + } - } else { - throw (new Error('key is not a Key or PrivateKey')); - } + function bnEquals(a) { return(this.compareTo(a)==0); } + function bnMin(a) { return(this.compareTo(a)<0)?this:a; } + function bnMax(a) { return(this.compareTo(a)>0)?this:a; } - var tmp = der.buffer.toString('base64'); - var len = tmp.length + (tmp.length / 64) + - 18 + 16 + header.length*2 + 10; - var buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 64; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); + // (protected) r = this op a (bitwise) + function bnpBitwiseTo(a,op,r) { + var i, f, m = Math.min(a.t,this.t); + for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); + if(a.t < this.t) { + f = a.s&this.DM; + for(i = m; i < this.t; ++i) r[i] = op(this[i],f); + r.t = this.t; + } + else { + f = this.s&this.DM; + for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); + r.t = a.t; + } + r.s = op(this.s,a.s); + r.clamp(); + } - return (buf.slice(0, o)); -} + // (public) this & a + function op_and(x,y) { return x&y; } + function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } + // (public) this | a + function op_or(x,y) { return x|y; } + function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } -/***/ }), + // (public) this ^ a + function op_xor(x,y) { return x^y; } + function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } -/***/ 208: -/***/ (function(module, __unusedexports, __webpack_require__) { + // (public) this & ~a + function op_andnot(x,y) { return x&~y; } + function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } -"use strict"; + // (public) ~this + function bnNot() { + var r = nbi(); + for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; + r.t = this.t; + r.s = ~this.s; + return r; + } + + // (public) this << n + function bnShiftLeft(n) { + var r = nbi(); + if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); + return r; + } + // (public) this >> n + function bnShiftRight(n) { + var r = nbi(); + if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); + return r; + } -var stringify = __webpack_require__(361); -var parse = __webpack_require__(324); -var formats = __webpack_require__(751); + // return index of lowest 1-bit in x, x < 2^31 + function lbit(x) { + if(x == 0) return -1; + var r = 0; + if((x&0xffff) == 0) { x >>= 16; r += 16; } + if((x&0xff) == 0) { x >>= 8; r += 8; } + if((x&0xf) == 0) { x >>= 4; r += 4; } + if((x&3) == 0) { x >>= 2; r += 2; } + if((x&1) == 0) ++r; + return r; + } -module.exports = { - formats: formats, - parse: parse, - stringify: stringify -}; + // (public) returns index of lowest 1-bit (or -1 if none) + function bnGetLowestSetBit() { + for(var i = 0; i < this.t; ++i) + if(this[i] != 0) return i*this.DB+lbit(this[i]); + if(this.s < 0) return this.t*this.DB; + return -1; + } + // return number of 1 bits in x + function cbit(x) { + var r = 0; + while(x != 0) { x &= x-1; ++r; } + return r; + } -/***/ }), + // (public) return number of set bits + function bnBitCount() { + var r = 0, x = this.s&this.DM; + for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); + return r; + } -/***/ 211: -/***/ (function(module) { + // (public) true iff nth bit is set + function bnTestBit(n) { + var j = Math.floor(n/this.DB); + if(j >= this.t) return(this.s!=0); + return((this[j]&(1<<(n%this.DB)))!=0); + } -module.exports = require("https"); + // (protected) this op (1<>= this.DB; + } + if(a.t < this.t) { + c += a.s; + while(i < this.t) { + c += this[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += this.s; + } + else { + c += this.s; + while(i < a.t) { + c += a[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += a.s; + } + r.s = (c<0)?-1:0; + if(c > 0) r[i++] = c; + else if(c < -1) r[i++] = this.DV+c; + r.t = i; + r.clamp(); + } -/***/ 214: -/***/ (function(module) { + // (public) this + a + function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } -module.exports = {"$id":"query.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"comment":{"type":"string"}}}; + // (public) this - a + function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } -/***/ }), + // (public) this * a + function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } -/***/ 218: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + // (public) this^2 + function bnSquare() { var r = nbi(); this.squareTo(r); return r; } -"use strict"; + // (public) this / a + function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const os = __webpack_require__(87); -const events = __webpack_require__(614); -const child = __webpack_require__(129); -/* eslint-disable @typescript-eslint/unbound-method */ -const IS_WINDOWS = process.platform === 'win32'; -/* - * Class for running command line tools. Handles quoting and arg parsing in a platform agnostic way. - */ -class ToolRunner extends events.EventEmitter { - constructor(toolPath, args, options) { - super(); - if (!toolPath) { - throw new Error("Parameter 'toolPath' cannot be null or empty."); - } - this.toolPath = toolPath; - this.args = args || []; - this.options = options || {}; + // (public) this % a + function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } + + // (public) [this/a,this%a] + function bnDivideAndRemainder(a) { + var q = nbi(), r = nbi(); + this.divRemTo(a,q,r); + return new Array(q,r); } - _debug(message) { - if (this.options.listeners && this.options.listeners.debug) { - this.options.listeners.debug(message); - } + + // (protected) this *= n, this >= 0, 1 < n < DV + function bnpDMultiply(n) { + this[this.t] = this.am(0,n-1,this,0,0,this.t); + ++this.t; + this.clamp(); } - _getCommandString(options, noPrefix) { - const toolPath = this._getSpawnFileName(); - const args = this._getSpawnArgs(options); - let cmd = noPrefix ? '' : '[command]'; // omit prefix when piped to a second tool - if (IS_WINDOWS) { - // Windows + cmd file - if (this._isCmdFile()) { - cmd += toolPath; - for (const a of args) { - cmd += ` ${a}`; - } - } - // Windows + verbatim - else if (options.windowsVerbatimArguments) { - cmd += `"${toolPath}"`; - for (const a of args) { - cmd += ` ${a}`; - } - } - // Windows (regular) - else { - cmd += this._windowsQuoteCmdArg(toolPath); - for (const a of args) { - cmd += ` ${this._windowsQuoteCmdArg(a)}`; - } - } - } - else { - // OSX/Linux - this can likely be improved with some form of quoting. - // creating processes on Unix is fundamentally different than Windows. - // on Unix, execvp() takes an arg array. - cmd += toolPath; - for (const a of args) { - cmd += ` ${a}`; - } - } - return cmd; + + // (protected) this += n << w words, this >= 0 + function bnpDAddOffset(n,w) { + if(n == 0) return; + while(this.t <= w) this[this.t++] = 0; + this[w] += n; + while(this[w] >= this.DV) { + this[w] -= this.DV; + if(++w >= this.t) this[this.t++] = 0; + ++this[w]; + } } - _processLineBuffer(data, strBuffer, onLine) { - try { - let s = strBuffer + data.toString(); - let n = s.indexOf(os.EOL); - while (n > -1) { - const line = s.substring(0, n); - onLine(line); - // the rest of the string ... - s = s.substring(n + os.EOL.length); - n = s.indexOf(os.EOL); - } - strBuffer = s; - } - catch (err) { - // streaming lines to console is best effort. Don't fail a build. - this._debug(`error processing line. Failed with error ${err}`); - } + + // A "null" reducer + function NullExp() {} + function nNop(x) { return x; } + function nMulTo(x,y,r) { x.multiplyTo(y,r); } + function nSqrTo(x,r) { x.squareTo(r); } + + NullExp.prototype.convert = nNop; + NullExp.prototype.revert = nNop; + NullExp.prototype.mulTo = nMulTo; + NullExp.prototype.sqrTo = nSqrTo; + + // (public) this^e + function bnPow(e) { return this.exp(e,new NullExp()); } + + // (protected) r = lower n words of "this * a", a.t <= n + // "this" should be the larger one if appropriate. + function bnpMultiplyLowerTo(a,n,r) { + var i = Math.min(this.t+a.t,n); + r.s = 0; // assumes a,this >= 0 + r.t = i; + while(i > 0) r[--i] = 0; + var j; + for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); + for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); + r.clamp(); } - _getSpawnFileName() { - if (IS_WINDOWS) { - if (this._isCmdFile()) { - return process.env['COMSPEC'] || 'cmd.exe'; - } - } - return this.toolPath; + + // (protected) r = "this * a" without lower n words, n > 0 + // "this" should be the larger one if appropriate. + function bnpMultiplyUpperTo(a,n,r) { + --n; + var i = r.t = this.t+a.t-n; + r.s = 0; // assumes a,this >= 0 + while(--i >= 0) r[i] = 0; + for(i = Math.max(n-this.t,0); i < a.t; ++i) + r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); + r.clamp(); + r.drShiftTo(1,r); } - _getSpawnArgs(options) { - if (IS_WINDOWS) { - if (this._isCmdFile()) { - let argline = `/D /S /C "${this._windowsQuoteCmdArg(this.toolPath)}`; - for (const a of this.args) { - argline += ' '; - argline += options.windowsVerbatimArguments - ? a - : this._windowsQuoteCmdArg(a); - } - argline += '"'; - return [argline]; - } - } - return this.args; + + // Barrett modular reduction + function Barrett(m) { + // setup Barrett + this.r2 = nbi(); + this.q3 = nbi(); + BigInteger.ONE.dlShiftTo(2*m.t,this.r2); + this.mu = this.r2.divide(m); + this.m = m; } - _endsWith(str, end) { - return str.endsWith(end); + + function barrettConvert(x) { + if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); + else if(x.compareTo(this.m) < 0) return x; + else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } } - _isCmdFile() { - const upperToolPath = this.toolPath.toUpperCase(); - return (this._endsWith(upperToolPath, '.CMD') || - this._endsWith(upperToolPath, '.BAT')); + + function barrettRevert(x) { return x; } + + // x = x mod m (HAC 14.42) + function barrettReduce(x) { + x.drShiftTo(this.m.t-1,this.r2); + if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } + this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); + this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); + while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); + x.subTo(this.r2,x); + while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } - _windowsQuoteCmdArg(arg) { - // for .exe, apply the normal quoting rules that libuv applies - if (!this._isCmdFile()) { - return this._uvQuoteCmdArg(arg); + + // r = x^2 mod m; x != r + function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + // r = x*y mod m; x,y != r + function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + + Barrett.prototype.convert = barrettConvert; + Barrett.prototype.revert = barrettRevert; + Barrett.prototype.reduce = barrettReduce; + Barrett.prototype.mulTo = barrettMulTo; + Barrett.prototype.sqrTo = barrettSqrTo; + + // (public) this^e % m (HAC 14.85) + function bnModPow(e,m) { + var i = e.bitLength(), k, r = nbv(1), z; + if(i <= 0) return r; + else if(i < 18) k = 1; + else if(i < 48) k = 3; + else if(i < 144) k = 4; + else if(i < 768) k = 5; + else k = 6; + if(i < 8) + z = new Classic(m); + else if(m.isEven()) + z = new Barrett(m); + else + z = new Montgomery(m); + + // precomputation + var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { + var g2 = nbi(); + z.sqrTo(g[1],g2); + while(n <= km) { + g[n] = nbi(); + z.mulTo(g2,g[n-2],g[n]); + n += 2; } - // otherwise apply quoting rules specific to the cmd.exe command line parser. - // the libuv rules are generic and are not designed specifically for cmd.exe - // command line parser. - // - // for a detailed description of the cmd.exe command line parser, refer to - // http://stackoverflow.com/questions/4094699/how-does-the-windows-command-interpreter-cmd-exe-parse-scripts/7970912#7970912 - // need quotes for empty arg - if (!arg) { - return '""'; + } + + var j = e.t-1, w, is1 = true, r2 = nbi(), t; + i = nbits(e[j])-1; + while(j >= 0) { + if(i >= k1) w = (e[j]>>(i-k1))&km; + else { + w = (e[j]&((1<<(i+1))-1))<<(k1-i); + if(j > 0) w |= e[j-1]>>(this.DB+i-k1); } - // determine whether the arg needs to be quoted - const cmdSpecialChars = [ - ' ', - '\t', - '&', - '(', - ')', - '[', - ']', - '{', - '}', - '^', - '=', - ';', - '!', - "'", - '+', - ',', - '`', - '~', - '|', - '<', - '>', - '"' - ]; - let needsQuotes = false; - for (const char of arg) { - if (cmdSpecialChars.some(x => x === char)) { - needsQuotes = true; - break; - } + + n = k; + while((w&1) == 0) { w >>= 1; --n; } + if((i -= n) < 0) { i += this.DB; --j; } + if(is1) { // ret == 1, don't bother squaring or multiplying it + g[w].copyTo(r); + is1 = false; } - // short-circuit if quotes not needed - if (!needsQuotes) { - return arg; + else { + while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } + if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } + z.mulTo(r2,g[w],r); } - // the following quoting rules are very similar to the rules that by libuv applies. - // - // 1) wrap the string in quotes - // - // 2) double-up quotes - i.e. " => "" - // - // this is different from the libuv quoting rules. libuv replaces " with \", which unfortunately - // doesn't work well with a cmd.exe command line. - // - // note, replacing " with "" also works well if the arg is passed to a downstream .NET console app. - // for example, the command line: - // foo.exe "myarg:""my val""" - // is parsed by a .NET console app into an arg array: - // [ "myarg:\"my val\"" ] - // which is the same end result when applying libuv quoting rules. although the actual - // command line from libuv quoting rules would look like: - // foo.exe "myarg:\"my val\"" - // - // 3) double-up slashes that precede a quote, - // e.g. hello \world => "hello \world" - // hello\"world => "hello\\""world" - // hello\\"world => "hello\\\\""world" - // hello world\ => "hello world\\" - // - // technically this is not required for a cmd.exe command line, or the batch argument parser. - // the reasons for including this as a .cmd quoting rule are: - // - // a) this is optimized for the scenario where the argument is passed from the .cmd file to an - // external program. many programs (e.g. .NET console apps) rely on the slash-doubling rule. - // - // b) it's what we've been doing previously (by deferring to node default behavior) and we - // haven't heard any complaints about that aspect. - // - // note, a weakness of the quoting rules chosen here, is that % is not escaped. in fact, % cannot be - // escaped when used on the command line directly - even though within a .cmd file % can be escaped - // by using %%. - // - // the saving grace is, on the command line, %var% is left as-is if var is not defined. this contrasts - // the line parsing rules within a .cmd file, where if var is not defined it is replaced with nothing. - // - // one option that was explored was replacing % with ^% - i.e. %var% => ^%var^%. this hack would - // often work, since it is unlikely that var^ would exist, and the ^ character is removed when the - // variable is used. the problem, however, is that ^ is not removed when %* is used to pass the args - // to an external program. - // - // an unexplored potential solution for the % escaping problem, is to create a wrapper .cmd file. - // % can be escaped within a .cmd file. - let reverse = '"'; - let quoteHit = true; - for (let i = arg.length; i > 0; i--) { - // walk the string in reverse - reverse += arg[i - 1]; - if (quoteHit && arg[i - 1] === '\\') { - reverse += '\\'; // double the slash - } - else if (arg[i - 1] === '"') { - quoteHit = true; - reverse += '"'; // double the quote - } - else { - quoteHit = false; - } + + while(j >= 0 && (e[j]&(1< 0; i--) { - // walk the string in reverse - reverse += arg[i - 1]; - if (quoteHit && arg[i - 1] === '\\') { - reverse += '\\'; - } - else if (arg[i - 1] === '"') { - quoteHit = true; - reverse += '\\'; - } - else { - quoteHit = false; - } + + // (public) gcd(this,a) (HAC 14.54) + function bnGCD(a) { + var x = (this.s<0)?this.negate():this.clone(); + var y = (a.s<0)?a.negate():a.clone(); + if(x.compareTo(y) < 0) { var t = x; x = y; y = t; } + var i = x.getLowestSetBit(), g = y.getLowestSetBit(); + if(g < 0) return x; + if(i < g) g = i; + if(g > 0) { + x.rShiftTo(g,x); + y.rShiftTo(g,y); + } + while(x.signum() > 0) { + if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); + if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); + if(x.compareTo(y) >= 0) { + x.subTo(y,x); + x.rShiftTo(1,x); } - reverse += '"'; - return reverse - .split('') - .reverse() - .join(''); - } - _cloneExecOptions(options) { - options = options || {}; - const result = { - cwd: options.cwd || process.cwd(), - env: options.env || process.env, - silent: options.silent || false, - windowsVerbatimArguments: options.windowsVerbatimArguments || false, - failOnStdErr: options.failOnStdErr || false, - ignoreReturnCode: options.ignoreReturnCode || false, - delay: options.delay || 10000 - }; - result.outStream = options.outStream || process.stdout; - result.errStream = options.errStream || process.stderr; - return result; - } - _getSpawnOptions(options, toolPath) { - options = options || {}; - const result = {}; - result.cwd = options.cwd; - result.env = options.env; - result['windowsVerbatimArguments'] = - options.windowsVerbatimArguments || this._isCmdFile(); - if (options.windowsVerbatimArguments) { - result.argv0 = `"${toolPath}"`; + else { + y.subTo(x,y); + y.rShiftTo(1,y); } - return result; + } + if(g > 0) y.lShiftTo(g,y); + return y; } - /** - * Exec a tool. - * Output will be streamed to the live console. - * Returns promise with return code - * - * @param tool path to tool to exec - * @param options optional exec options. See ExecOptions - * @returns number - */ - exec() { - return __awaiter(this, void 0, void 0, function* () { - return new Promise((resolve, reject) => { - this._debug(`exec tool: ${this.toolPath}`); - this._debug('arguments:'); - for (const arg of this.args) { - this._debug(` ${arg}`); - } - const optionsNonNull = this._cloneExecOptions(this.options); - if (!optionsNonNull.silent && optionsNonNull.outStream) { - optionsNonNull.outStream.write(this._getCommandString(optionsNonNull) + os.EOL); - } - const state = new ExecState(optionsNonNull, this.toolPath); - state.on('debug', (message) => { - this._debug(message); - }); - const fileName = this._getSpawnFileName(); - const cp = child.spawn(fileName, this._getSpawnArgs(optionsNonNull), this._getSpawnOptions(this.options, fileName)); - const stdbuffer = ''; - if (cp.stdout) { - cp.stdout.on('data', (data) => { - if (this.options.listeners && this.options.listeners.stdout) { - this.options.listeners.stdout(data); - } - if (!optionsNonNull.silent && optionsNonNull.outStream) { - optionsNonNull.outStream.write(data); - } - this._processLineBuffer(data, stdbuffer, (line) => { - if (this.options.listeners && this.options.listeners.stdline) { - this.options.listeners.stdline(line); - } - }); - }); - } - const errbuffer = ''; - if (cp.stderr) { - cp.stderr.on('data', (data) => { - state.processStderr = true; - if (this.options.listeners && this.options.listeners.stderr) { - this.options.listeners.stderr(data); - } - if (!optionsNonNull.silent && - optionsNonNull.errStream && - optionsNonNull.outStream) { - const s = optionsNonNull.failOnStdErr - ? optionsNonNull.errStream - : optionsNonNull.outStream; - s.write(data); - } - this._processLineBuffer(data, errbuffer, (line) => { - if (this.options.listeners && this.options.listeners.errline) { - this.options.listeners.errline(line); - } - }); - }); - } - cp.on('error', (err) => { - state.processError = err.message; - state.processExited = true; - state.processClosed = true; - state.CheckComplete(); - }); - cp.on('exit', (code) => { - state.processExitCode = code; - state.processExited = true; - this._debug(`Exit code ${code} received from tool '${this.toolPath}'`); - state.CheckComplete(); - }); - cp.on('close', (code) => { - state.processExitCode = code; - state.processExited = true; - state.processClosed = true; - this._debug(`STDIO streams have closed for tool '${this.toolPath}'`); - state.CheckComplete(); - }); - state.on('done', (error, exitCode) => { - if (stdbuffer.length > 0) { - this.emit('stdline', stdbuffer); - } - if (errbuffer.length > 0) { - this.emit('errline', errbuffer); - } - cp.removeAllListeners(); - if (error) { - reject(error); - } - else { - resolve(exitCode); - } - }); - }); - }); + + // (protected) this % n, n < 2^26 + function bnpModInt(n) { + if(n <= 0) return 0; + var d = this.DV%n, r = (this.s<0)?n-1:0; + if(this.t > 0) + if(d == 0) r = this[0]%n; + else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; + return r; } -} -exports.ToolRunner = ToolRunner; -/** - * Convert an arg string to an array of args. Handles escaping - * - * @param argString string of arguments - * @returns string[] array of arguments - */ -function argStringToArray(argString) { - const args = []; - let inQuotes = false; - let escaped = false; - let arg = ''; - function append(c) { - // we only escape double quotes. - if (escaped && c !== '"') { - arg += '\\'; + + // (public) 1/this % m (HAC 14.61) + function bnModInverse(m) { + var ac = m.isEven(); + if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; + var u = m.clone(), v = this.clone(); + var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); + while(u.signum() != 0) { + while(u.isEven()) { + u.rShiftTo(1,u); + if(ac) { + if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } + a.rShiftTo(1,a); + } + else if(!b.isEven()) b.subTo(m,b); + b.rShiftTo(1,b); } - arg += c; - escaped = false; - } - for (let i = 0; i < argString.length; i++) { - const c = argString.charAt(i); - if (c === '"') { - if (!escaped) { - inQuotes = !inQuotes; - } - else { - append(c); - } - continue; + while(v.isEven()) { + v.rShiftTo(1,v); + if(ac) { + if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } + c.rShiftTo(1,c); + } + else if(!d.isEven()) d.subTo(m,d); + d.rShiftTo(1,d); } - if (c === '\\' && escaped) { - append(c); - continue; + if(u.compareTo(v) >= 0) { + u.subTo(v,u); + if(ac) a.subTo(c,a); + b.subTo(d,b); } - if (c === '\\' && inQuotes) { - escaped = true; - continue; + else { + v.subTo(u,v); + if(ac) c.subTo(a,c); + d.subTo(b,d); } - if (c === ' ' && !inQuotes) { - if (arg.length > 0) { - args.push(arg); - arg = ''; - } - continue; + } + if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; + if(d.compareTo(m) >= 0) return d.subtract(m); + if(d.signum() < 0) d.addTo(m,d); else return d; + if(d.signum() < 0) return d.add(m); else return d; + } + + var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; + var lplim = (1<<26)/lowprimes[lowprimes.length-1]; + + // (public) test primality with certainty >= 1-.5^t + function bnIsProbablePrime(t) { + var i, x = this.abs(); + if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { + for(i = 0; i < lowprimes.length; ++i) + if(x[0] == lowprimes[i]) return true; + return false; + } + if(x.isEven()) return false; + i = 1; + while(i < lowprimes.length) { + var m = lowprimes[i], j = i+1; + while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; + m = x.modInt(m); + while(i < j) if(m%lowprimes[i++] == 0) return false; + } + return x.millerRabin(t); + } + + // (protected) true if probably prime (HAC 4.24, Miller-Rabin) + function bnpMillerRabin(t) { + var n1 = this.subtract(BigInteger.ONE); + var k = n1.getLowestSetBit(); + if(k <= 0) return false; + var r = n1.shiftRight(k); + t = (t+1)>>1; + if(t > lowprimes.length) t = lowprimes.length; + var a = nbi(); + for(var i = 0; i < t; ++i) { + //Pick bases at random, instead of starting at 2 + a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); + var y = a.modPow(r,this); + if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { + var j = 1; + while(j++ < k && y.compareTo(n1) != 0) { + y = y.modPowInt(2,this); + if(y.compareTo(BigInteger.ONE) == 0) return false; + } + if(y.compareTo(n1) != 0) return false; } - append(c); + } + return true; } - if (arg.length > 0) { - args.push(arg.trim()); + + // protected + BigInteger.prototype.chunkSize = bnpChunkSize; + BigInteger.prototype.toRadix = bnpToRadix; + BigInteger.prototype.fromRadix = bnpFromRadix; + BigInteger.prototype.fromNumber = bnpFromNumber; + BigInteger.prototype.bitwiseTo = bnpBitwiseTo; + BigInteger.prototype.changeBit = bnpChangeBit; + BigInteger.prototype.addTo = bnpAddTo; + BigInteger.prototype.dMultiply = bnpDMultiply; + BigInteger.prototype.dAddOffset = bnpDAddOffset; + BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; + BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; + BigInteger.prototype.modInt = bnpModInt; + BigInteger.prototype.millerRabin = bnpMillerRabin; + + // public + BigInteger.prototype.clone = bnClone; + BigInteger.prototype.intValue = bnIntValue; + BigInteger.prototype.byteValue = bnByteValue; + BigInteger.prototype.shortValue = bnShortValue; + BigInteger.prototype.signum = bnSigNum; + BigInteger.prototype.toByteArray = bnToByteArray; + BigInteger.prototype.equals = bnEquals; + BigInteger.prototype.min = bnMin; + BigInteger.prototype.max = bnMax; + BigInteger.prototype.and = bnAnd; + BigInteger.prototype.or = bnOr; + BigInteger.prototype.xor = bnXor; + BigInteger.prototype.andNot = bnAndNot; + BigInteger.prototype.not = bnNot; + BigInteger.prototype.shiftLeft = bnShiftLeft; + BigInteger.prototype.shiftRight = bnShiftRight; + BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; + BigInteger.prototype.bitCount = bnBitCount; + BigInteger.prototype.testBit = bnTestBit; + BigInteger.prototype.setBit = bnSetBit; + BigInteger.prototype.clearBit = bnClearBit; + BigInteger.prototype.flipBit = bnFlipBit; + BigInteger.prototype.add = bnAdd; + BigInteger.prototype.subtract = bnSubtract; + BigInteger.prototype.multiply = bnMultiply; + BigInteger.prototype.divide = bnDivide; + BigInteger.prototype.remainder = bnRemainder; + BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; + BigInteger.prototype.modPow = bnModPow; + BigInteger.prototype.modInverse = bnModInverse; + BigInteger.prototype.pow = bnPow; + BigInteger.prototype.gcd = bnGCD; + BigInteger.prototype.isProbablePrime = bnIsProbablePrime; + + // JSBN-specific extension + BigInteger.prototype.square = bnSquare; + + // Expose the Barrett function + BigInteger.prototype.Barrett = Barrett + + // BigInteger interfaces not implemented in jsbn: + + // BigInteger(int signum, byte[] magnitude) + // double doubleValue() + // float floatValue() + // int hashCode() + // long longValue() + // static BigInteger valueOf(long val) + + // Random number generator - requires a PRNG backend, e.g. prng4.js + + // For best results, put code like + // + // in your main HTML document. + + var rng_state; + var rng_pool; + var rng_pptr; + + // Mix in a 32-bit integer into the pool + function rng_seed_int(x) { + rng_pool[rng_pptr++] ^= x & 255; + rng_pool[rng_pptr++] ^= (x >> 8) & 255; + rng_pool[rng_pptr++] ^= (x >> 16) & 255; + rng_pool[rng_pptr++] ^= (x >> 24) & 255; + if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; + } + + // Mix in the current time (w/milliseconds) into the pool + function rng_seed_time() { + rng_seed_int(new Date().getTime()); + } + + // Initialize the pool with junk if needed. + if(rng_pool == null) { + rng_pool = new Array(); + rng_pptr = 0; + var t; + if(typeof window !== "undefined" && window.crypto) { + if (window.crypto.getRandomValues) { + // Use webcrypto if available + var ua = new Uint8Array(32); + window.crypto.getRandomValues(ua); + for(t = 0; t < 32; ++t) + rng_pool[rng_pptr++] = ua[t]; + } + else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { + // Extract entropy (256 bits) from NS4 RNG if available + var z = window.crypto.random(32); + for(t = 0; t < z.length; ++t) + rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; + } + } + while(rng_pptr < rng_psize) { // extract some randomness from Math.random() + t = Math.floor(65536 * Math.random()); + rng_pool[rng_pptr++] = t >>> 8; + rng_pool[rng_pptr++] = t & 255; + } + rng_pptr = 0; + rng_seed_time(); + //rng_seed_int(window.screenX); + //rng_seed_int(window.screenY); + } + + function rng_get_byte() { + if(rng_state == null) { + rng_seed_time(); + rng_state = prng_newstate(); + rng_state.init(rng_pool); + for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) + rng_pool[rng_pptr] = 0; + rng_pptr = 0; + //rng_pool = null; + } + // TODO: allow reseeding after first request + return rng_state.next(); + } + + function rng_get_bytes(ba) { + var i; + for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); + } + + function SecureRandom() {} + + SecureRandom.prototype.nextBytes = rng_get_bytes; + + // prng4.js - uses Arcfour as a PRNG + + function Arcfour() { + this.i = 0; + this.j = 0; + this.S = new Array(); + } + + // Initialize arcfour context from key, an array of ints, each from [0..255] + function ARC4init(key) { + var i, j, t; + for(i = 0; i < 256; ++i) + this.S[i] = i; + j = 0; + for(i = 0; i < 256; ++i) { + j = (j + this.S[i] + key[i % key.length]) & 255; + t = this.S[i]; + this.S[i] = this.S[j]; + this.S[j] = t; + } + this.i = 0; + this.j = 0; + } + + function ARC4next() { + var t; + this.i = (this.i + 1) & 255; + this.j = (this.j + this.S[this.i]) & 255; + t = this.S[this.i]; + this.S[this.i] = this.S[this.j]; + this.S[this.j] = t; + return this.S[(t + this.S[this.i]) & 255]; + } + + Arcfour.prototype.init = ARC4init; + Arcfour.prototype.next = ARC4next; + + // Plug in your RNG constructor here + function prng_newstate() { + return new Arcfour(); + } + + // Pool size must be a multiple of 4 and greater than 32. + // An array of bytes the size of the pool will be passed to init() + var rng_psize = 256; + + BigInteger.SecureRandom = SecureRandom; + BigInteger.BigInteger = BigInteger; + if (true) { + exports = module.exports = BigInteger; + } else {} + +}).call(this); + + +/***/ }), + +/***/ 243: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + + +var net = __webpack_require__(631) + , tls = __webpack_require__(16) + , http = __webpack_require__(605) + , https = __webpack_require__(211) + , events = __webpack_require__(614) + , assert = __webpack_require__(357) + , util = __webpack_require__(669) + , Buffer = __webpack_require__(149).Buffer + ; + +exports.httpOverHttp = httpOverHttp +exports.httpsOverHttp = httpsOverHttp +exports.httpOverHttps = httpOverHttps +exports.httpsOverHttps = httpsOverHttps + + +function httpOverHttp(options) { + var agent = new TunnelingAgent(options) + agent.request = http.request + return agent +} + +function httpsOverHttp(options) { + var agent = new TunnelingAgent(options) + agent.request = http.request + agent.createSocket = createSecureSocket + agent.defaultPort = 443 + return agent +} + +function httpOverHttps(options) { + var agent = new TunnelingAgent(options) + agent.request = https.request + return agent +} + +function httpsOverHttps(options) { + var agent = new TunnelingAgent(options) + agent.request = https.request + agent.createSocket = createSecureSocket + agent.defaultPort = 443 + return agent +} + + +function TunnelingAgent(options) { + var self = this + self.options = options || {} + self.proxyOptions = self.options.proxy || {} + self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets + self.requests = [] + self.sockets = [] + + self.on('free', function onFree(socket, host, port) { + for (var i = 0, len = self.requests.length; i < len; ++i) { + var pending = self.requests[i] + if (pending.host === host && pending.port === port) { + // Detect the request to connect same origin server, + // reuse the connection. + self.requests.splice(i, 1) + pending.request.onSocket(socket) + return + } } - return args; + socket.destroy() + self.removeSocket(socket) + }) } -exports.argStringToArray = argStringToArray; -class ExecState extends events.EventEmitter { - constructor(options, toolPath) { - super(); - this.processClosed = false; // tracks whether the process has exited and stdio is closed - this.processError = ''; - this.processExitCode = 0; - this.processExited = false; // tracks whether the process has exited - this.processStderr = false; // tracks whether stderr was written to - this.delay = 10000; // 10 seconds - this.done = false; - this.timeout = null; - if (!toolPath) { - throw new Error('toolPath must not be empty'); - } - this.options = options; - this.toolPath = toolPath; - if (options.delay) { - this.delay = options.delay; - } +util.inherits(TunnelingAgent, events.EventEmitter) + +TunnelingAgent.prototype.addRequest = function addRequest(req, options) { + var self = this + + // Legacy API: addRequest(req, host, port, path) + if (typeof options === 'string') { + options = { + host: options, + port: arguments[2], + path: arguments[3] + }; + } + + if (self.sockets.length >= this.maxSockets) { + // We are over limit so we'll add it to the queue. + self.requests.push({host: options.host, port: options.port, request: req}) + return + } + + // If we are under maxSockets create a new one. + self.createConnection({host: options.host, port: options.port, request: req}) +} + +TunnelingAgent.prototype.createConnection = function createConnection(pending) { + var self = this + + self.createSocket(pending, function(socket) { + socket.on('free', onFree) + socket.on('close', onCloseOrRemove) + socket.on('agentRemove', onCloseOrRemove) + pending.request.onSocket(socket) + + function onFree() { + self.emit('free', socket, pending.host, pending.port) } - CheckComplete() { - if (this.done) { - return; - } - if (this.processClosed) { - this._setResult(); - } - else if (this.processExited) { - this.timeout = setTimeout(ExecState.HandleTimeout, this.delay, this); - } + + function onCloseOrRemove(err) { + self.removeSocket(socket) + socket.removeListener('free', onFree) + socket.removeListener('close', onCloseOrRemove) + socket.removeListener('agentRemove', onCloseOrRemove) } - _debug(message) { - this.emit('debug', message); + }) +} + +TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { + var self = this + var placeholder = {} + self.sockets.push(placeholder) + + var connectOptions = mergeOptions({}, self.proxyOptions, + { method: 'CONNECT' + , path: options.host + ':' + options.port + , agent: false } - _setResult() { - // determine whether there is an error - let error; - if (this.processExited) { - if (this.processError) { - error = new Error(`There was an error when attempting to execute the process '${this.toolPath}'. This may indicate the process failed to start. Error: ${this.processError}`); - } - else if (this.processExitCode !== 0 && !this.options.ignoreReturnCode) { - error = new Error(`The process '${this.toolPath}' failed with exit code ${this.processExitCode}`); - } - else if (this.processStderr && this.options.failOnStdErr) { - error = new Error(`The process '${this.toolPath}' failed because one or more lines were written to the STDERR stream`); - } - } - // clear the timeout - if (this.timeout) { - clearTimeout(this.timeout); - this.timeout = null; - } - this.done = true; - this.emit('done', error, this.processExitCode); + ) + if (connectOptions.proxyAuth) { + connectOptions.headers = connectOptions.headers || {} + connectOptions.headers['Proxy-Authorization'] = 'Basic ' + + Buffer.from(connectOptions.proxyAuth).toString('base64') + } + + debug('making CONNECT request') + var connectReq = self.request(connectOptions) + connectReq.useChunkedEncodingByDefault = false // for v0.6 + connectReq.once('response', onResponse) // for v0.6 + connectReq.once('upgrade', onUpgrade) // for v0.6 + connectReq.once('connect', onConnect) // for v0.7 or later + connectReq.once('error', onError) + connectReq.end() + + function onResponse(res) { + // Very hacky. This is necessary to avoid http-parser leaks. + res.upgrade = true + } + + function onUpgrade(res, socket, head) { + // Hacky. + process.nextTick(function() { + onConnect(res, socket, head) + }) + } + + function onConnect(res, socket, head) { + connectReq.removeAllListeners() + socket.removeAllListeners() + + if (res.statusCode === 200) { + assert.equal(head.length, 0) + debug('tunneling connection has established') + self.sockets[self.sockets.indexOf(placeholder)] = socket + cb(socket) + } else { + debug('tunneling socket could not be established, statusCode=%d', res.statusCode) + var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) + error.code = 'ECONNRESET' + options.request.emit('error', error) + self.removeSocket(placeholder) } - static HandleTimeout(state) { - if (state.done) { - return; - } - if (!state.processClosed && state.processExited) { - const message = `The STDIO streams did not close within ${state.delay / - 1000} seconds of the exit event from process '${state.toolPath}'. This may indicate a child process inherited the STDIO streams and has not yet exited.`; - state._debug(message); + } + + function onError(cause) { + connectReq.removeAllListeners() + + debug('tunneling socket could not be established, cause=%s\n', cause.message, cause.stack) + var error = new Error('tunneling socket could not be established, ' + 'cause=' + cause.message) + error.code = 'ECONNRESET' + options.request.emit('error', error) + self.removeSocket(placeholder) + } +} + +TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { + var pos = this.sockets.indexOf(socket) + if (pos === -1) return + + this.sockets.splice(pos, 1) + + var pending = this.requests.shift() + if (pending) { + // If we have pending requests and a socket gets closed a new one + // needs to be created to take over in the pool for the one that closed. + this.createConnection(pending) + } +} + +function createSecureSocket(options, cb) { + var self = this + TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { + // 0 is dummy port for v0.6 + var secureSocket = tls.connect(0, mergeOptions({}, self.options, + { servername: options.host + , socket: socket + } + )) + self.sockets[self.sockets.indexOf(socket)] = secureSocket + cb(secureSocket) + }) +} + + +function mergeOptions(target) { + for (var i = 1, len = arguments.length; i < len; ++i) { + var overrides = arguments[i] + if (typeof overrides === 'object') { + var keys = Object.keys(overrides) + for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { + var k = keys[j] + if (overrides[k] !== undefined) { + target[k] = overrides[k] } - state._setResult(); + } } + } + return target } -//# sourceMappingURL=toolrunner.js.map + + +var debug +if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { + debug = function() { + var args = Array.prototype.slice.call(arguments) + if (typeof args[0] === 'string') { + args[0] = 'TUNNEL: ' + args[0] + } else { + args.unshift('TUNNEL:') + } + console.error.apply(console, args) + } +} else { + debug = function() {} +} +exports.debug = debug // for test + /***/ }), -/***/ 221: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 249: +/***/ (function(module, __unusedexports, __webpack_require__) { -var crypto = __webpack_require__(417) +// Copyright 2011 Mark Cavage All rights reserved. -function sha (key, body, algorithm) { - return crypto.createHmac(algorithm, key).update(body).digest('base64') -} +var errors = __webpack_require__(584); +var types = __webpack_require__(362); -function rsa (key, body) { - return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') +var Reader = __webpack_require__(733); +var Writer = __webpack_require__(998); + + +// --- Exports + +module.exports = { + + Reader: Reader, + + Writer: Writer + +}; + +for (var t in types) { + if (types.hasOwnProperty(t)) + module.exports[t] = types[t]; +} +for (var e in errors) { + if (errors.hasOwnProperty(e)) + module.exports[e] = errors[e]; } -function rfc3986 (str) { - return encodeURIComponent(str) - .replace(/!/g,'%21') - .replace(/\*/g,'%2A') - .replace(/\(/g,'%28') - .replace(/\)/g,'%29') - .replace(/'/g,'%27') + +/***/ }), + +/***/ 254: +/***/ (function(module) { + +function Caseless (dict) { + this.dict = dict || {} } +Caseless.prototype.set = function (name, value, clobber) { + if (typeof name === 'object') { + for (var i in name) { + this.set(i, name[i], value) + } + } else { + if (typeof clobber === 'undefined') clobber = true + var has = this.has(name) -// Maps object to bi-dimensional array -// Converts { foo: 'A', bar: [ 'b', 'B' ]} to -// [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] -function map (obj) { - var key, val, arr = [] - for (key in obj) { - val = obj[key] - if (Array.isArray(val)) - for (var i = 0; i < val.length; i++) - arr.push([key, val[i]]) - else if (typeof val === 'object') - for (var prop in val) - arr.push([key + '[' + prop + ']', val[prop]]) - else - arr.push([key, val]) + if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value + else this.dict[has || name] = value + return has } - return arr +} +Caseless.prototype.has = function (name) { + var keys = Object.keys(this.dict) + , name = name.toLowerCase() + ; + for (var i=0;i b ? 1 : a < b ? -1 : 0 +module.exports = function (dict) {return new Caseless(dict)} +module.exports.httpify = function (resp, headers) { + var c = new Caseless(headers) + resp.setHeader = function (key, value, clobber) { + if (typeof value === 'undefined') return + return c.set(key, value, clobber) + } + resp.hasHeader = function (key) { + return c.has(key) + } + resp.getHeader = function (key) { + return c.get(key) + } + resp.removeHeader = function (key) { + return c.del(key) + } + resp.headers = c.dict + return c } -function generateBase (httpMethod, base_uri, params) { - // adapted from https://dev.twitter.com/docs/auth/oauth and - // https://dev.twitter.com/docs/auth/creating-signature - // Parameter normalization - // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 - var normalized = map(params) - // 1. First, the name and value of each parameter are encoded - .map(function (p) { - return [ rfc3986(p[0]), rfc3986(p[1] || '') ] - }) - // 2. The parameters are sorted by name, using ascending byte value - // ordering. If two or more parameters share the same name, they - // are sorted by their value. - .sort(function (a, b) { - return compare(a[0], b[0]) || compare(a[1], b[1]) - }) - // 3. The name of each parameter is concatenated to its corresponding - // value using an "=" character (ASCII code 61) as a separator, even - // if the value is empty. - .map(function (p) { return p.join('=') }) - // 4. The sorted name/value pairs are concatenated together into a - // single string by using an "&" character (ASCII code 38) as - // separator. - .join('&') +/***/ }), - var base = [ - rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), - rfc3986(base_uri), - rfc3986(normalized) - ].join('&') +/***/ 266: +/***/ (function(module) { - return base +"use strict"; + +module.exports = function generate_ref(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $async, $refCode; + if ($schema == '#' || $schema == '#/') { + if (it.isRoot) { + $async = it.async; + $refCode = 'validate'; + } else { + $async = it.root.schema.$async === true; + $refCode = 'root.refVal[0]'; + } + } else { + var $refVal = it.resolveRef(it.baseId, $schema, it.isRoot); + if ($refVal === undefined) { + var $message = it.MissingRefError.message(it.baseId, $schema); + if (it.opts.missingRefs == 'fail') { + it.logger.error($message); + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('$ref') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { ref: \'' + (it.util.escapeQuotes($schema)) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'can\\\'t resolve reference ' + (it.util.escapeQuotes($schema)) + '\' '; + } + if (it.opts.verbose) { + out += ' , schema: ' + (it.util.toQuotedString($schema)) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + if ($breakOnError) { + out += ' if (false) { '; + } + } else if (it.opts.missingRefs == 'ignore') { + it.logger.warn($message); + if ($breakOnError) { + out += ' if (true) { '; + } + } else { + throw new it.MissingRefError(it.baseId, $schema, $message); + } + } else if ($refVal.inline) { + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + $it.schema = $refVal.schema; + $it.schemaPath = ''; + $it.errSchemaPath = $schema; + var $code = it.validate($it).replace(/validate\.schema/g, $refVal.code); + out += ' ' + ($code) + ' '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + } + } else { + $async = $refVal.$async === true || (it.async && $refVal.$async !== false); + $refCode = $refVal.code; + } + } + if ($refCode) { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + if (it.opts.passContext) { + out += ' ' + ($refCode) + '.call(this, '; + } else { + out += ' ' + ($refCode) + '( '; + } + out += ' ' + ($data) + ', (dataPath || \'\')'; + if (it.errorPath != '""') { + out += ' + ' + (it.errorPath); + } + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ', rootData) '; + var __callValidate = out; + out = $$outStack.pop(); + if ($async) { + if (!it.async) throw new Error('async schema referenced by sync schema'); + if ($breakOnError) { + out += ' var ' + ($valid) + '; '; + } + out += ' try { await ' + (__callValidate) + '; '; + if ($breakOnError) { + out += ' ' + ($valid) + ' = true; '; + } + out += ' } catch (e) { if (!(e instanceof ValidationError)) throw e; if (vErrors === null) vErrors = e.errors; else vErrors = vErrors.concat(e.errors); errors = vErrors.length; '; + if ($breakOnError) { + out += ' ' + ($valid) + ' = false; '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($valid) + ') { '; + } + } else { + out += ' if (!' + (__callValidate) + ') { if (vErrors === null) vErrors = ' + ($refCode) + '.errors; else vErrors = vErrors.concat(' + ($refCode) + '.errors); errors = vErrors.length; } '; + if ($breakOnError) { + out += ' else { '; + } + } + } + return out; } -function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') - return sha(key, base, 'sha1') -} +/***/ }), -function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') +/***/ 268: +/***/ (function(module, __unusedexports, __webpack_require__) { - return sha(key, base, 'sha256') -} +// Copyright 2018 Joyent, Inc. -function rsasign (httpMethod, base_uri, params, private_key, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = private_key || '' +module.exports = { + read: read, + write: write +}; - return rsa(key, base) -} +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var crypto = __webpack_require__(417); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); -function plaintext (consumer_secret, token_secret) { - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') +var pkcs1 = __webpack_require__(449); +var pkcs8 = __webpack_require__(707); +var sshpriv = __webpack_require__(78); +var rfc4253 = __webpack_require__(538); - return key -} +var errors = __webpack_require__(753); -function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { - var method - var skipArgs = 1 +var OID_PBES2 = '1.2.840.113549.1.5.13'; +var OID_PBKDF2 = '1.2.840.113549.1.5.12'; - switch (signMethod) { - case 'RSA-SHA1': - method = rsasign - break - case 'HMAC-SHA1': - method = hmacsign - break - case 'HMAC-SHA256': - method = hmacsign256 - break - case 'PLAINTEXT': - method = plaintext - skipArgs = 4 - break - default: - throw new Error('Signature method not supported: ' + signMethod) - } +var OID_TO_CIPHER = { + '1.2.840.113549.3.7': '3des-cbc', + '2.16.840.1.101.3.4.1.2': 'aes128-cbc', + '2.16.840.1.101.3.4.1.42': 'aes256-cbc' +}; +var CIPHER_TO_OID = {}; +Object.keys(OID_TO_CIPHER).forEach(function (k) { + CIPHER_TO_OID[OID_TO_CIPHER[k]] = k; +}); - return method.apply(null, [].slice.call(arguments, skipArgs)) -} +var OID_TO_HASH = { + '1.2.840.113549.2.7': 'sha1', + '1.2.840.113549.2.9': 'sha256', + '1.2.840.113549.2.11': 'sha512' +}; +var HASH_TO_OID = {}; +Object.keys(OID_TO_HASH).forEach(function (k) { + HASH_TO_OID[OID_TO_HASH[k]] = k; +}); -exports.hmacsign = hmacsign -exports.hmacsign256 = hmacsign256 -exports.rsasign = rsasign -exports.plaintext = plaintext -exports.sign = sign -exports.rfc3986 = rfc3986 -exports.generateBase = generateBase +/* + * For reading we support both PKCS#1 and PKCS#8. If we find a private key, + * we just take the public component of it and use that. + */ +function read(buf, options, forceType) { + var input = buf; + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } + + var lines = buf.trim().split(/[\r\n]+/g); + + var m; + var si = -1; + while (!m && si < lines.length) { + m = lines[++si].match(/*JSSTYLED*/ + /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); + } + assert.ok(m, 'invalid PEM header'); + + var m2; + var ei = lines.length; + while (!m2 && ei > 0) { + m2 = lines[--ei].match(/*JSSTYLED*/ + /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); + } + assert.ok(m2, 'invalid PEM footer'); + + /* Begin and end banners must match key type */ + assert.equal(m[2], m2[2]); + var type = m[2].toLowerCase(); + + var alg; + if (m[1]) { + /* They also must match algorithms, if given */ + assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); + alg = m[1].trim(); + } + + lines = lines.slice(si, ei + 1); + + var headers = {}; + while (true) { + lines = lines.slice(1); + m = lines[0].match(/*JSSTYLED*/ + /^([A-Za-z0-9-]+): (.+)$/); + if (!m) + break; + headers[m[1].toLowerCase()] = m[2]; + } + + /* Chop off the first and last lines */ + lines = lines.slice(0, -1).join(''); + buf = Buffer.from(lines, 'base64'); + + var cipher, key, iv; + if (headers['proc-type']) { + var parts = headers['proc-type'].split(','); + if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from( + options.passphrase, 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'PEM')); + } else { + parts = headers['dek-info'].split(','); + assert.ok(parts.length === 2); + cipher = parts[0].toLowerCase(); + iv = Buffer.from(parts[1], 'hex'); + key = utils.opensslKeyDeriv(cipher, iv, + options.passphrase, 1).key; + } + } + } -/***/ }), + if (alg && alg.toLowerCase() === 'encrypted') { + var eder = new asn1.BerReader(buf); + var pbesEnd; + eder.readSequence(); -/***/ 230: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + eder.readSequence(); + pbesEnd = eder.offset + eder.length; -"use strict"; + var method = eder.readOID(); + if (method !== OID_PBES2) { + throw (new Error('Unsupported PEM/PKCS8 encryption ' + + 'scheme: ' + method)); + } -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const tr = __webpack_require__(218); -/** - * Exec a command. - * Output will be streamed to the live console. - * Returns promise with return code - * - * @param commandLine command to execute (can include additional args). Must be correctly escaped. - * @param args optional arguments for tool. Escaping is handled by the lib. - * @param options optional exec options. See ExecOptions - * @returns Promise exit code - */ -function exec(commandLine, args, options) { - return __awaiter(this, void 0, void 0, function* () { - const commandArgs = tr.argStringToArray(commandLine); - if (commandArgs.length === 0) { - throw new Error(`Parameter 'commandLine' cannot be null or empty.`); - } - // Path to tool to execute should be first arg - const toolPath = commandArgs[0]; - args = commandArgs.slice(1).concat(args || []); - const runner = new tr.ToolRunner(toolPath, args, options); - return runner.exec(); - }); -} -exports.exec = exec; -//# sourceMappingURL=exec.js.map + eder.readSequence(); /* PBES2-params */ -/***/ }), + eder.readSequence(); /* keyDerivationFunc */ + var kdfEnd = eder.offset + eder.length; + var kdfOid = eder.readOID(); + if (kdfOid !== OID_PBKDF2) + throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); + eder.readSequence(); + var salt = eder.readString(asn1.Ber.OctetString, true); + var iterations = eder.readInt(); + var hashAlg = 'sha1'; + if (eder.offset < kdfEnd) { + eder.readSequence(); + var hashAlgOid = eder.readOID(); + hashAlg = OID_TO_HASH[hashAlgOid]; + if (hashAlg === undefined) { + throw (new Error('Unsupported PBKDF2 hash: ' + + hashAlgOid)); + } + } + eder._offset = kdfEnd; -/***/ 254: -/***/ (function(module, __unusedexports, __webpack_require__) { + eder.readSequence(); /* encryptionScheme */ + var cipherOid = eder.readOID(); + cipher = OID_TO_CIPHER[cipherOid]; + if (cipher === undefined) { + throw (new Error('Unsupported PBES2 cipher: ' + + cipherOid)); + } + iv = eder.readString(asn1.Ber.OctetString, true); -var util = __webpack_require__(669); -var Stream = __webpack_require__(413).Stream; -var DelayedStream = __webpack_require__(584); + eder._offset = pbesEnd; + buf = eder.readString(asn1.Ber.OctetString, true); -module.exports = CombinedStream; -function CombinedStream() { - this.writable = false; - this.readable = true; - this.dataSize = 0; - this.maxDataSize = 2 * 1024 * 1024; - this.pauseStreams = true; + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from( + options.passphrase, 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'PEM')); + } - this._released = false; - this._streams = []; - this._currentStream = null; - this._insideLoop = false; - this._pendingNext = false; -} -util.inherits(CombinedStream, Stream); + var cinfo = utils.opensshCipherInfo(cipher); -CombinedStream.create = function(options) { - var combinedStream = new this(); + cipher = cinfo.opensslName; + key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, + options.passphrase); + alg = undefined; + } - options = options || {}; - for (var option in options) { - combinedStream[option] = options[option]; - } + if (cipher && key && iv) { + var cipherStream = crypto.createDecipheriv(cipher, key, iv); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + if (e.toString().indexOf('bad decrypt') !== -1) { + throw (new Error('Incorrect passphrase ' + + 'supplied, could not decrypt key')); + } + throw (e); + }); + cipherStream.write(buf); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + buf = Buffer.concat(chunks); + } - return combinedStream; -}; + /* The new OpenSSH internal format abuses PEM headers */ + if (alg && alg.toLowerCase() === 'openssh') + return (sshpriv.readSSHPrivate(type, buf, options)); + if (alg && alg.toLowerCase() === 'ssh2') + return (rfc4253.readType(type, buf, options)); -CombinedStream.isStreamLike = function(stream) { - return (typeof stream !== 'function') - && (typeof stream !== 'string') - && (typeof stream !== 'boolean') - && (typeof stream !== 'number') - && (!Buffer.isBuffer(stream)); -}; + var der = new asn1.BerReader(buf); + der.originalInput = input; -CombinedStream.prototype.append = function(stream) { - var isStreamLike = CombinedStream.isStreamLike(stream); + /* + * All of the PEM file types start with a sequence tag, so chop it + * off here + */ + der.readSequence(); - if (isStreamLike) { - if (!(stream instanceof DelayedStream)) { - var newStream = DelayedStream.create(stream, { - maxDataSize: Infinity, - pauseStream: this.pauseStreams, - }); - stream.on('data', this._checkDataSize.bind(this)); - stream = newStream; - } + /* PKCS#1 type keys name an algorithm in the banner explicitly */ + if (alg) { + if (forceType) + assert.strictEqual(forceType, 'pkcs1'); + return (pkcs1.readPkcs1(alg, type, der)); + } else { + if (forceType) + assert.strictEqual(forceType, 'pkcs8'); + return (pkcs8.readPkcs8(alg, type, der)); + } +} - this._handleErrors(stream); +function write(key, options, type) { + assert.object(key); - if (this.pauseStreams) { - stream.pause(); - } - } + var alg = { + 'ecdsa': 'EC', + 'rsa': 'RSA', + 'dsa': 'DSA', + 'ed25519': 'EdDSA' + }[key.type]; + var header; - this._streams.push(stream); - return this; -}; + var der = new asn1.BerWriter(); -CombinedStream.prototype.pipe = function(dest, options) { - Stream.prototype.pipe.call(this, dest, options); - this.resume(); - return dest; -}; + if (PrivateKey.isPrivateKey(key)) { + if (type && type === 'pkcs8') { + header = 'PRIVATE KEY'; + pkcs8.writePkcs8(der, key); + } else { + if (type) + assert.strictEqual(type, 'pkcs1'); + header = alg + ' PRIVATE KEY'; + pkcs1.writePkcs1(der, key); + } -CombinedStream.prototype._getNext = function() { - this._currentStream = null; + } else if (Key.isKey(key)) { + if (type && type === 'pkcs1') { + header = alg + ' PUBLIC KEY'; + pkcs1.writePkcs1(der, key); + } else { + if (type) + assert.strictEqual(type, 'pkcs8'); + header = 'PUBLIC KEY'; + pkcs8.writePkcs8(der, key); + } - if (this._insideLoop) { - this._pendingNext = true; - return; // defer call - } + } else { + throw (new Error('key is not a Key or PrivateKey')); + } - this._insideLoop = true; - try { - do { - this._pendingNext = false; - this._realGetNext(); - } while (this._pendingNext); - } finally { - this._insideLoop = false; - } -}; + var tmp = der.buffer.toString('base64'); + var len = tmp.length + (tmp.length / 64) + + 18 + 16 + header.length*2 + 10; + var buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 64; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); -CombinedStream.prototype._realGetNext = function() { - var stream = this._streams.shift(); + return (buf.slice(0, o)); +} - if (typeof stream == 'undefined') { - this.end(); - return; - } +/***/ }), - if (typeof stream !== 'function') { - this._pipeNext(stream); - return; - } +/***/ 270: +/***/ (function(module, __unusedexports, __webpack_require__) { - var getStream = stream; - getStream(function(stream) { - var isStreamLike = CombinedStream.isStreamLike(stream); - if (isStreamLike) { - stream.on('data', this._checkDataSize.bind(this)); - this._handleErrors(stream); - } +// Copyright 2015 Joyent, Inc. - this._pipeNext(stream); - }.bind(this)); +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + calculateED25519Public: calculateED25519Public, + calculateX25519Public: calculateX25519Public, + mpNormalize: mpNormalize, + mpDenormalize: mpDenormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo, + publicFromPrivateECDSA: publicFromPrivateECDSA, + zeroPadToLength: zeroPadToLength, + writeBitString: writeBitString, + readBitString: readBitString, + pbkdf2: pbkdf2 }; -CombinedStream.prototype._pipeNext = function(stream) { - this._currentStream = stream; - - var isStreamLike = CombinedStream.isStreamLike(stream); - if (isStreamLike) { - stream.on('end', this._getNext.bind(this)); - stream.pipe(this, {end: false}); - return; - } +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var PrivateKey = __webpack_require__(502); +var Key = __webpack_require__(852); +var crypto = __webpack_require__(417); +var algs = __webpack_require__(98); +var asn1 = __webpack_require__(62); - var value = stream; - this.write(value); - this._getNext(); -}; +var ec = __webpack_require__(729); +var jsbn = __webpack_require__(242).BigInteger; +var nacl = __webpack_require__(196); -CombinedStream.prototype._handleErrors = function(stream) { - var self = this; - stream.on('error', function(err) { - self._emitError(err); - }); -}; +var MAX_CLASS_DEPTH = 3; -CombinedStream.prototype.write = function(data) { - this.emit('data', data); -}; +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} -CombinedStream.prototype.pause = function() { - if (!this.pauseStreams) { - return; - } +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} - if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); - this.emit('pause'); +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 24, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 }, + 'aes-256-cbc': { key: 32, iv: 16 } }; +var PKCS5_SALT_LEN = 8; -CombinedStream.prototype.resume = function() { - if (!this._released) { - this._released = true; - this.writable = true; - this._getNext(); - } +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); - if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); - this.emit('resume'); -}; + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); -CombinedStream.prototype.end = function() { - this._reset(); - this.emit('end'); -}; + salt = salt.slice(0, PKCS5_SALT_LEN); -CombinedStream.prototype.destroy = function() { - this._reset(); - this.emit('close'); -}; + var D, D_prev, bufs; + var material = Buffer.alloc(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } -CombinedStream.prototype._reset = function() { - this.writable = false; - this._streams = []; - this._currentStream = null; -}; + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} -CombinedStream.prototype._checkDataSize = function() { - this._updateDataSize(); - if (this.dataSize <= this.maxDataSize) { - return; - } +/* See: RFC2898 */ +function pbkdf2(hashAlg, salt, iterations, size, passphrase) { + var hkey = Buffer.alloc(salt.length + 4); + salt.copy(hkey); - var message = - 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; - this._emitError(new Error(message)); -}; + var gen = 0, ts = []; + var i = 1; + while (gen < size) { + var t = T(i++); + gen += t.length; + ts.push(t); + } + return (Buffer.concat(ts).slice(0, size)); -CombinedStream.prototype._updateDataSize = function() { - this.dataSize = 0; + function T(I) { + hkey.writeUInt32BE(I, hkey.length - 4); - var self = this; - this._streams.forEach(function(stream) { - if (!stream.dataSize) { - return; - } + var hmac = crypto.createHmac(hashAlg, passphrase); + hmac.update(hkey); - self.dataSize += stream.dataSize; - }); + var Ti = hmac.digest(); + var Uc = Ti; + var c = 1; + while (c++ < iterations) { + hmac = crypto.createHmac(hashAlg, passphrase); + hmac.update(Uc); + Uc = hmac.digest(); + for (var x = 0; x < Ti.length; ++x) + Ti[x] ^= Uc[x]; + } + return (Ti); + } +} - if (this._currentStream && this._currentStream.dataSize) { - this.dataSize += this._currentStream.dataSize; - } -}; +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} -CombinedStream.prototype._emitError = function(err) { - this._reset(); - this.emit('error', err); -}; +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; -/***/ }), + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); -/***/ 256: -/***/ (function(module) { + return (parts); +} -module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} -/***/ }), +function readBitString(der, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var buf = der.readString(tag, true); + assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + + 'not supported (0x' + buf[0].toString(16) + ')'); + return (buf.slice(1)); +} -/***/ 258: -/***/ (function(module) { +function writeBitString(der, buf, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + der.writeBuffer(b, tag); +} -module.exports = function(size) { - return new LruCache(size) +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); } -function LruCache(size) { - this.capacity = size | 0 - this.map = Object.create(null) - this.list = new DoublyLinkedList() +function mpDenormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00) + buf = buf.slice(1); + return (buf); } -LruCache.prototype.get = function(key) { - var node = this.map[key] - if (node == null) return undefined - this.used(node) - return node.val +function zeroPadToLength(buf, len) { + assert.buffer(buf); + assert.number(len); + while (buf.length > len) { + assert.equal(buf[0], 0x00); + buf = buf.slice(1); + } + while (buf.length < len) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); } -LruCache.prototype.set = function(key, val) { - var node = this.map[key] - if (node != null) { - node.val = val - } else { - if (!this.capacity) this.prune() - if (!this.capacity) return false - node = new DoublyLinkedNode(key, val) - this.map[key] = node - this.capacity-- - } - this.used(node) - return true +function bigintToMpBuf(bigint) { + var buf = Buffer.from(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); } -LruCache.prototype.used = function(node) { - this.list.moveToFront(node) +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + g = new jsbn(g); + p = new jsbn(p); + x = new jsbn(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); } -LruCache.prototype.prune = function() { - var node = this.list.pop() - if (node != null) { - delete this.map[node.key] - this.capacity++ - } +function calculateED25519Public(k) { + assert.buffer(k); + + var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); } +function calculateX25519Public(k) { + assert.buffer(k); -function DoublyLinkedList() { - this.firstNode = null - this.lastNode = null + var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); } -DoublyLinkedList.prototype.moveToFront = function(node) { - if (this.firstNode == node) return +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); - this.remove(node) + var d = new jsbn(key.part.d.data); + var buf; - if (this.firstNode == null) { - this.firstNode = node - this.lastNode = node - node.prev = null - node.next = null - } else { - node.prev = null - node.next = this.firstNode - node.next.prev = node - this.firstNode = node - } -} + if (!key.part.dmodp) { + var p = new jsbn(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); -DoublyLinkedList.prototype.pop = function() { - var lastNode = this.lastNode - if (lastNode != null) { - this.remove(lastNode) - } - return lastNode -} + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new jsbn(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); -DoublyLinkedList.prototype.remove = function(node) { - if (this.firstNode == node) { - this.firstNode = node.next - } else if (node.prev != null) { - node.prev.next = node.next - } - if (this.lastNode == node) { - this.lastNode = node.prev - } else if (node.next != null) { - node.next.prev = node.prev - } + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } } +function publicFromPrivateECDSA(curveName, priv) { + assert.string(curveName, 'curveName'); + assert.buffer(priv); + var params = algs.curves[curveName]; + var p = new jsbn(params.p); + var a = new jsbn(params.a); + var b = new jsbn(params.b); + var curve = new ec.ECCurveFp(p, a, b); + var G = curve.decodePointHex(params.G.toString('hex')); -function DoublyLinkedNode(key, val) { - this.key = key - this.val = val - this.prev = null - this.next = null -} + var d = new jsbn(mpNormalize(priv)); + var pub = G.multiply(d); + pub = Buffer.from(curve.encodePointHex(pub), 'hex'); + var parts = []; + parts.push({name: 'curve', data: Buffer.from(curveName)}); + parts.push({name: 'Q', data: pub}); -/***/ }), + var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); + return (key); +} -/***/ 259: -/***/ (function(module) { +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} -module.exports = {"application/1d-interleaved-parityfec":{"source":"iana"},"application/3gpdash-qoe-report+xml":{"source":"iana","compressible":true},"application/3gpp-ims+xml":{"source":"iana","compressible":true},"application/a2l":{"source":"iana"},"application/activemessage":{"source":"iana"},"application/activity+json":{"source":"iana","compressible":true},"application/alto-costmap+json":{"source":"iana","compressible":true},"application/alto-costmapfilter+json":{"source":"iana","compressible":true},"application/alto-directory+json":{"source":"iana","compressible":true},"application/alto-endpointcost+json":{"source":"iana","compressible":true},"application/alto-endpointcostparams+json":{"source":"iana","compressible":true},"application/alto-endpointprop+json":{"source":"iana","compressible":true},"application/alto-endpointpropparams+json":{"source":"iana","compressible":true},"application/alto-error+json":{"source":"iana","compressible":true},"application/alto-networkmap+json":{"source":"iana","compressible":true},"application/alto-networkmapfilter+json":{"source":"iana","compressible":true},"application/aml":{"source":"iana"},"application/andrew-inset":{"source":"iana","extensions":["ez"]},"application/applefile":{"source":"iana"},"application/applixware":{"source":"apache","extensions":["aw"]},"application/atf":{"source":"iana"},"application/atfx":{"source":"iana"},"application/atom+xml":{"source":"iana","compressible":true,"extensions":["atom"]},"application/atomcat+xml":{"source":"iana","compressible":true,"extensions":["atomcat"]},"application/atomdeleted+xml":{"source":"iana","compressible":true},"application/atomicmail":{"source":"iana"},"application/atomsvc+xml":{"source":"iana","compressible":true,"extensions":["atomsvc"]},"application/atsc-dwd+xml":{"source":"iana","compressible":true},"application/atsc-held+xml":{"source":"iana","compressible":true},"application/atsc-rsat+xml":{"source":"iana","compressible":true},"application/atxml":{"source":"iana"},"application/auth-policy+xml":{"source":"iana","compressible":true},"application/bacnet-xdd+zip":{"source":"iana","compressible":false},"application/batch-smtp":{"source":"iana"},"application/bdoc":{"compressible":false,"extensions":["bdoc"]},"application/beep+xml":{"source":"iana","compressible":true},"application/calendar+json":{"source":"iana","compressible":true},"application/calendar+xml":{"source":"iana","compressible":true},"application/call-completion":{"source":"iana"},"application/cals-1840":{"source":"iana"},"application/cbor":{"source":"iana"},"application/cccex":{"source":"iana"},"application/ccmp+xml":{"source":"iana","compressible":true},"application/ccxml+xml":{"source":"iana","compressible":true,"extensions":["ccxml"]},"application/cdfx+xml":{"source":"iana","compressible":true},"application/cdmi-capability":{"source":"iana","extensions":["cdmia"]},"application/cdmi-container":{"source":"iana","extensions":["cdmic"]},"application/cdmi-domain":{"source":"iana","extensions":["cdmid"]},"application/cdmi-object":{"source":"iana","extensions":["cdmio"]},"application/cdmi-queue":{"source":"iana","extensions":["cdmiq"]},"application/cdni":{"source":"iana"},"application/cea":{"source":"iana"},"application/cea-2018+xml":{"source":"iana","compressible":true},"application/cellml+xml":{"source":"iana","compressible":true},"application/cfw":{"source":"iana"},"application/clue_info+xml":{"source":"iana","compressible":true},"application/cms":{"source":"iana"},"application/cnrp+xml":{"source":"iana","compressible":true},"application/coap-group+json":{"source":"iana","compressible":true},"application/coap-payload":{"source":"iana"},"application/commonground":{"source":"iana"},"application/conference-info+xml":{"source":"iana","compressible":true},"application/cose":{"source":"iana"},"application/cose-key":{"source":"iana"},"application/cose-key-set":{"source":"iana"},"application/cpl+xml":{"source":"iana","compressible":true},"application/csrattrs":{"source":"iana"},"application/csta+xml":{"source":"iana","compressible":true},"application/cstadata+xml":{"source":"iana","compressible":true},"application/csvm+json":{"source":"iana","compressible":true},"application/cu-seeme":{"source":"apache","extensions":["cu"]},"application/cwt":{"source":"iana"},"application/cybercash":{"source":"iana"},"application/dart":{"compressible":true},"application/dash+xml":{"source":"iana","compressible":true,"extensions":["mpd"]},"application/dashdelta":{"source":"iana"},"application/davmount+xml":{"source":"iana","compressible":true,"extensions":["davmount"]},"application/dca-rft":{"source":"iana"},"application/dcd":{"source":"iana"},"application/dec-dx":{"source":"iana"},"application/dialog-info+xml":{"source":"iana","compressible":true},"application/dicom":{"source":"iana"},"application/dicom+json":{"source":"iana","compressible":true},"application/dicom+xml":{"source":"iana","compressible":true},"application/dii":{"source":"iana"},"application/dit":{"source":"iana"},"application/dns":{"source":"iana"},"application/dns+json":{"source":"iana","compressible":true},"application/dns-message":{"source":"iana"},"application/docbook+xml":{"source":"apache","compressible":true,"extensions":["dbk"]},"application/dskpp+xml":{"source":"iana","compressible":true},"application/dssc+der":{"source":"iana","extensions":["dssc"]},"application/dssc+xml":{"source":"iana","compressible":true,"extensions":["xdssc"]},"application/dvcs":{"source":"iana"},"application/ecmascript":{"source":"iana","compressible":true,"extensions":["ecma","es"]},"application/edi-consent":{"source":"iana"},"application/edi-x12":{"source":"iana","compressible":false},"application/edifact":{"source":"iana","compressible":false},"application/efi":{"source":"iana"},"application/emergencycalldata.comment+xml":{"source":"iana","compressible":true},"application/emergencycalldata.control+xml":{"source":"iana","compressible":true},"application/emergencycalldata.deviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.ecall.msd":{"source":"iana"},"application/emergencycalldata.providerinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.serviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.subscriberinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.veds+xml":{"source":"iana","compressible":true},"application/emma+xml":{"source":"iana","compressible":true,"extensions":["emma"]},"application/emotionml+xml":{"source":"iana","compressible":true},"application/encaprtp":{"source":"iana"},"application/epp+xml":{"source":"iana","compressible":true},"application/epub+zip":{"source":"iana","compressible":false,"extensions":["epub"]},"application/eshop":{"source":"iana"},"application/exi":{"source":"iana","extensions":["exi"]},"application/expect-ct-report+json":{"source":"iana","compressible":true},"application/fastinfoset":{"source":"iana"},"application/fastsoap":{"source":"iana"},"application/fdt+xml":{"source":"iana","compressible":true},"application/fhir+json":{"source":"iana","compressible":true},"application/fhir+xml":{"source":"iana","compressible":true},"application/fido.trusted-apps+json":{"compressible":true},"application/fits":{"source":"iana"},"application/flexfec":{"source":"iana"},"application/font-sfnt":{"source":"iana"},"application/font-tdpfr":{"source":"iana","extensions":["pfr"]},"application/font-woff":{"source":"iana","compressible":false},"application/framework-attributes+xml":{"source":"iana","compressible":true},"application/geo+json":{"source":"iana","compressible":true,"extensions":["geojson"]},"application/geo+json-seq":{"source":"iana"},"application/geopackage+sqlite3":{"source":"iana"},"application/geoxacml+xml":{"source":"iana","compressible":true},"application/gltf-buffer":{"source":"iana"},"application/gml+xml":{"source":"iana","compressible":true,"extensions":["gml"]},"application/gpx+xml":{"source":"apache","compressible":true,"extensions":["gpx"]},"application/gxf":{"source":"apache","extensions":["gxf"]},"application/gzip":{"source":"iana","compressible":false,"extensions":["gz"]},"application/h224":{"source":"iana"},"application/held+xml":{"source":"iana","compressible":true},"application/hjson":{"extensions":["hjson"]},"application/http":{"source":"iana"},"application/hyperstudio":{"source":"iana","extensions":["stk"]},"application/ibe-key-request+xml":{"source":"iana","compressible":true},"application/ibe-pkg-reply+xml":{"source":"iana","compressible":true},"application/ibe-pp-data":{"source":"iana"},"application/iges":{"source":"iana"},"application/im-iscomposing+xml":{"source":"iana","compressible":true},"application/index":{"source":"iana"},"application/index.cmd":{"source":"iana"},"application/index.obj":{"source":"iana"},"application/index.response":{"source":"iana"},"application/index.vnd":{"source":"iana"},"application/inkml+xml":{"source":"iana","compressible":true,"extensions":["ink","inkml"]},"application/iotp":{"source":"iana"},"application/ipfix":{"source":"iana","extensions":["ipfix"]},"application/ipp":{"source":"iana"},"application/isup":{"source":"iana"},"application/its+xml":{"source":"iana","compressible":true},"application/java-archive":{"source":"apache","compressible":false,"extensions":["jar","war","ear"]},"application/java-serialized-object":{"source":"apache","compressible":false,"extensions":["ser"]},"application/java-vm":{"source":"apache","compressible":false,"extensions":["class"]},"application/javascript":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["js","mjs"]},"application/jf2feed+json":{"source":"iana","compressible":true},"application/jose":{"source":"iana"},"application/jose+json":{"source":"iana","compressible":true},"application/jrd+json":{"source":"iana","compressible":true},"application/json":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["json","map"]},"application/json-patch+json":{"source":"iana","compressible":true},"application/json-seq":{"source":"iana"},"application/json5":{"extensions":["json5"]},"application/jsonml+json":{"source":"apache","compressible":true,"extensions":["jsonml"]},"application/jwk+json":{"source":"iana","compressible":true},"application/jwk-set+json":{"source":"iana","compressible":true},"application/jwt":{"source":"iana"},"application/kpml-request+xml":{"source":"iana","compressible":true},"application/kpml-response+xml":{"source":"iana","compressible":true},"application/ld+json":{"source":"iana","compressible":true,"extensions":["jsonld"]},"application/lgr+xml":{"source":"iana","compressible":true},"application/link-format":{"source":"iana"},"application/load-control+xml":{"source":"iana","compressible":true},"application/lost+xml":{"source":"iana","compressible":true,"extensions":["lostxml"]},"application/lostsync+xml":{"source":"iana","compressible":true},"application/lxf":{"source":"iana"},"application/mac-binhex40":{"source":"iana","extensions":["hqx"]},"application/mac-compactpro":{"source":"apache","extensions":["cpt"]},"application/macwriteii":{"source":"iana"},"application/mads+xml":{"source":"iana","compressible":true,"extensions":["mads"]},"application/manifest+json":{"charset":"UTF-8","compressible":true,"extensions":["webmanifest"]},"application/marc":{"source":"iana","extensions":["mrc"]},"application/marcxml+xml":{"source":"iana","compressible":true,"extensions":["mrcx"]},"application/mathematica":{"source":"iana","extensions":["ma","nb","mb"]},"application/mathml+xml":{"source":"iana","compressible":true,"extensions":["mathml"]},"application/mathml-content+xml":{"source":"iana","compressible":true},"application/mathml-presentation+xml":{"source":"iana","compressible":true},"application/mbms-associated-procedure-description+xml":{"source":"iana","compressible":true},"application/mbms-deregister+xml":{"source":"iana","compressible":true},"application/mbms-envelope+xml":{"source":"iana","compressible":true},"application/mbms-msk+xml":{"source":"iana","compressible":true},"application/mbms-msk-response+xml":{"source":"iana","compressible":true},"application/mbms-protection-description+xml":{"source":"iana","compressible":true},"application/mbms-reception-report+xml":{"source":"iana","compressible":true},"application/mbms-register+xml":{"source":"iana","compressible":true},"application/mbms-register-response+xml":{"source":"iana","compressible":true},"application/mbms-schedule+xml":{"source":"iana","compressible":true},"application/mbms-user-service-description+xml":{"source":"iana","compressible":true},"application/mbox":{"source":"iana","extensions":["mbox"]},"application/media-policy-dataset+xml":{"source":"iana","compressible":true},"application/media_control+xml":{"source":"iana","compressible":true},"application/mediaservercontrol+xml":{"source":"iana","compressible":true,"extensions":["mscml"]},"application/merge-patch+json":{"source":"iana","compressible":true},"application/metalink+xml":{"source":"apache","compressible":true,"extensions":["metalink"]},"application/metalink4+xml":{"source":"iana","compressible":true,"extensions":["meta4"]},"application/mets+xml":{"source":"iana","compressible":true,"extensions":["mets"]},"application/mf4":{"source":"iana"},"application/mikey":{"source":"iana"},"application/mipc":{"source":"iana"},"application/mmt-aei+xml":{"source":"iana","compressible":true},"application/mmt-usd+xml":{"source":"iana","compressible":true},"application/mods+xml":{"source":"iana","compressible":true,"extensions":["mods"]},"application/moss-keys":{"source":"iana"},"application/moss-signature":{"source":"iana"},"application/mosskey-data":{"source":"iana"},"application/mosskey-request":{"source":"iana"},"application/mp21":{"source":"iana","extensions":["m21","mp21"]},"application/mp4":{"source":"iana","extensions":["mp4s","m4p"]},"application/mpeg4-generic":{"source":"iana"},"application/mpeg4-iod":{"source":"iana"},"application/mpeg4-iod-xmt":{"source":"iana"},"application/mrb-consumer+xml":{"source":"iana","compressible":true},"application/mrb-publish+xml":{"source":"iana","compressible":true},"application/msc-ivr+xml":{"source":"iana","compressible":true},"application/msc-mixer+xml":{"source":"iana","compressible":true},"application/msword":{"source":"iana","compressible":false,"extensions":["doc","dot"]},"application/mud+json":{"source":"iana","compressible":true},"application/mxf":{"source":"iana","extensions":["mxf"]},"application/n-quads":{"source":"iana","extensions":["nq"]},"application/n-triples":{"source":"iana","extensions":["nt"]},"application/nasdata":{"source":"iana"},"application/news-checkgroups":{"source":"iana"},"application/news-groupinfo":{"source":"iana"},"application/news-transmission":{"source":"iana"},"application/nlsml+xml":{"source":"iana","compressible":true},"application/node":{"source":"iana"},"application/nss":{"source":"iana"},"application/ocsp-request":{"source":"iana"},"application/ocsp-response":{"source":"iana"},"application/octet-stream":{"source":"iana","compressible":false,"extensions":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"]},"application/oda":{"source":"iana","extensions":["oda"]},"application/odm+xml":{"source":"iana","compressible":true},"application/odx":{"source":"iana"},"application/oebps-package+xml":{"source":"iana","compressible":true,"extensions":["opf"]},"application/ogg":{"source":"iana","compressible":false,"extensions":["ogx"]},"application/omdoc+xml":{"source":"apache","compressible":true,"extensions":["omdoc"]},"application/onenote":{"source":"apache","extensions":["onetoc","onetoc2","onetmp","onepkg"]},"application/oscore":{"source":"iana"},"application/oxps":{"source":"iana","extensions":["oxps"]},"application/p2p-overlay+xml":{"source":"iana","compressible":true},"application/parityfec":{"source":"iana"},"application/passport":{"source":"iana"},"application/patch-ops-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/pdf":{"source":"iana","compressible":false,"extensions":["pdf"]},"application/pdx":{"source":"iana"},"application/pem-certificate-chain":{"source":"iana"},"application/pgp-encrypted":{"source":"iana","compressible":false,"extensions":["pgp"]},"application/pgp-keys":{"source":"iana"},"application/pgp-signature":{"source":"iana","extensions":["asc","sig"]},"application/pics-rules":{"source":"apache","extensions":["prf"]},"application/pidf+xml":{"source":"iana","compressible":true},"application/pidf-diff+xml":{"source":"iana","compressible":true},"application/pkcs10":{"source":"iana","extensions":["p10"]},"application/pkcs12":{"source":"iana"},"application/pkcs7-mime":{"source":"iana","extensions":["p7m","p7c"]},"application/pkcs7-signature":{"source":"iana","extensions":["p7s"]},"application/pkcs8":{"source":"iana","extensions":["p8"]},"application/pkcs8-encrypted":{"source":"iana"},"application/pkix-attr-cert":{"source":"iana","extensions":["ac"]},"application/pkix-cert":{"source":"iana","extensions":["cer"]},"application/pkix-crl":{"source":"iana","extensions":["crl"]},"application/pkix-pkipath":{"source":"iana","extensions":["pkipath"]},"application/pkixcmp":{"source":"iana","extensions":["pki"]},"application/pls+xml":{"source":"iana","compressible":true,"extensions":["pls"]},"application/poc-settings+xml":{"source":"iana","compressible":true},"application/postscript":{"source":"iana","compressible":true,"extensions":["ai","eps","ps"]},"application/ppsp-tracker+json":{"source":"iana","compressible":true},"application/problem+json":{"source":"iana","compressible":true},"application/problem+xml":{"source":"iana","compressible":true},"application/provenance+xml":{"source":"iana","compressible":true},"application/prs.alvestrand.titrax-sheet":{"source":"iana"},"application/prs.cww":{"source":"iana","extensions":["cww"]},"application/prs.hpub+zip":{"source":"iana","compressible":false},"application/prs.nprend":{"source":"iana"},"application/prs.plucker":{"source":"iana"},"application/prs.rdf-xml-crypt":{"source":"iana"},"application/prs.xsf+xml":{"source":"iana","compressible":true},"application/pskc+xml":{"source":"iana","compressible":true,"extensions":["pskcxml"]},"application/qsig":{"source":"iana"},"application/raml+yaml":{"compressible":true,"extensions":["raml"]},"application/raptorfec":{"source":"iana"},"application/rdap+json":{"source":"iana","compressible":true},"application/rdf+xml":{"source":"iana","compressible":true,"extensions":["rdf","owl"]},"application/reginfo+xml":{"source":"iana","compressible":true,"extensions":["rif"]},"application/relax-ng-compact-syntax":{"source":"iana","extensions":["rnc"]},"application/remote-printing":{"source":"iana"},"application/reputon+json":{"source":"iana","compressible":true},"application/resource-lists+xml":{"source":"iana","compressible":true,"extensions":["rl"]},"application/resource-lists-diff+xml":{"source":"iana","compressible":true,"extensions":["rld"]},"application/rfc+xml":{"source":"iana","compressible":true},"application/riscos":{"source":"iana"},"application/rlmi+xml":{"source":"iana","compressible":true},"application/rls-services+xml":{"source":"iana","compressible":true,"extensions":["rs"]},"application/route-apd+xml":{"source":"iana","compressible":true},"application/route-s-tsid+xml":{"source":"iana","compressible":true},"application/route-usd+xml":{"source":"iana","compressible":true},"application/rpki-ghostbusters":{"source":"iana","extensions":["gbr"]},"application/rpki-manifest":{"source":"iana","extensions":["mft"]},"application/rpki-publication":{"source":"iana"},"application/rpki-roa":{"source":"iana","extensions":["roa"]},"application/rpki-updown":{"source":"iana"},"application/rsd+xml":{"source":"apache","compressible":true,"extensions":["rsd"]},"application/rss+xml":{"source":"apache","compressible":true,"extensions":["rss"]},"application/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"application/rtploopback":{"source":"iana"},"application/rtx":{"source":"iana"},"application/samlassertion+xml":{"source":"iana","compressible":true},"application/samlmetadata+xml":{"source":"iana","compressible":true},"application/sbml+xml":{"source":"iana","compressible":true,"extensions":["sbml"]},"application/scaip+xml":{"source":"iana","compressible":true},"application/scim+json":{"source":"iana","compressible":true},"application/scvp-cv-request":{"source":"iana","extensions":["scq"]},"application/scvp-cv-response":{"source":"iana","extensions":["scs"]},"application/scvp-vp-request":{"source":"iana","extensions":["spq"]},"application/scvp-vp-response":{"source":"iana","extensions":["spp"]},"application/sdp":{"source":"iana","extensions":["sdp"]},"application/secevent+jwt":{"source":"iana"},"application/senml+cbor":{"source":"iana"},"application/senml+json":{"source":"iana","compressible":true},"application/senml+xml":{"source":"iana","compressible":true},"application/senml-exi":{"source":"iana"},"application/sensml+cbor":{"source":"iana"},"application/sensml+json":{"source":"iana","compressible":true},"application/sensml+xml":{"source":"iana","compressible":true},"application/sensml-exi":{"source":"iana"},"application/sep+xml":{"source":"iana","compressible":true},"application/sep-exi":{"source":"iana"},"application/session-info":{"source":"iana"},"application/set-payment":{"source":"iana"},"application/set-payment-initiation":{"source":"iana","extensions":["setpay"]},"application/set-registration":{"source":"iana"},"application/set-registration-initiation":{"source":"iana","extensions":["setreg"]},"application/sgml":{"source":"iana"},"application/sgml-open-catalog":{"source":"iana"},"application/shf+xml":{"source":"iana","compressible":true,"extensions":["shf"]},"application/sieve":{"source":"iana","extensions":["siv","sieve"]},"application/simple-filter+xml":{"source":"iana","compressible":true},"application/simple-message-summary":{"source":"iana"},"application/simplesymbolcontainer":{"source":"iana"},"application/sipc":{"source":"iana"},"application/slate":{"source":"iana"},"application/smil":{"source":"iana"},"application/smil+xml":{"source":"iana","compressible":true,"extensions":["smi","smil"]},"application/smpte336m":{"source":"iana"},"application/soap+fastinfoset":{"source":"iana"},"application/soap+xml":{"source":"iana","compressible":true},"application/sparql-query":{"source":"iana","extensions":["rq"]},"application/sparql-results+xml":{"source":"iana","compressible":true,"extensions":["srx"]},"application/spirits-event+xml":{"source":"iana","compressible":true},"application/sql":{"source":"iana"},"application/srgs":{"source":"iana","extensions":["gram"]},"application/srgs+xml":{"source":"iana","compressible":true,"extensions":["grxml"]},"application/sru+xml":{"source":"iana","compressible":true,"extensions":["sru"]},"application/ssdl+xml":{"source":"apache","compressible":true,"extensions":["ssdl"]},"application/ssml+xml":{"source":"iana","compressible":true,"extensions":["ssml"]},"application/stix+json":{"source":"iana","compressible":true},"application/swid+xml":{"source":"iana","compressible":true},"application/tamp-apex-update":{"source":"iana"},"application/tamp-apex-update-confirm":{"source":"iana"},"application/tamp-community-update":{"source":"iana"},"application/tamp-community-update-confirm":{"source":"iana"},"application/tamp-error":{"source":"iana"},"application/tamp-sequence-adjust":{"source":"iana"},"application/tamp-sequence-adjust-confirm":{"source":"iana"},"application/tamp-status-query":{"source":"iana"},"application/tamp-status-response":{"source":"iana"},"application/tamp-update":{"source":"iana"},"application/tamp-update-confirm":{"source":"iana"},"application/tar":{"compressible":true},"application/taxii+json":{"source":"iana","compressible":true},"application/tei+xml":{"source":"iana","compressible":true,"extensions":["tei","teicorpus"]},"application/tetra_isi":{"source":"iana"},"application/thraud+xml":{"source":"iana","compressible":true,"extensions":["tfi"]},"application/timestamp-query":{"source":"iana"},"application/timestamp-reply":{"source":"iana"},"application/timestamped-data":{"source":"iana","extensions":["tsd"]},"application/tlsrpt+gzip":{"source":"iana"},"application/tlsrpt+json":{"source":"iana","compressible":true},"application/tnauthlist":{"source":"iana"},"application/toml":{"compressible":true,"extensions":["toml"]},"application/trickle-ice-sdpfrag":{"source":"iana"},"application/trig":{"source":"iana"},"application/ttml+xml":{"source":"iana","compressible":true},"application/tve-trigger":{"source":"iana"},"application/tzif":{"source":"iana"},"application/tzif-leap":{"source":"iana"},"application/ulpfec":{"source":"iana"},"application/urc-grpsheet+xml":{"source":"iana","compressible":true},"application/urc-ressheet+xml":{"source":"iana","compressible":true},"application/urc-targetdesc+xml":{"source":"iana","compressible":true},"application/urc-uisocketdesc+xml":{"source":"iana","compressible":true},"application/vcard+json":{"source":"iana","compressible":true},"application/vcard+xml":{"source":"iana","compressible":true},"application/vemmi":{"source":"iana"},"application/vividence.scriptfile":{"source":"apache"},"application/vnd.1000minds.decision-model+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose-pc3ch+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-v2x-local-service-information":{"source":"iana"},"application/vnd.3gpp.access-transfer-events+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.bsf+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.gmop+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mc-signalling-ear":{"source":"iana"},"application/vnd.3gpp.mcdata-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-payload":{"source":"iana"},"application/vnd.3gpp.mcdata-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-signalling":{"source":"iana"},"application/vnd.3gpp.mcdata-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-floor-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-signed+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-init-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-transmission-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mid-call+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.pic-bw-large":{"source":"iana","extensions":["plb"]},"application/vnd.3gpp.pic-bw-small":{"source":"iana","extensions":["psb"]},"application/vnd.3gpp.pic-bw-var":{"source":"iana","extensions":["pvb"]},"application/vnd.3gpp.sms":{"source":"iana"},"application/vnd.3gpp.sms+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-ext+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.state-and-event-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.ussd+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.bcmcsinfo+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.sms":{"source":"iana"},"application/vnd.3gpp2.tcap":{"source":"iana","extensions":["tcap"]},"application/vnd.3lightssoftware.imagescal":{"source":"iana"},"application/vnd.3m.post-it-notes":{"source":"iana","extensions":["pwn"]},"application/vnd.accpac.simply.aso":{"source":"iana","extensions":["aso"]},"application/vnd.accpac.simply.imp":{"source":"iana","extensions":["imp"]},"application/vnd.acucobol":{"source":"iana","extensions":["acu"]},"application/vnd.acucorp":{"source":"iana","extensions":["atc","acutc"]},"application/vnd.adobe.air-application-installer-package+zip":{"source":"apache","compressible":false,"extensions":["air"]},"application/vnd.adobe.flash.movie":{"source":"iana"},"application/vnd.adobe.formscentral.fcdt":{"source":"iana","extensions":["fcdt"]},"application/vnd.adobe.fxp":{"source":"iana","extensions":["fxp","fxpl"]},"application/vnd.adobe.partial-upload":{"source":"iana"},"application/vnd.adobe.xdp+xml":{"source":"iana","compressible":true,"extensions":["xdp"]},"application/vnd.adobe.xfdf":{"source":"iana","extensions":["xfdf"]},"application/vnd.aether.imp":{"source":"iana"},"application/vnd.afpc.afplinedata":{"source":"iana"},"application/vnd.afpc.modca":{"source":"iana"},"application/vnd.ah-barcode":{"source":"iana"},"application/vnd.ahead.space":{"source":"iana","extensions":["ahead"]},"application/vnd.airzip.filesecure.azf":{"source":"iana","extensions":["azf"]},"application/vnd.airzip.filesecure.azs":{"source":"iana","extensions":["azs"]},"application/vnd.amadeus+json":{"source":"iana","compressible":true},"application/vnd.amazon.ebook":{"source":"apache","extensions":["azw"]},"application/vnd.amazon.mobi8-ebook":{"source":"iana"},"application/vnd.americandynamics.acc":{"source":"iana","extensions":["acc"]},"application/vnd.amiga.ami":{"source":"iana","extensions":["ami"]},"application/vnd.amundsen.maze+xml":{"source":"iana","compressible":true},"application/vnd.android.ota":{"source":"iana"},"application/vnd.android.package-archive":{"source":"apache","compressible":false,"extensions":["apk"]},"application/vnd.anki":{"source":"iana"},"application/vnd.anser-web-certificate-issue-initiation":{"source":"iana","extensions":["cii"]},"application/vnd.anser-web-funds-transfer-initiation":{"source":"apache","extensions":["fti"]},"application/vnd.antix.game-component":{"source":"iana","extensions":["atx"]},"application/vnd.apache.thrift.binary":{"source":"iana"},"application/vnd.apache.thrift.compact":{"source":"iana"},"application/vnd.apache.thrift.json":{"source":"iana"},"application/vnd.api+json":{"source":"iana","compressible":true},"application/vnd.apothekende.reservation+json":{"source":"iana","compressible":true},"application/vnd.apple.installer+xml":{"source":"iana","compressible":true,"extensions":["mpkg"]},"application/vnd.apple.keynote":{"source":"iana","extensions":["keynote"]},"application/vnd.apple.mpegurl":{"source":"iana","extensions":["m3u8"]},"application/vnd.apple.numbers":{"source":"iana","extensions":["numbers"]},"application/vnd.apple.pages":{"source":"iana","extensions":["pages"]},"application/vnd.apple.pkpass":{"compressible":false,"extensions":["pkpass"]},"application/vnd.arastra.swi":{"source":"iana"},"application/vnd.aristanetworks.swi":{"source":"iana","extensions":["swi"]},"application/vnd.artisan+json":{"source":"iana","compressible":true},"application/vnd.artsquare":{"source":"iana"},"application/vnd.astraea-software.iota":{"source":"iana","extensions":["iota"]},"application/vnd.audiograph":{"source":"iana","extensions":["aep"]},"application/vnd.autopackage":{"source":"iana"},"application/vnd.avalon+json":{"source":"iana","compressible":true},"application/vnd.avistar+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmml+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmpr":{"source":"iana"},"application/vnd.banana-accounting":{"source":"iana"},"application/vnd.bbf.usp.error":{"source":"iana"},"application/vnd.bbf.usp.msg":{"source":"iana"},"application/vnd.bbf.usp.msg+json":{"source":"iana","compressible":true},"application/vnd.bekitzur-stech+json":{"source":"iana","compressible":true},"application/vnd.bint.med-content":{"source":"iana"},"application/vnd.biopax.rdf+xml":{"source":"iana","compressible":true},"application/vnd.blink-idb-value-wrapper":{"source":"iana"},"application/vnd.blueice.multipass":{"source":"iana","extensions":["mpm"]},"application/vnd.bluetooth.ep.oob":{"source":"iana"},"application/vnd.bluetooth.le.oob":{"source":"iana"},"application/vnd.bmi":{"source":"iana","extensions":["bmi"]},"application/vnd.bpf":{"source":"iana"},"application/vnd.bpf3":{"source":"iana"},"application/vnd.businessobjects":{"source":"iana","extensions":["rep"]},"application/vnd.byu.uapi+json":{"source":"iana","compressible":true},"application/vnd.cab-jscript":{"source":"iana"},"application/vnd.canon-cpdl":{"source":"iana"},"application/vnd.canon-lips":{"source":"iana"},"application/vnd.capasystems-pg+json":{"source":"iana","compressible":true},"application/vnd.cendio.thinlinc.clientconf":{"source":"iana"},"application/vnd.century-systems.tcp_stream":{"source":"iana"},"application/vnd.chemdraw+xml":{"source":"iana","compressible":true,"extensions":["cdxml"]},"application/vnd.chess-pgn":{"source":"iana"},"application/vnd.chipnuts.karaoke-mmd":{"source":"iana","extensions":["mmd"]},"application/vnd.ciedi":{"source":"iana"},"application/vnd.cinderella":{"source":"iana","extensions":["cdy"]},"application/vnd.cirpack.isdn-ext":{"source":"iana"},"application/vnd.citationstyles.style+xml":{"source":"iana","compressible":true,"extensions":["csl"]},"application/vnd.claymore":{"source":"iana","extensions":["cla"]},"application/vnd.cloanto.rp9":{"source":"iana","extensions":["rp9"]},"application/vnd.clonk.c4group":{"source":"iana","extensions":["c4g","c4d","c4f","c4p","c4u"]},"application/vnd.cluetrust.cartomobile-config":{"source":"iana","extensions":["c11amc"]},"application/vnd.cluetrust.cartomobile-config-pkg":{"source":"iana","extensions":["c11amz"]},"application/vnd.coffeescript":{"source":"iana"},"application/vnd.collabio.xodocuments.document":{"source":"iana"},"application/vnd.collabio.xodocuments.document-template":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation-template":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet-template":{"source":"iana"},"application/vnd.collection+json":{"source":"iana","compressible":true},"application/vnd.collection.doc+json":{"source":"iana","compressible":true},"application/vnd.collection.next+json":{"source":"iana","compressible":true},"application/vnd.comicbook+zip":{"source":"iana","compressible":false},"application/vnd.comicbook-rar":{"source":"iana"},"application/vnd.commerce-battelle":{"source":"iana"},"application/vnd.commonspace":{"source":"iana","extensions":["csp"]},"application/vnd.contact.cmsg":{"source":"iana","extensions":["cdbcmsg"]},"application/vnd.coreos.ignition+json":{"source":"iana","compressible":true},"application/vnd.cosmocaller":{"source":"iana","extensions":["cmc"]},"application/vnd.crick.clicker":{"source":"iana","extensions":["clkx"]},"application/vnd.crick.clicker.keyboard":{"source":"iana","extensions":["clkk"]},"application/vnd.crick.clicker.palette":{"source":"iana","extensions":["clkp"]},"application/vnd.crick.clicker.template":{"source":"iana","extensions":["clkt"]},"application/vnd.crick.clicker.wordbank":{"source":"iana","extensions":["clkw"]},"application/vnd.criticaltools.wbs+xml":{"source":"iana","compressible":true,"extensions":["wbs"]},"application/vnd.cryptii.pipe+json":{"source":"iana","compressible":true},"application/vnd.crypto-shade-file":{"source":"iana"},"application/vnd.ctc-posml":{"source":"iana","extensions":["pml"]},"application/vnd.ctct.ws+xml":{"source":"iana","compressible":true},"application/vnd.cups-pdf":{"source":"iana"},"application/vnd.cups-postscript":{"source":"iana"},"application/vnd.cups-ppd":{"source":"iana","extensions":["ppd"]},"application/vnd.cups-raster":{"source":"iana"},"application/vnd.cups-raw":{"source":"iana"},"application/vnd.curl":{"source":"iana"},"application/vnd.curl.car":{"source":"apache","extensions":["car"]},"application/vnd.curl.pcurl":{"source":"apache","extensions":["pcurl"]},"application/vnd.cyan.dean.root+xml":{"source":"iana","compressible":true},"application/vnd.cybank":{"source":"iana"},"application/vnd.d2l.coursepackage1p0+zip":{"source":"iana","compressible":false},"application/vnd.dart":{"source":"iana","compressible":true,"extensions":["dart"]},"application/vnd.data-vision.rdz":{"source":"iana","extensions":["rdz"]},"application/vnd.datapackage+json":{"source":"iana","compressible":true},"application/vnd.dataresource+json":{"source":"iana","compressible":true},"application/vnd.debian.binary-package":{"source":"iana"},"application/vnd.dece.data":{"source":"iana","extensions":["uvf","uvvf","uvd","uvvd"]},"application/vnd.dece.ttml+xml":{"source":"iana","compressible":true,"extensions":["uvt","uvvt"]},"application/vnd.dece.unspecified":{"source":"iana","extensions":["uvx","uvvx"]},"application/vnd.dece.zip":{"source":"iana","extensions":["uvz","uvvz"]},"application/vnd.denovo.fcselayout-link":{"source":"iana","extensions":["fe_launch"]},"application/vnd.desmume.movie":{"source":"iana"},"application/vnd.dir-bi.plate-dl-nosuffix":{"source":"iana"},"application/vnd.dm.delegation+xml":{"source":"iana","compressible":true},"application/vnd.dna":{"source":"iana","extensions":["dna"]},"application/vnd.document+json":{"source":"iana","compressible":true},"application/vnd.dolby.mlp":{"source":"apache","extensions":["mlp"]},"application/vnd.dolby.mobile.1":{"source":"iana"},"application/vnd.dolby.mobile.2":{"source":"iana"},"application/vnd.doremir.scorecloud-binary-document":{"source":"iana"},"application/vnd.dpgraph":{"source":"iana","extensions":["dpg"]},"application/vnd.dreamfactory":{"source":"iana","extensions":["dfac"]},"application/vnd.drive+json":{"source":"iana","compressible":true},"application/vnd.ds-keypoint":{"source":"apache","extensions":["kpxx"]},"application/vnd.dtg.local":{"source":"iana"},"application/vnd.dtg.local.flash":{"source":"iana"},"application/vnd.dtg.local.html":{"source":"iana"},"application/vnd.dvb.ait":{"source":"iana","extensions":["ait"]},"application/vnd.dvb.dvbj":{"source":"iana"},"application/vnd.dvb.esgcontainer":{"source":"iana"},"application/vnd.dvb.ipdcdftnotifaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess2":{"source":"iana"},"application/vnd.dvb.ipdcesgpdd":{"source":"iana"},"application/vnd.dvb.ipdcroaming":{"source":"iana"},"application/vnd.dvb.iptv.alfec-base":{"source":"iana"},"application/vnd.dvb.iptv.alfec-enhancement":{"source":"iana"},"application/vnd.dvb.notif-aggregate-root+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-container+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-generic+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-msglist+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-request+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-response+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-init+xml":{"source":"iana","compressible":true},"application/vnd.dvb.pfr":{"source":"iana"},"application/vnd.dvb.service":{"source":"iana","extensions":["svc"]},"application/vnd.dxr":{"source":"iana"},"application/vnd.dynageo":{"source":"iana","extensions":["geo"]},"application/vnd.dzr":{"source":"iana"},"application/vnd.easykaraoke.cdgdownload":{"source":"iana"},"application/vnd.ecdis-update":{"source":"iana"},"application/vnd.ecip.rlp":{"source":"iana"},"application/vnd.ecowin.chart":{"source":"iana","extensions":["mag"]},"application/vnd.ecowin.filerequest":{"source":"iana"},"application/vnd.ecowin.fileupdate":{"source":"iana"},"application/vnd.ecowin.series":{"source":"iana"},"application/vnd.ecowin.seriesrequest":{"source":"iana"},"application/vnd.ecowin.seriesupdate":{"source":"iana"},"application/vnd.efi.img":{"source":"iana"},"application/vnd.efi.iso":{"source":"iana"},"application/vnd.emclient.accessrequest+xml":{"source":"iana","compressible":true},"application/vnd.enliven":{"source":"iana","extensions":["nml"]},"application/vnd.enphase.envoy":{"source":"iana"},"application/vnd.eprints.data+xml":{"source":"iana","compressible":true},"application/vnd.epson.esf":{"source":"iana","extensions":["esf"]},"application/vnd.epson.msf":{"source":"iana","extensions":["msf"]},"application/vnd.epson.quickanime":{"source":"iana","extensions":["qam"]},"application/vnd.epson.salt":{"source":"iana","extensions":["slt"]},"application/vnd.epson.ssf":{"source":"iana","extensions":["ssf"]},"application/vnd.ericsson.quickcall":{"source":"iana"},"application/vnd.espass-espass+zip":{"source":"iana","compressible":false},"application/vnd.eszigno3+xml":{"source":"iana","compressible":true,"extensions":["es3","et3"]},"application/vnd.etsi.aoc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.asic-e+zip":{"source":"iana","compressible":false},"application/vnd.etsi.asic-s+zip":{"source":"iana","compressible":false},"application/vnd.etsi.cug+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvcommand+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-bc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-cod+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-npvr+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvservice+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsync+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvueprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mcid+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mheg5":{"source":"iana"},"application/vnd.etsi.overload-control-policy-dataset+xml":{"source":"iana","compressible":true},"application/vnd.etsi.pstn+xml":{"source":"iana","compressible":true},"application/vnd.etsi.sci+xml":{"source":"iana","compressible":true},"application/vnd.etsi.simservs+xml":{"source":"iana","compressible":true},"application/vnd.etsi.timestamp-token":{"source":"iana"},"application/vnd.etsi.tsl+xml":{"source":"iana","compressible":true},"application/vnd.etsi.tsl.der":{"source":"iana"},"application/vnd.eudora.data":{"source":"iana"},"application/vnd.evolv.ecig.profile":{"source":"iana"},"application/vnd.evolv.ecig.settings":{"source":"iana"},"application/vnd.evolv.ecig.theme":{"source":"iana"},"application/vnd.exstream-empower+zip":{"source":"iana","compressible":false},"application/vnd.exstream-package":{"source":"iana"},"application/vnd.ezpix-album":{"source":"iana","extensions":["ez2"]},"application/vnd.ezpix-package":{"source":"iana","extensions":["ez3"]},"application/vnd.f-secure.mobile":{"source":"iana"},"application/vnd.fastcopy-disk-image":{"source":"iana"},"application/vnd.fdf":{"source":"iana","extensions":["fdf"]},"application/vnd.fdsn.mseed":{"source":"iana","extensions":["mseed"]},"application/vnd.fdsn.seed":{"source":"iana","extensions":["seed","dataless"]},"application/vnd.ffsns":{"source":"iana"},"application/vnd.ficlab.flb+zip":{"source":"iana","compressible":false},"application/vnd.filmit.zfc":{"source":"iana"},"application/vnd.fints":{"source":"iana"},"application/vnd.firemonkeys.cloudcell":{"source":"iana"},"application/vnd.flographit":{"source":"iana","extensions":["gph"]},"application/vnd.fluxtime.clip":{"source":"iana","extensions":["ftc"]},"application/vnd.font-fontforge-sfd":{"source":"iana"},"application/vnd.framemaker":{"source":"iana","extensions":["fm","frame","maker","book"]},"application/vnd.frogans.fnc":{"source":"iana","extensions":["fnc"]},"application/vnd.frogans.ltf":{"source":"iana","extensions":["ltf"]},"application/vnd.fsc.weblaunch":{"source":"iana","extensions":["fsc"]},"application/vnd.fujitsu.oasys":{"source":"iana","extensions":["oas"]},"application/vnd.fujitsu.oasys2":{"source":"iana","extensions":["oa2"]},"application/vnd.fujitsu.oasys3":{"source":"iana","extensions":["oa3"]},"application/vnd.fujitsu.oasysgp":{"source":"iana","extensions":["fg5"]},"application/vnd.fujitsu.oasysprs":{"source":"iana","extensions":["bh2"]},"application/vnd.fujixerox.art-ex":{"source":"iana"},"application/vnd.fujixerox.art4":{"source":"iana"},"application/vnd.fujixerox.ddd":{"source":"iana","extensions":["ddd"]},"application/vnd.fujixerox.docuworks":{"source":"iana","extensions":["xdw"]},"application/vnd.fujixerox.docuworks.binder":{"source":"iana","extensions":["xbd"]},"application/vnd.fujixerox.docuworks.container":{"source":"iana"},"application/vnd.fujixerox.hbpl":{"source":"iana"},"application/vnd.fut-misnet":{"source":"iana"},"application/vnd.futoin+cbor":{"source":"iana"},"application/vnd.futoin+json":{"source":"iana","compressible":true},"application/vnd.fuzzysheet":{"source":"iana","extensions":["fzs"]},"application/vnd.genomatix.tuxedo":{"source":"iana","extensions":["txd"]},"application/vnd.geo+json":{"source":"iana","compressible":true},"application/vnd.geocube+xml":{"source":"iana","compressible":true},"application/vnd.geogebra.file":{"source":"iana","extensions":["ggb"]},"application/vnd.geogebra.tool":{"source":"iana","extensions":["ggt"]},"application/vnd.geometry-explorer":{"source":"iana","extensions":["gex","gre"]},"application/vnd.geonext":{"source":"iana","extensions":["gxt"]},"application/vnd.geoplan":{"source":"iana","extensions":["g2w"]},"application/vnd.geospace":{"source":"iana","extensions":["g3w"]},"application/vnd.gerber":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt-response":{"source":"iana"},"application/vnd.gmx":{"source":"iana","extensions":["gmx"]},"application/vnd.google-apps.document":{"compressible":false,"extensions":["gdoc"]},"application/vnd.google-apps.presentation":{"compressible":false,"extensions":["gslides"]},"application/vnd.google-apps.spreadsheet":{"compressible":false,"extensions":["gsheet"]},"application/vnd.google-earth.kml+xml":{"source":"iana","compressible":true,"extensions":["kml"]},"application/vnd.google-earth.kmz":{"source":"iana","compressible":false,"extensions":["kmz"]},"application/vnd.gov.sk.e-form+xml":{"source":"iana","compressible":true},"application/vnd.gov.sk.e-form+zip":{"source":"iana","compressible":false},"application/vnd.gov.sk.xmldatacontainer+xml":{"source":"iana","compressible":true},"application/vnd.grafeq":{"source":"iana","extensions":["gqf","gqs"]},"application/vnd.gridmp":{"source":"iana"},"application/vnd.groove-account":{"source":"iana","extensions":["gac"]},"application/vnd.groove-help":{"source":"iana","extensions":["ghf"]},"application/vnd.groove-identity-message":{"source":"iana","extensions":["gim"]},"application/vnd.groove-injector":{"source":"iana","extensions":["grv"]},"application/vnd.groove-tool-message":{"source":"iana","extensions":["gtm"]},"application/vnd.groove-tool-template":{"source":"iana","extensions":["tpl"]},"application/vnd.groove-vcard":{"source":"iana","extensions":["vcg"]},"application/vnd.hal+json":{"source":"iana","compressible":true},"application/vnd.hal+xml":{"source":"iana","compressible":true,"extensions":["hal"]},"application/vnd.handheld-entertainment+xml":{"source":"iana","compressible":true,"extensions":["zmm"]},"application/vnd.hbci":{"source":"iana","extensions":["hbci"]},"application/vnd.hc+json":{"source":"iana","compressible":true},"application/vnd.hcl-bireports":{"source":"iana"},"application/vnd.hdt":{"source":"iana"},"application/vnd.heroku+json":{"source":"iana","compressible":true},"application/vnd.hhe.lesson-player":{"source":"iana","extensions":["les"]},"application/vnd.hp-hpgl":{"source":"iana","extensions":["hpgl"]},"application/vnd.hp-hpid":{"source":"iana","extensions":["hpid"]},"application/vnd.hp-hps":{"source":"iana","extensions":["hps"]},"application/vnd.hp-jlyt":{"source":"iana","extensions":["jlt"]},"application/vnd.hp-pcl":{"source":"iana","extensions":["pcl"]},"application/vnd.hp-pclxl":{"source":"iana","extensions":["pclxl"]},"application/vnd.httphone":{"source":"iana"},"application/vnd.hydrostatix.sof-data":{"source":"iana","extensions":["sfd-hdstx"]},"application/vnd.hyper+json":{"source":"iana","compressible":true},"application/vnd.hyper-item+json":{"source":"iana","compressible":true},"application/vnd.hyperdrive+json":{"source":"iana","compressible":true},"application/vnd.hzn-3d-crossword":{"source":"iana"},"application/vnd.ibm.afplinedata":{"source":"iana"},"application/vnd.ibm.electronic-media":{"source":"iana"},"application/vnd.ibm.minipay":{"source":"iana","extensions":["mpy"]},"application/vnd.ibm.modcap":{"source":"iana","extensions":["afp","listafp","list3820"]},"application/vnd.ibm.rights-management":{"source":"iana","extensions":["irm"]},"application/vnd.ibm.secure-container":{"source":"iana","extensions":["sc"]},"application/vnd.iccprofile":{"source":"iana","extensions":["icc","icm"]},"application/vnd.ieee.1905":{"source":"iana"},"application/vnd.igloader":{"source":"iana","extensions":["igl"]},"application/vnd.imagemeter.folder+zip":{"source":"iana","compressible":false},"application/vnd.imagemeter.image+zip":{"source":"iana","compressible":false},"application/vnd.immervision-ivp":{"source":"iana","extensions":["ivp"]},"application/vnd.immervision-ivu":{"source":"iana","extensions":["ivu"]},"application/vnd.ims.imsccv1p1":{"source":"iana"},"application/vnd.ims.imsccv1p2":{"source":"iana"},"application/vnd.ims.imsccv1p3":{"source":"iana"},"application/vnd.ims.lis.v2.result+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolconsumerprofile+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy.id+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings.simple+json":{"source":"iana","compressible":true},"application/vnd.informedcontrol.rms+xml":{"source":"iana","compressible":true},"application/vnd.informix-visionary":{"source":"iana"},"application/vnd.infotech.project":{"source":"iana"},"application/vnd.infotech.project+xml":{"source":"iana","compressible":true},"application/vnd.innopath.wamp.notification":{"source":"iana"},"application/vnd.insors.igm":{"source":"iana","extensions":["igm"]},"application/vnd.intercon.formnet":{"source":"iana","extensions":["xpw","xpx"]},"application/vnd.intergeo":{"source":"iana","extensions":["i2g"]},"application/vnd.intertrust.digibox":{"source":"iana"},"application/vnd.intertrust.nncp":{"source":"iana"},"application/vnd.intu.qbo":{"source":"iana","extensions":["qbo"]},"application/vnd.intu.qfx":{"source":"iana","extensions":["qfx"]},"application/vnd.iptc.g2.catalogitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.conceptitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.knowledgeitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsmessage+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.packageitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.planningitem+xml":{"source":"iana","compressible":true},"application/vnd.ipunplugged.rcprofile":{"source":"iana","extensions":["rcprofile"]},"application/vnd.irepository.package+xml":{"source":"iana","compressible":true,"extensions":["irp"]},"application/vnd.is-xpr":{"source":"iana","extensions":["xpr"]},"application/vnd.isac.fcs":{"source":"iana","extensions":["fcs"]},"application/vnd.iso11783-10+zip":{"source":"iana","compressible":false},"application/vnd.jam":{"source":"iana","extensions":["jam"]},"application/vnd.japannet-directory-service":{"source":"iana"},"application/vnd.japannet-jpnstore-wakeup":{"source":"iana"},"application/vnd.japannet-payment-wakeup":{"source":"iana"},"application/vnd.japannet-registration":{"source":"iana"},"application/vnd.japannet-registration-wakeup":{"source":"iana"},"application/vnd.japannet-setstore-wakeup":{"source":"iana"},"application/vnd.japannet-verification":{"source":"iana"},"application/vnd.japannet-verification-wakeup":{"source":"iana"},"application/vnd.jcp.javame.midlet-rms":{"source":"iana","extensions":["rms"]},"application/vnd.jisp":{"source":"iana","extensions":["jisp"]},"application/vnd.joost.joda-archive":{"source":"iana","extensions":["joda"]},"application/vnd.jsk.isdn-ngn":{"source":"iana"},"application/vnd.kahootz":{"source":"iana","extensions":["ktz","ktr"]},"application/vnd.kde.karbon":{"source":"iana","extensions":["karbon"]},"application/vnd.kde.kchart":{"source":"iana","extensions":["chrt"]},"application/vnd.kde.kformula":{"source":"iana","extensions":["kfo"]},"application/vnd.kde.kivio":{"source":"iana","extensions":["flw"]},"application/vnd.kde.kontour":{"source":"iana","extensions":["kon"]},"application/vnd.kde.kpresenter":{"source":"iana","extensions":["kpr","kpt"]},"application/vnd.kde.kspread":{"source":"iana","extensions":["ksp"]},"application/vnd.kde.kword":{"source":"iana","extensions":["kwd","kwt"]},"application/vnd.kenameaapp":{"source":"iana","extensions":["htke"]},"application/vnd.kidspiration":{"source":"iana","extensions":["kia"]},"application/vnd.kinar":{"source":"iana","extensions":["kne","knp"]},"application/vnd.koan":{"source":"iana","extensions":["skp","skd","skt","skm"]},"application/vnd.kodak-descriptor":{"source":"iana","extensions":["sse"]},"application/vnd.las":{"source":"iana"},"application/vnd.las.las+json":{"source":"iana","compressible":true},"application/vnd.las.las+xml":{"source":"iana","compressible":true,"extensions":["lasxml"]},"application/vnd.laszip":{"source":"iana"},"application/vnd.leap+json":{"source":"iana","compressible":true},"application/vnd.liberty-request+xml":{"source":"iana","compressible":true},"application/vnd.llamagraphics.life-balance.desktop":{"source":"iana","extensions":["lbd"]},"application/vnd.llamagraphics.life-balance.exchange+xml":{"source":"iana","compressible":true,"extensions":["lbe"]},"application/vnd.logipipe.circuit+zip":{"source":"iana","compressible":false},"application/vnd.loom":{"source":"iana"},"application/vnd.lotus-1-2-3":{"source":"iana","extensions":["123"]},"application/vnd.lotus-approach":{"source":"iana","extensions":["apr"]},"application/vnd.lotus-freelance":{"source":"iana","extensions":["pre"]},"application/vnd.lotus-notes":{"source":"iana","extensions":["nsf"]},"application/vnd.lotus-organizer":{"source":"iana","extensions":["org"]},"application/vnd.lotus-screencam":{"source":"iana","extensions":["scm"]},"application/vnd.lotus-wordpro":{"source":"iana","extensions":["lwp"]},"application/vnd.macports.portpkg":{"source":"iana","extensions":["portpkg"]},"application/vnd.mapbox-vector-tile":{"source":"iana"},"application/vnd.marlin.drm.actiontoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.conftoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.license+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.mdcf":{"source":"iana"},"application/vnd.mason+json":{"source":"iana","compressible":true},"application/vnd.maxmind.maxmind-db":{"source":"iana"},"application/vnd.mcd":{"source":"iana","extensions":["mcd"]},"application/vnd.medcalcdata":{"source":"iana","extensions":["mc1"]},"application/vnd.mediastation.cdkey":{"source":"iana","extensions":["cdkey"]},"application/vnd.meridian-slingshot":{"source":"iana"},"application/vnd.mfer":{"source":"iana","extensions":["mwf"]},"application/vnd.mfmp":{"source":"iana","extensions":["mfm"]},"application/vnd.micro+json":{"source":"iana","compressible":true},"application/vnd.micrografx.flo":{"source":"iana","extensions":["flo"]},"application/vnd.micrografx.igx":{"source":"iana","extensions":["igx"]},"application/vnd.microsoft.portable-executable":{"source":"iana"},"application/vnd.microsoft.windows.thumbnail-cache":{"source":"iana"},"application/vnd.miele+json":{"source":"iana","compressible":true},"application/vnd.mif":{"source":"iana","extensions":["mif"]},"application/vnd.minisoft-hp3000-save":{"source":"iana"},"application/vnd.mitsubishi.misty-guard.trustweb":{"source":"iana"},"application/vnd.mobius.daf":{"source":"iana","extensions":["daf"]},"application/vnd.mobius.dis":{"source":"iana","extensions":["dis"]},"application/vnd.mobius.mbk":{"source":"iana","extensions":["mbk"]},"application/vnd.mobius.mqy":{"source":"iana","extensions":["mqy"]},"application/vnd.mobius.msl":{"source":"iana","extensions":["msl"]},"application/vnd.mobius.plc":{"source":"iana","extensions":["plc"]},"application/vnd.mobius.txf":{"source":"iana","extensions":["txf"]},"application/vnd.mophun.application":{"source":"iana","extensions":["mpn"]},"application/vnd.mophun.certificate":{"source":"iana","extensions":["mpc"]},"application/vnd.motorola.flexsuite":{"source":"iana"},"application/vnd.motorola.flexsuite.adsi":{"source":"iana"},"application/vnd.motorola.flexsuite.fis":{"source":"iana"},"application/vnd.motorola.flexsuite.gotap":{"source":"iana"},"application/vnd.motorola.flexsuite.kmr":{"source":"iana"},"application/vnd.motorola.flexsuite.ttc":{"source":"iana"},"application/vnd.motorola.flexsuite.wem":{"source":"iana"},"application/vnd.motorola.iprm":{"source":"iana"},"application/vnd.mozilla.xul+xml":{"source":"iana","compressible":true,"extensions":["xul"]},"application/vnd.ms-3mfdocument":{"source":"iana"},"application/vnd.ms-artgalry":{"source":"iana","extensions":["cil"]},"application/vnd.ms-asf":{"source":"iana"},"application/vnd.ms-cab-compressed":{"source":"iana","extensions":["cab"]},"application/vnd.ms-color.iccprofile":{"source":"apache"},"application/vnd.ms-excel":{"source":"iana","compressible":false,"extensions":["xls","xlm","xla","xlc","xlt","xlw"]},"application/vnd.ms-excel.addin.macroenabled.12":{"source":"iana","extensions":["xlam"]},"application/vnd.ms-excel.sheet.binary.macroenabled.12":{"source":"iana","extensions":["xlsb"]},"application/vnd.ms-excel.sheet.macroenabled.12":{"source":"iana","extensions":["xlsm"]},"application/vnd.ms-excel.template.macroenabled.12":{"source":"iana","extensions":["xltm"]},"application/vnd.ms-fontobject":{"source":"iana","compressible":true,"extensions":["eot"]},"application/vnd.ms-htmlhelp":{"source":"iana","extensions":["chm"]},"application/vnd.ms-ims":{"source":"iana","extensions":["ims"]},"application/vnd.ms-lrm":{"source":"iana","extensions":["lrm"]},"application/vnd.ms-office.activex+xml":{"source":"iana","compressible":true},"application/vnd.ms-officetheme":{"source":"iana","extensions":["thmx"]},"application/vnd.ms-opentype":{"source":"apache","compressible":true},"application/vnd.ms-outlook":{"compressible":false,"extensions":["msg"]},"application/vnd.ms-package.obfuscated-opentype":{"source":"apache"},"application/vnd.ms-pki.seccat":{"source":"apache","extensions":["cat"]},"application/vnd.ms-pki.stl":{"source":"apache","extensions":["stl"]},"application/vnd.ms-playready.initiator+xml":{"source":"iana","compressible":true},"application/vnd.ms-powerpoint":{"source":"iana","compressible":false,"extensions":["ppt","pps","pot"]},"application/vnd.ms-powerpoint.addin.macroenabled.12":{"source":"iana","extensions":["ppam"]},"application/vnd.ms-powerpoint.presentation.macroenabled.12":{"source":"iana","extensions":["pptm"]},"application/vnd.ms-powerpoint.slide.macroenabled.12":{"source":"iana","extensions":["sldm"]},"application/vnd.ms-powerpoint.slideshow.macroenabled.12":{"source":"iana","extensions":["ppsm"]},"application/vnd.ms-powerpoint.template.macroenabled.12":{"source":"iana","extensions":["potm"]},"application/vnd.ms-printdevicecapabilities+xml":{"source":"iana","compressible":true},"application/vnd.ms-printing.printticket+xml":{"source":"apache","compressible":true},"application/vnd.ms-printschematicket+xml":{"source":"iana","compressible":true},"application/vnd.ms-project":{"source":"iana","extensions":["mpp","mpt"]},"application/vnd.ms-tnef":{"source":"iana"},"application/vnd.ms-windows.devicepairing":{"source":"iana"},"application/vnd.ms-windows.nwprinting.oob":{"source":"iana"},"application/vnd.ms-windows.printerpairing":{"source":"iana"},"application/vnd.ms-windows.wsd.oob":{"source":"iana"},"application/vnd.ms-wmdrm.lic-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.lic-resp":{"source":"iana"},"application/vnd.ms-wmdrm.meter-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.meter-resp":{"source":"iana"},"application/vnd.ms-word.document.macroenabled.12":{"source":"iana","extensions":["docm"]},"application/vnd.ms-word.template.macroenabled.12":{"source":"iana","extensions":["dotm"]},"application/vnd.ms-works":{"source":"iana","extensions":["wps","wks","wcm","wdb"]},"application/vnd.ms-wpl":{"source":"iana","extensions":["wpl"]},"application/vnd.ms-xpsdocument":{"source":"iana","compressible":false,"extensions":["xps"]},"application/vnd.msa-disk-image":{"source":"iana"},"application/vnd.mseq":{"source":"iana","extensions":["mseq"]},"application/vnd.msign":{"source":"iana"},"application/vnd.multiad.creator":{"source":"iana"},"application/vnd.multiad.creator.cif":{"source":"iana"},"application/vnd.music-niff":{"source":"iana"},"application/vnd.musician":{"source":"iana","extensions":["mus"]},"application/vnd.muvee.style":{"source":"iana","extensions":["msty"]},"application/vnd.mynfc":{"source":"iana","extensions":["taglet"]},"application/vnd.ncd.control":{"source":"iana"},"application/vnd.ncd.reference":{"source":"iana"},"application/vnd.nearst.inv+json":{"source":"iana","compressible":true},"application/vnd.nervana":{"source":"iana"},"application/vnd.netfpx":{"source":"iana"},"application/vnd.neurolanguage.nlu":{"source":"iana","extensions":["nlu"]},"application/vnd.nimn":{"source":"iana"},"application/vnd.nintendo.nitro.rom":{"source":"iana"},"application/vnd.nintendo.snes.rom":{"source":"iana"},"application/vnd.nitf":{"source":"iana","extensions":["ntf","nitf"]},"application/vnd.noblenet-directory":{"source":"iana","extensions":["nnd"]},"application/vnd.noblenet-sealer":{"source":"iana","extensions":["nns"]},"application/vnd.noblenet-web":{"source":"iana","extensions":["nnw"]},"application/vnd.nokia.catalogs":{"source":"iana"},"application/vnd.nokia.conml+wbxml":{"source":"iana"},"application/vnd.nokia.conml+xml":{"source":"iana","compressible":true},"application/vnd.nokia.iptv.config+xml":{"source":"iana","compressible":true},"application/vnd.nokia.isds-radio-presets":{"source":"iana"},"application/vnd.nokia.landmark+wbxml":{"source":"iana"},"application/vnd.nokia.landmark+xml":{"source":"iana","compressible":true},"application/vnd.nokia.landmarkcollection+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.ac+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.data":{"source":"iana","extensions":["ngdat"]},"application/vnd.nokia.n-gage.symbian.install":{"source":"iana","extensions":["n-gage"]},"application/vnd.nokia.ncd":{"source":"iana"},"application/vnd.nokia.pcd+wbxml":{"source":"iana"},"application/vnd.nokia.pcd+xml":{"source":"iana","compressible":true},"application/vnd.nokia.radio-preset":{"source":"iana","extensions":["rpst"]},"application/vnd.nokia.radio-presets":{"source":"iana","extensions":["rpss"]},"application/vnd.novadigm.edm":{"source":"iana","extensions":["edm"]},"application/vnd.novadigm.edx":{"source":"iana","extensions":["edx"]},"application/vnd.novadigm.ext":{"source":"iana","extensions":["ext"]},"application/vnd.ntt-local.content-share":{"source":"iana"},"application/vnd.ntt-local.file-transfer":{"source":"iana"},"application/vnd.ntt-local.ogw_remote-access":{"source":"iana"},"application/vnd.ntt-local.sip-ta_remote":{"source":"iana"},"application/vnd.ntt-local.sip-ta_tcp_stream":{"source":"iana"},"application/vnd.oasis.opendocument.chart":{"source":"iana","extensions":["odc"]},"application/vnd.oasis.opendocument.chart-template":{"source":"iana","extensions":["otc"]},"application/vnd.oasis.opendocument.database":{"source":"iana","extensions":["odb"]},"application/vnd.oasis.opendocument.formula":{"source":"iana","extensions":["odf"]},"application/vnd.oasis.opendocument.formula-template":{"source":"iana","extensions":["odft"]},"application/vnd.oasis.opendocument.graphics":{"source":"iana","compressible":false,"extensions":["odg"]},"application/vnd.oasis.opendocument.graphics-template":{"source":"iana","extensions":["otg"]},"application/vnd.oasis.opendocument.image":{"source":"iana","extensions":["odi"]},"application/vnd.oasis.opendocument.image-template":{"source":"iana","extensions":["oti"]},"application/vnd.oasis.opendocument.presentation":{"source":"iana","compressible":false,"extensions":["odp"]},"application/vnd.oasis.opendocument.presentation-template":{"source":"iana","extensions":["otp"]},"application/vnd.oasis.opendocument.spreadsheet":{"source":"iana","compressible":false,"extensions":["ods"]},"application/vnd.oasis.opendocument.spreadsheet-template":{"source":"iana","extensions":["ots"]},"application/vnd.oasis.opendocument.text":{"source":"iana","compressible":false,"extensions":["odt"]},"application/vnd.oasis.opendocument.text-master":{"source":"iana","extensions":["odm"]},"application/vnd.oasis.opendocument.text-template":{"source":"iana","extensions":["ott"]},"application/vnd.oasis.opendocument.text-web":{"source":"iana","extensions":["oth"]},"application/vnd.obn":{"source":"iana"},"application/vnd.ocf+cbor":{"source":"iana"},"application/vnd.oftn.l10n+json":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessdownload+xml":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessstreaming+xml":{"source":"iana","compressible":true},"application/vnd.oipf.cspg-hexbinary":{"source":"iana"},"application/vnd.oipf.dae.svg+xml":{"source":"iana","compressible":true},"application/vnd.oipf.dae.xhtml+xml":{"source":"iana","compressible":true},"application/vnd.oipf.mippvcontrolmessage+xml":{"source":"iana","compressible":true},"application/vnd.oipf.pae.gem":{"source":"iana"},"application/vnd.oipf.spdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.oipf.spdlist+xml":{"source":"iana","compressible":true},"application/vnd.oipf.ueprofile+xml":{"source":"iana","compressible":true},"application/vnd.oipf.userprofile+xml":{"source":"iana","compressible":true},"application/vnd.olpc-sugar":{"source":"iana","extensions":["xo"]},"application/vnd.oma-scws-config":{"source":"iana"},"application/vnd.oma-scws-http-request":{"source":"iana"},"application/vnd.oma-scws-http-response":{"source":"iana"},"application/vnd.oma.bcast.associated-procedure-parameter+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.drm-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.imd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.ltkm":{"source":"iana"},"application/vnd.oma.bcast.notification+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.provisioningtrigger":{"source":"iana"},"application/vnd.oma.bcast.sgboot":{"source":"iana"},"application/vnd.oma.bcast.sgdd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sgdu":{"source":"iana"},"application/vnd.oma.bcast.simple-symbol-container":{"source":"iana"},"application/vnd.oma.bcast.smartcard-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sprov+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.stkm":{"source":"iana"},"application/vnd.oma.cab-address-book+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-feature-handler+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-pcc+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-subs-invite+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-user-prefs+xml":{"source":"iana","compressible":true},"application/vnd.oma.dcd":{"source":"iana"},"application/vnd.oma.dcdc":{"source":"iana"},"application/vnd.oma.dd2+xml":{"source":"iana","compressible":true,"extensions":["dd2"]},"application/vnd.oma.drm.risd+xml":{"source":"iana","compressible":true},"application/vnd.oma.group-usage-list+xml":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+json":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+tlv":{"source":"iana"},"application/vnd.oma.pal+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.detailed-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.final-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.groups+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.invocation-descriptor+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.optimized-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.push":{"source":"iana"},"application/vnd.oma.scidm.messages+xml":{"source":"iana","compressible":true},"application/vnd.oma.xcap-directory+xml":{"source":"iana","compressible":true},"application/vnd.omads-email+xml":{"source":"iana","compressible":true},"application/vnd.omads-file+xml":{"source":"iana","compressible":true},"application/vnd.omads-folder+xml":{"source":"iana","compressible":true},"application/vnd.omaloc-supl-init":{"source":"iana"},"application/vnd.onepager":{"source":"iana"},"application/vnd.onepagertamp":{"source":"iana"},"application/vnd.onepagertamx":{"source":"iana"},"application/vnd.onepagertat":{"source":"iana"},"application/vnd.onepagertatp":{"source":"iana"},"application/vnd.onepagertatx":{"source":"iana"},"application/vnd.openblox.game+xml":{"source":"iana","compressible":true},"application/vnd.openblox.game-binary":{"source":"iana"},"application/vnd.openeye.oeb":{"source":"iana"},"application/vnd.openofficeorg.extension":{"source":"apache","extensions":["oxt"]},"application/vnd.openstreetmap.data+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.custom-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.customxmlproperties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawing+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chart+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.extended-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presentation":{"source":"iana","compressible":false,"extensions":["pptx"]},"application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slide":{"source":"iana","extensions":["sldx"]},"application/vnd.openxmlformats-officedocument.presentationml.slide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideshow":{"source":"iana","extensions":["ppsx"]},"application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tags+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.template":{"source":"iana","extensions":["potx"]},"application/vnd.openxmlformats-officedocument.presentationml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":{"source":"iana","compressible":false,"extensions":["xlsx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.template":{"source":"iana","extensions":["xltx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.theme+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.themeoverride+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.vmldrawing":{"source":"iana"},"application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document":{"source":"iana","compressible":false,"extensions":["docx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.template":{"source":"iana","extensions":["dotx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.core-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.relationships+xml":{"source":"iana","compressible":true},"application/vnd.oracle.resource+json":{"source":"iana","compressible":true},"application/vnd.orange.indata":{"source":"iana"},"application/vnd.osa.netdeploy":{"source":"iana"},"application/vnd.osgeo.mapguide.package":{"source":"iana","extensions":["mgp"]},"application/vnd.osgi.bundle":{"source":"iana"},"application/vnd.osgi.dp":{"source":"iana","extensions":["dp"]},"application/vnd.osgi.subsystem":{"source":"iana","extensions":["esa"]},"application/vnd.otps.ct-kip+xml":{"source":"iana","compressible":true},"application/vnd.oxli.countgraph":{"source":"iana"},"application/vnd.pagerduty+json":{"source":"iana","compressible":true},"application/vnd.palm":{"source":"iana","extensions":["pdb","pqa","oprc"]},"application/vnd.panoply":{"source":"iana"},"application/vnd.paos.xml":{"source":"iana"},"application/vnd.patentdive":{"source":"iana"},"application/vnd.patientecommsdoc":{"source":"iana"},"application/vnd.pawaafile":{"source":"iana","extensions":["paw"]},"application/vnd.pcos":{"source":"iana"},"application/vnd.pg.format":{"source":"iana","extensions":["str"]},"application/vnd.pg.osasli":{"source":"iana","extensions":["ei6"]},"application/vnd.piaccess.application-licence":{"source":"iana"},"application/vnd.picsel":{"source":"iana","extensions":["efif"]},"application/vnd.pmi.widget":{"source":"iana","extensions":["wg"]},"application/vnd.poc.group-advertisement+xml":{"source":"iana","compressible":true},"application/vnd.pocketlearn":{"source":"iana","extensions":["plf"]},"application/vnd.powerbuilder6":{"source":"iana","extensions":["pbd"]},"application/vnd.powerbuilder6-s":{"source":"iana"},"application/vnd.powerbuilder7":{"source":"iana"},"application/vnd.powerbuilder7-s":{"source":"iana"},"application/vnd.powerbuilder75":{"source":"iana"},"application/vnd.powerbuilder75-s":{"source":"iana"},"application/vnd.preminet":{"source":"iana"},"application/vnd.previewsystems.box":{"source":"iana","extensions":["box"]},"application/vnd.proteus.magazine":{"source":"iana","extensions":["mgz"]},"application/vnd.psfs":{"source":"iana"},"application/vnd.publishare-delta-tree":{"source":"iana","extensions":["qps"]},"application/vnd.pvi.ptid1":{"source":"iana","extensions":["ptid"]},"application/vnd.pwg-multiplexed":{"source":"iana"},"application/vnd.pwg-xhtml-print+xml":{"source":"iana","compressible":true},"application/vnd.qualcomm.brew-app-res":{"source":"iana"},"application/vnd.quarantainenet":{"source":"iana"},"application/vnd.quark.quarkxpress":{"source":"iana","extensions":["qxd","qxt","qwd","qwt","qxl","qxb"]},"application/vnd.quobject-quoxdocument":{"source":"iana"},"application/vnd.radisys.moml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conn+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-stream+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-base+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-detect+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-sendrecv+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-group+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-speech+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-transform+xml":{"source":"iana","compressible":true},"application/vnd.rainstor.data":{"source":"iana"},"application/vnd.rapid":{"source":"iana"},"application/vnd.rar":{"source":"iana"},"application/vnd.realvnc.bed":{"source":"iana","extensions":["bed"]},"application/vnd.recordare.musicxml":{"source":"iana","extensions":["mxl"]},"application/vnd.recordare.musicxml+xml":{"source":"iana","compressible":true,"extensions":["musicxml"]},"application/vnd.renlearn.rlprint":{"source":"iana"},"application/vnd.restful+json":{"source":"iana","compressible":true},"application/vnd.rig.cryptonote":{"source":"iana","extensions":["cryptonote"]},"application/vnd.rim.cod":{"source":"apache","extensions":["cod"]},"application/vnd.rn-realmedia":{"source":"apache","extensions":["rm"]},"application/vnd.rn-realmedia-vbr":{"source":"apache","extensions":["rmvb"]},"application/vnd.route66.link66+xml":{"source":"iana","compressible":true,"extensions":["link66"]},"application/vnd.rs-274x":{"source":"iana"},"application/vnd.ruckus.download":{"source":"iana"},"application/vnd.s3sms":{"source":"iana"},"application/vnd.sailingtracker.track":{"source":"iana","extensions":["st"]},"application/vnd.sbm.cid":{"source":"iana"},"application/vnd.sbm.mid2":{"source":"iana"},"application/vnd.scribus":{"source":"iana"},"application/vnd.sealed.3df":{"source":"iana"},"application/vnd.sealed.csf":{"source":"iana"},"application/vnd.sealed.doc":{"source":"iana"},"application/vnd.sealed.eml":{"source":"iana"},"application/vnd.sealed.mht":{"source":"iana"},"application/vnd.sealed.net":{"source":"iana"},"application/vnd.sealed.ppt":{"source":"iana"},"application/vnd.sealed.tiff":{"source":"iana"},"application/vnd.sealed.xls":{"source":"iana"},"application/vnd.sealedmedia.softseal.html":{"source":"iana"},"application/vnd.sealedmedia.softseal.pdf":{"source":"iana"},"application/vnd.seemail":{"source":"iana","extensions":["see"]},"application/vnd.sema":{"source":"iana","extensions":["sema"]},"application/vnd.semd":{"source":"iana","extensions":["semd"]},"application/vnd.semf":{"source":"iana","extensions":["semf"]},"application/vnd.shade-save-file":{"source":"iana"},"application/vnd.shana.informed.formdata":{"source":"iana","extensions":["ifm"]},"application/vnd.shana.informed.formtemplate":{"source":"iana","extensions":["itp"]},"application/vnd.shana.informed.interchange":{"source":"iana","extensions":["iif"]},"application/vnd.shana.informed.package":{"source":"iana","extensions":["ipk"]},"application/vnd.shootproof+json":{"source":"iana","compressible":true},"application/vnd.shopkick+json":{"source":"iana","compressible":true},"application/vnd.sigrok.session":{"source":"iana"},"application/vnd.simtech-mindmapper":{"source":"iana","extensions":["twd","twds"]},"application/vnd.siren+json":{"source":"iana","compressible":true},"application/vnd.smaf":{"source":"iana","extensions":["mmf"]},"application/vnd.smart.notebook":{"source":"iana"},"application/vnd.smart.teacher":{"source":"iana","extensions":["teacher"]},"application/vnd.software602.filler.form+xml":{"source":"iana","compressible":true},"application/vnd.software602.filler.form-xml-zip":{"source":"iana"},"application/vnd.solent.sdkm+xml":{"source":"iana","compressible":true,"extensions":["sdkm","sdkd"]},"application/vnd.spotfire.dxp":{"source":"iana","extensions":["dxp"]},"application/vnd.spotfire.sfs":{"source":"iana","extensions":["sfs"]},"application/vnd.sqlite3":{"source":"iana"},"application/vnd.sss-cod":{"source":"iana"},"application/vnd.sss-dtf":{"source":"iana"},"application/vnd.sss-ntf":{"source":"iana"},"application/vnd.stardivision.calc":{"source":"apache","extensions":["sdc"]},"application/vnd.stardivision.draw":{"source":"apache","extensions":["sda"]},"application/vnd.stardivision.impress":{"source":"apache","extensions":["sdd"]},"application/vnd.stardivision.math":{"source":"apache","extensions":["smf"]},"application/vnd.stardivision.writer":{"source":"apache","extensions":["sdw","vor"]},"application/vnd.stardivision.writer-global":{"source":"apache","extensions":["sgl"]},"application/vnd.stepmania.package":{"source":"iana","extensions":["smzip"]},"application/vnd.stepmania.stepchart":{"source":"iana","extensions":["sm"]},"application/vnd.street-stream":{"source":"iana"},"application/vnd.sun.wadl+xml":{"source":"iana","compressible":true,"extensions":["wadl"]},"application/vnd.sun.xml.calc":{"source":"apache","extensions":["sxc"]},"application/vnd.sun.xml.calc.template":{"source":"apache","extensions":["stc"]},"application/vnd.sun.xml.draw":{"source":"apache","extensions":["sxd"]},"application/vnd.sun.xml.draw.template":{"source":"apache","extensions":["std"]},"application/vnd.sun.xml.impress":{"source":"apache","extensions":["sxi"]},"application/vnd.sun.xml.impress.template":{"source":"apache","extensions":["sti"]},"application/vnd.sun.xml.math":{"source":"apache","extensions":["sxm"]},"application/vnd.sun.xml.writer":{"source":"apache","extensions":["sxw"]},"application/vnd.sun.xml.writer.global":{"source":"apache","extensions":["sxg"]},"application/vnd.sun.xml.writer.template":{"source":"apache","extensions":["stw"]},"application/vnd.sus-calendar":{"source":"iana","extensions":["sus","susp"]},"application/vnd.svd":{"source":"iana","extensions":["svd"]},"application/vnd.swiftview-ics":{"source":"iana"},"application/vnd.symbian.install":{"source":"apache","extensions":["sis","sisx"]},"application/vnd.syncml+xml":{"source":"iana","compressible":true,"extensions":["xsm"]},"application/vnd.syncml.dm+wbxml":{"source":"iana","extensions":["bdm"]},"application/vnd.syncml.dm+xml":{"source":"iana","compressible":true,"extensions":["xdm"]},"application/vnd.syncml.dm.notification":{"source":"iana"},"application/vnd.syncml.dmddf+wbxml":{"source":"iana"},"application/vnd.syncml.dmddf+xml":{"source":"iana","compressible":true},"application/vnd.syncml.dmtnds+wbxml":{"source":"iana"},"application/vnd.syncml.dmtnds+xml":{"source":"iana","compressible":true},"application/vnd.syncml.ds.notification":{"source":"iana"},"application/vnd.tableschema+json":{"source":"iana","compressible":true},"application/vnd.tao.intent-module-archive":{"source":"iana","extensions":["tao"]},"application/vnd.tcpdump.pcap":{"source":"iana","extensions":["pcap","cap","dmp"]},"application/vnd.think-cell.ppttc+json":{"source":"iana","compressible":true},"application/vnd.tmd.mediaflex.api+xml":{"source":"iana","compressible":true},"application/vnd.tml":{"source":"iana"},"application/vnd.tmobile-livetv":{"source":"iana","extensions":["tmo"]},"application/vnd.tri.onesource":{"source":"iana"},"application/vnd.trid.tpt":{"source":"iana","extensions":["tpt"]},"application/vnd.triscape.mxs":{"source":"iana","extensions":["mxs"]},"application/vnd.trueapp":{"source":"iana","extensions":["tra"]},"application/vnd.truedoc":{"source":"iana"},"application/vnd.ubisoft.webplayer":{"source":"iana"},"application/vnd.ufdl":{"source":"iana","extensions":["ufd","ufdl"]},"application/vnd.uiq.theme":{"source":"iana","extensions":["utz"]},"application/vnd.umajin":{"source":"iana","extensions":["umj"]},"application/vnd.unity":{"source":"iana","extensions":["unityweb"]},"application/vnd.uoml+xml":{"source":"iana","compressible":true,"extensions":["uoml"]},"application/vnd.uplanet.alert":{"source":"iana"},"application/vnd.uplanet.alert-wbxml":{"source":"iana"},"application/vnd.uplanet.bearer-choice":{"source":"iana"},"application/vnd.uplanet.bearer-choice-wbxml":{"source":"iana"},"application/vnd.uplanet.cacheop":{"source":"iana"},"application/vnd.uplanet.cacheop-wbxml":{"source":"iana"},"application/vnd.uplanet.channel":{"source":"iana"},"application/vnd.uplanet.channel-wbxml":{"source":"iana"},"application/vnd.uplanet.list":{"source":"iana"},"application/vnd.uplanet.list-wbxml":{"source":"iana"},"application/vnd.uplanet.listcmd":{"source":"iana"},"application/vnd.uplanet.listcmd-wbxml":{"source":"iana"},"application/vnd.uplanet.signal":{"source":"iana"},"application/vnd.uri-map":{"source":"iana"},"application/vnd.valve.source.material":{"source":"iana"},"application/vnd.vcx":{"source":"iana","extensions":["vcx"]},"application/vnd.vd-study":{"source":"iana"},"application/vnd.vectorworks":{"source":"iana"},"application/vnd.vel+json":{"source":"iana","compressible":true},"application/vnd.verimatrix.vcas":{"source":"iana"},"application/vnd.veryant.thin":{"source":"iana"},"application/vnd.ves.encrypted":{"source":"iana"},"application/vnd.vidsoft.vidconference":{"source":"iana"},"application/vnd.visio":{"source":"iana","extensions":["vsd","vst","vss","vsw"]},"application/vnd.visionary":{"source":"iana","extensions":["vis"]},"application/vnd.vividence.scriptfile":{"source":"iana"},"application/vnd.vsf":{"source":"iana","extensions":["vsf"]},"application/vnd.wap.sic":{"source":"iana"},"application/vnd.wap.slc":{"source":"iana"},"application/vnd.wap.wbxml":{"source":"iana","extensions":["wbxml"]},"application/vnd.wap.wmlc":{"source":"iana","extensions":["wmlc"]},"application/vnd.wap.wmlscriptc":{"source":"iana","extensions":["wmlsc"]},"application/vnd.webturbo":{"source":"iana","extensions":["wtb"]},"application/vnd.wfa.p2p":{"source":"iana"},"application/vnd.wfa.wsc":{"source":"iana"},"application/vnd.windows.devicepairing":{"source":"iana"},"application/vnd.wmc":{"source":"iana"},"application/vnd.wmf.bootstrap":{"source":"iana"},"application/vnd.wolfram.mathematica":{"source":"iana"},"application/vnd.wolfram.mathematica.package":{"source":"iana"},"application/vnd.wolfram.player":{"source":"iana","extensions":["nbp"]},"application/vnd.wordperfect":{"source":"iana","extensions":["wpd"]},"application/vnd.wqd":{"source":"iana","extensions":["wqd"]},"application/vnd.wrq-hp3000-labelled":{"source":"iana"},"application/vnd.wt.stf":{"source":"iana","extensions":["stf"]},"application/vnd.wv.csp+wbxml":{"source":"iana"},"application/vnd.wv.csp+xml":{"source":"iana","compressible":true},"application/vnd.wv.ssp+xml":{"source":"iana","compressible":true},"application/vnd.xacml+json":{"source":"iana","compressible":true},"application/vnd.xara":{"source":"iana","extensions":["xar"]},"application/vnd.xfdl":{"source":"iana","extensions":["xfdl"]},"application/vnd.xfdl.webform":{"source":"iana"},"application/vnd.xmi+xml":{"source":"iana","compressible":true},"application/vnd.xmpie.cpkg":{"source":"iana"},"application/vnd.xmpie.dpkg":{"source":"iana"},"application/vnd.xmpie.plan":{"source":"iana"},"application/vnd.xmpie.ppkg":{"source":"iana"},"application/vnd.xmpie.xlim":{"source":"iana"},"application/vnd.yamaha.hv-dic":{"source":"iana","extensions":["hvd"]},"application/vnd.yamaha.hv-script":{"source":"iana","extensions":["hvs"]},"application/vnd.yamaha.hv-voice":{"source":"iana","extensions":["hvp"]},"application/vnd.yamaha.openscoreformat":{"source":"iana","extensions":["osf"]},"application/vnd.yamaha.openscoreformat.osfpvg+xml":{"source":"iana","compressible":true,"extensions":["osfpvg"]},"application/vnd.yamaha.remote-setup":{"source":"iana"},"application/vnd.yamaha.smaf-audio":{"source":"iana","extensions":["saf"]},"application/vnd.yamaha.smaf-phrase":{"source":"iana","extensions":["spf"]},"application/vnd.yamaha.through-ngn":{"source":"iana"},"application/vnd.yamaha.tunnel-udpencap":{"source":"iana"},"application/vnd.yaoweme":{"source":"iana"},"application/vnd.yellowriver-custom-menu":{"source":"iana","extensions":["cmp"]},"application/vnd.youtube.yt":{"source":"iana"},"application/vnd.zul":{"source":"iana","extensions":["zir","zirz"]},"application/vnd.zzazz.deck+xml":{"source":"iana","compressible":true,"extensions":["zaz"]},"application/voicexml+xml":{"source":"iana","compressible":true,"extensions":["vxml"]},"application/voucher-cms+json":{"source":"iana","compressible":true},"application/vq-rtcpxr":{"source":"iana"},"application/wasm":{"compressible":true,"extensions":["wasm"]},"application/watcherinfo+xml":{"source":"iana","compressible":true},"application/webpush-options+json":{"source":"iana","compressible":true},"application/whoispp-query":{"source":"iana"},"application/whoispp-response":{"source":"iana"},"application/widget":{"source":"iana","extensions":["wgt"]},"application/winhlp":{"source":"apache","extensions":["hlp"]},"application/wita":{"source":"iana"},"application/wordperfect5.1":{"source":"iana"},"application/wsdl+xml":{"source":"iana","compressible":true,"extensions":["wsdl"]},"application/wspolicy+xml":{"source":"iana","compressible":true,"extensions":["wspolicy"]},"application/x-7z-compressed":{"source":"apache","compressible":false,"extensions":["7z"]},"application/x-abiword":{"source":"apache","extensions":["abw"]},"application/x-ace-compressed":{"source":"apache","extensions":["ace"]},"application/x-amf":{"source":"apache"},"application/x-apple-diskimage":{"source":"apache","extensions":["dmg"]},"application/x-arj":{"compressible":false,"extensions":["arj"]},"application/x-authorware-bin":{"source":"apache","extensions":["aab","x32","u32","vox"]},"application/x-authorware-map":{"source":"apache","extensions":["aam"]},"application/x-authorware-seg":{"source":"apache","extensions":["aas"]},"application/x-bcpio":{"source":"apache","extensions":["bcpio"]},"application/x-bdoc":{"compressible":false,"extensions":["bdoc"]},"application/x-bittorrent":{"source":"apache","extensions":["torrent"]},"application/x-blorb":{"source":"apache","extensions":["blb","blorb"]},"application/x-bzip":{"source":"apache","compressible":false,"extensions":["bz"]},"application/x-bzip2":{"source":"apache","compressible":false,"extensions":["bz2","boz"]},"application/x-cbr":{"source":"apache","extensions":["cbr","cba","cbt","cbz","cb7"]},"application/x-cdlink":{"source":"apache","extensions":["vcd"]},"application/x-cfs-compressed":{"source":"apache","extensions":["cfs"]},"application/x-chat":{"source":"apache","extensions":["chat"]},"application/x-chess-pgn":{"source":"apache","extensions":["pgn"]},"application/x-chrome-extension":{"extensions":["crx"]},"application/x-cocoa":{"source":"nginx","extensions":["cco"]},"application/x-compress":{"source":"apache"},"application/x-conference":{"source":"apache","extensions":["nsc"]},"application/x-cpio":{"source":"apache","extensions":["cpio"]},"application/x-csh":{"source":"apache","extensions":["csh"]},"application/x-deb":{"compressible":false},"application/x-debian-package":{"source":"apache","extensions":["deb","udeb"]},"application/x-dgc-compressed":{"source":"apache","extensions":["dgc"]},"application/x-director":{"source":"apache","extensions":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]},"application/x-doom":{"source":"apache","extensions":["wad"]},"application/x-dtbncx+xml":{"source":"apache","compressible":true,"extensions":["ncx"]},"application/x-dtbook+xml":{"source":"apache","compressible":true,"extensions":["dtb"]},"application/x-dtbresource+xml":{"source":"apache","compressible":true,"extensions":["res"]},"application/x-dvi":{"source":"apache","compressible":false,"extensions":["dvi"]},"application/x-envoy":{"source":"apache","extensions":["evy"]},"application/x-eva":{"source":"apache","extensions":["eva"]},"application/x-font-bdf":{"source":"apache","extensions":["bdf"]},"application/x-font-dos":{"source":"apache"},"application/x-font-framemaker":{"source":"apache"},"application/x-font-ghostscript":{"source":"apache","extensions":["gsf"]},"application/x-font-libgrx":{"source":"apache"},"application/x-font-linux-psf":{"source":"apache","extensions":["psf"]},"application/x-font-pcf":{"source":"apache","extensions":["pcf"]},"application/x-font-snf":{"source":"apache","extensions":["snf"]},"application/x-font-speedo":{"source":"apache"},"application/x-font-sunos-news":{"source":"apache"},"application/x-font-type1":{"source":"apache","extensions":["pfa","pfb","pfm","afm"]},"application/x-font-vfont":{"source":"apache"},"application/x-freearc":{"source":"apache","extensions":["arc"]},"application/x-futuresplash":{"source":"apache","extensions":["spl"]},"application/x-gca-compressed":{"source":"apache","extensions":["gca"]},"application/x-glulx":{"source":"apache","extensions":["ulx"]},"application/x-gnumeric":{"source":"apache","extensions":["gnumeric"]},"application/x-gramps-xml":{"source":"apache","extensions":["gramps"]},"application/x-gtar":{"source":"apache","extensions":["gtar"]},"application/x-gzip":{"source":"apache"},"application/x-hdf":{"source":"apache","extensions":["hdf"]},"application/x-httpd-php":{"compressible":true,"extensions":["php"]},"application/x-install-instructions":{"source":"apache","extensions":["install"]},"application/x-iso9660-image":{"source":"apache","extensions":["iso"]},"application/x-java-archive-diff":{"source":"nginx","extensions":["jardiff"]},"application/x-java-jnlp-file":{"source":"apache","compressible":false,"extensions":["jnlp"]},"application/x-javascript":{"compressible":true},"application/x-latex":{"source":"apache","compressible":false,"extensions":["latex"]},"application/x-lua-bytecode":{"extensions":["luac"]},"application/x-lzh-compressed":{"source":"apache","extensions":["lzh","lha"]},"application/x-makeself":{"source":"nginx","extensions":["run"]},"application/x-mie":{"source":"apache","extensions":["mie"]},"application/x-mobipocket-ebook":{"source":"apache","extensions":["prc","mobi"]},"application/x-mpegurl":{"compressible":false},"application/x-ms-application":{"source":"apache","extensions":["application"]},"application/x-ms-shortcut":{"source":"apache","extensions":["lnk"]},"application/x-ms-wmd":{"source":"apache","extensions":["wmd"]},"application/x-ms-wmz":{"source":"apache","extensions":["wmz"]},"application/x-ms-xbap":{"source":"apache","extensions":["xbap"]},"application/x-msaccess":{"source":"apache","extensions":["mdb"]},"application/x-msbinder":{"source":"apache","extensions":["obd"]},"application/x-mscardfile":{"source":"apache","extensions":["crd"]},"application/x-msclip":{"source":"apache","extensions":["clp"]},"application/x-msdos-program":{"extensions":["exe"]},"application/x-msdownload":{"source":"apache","extensions":["exe","dll","com","bat","msi"]},"application/x-msmediaview":{"source":"apache","extensions":["mvb","m13","m14"]},"application/x-msmetafile":{"source":"apache","extensions":["wmf","wmz","emf","emz"]},"application/x-msmoney":{"source":"apache","extensions":["mny"]},"application/x-mspublisher":{"source":"apache","extensions":["pub"]},"application/x-msschedule":{"source":"apache","extensions":["scd"]},"application/x-msterminal":{"source":"apache","extensions":["trm"]},"application/x-mswrite":{"source":"apache","extensions":["wri"]},"application/x-netcdf":{"source":"apache","extensions":["nc","cdf"]},"application/x-ns-proxy-autoconfig":{"compressible":true,"extensions":["pac"]},"application/x-nzb":{"source":"apache","extensions":["nzb"]},"application/x-perl":{"source":"nginx","extensions":["pl","pm"]},"application/x-pilot":{"source":"nginx","extensions":["prc","pdb"]},"application/x-pkcs12":{"source":"apache","compressible":false,"extensions":["p12","pfx"]},"application/x-pkcs7-certificates":{"source":"apache","extensions":["p7b","spc"]},"application/x-pkcs7-certreqresp":{"source":"apache","extensions":["p7r"]},"application/x-rar-compressed":{"source":"apache","compressible":false,"extensions":["rar"]},"application/x-redhat-package-manager":{"source":"nginx","extensions":["rpm"]},"application/x-research-info-systems":{"source":"apache","extensions":["ris"]},"application/x-sea":{"source":"nginx","extensions":["sea"]},"application/x-sh":{"source":"apache","compressible":true,"extensions":["sh"]},"application/x-shar":{"source":"apache","extensions":["shar"]},"application/x-shockwave-flash":{"source":"apache","compressible":false,"extensions":["swf"]},"application/x-silverlight-app":{"source":"apache","extensions":["xap"]},"application/x-sql":{"source":"apache","extensions":["sql"]},"application/x-stuffit":{"source":"apache","compressible":false,"extensions":["sit"]},"application/x-stuffitx":{"source":"apache","extensions":["sitx"]},"application/x-subrip":{"source":"apache","extensions":["srt"]},"application/x-sv4cpio":{"source":"apache","extensions":["sv4cpio"]},"application/x-sv4crc":{"source":"apache","extensions":["sv4crc"]},"application/x-t3vm-image":{"source":"apache","extensions":["t3"]},"application/x-tads":{"source":"apache","extensions":["gam"]},"application/x-tar":{"source":"apache","compressible":true,"extensions":["tar"]},"application/x-tcl":{"source":"apache","extensions":["tcl","tk"]},"application/x-tex":{"source":"apache","extensions":["tex"]},"application/x-tex-tfm":{"source":"apache","extensions":["tfm"]},"application/x-texinfo":{"source":"apache","extensions":["texinfo","texi"]},"application/x-tgif":{"source":"apache","extensions":["obj"]},"application/x-ustar":{"source":"apache","extensions":["ustar"]},"application/x-virtualbox-hdd":{"compressible":true,"extensions":["hdd"]},"application/x-virtualbox-ova":{"compressible":true,"extensions":["ova"]},"application/x-virtualbox-ovf":{"compressible":true,"extensions":["ovf"]},"application/x-virtualbox-vbox":{"compressible":true,"extensions":["vbox"]},"application/x-virtualbox-vbox-extpack":{"compressible":false,"extensions":["vbox-extpack"]},"application/x-virtualbox-vdi":{"compressible":true,"extensions":["vdi"]},"application/x-virtualbox-vhd":{"compressible":true,"extensions":["vhd"]},"application/x-virtualbox-vmdk":{"compressible":true,"extensions":["vmdk"]},"application/x-wais-source":{"source":"apache","extensions":["src"]},"application/x-web-app-manifest+json":{"compressible":true,"extensions":["webapp"]},"application/x-www-form-urlencoded":{"source":"iana","compressible":true},"application/x-x509-ca-cert":{"source":"apache","extensions":["der","crt","pem"]},"application/x-xfig":{"source":"apache","extensions":["fig"]},"application/x-xliff+xml":{"source":"apache","compressible":true,"extensions":["xlf"]},"application/x-xpinstall":{"source":"apache","compressible":false,"extensions":["xpi"]},"application/x-xz":{"source":"apache","extensions":["xz"]},"application/x-zmachine":{"source":"apache","extensions":["z1","z2","z3","z4","z5","z6","z7","z8"]},"application/x400-bp":{"source":"iana"},"application/xacml+xml":{"source":"iana","compressible":true},"application/xaml+xml":{"source":"apache","compressible":true,"extensions":["xaml"]},"application/xcap-att+xml":{"source":"iana","compressible":true},"application/xcap-caps+xml":{"source":"iana","compressible":true},"application/xcap-diff+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/xcap-el+xml":{"source":"iana","compressible":true},"application/xcap-error+xml":{"source":"iana","compressible":true},"application/xcap-ns+xml":{"source":"iana","compressible":true},"application/xcon-conference-info+xml":{"source":"iana","compressible":true},"application/xcon-conference-info-diff+xml":{"source":"iana","compressible":true},"application/xenc+xml":{"source":"iana","compressible":true,"extensions":["xenc"]},"application/xhtml+xml":{"source":"iana","compressible":true,"extensions":["xhtml","xht"]},"application/xhtml-voice+xml":{"source":"apache","compressible":true},"application/xliff+xml":{"source":"iana","compressible":true},"application/xml":{"source":"iana","compressible":true,"extensions":["xml","xsl","xsd","rng"]},"application/xml-dtd":{"source":"iana","compressible":true,"extensions":["dtd"]},"application/xml-external-parsed-entity":{"source":"iana"},"application/xml-patch+xml":{"source":"iana","compressible":true},"application/xmpp+xml":{"source":"iana","compressible":true},"application/xop+xml":{"source":"iana","compressible":true,"extensions":["xop"]},"application/xproc+xml":{"source":"apache","compressible":true,"extensions":["xpl"]},"application/xslt+xml":{"source":"iana","compressible":true,"extensions":["xslt"]},"application/xspf+xml":{"source":"apache","compressible":true,"extensions":["xspf"]},"application/xv+xml":{"source":"iana","compressible":true,"extensions":["mxml","xhvml","xvml","xvm"]},"application/yang":{"source":"iana","extensions":["yang"]},"application/yang-data+json":{"source":"iana","compressible":true},"application/yang-data+xml":{"source":"iana","compressible":true},"application/yang-patch+json":{"source":"iana","compressible":true},"application/yang-patch+xml":{"source":"iana","compressible":true},"application/yin+xml":{"source":"iana","compressible":true,"extensions":["yin"]},"application/zip":{"source":"iana","compressible":false,"extensions":["zip"]},"application/zlib":{"source":"iana"},"application/zstd":{"source":"iana"},"audio/1d-interleaved-parityfec":{"source":"iana"},"audio/32kadpcm":{"source":"iana"},"audio/3gpp":{"source":"iana","compressible":false,"extensions":["3gpp"]},"audio/3gpp2":{"source":"iana"},"audio/aac":{"source":"iana"},"audio/ac3":{"source":"iana"},"audio/adpcm":{"source":"apache","extensions":["adp"]},"audio/amr":{"source":"iana"},"audio/amr-wb":{"source":"iana"},"audio/amr-wb+":{"source":"iana"},"audio/aptx":{"source":"iana"},"audio/asc":{"source":"iana"},"audio/atrac-advanced-lossless":{"source":"iana"},"audio/atrac-x":{"source":"iana"},"audio/atrac3":{"source":"iana"},"audio/basic":{"source":"iana","compressible":false,"extensions":["au","snd"]},"audio/bv16":{"source":"iana"},"audio/bv32":{"source":"iana"},"audio/clearmode":{"source":"iana"},"audio/cn":{"source":"iana"},"audio/dat12":{"source":"iana"},"audio/dls":{"source":"iana"},"audio/dsr-es201108":{"source":"iana"},"audio/dsr-es202050":{"source":"iana"},"audio/dsr-es202211":{"source":"iana"},"audio/dsr-es202212":{"source":"iana"},"audio/dv":{"source":"iana"},"audio/dvi4":{"source":"iana"},"audio/eac3":{"source":"iana"},"audio/encaprtp":{"source":"iana"},"audio/evrc":{"source":"iana"},"audio/evrc-qcp":{"source":"iana"},"audio/evrc0":{"source":"iana"},"audio/evrc1":{"source":"iana"},"audio/evrcb":{"source":"iana"},"audio/evrcb0":{"source":"iana"},"audio/evrcb1":{"source":"iana"},"audio/evrcnw":{"source":"iana"},"audio/evrcnw0":{"source":"iana"},"audio/evrcnw1":{"source":"iana"},"audio/evrcwb":{"source":"iana"},"audio/evrcwb0":{"source":"iana"},"audio/evrcwb1":{"source":"iana"},"audio/evs":{"source":"iana"},"audio/flexfec":{"source":"iana"},"audio/fwdred":{"source":"iana"},"audio/g711-0":{"source":"iana"},"audio/g719":{"source":"iana"},"audio/g722":{"source":"iana"},"audio/g7221":{"source":"iana"},"audio/g723":{"source":"iana"},"audio/g726-16":{"source":"iana"},"audio/g726-24":{"source":"iana"},"audio/g726-32":{"source":"iana"},"audio/g726-40":{"source":"iana"},"audio/g728":{"source":"iana"},"audio/g729":{"source":"iana"},"audio/g7291":{"source":"iana"},"audio/g729d":{"source":"iana"},"audio/g729e":{"source":"iana"},"audio/gsm":{"source":"iana"},"audio/gsm-efr":{"source":"iana"},"audio/gsm-hr-08":{"source":"iana"},"audio/ilbc":{"source":"iana"},"audio/ip-mr_v2.5":{"source":"iana"},"audio/isac":{"source":"apache"},"audio/l16":{"source":"iana"},"audio/l20":{"source":"iana"},"audio/l24":{"source":"iana","compressible":false},"audio/l8":{"source":"iana"},"audio/lpc":{"source":"iana"},"audio/melp":{"source":"iana"},"audio/melp1200":{"source":"iana"},"audio/melp2400":{"source":"iana"},"audio/melp600":{"source":"iana"},"audio/midi":{"source":"apache","extensions":["mid","midi","kar","rmi"]},"audio/mobile-xmf":{"source":"iana"},"audio/mp3":{"compressible":false,"extensions":["mp3"]},"audio/mp4":{"source":"iana","compressible":false,"extensions":["m4a","mp4a"]},"audio/mp4a-latm":{"source":"iana"},"audio/mpa":{"source":"iana"},"audio/mpa-robust":{"source":"iana"},"audio/mpeg":{"source":"iana","compressible":false,"extensions":["mpga","mp2","mp2a","mp3","m2a","m3a"]},"audio/mpeg4-generic":{"source":"iana"},"audio/musepack":{"source":"apache"},"audio/ogg":{"source":"iana","compressible":false,"extensions":["oga","ogg","spx"]},"audio/opus":{"source":"iana"},"audio/parityfec":{"source":"iana"},"audio/pcma":{"source":"iana"},"audio/pcma-wb":{"source":"iana"},"audio/pcmu":{"source":"iana"},"audio/pcmu-wb":{"source":"iana"},"audio/prs.sid":{"source":"iana"},"audio/qcelp":{"source":"iana"},"audio/raptorfec":{"source":"iana"},"audio/red":{"source":"iana"},"audio/rtp-enc-aescm128":{"source":"iana"},"audio/rtp-midi":{"source":"iana"},"audio/rtploopback":{"source":"iana"},"audio/rtx":{"source":"iana"},"audio/s3m":{"source":"apache","extensions":["s3m"]},"audio/silk":{"source":"apache","extensions":["sil"]},"audio/smv":{"source":"iana"},"audio/smv-qcp":{"source":"iana"},"audio/smv0":{"source":"iana"},"audio/sp-midi":{"source":"iana"},"audio/speex":{"source":"iana"},"audio/t140c":{"source":"iana"},"audio/t38":{"source":"iana"},"audio/telephone-event":{"source":"iana"},"audio/tetra_acelp":{"source":"iana"},"audio/tone":{"source":"iana"},"audio/uemclip":{"source":"iana"},"audio/ulpfec":{"source":"iana"},"audio/usac":{"source":"iana"},"audio/vdvi":{"source":"iana"},"audio/vmr-wb":{"source":"iana"},"audio/vnd.3gpp.iufp":{"source":"iana"},"audio/vnd.4sb":{"source":"iana"},"audio/vnd.audiokoz":{"source":"iana"},"audio/vnd.celp":{"source":"iana"},"audio/vnd.cisco.nse":{"source":"iana"},"audio/vnd.cmles.radio-events":{"source":"iana"},"audio/vnd.cns.anp1":{"source":"iana"},"audio/vnd.cns.inf1":{"source":"iana"},"audio/vnd.dece.audio":{"source":"iana","extensions":["uva","uvva"]},"audio/vnd.digital-winds":{"source":"iana","extensions":["eol"]},"audio/vnd.dlna.adts":{"source":"iana"},"audio/vnd.dolby.heaac.1":{"source":"iana"},"audio/vnd.dolby.heaac.2":{"source":"iana"},"audio/vnd.dolby.mlp":{"source":"iana"},"audio/vnd.dolby.mps":{"source":"iana"},"audio/vnd.dolby.pl2":{"source":"iana"},"audio/vnd.dolby.pl2x":{"source":"iana"},"audio/vnd.dolby.pl2z":{"source":"iana"},"audio/vnd.dolby.pulse.1":{"source":"iana"},"audio/vnd.dra":{"source":"iana","extensions":["dra"]},"audio/vnd.dts":{"source":"iana","extensions":["dts"]},"audio/vnd.dts.hd":{"source":"iana","extensions":["dtshd"]},"audio/vnd.dts.uhd":{"source":"iana"},"audio/vnd.dvb.file":{"source":"iana"},"audio/vnd.everad.plj":{"source":"iana"},"audio/vnd.hns.audio":{"source":"iana"},"audio/vnd.lucent.voice":{"source":"iana","extensions":["lvp"]},"audio/vnd.ms-playready.media.pya":{"source":"iana","extensions":["pya"]},"audio/vnd.nokia.mobile-xmf":{"source":"iana"},"audio/vnd.nortel.vbk":{"source":"iana"},"audio/vnd.nuera.ecelp4800":{"source":"iana","extensions":["ecelp4800"]},"audio/vnd.nuera.ecelp7470":{"source":"iana","extensions":["ecelp7470"]},"audio/vnd.nuera.ecelp9600":{"source":"iana","extensions":["ecelp9600"]},"audio/vnd.octel.sbc":{"source":"iana"},"audio/vnd.presonus.multitrack":{"source":"iana"},"audio/vnd.qcelp":{"source":"iana"},"audio/vnd.rhetorex.32kadpcm":{"source":"iana"},"audio/vnd.rip":{"source":"iana","extensions":["rip"]},"audio/vnd.rn-realaudio":{"compressible":false},"audio/vnd.sealedmedia.softseal.mpeg":{"source":"iana"},"audio/vnd.vmx.cvsd":{"source":"iana"},"audio/vnd.wave":{"compressible":false},"audio/vorbis":{"source":"iana","compressible":false},"audio/vorbis-config":{"source":"iana"},"audio/wav":{"compressible":false,"extensions":["wav"]},"audio/wave":{"compressible":false,"extensions":["wav"]},"audio/webm":{"source":"apache","compressible":false,"extensions":["weba"]},"audio/x-aac":{"source":"apache","compressible":false,"extensions":["aac"]},"audio/x-aiff":{"source":"apache","extensions":["aif","aiff","aifc"]},"audio/x-caf":{"source":"apache","compressible":false,"extensions":["caf"]},"audio/x-flac":{"source":"apache","extensions":["flac"]},"audio/x-m4a":{"source":"nginx","extensions":["m4a"]},"audio/x-matroska":{"source":"apache","extensions":["mka"]},"audio/x-mpegurl":{"source":"apache","extensions":["m3u"]},"audio/x-ms-wax":{"source":"apache","extensions":["wax"]},"audio/x-ms-wma":{"source":"apache","extensions":["wma"]},"audio/x-pn-realaudio":{"source":"apache","extensions":["ram","ra"]},"audio/x-pn-realaudio-plugin":{"source":"apache","extensions":["rmp"]},"audio/x-realaudio":{"source":"nginx","extensions":["ra"]},"audio/x-tta":{"source":"apache"},"audio/x-wav":{"source":"apache","extensions":["wav"]},"audio/xm":{"source":"apache","extensions":["xm"]},"chemical/x-cdx":{"source":"apache","extensions":["cdx"]},"chemical/x-cif":{"source":"apache","extensions":["cif"]},"chemical/x-cmdf":{"source":"apache","extensions":["cmdf"]},"chemical/x-cml":{"source":"apache","extensions":["cml"]},"chemical/x-csml":{"source":"apache","extensions":["csml"]},"chemical/x-pdb":{"source":"apache"},"chemical/x-xyz":{"source":"apache","extensions":["xyz"]},"font/collection":{"source":"iana","extensions":["ttc"]},"font/otf":{"source":"iana","compressible":true,"extensions":["otf"]},"font/sfnt":{"source":"iana"},"font/ttf":{"source":"iana","compressible":true,"extensions":["ttf"]},"font/woff":{"source":"iana","extensions":["woff"]},"font/woff2":{"source":"iana","extensions":["woff2"]},"image/aces":{"source":"iana","extensions":["exr"]},"image/apng":{"compressible":false,"extensions":["apng"]},"image/avci":{"source":"iana"},"image/avcs":{"source":"iana"},"image/bmp":{"source":"iana","compressible":true,"extensions":["bmp"]},"image/cgm":{"source":"iana","extensions":["cgm"]},"image/dicom-rle":{"source":"iana","extensions":["drle"]},"image/emf":{"source":"iana","extensions":["emf"]},"image/fits":{"source":"iana","extensions":["fits"]},"image/g3fax":{"source":"iana","extensions":["g3"]},"image/gif":{"source":"iana","compressible":false,"extensions":["gif"]},"image/heic":{"source":"iana","extensions":["heic"]},"image/heic-sequence":{"source":"iana","extensions":["heics"]},"image/heif":{"source":"iana","extensions":["heif"]},"image/heif-sequence":{"source":"iana","extensions":["heifs"]},"image/hej2k":{"source":"iana","extensions":["hej2"]},"image/hsj2":{"source":"iana","extensions":["hsj2"]},"image/ief":{"source":"iana","extensions":["ief"]},"image/jls":{"source":"iana","extensions":["jls"]},"image/jp2":{"source":"iana","compressible":false,"extensions":["jp2","jpg2"]},"image/jpeg":{"source":"iana","compressible":false,"extensions":["jpeg","jpg","jpe"]},"image/jph":{"source":"iana","extensions":["jph"]},"image/jphc":{"source":"iana","extensions":["jhc"]},"image/jpm":{"source":"iana","compressible":false,"extensions":["jpm"]},"image/jpx":{"source":"iana","compressible":false,"extensions":["jpx","jpf"]},"image/jxr":{"source":"iana","extensions":["jxr"]},"image/jxra":{"source":"iana","extensions":["jxra"]},"image/jxrs":{"source":"iana","extensions":["jxrs"]},"image/jxs":{"source":"iana","extensions":["jxs"]},"image/jxsc":{"source":"iana","extensions":["jxsc"]},"image/jxsi":{"source":"iana","extensions":["jxsi"]},"image/jxss":{"source":"iana","extensions":["jxss"]},"image/ktx":{"source":"iana","extensions":["ktx"]},"image/naplps":{"source":"iana"},"image/pjpeg":{"compressible":false},"image/png":{"source":"iana","compressible":false,"extensions":["png"]},"image/prs.btif":{"source":"iana","extensions":["btif"]},"image/prs.pti":{"source":"iana","extensions":["pti"]},"image/pwg-raster":{"source":"iana"},"image/sgi":{"source":"apache","extensions":["sgi"]},"image/svg+xml":{"source":"iana","compressible":true,"extensions":["svg","svgz"]},"image/t38":{"source":"iana","extensions":["t38"]},"image/tiff":{"source":"iana","compressible":false,"extensions":["tif","tiff"]},"image/tiff-fx":{"source":"iana","extensions":["tfx"]},"image/vnd.adobe.photoshop":{"source":"iana","compressible":true,"extensions":["psd"]},"image/vnd.airzip.accelerator.azv":{"source":"iana","extensions":["azv"]},"image/vnd.cns.inf2":{"source":"iana"},"image/vnd.dece.graphic":{"source":"iana","extensions":["uvi","uvvi","uvg","uvvg"]},"image/vnd.djvu":{"source":"iana","extensions":["djvu","djv"]},"image/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"image/vnd.dwg":{"source":"iana","extensions":["dwg"]},"image/vnd.dxf":{"source":"iana","extensions":["dxf"]},"image/vnd.fastbidsheet":{"source":"iana","extensions":["fbs"]},"image/vnd.fpx":{"source":"iana","extensions":["fpx"]},"image/vnd.fst":{"source":"iana","extensions":["fst"]},"image/vnd.fujixerox.edmics-mmr":{"source":"iana","extensions":["mmr"]},"image/vnd.fujixerox.edmics-rlc":{"source":"iana","extensions":["rlc"]},"image/vnd.globalgraphics.pgb":{"source":"iana"},"image/vnd.microsoft.icon":{"source":"iana","extensions":["ico"]},"image/vnd.mix":{"source":"iana"},"image/vnd.mozilla.apng":{"source":"iana"},"image/vnd.ms-dds":{"extensions":["dds"]},"image/vnd.ms-modi":{"source":"iana","extensions":["mdi"]},"image/vnd.ms-photo":{"source":"apache","extensions":["wdp"]},"image/vnd.net-fpx":{"source":"iana","extensions":["npx"]},"image/vnd.radiance":{"source":"iana"},"image/vnd.sealed.png":{"source":"iana"},"image/vnd.sealedmedia.softseal.gif":{"source":"iana"},"image/vnd.sealedmedia.softseal.jpg":{"source":"iana"},"image/vnd.svf":{"source":"iana"},"image/vnd.tencent.tap":{"source":"iana","extensions":["tap"]},"image/vnd.valve.source.texture":{"source":"iana","extensions":["vtf"]},"image/vnd.wap.wbmp":{"source":"iana","extensions":["wbmp"]},"image/vnd.xiff":{"source":"iana","extensions":["xif"]},"image/vnd.zbrush.pcx":{"source":"iana","extensions":["pcx"]},"image/webp":{"source":"apache","extensions":["webp"]},"image/wmf":{"source":"iana","extensions":["wmf"]},"image/x-3ds":{"source":"apache","extensions":["3ds"]},"image/x-cmu-raster":{"source":"apache","extensions":["ras"]},"image/x-cmx":{"source":"apache","extensions":["cmx"]},"image/x-freehand":{"source":"apache","extensions":["fh","fhc","fh4","fh5","fh7"]},"image/x-icon":{"source":"apache","compressible":true,"extensions":["ico"]},"image/x-jng":{"source":"nginx","extensions":["jng"]},"image/x-mrsid-image":{"source":"apache","extensions":["sid"]},"image/x-ms-bmp":{"source":"nginx","compressible":true,"extensions":["bmp"]},"image/x-pcx":{"source":"apache","extensions":["pcx"]},"image/x-pict":{"source":"apache","extensions":["pic","pct"]},"image/x-portable-anymap":{"source":"apache","extensions":["pnm"]},"image/x-portable-bitmap":{"source":"apache","extensions":["pbm"]},"image/x-portable-graymap":{"source":"apache","extensions":["pgm"]},"image/x-portable-pixmap":{"source":"apache","extensions":["ppm"]},"image/x-rgb":{"source":"apache","extensions":["rgb"]},"image/x-tga":{"source":"apache","extensions":["tga"]},"image/x-xbitmap":{"source":"apache","extensions":["xbm"]},"image/x-xcf":{"compressible":false},"image/x-xpixmap":{"source":"apache","extensions":["xpm"]},"image/x-xwindowdump":{"source":"apache","extensions":["xwd"]},"message/cpim":{"source":"iana"},"message/delivery-status":{"source":"iana"},"message/disposition-notification":{"source":"iana","extensions":["disposition-notification"]},"message/external-body":{"source":"iana"},"message/feedback-report":{"source":"iana"},"message/global":{"source":"iana","extensions":["u8msg"]},"message/global-delivery-status":{"source":"iana","extensions":["u8dsn"]},"message/global-disposition-notification":{"source":"iana","extensions":["u8mdn"]},"message/global-headers":{"source":"iana","extensions":["u8hdr"]},"message/http":{"source":"iana","compressible":false},"message/imdn+xml":{"source":"iana","compressible":true},"message/news":{"source":"iana"},"message/partial":{"source":"iana","compressible":false},"message/rfc822":{"source":"iana","compressible":true,"extensions":["eml","mime"]},"message/s-http":{"source":"iana"},"message/sip":{"source":"iana"},"message/sipfrag":{"source":"iana"},"message/tracking-status":{"source":"iana"},"message/vnd.si.simp":{"source":"iana"},"message/vnd.wfa.wsc":{"source":"iana","extensions":["wsc"]},"model/3mf":{"source":"iana","extensions":["3mf"]},"model/gltf+json":{"source":"iana","compressible":true,"extensions":["gltf"]},"model/gltf-binary":{"source":"iana","compressible":true,"extensions":["glb"]},"model/iges":{"source":"iana","compressible":false,"extensions":["igs","iges"]},"model/mesh":{"source":"iana","compressible":false,"extensions":["msh","mesh","silo"]},"model/stl":{"source":"iana","extensions":["stl"]},"model/vnd.collada+xml":{"source":"iana","compressible":true,"extensions":["dae"]},"model/vnd.dwf":{"source":"iana","extensions":["dwf"]},"model/vnd.flatland.3dml":{"source":"iana"},"model/vnd.gdl":{"source":"iana","extensions":["gdl"]},"model/vnd.gs-gdl":{"source":"apache"},"model/vnd.gs.gdl":{"source":"iana"},"model/vnd.gtw":{"source":"iana","extensions":["gtw"]},"model/vnd.moml+xml":{"source":"iana","compressible":true},"model/vnd.mts":{"source":"iana","extensions":["mts"]},"model/vnd.opengex":{"source":"iana","extensions":["ogex"]},"model/vnd.parasolid.transmit.binary":{"source":"iana","extensions":["x_b"]},"model/vnd.parasolid.transmit.text":{"source":"iana","extensions":["x_t"]},"model/vnd.rosette.annotated-data-model":{"source":"iana"},"model/vnd.usdz+zip":{"source":"iana","compressible":false,"extensions":["usdz"]},"model/vnd.valve.source.compiled-map":{"source":"iana","extensions":["bsp"]},"model/vnd.vtu":{"source":"iana","extensions":["vtu"]},"model/vrml":{"source":"iana","compressible":false,"extensions":["wrl","vrml"]},"model/x3d+binary":{"source":"apache","compressible":false,"extensions":["x3db","x3dbz"]},"model/x3d+fastinfoset":{"source":"iana","extensions":["x3db"]},"model/x3d+vrml":{"source":"apache","compressible":false,"extensions":["x3dv","x3dvz"]},"model/x3d+xml":{"source":"iana","compressible":true,"extensions":["x3d","x3dz"]},"model/x3d-vrml":{"source":"iana","extensions":["x3dv"]},"multipart/alternative":{"source":"iana","compressible":false},"multipart/appledouble":{"source":"iana"},"multipart/byteranges":{"source":"iana"},"multipart/digest":{"source":"iana"},"multipart/encrypted":{"source":"iana","compressible":false},"multipart/form-data":{"source":"iana","compressible":false},"multipart/header-set":{"source":"iana"},"multipart/mixed":{"source":"iana"},"multipart/multilingual":{"source":"iana"},"multipart/parallel":{"source":"iana"},"multipart/related":{"source":"iana","compressible":false},"multipart/report":{"source":"iana"},"multipart/signed":{"source":"iana","compressible":false},"multipart/vnd.bint.med-plus":{"source":"iana"},"multipart/voice-message":{"source":"iana"},"multipart/x-mixed-replace":{"source":"iana"},"text/1d-interleaved-parityfec":{"source":"iana"},"text/cache-manifest":{"source":"iana","compressible":true,"extensions":["appcache","manifest"]},"text/calendar":{"source":"iana","extensions":["ics","ifb"]},"text/calender":{"compressible":true},"text/cmd":{"compressible":true},"text/coffeescript":{"extensions":["coffee","litcoffee"]},"text/css":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["css"]},"text/csv":{"source":"iana","compressible":true,"extensions":["csv"]},"text/csv-schema":{"source":"iana"},"text/directory":{"source":"iana"},"text/dns":{"source":"iana"},"text/ecmascript":{"source":"iana"},"text/encaprtp":{"source":"iana"},"text/enriched":{"source":"iana"},"text/flexfec":{"source":"iana"},"text/fwdred":{"source":"iana"},"text/grammar-ref-list":{"source":"iana"},"text/html":{"source":"iana","compressible":true,"extensions":["html","htm","shtml"]},"text/jade":{"extensions":["jade"]},"text/javascript":{"source":"iana","compressible":true},"text/jcr-cnd":{"source":"iana"},"text/jsx":{"compressible":true,"extensions":["jsx"]},"text/less":{"compressible":true,"extensions":["less"]},"text/markdown":{"source":"iana","compressible":true,"extensions":["markdown","md"]},"text/mathml":{"source":"nginx","extensions":["mml"]},"text/mdx":{"compressible":true,"extensions":["mdx"]},"text/mizar":{"source":"iana"},"text/n3":{"source":"iana","compressible":true,"extensions":["n3"]},"text/parameters":{"source":"iana"},"text/parityfec":{"source":"iana"},"text/plain":{"source":"iana","compressible":true,"extensions":["txt","text","conf","def","list","log","in","ini"]},"text/provenance-notation":{"source":"iana"},"text/prs.fallenstein.rst":{"source":"iana"},"text/prs.lines.tag":{"source":"iana","extensions":["dsc"]},"text/prs.prop.logic":{"source":"iana"},"text/raptorfec":{"source":"iana"},"text/red":{"source":"iana"},"text/rfc822-headers":{"source":"iana"},"text/richtext":{"source":"iana","compressible":true,"extensions":["rtx"]},"text/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"text/rtp-enc-aescm128":{"source":"iana"},"text/rtploopback":{"source":"iana"},"text/rtx":{"source":"iana"},"text/sgml":{"source":"iana","extensions":["sgml","sgm"]},"text/shex":{"extensions":["shex"]},"text/slim":{"extensions":["slim","slm"]},"text/strings":{"source":"iana"},"text/stylus":{"extensions":["stylus","styl"]},"text/t140":{"source":"iana"},"text/tab-separated-values":{"source":"iana","compressible":true,"extensions":["tsv"]},"text/troff":{"source":"iana","extensions":["t","tr","roff","man","me","ms"]},"text/turtle":{"source":"iana","charset":"UTF-8","extensions":["ttl"]},"text/ulpfec":{"source":"iana"},"text/uri-list":{"source":"iana","compressible":true,"extensions":["uri","uris","urls"]},"text/vcard":{"source":"iana","compressible":true,"extensions":["vcard"]},"text/vnd.a":{"source":"iana"},"text/vnd.abc":{"source":"iana"},"text/vnd.ascii-art":{"source":"iana"},"text/vnd.curl":{"source":"iana","extensions":["curl"]},"text/vnd.curl.dcurl":{"source":"apache","extensions":["dcurl"]},"text/vnd.curl.mcurl":{"source":"apache","extensions":["mcurl"]},"text/vnd.curl.scurl":{"source":"apache","extensions":["scurl"]},"text/vnd.debian.copyright":{"source":"iana"},"text/vnd.dmclientscript":{"source":"iana"},"text/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"text/vnd.esmertec.theme-descriptor":{"source":"iana"},"text/vnd.ficlab.flt":{"source":"iana"},"text/vnd.fly":{"source":"iana","extensions":["fly"]},"text/vnd.fmi.flexstor":{"source":"iana","extensions":["flx"]},"text/vnd.gml":{"source":"iana"},"text/vnd.graphviz":{"source":"iana","extensions":["gv"]},"text/vnd.hgl":{"source":"iana"},"text/vnd.in3d.3dml":{"source":"iana","extensions":["3dml"]},"text/vnd.in3d.spot":{"source":"iana","extensions":["spot"]},"text/vnd.iptc.newsml":{"source":"iana"},"text/vnd.iptc.nitf":{"source":"iana"},"text/vnd.latex-z":{"source":"iana"},"text/vnd.motorola.reflex":{"source":"iana"},"text/vnd.ms-mediapackage":{"source":"iana"},"text/vnd.net2phone.commcenter.command":{"source":"iana"},"text/vnd.radisys.msml-basic-layout":{"source":"iana"},"text/vnd.senx.warpscript":{"source":"iana"},"text/vnd.si.uricatalogue":{"source":"iana"},"text/vnd.sosi":{"source":"iana"},"text/vnd.sun.j2me.app-descriptor":{"source":"iana","extensions":["jad"]},"text/vnd.trolltech.linguist":{"source":"iana"},"text/vnd.wap.si":{"source":"iana"},"text/vnd.wap.sl":{"source":"iana"},"text/vnd.wap.wml":{"source":"iana","extensions":["wml"]},"text/vnd.wap.wmlscript":{"source":"iana","extensions":["wmls"]},"text/vtt":{"charset":"UTF-8","compressible":true,"extensions":["vtt"]},"text/x-asm":{"source":"apache","extensions":["s","asm"]},"text/x-c":{"source":"apache","extensions":["c","cc","cxx","cpp","h","hh","dic"]},"text/x-component":{"source":"nginx","extensions":["htc"]},"text/x-fortran":{"source":"apache","extensions":["f","for","f77","f90"]},"text/x-gwt-rpc":{"compressible":true},"text/x-handlebars-template":{"extensions":["hbs"]},"text/x-java-source":{"source":"apache","extensions":["java"]},"text/x-jquery-tmpl":{"compressible":true},"text/x-lua":{"extensions":["lua"]},"text/x-markdown":{"compressible":true,"extensions":["mkd"]},"text/x-nfo":{"source":"apache","extensions":["nfo"]},"text/x-opml":{"source":"apache","extensions":["opml"]},"text/x-org":{"compressible":true,"extensions":["org"]},"text/x-pascal":{"source":"apache","extensions":["p","pas"]},"text/x-processing":{"compressible":true,"extensions":["pde"]},"text/x-sass":{"extensions":["sass"]},"text/x-scss":{"extensions":["scss"]},"text/x-setext":{"source":"apache","extensions":["etx"]},"text/x-sfv":{"source":"apache","extensions":["sfv"]},"text/x-suse-ymp":{"compressible":true,"extensions":["ymp"]},"text/x-uuencode":{"source":"apache","extensions":["uu"]},"text/x-vcalendar":{"source":"apache","extensions":["vcs"]},"text/x-vcard":{"source":"apache","extensions":["vcf"]},"text/xml":{"source":"iana","compressible":true,"extensions":["xml"]},"text/xml-external-parsed-entity":{"source":"iana"},"text/yaml":{"extensions":["yaml","yml"]},"video/1d-interleaved-parityfec":{"source":"iana"},"video/3gpp":{"source":"iana","extensions":["3gp","3gpp"]},"video/3gpp-tt":{"source":"iana"},"video/3gpp2":{"source":"iana","extensions":["3g2"]},"video/bmpeg":{"source":"iana"},"video/bt656":{"source":"iana"},"video/celb":{"source":"iana"},"video/dv":{"source":"iana"},"video/encaprtp":{"source":"iana"},"video/flexfec":{"source":"iana"},"video/h261":{"source":"iana","extensions":["h261"]},"video/h263":{"source":"iana","extensions":["h263"]},"video/h263-1998":{"source":"iana"},"video/h263-2000":{"source":"iana"},"video/h264":{"source":"iana","extensions":["h264"]},"video/h264-rcdo":{"source":"iana"},"video/h264-svc":{"source":"iana"},"video/h265":{"source":"iana"},"video/iso.segment":{"source":"iana"},"video/jpeg":{"source":"iana","extensions":["jpgv"]},"video/jpeg2000":{"source":"iana"},"video/jpm":{"source":"apache","extensions":["jpm","jpgm"]},"video/mj2":{"source":"iana","extensions":["mj2","mjp2"]},"video/mp1s":{"source":"iana"},"video/mp2p":{"source":"iana"},"video/mp2t":{"source":"iana","extensions":["ts"]},"video/mp4":{"source":"iana","compressible":false,"extensions":["mp4","mp4v","mpg4"]},"video/mp4v-es":{"source":"iana"},"video/mpeg":{"source":"iana","compressible":false,"extensions":["mpeg","mpg","mpe","m1v","m2v"]},"video/mpeg4-generic":{"source":"iana"},"video/mpv":{"source":"iana"},"video/nv":{"source":"iana"},"video/ogg":{"source":"iana","compressible":false,"extensions":["ogv"]},"video/parityfec":{"source":"iana"},"video/pointer":{"source":"iana"},"video/quicktime":{"source":"iana","compressible":false,"extensions":["qt","mov"]},"video/raptorfec":{"source":"iana"},"video/raw":{"source":"iana"},"video/rtp-enc-aescm128":{"source":"iana"},"video/rtploopback":{"source":"iana"},"video/rtx":{"source":"iana"},"video/smpte291":{"source":"iana"},"video/smpte292m":{"source":"iana"},"video/ulpfec":{"source":"iana"},"video/vc1":{"source":"iana"},"video/vc2":{"source":"iana"},"video/vnd.cctv":{"source":"iana"},"video/vnd.dece.hd":{"source":"iana","extensions":["uvh","uvvh"]},"video/vnd.dece.mobile":{"source":"iana","extensions":["uvm","uvvm"]},"video/vnd.dece.mp4":{"source":"iana"},"video/vnd.dece.pd":{"source":"iana","extensions":["uvp","uvvp"]},"video/vnd.dece.sd":{"source":"iana","extensions":["uvs","uvvs"]},"video/vnd.dece.video":{"source":"iana","extensions":["uvv","uvvv"]},"video/vnd.directv.mpeg":{"source":"iana"},"video/vnd.directv.mpeg-tts":{"source":"iana"},"video/vnd.dlna.mpeg-tts":{"source":"iana"},"video/vnd.dvb.file":{"source":"iana","extensions":["dvb"]},"video/vnd.fvt":{"source":"iana","extensions":["fvt"]},"video/vnd.hns.video":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.ttsavc":{"source":"iana"},"video/vnd.iptvforum.ttsmpeg2":{"source":"iana"},"video/vnd.motorola.video":{"source":"iana"},"video/vnd.motorola.videop":{"source":"iana"},"video/vnd.mpegurl":{"source":"iana","extensions":["mxu","m4u"]},"video/vnd.ms-playready.media.pyv":{"source":"iana","extensions":["pyv"]},"video/vnd.nokia.interleaved-multimedia":{"source":"iana"},"video/vnd.nokia.mp4vr":{"source":"iana"},"video/vnd.nokia.videovoip":{"source":"iana"},"video/vnd.objectvideo":{"source":"iana"},"video/vnd.radgamettools.bink":{"source":"iana"},"video/vnd.radgamettools.smacker":{"source":"iana"},"video/vnd.sealed.mpeg1":{"source":"iana"},"video/vnd.sealed.mpeg4":{"source":"iana"},"video/vnd.sealed.swf":{"source":"iana"},"video/vnd.sealedmedia.softseal.mov":{"source":"iana"},"video/vnd.uvvu.mp4":{"source":"iana","extensions":["uvu","uvvu"]},"video/vnd.vivo":{"source":"iana","extensions":["viv"]},"video/vnd.youtube.yt":{"source":"iana"},"video/vp8":{"source":"iana"},"video/webm":{"source":"apache","compressible":false,"extensions":["webm"]},"video/x-f4v":{"source":"apache","extensions":["f4v"]},"video/x-fli":{"source":"apache","extensions":["fli"]},"video/x-flv":{"source":"apache","compressible":false,"extensions":["flv"]},"video/x-m4v":{"source":"apache","extensions":["m4v"]},"video/x-matroska":{"source":"apache","compressible":false,"extensions":["mkv","mk3d","mks"]},"video/x-mng":{"source":"apache","extensions":["mng"]},"video/x-ms-asf":{"source":"apache","extensions":["asf","asx"]},"video/x-ms-vob":{"source":"apache","extensions":["vob"]},"video/x-ms-wm":{"source":"apache","extensions":["wm"]},"video/x-ms-wmv":{"source":"apache","compressible":false,"extensions":["wmv"]},"video/x-ms-wmx":{"source":"apache","extensions":["wmx"]},"video/x-ms-wvx":{"source":"apache","extensions":["wvx"]},"video/x-msvideo":{"source":"apache","extensions":["avi"]},"video/x-sgi-movie":{"source":"apache","extensions":["movie"]},"video/x-smv":{"source":"apache","extensions":["smv"]},"x-conference/x-cooltalk":{"source":"apache","extensions":["ice"]},"x-shader/x-fragment":{"compressible":true},"x-shader/x-vertex":{"compressible":true}}; /***/ }), -/***/ 261: +/***/ 281: /***/ (function(module) { -function HARError (errors) { - var message = 'validation failed' - - this.name = 'HARError' - this.message = message - this.errors = errors +"use strict"; - if (typeof Error.captureStackTrace === 'function') { - Error.captureStackTrace(this, this.constructor) +module.exports = function generate_enum(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; } else { - this.stack = (new Error(message)).stack + $schemaValue = $schema; + } + var $i = 'i' + $lvl, + $vSchema = 'schema' + $lvl; + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ';'; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to one of the allowed values\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; } + return out; } -HARError.prototype = Error.prototype -module.exports = HARError +/***/ }), +/***/ 286: +/***/ (function(__unusedmodule, exports) { -/***/ }), +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. -/***/ 264: -/***/ (function(module, __unusedexports, __webpack_require__) { +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. -"use strict"; +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; -var util = __webpack_require__(280); +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; -var DATE = /^(\d\d\d\d)-(\d\d)-(\d\d)$/; -var DAYS = [0,31,28,31,30,31,30,31,31,30,31,30,31]; -var TIME = /^(\d\d):(\d\d):(\d\d)(\.\d+)?(z|[+-]\d\d:\d\d)?$/i; -var HOSTNAME = /^[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[-0-9a-z]{0,61}[0-9a-z])?)*$/i; -var URI = /^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*)(?:\?(?:[a-z0-9\-._~!$&'()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i; -var URIREF = /^(?:[a-z][a-z0-9+\-.]*:)?(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'"()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?(?:\?(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i; -// uri-template: https://tools.ietf.org/html/rfc6570 -var URITEMPLATE = /^(?:(?:[^\x00-\x20"'<>%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; -// For the source: https://gist.github.com/dperini/729294 -// For test cases: https://mathiasbynens.be/demo/url-regex -// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. -// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; -var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; -var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; -var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; -var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; -var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; -module.exports = formats; +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; -function formats(mode) { - mode = mode == 'full' ? 'full' : 'fast'; - return util.copy(formats[mode]); +function isSymbol(arg) { + return typeof arg === 'symbol'; } +exports.isSymbol = isSymbol; +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; -formats.fast = { - // date: http://tools.ietf.org/html/rfc3339#section-5.6 - date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, - // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 - time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d:\d\d)?$/i, - 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d:\d\d)$/i, - // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js - uri: /^(?:[a-z][a-z0-9+-.]*:)(?:\/?\/)?[^\s]*$/i, - 'uri-reference': /^(?:(?:[a-z][a-z0-9+-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, - 'uri-template': URITEMPLATE, - url: URL, - // email (sources from jsen validator): - // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 - // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') - email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, - hostname: HOSTNAME, - // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html - ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, - // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses - ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, - regex: regex, - // uuid: http://tools.ietf.org/html/rfc4122 - uuid: UUID, - // JSON-pointer: https://tools.ietf.org/html/rfc6901 - // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A - 'json-pointer': JSON_POINTER, - 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, - // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 - 'relative-json-pointer': RELATIVE_JSON_POINTER -}; +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; -formats.full = { - date: date, - time: time, - 'date-time': date_time, - uri: uri, - 'uri-reference': URIREF, - 'uri-template': URITEMPLATE, - url: URL, - email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, - hostname: hostname, - ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, - ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, - regex: regex, - uuid: UUID, - 'json-pointer': JSON_POINTER, - 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, - 'relative-json-pointer': RELATIVE_JSON_POINTER -}; +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; +exports.isBuffer = Buffer.isBuffer; -function isLeapYear(year) { - // https://tools.ietf.org/html/rfc3339#appendix-C - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +function objectToString(o) { + return Object.prototype.toString.call(o); } -function date(str) { - // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 - var matches = str.match(DATE); - if (!matches) return false; +/***/ }), - var year = +matches[1]; - var month = +matches[2]; - var day = +matches[3]; +/***/ 287: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - return month >= 1 && month <= 12 && day >= 1 && - day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); -} +"use strict"; -function time(str, full) { - var matches = str.match(TIME); - if (!matches) return false; +var url = __webpack_require__(835) +var qs = __webpack_require__(386) +var caseless = __webpack_require__(254) +var uuid = __webpack_require__(826) +var oauth = __webpack_require__(113) +var crypto = __webpack_require__(417) +var Buffer = __webpack_require__(149).Buffer - var hour = matches[1]; - var minute = matches[2]; - var second = matches[3]; - var timeZone = matches[5]; - return ((hour <= 23 && minute <= 59 && second <= 59) || - (hour == 23 && minute == 59 && second == 60)) && - (!full || timeZone); +function OAuth (request) { + this.request = request + this.params = null } +OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { + var oa = {} + for (var i in _oauth) { + oa['oauth_' + i] = _oauth[i] + } + if (!oa.oauth_version) { + oa.oauth_version = '1.0' + } + if (!oa.oauth_timestamp) { + oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() + } + if (!oa.oauth_nonce) { + oa.oauth_nonce = uuid().replace(/-/g, '') + } + if (!oa.oauth_signature_method) { + oa.oauth_signature_method = 'HMAC-SHA1' + } -var DATE_TIME_SEPARATOR = /t|\s/i; -function date_time(str) { - // http://tools.ietf.org/html/rfc3339#section-5.6 - var dateTime = str.split(DATE_TIME_SEPARATOR); - return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); -} + var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase + delete oa.oauth_consumer_secret + delete oa.oauth_private_key + var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase + delete oa.oauth_token_secret -function hostname(str) { - // https://tools.ietf.org/html/rfc1034#section-3.5 - // https://tools.ietf.org/html/rfc1123#section-2 - return str.length <= 255 && HOSTNAME.test(str); + var realm = oa.oauth_realm + delete oa.oauth_realm + delete oa.oauth_transport_method + + var baseurl = uri.protocol + '//' + uri.host + uri.pathname + var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) + + oa.oauth_signature = oauth.sign( + oa.oauth_signature_method, + method, + baseurl, + params, + consumer_secret_or_private_key, // eslint-disable-line camelcase + token_secret // eslint-disable-line camelcase + ) + + if (realm) { + oa.realm = realm + } + + return oa } +OAuth.prototype.buildBodyHash = function (_oauth, body) { + if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { + this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + + ' signature_method not supported with body_hash signing.')) + } + + var shasum = crypto.createHash('sha1') + shasum.update(body || '') + var sha1 = shasum.digest('hex') -var NOT_URI_FRAGMENT = /\/|:/; -function uri(str) { - // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." - return NOT_URI_FRAGMENT.test(str) && URI.test(str); + return Buffer.from(sha1, 'hex').toString('base64') } +OAuth.prototype.concatParams = function (oa, sep, wrap) { + wrap = wrap || '' -var Z_ANCHOR = /[^\\]\\Z/; -function regex(str) { - if (Z_ANCHOR.test(str)) return false; - try { - new RegExp(str); - return true; - } catch(e) { - return false; + var params = Object.keys(oa).filter(function (i) { + return i !== 'realm' && i !== 'oauth_signature' + }).sort() + + if (oa.realm) { + params.splice(0, 0, 'realm') } -} + params.push('oauth_signature') + return params.map(function (i) { + return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap + }).join(sep) +} -/***/ }), +OAuth.prototype.onRequest = function (_oauth) { + var self = this + self.params = _oauth -/***/ 269: -/***/ (function(module) { + var uri = self.request.uri || {} + var method = self.request.method || '' + var headers = caseless(self.request.headers) + var body = self.request.body || '' + var qsLib = self.request.qsLib || qs -"use strict"; + var form + var query + var contentType = headers.get('content-type') || '' + var formContentType = 'application/x-www-form-urlencoded' + var transport = _oauth.transport_method || 'header' -module.exports = function generate_multipleOf(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - out += 'var division' + ($lvl) + ';if ('; - if ($isData) { - out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; - } - out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; - if (it.opts.multipleOfPrecision) { - out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; - } else { - out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; + if (contentType.slice(0, formContentType.length) === formContentType) { + contentType = formContentType + form = body } - out += ' ) '; - if ($isData) { - out += ' ) '; + if (uri.query) { + query = uri.query } - out += ' ) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be multiple of '; - if ($isData) { - out += '\' + ' + ($schemaValue); - } else { - out += '' + ($schemaValue) + '\''; - } - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; + if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { + self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + + 'and content-type ' + formContentType)) } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + + if (!form && typeof _oauth.body_hash === 'boolean') { + _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) } - out += '} '; - if ($breakOnError) { - out += ' else { '; + + var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) + + switch (transport) { + case 'header': + self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) + break + + case 'query': + var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') + self.request.uri = url.parse(href) + self.request.path = self.request.uri.path + break + + case 'body': + self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') + break + + default: + self.request.emit('error', new Error('oauth: transport_method invalid')) } - return out; } +exports.OAuth = OAuth + /***/ }), -/***/ 272: +/***/ 290: /***/ (function(module, __unusedexports, __webpack_require__) { -var abort = __webpack_require__(768) - , async = __webpack_require__(69) - ; +// Copyright 2017 Joyent, Inc. -// API -module.exports = terminator; +module.exports = { + DiffieHellman: DiffieHellman, + generateECDSA: generateECDSA, + generateED25519: generateED25519 +}; -/** - * Terminates jobs in the attached state context - * - * @this AsyncKitState# - * @param {function} callback - final callback to invoke after termination - */ -function terminator(callback) -{ - if (!Object.keys(this.jobs).length) - { - return; - } +var assert = __webpack_require__(477); +var crypto = __webpack_require__(417); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var nacl = __webpack_require__(196); - // fast forward iteration index - this.index = this.size; +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); - // abort jobs - abort(this); +var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); - // send back results we have so far - async(callback)(null, this.results); +var ecdh = __webpack_require__(886); +var ec = __webpack_require__(729); +var jsbn = __webpack_require__(242).BigInteger; + +function DiffieHellman(key) { + utils.assertCompatible(key, Key, [1, 4], 'key'); + this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); + this._algo = key.type; + this._curve = key.curve; + this._key = key; + if (key.type === 'dsa') { + if (!CRYPTO_HAVE_ECDH) { + throw (new Error('Due to bugs in the node 0.10 ' + + 'crypto API, node 0.12.x or later is required ' + + 'to use DH')); + } + this._dh = crypto.createDiffieHellman( + key.part.p.data, undefined, + key.part.g.data, undefined); + this._p = key.part.p; + this._g = key.part.g; + if (this._isPriv) + this._dh.setPrivateKey(key.part.x.data); + this._dh.setPublicKey(key.part.y.data); + + } else if (key.type === 'ecdsa') { + if (!CRYPTO_HAVE_ECDH) { + this._ecParams = new X9ECParameters(this._curve); + + if (this._isPriv) { + this._priv = new ECPrivate( + this._ecParams, key.part.d.data); + } + return; + } + + var curve = { + 'nistp256': 'prime256v1', + 'nistp384': 'secp384r1', + 'nistp521': 'secp521r1' + }[key.curve]; + this._dh = crypto.createECDH(curve); + if (typeof (this._dh) !== 'object' || + typeof (this._dh.setPrivateKey) !== 'function') { + CRYPTO_HAVE_ECDH = false; + DiffieHellman.call(this, key); + return; + } + if (this._isPriv) + this._dh.setPrivateKey(key.part.d.data); + this._dh.setPublicKey(key.part.Q.data); + + } else if (key.type === 'curve25519') { + if (this._isPriv) { + utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); + this._priv = key.part.k.data; + } + + } else { + throw (new Error('DH not supported for ' + key.type + ' keys')); + } } +DiffieHellman.prototype.getPublicKey = function () { + if (this._isPriv) + return (this._key.toPublic()); + return (this._key); +}; -/***/ }), +DiffieHellman.prototype.getPrivateKey = function () { + if (this._isPriv) + return (this._key); + else + return (undefined); +}; +DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; -/***/ 280: -/***/ (function(module, __unusedexports, __webpack_require__) { +DiffieHellman.prototype._keyCheck = function (pk, isPub) { + assert.object(pk, 'key'); + if (!isPub) + utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); + utils.assertCompatible(pk, Key, [1, 4], 'key'); -"use strict"; + if (pk.type !== this._algo) { + throw (new Error('A ' + pk.type + ' key cannot be used in ' + + this._algo + ' Diffie-Hellman')); + } + if (pk.curve !== this._curve) { + throw (new Error('A key from the ' + pk.curve + ' curve ' + + 'cannot be used with a ' + this._curve + + ' Diffie-Hellman')); + } + if (pk.type === 'dsa') { + assert.deepEqual(pk.part.p, this._p, + 'DSA key prime does not match'); + assert.deepEqual(pk.part.g, this._g, + 'DSA key generator does not match'); + } +}; -module.exports = { - copy: copy, - checkDataType: checkDataType, - checkDataTypes: checkDataTypes, - coerceToTypes: coerceToTypes, - toHash: toHash, - getProperty: getProperty, - escapeQuotes: escapeQuotes, - equal: __webpack_require__(446), - ucs2length: __webpack_require__(86), - varOccurences: varOccurences, - varReplace: varReplace, - cleanUpCode: cleanUpCode, - finalCleanUpCode: finalCleanUpCode, - schemaHasRules: schemaHasRules, - schemaHasRulesExcept: schemaHasRulesExcept, - schemaUnknownRules: schemaUnknownRules, - toQuotedString: toQuotedString, - getPathExpr: getPathExpr, - getPath: getPath, - getData: getData, - unescapeFragment: unescapeFragment, - unescapeJsonPointer: unescapeJsonPointer, - escapeFragment: escapeFragment, - escapeJsonPointer: escapeJsonPointer +DiffieHellman.prototype.setKey = function (pk) { + this._keyCheck(pk); + + if (pk.type === 'dsa') { + this._dh.setPrivateKey(pk.part.x.data); + this._dh.setPublicKey(pk.part.y.data); + + } else if (pk.type === 'ecdsa') { + if (CRYPTO_HAVE_ECDH) { + this._dh.setPrivateKey(pk.part.d.data); + this._dh.setPublicKey(pk.part.Q.data); + } else { + this._priv = new ECPrivate( + this._ecParams, pk.part.d.data); + } + + } else if (pk.type === 'curve25519') { + var k = pk.part.k; + if (!pk.part.k) + k = pk.part.r; + this._priv = k.data; + if (this._priv[0] === 0x00) + this._priv = this._priv.slice(1); + this._priv = this._priv.slice(0, 32); + } + this._key = pk; + this._isPriv = true; }; +DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; +DiffieHellman.prototype.computeSecret = function (otherpk) { + this._keyCheck(otherpk, true); + if (!this._isPriv) + throw (new Error('DH exchange has not been initialized with ' + + 'a private key yet')); -function copy(o, to) { - to = to || {}; - for (var key in o) to[key] = o[key]; - return to; -} + var pub; + if (this._algo === 'dsa') { + return (this._dh.computeSecret( + otherpk.part.y.data)); + } else if (this._algo === 'ecdsa') { + if (CRYPTO_HAVE_ECDH) { + return (this._dh.computeSecret( + otherpk.part.Q.data)); + } else { + pub = new ECPublic( + this._ecParams, otherpk.part.Q.data); + return (this._priv.deriveSharedSecret(pub)); + } -function checkDataType(dataType, data, negate) { - var EQUAL = negate ? ' !== ' : ' === ' - , AND = negate ? ' || ' : ' && ' - , OK = negate ? '!' : '' - , NOT = negate ? '' : '!'; - switch (dataType) { - case 'null': return data + EQUAL + 'null'; - case 'array': return OK + 'Array.isArray(' + data + ')'; - case 'object': return '(' + OK + data + AND + - 'typeof ' + data + EQUAL + '"object"' + AND + - NOT + 'Array.isArray(' + data + '))'; - case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + - NOT + '(' + data + ' % 1)' + - AND + data + EQUAL + data + ')'; - default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; - } -} + } else if (this._algo === 'curve25519') { + pub = otherpk.part.A.data; + while (pub[0] === 0x00 && pub.length > 32) + pub = pub.slice(1); + var priv = this._priv; + assert.strictEqual(pub.length, 32); + assert.strictEqual(priv.length, 32); + + var secret = nacl.box.before(new Uint8Array(pub), + new Uint8Array(priv)); + + return (Buffer.from(secret)); + } + + throw (new Error('Invalid algorithm: ' + this._algo)); +}; +DiffieHellman.prototype.generateKey = function () { + var parts = []; + var priv, pub; + if (this._algo === 'dsa') { + this._dh.generateKeys(); + + parts.push({name: 'p', data: this._p.data}); + parts.push({name: 'q', data: this._key.part.q.data}); + parts.push({name: 'g', data: this._g.data}); + parts.push({name: 'y', data: this._dh.getPublicKey()}); + parts.push({name: 'x', data: this._dh.getPrivateKey()}); + this._key = new PrivateKey({ + type: 'dsa', + parts: parts + }); + this._isPriv = true; + return (this._key); + + } else if (this._algo === 'ecdsa') { + if (CRYPTO_HAVE_ECDH) { + this._dh.generateKeys(); + + parts.push({name: 'curve', + data: Buffer.from(this._curve)}); + parts.push({name: 'Q', data: this._dh.getPublicKey()}); + parts.push({name: 'd', data: this._dh.getPrivateKey()}); + this._key = new PrivateKey({ + type: 'ecdsa', + curve: this._curve, + parts: parts + }); + this._isPriv = true; + return (this._key); -function checkDataTypes(dataTypes, data) { - switch (dataTypes.length) { - case 1: return checkDataType(dataTypes[0], data, true); - default: - var code = ''; - var types = toHash(dataTypes); - if (types.array && types.object) { - code = types.null ? '(': '(!' + data + ' || '; - code += 'typeof ' + data + ' !== "object")'; - delete types.null; - delete types.array; - delete types.object; - } - if (types.number) delete types.integer; - for (var t in types) - code += (code ? ' && ' : '' ) + checkDataType(t, data, true); + } else { + var n = this._ecParams.getN(); + var r = new jsbn(crypto.randomBytes(n.bitLength())); + var n1 = n.subtract(jsbn.ONE); + priv = r.mod(n1).add(jsbn.ONE); + pub = this._ecParams.getG().multiply(priv); - return code; - } -} + priv = Buffer.from(priv.toByteArray()); + pub = Buffer.from(this._ecParams.getCurve(). + encodePointHex(pub), 'hex'); + this._priv = new ECPrivate(this._ecParams, priv); -var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); -function coerceToTypes(optionCoerceTypes, dataTypes) { - if (Array.isArray(dataTypes)) { - var types = []; - for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); - return paths[lvl - up]; + $schemaValue = $schema; + } + var $rule = this, + $definition = 'definition' + $lvl, + $rDef = $rule.definition, + $closingBraces = ''; + var $compile, $inline, $macro, $ruleValidate, $validateCode; + if ($isData && $rDef.$data) { + $validateCode = 'keywordValidate' + $lvl; + var $validateSchema = $rDef.validateSchema; + out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; + } else { + $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); + if (!$ruleValidate) return; + $schemaValue = 'validate.schema' + $schemaPath; + $validateCode = $ruleValidate.code; + $compile = $rDef.compile; + $inline = $rDef.inline; + $macro = $rDef.macro; + } + var $ruleErrs = $validateCode + '.errors', + $i = 'i' + $lvl, + $ruleErr = 'ruleErr' + $lvl, + $asyncKeyword = $rDef.async; + if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); + if (!($inline || $macro)) { + out += '' + ($ruleErrs) + ' = null;'; + } + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($isData && $rDef.$data) { + $closingBraces += '}'; + out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; + if ($validateSchema) { + $closingBraces += '}'; + out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; } - - if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); - data = 'data' + ((lvl - up) || ''); - if (!jsonPointer) return data; } - - var expr = data; - var segments = jsonPointer.split('/'); - for (var i=0; i All rights reserved. +traverse.propsKeywords = { + definitions: true, + properties: true, + patternProperties: true, + dependencies: true +}; +traverse.skipKeywords = { + default: true, + enum: true, + const: true, + required: true, + maximum: true, + minimum: true, + exclusiveMaximum: true, + exclusiveMinimum: true, + multipleOf: true, + maxLength: true, + minLength: true, + pattern: true, + format: true, + maxItems: true, + minItems: true, + uniqueItems: true, + maxProperties: true, + minProperties: true +}; -module.exports = { - newInvalidAsn1Error: function (msg) { - var e = new Error(); - e.name = 'InvalidAsn1Error'; - e.message = msg || ''; - return e; +function _traverse(opts, pre, post, schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex) { + if (schema && typeof schema == 'object' && !Array.isArray(schema)) { + pre(schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex); + for (var key in schema) { + var sch = schema[key]; + if (Array.isArray(sch)) { + if (key in traverse.arrayKeywords) { + for (var i=0; i 0 : it.util.schemaHasRules($propertySch, it.RULES.all)))) { - $required[$required.length] = $property; - } - } + var $isMax = $keyword == 'maximum', + $exclusiveKeyword = $isMax ? 'exclusiveMaximum' : 'exclusiveMinimum', + $schemaExcl = it.schema[$exclusiveKeyword], + $isDataExcl = it.opts.$data && $schemaExcl && $schemaExcl.$data, + $op = $isMax ? '<' : '>', + $notOp = $isMax ? '>' : '<', + $errorKeyword = undefined; + if ($isDataExcl) { + var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), + $exclusive = 'exclusive' + $lvl, + $exclType = 'exclType' + $lvl, + $exclIsNumber = 'exclIsNumber' + $lvl, + $opExpr = 'op' + $lvl, + $opStr = '\' + ' + $opExpr + ' + \''; + out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; + $schemaValueExcl = 'schemaExcl' + $lvl; + out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; + var $errorKeyword = $exclusiveKeyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; } else { - var $required = $schema; + out += ' {} '; } - } - if ($isData || $required.length) { - var $currentErrorPath = it.errorPath, - $loopRequired = $isData || $required.length >= it.opts.loopRequired, - $ownProperties = it.opts.ownProperties; - if ($breakOnError) { - out += ' var missing' + ($lvl) + '; '; - if ($loopRequired) { - if (!$isData) { - out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; - } - var $i = 'i' + $lvl, - $propertyPath = 'schema' + $lvl + '[' + $i + ']', - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); - } - out += ' var ' + ($valid) + ' = true; '; - if ($isData) { - out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; - } - out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; - } - out += '; if (!' + ($valid) + ') break; } '; - if ($isData) { - out += ' } '; - } - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - out += ' if ( '; - var arr2 = $required; - if (arr2) { - var $propertyKey, $i = -1, - l2 = arr2.length - 1; - while ($i < l2) { - $propertyKey = arr2[$i += 1]; - if ($i) { - out += ' || '; - } - var $prop = it.util.getProperty($propertyKey), - $useData = $data + $prop; - out += ' ( ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; - } - } - out += ') { '; - var $propertyPath = 'missing' + $lvl, - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; + out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { - if ($loopRequired) { - if (!$isData) { - out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; - } - var $i = 'i' + $lvl, - $propertyPath = 'schema' + $lvl + '[' + $i + ']', - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); - } - if ($isData) { - out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; - } - out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; - } - out += ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; - if ($isData) { - out += ' } '; + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; + if ($schema === undefined) { + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaValueExcl; + $isData = $isDataExcl; + } + } else { + var $exclIsNumber = typeof $schemaExcl == 'number', + $opStr = $op; + if ($exclIsNumber && $isData) { + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; + } else { + if ($exclIsNumber && $schema === undefined) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaExcl; + $notOp += '='; + } else { + if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); + if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $notOp += '='; + } else { + $exclusive = false; + $opStr += '='; } + } + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; + } + } + $errorKeyword = $errorKeyword || $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be ' + ($opStr) + ' '; + if ($isData) { + out += '\' + ' + ($schemaValue); } else { - var arr3 = $required; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $prop = it.util.getProperty($propertyKey), - $missingProperty = it.util.escapeQuotes($propertyKey), - $useData = $data + $prop; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); - } - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; - } - } + out += '' + ($schemaValue) + '\''; } } - it.errorPath = $currentErrorPath; - } else if ($breakOnError) { - out += ' if (true) {'; + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; } return out; } @@ -9980,5850 +9461,5790 @@ module.exports = function generate_required(it, $keyword, $ruleType) { /***/ }), -/***/ 310: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 342: +/***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; +// Copyright 2012 Joyent, Inc. All rights reserved. -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const command_1 = __webpack_require__(997); -const os = __webpack_require__(87); -const path = __webpack_require__(622); -/** - * The code to exit an action - */ -var ExitCode; -(function (ExitCode) { - /** - * A code indicating that the action was successful - */ - ExitCode[ExitCode["Success"] = 0] = "Success"; - /** - * A code indicating that the action was a failure - */ - ExitCode[ExitCode["Failure"] = 1] = "Failure"; -})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); -//----------------------------------------------------------------------- -// Variables -//----------------------------------------------------------------------- -/** - * Sets env variable for this action and future actions in the job - * @param name the name of the variable to set - * @param val the value of the variable - */ -function exportVariable(name, val) { - process.env[name] = val; - command_1.issueCommand('set-env', { name }, val); -} -exports.exportVariable = exportVariable; -/** - * Registers a secret which will get masked from logs - * @param secret value of the secret - */ -function setSecret(secret) { - command_1.issueCommand('add-mask', {}, secret); -} -exports.setSecret = setSecret; -/** - * Prepends inputPath to the PATH (for this action and future actions) - * @param inputPath - */ -function addPath(inputPath) { - command_1.issueCommand('add-path', {}, inputPath); - process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; -} -exports.addPath = addPath; -/** - * Gets the value of an input. The value is also trimmed. - * - * @param name name of the input to get - * @param options optional. See InputOptions. - * @returns string - */ -function getInput(name, options) { - const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; - if (options && options.required && !val) { - throw new Error(`Input required and not supplied: ${name}`); - } - return val.trim(); -} -exports.getInput = getInput; -/** - * Sets the value of an output. - * - * @param name name of the output to set - * @param value value to store - */ -function setOutput(name, value) { - command_1.issueCommand('set-output', { name }, value); -} -exports.setOutput = setOutput; -//----------------------------------------------------------------------- -// Results -//----------------------------------------------------------------------- -/** - * Sets the action status to failed. - * When the action exits it will be with an exit code of 1 - * @param message add error issue message - */ -function setFailed(message) { - process.exitCode = ExitCode.Failure; - error(message); -} -exports.setFailed = setFailed; -//----------------------------------------------------------------------- -// Logging Commands -//----------------------------------------------------------------------- -/** - * Writes debug message to user log - * @param message debug message - */ -function debug(message) { - command_1.issueCommand('debug', {}, message); -} -exports.debug = debug; -/** - * Adds an error issue - * @param message error issue message - */ -function error(message) { - command_1.issue('error', message); -} -exports.error = error; -/** - * Adds an warning issue - * @param message warning issue message - */ -function warning(message) { - command_1.issue('warning', message); -} -exports.warning = warning; -/** - * Writes info to log with console.log. - * @param message info message - */ -function info(message) { - process.stdout.write(message + os.EOL); -} -exports.info = info; -/** - * Begin an output group. - * - * Output until the next `groupEnd` will be foldable in this group - * - * @param name The name of the output group - */ -function startGroup(name) { - command_1.issue('group', name); -} -exports.startGroup = startGroup; -/** - * End an output group. - */ -function endGroup() { - command_1.issue('endgroup'); -} -exports.endGroup = endGroup; -/** - * Wrap an asynchronous function call in a group. - * - * Returns the same type as the function itself. - * - * @param name The name of the group - * @param fn The function to wrap in the group - */ -function group(name, fn) { - return __awaiter(this, void 0, void 0, function* () { - startGroup(name); - let result; - try { - result = yield fn(); - } - finally { - endGroup(); - } - return result; - }); -} -exports.group = group; -//----------------------------------------------------------------------- -// Wrapper action state -//----------------------------------------------------------------------- -/** - * Saves state for current action, the state can only be retrieved by this action's post job execution. - * - * @param name name of the state to store - * @param value value to store - */ -function saveState(name, value) { - command_1.issueCommand('save-state', { name }, value); -} -exports.saveState = saveState; -/** - * Gets the value of an state set by this action's main execution. - * - * @param name name of the state to get - * @returns string - */ -function getState(name) { - return process.env[`STATE_${name}`] || ''; -} -exports.getState = getState; -//# sourceMappingURL=core.js.map +var assert = __webpack_require__(477); +var util = __webpack_require__(669); +var utils = __webpack_require__(909); -/***/ }), -/***/ 314: -/***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2018 Joyent, Inc. +///--- Globals -module.exports = { - read: read, - write: write +var HASH_ALGOS = utils.HASH_ALGOS; +var PK_ALGOS = utils.PK_ALGOS; +var HttpSignatureError = utils.HttpSignatureError; +var InvalidAlgorithmError = utils.InvalidAlgorithmError; +var validateAlgorithm = utils.validateAlgorithm; + +var State = { + New: 0, + Params: 1 }; -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var rfc4253 = __webpack_require__(563); -var Key = __webpack_require__(501); +var ParamsState = { + Name: 0, + Quote: 1, + Value: 2, + Comma: 3 +}; -var errors = __webpack_require__(481); -function read(buf, options) { - var lines = buf.toString('ascii').split(/[\r\n]+/); - var found = false; - var parts; - var si = 0; - while (si < lines.length) { - parts = splitHeader(lines[si++]); - if (parts && - parts[0].toLowerCase() === 'putty-user-key-file-2') { - found = true; - break; - } - } - if (!found) { - throw (new Error('No PuTTY format first line found')); - } - var alg = parts[1]; +///--- Specific Errors - parts = splitHeader(lines[si++]); - assert.equal(parts[0].toLowerCase(), 'encryption'); - parts = splitHeader(lines[si++]); - assert.equal(parts[0].toLowerCase(), 'comment'); - var comment = parts[1]; +function ExpiredRequestError(message) { + HttpSignatureError.call(this, message, ExpiredRequestError); +} +util.inherits(ExpiredRequestError, HttpSignatureError); - parts = splitHeader(lines[si++]); - assert.equal(parts[0].toLowerCase(), 'public-lines'); - var publicLines = parseInt(parts[1], 10); - if (!isFinite(publicLines) || publicLines < 0 || - publicLines > lines.length) { - throw (new Error('Invalid public-lines count')); - } - var publicBuf = Buffer.from( - lines.slice(si, si + publicLines).join(''), 'base64'); - var keyType = rfc4253.algToKeyType(alg); - var key = rfc4253.read(publicBuf); - if (key.type !== keyType) { - throw (new Error('Outer key algorithm mismatch')); - } - key.comment = comment; - return (key); +function InvalidHeaderError(message) { + HttpSignatureError.call(this, message, InvalidHeaderError); } +util.inherits(InvalidHeaderError, HttpSignatureError); -function splitHeader(line) { - var idx = line.indexOf(':'); - if (idx === -1) - return (null); - var header = line.slice(0, idx); - ++idx; - while (line[idx] === ' ') - ++idx; - var rest = line.slice(idx); - return ([header, rest]); + +function InvalidParamsError(message) { + HttpSignatureError.call(this, message, InvalidParamsError); } +util.inherits(InvalidParamsError, HttpSignatureError); -function write(key, options) { - assert.object(key); - if (!Key.isKey(key)) - throw (new Error('Must be a public key')); - var alg = rfc4253.keyTypeToAlg(key); - var buf = rfc4253.write(key); - var comment = key.comment || ''; +function MissingHeaderError(message) { + HttpSignatureError.call(this, message, MissingHeaderError); +} +util.inherits(MissingHeaderError, HttpSignatureError); - var b64 = buf.toString('base64'); - var lines = wrap(b64, 64); +function StrictParsingError(message) { + HttpSignatureError.call(this, message, StrictParsingError); +} +util.inherits(StrictParsingError, HttpSignatureError); - lines.unshift('Public-Lines: ' + lines.length); - lines.unshift('Comment: ' + comment); - lines.unshift('Encryption: none'); - lines.unshift('PuTTY-User-Key-File-2: ' + alg); +///--- Exported API - return (Buffer.from(lines.join('\n') + '\n')); -} +module.exports = { -function wrap(txt, len) { - var lines = []; - var pos = 0; - while (pos < txt.length) { - lines.push(txt.slice(pos, pos + 64)); - pos += 64; - } - return (lines); -} + /** + * Parses the 'Authorization' header out of an http.ServerRequest object. + * + * Note that this API will fully validate the Authorization header, and throw + * on any error. It will not however check the signature, or the keyId format + * as those are specific to your environment. You can use the options object + * to pass in extra constraints. + * + * As a response object you can expect this: + * + * { + * "scheme": "Signature", + * "params": { + * "keyId": "foo", + * "algorithm": "rsa-sha256", + * "headers": [ + * "date" or "x-date", + * "digest" + * ], + * "signature": "base64" + * }, + * "signingString": "ready to be passed to crypto.verify()" + * } + * + * @param {Object} request an http.ServerRequest. + * @param {Object} options an optional options object with: + * - clockSkew: allowed clock skew in seconds (default 300). + * - headers: required header names (def: date or x-date) + * - algorithms: algorithms to support (default: all). + * - strict: should enforce latest spec parsing + * (default: false). + * @return {Object} parsed out object (see above). + * @throws {TypeError} on invalid input. + * @throws {InvalidHeaderError} on an invalid Authorization header error. + * @throws {InvalidParamsError} if the params in the scheme are invalid. + * @throws {MissingHeaderError} if the params indicate a header not present, + * either in the request headers from the params, + * or not in the params from a required header + * in options. + * @throws {StrictParsingError} if old attributes are used in strict parsing + * mode. + * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. + */ + parseRequest: function parseRequest(request, options) { + assert.object(request, 'request'); + assert.object(request.headers, 'request.headers'); + if (options === undefined) { + options = {}; + } + if (options.headers === undefined) { + options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; + } + assert.object(options, 'options'); + assert.arrayOfString(options.headers, 'options.headers'); + assert.optionalFinite(options.clockSkew, 'options.clockSkew'); + + var authzHeaderName = options.authorizationHeaderName || 'authorization'; + + if (!request.headers[authzHeaderName]) { + throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + + 'present in the request'); + } + + options.clockSkew = options.clockSkew || 300; + + + var i = 0; + var state = State.New; + var substate = ParamsState.Name; + var tmpName = ''; + var tmpValue = ''; + + var parsed = { + scheme: '', + params: {}, + signingString: '' + }; + + var authz = request.headers[authzHeaderName]; + for (i = 0; i < authz.length; i++) { + var c = authz.charAt(i); + + switch (Number(state)) { + + case State.New: + if (c !== ' ') parsed.scheme += c; + else state = State.Params; + break; + + case State.Params: + switch (Number(substate)) { + + case ParamsState.Name: + var code = c.charCodeAt(0); + // restricted name of A-Z / a-z + if ((code >= 0x41 && code <= 0x5a) || // A-Z + (code >= 0x61 && code <= 0x7a)) { // a-z + tmpName += c; + } else if (c === '=') { + if (tmpName.length === 0) + throw new InvalidHeaderError('bad param format'); + substate = ParamsState.Quote; + } else { + throw new InvalidHeaderError('bad param format'); + } + break; + case ParamsState.Quote: + if (c === '"') { + tmpValue = ''; + substate = ParamsState.Value; + } else { + throw new InvalidHeaderError('bad param format'); + } + break; -/***/ }), + case ParamsState.Value: + if (c === '"') { + parsed.params[tmpName] = tmpValue; + substate = ParamsState.Comma; + } else { + tmpValue += c; + } + break; -/***/ 324: -/***/ (function(module, __unusedexports, __webpack_require__) { + case ParamsState.Comma: + if (c === ',') { + tmpName = ''; + substate = ParamsState.Name; + } else { + throw new InvalidHeaderError('bad param format'); + } + break; -"use strict"; + default: + throw new Error('Invalid substate'); + } + break; + default: + throw new Error('Invalid substate'); + } -var utils = __webpack_require__(561); + } -var has = Object.prototype.hasOwnProperty; + if (!parsed.params.headers || parsed.params.headers === '') { + if (request.headers['x-date']) { + parsed.params.headers = ['x-date']; + } else { + parsed.params.headers = ['date']; + } + } else { + parsed.params.headers = parsed.params.headers.split(' '); + } -var defaults = { - allowDots: false, - allowPrototypes: false, - arrayLimit: 20, - decoder: utils.decode, - delimiter: '&', - depth: 5, - parameterLimit: 1000, - plainObjects: false, - strictNullHandling: false -}; + // Minimally validate the parsed object + if (!parsed.scheme || parsed.scheme !== 'Signature') + throw new InvalidHeaderError('scheme was not "Signature"'); -var parseValues = function parseQueryStringValues(str, options) { - var obj = {}; - var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; - var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; - var parts = cleanStr.split(options.delimiter, limit); + if (!parsed.params.keyId) + throw new InvalidHeaderError('keyId was not specified'); - for (var i = 0; i < parts.length; ++i) { - var part = parts[i]; + if (!parsed.params.algorithm) + throw new InvalidHeaderError('algorithm was not specified'); - var bracketEqualsPos = part.indexOf(']='); - var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; + if (!parsed.params.signature) + throw new InvalidHeaderError('signature was not specified'); - var key, val; - if (pos === -1) { - key = options.decoder(part, defaults.decoder); - val = options.strictNullHandling ? null : ''; - } else { - key = options.decoder(part.slice(0, pos), defaults.decoder); - val = options.decoder(part.slice(pos + 1), defaults.decoder); - } - if (has.call(obj, key)) { - obj[key] = [].concat(obj[key]).concat(val); - } else { - obj[key] = val; - } + // Check the algorithm against the official list + parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); + try { + validateAlgorithm(parsed.params.algorithm); + } catch (e) { + if (e instanceof InvalidAlgorithmError) + throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + + 'supported')); + else + throw (e); } - return obj; -}; + // Build the signingString + for (i = 0; i < parsed.params.headers.length; i++) { + var h = parsed.params.headers[i].toLowerCase(); + parsed.params.headers[i] = h; -var parseObject = function (chain, val, options) { - var leaf = val; + if (h === 'request-line') { + if (!options.strict) { + /* + * We allow headers from the older spec drafts if strict parsing isn't + * specified in options. + */ + parsed.signingString += + request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; + } else { + /* Strict parsing doesn't allow older draft headers. */ + throw (new StrictParsingError('request-line is not a valid header ' + + 'with strict parsing enabled.')); + } + } else if (h === '(request-target)') { + parsed.signingString += + '(request-target): ' + request.method.toLowerCase() + ' ' + + request.url; + } else { + var value = request.headers[h]; + if (value === undefined) + throw new MissingHeaderError(h + ' was not in the request'); + parsed.signingString += h + ': ' + value; + } - for (var i = chain.length - 1; i >= 0; --i) { - var obj; - var root = chain[i]; + if ((i + 1) < parsed.params.headers.length) + parsed.signingString += '\n'; + } - if (root === '[]') { - obj = []; - obj = obj.concat(leaf); + // Check against the constraints + var date; + if (request.headers.date || request.headers['x-date']) { + if (request.headers['x-date']) { + date = new Date(request.headers['x-date']); } else { - obj = options.plainObjects ? Object.create(null) : {}; - var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; - var index = parseInt(cleanRoot, 10); - if ( - !isNaN(index) - && root !== cleanRoot - && String(index) === cleanRoot - && index >= 0 - && (options.parseArrays && index <= options.arrayLimit) - ) { - obj = []; - obj[index] = leaf; - } else { - obj[cleanRoot] = leaf; - } + date = new Date(request.headers.date); } + var now = new Date(); + var skew = Math.abs(now.getTime() - date.getTime()); - leaf = obj; + if (skew > options.clockSkew * 1000) { + throw new ExpiredRequestError('clock skew of ' + + (skew / 1000) + + 's was greater than ' + + options.clockSkew + 's'); + } } - return leaf; -}; + options.headers.forEach(function (hdr) { + // Remember that we already checked any headers in the params + // were in the request, so if this passes we're good. + if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) + throw new MissingHeaderError(hdr + ' was not a signed header'); + }); -var parseKeys = function parseQueryStringKeys(givenKey, val, options) { - if (!givenKey) { - return; + if (options.algorithms) { + if (options.algorithms.indexOf(parsed.params.algorithm) === -1) + throw new InvalidParamsError(parsed.params.algorithm + + ' is not a supported algorithm'); } - // Transform dot notation to bracket notation - var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; + parsed.algorithm = parsed.params.algorithm.toUpperCase(); + parsed.keyId = parsed.params.keyId; + return parsed; + } - // The regex chunks +}; - var brackets = /(\[[^[\]]*])/; - var child = /(\[[^[\]]*])/g; - // Get the parent +/***/ }), - var segment = brackets.exec(key); - var parent = segment ? key.slice(0, segment.index) : key; +/***/ 343: +/***/ (function(module) { - // Stash the parent if it exists +"use strict"; - var keys = []; - if (parent) { - // If we aren't using plain objects, optionally prefix keys - // that would overwrite object prototype properties - if (!options.plainObjects && has.call(Object.prototype, parent)) { - if (!options.allowPrototypes) { - return; +module.exports = function generate_properties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl; + var $schemaKeys = Object.keys($schema || {}), + $pProperties = it.schema.patternProperties || {}, + $pPropertyKeys = Object.keys($pProperties), + $aProperties = it.schema.additionalProperties, + $someProperties = $schemaKeys.length || $pPropertyKeys.length, + $noAdditional = $aProperties === false, + $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, + $removeAdditional = it.opts.removeAdditional, + $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + var $required = it.schema.required; + if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) var $requiredHash = it.util.toHash($required); + out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined;'; + } + if ($checkAdditional) { + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + if ($someProperties) { + out += ' var isAdditional' + ($lvl) + ' = !(false '; + if ($schemaKeys.length) { + if ($schemaKeys.length > 8) { + out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; + } else { + var arr1 = $schemaKeys; + if (arr1) { + var $propertyKey, i1 = -1, + l1 = arr1.length - 1; + while (i1 < l1) { + $propertyKey = arr1[i1 += 1]; + out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; } + } } - - keys.push(parent); + } + if ($pPropertyKeys.length) { + var arr2 = $pPropertyKeys; + if (arr2) { + var $pProperty, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $pProperty = arr2[$i += 1]; + out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; + } + } + } + out += ' ); if (isAdditional' + ($lvl) + ') { '; } - - // Loop through children appending to the array until we hit depth - - var i = 0; - while ((segment = child.exec(key)) !== null && i < options.depth) { - i += 1; - if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { - if (!options.allowPrototypes) { - return; + if ($removeAdditional == 'all') { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + var $currentErrorPath = it.errorPath; + var $additionalProperty = '\' + ' + $key + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + } + if ($noAdditional) { + if ($removeAdditional) { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + out += ' ' + ($nextValid) + ' = false; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalProperties'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is an invalid additional property'; + } else { + out += 'should NOT have additional properties'; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + out += ' break; '; + } } - keys.push(segment[1]); - } - - // If there's a remainder, just add whatever is left - - if (segment) { - keys.push('[' + key.slice(segment.index) + ']'); + } else if ($additionalIsSchema) { + if ($removeAdditional == 'failing') { + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + } else { + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + } + } + it.errorPath = $currentErrorPath; } - - return parseObject(keys, val, options); -}; - -module.exports = function (str, opts) { - var options = opts ? utils.assign({}, opts) : {}; - - if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { - throw new TypeError('Decoder has to be a function.'); + if ($someProperties) { + out += ' } '; } - - options.ignoreQueryPrefix = options.ignoreQueryPrefix === true; - options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; - options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; - options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; - options.parseArrays = options.parseArrays !== false; - options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; - options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; - options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; - options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; - options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; - options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; - - if (str === '' || str === null || typeof str === 'undefined') { - return options.plainObjects ? Object.create(null) : {}; + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; } - - var tempObj = typeof str === 'string' ? parseValues(str, options) : str; - var obj = options.plainObjects ? Object.create(null) : {}; - - // Iterate over the keys and setup the new object - - var keys = Object.keys(tempObj); - for (var i = 0; i < keys.length; ++i) { - var key = keys[i]; - var newObj = parseKeys(key, tempObj[key], options); - obj = utils.merge(obj, newObj, options); + } + var $useDefaults = it.opts.useDefaults && !it.compositeRule; + if ($schemaKeys.length) { + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + var $prop = it.util.getProperty($propertyKey), + $passData = $data + $prop, + $hasDefault = $useDefaults && $sch.default !== undefined; + $it.schema = $sch; + $it.schemaPath = $schemaPath + $prop; + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); + $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); + $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + $code = it.util.varReplace($code, $nextData, $passData); + var $useData = $passData; + } else { + var $useData = $nextData; + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; + } + if ($hasDefault) { + out += ' ' + ($code) + ' '; + } else { + if ($requiredHash && $requiredHash[$propertyKey]) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = false; '; + var $currentErrorPath = it.errorPath, + $currErrSchemaPath = $errSchemaPath, + $missingProperty = it.util.escapeQuotes($propertyKey); + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + $errSchemaPath = it.errSchemaPath + '/required'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + it.errorPath = $currentErrorPath; + out += ' } else { '; + } else { + if ($breakOnError) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = true; } else { '; + } else { + out += ' if (' + ($useData) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ' ) { '; + } + } + out += ' ' + ($code) + ' } '; + } + } + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } } - - return utils.compact(obj); -}; - - -/***/ }), - -/***/ 326: -/***/ (function(module) { - -module.exports = {"$id":"log.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["version","creator","entries"],"properties":{"version":{"type":"string"},"creator":{"$ref":"creator.json#"},"browser":{"$ref":"browser.json#"},"pages":{"type":"array","items":{"$ref":"page.json#"}},"entries":{"type":"array","items":{"$ref":"entry.json#"}},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 329: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2012 Joyent, Inc. All rights reserved. - -var assert = __webpack_require__(976); -var sshpk = __webpack_require__(133); -var util = __webpack_require__(669); - -var HASH_ALGOS = { - 'sha1': true, - 'sha256': true, - 'sha512': true -}; - -var PK_ALGOS = { - 'rsa': true, - 'dsa': true, - 'ecdsa': true -}; - -function HttpSignatureError(message, caller) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, caller || HttpSignatureError); - - this.message = message; - this.name = caller.name; -} -util.inherits(HttpSignatureError, Error); - -function InvalidAlgorithmError(message) { - HttpSignatureError.call(this, message, InvalidAlgorithmError); -} -util.inherits(InvalidAlgorithmError, HttpSignatureError); - -function validateAlgorithm(algorithm) { - var alg = algorithm.toLowerCase().split('-'); - - if (alg.length !== 2) { - throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' is not a ' + - 'valid algorithm')); } - - if (alg[0] !== 'hmac' && !PK_ALGOS[alg[0]]) { - throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' type keys ' + - 'are not supported')); + if ($pPropertyKeys.length) { + var arr4 = $pPropertyKeys; + if (arr4) { + var $pProperty, i4 = -1, + l4 = arr4.length - 1; + while (i4 < l4) { + $pProperty = arr4[i4 += 1]; + var $sch = $pProperties[$pProperty]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); + $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else ' + ($nextValid) + ' = true; '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } } - - if (!HASH_ALGOS[alg[1]]) { - throw (new InvalidAlgorithmError(alg[1].toUpperCase() + ' is not a ' + - 'supported hash algorithm')); + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } - - return (alg); + out = it.util.cleanUpCode(out); + return out; } -///--- API - -module.exports = { - - HASH_ALGOS: HASH_ALGOS, - PK_ALGOS: PK_ALGOS, - - HttpSignatureError: HttpSignatureError, - InvalidAlgorithmError: InvalidAlgorithmError, - - validateAlgorithm: validateAlgorithm, - /** - * Converts an OpenSSH public key (rsa only) to a PKCS#8 PEM file. - * - * The intent of this module is to interoperate with OpenSSL only, - * specifically the node crypto module's `verify` method. - * - * @param {String} key an OpenSSH public key. - * @return {String} PEM encoded form of the RSA public key. - * @throws {TypeError} on bad input. - * @throws {Error} on invalid ssh key formatted data. - */ - sshKeyToPEM: function sshKeyToPEM(key) { - assert.string(key, 'ssh_key'); +/***/ }), - var k = sshpk.parseKey(key, 'ssh'); - return (k.toString('pem')); - }, +/***/ 348: +/***/ (function(__unusedmodule, exports, __webpack_require__) { +/* + * lib/jsprim.js: utilities for primitive JavaScript types + */ - /** - * Generates an OpenSSH fingerprint from an ssh public key. - * - * @param {String} key an OpenSSH public key. - * @return {String} key fingerprint. - * @throws {TypeError} on bad input. - * @throws {Error} if what you passed doesn't look like an ssh public key. - */ - fingerprint: function fingerprint(key) { - assert.string(key, 'ssh_key'); +var mod_assert = __webpack_require__(477); +var mod_util = __webpack_require__(669); - var k = sshpk.parseKey(key, 'ssh'); - return (k.fingerprint('md5').toString('hex')); - }, +var mod_extsprintf = __webpack_require__(697); +var mod_verror = __webpack_require__(956); +var mod_jsonschema = __webpack_require__(703); - /** - * Converts a PKGCS#8 PEM file to an OpenSSH public key (rsa) - * - * The reverse of the above function. - */ - pemToRsaSSHKey: function pemToRsaSSHKey(pem, comment) { - assert.equal('string', typeof (pem), 'typeof pem'); +/* + * Public interface + */ +exports.deepCopy = deepCopy; +exports.deepEqual = deepEqual; +exports.isEmpty = isEmpty; +exports.hasKey = hasKey; +exports.forEachKey = forEachKey; +exports.pluck = pluck; +exports.flattenObject = flattenObject; +exports.flattenIter = flattenIter; +exports.validateJsonObject = validateJsonObjectJS; +exports.validateJsonObjectJS = validateJsonObjectJS; +exports.randElt = randElt; +exports.extraProperties = extraProperties; +exports.mergeObjects = mergeObjects; - var k = sshpk.parseKey(pem, 'pem'); - k.comment = comment; - return (k.toString('ssh')); - } -}; +exports.startsWith = startsWith; +exports.endsWith = endsWith; +exports.parseInteger = parseInteger; -/***/ }), +exports.iso8601 = iso8601; +exports.rfc1123 = rfc1123; +exports.parseDateTime = parseDateTime; -/***/ 339: -/***/ (function(module) { +exports.hrtimediff = hrtimeDiff; +exports.hrtimeDiff = hrtimeDiff; +exports.hrtimeAccum = hrtimeAccum; +exports.hrtimeAdd = hrtimeAdd; +exports.hrtimeNanosec = hrtimeNanosec; +exports.hrtimeMicrosec = hrtimeMicrosec; +exports.hrtimeMillisec = hrtimeMillisec; -"use strict"; -module.exports = function generate_comment(it, $keyword, $ruleType) { - var out = ' '; - var $schema = it.schema[$keyword]; - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $comment = it.util.toQuotedString($schema); - if (it.opts.$comment === true) { - out += ' console.log(' + ($comment) + ');'; - } else if (typeof it.opts.$comment == 'function') { - out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; - } - return out; -} +/* + * Deep copy an acyclic *basic* Javascript object. This only handles basic + * scalars (strings, numbers, booleans) and arbitrarily deep arrays and objects + * containing these. This does *not* handle instances of other classes. + */ +function deepCopy(obj) +{ + var ret, key; + var marker = '__deepCopy'; + if (obj && obj[marker]) + throw (new Error('attempted deep copy of cyclic object')); -/***/ }), + if (obj && obj.constructor == Object) { + ret = {}; + obj[marker] = true; -/***/ 357: -/***/ (function(module) { + for (key in obj) { + if (key == marker) + continue; -module.exports = require("assert"); + ret[key] = deepCopy(obj[key]); + } -/***/ }), + delete (obj[marker]); + return (ret); + } -/***/ 361: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (obj && obj.constructor == Array) { + ret = []; + obj[marker] = true; -"use strict"; + for (key = 0; key < obj.length; key++) + ret.push(deepCopy(obj[key])); + delete (obj[marker]); + return (ret); + } -var utils = __webpack_require__(561); -var formats = __webpack_require__(751); + /* + * It must be a primitive type -- just return it. + */ + return (obj); +} -var arrayPrefixGenerators = { - brackets: function brackets(prefix) { // eslint-disable-line func-name-matching - return prefix + '[]'; - }, - indices: function indices(prefix, key) { // eslint-disable-line func-name-matching - return prefix + '[' + key + ']'; - }, - repeat: function repeat(prefix) { // eslint-disable-line func-name-matching - return prefix; - } -}; +function deepEqual(obj1, obj2) +{ + if (typeof (obj1) != typeof (obj2)) + return (false); -var toISO = Date.prototype.toISOString; + if (obj1 === null || obj2 === null || typeof (obj1) != 'object') + return (obj1 === obj2); -var defaults = { - delimiter: '&', - encode: true, - encoder: utils.encode, - encodeValuesOnly: false, - serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching - return toISO.call(date); - }, - skipNulls: false, - strictNullHandling: false -}; + if (obj1.constructor != obj2.constructor) + return (false); -var stringify = function stringify( // eslint-disable-line func-name-matching - object, - prefix, - generateArrayPrefix, - strictNullHandling, - skipNulls, - encoder, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly -) { - var obj = object; - if (typeof filter === 'function') { - obj = filter(prefix, obj); - } else if (obj instanceof Date) { - obj = serializeDate(obj); - } else if (obj === null) { - if (strictNullHandling) { - return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder) : prefix; - } + var k; + for (k in obj1) { + if (!obj2.hasOwnProperty(k)) + return (false); - obj = ''; - } + if (!deepEqual(obj1[k], obj2[k])) + return (false); + } - if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { - if (encoder) { - var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder); - return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder))]; - } - return [formatter(prefix) + '=' + formatter(String(obj))]; - } + for (k in obj2) { + if (!obj1.hasOwnProperty(k)) + return (false); + } - var values = []; + return (true); +} - if (typeof obj === 'undefined') { - return values; - } +function isEmpty(obj) +{ + var key; + for (key in obj) + return (false); + return (true); +} - var objKeys; - if (Array.isArray(filter)) { - objKeys = filter; - } else { - var keys = Object.keys(obj); - objKeys = sort ? keys.sort(sort) : keys; - } +function hasKey(obj, key) +{ + mod_assert.equal(typeof (key), 'string'); + return (Object.prototype.hasOwnProperty.call(obj, key)); +} - for (var i = 0; i < objKeys.length; ++i) { - var key = objKeys[i]; +function forEachKey(obj, callback) +{ + for (var key in obj) { + if (hasKey(obj, key)) { + callback(key, obj[key]); + } + } +} - if (skipNulls && obj[key] === null) { - continue; - } +function pluck(obj, key) +{ + mod_assert.equal(typeof (key), 'string'); + return (pluckv(obj, key)); +} - if (Array.isArray(obj)) { - values = values.concat(stringify( - obj[key], - generateArrayPrefix(prefix, key), - generateArrayPrefix, - strictNullHandling, - skipNulls, - encoder, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly - )); - } else { - values = values.concat(stringify( - obj[key], - prefix + (allowDots ? '.' + key : '[' + key + ']'), - generateArrayPrefix, - strictNullHandling, - skipNulls, - encoder, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly - )); - } - } +function pluckv(obj, key) +{ + if (obj === null || typeof (obj) !== 'object') + return (undefined); - return values; -}; + if (obj.hasOwnProperty(key)) + return (obj[key]); -module.exports = function (object, opts) { - var obj = object; - var options = opts ? utils.assign({}, opts) : {}; + var i = key.indexOf('.'); + if (i == -1) + return (undefined); - if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { - throw new TypeError('Encoder has to be a function.'); - } + var key1 = key.substr(0, i); + if (!obj.hasOwnProperty(key1)) + return (undefined); - var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; - var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; - var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; - var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; - var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; - var sort = typeof options.sort === 'function' ? options.sort : null; - var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; - var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; - var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; - if (typeof options.format === 'undefined') { - options.format = formats['default']; - } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { - throw new TypeError('Unknown format option provided.'); - } - var formatter = formats.formatters[options.format]; - var objKeys; - var filter; + return (pluckv(obj[key1], key.substr(i + 1))); +} - if (typeof options.filter === 'function') { - filter = options.filter; - obj = filter('', obj); - } else if (Array.isArray(options.filter)) { - filter = options.filter; - objKeys = filter; - } +/* + * Invoke callback(row) for each entry in the array that would be returned by + * flattenObject(data, depth). This is just like flattenObject(data, + * depth).forEach(callback), except that the intermediate array is never + * created. + */ +function flattenIter(data, depth, callback) +{ + doFlattenIter(data, depth, [], callback); +} - var keys = []; +function doFlattenIter(data, depth, accum, callback) +{ + var each; + var key; - if (typeof obj !== 'object' || obj === null) { - return ''; - } + if (depth === 0) { + each = accum.slice(0); + each.push(data); + callback(each); + return; + } - var arrayFormat; - if (options.arrayFormat in arrayPrefixGenerators) { - arrayFormat = options.arrayFormat; - } else if ('indices' in options) { - arrayFormat = options.indices ? 'indices' : 'repeat'; - } else { - arrayFormat = 'indices'; - } + mod_assert.ok(data !== null); + mod_assert.equal(typeof (data), 'object'); + mod_assert.equal(typeof (depth), 'number'); + mod_assert.ok(depth >= 0); - var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + for (key in data) { + each = accum.slice(0); + each.push(key); + doFlattenIter(data[key], depth - 1, each, callback); + } +} - if (!objKeys) { - objKeys = Object.keys(obj); - } +function flattenObject(data, depth) +{ + if (depth === 0) + return ([ data ]); - if (sort) { - objKeys.sort(sort); - } + mod_assert.ok(data !== null); + mod_assert.equal(typeof (data), 'object'); + mod_assert.equal(typeof (depth), 'number'); + mod_assert.ok(depth >= 0); - for (var i = 0; i < objKeys.length; ++i) { - var key = objKeys[i]; + var rv = []; + var key; - if (skipNulls && obj[key] === null) { - continue; - } + for (key in data) { + flattenObject(data[key], depth - 1).forEach(function (p) { + rv.push([ key ].concat(p)); + }); + } - keys = keys.concat(stringify( - obj[key], - key, - generateArrayPrefix, - strictNullHandling, - skipNulls, - encode ? encoder : null, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly - )); - } + return (rv); +} - var joined = keys.join(delimiter); - var prefix = options.addQueryPrefix === true ? '?' : ''; +function startsWith(str, prefix) +{ + return (str.substr(0, prefix.length) == prefix); +} - return joined.length > 0 ? prefix + joined : ''; -}; +function endsWith(str, suffix) +{ + return (str.substr( + str.length - suffix.length, suffix.length) == suffix); +} +function iso8601(d) +{ + if (typeof (d) == 'number') + d = new Date(d); + mod_assert.ok(d.constructor === Date); + return (mod_extsprintf.sprintf('%4d-%02d-%02dT%02d:%02d:%02d.%03dZ', + d.getUTCFullYear(), d.getUTCMonth() + 1, d.getUTCDate(), + d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), + d.getUTCMilliseconds())); +} -/***/ }), +var RFC1123_MONTHS = [ + 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', + 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']; +var RFC1123_DAYS = [ + 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat']; -/***/ 375: -/***/ (function(module, __unusedexports, __webpack_require__) { +function rfc1123(date) { + return (mod_extsprintf.sprintf('%s, %02d %s %04d %02d:%02d:%02d GMT', + RFC1123_DAYS[date.getUTCDay()], date.getUTCDate(), + RFC1123_MONTHS[date.getUTCMonth()], date.getUTCFullYear(), + date.getUTCHours(), date.getUTCMinutes(), + date.getUTCSeconds())); +} -var iterate = __webpack_require__(454) - , initState = __webpack_require__(729) - , terminator = __webpack_require__(272) - ; +/* + * Parses a date expressed as a string, as either a number of milliseconds since + * the epoch or any string format that Date accepts, giving preference to the + * former where these two sets overlap (e.g., small numbers). + */ +function parseDateTime(str) +{ + /* + * This is irritatingly implicit, but significantly more concise than + * alternatives. The "+str" will convert a string containing only a + * number directly to a Number, or NaN for other strings. Thus, if the + * conversion succeeds, we use it (this is the milliseconds-since-epoch + * case). Otherwise, we pass the string directly to the Date + * constructor to parse. + */ + var numeric = +str; + if (!isNaN(numeric)) { + return (new Date(numeric)); + } else { + return (new Date(str)); + } +} -// Public API -module.exports = serialOrdered; -// sorting helpers -module.exports.ascending = ascending; -module.exports.descending = descending; -/** - * Runs iterator over provided sorted array elements in series - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} sortMethod - custom sort function - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator +/* + * Number.*_SAFE_INTEGER isn't present before node v0.12, so we hardcode + * the ES6 definitions here, while allowing for them to someday be higher. */ -function serialOrdered(list, iterator, sortMethod, callback) -{ - var state = initState(list, sortMethod); +var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; +var MIN_SAFE_INTEGER = Number.MIN_SAFE_INTEGER || -9007199254740991; - iterate(list, iterator, state, function iteratorHandler(error, result) - { - if (error) - { - callback(error, result); - return; - } - state.index++; +/* + * Default options for parseInteger(). + */ +var PI_DEFAULTS = { + base: 10, + allowSign: true, + allowPrefix: false, + allowTrailing: false, + allowImprecise: false, + trimWhitespace: false, + leadingZeroIsOctal: false +}; - // are we there yet? - if (state.index < (state['keyedList'] || list).length) - { - iterate(list, iterator, state, iteratorHandler); - return; - } +var CP_0 = 0x30; +var CP_9 = 0x39; - // done here - callback(null, state.results); - }); +var CP_A = 0x41; +var CP_B = 0x42; +var CP_O = 0x4f; +var CP_T = 0x54; +var CP_X = 0x58; +var CP_Z = 0x5a; - return terminator.bind(state, callback); -} +var CP_a = 0x61; +var CP_b = 0x62; +var CP_o = 0x6f; +var CP_t = 0x74; +var CP_x = 0x78; +var CP_z = 0x7a; -/* - * -- Sort methods - */ +var PI_CONV_DEC = 0x30; +var PI_CONV_UC = 0x37; +var PI_CONV_LC = 0x57; -/** - * sort helper to sort array elements in ascending order - * - * @param {mixed} a - an item to compare - * @param {mixed} b - an item to compare - * @returns {number} - comparison result - */ -function ascending(a, b) -{ - return a < b ? -1 : a > b ? 1 : 0; -} -/** - * sort helper to sort array elements in descending order - * - * @param {mixed} a - an item to compare - * @param {mixed} b - an item to compare - * @returns {number} - comparison result +/* + * A stricter version of parseInt() that provides options for changing what + * is an acceptable string (for example, disallowing trailing characters). */ -function descending(a, b) +function parseInteger(str, uopts) { - return -1 * ascending(a, b); -} - - -/***/ }), + mod_assert.string(str, 'str'); + mod_assert.optionalObject(uopts, 'options'); -/***/ 376: -/***/ (function(module, __unusedexports, __webpack_require__) { + var baseOverride = false; + var options = PI_DEFAULTS; -"use strict"; + if (uopts) { + baseOverride = hasKey(uopts, 'base'); + options = mergeObjects(options, uopts); + mod_assert.number(options.base, 'options.base'); + mod_assert.ok(options.base >= 2, 'options.base >= 2'); + mod_assert.ok(options.base <= 36, 'options.base <= 36'); + mod_assert.bool(options.allowSign, 'options.allowSign'); + mod_assert.bool(options.allowPrefix, 'options.allowPrefix'); + mod_assert.bool(options.allowTrailing, + 'options.allowTrailing'); + mod_assert.bool(options.allowImprecise, + 'options.allowImprecise'); + mod_assert.bool(options.trimWhitespace, + 'options.trimWhitespace'); + mod_assert.bool(options.leadingZeroIsOctal, + 'options.leadingZeroIsOctal'); + if (options.leadingZeroIsOctal) { + mod_assert.ok(!baseOverride, + '"base" and "leadingZeroIsOctal" are ' + + 'mutually exclusive'); + } + } -var ruleModules = __webpack_require__(37) - , toHash = __webpack_require__(280).toHash; + var c; + var pbase = -1; + var base = options.base; + var start; + var mult = 1; + var value = 0; + var idx = 0; + var len = str.length; -module.exports = function rules() { - var RULES = [ - { type: 'number', - rules: [ { 'maximum': ['exclusiveMaximum'] }, - { 'minimum': ['exclusiveMinimum'] }, 'multipleOf', 'format'] }, - { type: 'string', - rules: [ 'maxLength', 'minLength', 'pattern', 'format' ] }, - { type: 'array', - rules: [ 'maxItems', 'minItems', 'items', 'contains', 'uniqueItems' ] }, - { type: 'object', - rules: [ 'maxProperties', 'minProperties', 'required', 'dependencies', 'propertyNames', - { 'properties': ['additionalProperties', 'patternProperties'] } ] }, - { rules: [ '$ref', 'const', 'enum', 'not', 'anyOf', 'oneOf', 'allOf', 'if' ] } - ]; + /* Trim any whitespace on the left side. */ + if (options.trimWhitespace) { + while (idx < len && isSpace(str.charCodeAt(idx))) { + ++idx; + } + } - var ALL = [ 'type', '$comment' ]; - var KEYWORDS = [ - '$schema', '$id', 'id', '$data', '$async', 'title', - 'description', 'default', 'definitions', - 'examples', 'readOnly', 'writeOnly', - 'contentMediaType', 'contentEncoding', - 'additionalItems', 'then', 'else' - ]; - var TYPES = [ 'number', 'integer', 'string', 'array', 'object', 'boolean', 'null' ]; - RULES.all = toHash(ALL); - RULES.types = toHash(TYPES); + /* Check the number for a leading sign. */ + if (options.allowSign) { + if (str[idx] === '-') { + idx += 1; + mult = -1; + } else if (str[idx] === '+') { + idx += 1; + } + } - RULES.forEach(function (group) { - group.rules = group.rules.map(function (keyword) { - var implKeywords; - if (typeof keyword == 'object') { - var key = Object.keys(keyword)[0]; - implKeywords = keyword[key]; - keyword = key; - implKeywords.forEach(function (k) { - ALL.push(k); - RULES.all[k] = true; - }); - } - ALL.push(keyword); - var rule = RULES.all[keyword] = { - keyword: keyword, - code: ruleModules[keyword], - implements: implKeywords - }; - return rule; - }); + /* Parse the base-indicating prefix if there is one. */ + if (str[idx] === '0') { + if (options.allowPrefix) { + pbase = prefixToBase(str.charCodeAt(idx + 1)); + if (pbase !== -1 && (!baseOverride || pbase === base)) { + base = pbase; + idx += 2; + } + } - RULES.all.$comment = { - keyword: '$comment', - code: ruleModules.$comment - }; + if (pbase === -1 && options.leadingZeroIsOctal) { + base = 8; + } + } - if (group.type) RULES.types[group.type] = group; - }); + /* Parse the actual digits. */ + for (start = idx; idx < len; ++idx) { + c = translateDigit(str.charCodeAt(idx)); + if (c !== -1 && c < base) { + value *= base; + value += c; + } else { + break; + } + } - RULES.keywords = toHash(ALL.concat(KEYWORDS)); - RULES.custom = {}; + /* If we didn't parse any digits, we have an invalid number. */ + if (start === idx) { + return (new Error('invalid number: ' + JSON.stringify(str))); + } - return RULES; -}; + /* Trim any whitespace on the right side. */ + if (options.trimWhitespace) { + while (idx < len && isSpace(str.charCodeAt(idx))) { + ++idx; + } + } + /* Check for trailing characters. */ + if (idx < len && !options.allowTrailing) { + return (new Error('trailing characters after number: ' + + JSON.stringify(str.slice(idx)))); + } -/***/ }), + /* If our value is 0, we return now, to avoid returning -0. */ + if (value === 0) { + return (0); + } -/***/ 380: -/***/ (function(module) { + /* Calculate our final value. */ + var result = value * mult; -"use strict"; + /* + * If the string represents a value that cannot be precisely represented + * by JavaScript, then we want to check that: + * + * - We never increased the value past MAX_SAFE_INTEGER + * - We don't make the result negative and below MIN_SAFE_INTEGER + * + * Because we only ever increment the value during parsing, there's no + * chance of moving past MAX_SAFE_INTEGER and then dropping below it + * again, losing precision in the process. This means that we only need + * to do our checks here, at the end. + */ + if (!options.allowImprecise && + (value > MAX_SAFE_INTEGER || result < MIN_SAFE_INTEGER)) { + return (new Error('number is outside of the supported range: ' + + JSON.stringify(str.slice(start, idx)))); + } -module.exports = function generate_not(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - $it.level++; - var $nextValid = 'valid' + $it.level; - if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' var ' + ($errs) + ' = errors; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.createErrors = false; - var $allErrorsOption; - if ($it.opts.allErrors) { - $allErrorsOption = $it.opts.allErrors; - $it.opts.allErrors = false; - } - out += ' ' + (it.validate($it)) + ' '; - $it.createErrors = true; - if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' if (' + ($nextValid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT be valid\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - if (it.opts.allErrors) { - out += ' } '; - } - } else { - out += ' var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT be valid\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - if ($breakOnError) { - out += ' if (false) { '; - } - } - return out; + return (result); } -/***/ }), +/* + * Interpret a character code as a base-36 digit. + */ +function translateDigit(d) +{ + if (d >= CP_0 && d <= CP_9) { + /* '0' to '9' -> 0 to 9 */ + return (d - PI_CONV_DEC); + } else if (d >= CP_A && d <= CP_Z) { + /* 'A' - 'Z' -> 10 to 35 */ + return (d - PI_CONV_UC); + } else if (d >= CP_a && d <= CP_z) { + /* 'a' - 'z' -> 10 to 35 */ + return (d - PI_CONV_LC); + } else { + /* Invalid character code */ + return (-1); + } +} -/***/ 385: -/***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; +/* + * Test if a value matches the ECMAScript definition of trimmable whitespace. + */ +function isSpace(c) +{ + return (c === 0x20) || + (c >= 0x0009 && c <= 0x000d) || + (c === 0x00a0) || + (c === 0x1680) || + (c === 0x180e) || + (c >= 0x2000 && c <= 0x200a) || + (c === 0x2028) || + (c === 0x2029) || + (c === 0x202f) || + (c === 0x205f) || + (c === 0x3000) || + (c === 0xfeff); +} -module.exports = { - afterRequest: __webpack_require__(518), - beforeRequest: __webpack_require__(686), - browser: __webpack_require__(696), - cache: __webpack_require__(439), - content: __webpack_require__(256), - cookie: __webpack_require__(736), - creator: __webpack_require__(992), - entry: __webpack_require__(619), - har: __webpack_require__(152), - header: __webpack_require__(536), - log: __webpack_require__(326), - page: __webpack_require__(128), - pageTimings: __webpack_require__(127), - postData: __webpack_require__(890), - query: __webpack_require__(214), - request: __webpack_require__(50), - response: __webpack_require__(187), - timings: __webpack_require__(555) +/* + * Determine which base a character indicates (e.g., 'x' indicates hex). + */ +function prefixToBase(c) +{ + if (c === CP_b || c === CP_B) { + /* 0b/0B (binary) */ + return (2); + } else if (c === CP_o || c === CP_O) { + /* 0o/0O (octal) */ + return (8); + } else if (c === CP_t || c === CP_T) { + /* 0t/0T (decimal) */ + return (10); + } else if (c === CP_x || c === CP_X) { + /* 0x/0X (hexadecimal) */ + return (16); + } else { + /* Not a meaningful character */ + return (-1); + } } -/***/ }), - -/***/ 387: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. +function validateJsonObjectJS(schema, input) +{ + var report = mod_jsonschema.validate(input, schema); -module.exports = { - read: read, - verify: verify, - sign: sign, - signAsync: signAsync, - write: write, + if (report.errors.length === 0) + return (null); - /* Internal private API */ - fromBuffer: fromBuffer, - toBuffer: toBuffer -}; + /* Currently, we only do anything useful with the first error. */ + var error = report.errors[0]; -var assert = __webpack_require__(976); -var SSHBuffer = __webpack_require__(981); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var Identity = __webpack_require__(183); -var rfc4253 = __webpack_require__(563); -var Signature = __webpack_require__(437); -var utils = __webpack_require__(57); -var Certificate = __webpack_require__(646); + /* The failed property is given by a URI with an irrelevant prefix. */ + var propname = error['property']; + var reason = error['message'].toLowerCase(); + var i, j; -function verify(cert, key) { /* - * We always give an issuerKey, so if our verify() is being called then - * there was no signature. Return false. + * There's at least one case where the property error message is + * confusing at best. We work around this here. */ - return (false); -} - -var TYPES = { - 'user': 1, - 'host': 2 -}; -Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; }); - -var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/; - -function read(buf, options) { - if (Buffer.isBuffer(buf)) - buf = buf.toString('ascii'); - var parts = buf.trim().split(/[ \t\n]+/g); - if (parts.length < 2 || parts.length > 3) - throw (new Error('Not a valid SSH certificate line')); + if ((i = reason.indexOf('the property ')) != -1 && + (j = reason.indexOf(' is not defined in the schema and the ' + + 'schema does not allow additional properties')) != -1) { + i += 'the property '.length; + if (propname === '') + propname = reason.substr(i, j - i); + else + propname = propname + '.' + reason.substr(i, j - i); - var algo = parts[0]; - var data = parts[1]; + reason = 'unsupported property'; + } - data = Buffer.from(data, 'base64'); - return (fromBuffer(data, algo)); + var rv = new mod_verror.VError('property "%s": %s', propname, reason); + rv.jsv_details = error; + return (rv); } -function fromBuffer(data, algo, partial) { - var sshbuf = new SSHBuffer({ buffer: data }); - var innerAlgo = sshbuf.readString(); - if (algo !== undefined && innerAlgo !== algo) - throw (new Error('SSH certificate algorithm mismatch')); - if (algo === undefined) - algo = innerAlgo; +function randElt(arr) +{ + mod_assert.ok(Array.isArray(arr) && arr.length > 0, + 'randElt argument must be a non-empty array'); - var cert = {}; - cert.signatures = {}; - cert.signatures.openssh = {}; + return (arr[Math.floor(Math.random() * arr.length)]); +} - cert.signatures.openssh.nonce = sshbuf.readBuffer(); +function assertHrtime(a) +{ + mod_assert.ok(a[0] >= 0 && a[1] >= 0, + 'negative numbers not allowed in hrtimes'); + mod_assert.ok(a[1] < 1e9, 'nanoseconds column overflow'); +} - var key = {}; - var parts = (key.parts = []); - key.type = getAlg(algo); +/* + * Compute the time elapsed between hrtime readings A and B, where A is later + * than B. hrtime readings come from Node's process.hrtime(). There is no + * defined way to represent negative deltas, so it's illegal to diff B from A + * where the time denoted by B is later than the time denoted by A. If this + * becomes valuable, we can define a representation and extend the + * implementation to support it. + */ +function hrtimeDiff(a, b) +{ + assertHrtime(a); + assertHrtime(b); + mod_assert.ok(a[0] > b[0] || (a[0] == b[0] && a[1] >= b[1]), + 'negative differences not allowed'); - var partCount = algs.info[key.type].parts.length; - while (parts.length < partCount) - parts.push(sshbuf.readPart()); - assert.ok(parts.length >= 1, 'key must have at least one part'); + var rv = [ a[0] - b[0], 0 ]; - var algInfo = algs.info[key.type]; - if (key.type === 'ecdsa') { - var res = ECDSA_ALGO.exec(algo); - assert.ok(res !== null); - assert.strictEqual(res[1], parts[0].data.toString()); + if (a[1] >= b[1]) { + rv[1] = a[1] - b[1]; + } else { + rv[0]--; + rv[1] = 1e9 - (b[1] - a[1]); } - for (var i = 0; i < algInfo.parts.length; ++i) { - parts[i].name = algInfo.parts[i]; - if (parts[i].name !== 'curve' && - algInfo.normalize !== false) { - var p = parts[i]; - p.data = utils.mpNormalize(p.data); - } - } + return (rv); +} - cert.subjectKey = new Key(key); +/* + * Convert a hrtime reading from the array format returned by Node's + * process.hrtime() into a scalar number of nanoseconds. + */ +function hrtimeNanosec(a) +{ + assertHrtime(a); - cert.serial = sshbuf.readInt64(); + return (Math.floor(a[0] * 1e9 + a[1])); +} - var type = TYPES[sshbuf.readInt()]; - assert.string(type, 'valid cert type'); +/* + * Convert a hrtime reading from the array format returned by Node's + * process.hrtime() into a scalar number of microseconds. + */ +function hrtimeMicrosec(a) +{ + assertHrtime(a); - cert.signatures.openssh.keyId = sshbuf.readString(); + return (Math.floor(a[0] * 1e6 + a[1] / 1e3)); +} - var principals = []; - var pbuf = sshbuf.readBuffer(); - var psshbuf = new SSHBuffer({ buffer: pbuf }); - while (!psshbuf.atEnd()) - principals.push(psshbuf.readString()); - if (principals.length === 0) - principals = ['*']; +/* + * Convert a hrtime reading from the array format returned by Node's + * process.hrtime() into a scalar number of milliseconds. + */ +function hrtimeMillisec(a) +{ + assertHrtime(a); - cert.subjects = principals.map(function (pr) { - if (type === 'user') - return (Identity.forUser(pr)); - else if (type === 'host') - return (Identity.forHost(pr)); - throw (new Error('Unknown identity type ' + type)); - }); + return (Math.floor(a[0] * 1e3 + a[1] / 1e6)); +} - cert.validFrom = int64ToDate(sshbuf.readInt64()); - cert.validUntil = int64ToDate(sshbuf.readInt64()); +/* + * Add two hrtime readings A and B, overwriting A with the result of the + * addition. This function is useful for accumulating several hrtime intervals + * into a counter. Returns A. + */ +function hrtimeAccum(a, b) +{ + assertHrtime(a); + assertHrtime(b); - var exts = []; - var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); - var ext; - while (!extbuf.atEnd()) { - ext = { critical: true }; - ext.name = extbuf.readString(); - ext.data = extbuf.readBuffer(); - exts.push(ext); - } - extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); - while (!extbuf.atEnd()) { - ext = { critical: false }; - ext.name = extbuf.readString(); - ext.data = extbuf.readBuffer(); - exts.push(ext); + /* + * Accumulate the nanosecond component. + */ + a[1] += b[1]; + if (a[1] >= 1e9) { + /* + * The nanosecond component overflowed, so carry to the seconds + * field. + */ + a[0]++; + a[1] -= 1e9; } - cert.signatures.openssh.exts = exts; - - /* reserved */ - sshbuf.readBuffer(); - - var signingKeyBuf = sshbuf.readBuffer(); - cert.issuerKey = rfc4253.read(signingKeyBuf); /* - * OpenSSH certs don't give the identity of the issuer, just their - * public key. So, we use an Identity that matches anything. The - * isSignedBy() function will later tell you if the key matches. + * Accumulate the seconds component. */ - cert.issuer = Identity.forHost('**'); - - var sigBuf = sshbuf.readBuffer(); - cert.signatures.openssh.signature = - Signature.parse(sigBuf, cert.issuerKey.type, 'ssh'); - - if (partial !== undefined) { - partial.remainder = sshbuf.remainder(); - partial.consumed = sshbuf._offset; - } + a[0] += b[0]; - return (new Certificate(cert)); + return (a); } -function int64ToDate(buf) { - var i = buf.readUInt32BE(0) * 4294967296; - i += buf.readUInt32BE(4); - var d = new Date(); - d.setTime(i * 1000); - d.sourceInt64 = buf; - return (d); -} +/* + * Add two hrtime readings A and B, returning the result as a new hrtime array. + * Does not modify either input argument. + */ +function hrtimeAdd(a, b) +{ + assertHrtime(a); -function dateToInt64(date) { - if (date.sourceInt64 !== undefined) - return (date.sourceInt64); - var i = Math.round(date.getTime() / 1000); - var upper = Math.floor(i / 4294967296); - var lower = Math.floor(i % 4294967296); - var buf = Buffer.alloc(8); - buf.writeUInt32BE(upper, 0); - buf.writeUInt32BE(lower, 4); - return (buf); -} + var rv = [ a[0], a[1] ]; -function sign(cert, key) { - if (cert.signatures.openssh === undefined) - cert.signatures.openssh = {}; - try { - var blob = toBuffer(cert, true); - } catch (e) { - delete (cert.signatures.openssh); - return (false); - } - var sig = cert.signatures.openssh; - var hashAlgo = undefined; - if (key.type === 'rsa' || key.type === 'dsa') - hashAlgo = 'sha1'; - var signer = key.createSign(hashAlgo); - signer.write(blob); - sig.signature = signer.sign(); - return (true); + return (hrtimeAccum(rv, b)); } -function signAsync(cert, signer, done) { - if (cert.signatures.openssh === undefined) - cert.signatures.openssh = {}; - try { - var blob = toBuffer(cert, true); - } catch (e) { - delete (cert.signatures.openssh); - done(e); - return; - } - var sig = cert.signatures.openssh; - - signer(blob, function (err, signature) { - if (err) { - done(err); - return; - } - try { - /* - * This will throw if the signature isn't of a - * type/algo that can be used for SSH. - */ - signature.toBuffer('ssh'); - } catch (e) { - done(e); - return; - } - sig.signature = signature; - done(); - }); -} -function write(cert, options) { - if (options === undefined) - options = {}; +/* + * Check an object for unexpected properties. Accepts the object to check, and + * an array of allowed property names (strings). Returns an array of key names + * that were found on the object, but did not appear in the list of allowed + * properties. If no properties were found, the returned array will be of + * zero length. + */ +function extraProperties(obj, allowed) +{ + mod_assert.ok(typeof (obj) === 'object' && obj !== null, + 'obj argument must be a non-null object'); + mod_assert.ok(Array.isArray(allowed), + 'allowed argument must be an array of strings'); + for (var i = 0; i < allowed.length; i++) { + mod_assert.ok(typeof (allowed[i]) === 'string', + 'allowed argument must be an array of strings'); + } - var blob = toBuffer(cert); - var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64'); - if (options.comment) - out = out + ' ' + options.comment; - return (out); + return (Object.keys(obj).filter(function (key) { + return (allowed.indexOf(key) === -1); + })); } +/* + * Given three sets of properties "provided" (may be undefined), "overrides" + * (required), and "defaults" (may be undefined), construct an object containing + * the union of these sets with "overrides" overriding "provided", and + * "provided" overriding "defaults". None of the input objects are modified. + */ +function mergeObjects(provided, overrides, defaults) +{ + var rv, k; -function toBuffer(cert, noSig) { - assert.object(cert.signatures.openssh, 'signature for openssh format'); - var sig = cert.signatures.openssh; - - if (sig.nonce === undefined) - sig.nonce = crypto.randomBytes(16); - var buf = new SSHBuffer({}); - buf.writeString(getCertType(cert.subjectKey)); - buf.writeBuffer(sig.nonce); - - var key = cert.subjectKey; - var algInfo = algs.info[key.type]; - algInfo.parts.forEach(function (part) { - buf.writePart(key.part[part]); - }); - - buf.writeInt64(cert.serial); + rv = {}; + if (defaults) { + for (k in defaults) + rv[k] = defaults[k]; + } - var type = cert.subjects[0].type; - assert.notStrictEqual(type, 'unknown'); - cert.subjects.forEach(function (id) { - assert.strictEqual(id.type, type); - }); - type = TYPES[type]; - buf.writeInt(type); + if (provided) { + for (k in provided) + rv[k] = provided[k]; + } - if (sig.keyId === undefined) { - sig.keyId = cert.subjects[0].type + '_' + - (cert.subjects[0].uid || cert.subjects[0].hostname); + if (overrides) { + for (k in overrides) + rv[k] = overrides[k]; } - buf.writeString(sig.keyId); - var sub = new SSHBuffer({}); - cert.subjects.forEach(function (id) { - if (type === TYPES.host) - sub.writeString(id.hostname); - else if (type === TYPES.user) - sub.writeString(id.uid); - }); - buf.writeBuffer(sub.toBuffer()); + return (rv); +} - buf.writeInt64(dateToInt64(cert.validFrom)); - buf.writeInt64(dateToInt64(cert.validUntil)); - var exts = sig.exts; - if (exts === undefined) - exts = []; +/***/ }), - var extbuf = new SSHBuffer({}); - exts.forEach(function (ext) { - if (ext.critical !== true) - return; - extbuf.writeString(ext.name); - extbuf.writeBuffer(ext.data); - }); - buf.writeBuffer(extbuf.toBuffer()); +/***/ 349: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - extbuf = new SSHBuffer({}); - exts.forEach(function (ext) { - if (ext.critical === true) - return; - extbuf.writeString(ext.name); - extbuf.writeBuffer(ext.data); - }); - buf.writeBuffer(extbuf.toBuffer()); +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ - /* reserved */ - buf.writeBuffer(Buffer.alloc(0)); +var Store = __webpack_require__(627).Store; +var permuteDomain = __webpack_require__(383).permuteDomain; +var pathMatch = __webpack_require__(54).pathMatch; +var util = __webpack_require__(669); - sub = rfc4253.write(cert.issuerKey); - buf.writeBuffer(sub); +function MemoryCookieStore() { + Store.call(this); + this.idx = {}; +} +util.inherits(MemoryCookieStore, Store); +exports.MemoryCookieStore = MemoryCookieStore; +MemoryCookieStore.prototype.idx = null; - if (!noSig) - buf.writeBuffer(sig.signature.toBuffer('ssh')); +// Since it's just a struct in RAM, this Store is synchronous +MemoryCookieStore.prototype.synchronous = true; - return (buf.toBuffer()); -} +// force a default depth: +MemoryCookieStore.prototype.inspect = function() { + return "{ idx: "+util.inspect(this.idx, false, 2)+' }'; +}; -function getAlg(certType) { - if (certType === 'ssh-rsa-cert-v01@openssh.com') - return ('rsa'); - if (certType === 'ssh-dss-cert-v01@openssh.com') - return ('dsa'); - if (certType.match(ECDSA_ALGO)) - return ('ecdsa'); - if (certType === 'ssh-ed25519-cert-v01@openssh.com') - return ('ed25519'); - throw (new Error('Unsupported cert type ' + certType)); +// Use the new custom inspection symbol to add the custom inspect function if +// available. +if (util.inspect.custom) { + MemoryCookieStore.prototype[util.inspect.custom] = MemoryCookieStore.prototype.inspect; } -function getCertType(key) { - if (key.type === 'rsa') - return ('ssh-rsa-cert-v01@openssh.com'); - if (key.type === 'dsa') - return ('ssh-dss-cert-v01@openssh.com'); - if (key.type === 'ecdsa') - return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com'); - if (key.type === 'ed25519') - return ('ssh-ed25519-cert-v01@openssh.com'); - throw (new Error('Unsupported key type ' + key.type)); -} +MemoryCookieStore.prototype.findCookie = function(domain, path, key, cb) { + if (!this.idx[domain]) { + return cb(null,undefined); + } + if (!this.idx[domain][path]) { + return cb(null,undefined); + } + return cb(null,this.idx[domain][path][key]||null); +}; + +MemoryCookieStore.prototype.findCookies = function(domain, path, cb) { + var results = []; + if (!domain) { + return cb(null,[]); + } + + var pathMatcher; + if (!path) { + // null means "all paths" + pathMatcher = function matchAll(domainIndex) { + for (var curPath in domainIndex) { + var pathIndex = domainIndex[curPath]; + for (var key in pathIndex) { + results.push(pathIndex[key]); + } + } + }; + } else { + pathMatcher = function matchRFC(domainIndex) { + //NOTE: we should use path-match algorithm from S5.1.4 here + //(see : https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/canonical_cookie.cc#L299) + Object.keys(domainIndex).forEach(function (cookiePath) { + if (pathMatch(path, cookiePath)) { + var pathIndex = domainIndex[cookiePath]; -/***/ }), + for (var key in pathIndex) { + results.push(pathIndex[key]); + } + } + }); + }; + } -/***/ 396: -/***/ (function(module, __unusedexports, __webpack_require__) { + var domains = permuteDomain(domain) || [domain]; + var idx = this.idx; + domains.forEach(function(curDomain) { + var domainIndex = idx[curDomain]; + if (!domainIndex) { + return; + } + pathMatcher(domainIndex); + }); -// Basic Javascript Elliptic Curve implementation -// Ported loosely from BouncyCastle's Java EC code -// Only Fp curves implemented for now + cb(null,results); +}; -// Requires jsbn.js and jsbn2.js -var BigInteger = __webpack_require__(36).BigInteger -var Barrett = BigInteger.prototype.Barrett +MemoryCookieStore.prototype.putCookie = function(cookie, cb) { + if (!this.idx[cookie.domain]) { + this.idx[cookie.domain] = {}; + } + if (!this.idx[cookie.domain][cookie.path]) { + this.idx[cookie.domain][cookie.path] = {}; + } + this.idx[cookie.domain][cookie.path][cookie.key] = cookie; + cb(null); +}; -// ---------------- -// ECFieldElementFp +MemoryCookieStore.prototype.updateCookie = function(oldCookie, newCookie, cb) { + // updateCookie() may avoid updating cookies that are identical. For example, + // lastAccessed may not be important to some stores and an equality + // comparison could exclude that field. + this.putCookie(newCookie,cb); +}; -// constructor -function ECFieldElementFp(q,x) { - this.x = x; - // TODO if(x.compareTo(q) >= 0) error - this.q = q; -} +MemoryCookieStore.prototype.removeCookie = function(domain, path, key, cb) { + if (this.idx[domain] && this.idx[domain][path] && this.idx[domain][path][key]) { + delete this.idx[domain][path][key]; + } + cb(null); +}; -function feFpEquals(other) { - if(other == this) return true; - return (this.q.equals(other.q) && this.x.equals(other.x)); -} +MemoryCookieStore.prototype.removeCookies = function(domain, path, cb) { + if (this.idx[domain]) { + if (path) { + delete this.idx[domain][path]; + } else { + delete this.idx[domain]; + } + } + return cb(null); +}; -function feFpToBigInteger() { - return this.x; -} +MemoryCookieStore.prototype.getAllCookies = function(cb) { + var cookies = []; + var idx = this.idx; -function feFpNegate() { - return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); -} + var domains = Object.keys(idx); + domains.forEach(function(domain) { + var paths = Object.keys(idx[domain]); + paths.forEach(function(path) { + var keys = Object.keys(idx[domain][path]); + keys.forEach(function(key) { + if (key !== null) { + cookies.push(idx[domain][path][key]); + } + }); + }); + }); -function feFpAdd(b) { - return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); -} + // Sort by creationIndex so deserializing retains the creation order. + // When implementing your own store, this SHOULD retain the order too + cookies.sort(function(a,b) { + return (a.creationIndex||0) - (b.creationIndex||0); + }); -function feFpSubtract(b) { - return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); -} + cb(null, cookies); +}; -function feFpMultiply(b) { - return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); -} -function feFpSquare() { - return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); -} +/***/ }), -function feFpDivide(b) { - return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); -} +/***/ 357: +/***/ (function(module) { -ECFieldElementFp.prototype.equals = feFpEquals; -ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; -ECFieldElementFp.prototype.negate = feFpNegate; -ECFieldElementFp.prototype.add = feFpAdd; -ECFieldElementFp.prototype.subtract = feFpSubtract; -ECFieldElementFp.prototype.multiply = feFpMultiply; -ECFieldElementFp.prototype.square = feFpSquare; -ECFieldElementFp.prototype.divide = feFpDivide; +module.exports = require("assert"); -// ---------------- -// ECPointFp +/***/ }), -// constructor -function ECPointFp(curve,x,y,z) { - this.curve = curve; - this.x = x; - this.y = y; - // Projective coordinates: either zinv == null or z * zinv == 1 - // z and zinv are just BigIntegers, not fieldElements - if(z == null) { - this.z = BigInteger.ONE; - } - else { - this.z = z; - } - this.zinv = null; - //TODO: compression flag -} +/***/ 362: +/***/ (function(module) { -function pointFpGetX() { - if(this.zinv == null) { - this.zinv = this.z.modInverse(this.curve.q); - } - var r = this.x.toBigInteger().multiply(this.zinv); - this.curve.reduce(r); - return this.curve.fromBigInteger(r); -} +// Copyright 2011 Mark Cavage All rights reserved. -function pointFpGetY() { - if(this.zinv == null) { - this.zinv = this.z.modInverse(this.curve.q); - } - var r = this.y.toBigInteger().multiply(this.zinv); - this.curve.reduce(r); - return this.curve.fromBigInteger(r); -} -function pointFpEquals(other) { - if(other == this) return true; - if(this.isInfinity()) return other.isInfinity(); - if(other.isInfinity()) return this.isInfinity(); - var u, v; - // u = Y2 * Z1 - Y1 * Z2 - u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); - if(!u.equals(BigInteger.ZERO)) return false; - // v = X2 * Z1 - X1 * Z2 - v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); - return v.equals(BigInteger.ZERO); -} +module.exports = { + EOC: 0, + Boolean: 1, + Integer: 2, + BitString: 3, + OctetString: 4, + Null: 5, + OID: 6, + ObjectDescriptor: 7, + External: 8, + Real: 9, // float + Enumeration: 10, + PDV: 11, + Utf8String: 12, + RelativeOID: 13, + Sequence: 16, + Set: 17, + NumericString: 18, + PrintableString: 19, + T61String: 20, + VideotexString: 21, + IA5String: 22, + UTCTime: 23, + GeneralizedTime: 24, + GraphicString: 25, + VisibleString: 26, + GeneralString: 28, + UniversalString: 29, + CharacterString: 30, + BMPString: 31, + Constructor: 32, + Context: 128 +}; -function pointFpIsInfinity() { - if((this.x == null) && (this.y == null)) return true; - return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); -} -function pointFpNegate() { - return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); -} +/***/ }), -function pointFpAdd(b) { - if(this.isInfinity()) return b; - if(b.isInfinity()) return this; +/***/ 363: +/***/ (function(module, __unusedexports, __webpack_require__) { - // u = Y2 * Z1 - Y1 * Z2 - var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); - // v = X2 * Z1 - X1 * Z2 - var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); +// Copyright 2015 Joyent, Inc. - if(BigInteger.ZERO.equals(v)) { - if(BigInteger.ZERO.equals(u)) { - return this.twice(); // this == b, so double - } - return this.curve.getInfinity(); // this = -b, so infinity - } +module.exports = { + Verifier: Verifier, + Signer: Signer +}; - var THREE = new BigInteger("3"); - var x1 = this.x.toBigInteger(); - var y1 = this.y.toBigInteger(); - var x2 = b.x.toBigInteger(); - var y2 = b.y.toBigInteger(); +var nacl = __webpack_require__(196); +var stream = __webpack_require__(413); +var util = __webpack_require__(669); +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var Signature = __webpack_require__(575); - var v2 = v.square(); - var v3 = v2.multiply(v); - var x1v2 = x1.multiply(v2); - var zu2 = u.square().multiply(this.z); +function Verifier(key, hashAlgo) { + if (hashAlgo.toLowerCase() !== 'sha512') + throw (new Error('ED25519 only supports the use of ' + + 'SHA-512 hashes')); - // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) - var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); - // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 - var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); - // z3 = v^3 * z1 * z2 - var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); + this.key = key; + this.chunks = []; - return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); + stream.Writable.call(this, {}); } +util.inherits(Verifier, stream.Writable); -function pointFpTwice() { - if(this.isInfinity()) return this; - if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); - - // TODO: optimized handling of constants - var THREE = new BigInteger("3"); - var x1 = this.x.toBigInteger(); - var y1 = this.y.toBigInteger(); +Verifier.prototype._write = function (chunk, enc, cb) { + this.chunks.push(chunk); + cb(); +}; - var y1z1 = y1.multiply(this.z); - var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); - var a = this.curve.a.toBigInteger(); +Verifier.prototype.update = function (chunk) { + if (typeof (chunk) === 'string') + chunk = Buffer.from(chunk, 'binary'); + this.chunks.push(chunk); +}; - // w = 3 * x1^2 + a * z1^2 - var w = x1.square().multiply(THREE); - if(!BigInteger.ZERO.equals(a)) { - w = w.add(this.z.square().multiply(a)); - } - w = w.mod(this.curve.q); - //this.curve.reduce(w); - // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) - var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); - // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 - var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); - // z3 = 8 * (y1 * z1)^3 - var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); +Verifier.prototype.verify = function (signature, fmt) { + var sig; + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== 'ed25519') + return (false); + sig = signature.toBuffer('raw'); - return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); -} + } else if (typeof (signature) === 'string') { + sig = Buffer.from(signature, 'base64'); -// Simple NAF (Non-Adjacent Form) multiplication algorithm -// TODO: modularize the multiplication algorithm -function pointFpMultiply(k) { - if(this.isInfinity()) return this; - if(k.signum() == 0) return this.curve.getInfinity(); + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); + } - var e = k; - var h = e.multiply(new BigInteger("3")); + assert.buffer(sig); + return (nacl.sign.detached.verify( + new Uint8Array(Buffer.concat(this.chunks)), + new Uint8Array(sig), + new Uint8Array(this.key.part.A.data))); +}; - var neg = this.negate(); - var R = this; +function Signer(key, hashAlgo) { + if (hashAlgo.toLowerCase() !== 'sha512') + throw (new Error('ED25519 only supports the use of ' + + 'SHA-512 hashes')); - var i; - for(i = h.bitLength() - 2; i > 0; --i) { - R = R.twice(); + this.key = key; + this.chunks = []; - var hBit = h.testBit(i); - var eBit = e.testBit(i); + stream.Writable.call(this, {}); +} +util.inherits(Signer, stream.Writable); - if (hBit != eBit) { - R = R.add(hBit ? this : neg); - } - } +Signer.prototype._write = function (chunk, enc, cb) { + this.chunks.push(chunk); + cb(); +}; - return R; -} +Signer.prototype.update = function (chunk) { + if (typeof (chunk) === 'string') + chunk = Buffer.from(chunk, 'binary'); + this.chunks.push(chunk); +}; -// Compute this*j + x*k (simultaneous multiplication) -function pointFpMultiplyTwo(j,x,k) { - var i; - if(j.bitLength() > k.bitLength()) - i = j.bitLength() - 1; - else - i = k.bitLength() - 1; +Signer.prototype.sign = function () { + var sig = nacl.sign.detached( + new Uint8Array(Buffer.concat(this.chunks)), + new Uint8Array(Buffer.concat([ + this.key.part.k.data, this.key.part.A.data]))); + var sigBuf = Buffer.from(sig); + var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); + sigObj.hashAlgorithm = 'sha512'; + return (sigObj); +}; - var R = this.curve.getInfinity(); - var both = this.add(x); - while(i >= 0) { - R = R.twice(); - if(j.testBit(i)) { - if(k.testBit(i)) { - R = R.add(both); - } - else { - R = R.add(this); - } - } - else { - if(k.testBit(i)) { - R = R.add(x); - } - } - --i; - } - return R; -} +/***/ }), -ECPointFp.prototype.getX = pointFpGetX; -ECPointFp.prototype.getY = pointFpGetY; -ECPointFp.prototype.equals = pointFpEquals; -ECPointFp.prototype.isInfinity = pointFpIsInfinity; -ECPointFp.prototype.negate = pointFpNegate; -ECPointFp.prototype.add = pointFpAdd; -ECPointFp.prototype.twice = pointFpTwice; -ECPointFp.prototype.multiply = pointFpMultiply; -ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; +/***/ 374: +/***/ (function(module) { -// ---------------- -// ECCurveFp +"use strict"; -// constructor -function ECCurveFp(q,a,b) { - this.q = q; - this.a = this.fromBigInteger(a); - this.b = this.fromBigInteger(b); - this.infinity = new ECPointFp(this, null, null); - this.reducer = new Barrett(this.q); -} -function curveFpGetQ() { - return this.q; -} +var hasOwn = Object.prototype.hasOwnProperty; +var toStr = Object.prototype.toString; +var defineProperty = Object.defineProperty; +var gOPD = Object.getOwnPropertyDescriptor; -function curveFpGetA() { - return this.a; -} +var isArray = function isArray(arr) { + if (typeof Array.isArray === 'function') { + return Array.isArray(arr); + } -function curveFpGetB() { - return this.b; -} + return toStr.call(arr) === '[object Array]'; +}; -function curveFpEquals(other) { - if(other == this) return true; - return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); -} +var isPlainObject = function isPlainObject(obj) { + if (!obj || toStr.call(obj) !== '[object Object]') { + return false; + } -function curveFpGetInfinity() { - return this.infinity; -} + var hasOwnConstructor = hasOwn.call(obj, 'constructor'); + var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); + // Not own constructor property must be Object + if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { + return false; + } -function curveFpFromBigInteger(x) { - return new ECFieldElementFp(this.q, x); -} + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + var key; + for (key in obj) { /**/ } -function curveReduce(x) { - this.reducer.reduce(x); -} + return typeof key === 'undefined' || hasOwn.call(obj, key); +}; -// for now, work with hex strings because they're easier in JS -function curveFpDecodePointHex(s) { - switch(parseInt(s.substr(0,2), 16)) { // first byte - case 0: - return this.infinity; - case 2: - case 3: - // point compression not supported yet - return null; - case 4: - case 6: - case 7: - var len = (s.length - 2) / 2; - var xHex = s.substr(2, len); - var yHex = s.substr(len+2, len); +// If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target +var setProperty = function setProperty(target, options) { + if (defineProperty && options.name === '__proto__') { + defineProperty(target, options.name, { + enumerable: true, + configurable: true, + value: options.newValue, + writable: true + }); + } else { + target[options.name] = options.newValue; + } +}; - return new ECPointFp(this, - this.fromBigInteger(new BigInteger(xHex, 16)), - this.fromBigInteger(new BigInteger(yHex, 16))); +// Return undefined instead of __proto__ if '__proto__' is not an own property +var getProperty = function getProperty(obj, name) { + if (name === '__proto__') { + if (!hasOwn.call(obj, name)) { + return void 0; + } else if (gOPD) { + // In early versions of node, obj['__proto__'] is buggy when obj has + // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. + return gOPD(obj, name).value; + } + } - default: // unsupported - return null; - } -} + return obj[name]; +}; -function curveFpEncodePointHex(p) { - if (p.isInfinity()) return "00"; - var xHex = p.getX().toBigInteger().toString(16); - var yHex = p.getY().toBigInteger().toString(16); - var oLen = this.getQ().toString(16).length; - if ((oLen % 2) != 0) oLen++; - while (xHex.length < oLen) { - xHex = "0" + xHex; +module.exports = function extend() { + var options, name, src, copy, copyIsArray, clone; + var target = arguments[0]; + var i = 1; + var length = arguments.length; + var deep = false; + + // Handle a deep copy situation + if (typeof target === 'boolean') { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; } - while (yHex.length < oLen) { - yHex = "0" + yHex; + if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { + target = {}; } - return "04" + xHex + yHex; -} -ECCurveFp.prototype.getQ = curveFpGetQ; -ECCurveFp.prototype.getA = curveFpGetA; -ECCurveFp.prototype.getB = curveFpGetB; -ECCurveFp.prototype.equals = curveFpEquals; -ECCurveFp.prototype.getInfinity = curveFpGetInfinity; -ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; -ECCurveFp.prototype.reduce = curveReduce; -//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; -ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; + for (; i < length; ++i) { + options = arguments[i]; + // Only deal with non-null/undefined values + if (options != null) { + // Extend the base object + for (name in options) { + src = getProperty(target, name); + copy = getProperty(options, name); -// from: https://github.com/kaielvin/jsbn-ec-point-compression -ECCurveFp.prototype.decodePointHex = function(s) -{ - var yIsEven; - switch(parseInt(s.substr(0,2), 16)) { // first byte - case 0: - return this.infinity; - case 2: - yIsEven = false; - case 3: - if(yIsEven == undefined) yIsEven = true; - var len = s.length - 2; - var xHex = s.substr(2, len); - var x = this.fromBigInteger(new BigInteger(xHex,16)); - var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); - var beta = alpha.sqrt(); + // Prevent never-ending loop + if (target !== copy) { + // Recurse if we're merging plain objects or arrays + if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { + if (copyIsArray) { + copyIsArray = false; + clone = src && isArray(src) ? src : []; + } else { + clone = src && isPlainObject(src) ? src : {}; + } - if (beta == null) throw "Invalid point compression"; + // Never move original objects, clone them + setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); - var betaValue = beta.toBigInteger(); - if (betaValue.testBit(0) != yIsEven) - { - // Use the other root - beta = this.fromBigInteger(this.getQ().subtract(betaValue)); - } - return new ECPointFp(this,x,beta); - case 4: - case 6: - case 7: - var len = (s.length - 2) / 2; - var xHex = s.substr(2, len); - var yHex = s.substr(len+2, len); + // Don't bring in undefined values + } else if (typeof copy !== 'undefined') { + setProperty(target, { name: name, newValue: copy }); + } + } + } + } + } - return new ECPointFp(this, - this.fromBigInteger(new BigInteger(xHex, 16)), - this.fromBigInteger(new BigInteger(yHex, 16))); + // Return the modified object + return target; +}; - default: // unsupported - return null; - } -} -ECCurveFp.prototype.encodeCompressedPointHex = function(p) -{ - if (p.isInfinity()) return "00"; - var xHex = p.getX().toBigInteger().toString(16); - var oLen = this.getQ().toString(16).length; - if ((oLen % 2) != 0) oLen++; - while (xHex.length < oLen) - xHex = "0" + xHex; - var yPrefix; - if(p.getY().toBigInteger().isEven()) yPrefix = "02"; - else yPrefix = "03"; - return yPrefix + xHex; -} +/***/ }), +/***/ 378: +/***/ (function(module, __unusedexports, __webpack_require__) { -ECFieldElementFp.prototype.getR = function() -{ - if(this.r != undefined) return this.r; +// Copyright 2017 Joyent, Inc. - this.r = null; - var bitLength = this.q.bitLength(); - if (bitLength > 128) - { - var firstWord = this.q.shiftRight(bitLength - 64); - if (firstWord.intValue() == -1) - { - this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); - } - } - return this.r; -} -ECFieldElementFp.prototype.modMult = function(x1,x2) -{ - return this.modReduce(x1.multiply(x2)); -} -ECFieldElementFp.prototype.modReduce = function(x) -{ - if (this.getR() != null) - { - var qLen = q.bitLength(); - while (x.bitLength() > (qLen + 1)) - { - var u = x.shiftRight(qLen); - var v = x.subtract(u.shiftLeft(qLen)); - if (!this.getR().equals(BigInteger.ONE)) - { - u = u.multiply(this.getR()); - } - x = u.add(v); - } - while (x.compareTo(q) >= 0) - { - x = x.subtract(q); - } - } - else - { - x = x.mod(q); - } - return x; -} -ECFieldElementFp.prototype.sqrt = function() -{ - if (!this.q.testBit(0)) throw "unsupported"; +module.exports = Identity; - // p mod 4 == 3 - if (this.q.testBit(1)) - { - var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); - return z.square().equals(this) ? z : null; - } +var assert = __webpack_require__(477); +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var errs = __webpack_require__(753); +var util = __webpack_require__(669); +var utils = __webpack_require__(270); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; - // p mod 4 == 1 - var qMinusOne = this.q.subtract(BigInteger.ONE); +/*JSSTYLED*/ +var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; - var legendreExponent = qMinusOne.shiftRight(1); - if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) - { - return null; - } +var oids = {}; +oids.cn = '2.5.4.3'; +oids.o = '2.5.4.10'; +oids.ou = '2.5.4.11'; +oids.l = '2.5.4.7'; +oids.s = '2.5.4.8'; +oids.c = '2.5.4.6'; +oids.sn = '2.5.4.4'; +oids.postalCode = '2.5.4.17'; +oids.serialNumber = '2.5.4.5'; +oids.street = '2.5.4.9'; +oids.x500UniqueIdentifier = '2.5.4.45'; +oids.role = '2.5.4.72'; +oids.telephoneNumber = '2.5.4.20'; +oids.description = '2.5.4.13'; +oids.dc = '0.9.2342.19200300.100.1.25'; +oids.uid = '0.9.2342.19200300.100.1.1'; +oids.mail = '0.9.2342.19200300.100.1.3'; +oids.title = '2.5.4.12'; +oids.gn = '2.5.4.42'; +oids.initials = '2.5.4.43'; +oids.pseudonym = '2.5.4.65'; +oids.emailAddress = '1.2.840.113549.1.9.1'; - var u = qMinusOne.shiftRight(2); - var k = u.shiftLeft(1).add(BigInteger.ONE); +var unoids = {}; +Object.keys(oids).forEach(function (k) { + unoids[oids[k]] = k; +}); - var Q = this.x; - var fourQ = modDouble(modDouble(Q)); +function Identity(opts) { + var self = this; + assert.object(opts, 'options'); + assert.arrayOfObject(opts.components, 'options.components'); + this.components = opts.components; + this.componentLookup = {}; + this.components.forEach(function (c) { + if (c.name && !c.oid) + c.oid = oids[c.name]; + if (c.oid && !c.name) + c.name = unoids[c.oid]; + if (self.componentLookup[c.name] === undefined) + self.componentLookup[c.name] = []; + self.componentLookup[c.name].push(c); + }); + if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { + this.cn = this.componentLookup.cn[0].value; + } + assert.optionalString(opts.type, 'options.type'); + if (opts.type === undefined) { + if (this.components.length === 1 && + this.componentLookup.cn && + this.componentLookup.cn.length === 1 && + this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { + this.type = 'host'; + this.hostname = this.componentLookup.cn[0].value; - var U, V; - do - { - var P; - do - { - P = new BigInteger(this.q.bitLength(), new SecureRandom()); - } - while (P.compareTo(this.q) >= 0 - || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); + } else if (this.componentLookup.dc && + this.components.length === this.componentLookup.dc.length) { + this.type = 'host'; + this.hostname = this.componentLookup.dc.map( + function (c) { + return (c.value); + }).join('.'); - var result = this.lucasSequence(P, Q, k); - U = result[0]; - V = result[1]; + } else if (this.componentLookup.uid && + this.components.length === + this.componentLookup.uid.length) { + this.type = 'user'; + this.uid = this.componentLookup.uid[0].value; - if (this.modMult(V, V).equals(fourQ)) - { - // Integer division by 2, mod q - if (V.testBit(0)) - { - V = V.add(q); - } + } else if (this.componentLookup.cn && + this.componentLookup.cn.length === 1 && + this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { + this.type = 'host'; + this.hostname = this.componentLookup.cn[0].value; - V = V.shiftRight(1); + } else if (this.componentLookup.uid && + this.componentLookup.uid.length === 1) { + this.type = 'user'; + this.uid = this.componentLookup.uid[0].value; - return new ECFieldElementFp(q,V); - } - } - while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); + } else if (this.componentLookup.mail && + this.componentLookup.mail.length === 1) { + this.type = 'email'; + this.email = this.componentLookup.mail[0].value; - return null; + } else if (this.componentLookup.cn && + this.componentLookup.cn.length === 1) { + this.type = 'user'; + this.uid = this.componentLookup.cn[0].value; + + } else { + this.type = 'unknown'; + } + } else { + this.type = opts.type; + if (this.type === 'host') + this.hostname = opts.hostname; + else if (this.type === 'user') + this.uid = opts.uid; + else if (this.type === 'email') + this.email = opts.email; + else + throw (new Error('Unknown type ' + this.type)); + } } -ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) -{ - var n = k.bitLength(); - var s = k.getLowestSetBit(); - var Uh = BigInteger.ONE; - var Vl = BigInteger.TWO; - var Vh = P; - var Ql = BigInteger.ONE; - var Qh = BigInteger.ONE; +Identity.prototype.toString = function () { + return (this.components.map(function (c) { + var n = c.name.toUpperCase(); + /*JSSTYLED*/ + n = n.replace(/=/g, '\\='); + var v = c.value; + /*JSSTYLED*/ + v = v.replace(/,/g, '\\,'); + return (n + '=' + v); + }).join(', ')); +}; - for (var j = n - 1; j >= s + 1; --j) - { - Ql = this.modMult(Ql, Qh); +Identity.prototype.get = function (name, asArray) { + assert.string(name, 'name'); + var arr = this.componentLookup[name]; + if (arr === undefined || arr.length === 0) + return (undefined); + if (!asArray && arr.length > 1) + throw (new Error('Multiple values for attribute ' + name)); + if (!asArray) + return (arr[0].value); + return (arr.map(function (c) { + return (c.value); + })); +}; - if (k.testBit(j)) - { - Qh = this.modMult(Ql, Q); - Uh = this.modMult(Uh, Vh); - Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); - } - else - { - Qh = Ql; - Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); - Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); - } - } +Identity.prototype.toArray = function (idx) { + return (this.components.map(function (c) { + return ({ + name: c.name, + value: c.value + }); + })); +}; - Ql = this.modMult(Ql, Qh); - Qh = this.modMult(Ql, Q); - Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); - Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Ql = this.modMult(Ql, Qh); +/* + * These are from X.680 -- PrintableString allowed chars are in section 37.4 + * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to + * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 + * (the basic ASCII character set). + */ +/* JSSTYLED */ +var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; +/* JSSTYLED */ +var NOT_IA5 = /[^\x00-\x7f]/; - for (var j = 1; j <= s; ++j) - { - Uh = this.modMult(Uh, Vl); - Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); - Ql = this.modMult(Ql, Ql); - } +Identity.prototype.toAsn1 = function (der, tag) { + der.startSequence(tag); + this.components.forEach(function (c) { + der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); + der.startSequence(); + der.writeOID(c.oid); + /* + * If we fit in a PrintableString, use that. Otherwise use an + * IA5String or UTF8String. + * + * If this identity was parsed from a DN, use the ASN.1 types + * from the original representation (otherwise this might not + * be a full match for the original in some validators). + */ + if (c.asn1type === asn1.Ber.Utf8String || + c.value.match(NOT_IA5)) { + var v = Buffer.from(c.value, 'utf8'); + der.writeBuffer(v, asn1.Ber.Utf8String); - return [ Uh, Vl ]; -} + } else if (c.asn1type === asn1.Ber.IA5String || + c.value.match(NOT_PRINTABLE)) { + der.writeString(c.value, asn1.Ber.IA5String); -var exports = { - ECCurveFp: ECCurveFp, - ECPointFp: ECPointFp, - ECFieldElementFp: ECFieldElementFp + } else { + var type = asn1.Ber.PrintableString; + if (c.asn1type !== undefined) + type = c.asn1type; + der.writeString(c.value, type); + } + der.endSequence(); + der.endSequence(); + }); + der.endSequence(); +}; + +function globMatch(a, b) { + if (a === '**' || b === '**') + return (true); + var aParts = a.split('.'); + var bParts = b.split('.'); + if (aParts.length !== bParts.length) + return (false); + for (var i = 0; i < aParts.length; ++i) { + if (aParts[i] === '*' || bParts[i] === '*') + continue; + if (aParts[i] !== bParts[i]) + return (false); + } + return (true); } -module.exports = exports +Identity.prototype.equals = function (other) { + if (!Identity.isIdentity(other, [1, 0])) + return (false); + if (other.components.length !== this.components.length) + return (false); + for (var i = 0; i < this.components.length; ++i) { + if (this.components[i].oid !== other.components[i].oid) + return (false); + if (!globMatch(this.components[i].value, + other.components[i].value)) { + return (false); + } + } + return (true); +}; + +Identity.forHost = function (hostname) { + assert.string(hostname, 'hostname'); + return (new Identity({ + type: 'host', + hostname: hostname, + components: [ { name: 'cn', value: hostname } ] + })); +}; + +Identity.forUser = function (uid) { + assert.string(uid, 'uid'); + return (new Identity({ + type: 'user', + uid: uid, + components: [ { name: 'uid', value: uid } ] + })); +}; + +Identity.forEmail = function (email) { + assert.string(email, 'email'); + return (new Identity({ + type: 'email', + email: email, + components: [ { name: 'mail', value: email } ] + })); +}; +Identity.parseDN = function (dn) { + assert.string(dn, 'dn'); + var parts = ['']; + var idx = 0; + var rem = dn; + while (rem.length > 0) { + var m; + /*JSSTYLED*/ + if ((m = /^,/.exec(rem)) !== null) { + parts[++idx] = ''; + rem = rem.slice(m[0].length); + /*JSSTYLED*/ + } else if ((m = /^\\,/.exec(rem)) !== null) { + parts[idx] += ','; + rem = rem.slice(m[0].length); + /*JSSTYLED*/ + } else if ((m = /^\\./.exec(rem)) !== null) { + parts[idx] += m[0]; + rem = rem.slice(m[0].length); + /*JSSTYLED*/ + } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { + parts[idx] += m[0]; + rem = rem.slice(m[0].length); + } else { + throw (new Error('Failed to parse DN')); + } + } + var cmps = parts.map(function (c) { + c = c.trim(); + var eqPos = c.indexOf('='); + while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') + eqPos = c.indexOf('=', eqPos + 1); + if (eqPos === -1) { + throw (new Error('Failed to parse DN')); + } + /*JSSTYLED*/ + var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); + var value = c.slice(eqPos + 1); + return ({ name: name, value: value }); + }); + return (new Identity({ components: cmps })); +}; -/***/ }), +Identity.fromArray = function (components) { + assert.arrayOfObject(components, 'components'); + components.forEach(function (cmp) { + assert.object(cmp, 'component'); + assert.string(cmp.name, 'component.name'); + if (!Buffer.isBuffer(cmp.value) && + !(typeof (cmp.value) === 'string')) { + throw (new Error('Invalid component value')); + } + }); + return (new Identity({ components: components })); +}; -/***/ 402: -/***/ (function(module, __unusedexports, __webpack_require__) { +Identity.parseAsn1 = function (der, top) { + var components = []; + der.readSequence(top); + var end = der.offset + der.length; + while (der.offset < end) { + der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); + var after = der.offset + der.length; + der.readSequence(); + var oid = der.readOID(); + var type = der.peek(); + var value; + switch (type) { + case asn1.Ber.PrintableString: + case asn1.Ber.IA5String: + case asn1.Ber.OctetString: + case asn1.Ber.T61String: + value = der.readString(type); + break; + case asn1.Ber.Utf8String: + value = der.readString(type, true); + value = value.toString('utf8'); + break; + case asn1.Ber.CharacterString: + case asn1.Ber.BMPString: + value = der.readString(type, true); + value = value.toString('utf16le'); + break; + default: + throw (new Error('Unknown asn1 type ' + type)); + } + components.push({ oid: oid, asn1type: type, value: value }); + der._offset = after; + } + der._offset = end; + return (new Identity({ + components: components + })); +}; -// Copyright 2011 Mark Cavage All rights reserved. +Identity.isIdentity = function (obj, ver) { + return (utils.isCompatible(obj, Identity, ver)); +}; -var assert = __webpack_require__(357); -var Buffer = __webpack_require__(601).Buffer; -var ASN1 = __webpack_require__(850); -var errors = __webpack_require__(294); +/* + * API versions for Identity: + * [1,0] -- initial ver + */ +Identity.prototype._sshpkApiVersion = [1, 0]; +Identity._oldVersionDetect = function (obj) { + return ([1, 0]); +}; -// --- Globals -var newInvalidAsn1Error = errors.newInvalidAsn1Error; +/***/ }), -var DEFAULT_OPTS = { - size: 1024, - growthFactor: 8 -}; +/***/ 380: +/***/ (function(module) { +module.exports = {"$id":"request.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["method","url","httpVersion","cookies","headers","queryString","headersSize","bodySize"],"properties":{"method":{"type":"string"},"url":{"type":"string","format":"uri"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"queryString":{"type":"array","items":{"$ref":"query.json#"}},"postData":{"$ref":"postData.json#"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; -// --- Helpers +/***/ }), -function merge(from, to) { - assert.ok(from); - assert.equal(typeof (from), 'object'); - assert.ok(to); - assert.equal(typeof (to), 'object'); +/***/ 382: +/***/ (function(module, __unusedexports, __webpack_require__) { - var keys = Object.getOwnPropertyNames(from); - keys.forEach(function (key) { - if (to[key]) - return; +var stream = __webpack_require__(413) - var value = Object.getOwnPropertyDescriptor(from, key); - Object.defineProperty(to, key, value); - }); - return to; +function isStream (obj) { + return obj instanceof stream.Stream } +function isReadable (obj) { + return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' +} -// --- API -function Writer(options) { - options = merge(DEFAULT_OPTS, options || {}); +function isWritable (obj) { + return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' +} - this._buf = Buffer.alloc(options.size || 1024); - this._size = this._buf.length; - this._offset = 0; - this._options = options; - // A list of offsets in the buffer where we need to insert - // sequence tag/len pairs. - this._seq = []; +function isDuplex (obj) { + return isReadable(obj) && isWritable(obj) } -Object.defineProperty(Writer.prototype, 'buffer', { - get: function () { - if (this._seq.length) - throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); - return (this._buf.slice(0, this._offset)); - } -}); +module.exports = isStream +module.exports.isReadable = isReadable +module.exports.isWritable = isWritable +module.exports.isDuplex = isDuplex -Writer.prototype.writeByte = function (b) { - if (typeof (b) !== 'number') - throw new TypeError('argument must be a Number'); - this._ensure(1); - this._buf[this._offset++] = b; -}; +/***/ }), +/***/ 383: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -Writer.prototype.writeInt = function (i, tag) { - if (typeof (i) !== 'number') - throw new TypeError('argument must be a Number'); - if (typeof (tag) !== 'number') - tag = ASN1.Integer; +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ - var sz = 4; +var pubsuffix = __webpack_require__(519); - while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && - (sz > 1)) { - sz--; - i <<= 8; +// Gives the permutation of all possible domainMatch()es of a given domain. The +// array is in shortest-to-longest order. Handy for indexing. +function permuteDomain (domain) { + var pubSuf = pubsuffix.getPublicSuffix(domain); + if (!pubSuf) { + return null; } - - if (sz > 4) - throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); - - this._ensure(2 + sz); - this._buf[this._offset++] = tag; - this._buf[this._offset++] = sz; - - while (sz-- > 0) { - this._buf[this._offset++] = ((i & 0xff000000) >>> 24); - i <<= 8; + if (pubSuf == domain) { + return [domain]; } -}; - - -Writer.prototype.writeNull = function () { - this.writeByte(ASN1.Null); - this.writeByte(0x00); -}; - - -Writer.prototype.writeEnumeration = function (i, tag) { - if (typeof (i) !== 'number') - throw new TypeError('argument must be a Number'); - if (typeof (tag) !== 'number') - tag = ASN1.Enumeration; - - return this.writeInt(i, tag); -}; - + var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" + var parts = prefix.split('.').reverse(); + var cur = pubSuf; + var permutations = [cur]; + while (parts.length) { + cur = parts.shift() + '.' + cur; + permutations.push(cur); + } + return permutations; +} -Writer.prototype.writeBoolean = function (b, tag) { - if (typeof (b) !== 'boolean') - throw new TypeError('argument must be a Boolean'); - if (typeof (tag) !== 'number') - tag = ASN1.Boolean; +exports.permuteDomain = permuteDomain; - this._ensure(3); - this._buf[this._offset++] = tag; - this._buf[this._offset++] = 0x01; - this._buf[this._offset++] = b ? 0xff : 0x00; -}; +/***/ }), -Writer.prototype.writeString = function (s, tag) { - if (typeof (s) !== 'string') - throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); - if (typeof (tag) !== 'number') - tag = ASN1.OctetString; +/***/ 386: +/***/ (function(module, __unusedexports, __webpack_require__) { - var len = Buffer.byteLength(s); - this.writeByte(tag); - this.writeLength(len); - if (len) { - this._ensure(len); - this._buf.write(s, this._offset); - this._offset += len; - } -}; +"use strict"; -Writer.prototype.writeBuffer = function (buf, tag) { - if (typeof (tag) !== 'number') - throw new TypeError('tag must be a number'); - if (!Buffer.isBuffer(buf)) - throw new TypeError('argument must be a buffer'); +var stringify = __webpack_require__(897); +var parse = __webpack_require__(755); +var formats = __webpack_require__(13); - this.writeByte(tag); - this.writeLength(buf.length); - this._ensure(buf.length); - buf.copy(this._buf, this._offset, 0, buf.length); - this._offset += buf.length; +module.exports = { + formats: formats, + parse: parse, + stringify: stringify }; -Writer.prototype.writeStringArray = function (strings) { - if ((!strings instanceof Array)) - throw new TypeError('argument must be an Array[String]'); - - var self = this; - strings.forEach(function (s) { - self.writeString(s); - }); -}; +/***/ }), -// This is really to solve DER cases, but whatever for now -Writer.prototype.writeOID = function (s, tag) { - if (typeof (s) !== 'string') - throw new TypeError('argument must be a string'); - if (typeof (tag) !== 'number') - tag = ASN1.OID; +/***/ 397: +/***/ (function(module) { - if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) - throw new Error('argument is not a valid OID string'); +"use strict"; - function encodeOctet(bytes, octet) { - if (octet < 128) { - bytes.push(octet); - } else if (octet < 16384) { - bytes.push((octet >>> 7) | 0x80); - bytes.push(octet & 0x7F); - } else if (octet < 2097152) { - bytes.push((octet >>> 14) | 0x80); - bytes.push(((octet >>> 7) | 0x80) & 0xFF); - bytes.push(octet & 0x7F); - } else if (octet < 268435456) { - bytes.push((octet >>> 21) | 0x80); - bytes.push(((octet >>> 14) | 0x80) & 0xFF); - bytes.push(((octet >>> 7) | 0x80) & 0xFF); - bytes.push(octet & 0x7F); - } else { - bytes.push(((octet >>> 28) | 0x80) & 0xFF); - bytes.push(((octet >>> 21) | 0x80) & 0xFF); - bytes.push(((octet >>> 14) | 0x80) & 0xFF); - bytes.push(((octet >>> 7) | 0x80) & 0xFF); - bytes.push(octet & 0x7F); +module.exports = function generate_multipleOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + out += 'var division' + ($lvl) + ';if ('; + if ($isData) { + out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; + } + out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; + if (it.opts.multipleOfPrecision) { + out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; + } else { + out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; + } + out += ' ) '; + if ($isData) { + out += ' ) '; + } + out += ' ) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be multiple of '; + if ($isData) { + out += '\' + ' + ($schemaValue); + } else { + out += '' + ($schemaValue) + '\''; + } + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } + out += ' } '; + } else { + out += ' {} '; } - - var tmp = s.split('.'); - var bytes = []; - bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); - tmp.slice(2).forEach(function (b) { - encodeOctet(bytes, parseInt(b, 10)); - }); - - var self = this; - this._ensure(2 + bytes.length); - this.writeByte(tag); - this.writeLength(bytes.length); - bytes.forEach(function (b) { - self.writeByte(b); - }); -}; - - -Writer.prototype.writeLength = function (len) { - if (typeof (len) !== 'number') - throw new TypeError('argument must be a Number'); - - this._ensure(4); - - if (len <= 0x7f) { - this._buf[this._offset++] = len; - } else if (len <= 0xff) { - this._buf[this._offset++] = 0x81; - this._buf[this._offset++] = len; - } else if (len <= 0xffff) { - this._buf[this._offset++] = 0x82; - this._buf[this._offset++] = len >> 8; - this._buf[this._offset++] = len; - } else if (len <= 0xffffff) { - this._buf[this._offset++] = 0x83; - this._buf[this._offset++] = len >> 16; - this._buf[this._offset++] = len >> 8; - this._buf[this._offset++] = len; + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } } else { - throw newInvalidAsn1Error('Length too long (> 4 bytes)'); + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } -}; + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} -Writer.prototype.startSequence = function (tag) { - if (typeof (tag) !== 'number') - tag = ASN1.Sequence | ASN1.Constructor; - this.writeByte(tag); - this._seq.push(this._offset); - this._ensure(3); - this._offset += 3; -}; +/***/ }), +/***/ 400: +/***/ (function(module, __unusedexports, __webpack_require__) { -Writer.prototype.endSequence = function () { - var seq = this._seq.pop(); - var start = seq + 3; - var len = this._offset - start; +// Copyright 2018 Joyent, Inc. - if (len <= 0x7f) { - this._shift(start, len, -2); - this._buf[seq] = len; - } else if (len <= 0xff) { - this._shift(start, len, -1); - this._buf[seq] = 0x81; - this._buf[seq + 1] = len; - } else if (len <= 0xffff) { - this._buf[seq] = 0x82; - this._buf[seq + 1] = len >> 8; - this._buf[seq + 2] = len; - } else if (len <= 0xffffff) { - this._shift(start, len, 1); - this._buf[seq] = 0x83; - this._buf[seq + 1] = len >> 16; - this._buf[seq + 2] = len >> 8; - this._buf[seq + 3] = len; - } else { - throw newInvalidAsn1Error('Sequence too long'); - } -}; +module.exports = Fingerprint; +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var errs = __webpack_require__(753); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var Certificate = __webpack_require__(752); +var utils = __webpack_require__(270); -Writer.prototype._shift = function (start, len, shift) { - assert.ok(start !== undefined); - assert.ok(len !== undefined); - assert.ok(shift); +var FingerprintFormatError = errs.FingerprintFormatError; +var InvalidAlgorithmError = errs.InvalidAlgorithmError; - this._buf.copy(this._buf, start + shift, start, start + len); - this._offset += shift; -}; +function Fingerprint(opts) { + assert.object(opts, 'options'); + assert.string(opts.type, 'options.type'); + assert.buffer(opts.hash, 'options.hash'); + assert.string(opts.algorithm, 'options.algorithm'); -Writer.prototype._ensure = function (len) { - assert.ok(len); + this.algorithm = opts.algorithm.toLowerCase(); + if (algs.hashAlgs[this.algorithm] !== true) + throw (new InvalidAlgorithmError(this.algorithm)); - if (this._size - this._offset < len) { - var sz = this._size * this._options.growthFactor; - if (sz - this._offset < len) - sz += len; + this.hash = opts.hash; + this.type = opts.type; + this.hashType = opts.hashType; +} - var buf = Buffer.alloc(sz); +Fingerprint.prototype.toString = function (format) { + if (format === undefined) { + if (this.algorithm === 'md5' || this.hashType === 'spki') + format = 'hex'; + else + format = 'base64'; + } + assert.string(format); - this._buf.copy(buf, 0, 0, this._offset); - this._buf = buf; - this._size = sz; - } + switch (format) { + case 'hex': + if (this.hashType === 'spki') + return (this.hash.toString('hex')); + return (addColons(this.hash.toString('hex'))); + case 'base64': + if (this.hashType === 'spki') + return (this.hash.toString('base64')); + return (sshBase64Format(this.algorithm, + this.hash.toString('base64'))); + default: + throw (new FingerprintFormatError(undefined, format)); + } }; +Fingerprint.prototype.matches = function (other) { + assert.object(other, 'key or certificate'); + if (this.type === 'key' && this.hashType !== 'ssh') { + utils.assertCompatible(other, Key, [1, 7], 'key with spki'); + if (PrivateKey.isPrivateKey(other)) { + utils.assertCompatible(other, PrivateKey, [1, 6], + 'privatekey with spki support'); + } + } else if (this.type === 'key') { + utils.assertCompatible(other, Key, [1, 0], 'key'); + } else { + utils.assertCompatible(other, Certificate, [1, 0], + 'certificate'); + } + var theirHash = other.hash(this.algorithm, this.hashType); + var theirHash2 = crypto.createHash(this.algorithm). + update(theirHash).digest('base64'); -// --- Exported API + if (this.hash2 === undefined) + this.hash2 = crypto.createHash(this.algorithm). + update(this.hash).digest('base64'); -module.exports = Writer; + return (this.hash2 === theirHash2); +}; +/*JSSTYLED*/ +var base64RE = /^[A-Za-z0-9+\/=]+$/; +/*JSSTYLED*/ +var hexRE = /^[a-fA-F0-9]+$/; -/***/ }), +Fingerprint.parse = function (fp, options) { + assert.string(fp, 'fingerprint'); -/***/ 407: -/***/ (function(module) { + var alg, hash, enAlgs; + if (Array.isArray(options)) { + enAlgs = options; + options = {}; + } + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + if (options.enAlgs !== undefined) + enAlgs = options.enAlgs; + if (options.algorithms !== undefined) + enAlgs = options.algorithms; + assert.optionalArrayOfString(enAlgs, 'algorithms'); -module.exports = require("buffer"); + var hashType = 'ssh'; + if (options.hashType !== undefined) + hashType = options.hashType; + assert.string(hashType, 'options.hashType'); -/***/ }), + var parts = fp.split(':'); + if (parts.length == 2) { + alg = parts[0].toLowerCase(); + if (!base64RE.test(parts[1])) + throw (new FingerprintFormatError(fp)); + try { + hash = Buffer.from(parts[1], 'base64'); + } catch (e) { + throw (new FingerprintFormatError(fp)); + } + } else if (parts.length > 2) { + alg = 'md5'; + if (parts[0].toLowerCase() === 'md5') + parts = parts.slice(1); + parts = parts.map(function (p) { + while (p.length < 2) + p = '0' + p; + if (p.length > 2) + throw (new FingerprintFormatError(fp)); + return (p); + }); + parts = parts.join(''); + if (!hexRE.test(parts) || parts.length % 2 !== 0) + throw (new FingerprintFormatError(fp)); + try { + hash = Buffer.from(parts, 'hex'); + } catch (e) { + throw (new FingerprintFormatError(fp)); + } + } else { + if (hexRE.test(fp)) { + hash = Buffer.from(fp, 'hex'); + } else if (base64RE.test(fp)) { + hash = Buffer.from(fp, 'base64'); + } else { + throw (new FingerprintFormatError(fp)); + } -/***/ 413: -/***/ (function(module) { + switch (hash.length) { + case 32: + alg = 'sha256'; + break; + case 16: + alg = 'md5'; + break; + case 20: + alg = 'sha1'; + break; + case 64: + alg = 'sha512'; + break; + default: + throw (new FingerprintFormatError(fp)); + } -module.exports = require("stream"); + /* Plain hex/base64: guess it's probably SPKI unless told. */ + if (options.hashType === undefined) + hashType = 'spki'; + } -/***/ }), + if (alg === undefined) + throw (new FingerprintFormatError(fp)); -/***/ 414: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (algs.hashAlgs[alg] === undefined) + throw (new InvalidAlgorithmError(alg)); -var stream = __webpack_require__(413) + if (enAlgs !== undefined) { + enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); + if (enAlgs.indexOf(alg) === -1) + throw (new InvalidAlgorithmError(alg)); + } + return (new Fingerprint({ + algorithm: alg, + hash: hash, + type: options.type || 'key', + hashType: hashType + })); +}; -function isStream (obj) { - return obj instanceof stream.Stream +function addColons(s) { + /*JSSTYLED*/ + return (s.replace(/(.{2})(?=.)/g, '$1:')); } +function base64Strip(s) { + /*JSSTYLED*/ + return (s.replace(/=*$/, '')); +} -function isReadable (obj) { - return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' +function sshBase64Format(alg, h) { + return (alg.toUpperCase() + ':' + base64Strip(h)); } +Fingerprint.isFingerprint = function (obj, ver) { + return (utils.isCompatible(obj, Fingerprint, ver)); +}; -function isWritable (obj) { - return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' -} +/* + * API versions for Fingerprint: + * [1,0] -- initial ver + * [1,1] -- first tagged ver + * [1,2] -- hashType and spki support + */ +Fingerprint.prototype._sshpkApiVersion = [1, 2]; +Fingerprint._oldVersionDetect = function (obj) { + assert.func(obj.toString); + assert.func(obj.matches); + return ([1, 0]); +}; -function isDuplex (obj) { - return isReadable(obj) && isWritable(obj) -} +/***/ }), -module.exports = isStream -module.exports.isReadable = isReadable -module.exports.isWritable = isWritable -module.exports.isDuplex = isDuplex +/***/ 413: +/***/ (function(module) { +module.exports = require("stream"); /***/ }), -/***/ 415: +/***/ 416: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -var Store = __webpack_require__(895).Store; -var permuteDomain = __webpack_require__(293).permuteDomain; -var pathMatch = __webpack_require__(560).pathMatch; -var util = __webpack_require__(669); - -function MemoryCookieStore() { - Store.call(this); - this.idx = {}; -} -util.inherits(MemoryCookieStore, Store); -exports.MemoryCookieStore = MemoryCookieStore; -MemoryCookieStore.prototype.idx = null; -// Since it's just a struct in RAM, this Store is synchronous -MemoryCookieStore.prototype.synchronous = true; -// force a default depth: -MemoryCookieStore.prototype.inspect = function() { - return "{ idx: "+util.inspect(this.idx, false, 2)+' }'; -}; +var fs = __webpack_require__(747) +var qs = __webpack_require__(191) +var validate = __webpack_require__(846) +var extend = __webpack_require__(374) -// Use the new custom inspection symbol to add the custom inspect function if -// available. -if (util.inspect.custom) { - MemoryCookieStore.prototype[util.inspect.custom] = MemoryCookieStore.prototype.inspect; +function Har (request) { + this.request = request } -MemoryCookieStore.prototype.findCookie = function(domain, path, key, cb) { - if (!this.idx[domain]) { - return cb(null,undefined); - } - if (!this.idx[domain][path]) { - return cb(null,undefined); - } - return cb(null,this.idx[domain][path][key]||null); -}; - -MemoryCookieStore.prototype.findCookies = function(domain, path, cb) { - var results = []; - if (!domain) { - return cb(null,[]); +Har.prototype.reducer = function (obj, pair) { + // new property ? + if (obj[pair.name] === undefined) { + obj[pair.name] = pair.value + return obj } - var pathMatcher; - if (!path) { - // null means "all paths" - pathMatcher = function matchAll(domainIndex) { - for (var curPath in domainIndex) { - var pathIndex = domainIndex[curPath]; - for (var key in pathIndex) { - results.push(pathIndex[key]); - } - } - }; - - } else { - pathMatcher = function matchRFC(domainIndex) { - //NOTE: we should use path-match algorithm from S5.1.4 here - //(see : https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/canonical_cookie.cc#L299) - Object.keys(domainIndex).forEach(function (cookiePath) { - if (pathMatch(path, cookiePath)) { - var pathIndex = domainIndex[cookiePath]; + // existing? convert to array + var arr = [ + obj[pair.name], + pair.value + ] - for (var key in pathIndex) { - results.push(pathIndex[key]); - } - } - }); - }; - } + obj[pair.name] = arr - var domains = permuteDomain(domain) || [domain]; - var idx = this.idx; - domains.forEach(function(curDomain) { - var domainIndex = idx[curDomain]; - if (!domainIndex) { - return; - } - pathMatcher(domainIndex); - }); + return obj +} - cb(null,results); -}; +Har.prototype.prep = function (data) { + // construct utility properties + data.queryObj = {} + data.headersObj = {} + data.postData.jsonObj = false + data.postData.paramsObj = false -MemoryCookieStore.prototype.putCookie = function(cookie, cb) { - if (!this.idx[cookie.domain]) { - this.idx[cookie.domain] = {}; - } - if (!this.idx[cookie.domain][cookie.path]) { - this.idx[cookie.domain][cookie.path] = {}; + // construct query objects + if (data.queryString && data.queryString.length) { + data.queryObj = data.queryString.reduce(this.reducer, {}) } - this.idx[cookie.domain][cookie.path][cookie.key] = cookie; - cb(null); -}; - -MemoryCookieStore.prototype.updateCookie = function(oldCookie, newCookie, cb) { - // updateCookie() may avoid updating cookies that are identical. For example, - // lastAccessed may not be important to some stores and an equality - // comparison could exclude that field. - this.putCookie(newCookie,cb); -}; -MemoryCookieStore.prototype.removeCookie = function(domain, path, key, cb) { - if (this.idx[domain] && this.idx[domain][path] && this.idx[domain][path][key]) { - delete this.idx[domain][path][key]; + // construct headers objects + if (data.headers && data.headers.length) { + // loweCase header keys + data.headersObj = data.headers.reduceRight(function (headers, header) { + headers[header.name] = header.value + return headers + }, {}) } - cb(null); -}; -MemoryCookieStore.prototype.removeCookies = function(domain, path, cb) { - if (this.idx[domain]) { - if (path) { - delete this.idx[domain][path]; - } else { - delete this.idx[domain]; + // construct Cookie header + if (data.cookies && data.cookies.length) { + var cookies = data.cookies.map(function (cookie) { + return cookie.name + '=' + cookie.value + }) + + if (cookies.length) { + data.headersObj.cookie = cookies.join('; ') } } - return cb(null); -}; -MemoryCookieStore.prototype.getAllCookies = function(cb) { - var cookies = []; - var idx = this.idx; + // prep body + function some (arr) { + return arr.some(function (type) { + return data.postData.mimeType.indexOf(type) === 0 + }) + } - var domains = Object.keys(idx); - domains.forEach(function(domain) { - var paths = Object.keys(idx[domain]); - paths.forEach(function(path) { - var keys = Object.keys(idx[domain][path]); - keys.forEach(function(key) { - if (key !== null) { - cookies.push(idx[domain][path][key]); - } - }); - }); - }); + if (some([ + 'multipart/mixed', + 'multipart/related', + 'multipart/form-data', + 'multipart/alternative'])) { + // reset values + data.postData.mimeType = 'multipart/form-data' + } else if (some([ + 'application/x-www-form-urlencoded'])) { + if (!data.postData.params) { + data.postData.text = '' + } else { + data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) - // Sort by creationIndex so deserializing retains the creation order. - // When implementing your own store, this SHOULD retain the order too - cookies.sort(function(a,b) { - return (a.creationIndex||0) - (b.creationIndex||0); - }); + // always overwrite + data.postData.text = qs.stringify(data.postData.paramsObj) + } + } else if (some([ + 'text/json', + 'text/x-json', + 'application/json', + 'application/x-json'])) { + data.postData.mimeType = 'application/json' - cb(null, cookies); -}; + if (data.postData.text) { + try { + data.postData.jsonObj = JSON.parse(data.postData.text) + } catch (e) { + this.request.debug(e) + // force back to text/plain + data.postData.mimeType = 'text/plain' + } + } + } -/***/ }), + return data +} -/***/ 417: -/***/ (function(module) { +Har.prototype.options = function (options) { + // skip if no har property defined + if (!options.har) { + return options + } -module.exports = require("crypto"); + var har = {} + extend(har, options.har) -/***/ }), + // only process the first entry + if (har.log && har.log.entries) { + har = har.log.entries[0] + } -/***/ 424: -/***/ (function(module, __unusedexports, __webpack_require__) { + // add optional properties to make validation successful + har.url = har.url || options.url || options.uri || options.baseUrl || '/' + har.httpVersion = har.httpVersion || 'HTTP/1.1' + har.queryString = har.queryString || [] + har.headers = har.headers || [] + har.cookies = har.cookies || [] + har.postData = har.postData || {} + har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' -"use strict"; + har.bodySize = 0 + har.headersSize = 0 + har.postData.size = 0 + if (!validate.request(har)) { + return options + } -var metaSchema = __webpack_require__(864); + // clean up and get some utility properties + var req = this.prep(har) -module.exports = { - $id: 'https://github.com/epoberezkin/ajv/blob/master/lib/definition_schema.js', - definitions: { - simpleTypes: metaSchema.definitions.simpleTypes - }, - type: 'object', - dependencies: { - schema: ['validate'], - $data: ['validate'], - statements: ['inline'], - valid: {not: {required: ['macro']}} - }, - properties: { - type: metaSchema.properties.type, - schema: {type: 'boolean'}, - statements: {type: 'boolean'}, - dependencies: { - type: 'array', - items: {type: 'string'} - }, - metaSchema: {type: 'object'}, - modifying: {type: 'boolean'}, - valid: {type: 'boolean'}, - $data: {type: 'boolean'}, - async: {type: 'boolean'}, - errors: { - anyOf: [ - {type: 'boolean'}, - {const: 'full'} - ] - } + // construct new options + if (req.url) { + options.url = req.url } -}; + if (req.method) { + options.method = req.method + } -/***/ }), + if (Object.keys(req.queryObj).length) { + options.qs = req.queryObj + } -/***/ 437: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (Object.keys(req.headersObj).length) { + options.headers = req.headersObj + } -// Copyright 2015 Joyent, Inc. + function test (type) { + return req.postData.mimeType.indexOf(type) === 0 + } + if (test('application/x-www-form-urlencoded')) { + options.form = req.postData.paramsObj + } else if (test('application/json')) { + if (req.postData.jsonObj) { + options.body = req.postData.jsonObj + options.json = true + } + } else if (test('multipart/form-data')) { + options.formData = {} -module.exports = Signature; + req.postData.params.forEach(function (param) { + var attachment = {} -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var crypto = __webpack_require__(417); -var errs = __webpack_require__(481); -var utils = __webpack_require__(57); -var asn1 = __webpack_require__(856); -var SSHBuffer = __webpack_require__(981); + if (!param.fileName && !param.fileName && !param.contentType) { + options.formData[param.name] = param.value + return + } -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var SignatureParseError = errs.SignatureParseError; + // attempt to read from disk! + if (param.fileName && !param.value) { + attachment.value = fs.createReadStream(param.fileName) + } else if (param.value) { + attachment.value = param.value + } -function Signature(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); + if (param.fileName) { + attachment.options = { + filename: param.fileName, + contentType: param.contentType ? param.contentType : null + } + } - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } + options.formData[param.name] = attachment + }) + } else { + if (req.postData.text) { + options.body = req.postData.text + } + } - this.type = opts.type; - this.hashAlgorithm = opts.hashAlgo; - this.curve = opts.curve; - this.parts = opts.parts; - this.part = partLookup; + return options } -Signature.prototype.toBuffer = function (format) { - if (format === undefined) - format = 'asn1'; - assert.string(format, 'format'); +exports.Har = Har - var buf; - var stype = 'ssh-' + this.type; - switch (this.type) { - case 'rsa': - switch (this.hashAlgorithm) { - case 'sha256': - stype = 'rsa-sha2-256'; - break; - case 'sha512': - stype = 'rsa-sha2-512'; - break; - case 'sha1': - case undefined: - break; - default: - throw (new Error('SSH signature ' + - 'format does not support hash ' + - 'algorithm ' + this.hashAlgorithm)); - } - if (format === 'ssh') { - buf = new SSHBuffer({}); - buf.writeString(stype); - buf.writePart(this.part.sig); - return (buf.toBuffer()); - } else { - return (this.part.sig.data); - } - break; +/***/ }), - case 'ed25519': - if (format === 'ssh') { - buf = new SSHBuffer({}); - buf.writeString(stype); - buf.writePart(this.part.sig); - return (buf.toBuffer()); - } else { - return (this.part.sig.data); - } - break; +/***/ 417: +/***/ (function(module) { - case 'dsa': - case 'ecdsa': - var r, s; - if (format === 'asn1') { - var der = new asn1.BerWriter(); - der.startSequence(); - r = utils.mpNormalize(this.part.r.data); - s = utils.mpNormalize(this.part.s.data); - der.writeBuffer(r, asn1.Ber.Integer); - der.writeBuffer(s, asn1.Ber.Integer); - der.endSequence(); - return (der.buffer); - } else if (format === 'ssh' && this.type === 'dsa') { - buf = new SSHBuffer({}); - buf.writeString('ssh-dss'); - r = this.part.r.data; - if (r.length > 20 && r[0] === 0x00) - r = r.slice(1); - s = this.part.s.data; - if (s.length > 20 && s[0] === 0x00) - s = s.slice(1); - if ((this.hashAlgorithm && - this.hashAlgorithm !== 'sha1') || - r.length + s.length !== 40) { - throw (new Error('OpenSSH only supports ' + - 'DSA signatures with SHA1 hash')); - } - buf.writeBuffer(Buffer.concat([r, s])); - return (buf.toBuffer()); - } else if (format === 'ssh' && this.type === 'ecdsa') { - var inner = new SSHBuffer({}); - r = this.part.r.data; - inner.writeBuffer(r); - inner.writePart(this.part.s); +module.exports = require("crypto"); - buf = new SSHBuffer({}); - /* XXX: find a more proper way to do this? */ - var curve; - if (r[0] === 0x00) - r = r.slice(1); - var sz = r.length * 8; - if (sz === 256) - curve = 'nistp256'; - else if (sz === 384) - curve = 'nistp384'; - else if (sz === 528) - curve = 'nistp521'; - buf.writeString('ecdsa-sha2-' + curve); - buf.writeBuffer(inner.toBuffer()); - return (buf.toBuffer()); - } - throw (new Error('Invalid signature format')); - default: - throw (new Error('Invalid signature data')); - } -}; +/***/ }), -Signature.prototype.toString = function (format) { - assert.optionalString(format, 'format'); - return (this.toBuffer(format).toString('base64')); -}; +/***/ 424: +/***/ (function(module, __unusedexports, __webpack_require__) { -Signature.parse = function (data, type, format) { - if (typeof (data) === 'string') - data = Buffer.from(data, 'base64'); - assert.buffer(data, 'data'); - assert.string(format, 'format'); - assert.string(type, 'type'); +var iterate = __webpack_require__(157) + , initState = __webpack_require__(147) + , terminator = __webpack_require__(939) + ; - var opts = {}; - opts.type = type.toLowerCase(); - opts.parts = []; +// Public API +module.exports = parallel; - try { - assert.ok(data.length > 0, 'signature must not be empty'); - switch (opts.type) { - case 'rsa': - return (parseOneNum(data, type, format, opts)); - case 'ed25519': - return (parseOneNum(data, type, format, opts)); +/** + * Runs iterator over provided array elements in parallel + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function parallel(list, iterator, callback) +{ + var state = initState(list); - case 'dsa': - case 'ecdsa': - if (format === 'asn1') - return (parseDSAasn1(data, type, format, opts)); - else if (opts.type === 'dsa') - return (parseDSA(data, type, format, opts)); - else - return (parseECDSA(data, type, format, opts)); + while (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, function(error, result) + { + if (error) + { + callback(error, result); + return; + } - default: - throw (new InvalidAlgorithmError(type)); - } + // looks like it's the last one + if (Object.keys(state.jobs).length === 0) + { + callback(null, state.results); + return; + } + }); - } catch (e) { - if (e instanceof InvalidAlgorithmError) - throw (e); - throw (new SignatureParseError(type, format, e)); - } -}; + state.index++; + } -function parseOneNum(data, type, format, opts) { - if (format === 'ssh') { - try { - var buf = new SSHBuffer({buffer: data}); - var head = buf.readString(); - } catch (e) { - /* fall through */ - } - if (buf !== undefined) { - var msg = 'SSH signature does not match expected ' + - 'type (expected ' + type + ', got ' + head + ')'; - switch (head) { - case 'ssh-rsa': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha1'; - break; - case 'rsa-sha2-256': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha256'; - break; - case 'rsa-sha2-512': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha512'; - break; - case 'ssh-ed25519': - assert.strictEqual(type, 'ed25519', msg); - opts.hashAlgo = 'sha512'; - break; - default: - throw (new Error('Unknown SSH signature ' + - 'type: ' + head)); - } - var sig = buf.readPart(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - sig.name = 'sig'; - opts.parts.push(sig); - return (new Signature(opts)); - } - } - opts.parts.push({name: 'sig', data: data}); - return (new Signature(opts)); + return terminator.bind(state, callback); } -function parseDSAasn1(data, type, format, opts) { - var der = new asn1.BerReader(data); - der.readSequence(); - var r = der.readString(asn1.Ber.Integer, true); - var s = der.readString(asn1.Ber.Integer, true); - - opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); - opts.parts.push({name: 's', data: utils.mpNormalize(s)}); - return (new Signature(opts)); -} +/***/ }), -function parseDSA(data, type, format, opts) { - if (data.length != 40) { - var buf = new SSHBuffer({buffer: data}); - var d = buf.readBuffer(); - if (d.toString('ascii') === 'ssh-dss') - d = buf.readBuffer(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - assert.strictEqual(d.length, 40, 'invalid inner length'); - data = d; - } - opts.parts.push({name: 'r', data: data.slice(0, 20)}); - opts.parts.push({name: 's', data: data.slice(20, 40)}); - return (new Signature(opts)); -} +/***/ 428: +/***/ (function(module, __unusedexports, __webpack_require__) { -function parseECDSA(data, type, format, opts) { - var buf = new SSHBuffer({buffer: data}); +// Copyright 2015 Joyent, Inc. - var r, s; - var inner = buf.readBuffer(); - var stype = inner.toString('ascii'); - if (stype.slice(0, 6) === 'ecdsa-') { - var parts = stype.split('-'); - assert.strictEqual(parts[0], 'ecdsa'); - assert.strictEqual(parts[1], 'sha2'); - opts.curve = parts[2]; - switch (opts.curve) { - case 'nistp256': - opts.hashAlgo = 'sha256'; - break; - case 'nistp384': - opts.hashAlgo = 'sha384'; - break; - case 'nistp521': - opts.hashAlgo = 'sha512'; - break; - default: - throw (new Error('Unsupported ECDSA curve: ' + - opts.curve)); - } - inner = buf.readBuffer(); - assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); - buf = new SSHBuffer({buffer: inner}); - r = buf.readPart(); - } else { - r = {data: inner}; - } +var assert = __webpack_require__(477); +var crypto = __webpack_require__(417); +var sshpk = __webpack_require__(650); +var utils = __webpack_require__(909); - s = buf.readPart(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); +var HASH_ALGOS = utils.HASH_ALGOS; +var PK_ALGOS = utils.PK_ALGOS; +var InvalidAlgorithmError = utils.InvalidAlgorithmError; +var HttpSignatureError = utils.HttpSignatureError; +var validateAlgorithm = utils.validateAlgorithm; - r.name = 'r'; - s.name = 's'; +///--- Exported API - opts.parts.push(r); - opts.parts.push(s); - return (new Signature(opts)); -} +module.exports = { + /** + * Verify RSA/DSA signature against public key. You are expected to pass in + * an object that was returned from `parse()`. + * + * @param {Object} parsedSignature the object you got from `parse`. + * @param {String} pubkey RSA/DSA private key PEM. + * @return {Boolean} true if valid, false otherwise. + * @throws {TypeError} if you pass in bad arguments. + * @throws {InvalidAlgorithmError} + */ + verifySignature: function verifySignature(parsedSignature, pubkey) { + assert.object(parsedSignature, 'parsedSignature'); + if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) + pubkey = sshpk.parseKey(pubkey); + assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); -Signature.isSignature = function (obj, ver) { - return (utils.isCompatible(obj, Signature, ver)); -}; + var alg = validateAlgorithm(parsedSignature.algorithm); + if (alg[0] === 'hmac' || alg[0] !== pubkey.type) + return (false); -/* - * API versions for Signature: - * [1,0] -- initial ver - * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent - * hashAlgorithm property - * [2,1] -- first tagged version - */ -Signature.prototype._sshpkApiVersion = [2, 1]; + var v = pubkey.createVerify(alg[1]); + v.update(parsedSignature.signingString); + return (v.verify(parsedSignature.params.signature, 'base64')); + }, -Signature._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - if (obj.hasOwnProperty('hashAlgorithm')) - return ([2, 0]); - return ([1, 0]); -}; + /** + * Verify HMAC against shared secret. You are expected to pass in an object + * that was returned from `parse()`. + * + * @param {Object} parsedSignature the object you got from `parse`. + * @param {String} secret HMAC shared secret. + * @return {Boolean} true if valid, false otherwise. + * @throws {TypeError} if you pass in bad arguments. + * @throws {InvalidAlgorithmError} + */ + verifyHMAC: function verifyHMAC(parsedSignature, secret) { + assert.object(parsedSignature, 'parsedHMAC'); + assert.string(secret, 'secret'); + var alg = validateAlgorithm(parsedSignature.algorithm); + if (alg[0] !== 'hmac') + return (false); -/***/ }), + var hashAlg = alg[1].toUpperCase(); -/***/ 438: -/***/ (function(module) { + var hmac = crypto.createHmac(hashAlg, secret); + hmac.update(parsedSignature.signingString); -"use strict"; + /* + * Now double-hash to avoid leaking timing information - there's + * no easy constant-time compare in JS, so we use this approach + * instead. See for more info: + * https://www.isecpartners.com/blog/2011/february/double-hmac- + * verification.aspx + */ + var h1 = crypto.createHmac(hashAlg, secret); + h1.update(hmac.digest()); + h1 = h1.digest(); + var h2 = crypto.createHmac(hashAlg, secret); + h2.update(new Buffer(parsedSignature.params.signature, 'base64')); + h2 = h2.digest(); -module.exports = function generate_propertyNames(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - out += 'var ' + ($errs) + ' = errors;'; - if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - var $key = 'key' + $lvl, - $idx = 'idx' + $lvl, - $i = 'i' + $lvl, - $invalidName = '\' + ' + $key + ' + \'', - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $dataProperties = 'dataProperties' + $lvl, - $ownProperties = it.opts.ownProperties, - $currentBaseId = it.baseId; - if ($ownProperties) { - out += ' var ' + ($dataProperties) + ' = undefined; '; - } - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - out += ' var startErrs' + ($lvl) + ' = errors; '; - var $passData = $key; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' 0) { + cmdStr += ' '; + for (const key in this.properties) { + if (this.properties.hasOwnProperty(key)) { + const val = this.properties[key]; + if (val) { + // safely append the val - avoid blowing up when attempting to + // call .replace() if message is not a string for some reason + cmdStr += `${key}=${escape(`${val || ''}`)},`; + } + } + } + } + cmdStr += CMD_STRING; + // safely append the message - avoid blowing up when attempting to + // call .replace() if message is not a string for some reason + const message = `${this.message || ''}`; + cmdStr += escapeData(message); + return cmdStr; + } +} +function escapeData(s) { + return s.replace(/\r/g, '%0D').replace(/\n/g, '%0A'); +} +function escape(s) { + return s + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A') + .replace(/]/g, '%5D') + .replace(/;/g, '%3B'); +} +//# sourceMappingURL=command.js.map /***/ }), -/***/ 443: +/***/ 449: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2012 Joyent, Inc. All rights reserved. +// Copyright 2015 Joyent, Inc. -var assert = __webpack_require__(976); -var crypto = __webpack_require__(417); -var http = __webpack_require__(605); -var util = __webpack_require__(669); -var sshpk = __webpack_require__(133); -var jsprim = __webpack_require__(937); -var utils = __webpack_require__(329); +module.exports = { + read: read, + readPkcs1: readPkcs1, + write: write, + writePkcs1: writePkcs1 +}; -var sprintf = __webpack_require__(669).format; +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var HttpSignatureError = utils.HttpSignatureError; -var validateAlgorithm = utils.validateAlgorithm; +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); -///--- Globals +var pkcs8 = __webpack_require__(707); +var readECDSACurve = pkcs8.readECDSACurve; -var AUTHZ_FMT = - 'Signature keyId="%s",algorithm="%s",headers="%s",signature="%s"'; +function read(buf, options) { + return (pem.read(buf, options, 'pkcs1')); +} -///--- Specific Errors +function write(key, options) { + return (pem.write(key, options, 'pkcs1')); +} -function MissingHeaderError(message) { - HttpSignatureError.call(this, message, MissingHeaderError); +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } -util.inherits(MissingHeaderError, HttpSignatureError); -function StrictParsingError(message) { - HttpSignatureError.call(this, message, StrictParsingError); +function readPkcs1(alg, type, der) { + switch (alg) { + case 'RSA': + if (type === 'public') + return (readPkcs1RSAPublic(der)); + else if (type === 'private') + return (readPkcs1RSAPrivate(der)); + throw (new Error('Unknown key type: ' + type)); + case 'DSA': + if (type === 'public') + return (readPkcs1DSAPublic(der)); + else if (type === 'private') + return (readPkcs1DSAPrivate(der)); + throw (new Error('Unknown key type: ' + type)); + case 'EC': + case 'ECDSA': + if (type === 'private') + return (readPkcs1ECDSAPrivate(der)); + else if (type === 'public') + return (readPkcs1ECDSAPublic(der)); + throw (new Error('Unknown key type: ' + type)); + case 'EDDSA': + case 'EdDSA': + if (type === 'private') + return (readPkcs1EdDSAPrivate(der)); + throw (new Error(type + ' keys not supported with EdDSA')); + default: + throw (new Error('Unknown key algo: ' + alg)); + } } -util.inherits(StrictParsingError, HttpSignatureError); -/* See createSigner() */ -function RequestSigner(options) { - assert.object(options, 'options'); +function readPkcs1RSAPublic(der) { + // modulus and exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'exponent'); - var alg = []; - if (options.algorithm !== undefined) { - assert.string(options.algorithm, 'options.algorithm'); - alg = validateAlgorithm(options.algorithm); - } - this.rs_alg = alg; + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'e', data: e }, + { name: 'n', data: n } + ] + }; - /* - * RequestSigners come in two varieties: ones with an rs_signFunc, and ones - * with an rs_signer. - * - * rs_signFunc-based RequestSigners have to build up their entire signing - * string within the rs_lines array and give it to rs_signFunc as a single - * concat'd blob. rs_signer-based RequestSigners can add a line at a time to - * their signing state by using rs_signer.update(), thus only needing to - * buffer the hash function state and one line at a time. - */ - if (options.sign !== undefined) { - assert.func(options.sign, 'options.sign'); - this.rs_signFunc = options.sign; + return (new Key(key)); +} - } else if (alg[0] === 'hmac' && options.key !== undefined) { - assert.string(options.keyId, 'options.keyId'); - this.rs_keyId = options.keyId; +function readPkcs1RSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version[0], 0); - if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) - throw (new TypeError('options.key for HMAC must be a string or Buffer')); + // modulus then public exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'public exponent'); + var d = readMPInt(der, 'private exponent'); + var p = readMPInt(der, 'prime1'); + var q = readMPInt(der, 'prime2'); + var dmodp = readMPInt(der, 'exponent1'); + var dmodq = readMPInt(der, 'exponent2'); + var iqmp = readMPInt(der, 'iqmp'); - /* - * Make an rs_signer for HMACs, not a rs_signFunc -- HMACs digest their - * data in chunks rather than requiring it all to be given in one go - * at the end, so they are more similar to signers than signFuncs. - */ - this.rs_signer = crypto.createHmac(alg[1].toUpperCase(), options.key); - this.rs_signer.sign = function () { - var digest = this.digest('base64'); - return ({ - hashAlgorithm: alg[1], - toString: function () { return (digest); } - }); - }; + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'n', data: n }, + { name: 'e', data: e }, + { name: 'd', data: d }, + { name: 'iqmp', data: iqmp }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'dmodp', data: dmodp }, + { name: 'dmodq', data: dmodq } + ] + }; - } else if (options.key !== undefined) { - var key = options.key; - if (typeof (key) === 'string' || Buffer.isBuffer(key)) - key = sshpk.parsePrivateKey(key); + return (new PrivateKey(key)); +} - assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), - 'options.key must be a sshpk.PrivateKey'); - this.rs_key = key; +function readPkcs1DSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version.readUInt8(0), 0); - assert.string(options.keyId, 'options.keyId'); - this.rs_keyId = options.keyId; + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + var y = readMPInt(der, 'y'); + var x = readMPInt(der, 'x'); - if (!PK_ALGOS[key.type]) { - throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + - 'keys are not supported')); - } + // now, make the key + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y }, + { name: 'x', data: x } + ] + }; - if (alg[0] !== undefined && key.type !== alg[0]) { - throw (new InvalidAlgorithmError('options.key must be a ' + - alg[0].toUpperCase() + ' key, was given a ' + - key.type.toUpperCase() + ' key instead')); - } + return (new PrivateKey(key)); +} - this.rs_signer = key.createSign(alg[1]); +function readPkcs1EdDSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version.readUInt8(0), 1); - } else { - throw (new TypeError('options.sign (func) or options.key is required')); - } + // private key + var k = der.readString(asn1.Ber.OctetString, true); - this.rs_headers = []; - this.rs_lines = []; + der.readSequence(0xa0); + var oid = der.readOID(); + assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); + + der.readSequence(0xa1); + var A = utils.readBitString(der); + + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) }, + { name: 'k', data: k } + ] + }; + + return (new PrivateKey(key)); } -/** - * Adds a header to be signed, with its value, into this signer. - * - * @param {String} header - * @param {String} value - * @return {String} value written - */ -RequestSigner.prototype.writeHeader = function (header, value) { - assert.string(header, 'header'); - header = header.toLowerCase(); - assert.string(value, 'value'); +function readPkcs1DSAPublic(der) { + var y = readMPInt(der, 'y'); + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); - this.rs_headers.push(header); + var key = { + type: 'dsa', + parts: [ + { name: 'y', data: y }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g } + ] + }; - if (this.rs_signFunc) { - this.rs_lines.push(header + ': ' + value); + return (new Key(key)); +} - } else { - var line = header + ': ' + value; - if (this.rs_headers.length > 0) - line = '\n' + line; - this.rs_signer.update(line); - } +function readPkcs1ECDSAPublic(der) { + der.readSequence(); - return (value); -}; + var oid = der.readOID(); + assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); -/** - * Adds a default Date header, returning its value. - * - * @return {String} - */ -RequestSigner.prototype.writeDateHeader = function () { - return (this.writeHeader('date', jsprim.rfc1123(new Date()))); -}; + var curveOid = der.readOID(); -/** - * Adds the request target line to be signed. - * - * @param {String} method, HTTP method (e.g. 'get', 'post', 'put') - * @param {String} path - */ -RequestSigner.prototype.writeTarget = function (method, path) { - assert.string(method, 'method'); - assert.string(path, 'path'); - method = method.toLowerCase(); - this.writeHeader('(request-target)', method + ' ' + path); -}; + var curve; + var curves = Object.keys(algs.curves); + for (var j = 0; j < curves.length; ++j) { + var c = curves[j]; + var cd = algs.curves[c]; + if (cd.pkcs8oid === curveOid) { + curve = c; + break; + } + } + assert.string(curve, 'a known ECDSA named curve'); -/** - * Calculate the value for the Authorization header on this request - * asynchronously. - * - * @param {Func} callback (err, authz) - */ -RequestSigner.prototype.sign = function (cb) { - assert.func(cb, 'callback'); + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); - if (this.rs_headers.length < 1) - throw (new Error('At least one header must be signed')); + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curve) }, + { name: 'Q', data: Q } + ] + }; - var alg, authz; - if (this.rs_signFunc) { - var data = this.rs_lines.join('\n'); - var self = this; - this.rs_signFunc(data, function (err, sig) { - if (err) { - cb(err); - return; - } - try { - assert.object(sig, 'signature'); - assert.string(sig.keyId, 'signature.keyId'); - assert.string(sig.algorithm, 'signature.algorithm'); - assert.string(sig.signature, 'signature.signature'); - alg = validateAlgorithm(sig.algorithm); + return (new Key(key)); +} - authz = sprintf(AUTHZ_FMT, - sig.keyId, - sig.algorithm, - self.rs_headers.join(' '), - sig.signature); - } catch (e) { - cb(e); - return; - } - cb(null, authz); - }); +function readPkcs1ECDSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version.readUInt8(0), 1); - } else { - try { - var sigObj = this.rs_signer.sign(); - } catch (e) { - cb(e); - return; - } - alg = (this.rs_alg[0] || this.rs_key.type) + '-' + sigObj.hashAlgorithm; - var signature = sigObj.toString(); - authz = sprintf(AUTHZ_FMT, - this.rs_keyId, - alg, - this.rs_headers.join(' '), - signature); - cb(null, authz); - } -}; + // private key + var d = der.readString(asn1.Ber.OctetString, true); -///--- Exported API + der.readSequence(0xa0); + var curve = readECDSACurve(der); + assert.string(curve, 'a known elliptic curve'); -module.exports = { - /** - * Identifies whether a given object is a request signer or not. - * - * @param {Object} object, the object to identify - * @returns {Boolean} - */ - isSigner: function (obj) { - if (typeof (obj) === 'object' && obj instanceof RequestSigner) - return (true); - return (false); - }, + der.readSequence(0xa1); + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); - /** - * Creates a request signer, used to asynchronously build a signature - * for a request (does not have to be an http.ClientRequest). - * - * @param {Object} options, either: - * - {String} keyId - * - {String|Buffer} key - * - {String} algorithm (optional, required for HMAC) - * or: - * - {Func} sign (data, cb) - * @return {RequestSigner} - */ - createSigner: function createSigner(options) { - return (new RequestSigner(options)); - }, + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curve) }, + { name: 'Q', data: Q }, + { name: 'd', data: d } + ] + }; + + return (new PrivateKey(key)); +} + +function writePkcs1(der, key) { + der.startSequence(); + + switch (key.type) { + case 'rsa': + if (PrivateKey.isPrivateKey(key)) + writePkcs1RSAPrivate(der, key); + else + writePkcs1RSAPublic(der, key); + break; + case 'dsa': + if (PrivateKey.isPrivateKey(key)) + writePkcs1DSAPrivate(der, key); + else + writePkcs1DSAPublic(der, key); + break; + case 'ecdsa': + if (PrivateKey.isPrivateKey(key)) + writePkcs1ECDSAPrivate(der, key); + else + writePkcs1ECDSAPublic(der, key); + break; + case 'ed25519': + if (PrivateKey.isPrivateKey(key)) + writePkcs1EdDSAPrivate(der, key); + else + writePkcs1EdDSAPublic(der, key); + break; + default: + throw (new Error('Unknown key algo: ' + key.type)); + } - /** - * Adds an 'Authorization' header to an http.ClientRequest object. - * - * Note that this API will add a Date header if it's not already set. Any - * other headers in the options.headers array MUST be present, or this - * will throw. - * - * You shouldn't need to check the return type; it's just there if you want - * to be pedantic. - * - * The optional flag indicates whether parsing should use strict enforcement - * of the version draft-cavage-http-signatures-04 of the spec or beyond. - * The default is to be loose and support - * older versions for compatibility. - * - * @param {Object} request an instance of http.ClientRequest. - * @param {Object} options signing parameters object: - * - {String} keyId required. - * - {String} key required (either a PEM or HMAC key). - * - {Array} headers optional; defaults to ['date']. - * - {String} algorithm optional (unless key is HMAC); - * default is the same as the sshpk default - * signing algorithm for the type of key given - * - {String} httpVersion optional; defaults to '1.1'. - * - {Boolean} strict optional; defaults to 'false'. - * @return {Boolean} true if Authorization (and optionally Date) were added. - * @throws {TypeError} on bad parameter types (input). - * @throws {InvalidAlgorithmError} if algorithm was bad or incompatible with - * the given key. - * @throws {sshpk.KeyParseError} if key was bad. - * @throws {MissingHeaderError} if a header to be signed was specified but - * was not present. - */ - signRequest: function signRequest(request, options) { - assert.object(request, 'request'); - assert.object(options, 'options'); - assert.optionalString(options.algorithm, 'options.algorithm'); - assert.string(options.keyId, 'options.keyId'); - assert.optionalArrayOfString(options.headers, 'options.headers'); - assert.optionalString(options.httpVersion, 'options.httpVersion'); + der.endSequence(); +} - if (!request.getHeader('Date')) - request.setHeader('Date', jsprim.rfc1123(new Date())); - if (!options.headers) - options.headers = ['date']; - if (!options.httpVersion) - options.httpVersion = '1.1'; +function writePkcs1RSAPublic(der, key) { + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); +} - var alg = []; - if (options.algorithm) { - options.algorithm = options.algorithm.toLowerCase(); - alg = validateAlgorithm(options.algorithm); - } +function writePkcs1RSAPrivate(der, key) { + var ver = Buffer.from([0]); + der.writeBuffer(ver, asn1.Ber.Integer); - var i; - var stringToSign = ''; - for (i = 0; i < options.headers.length; i++) { - if (typeof (options.headers[i]) !== 'string') - throw new TypeError('options.headers must be an array of Strings'); + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); + der.writeBuffer(key.part.d.data, asn1.Ber.Integer); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + if (!key.part.dmodp || !key.part.dmodq) + utils.addRSAMissing(key); + der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); + der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); + der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); +} - var h = options.headers[i].toLowerCase(); +function writePkcs1DSAPrivate(der, key) { + var ver = Buffer.from([0]); + der.writeBuffer(ver, asn1.Ber.Integer); - if (h === 'request-line') { - if (!options.strict) { - /** - * We allow headers from the older spec drafts if strict parsing isn't - * specified in options. - */ - stringToSign += - request.method + ' ' + request.path + ' HTTP/' + - options.httpVersion; - } else { - /* Strict parsing doesn't allow older draft headers. */ - throw (new StrictParsingError('request-line is not a valid header ' + - 'with strict parsing enabled.')); - } - } else if (h === '(request-target)') { - stringToSign += - '(request-target): ' + request.method.toLowerCase() + ' ' + - request.path; - } else { - var value = request.getHeader(h); - if (value === undefined || value === '') { - throw new MissingHeaderError(h + ' was not in the request'); - } - stringToSign += h + ': ' + value; - } + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); + der.writeBuffer(key.part.y.data, asn1.Ber.Integer); + der.writeBuffer(key.part.x.data, asn1.Ber.Integer); +} - if ((i + 1) < options.headers.length) - stringToSign += '\n'; - } +function writePkcs1DSAPublic(der, key) { + der.writeBuffer(key.part.y.data, asn1.Ber.Integer); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); +} - /* This is just for unit tests. */ - if (request.hasOwnProperty('_stringToSign')) { - request._stringToSign = stringToSign; - } +function writePkcs1ECDSAPublic(der, key) { + der.startSequence(); - var signature; - if (alg[0] === 'hmac') { - if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) - throw (new TypeError('options.key must be a string or Buffer')); + der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ + var curve = key.part.curve.data.toString(); + var curveOid = algs.curves[curve].pkcs8oid; + assert.string(curveOid, 'a known ECDSA named curve'); + der.writeOID(curveOid); - var hmac = crypto.createHmac(alg[1].toUpperCase(), options.key); - hmac.update(stringToSign); - signature = hmac.digest('base64'); + der.endSequence(); - } else { - var key = options.key; - if (typeof (key) === 'string' || Buffer.isBuffer(key)) - key = sshpk.parsePrivateKey(options.key); + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); +} - assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), - 'options.key must be a sshpk.PrivateKey'); +function writePkcs1ECDSAPrivate(der, key) { + var ver = Buffer.from([1]); + der.writeBuffer(ver, asn1.Ber.Integer); - if (!PK_ALGOS[key.type]) { - throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + - 'keys are not supported')); - } + der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); - if (alg[0] !== undefined && key.type !== alg[0]) { - throw (new InvalidAlgorithmError('options.key must be a ' + - alg[0].toUpperCase() + ' key, was given a ' + - key.type.toUpperCase() + ' key instead')); - } + der.startSequence(0xa0); + var curve = key.part.curve.data.toString(); + var curveOid = algs.curves[curve].pkcs8oid; + assert.string(curveOid, 'a known ECDSA named curve'); + der.writeOID(curveOid); + der.endSequence(); - var signer = key.createSign(alg[1]); - signer.update(stringToSign); - var sigObj = signer.sign(); - if (!HASH_ALGOS[sigObj.hashAlgorithm]) { - throw (new InvalidAlgorithmError(sigObj.hashAlgorithm.toUpperCase() + - ' is not a supported hash algorithm')); - } - options.algorithm = key.type + '-' + sigObj.hashAlgorithm; - signature = sigObj.toString(); - assert.notStrictEqual(signature, '', 'empty signature produced'); - } + der.startSequence(0xa1); + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); + der.endSequence(); +} - var authzHeaderName = options.authorizationHeaderName || 'Authorization'; +function writePkcs1EdDSAPrivate(der, key) { + var ver = Buffer.from([1]); + der.writeBuffer(ver, asn1.Ber.Integer); - request.setHeader(authzHeaderName, sprintf(AUTHZ_FMT, - options.keyId, - options.algorithm, - options.headers.join(' '), - signature)); + der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); - return true; - } + der.startSequence(0xa0); + der.writeOID('1.3.101.112'); + der.endSequence(); -}; + der.startSequence(0xa1); + utils.writeBitString(der, key.part.A.data); + der.endSequence(); +} + +function writePkcs1EdDSAPublic(der, key) { + throw (new Error('Public keys are not supported for EdDSA PKCS#1')); +} /***/ }), -/***/ 446: -/***/ (function(module) { +/***/ 455: +/***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -var isArray = Array.isArray; -var keyList = Object.keys; -var hasProp = Object.prototype.hasOwnProperty; +var http = __webpack_require__(605) +var https = __webpack_require__(211) +var url = __webpack_require__(835) +var util = __webpack_require__(669) +var stream = __webpack_require__(413) +var zlib = __webpack_require__(761) +var aws2 = __webpack_require__(942) +var aws4 = __webpack_require__(658) +var httpSignature = __webpack_require__(789) +var mime = __webpack_require__(779) +var caseless = __webpack_require__(254) +var ForeverAgent = __webpack_require__(792) +var FormData = __webpack_require__(928) +var extend = __webpack_require__(374) +var isstream = __webpack_require__(382) +var isTypedArray = __webpack_require__(944).strict +var helpers = __webpack_require__(810) +var cookies = __webpack_require__(602) +var getProxyFromURI = __webpack_require__(721) +var Querystring = __webpack_require__(629).Querystring +var Har = __webpack_require__(416).Har +var Auth = __webpack_require__(554).Auth +var OAuth = __webpack_require__(287).OAuth +var hawk = __webpack_require__(964) +var Multipart = __webpack_require__(469).Multipart +var Redirect = __webpack_require__(552).Redirect +var Tunnel = __webpack_require__(461).Tunnel +var now = __webpack_require__(742) +var Buffer = __webpack_require__(149).Buffer -module.exports = function equal(a, b) { - if (a === b) return true; +var safeStringify = helpers.safeStringify +var isReadStream = helpers.isReadStream +var toBase64 = helpers.toBase64 +var defer = helpers.defer +var copy = helpers.copy +var version = helpers.version +var globalCookieJar = cookies.jar() - if (a && b && typeof a == 'object' && typeof b == 'object') { - var arrA = isArray(a) - , arrB = isArray(b) - , i - , length - , key; +var globalPool = {} - if (arrA && arrB) { - length = a.length; - if (length != b.length) return false; - for (i = length; i-- !== 0;) - if (!equal(a[i], b[i])) return false; - return true; +function filterForNonReserved (reserved, options) { + // Filter out properties that are not reserved. + // Reserved values are passed in at call site. + + var object = {} + for (var i in options) { + var notReserved = (reserved.indexOf(i) === -1) + if (notReserved) { + object[i] = options[i] } + } + return object +} - if (arrA != arrB) return false; +function filterOutReservedFunctions (reserved, options) { + // Filter out properties that are functions and are reserved. + // Reserved values are passed in at call site. - var dateA = a instanceof Date - , dateB = b instanceof Date; - if (dateA != dateB) return false; - if (dateA && dateB) return a.getTime() == b.getTime(); + var object = {} + for (var i in options) { + var isReserved = !(reserved.indexOf(i) === -1) + var isFunction = (typeof options[i] === 'function') + if (!(isReserved && isFunction)) { + object[i] = options[i] + } + } + return object +} - var regexpA = a instanceof RegExp - , regexpB = b instanceof RegExp; - if (regexpA != regexpB) return false; - if (regexpA && regexpB) return a.toString() == b.toString(); +// Return a simpler request object to allow serialization +function requestToJSON () { + var self = this + return { + uri: self.uri, + method: self.method, + headers: self.headers + } +} - var keys = keyList(a); - length = keys.length; +// Return a simpler response object to allow serialization +function responseToJSON () { + var self = this + return { + statusCode: self.statusCode, + body: self.body, + headers: self.headers, + request: requestToJSON.call(self.request) + } +} - if (length !== keyList(b).length) - return false; +function Request (options) { + // if given the method property in options, set property explicitMethod to true - for (i = length; i-- !== 0;) - if (!hasProp.call(b, keys[i])) return false; + // extend the Request instance with any non-reserved properties + // remove any reserved functions from the options object + // set Request instance to be readable and writable + // call init - for (i = length; i-- !== 0;) { - key = keys[i]; - if (!equal(a[key], b[key])) return false; - } + var self = this - return true; + // start with HAR, then override with additional options + if (options.har) { + self._har = new Har(self) + options = self._har.options(options) } - return a!==a && b!==b; -}; + stream.Stream.call(self) + var reserved = Object.keys(Request.prototype) + var nonReserved = filterForNonReserved(reserved, options) + extend(self, nonReserved) + options = filterOutReservedFunctions(reserved, options) -/***/ }), + self.readable = true + self.writable = true + if (options.method) { + self.explicitMethod = true + } + self._qs = new Querystring(self) + self._auth = new Auth(self) + self._oauth = new OAuth(self) + self._multipart = new Multipart(self) + self._redirect = new Redirect(self) + self._tunnel = new Tunnel(self) + self.init(options) +} -/***/ 449: -/***/ (function(module) { +util.inherits(Request, stream.Stream) -"use strict"; +// Debugging +Request.debug = process.env.NODE_DEBUG && /\brequest\b/.test(process.env.NODE_DEBUG) +function debug () { + if (Request.debug) { + console.error('REQUEST %s', util.format.apply(util, arguments)) + } +} +Request.prototype.debug = debug -module.exports = function generate_ref(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $async, $refCode; - if ($schema == '#' || $schema == '#/') { - if (it.isRoot) { - $async = it.async; - $refCode = 'validate'; - } else { - $async = it.root.schema.$async === true; - $refCode = 'root.refVal[0]'; +Request.prototype.init = function (options) { + // init() contains all the code to setup the request object. + // the actual outgoing request is not started until start() is called + // this function is called from both the constructor and on redirect. + var self = this + if (!options) { + options = {} + } + self.headers = self.headers ? copy(self.headers) : {} + + // Delete headers with value undefined since they break + // ClientRequest.OutgoingMessage.setHeader in node 0.12 + for (var headerName in self.headers) { + if (typeof self.headers[headerName] === 'undefined') { + delete self.headers[headerName] } - } else { - var $refVal = it.resolveRef(it.baseId, $schema, it.isRoot); - if ($refVal === undefined) { - var $message = it.MissingRefError.message(it.baseId, $schema); - if (it.opts.missingRefs == 'fail') { - it.logger.error($message); - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('$ref') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { ref: \'' + (it.util.escapeQuotes($schema)) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'can\\\'t resolve reference ' + (it.util.escapeQuotes($schema)) + '\' '; - } - if (it.opts.verbose) { - out += ' , schema: ' + (it.util.toQuotedString($schema)) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - if ($breakOnError) { - out += ' if (false) { '; - } - } else if (it.opts.missingRefs == 'ignore') { - it.logger.warn($message); - if ($breakOnError) { - out += ' if (true) { '; - } - } else { - throw new it.MissingRefError(it.baseId, $schema, $message); - } - } else if ($refVal.inline) { - var $it = it.util.copy(it); - $it.level++; - var $nextValid = 'valid' + $it.level; - $it.schema = $refVal.schema; - $it.schemaPath = ''; - $it.errSchemaPath = $schema; - var $code = it.validate($it).replace(/validate\.schema/g, $refVal.code); - out += ' ' + ($code) + ' '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; + } + + caseless.httpify(self, self.headers) + + if (!self.method) { + self.method = options.method || 'GET' + } + if (!self.localAddress) { + self.localAddress = options.localAddress + } + + self._qs.init(options) + + debug(options) + if (!self.pool && self.pool !== false) { + self.pool = globalPool + } + self.dests = self.dests || [] + self.__isRequestRequest = true + + // Protect against double callback + if (!self._callback && self.callback) { + self._callback = self.callback + self.callback = function () { + if (self._callbackCalled) { + return // Print a warning maybe? } - } else { - $async = $refVal.$async === true || (it.async && $refVal.$async !== false); - $refCode = $refVal.code; + self._callbackCalled = true + self._callback.apply(self, arguments) } + self.on('error', self.callback.bind()) + self.on('complete', self.callback.bind(self, null)) } - if ($refCode) { - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; - if (it.opts.passContext) { - out += ' ' + ($refCode) + '.call(this, '; - } else { - out += ' ' + ($refCode) + '( '; - } - out += ' ' + ($data) + ', (dataPath || \'\')'; - if (it.errorPath != '""') { - out += ' + ' + (it.errorPath); - } - var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', - $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; - out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ', rootData) '; - var __callValidate = out; - out = $$outStack.pop(); - if ($async) { - if (!it.async) throw new Error('async schema referenced by sync schema'); - if ($breakOnError) { - out += ' var ' + ($valid) + '; '; - } - out += ' try { await ' + (__callValidate) + '; '; - if ($breakOnError) { - out += ' ' + ($valid) + ' = true; '; - } - out += ' } catch (e) { if (!(e instanceof ValidationError)) throw e; if (vErrors === null) vErrors = e.errors; else vErrors = vErrors.concat(e.errors); errors = vErrors.length; '; - if ($breakOnError) { - out += ' ' + ($valid) + ' = false; '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($valid) + ') { '; - } + + // People use this property instead all the time, so support it + if (!self.uri && self.url) { + self.uri = self.url + delete self.url + } + + // If there's a baseUrl, then use it as the base URL (i.e. uri must be + // specified as a relative path and is appended to baseUrl). + if (self.baseUrl) { + if (typeof self.baseUrl !== 'string') { + return self.emit('error', new Error('options.baseUrl must be a string')) + } + + if (typeof self.uri !== 'string') { + return self.emit('error', new Error('options.uri must be a string when using options.baseUrl')) + } + + if (self.uri.indexOf('//') === 0 || self.uri.indexOf('://') !== -1) { + return self.emit('error', new Error('options.uri must be a path when using options.baseUrl')) + } + + // Handle all cases to make sure that there's only one slash between + // baseUrl and uri. + var baseUrlEndsWithSlash = self.baseUrl.lastIndexOf('/') === self.baseUrl.length - 1 + var uriStartsWithSlash = self.uri.indexOf('/') === 0 + + if (baseUrlEndsWithSlash && uriStartsWithSlash) { + self.uri = self.baseUrl + self.uri.slice(1) + } else if (baseUrlEndsWithSlash || uriStartsWithSlash) { + self.uri = self.baseUrl + self.uri + } else if (self.uri === '') { + self.uri = self.baseUrl } else { - out += ' if (!' + (__callValidate) + ') { if (vErrors === null) vErrors = ' + ($refCode) + '.errors; else vErrors = vErrors.concat(' + ($refCode) + '.errors); errors = vErrors.length; } '; - if ($breakOnError) { - out += ' else { '; - } + self.uri = self.baseUrl + '/' + self.uri } + delete self.baseUrl } - return out; -} + // A URI is needed by this point, emit error if we haven't been able to get one + if (!self.uri) { + return self.emit('error', new Error('options.uri is a required argument')) + } -/***/ }), + // If a string URI/URL was given, parse it into a URL object + if (typeof self.uri === 'string') { + self.uri = url.parse(self.uri) + } -/***/ 454: -/***/ (function(module, __unusedexports, __webpack_require__) { + // Some URL objects are not from a URL parsed string and need href added + if (!self.uri.href) { + self.uri.href = url.format(self.uri) + } -var async = __webpack_require__(69) - , abort = __webpack_require__(768) - ; + // DEPRECATED: Warning for users of the old Unix Sockets URL Scheme + if (self.uri.protocol === 'unix:') { + return self.emit('error', new Error('`unix://` URL scheme is no longer supported. Please use the format `http://unix:SOCKET:PATH`')) + } -// API -module.exports = iterate; + // Support Unix Sockets + if (self.uri.host === 'unix') { + self.enableUnixSocket() + } -/** - * Iterates over each job object - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {object} state - current job status - * @param {function} callback - invoked when all elements processed - */ -function iterate(list, iterator, state, callback) -{ - // store current index - var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; + if (self.strictSSL === false) { + self.rejectUnauthorized = false + } - state.jobs[key] = runJob(iterator, key, list[key], function(error, output) - { - // don't repeat yourself - // skip secondary callbacks - if (!(key in state.jobs)) - { - return; + if (!self.uri.pathname) { self.uri.pathname = '/' } + + if (!(self.uri.host || (self.uri.hostname && self.uri.port)) && !self.uri.isUnix) { + // Invalid URI: it may generate lot of bad errors, like 'TypeError: Cannot call method `indexOf` of undefined' in CookieJar + // Detect and reject it as soon as possible + var faultyUri = url.format(self.uri) + var message = 'Invalid URI "' + faultyUri + '"' + if (Object.keys(options).length === 0) { + // No option ? This can be the sign of a redirect + // As this is a case where the user cannot do anything (they didn't call request directly with this URL) + // they should be warned that it can be caused by a redirection (can save some hair) + message += '. This can be caused by a crappy redirection.' } + // This error was fatal + self.abort() + return self.emit('error', new Error(message)) + } - // clean up jobs - delete state.jobs[key]; + if (!self.hasOwnProperty('proxy')) { + self.proxy = getProxyFromURI(self.uri) + } - if (error) - { - // don't process rest of the results - // stop still active jobs - // and reset the list - abort(state); - } - else - { - state.results[key] = output; + self.tunnel = self._tunnel.isEnabled() + if (self.proxy) { + self._tunnel.setup(options) + } + + self._redirect.onRequest(options) + + self.setHost = false + if (!self.hasHeader('host')) { + var hostHeaderName = self.originalHostHeaderName || 'host' + self.setHeader(hostHeaderName, self.uri.host) + // Drop :port suffix from Host header if known protocol. + if (self.uri.port) { + if ((self.uri.port === '80' && self.uri.protocol === 'http:') || + (self.uri.port === '443' && self.uri.protocol === 'https:')) { + self.setHeader(hostHeaderName, self.uri.hostname) + } } + self.setHost = true + } - // return salvaged results - callback(error, state.results); - }); -} + self.jar(self._jar || options.jar) -/** - * Runs iterator over provided job element - * - * @param {function} iterator - iterator to invoke - * @param {string|number} key - key/index of the element in the list of jobs - * @param {mixed} item - job description - * @param {function} callback - invoked after iterator is done with the job - * @returns {function|mixed} - job abort function or something else - */ -function runJob(iterator, key, item, callback) -{ - var aborter; + if (!self.uri.port) { + if (self.uri.protocol === 'http:') { self.uri.port = 80 } else if (self.uri.protocol === 'https:') { self.uri.port = 443 } + } - // allow shortcut if iterator expects only two arguments - if (iterator.length == 2) - { - aborter = iterator(item, async(callback)); + if (self.proxy && !self.tunnel) { + self.port = self.proxy.port + self.host = self.proxy.hostname + } else { + self.port = self.uri.port + self.host = self.uri.hostname } - // otherwise go with full three arguments - else - { - aborter = iterator(item, key, async(callback)); + + if (options.form) { + self.form(options.form) } - return aborter; -} + if (options.formData) { + var formData = options.formData + var requestForm = self.form() + var appendFormValue = function (key, value) { + if (value && value.hasOwnProperty('value') && value.hasOwnProperty('options')) { + requestForm.append(key, value.value, value.options) + } else { + requestForm.append(key, value) + } + } + for (var formKey in formData) { + if (formData.hasOwnProperty(formKey)) { + var formValue = formData[formKey] + if (formValue instanceof Array) { + for (var j = 0; j < formValue.length; j++) { + appendFormValue(formKey, formValue[j]) + } + } else { + appendFormValue(formKey, formValue) + } + } + } + } + if (options.qs) { + self.qs(options.qs) + } -/***/ }), + if (self.uri.path) { + self.path = self.uri.path + } else { + self.path = self.uri.pathname + (self.uri.search || '') + } -/***/ 461: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + if (self.path.length === 0) { + self.path = '/' + } -"use strict"; + // Auth must happen last in case signing is dependent on other headers + if (options.aws) { + self.aws(options.aws) + } + if (options.hawk) { + self.hawk(options.hawk) + } -var url = __webpack_require__(835) -var qs = __webpack_require__(208) -var caseless = __webpack_require__(48) -var uuid = __webpack_require__(926) -var oauth = __webpack_require__(221) -var crypto = __webpack_require__(417) -var Buffer = __webpack_require__(612).Buffer + if (options.httpSignature) { + self.httpSignature(options.httpSignature) + } -function OAuth (request) { - this.request = request - this.params = null -} + if (options.auth) { + if (Object.prototype.hasOwnProperty.call(options.auth, 'username')) { + options.auth.user = options.auth.username + } + if (Object.prototype.hasOwnProperty.call(options.auth, 'password')) { + options.auth.pass = options.auth.password + } -OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { - var oa = {} - for (var i in _oauth) { - oa['oauth_' + i] = _oauth[i] + self.auth( + options.auth.user, + options.auth.pass, + options.auth.sendImmediately, + options.auth.bearer + ) } - if (!oa.oauth_version) { - oa.oauth_version = '1.0' + + if (self.gzip && !self.hasHeader('accept-encoding')) { + self.setHeader('accept-encoding', 'gzip, deflate') } - if (!oa.oauth_timestamp) { - oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() + + if (self.uri.auth && !self.hasHeader('authorization')) { + var uriAuthPieces = self.uri.auth.split(':').map(function (item) { return self._qs.unescape(item) }) + self.auth(uriAuthPieces[0], uriAuthPieces.slice(1).join(':'), true) } - if (!oa.oauth_nonce) { - oa.oauth_nonce = uuid().replace(/-/g, '') + + if (!self.tunnel && self.proxy && self.proxy.auth && !self.hasHeader('proxy-authorization')) { + var proxyAuthPieces = self.proxy.auth.split(':').map(function (item) { return self._qs.unescape(item) }) + var authHeader = 'Basic ' + toBase64(proxyAuthPieces.join(':')) + self.setHeader('proxy-authorization', authHeader) } - if (!oa.oauth_signature_method) { - oa.oauth_signature_method = 'HMAC-SHA1' + + if (self.proxy && !self.tunnel) { + self.path = (self.uri.protocol + '//' + self.uri.host + self.path) } - var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase - delete oa.oauth_consumer_secret - delete oa.oauth_private_key + if (options.json) { + self.json(options.json) + } + if (options.multipart) { + self.multipart(options.multipart) + } - var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase - delete oa.oauth_token_secret + if (options.time) { + self.timing = true - var realm = oa.oauth_realm - delete oa.oauth_realm - delete oa.oauth_transport_method + // NOTE: elapsedTime is deprecated in favor of .timings + self.elapsedTime = self.elapsedTime || 0 + } - var baseurl = uri.protocol + '//' + uri.host + uri.pathname - var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) + function setContentLength () { + if (isTypedArray(self.body)) { + self.body = Buffer.from(self.body) + } - oa.oauth_signature = oauth.sign( - oa.oauth_signature_method, - method, - baseurl, - params, - consumer_secret_or_private_key, // eslint-disable-line camelcase - token_secret // eslint-disable-line camelcase - ) + if (!self.hasHeader('content-length')) { + var length + if (typeof self.body === 'string') { + length = Buffer.byteLength(self.body) + } else if (Array.isArray(self.body)) { + length = self.body.reduce(function (a, b) { return a + b.length }, 0) + } else { + length = self.body.length + } - if (realm) { - oa.realm = realm + if (length) { + self.setHeader('content-length', length) + } else { + self.emit('error', new Error('Argument error, options.body.')) + } + } + } + if (self.body && !isstream(self.body)) { + setContentLength() } - return oa -} - -OAuth.prototype.buildBodyHash = function (_oauth, body) { - if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { - this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + - ' signature_method not supported with body_hash signing.')) + if (options.oauth) { + self.oauth(options.oauth) + } else if (self._oauth.params && self.hasHeader('authorization')) { + self.oauth(self._oauth.params) } - var shasum = crypto.createHash('sha1') - shasum.update(body || '') - var sha1 = shasum.digest('hex') + var protocol = self.proxy && !self.tunnel ? self.proxy.protocol : self.uri.protocol + var defaultModules = {'http:': http, 'https:': https} + var httpModules = self.httpModules || {} - return Buffer.from(sha1, 'hex').toString('base64') -} + self.httpModule = httpModules[protocol] || defaultModules[protocol] -OAuth.prototype.concatParams = function (oa, sep, wrap) { - wrap = wrap || '' + if (!self.httpModule) { + return self.emit('error', new Error('Invalid protocol: ' + protocol)) + } - var params = Object.keys(oa).filter(function (i) { - return i !== 'realm' && i !== 'oauth_signature' - }).sort() + if (options.ca) { + self.ca = options.ca + } - if (oa.realm) { - params.splice(0, 0, 'realm') + if (!self.agent) { + if (options.agentOptions) { + self.agentOptions = options.agentOptions + } + + if (options.agentClass) { + self.agentClass = options.agentClass + } else if (options.forever) { + var v = version() + // use ForeverAgent in node 0.10- only + if (v.major === 0 && v.minor <= 10) { + self.agentClass = protocol === 'http:' ? ForeverAgent : ForeverAgent.SSL + } else { + self.agentClass = self.httpModule.Agent + self.agentOptions = self.agentOptions || {} + self.agentOptions.keepAlive = true + } + } else { + self.agentClass = self.httpModule.Agent + } } - params.push('oauth_signature') - return params.map(function (i) { - return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap - }).join(sep) -} + if (self.pool === false) { + self.agent = false + } else { + self.agent = self.agent || self.getNewAgent() + } -OAuth.prototype.onRequest = function (_oauth) { - var self = this - self.params = _oauth + self.on('pipe', function (src) { + if (self.ntick && self._started) { + self.emit('error', new Error('You cannot pipe to this stream after the outbound request has started.')) + } + self.src = src + if (isReadStream(src)) { + if (!self.hasHeader('content-type')) { + self.setHeader('content-type', mime.lookup(src.path)) + } + } else { + if (src.headers) { + for (var i in src.headers) { + if (!self.hasHeader(i)) { + self.setHeader(i, src.headers[i]) + } + } + } + if (self._json && !self.hasHeader('content-type')) { + self.setHeader('content-type', 'application/json') + } + if (src.method && !self.explicitMethod) { + self.method = src.method + } + } - var uri = self.request.uri || {} - var method = self.request.method || '' - var headers = caseless(self.request.headers) - var body = self.request.body || '' - var qsLib = self.request.qsLib || qs + // self.on('pipe', function () { + // console.error('You have already piped to this stream. Pipeing twice is likely to break the request.') + // }) + }) - var form - var query - var contentType = headers.get('content-type') || '' - var formContentType = 'application/x-www-form-urlencoded' - var transport = _oauth.transport_method || 'header' + defer(function () { + if (self._aborted) { + return + } - if (contentType.slice(0, formContentType.length) === formContentType) { - contentType = formContentType - form = body + var end = function () { + if (self._form) { + if (!self._auth.hasAuth) { + self._form.pipe(self) + } else if (self._auth.hasAuth && self._auth.sentAuth) { + self._form.pipe(self) + } + } + if (self._multipart && self._multipart.chunked) { + self._multipart.body.pipe(self) + } + if (self.body) { + if (isstream(self.body)) { + self.body.pipe(self) + } else { + setContentLength() + if (Array.isArray(self.body)) { + self.body.forEach(function (part) { + self.write(part) + }) + } else { + self.write(self.body) + } + self.end() + } + } else if (self.requestBodyStream) { + console.warn('options.requestBodyStream is deprecated, please pass the request object to stream.pipe.') + self.requestBodyStream.pipe(self) + } else if (!self.src) { + if (self._auth.hasAuth && !self._auth.sentAuth) { + self.end() + return + } + if (self.method !== 'GET' && typeof self.method !== 'undefined') { + self.setHeader('content-length', 0) + } + self.end() + } + } + + if (self._form && !self.hasHeader('content-length')) { + // Before ending the request, we had to compute the length of the whole form, asyncly + self.setHeader(self._form.getHeaders(), true) + self._form.getLength(function (err, length) { + if (!err && !isNaN(length)) { + self.setHeader('content-length', length) + } + end() + }) + } else { + end() + } + + self.ntick = true + }) +} + +Request.prototype.getNewAgent = function () { + var self = this + var Agent = self.agentClass + var options = {} + if (self.agentOptions) { + for (var i in self.agentOptions) { + options[i] = self.agentOptions[i] + } } - if (uri.query) { - query = uri.query + if (self.ca) { + options.ca = self.ca } - if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { - self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + - 'and content-type ' + formContentType)) + if (self.ciphers) { + options.ciphers = self.ciphers + } + if (self.secureProtocol) { + options.secureProtocol = self.secureProtocol + } + if (self.secureOptions) { + options.secureOptions = self.secureOptions + } + if (typeof self.rejectUnauthorized !== 'undefined') { + options.rejectUnauthorized = self.rejectUnauthorized } - if (!form && typeof _oauth.body_hash === 'boolean') { - _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) + if (self.cert && self.key) { + options.key = self.key + options.cert = self.cert } - var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) - - switch (transport) { - case 'header': - self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) - break - - case 'query': - var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') - self.request.uri = url.parse(href) - self.request.path = self.request.uri.path - break - - case 'body': - self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') - break - - default: - self.request.emit('error', new Error('oauth: transport_method invalid')) + if (self.pfx) { + options.pfx = self.pfx } -} - -exports.OAuth = OAuth - - -/***/ }), - -/***/ 462: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var resolve = __webpack_require__(538); - -module.exports = { - Validation: errorSubclass(ValidationError), - MissingRef: errorSubclass(MissingRefError) -}; - - -function ValidationError(errors) { - this.message = 'validation failed'; - this.errors = errors; - this.ajv = this.validation = true; -} + if (self.passphrase) { + options.passphrase = self.passphrase + } -MissingRefError.message = function (baseId, ref) { - return 'can\'t resolve reference ' + ref + ' from id ' + baseId; -}; + var poolKey = '' + // different types of agents are in different pools + if (Agent !== self.httpModule.Agent) { + poolKey += Agent.name + } -function MissingRefError(baseId, ref, message) { - this.message = message || MissingRefError.message(baseId, ref); - this.missingRef = resolve.url(baseId, ref); - this.missingSchema = resolve.normalizeId(resolve.fullPath(this.missingRef)); -} + // ca option is only relevant if proxy or destination are https + var proxy = self.proxy + if (typeof proxy === 'string') { + proxy = url.parse(proxy) + } + var isHttps = (proxy && proxy.protocol === 'https:') || this.uri.protocol === 'https:' + if (isHttps) { + if (options.ca) { + if (poolKey) { + poolKey += ':' + } + poolKey += options.ca + } -function errorSubclass(Subclass) { - Subclass.prototype = Object.create(Error.prototype); - Subclass.prototype.constructor = Subclass; - return Subclass; -} + if (typeof options.rejectUnauthorized !== 'undefined') { + if (poolKey) { + poolKey += ':' + } + poolKey += options.rejectUnauthorized + } + if (options.cert) { + if (poolKey) { + poolKey += ':' + } + poolKey += options.cert.toString('ascii') + options.key.toString('ascii') + } -/***/ }), + if (options.pfx) { + if (poolKey) { + poolKey += ':' + } + poolKey += options.pfx.toString('ascii') + } -/***/ 466: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (options.ciphers) { + if (poolKey) { + poolKey += ':' + } + poolKey += options.ciphers + } -// Copyright 2018 Joyent, Inc. + if (options.secureProtocol) { + if (poolKey) { + poolKey += ':' + } + poolKey += options.secureProtocol + } -module.exports = { - read: read, - write: write -}; + if (options.secureOptions) { + if (poolKey) { + poolKey += ':' + } + poolKey += options.secureOptions + } + } -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); + if (self.pool === globalPool && !poolKey && Object.keys(options).length === 0 && self.httpModule.globalAgent) { + // not doing anything special. Use the globalAgent + return self.httpModule.globalAgent + } -var pem = __webpack_require__(207); -var ssh = __webpack_require__(991); -var rfc4253 = __webpack_require__(563); -var dnssec = __webpack_require__(962); -var putty = __webpack_require__(314); + // we're using a stored agent. Make sure it's protocol-specific + poolKey = self.uri.protocol + poolKey -var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; + // generate a new agent for this setting if none yet exists + if (!self.pool[poolKey]) { + self.pool[poolKey] = new Agent(options) + // properly set maxSockets on new agents + if (self.pool.maxSockets) { + self.pool[poolKey].maxSockets = self.pool.maxSockets + } + } -function read(buf, options) { - if (typeof (buf) === 'string') { - if (buf.trim().match(/^[-]+[ ]*BEGIN/)) - return (pem.read(buf, options)); - if (buf.match(/^\s*ssh-[a-z]/)) - return (ssh.read(buf, options)); - if (buf.match(/^\s*ecdsa-/)) - return (ssh.read(buf, options)); - if (buf.match(/^putty-user-key-file-2:/i)) - return (putty.read(buf, options)); - if (findDNSSECHeader(buf)) - return (dnssec.read(buf, options)); - buf = Buffer.from(buf, 'binary'); - } else { - assert.buffer(buf); - if (findPEMHeader(buf)) - return (pem.read(buf, options)); - if (findSSHHeader(buf)) - return (ssh.read(buf, options)); - if (findPuTTYHeader(buf)) - return (putty.read(buf, options)); - if (findDNSSECHeader(buf)) - return (dnssec.read(buf, options)); - } - if (buf.readUInt32BE(0) < buf.length) - return (rfc4253.read(buf, options)); - throw (new Error('Failed to auto-detect format of key')); + return self.pool[poolKey] } -function findPuTTYHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) - ++offset; - if (offset + 22 <= buf.length && - buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === - 'putty-user-key-file-2:') - return (true); - return (false); -} +Request.prototype.start = function () { + // start() is called once we are ready to send the outgoing HTTP request. + // this is usually called on the first write(), end() or on nextTick() + var self = this -function findSSHHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) - ++offset; - if (offset + 4 <= buf.length && - buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') - return (true); - if (offset + 6 <= buf.length && - buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') - return (true); - return (false); -} + if (self.timing) { + // All timings will be relative to this request's startTime. In order to do this, + // we need to capture the wall-clock start time (via Date), immediately followed + // by the high-resolution timer (via now()). While these two won't be set + // at the _exact_ same time, they should be close enough to be able to calculate + // high-resolution, monotonically non-decreasing timestamps relative to startTime. + var startTime = new Date().getTime() + var startTimeNow = now() + } -function findPEMHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10)) - ++offset; - if (buf[offset] !== 45) - return (false); - while (offset < buf.length && - (buf[offset] === 45)) - ++offset; - while (offset < buf.length && - (buf[offset] === 32)) - ++offset; - if (offset + 5 > buf.length || - buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') - return (false); - return (true); -} + if (self._aborted) { + return + } -function findDNSSECHeader(buf) { - // private case first - if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) - return (false); - var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); - if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) - return (true); + self._started = true + self.method = self.method || 'GET' + self.href = self.uri.href - // public-key RFC3110 ? - // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' - // skip any comment-lines - if (typeof (buf) !== 'string') { - buf = buf.toString('ascii'); - } - var lines = buf.split('\n'); - var line = 0; - /* JSSTYLED */ - while (lines[line].match(/^\;/)) - line++; - if (lines[line].toString('ascii').match(/\. IN KEY /)) - return (true); - if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) - return (true); - return (false); -} + if (self.src && self.src.stat && self.src.stat.size && !self.hasHeader('content-length')) { + self.setHeader('content-length', self.src.stat.size) + } + if (self._aws) { + self.aws(self._aws, true) + } -function write(key, options) { - throw (new Error('"auto" format cannot be used for writing')); -} + // We have a method named auth, which is completely different from the http.request + // auth option. If we don't remove it, we're gonna have a bad time. + var reqOptions = copy(self) + delete reqOptions.auth + debug('make request', self.uri.href) -/***/ }), + // node v6.8.0 now supports a `timeout` value in `http.request()`, but we + // should delete it for now since we handle timeouts manually for better + // consistency with node versions before v6.8.0 + delete reqOptions.timeout -/***/ 471: -/***/ (function(module) { + try { + self.req = self.httpModule.request(reqOptions) + } catch (err) { + self.emit('error', err) + return + } -"use strict"; + if (self.timing) { + self.startTime = startTime + self.startTimeNow = startTimeNow -module.exports = function generate_custom(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $rule = this, - $definition = 'definition' + $lvl, - $rDef = $rule.definition, - $closingBraces = ''; - var $compile, $inline, $macro, $ruleValidate, $validateCode; - if ($isData && $rDef.$data) { - $validateCode = 'keywordValidate' + $lvl; - var $validateSchema = $rDef.validateSchema; - out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; - } else { - $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); - if (!$ruleValidate) return; - $schemaValue = 'validate.schema' + $schemaPath; - $validateCode = $ruleValidate.code; - $compile = $rDef.compile; - $inline = $rDef.inline; - $macro = $rDef.macro; - } - var $ruleErrs = $validateCode + '.errors', - $i = 'i' + $lvl, - $ruleErr = 'ruleErr' + $lvl, - $asyncKeyword = $rDef.async; - if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); - if (!($inline || $macro)) { - out += '' + ($ruleErrs) + ' = null;'; - } - out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; - if ($isData && $rDef.$data) { - $closingBraces += '}'; - out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; - if ($validateSchema) { - $closingBraces += '}'; - out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; - } - } - if ($inline) { - if ($rDef.statements) { - out += ' ' + ($ruleValidate.validate) + ' '; - } else { - out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; '; - } - } else if ($macro) { - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - $it.schema = $ruleValidate.validate; - $it.schemaPath = ''; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var $code = it.validate($it).replace(/validate\.schema/g, $validateCode); - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' ' + ($code); - } else { - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; - out += ' ' + ($validateCode) + '.call( '; - if (it.opts.passContext) { - out += 'this'; - } else { - out += 'self'; - } - if ($compile || $rDef.schema === false) { - out += ' , ' + ($data) + ' '; - } else { - out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' '; - } - out += ' , (dataPath || \'\')'; - if (it.errorPath != '""') { - out += ' + ' + (it.errorPath); - } - var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', - $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; - out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) '; - var def_callRuleValidate = out; - out = $$outStack.pop(); - if ($rDef.errors === false) { - out += ' ' + ($valid) + ' = '; - if ($asyncKeyword) { - out += 'await '; - } - out += '' + (def_callRuleValidate) + '; '; - } else { - if ($asyncKeyword) { - $ruleErrs = 'customErrors' + $lvl; - out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } '; - } else { - out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; '; - } - } - } - if ($rDef.modifying) { - out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];'; + // Timing values will all be relative to startTime (by comparing to startTimeNow + // so we have an accurate clock) + self.timings = {} } - out += '' + ($closingBraces); - if ($rDef.valid) { - if ($breakOnError) { - out += ' if (true) { '; - } - } else { - out += ' if ( '; - if ($rDef.valid === undefined) { - out += ' !'; - if ($macro) { - out += '' + ($nextValid); - } else { - out += '' + ($valid); - } - } else { - out += ' ' + (!$rDef.valid) + ' '; - } - out += ') { '; - $errorKeyword = $rule.keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - var def_customError = out; - out = $$outStack.pop(); - if ($inline) { - if ($rDef.errors) { - if ($rDef.errors != 'full') { - out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + ' -1 + // clean up timing event listeners if needed on error + self.req.once('error', function () { + socket.removeListener('lookup', onLookupTiming) + socket.removeListener('connect', onConnectTiming) + }) + } + } - return {hostname: zoneHost, port: zonePort, hasPort: hasPort} -} + var setReqTimeout = function () { + // This timeout sets the amount of time to wait *between* bytes sent + // from the server once connected. + // + // In particular, it's useful for erroring if the server fails to send + // data halfway through streaming a response. + self.req.setTimeout(timeout, function () { + if (self.req) { + self.abort() + var e = new Error('ESOCKETTIMEDOUT') + e.code = 'ESOCKETTIMEDOUT' + e.connect = false + self.emit('error', e) + } + }) + } + if (timeout !== undefined) { + // Only start the connection timer if we're actually connecting a new + // socket, otherwise if we're already connected (because this is a + // keep-alive connection) do not bother. This is important since we won't + // get a 'connect' event for an already connected socket. + if (isConnecting) { + var onReqSockConnect = function () { + socket.removeListener('connect', onReqSockConnect) + clearTimeout(self.timeoutTimer) + self.timeoutTimer = null + setReqTimeout() + } -function uriInNoProxy (uri, noProxy) { - var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') - var hostname = formatHostname(uri.hostname) - var noProxyList = noProxy.split(',') + socket.on('connect', onReqSockConnect) - // iterate through the noProxyList until it finds a match. - return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { - var isMatchedAt = hostname.indexOf(noProxyZone.hostname) - var hostnameMatched = ( - isMatchedAt > -1 && - (isMatchedAt === hostname.length - noProxyZone.hostname.length) - ) + self.req.on('error', function (err) { // eslint-disable-line handle-callback-err + socket.removeListener('connect', onReqSockConnect) + }) - if (noProxyZone.hasPort) { - return (port === noProxyZone.port) && hostnameMatched + // Set a timeout in memory - this block will throw if the server takes more + // than `timeout` to write the HTTP status and headers (corresponding to + // the on('response') event on the client). NB: this measures wall-clock + // time, not the time between bytes sent by the server. + self.timeoutTimer = setTimeout(function () { + socket.removeListener('connect', onReqSockConnect) + self.abort() + var e = new Error('ETIMEDOUT') + e.code = 'ETIMEDOUT' + e.connect = true + self.emit('error', e) + }, timeout) + } else { + // We're already connected + setReqTimeout() + } } - - return hostnameMatched + self.emit('socket', socket) }) -} - -function getProxyFromURI (uri) { - // Decide the proper request proxy to use based on the request URI object and the - // environmental variables (NO_PROXY, HTTP_PROXY, etc.) - // respect NO_PROXY environment variables (see: http://lynx.isc.org/current/breakout/lynx_help/keystrokes/environments.html) - - var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' - // if the noProxy is a wildcard then return null + self.emit('request', self.req) +} - if (noProxy === '*') { - return null +Request.prototype.onRequestError = function (error) { + var self = this + if (self._aborted) { + return } - - // if the noProxy is not empty and the uri is found return null - - if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { - return null + if (self.req && self.req._reusedSocket && error.code === 'ECONNRESET' && + self.agent.addRequestNoreuse) { + self.agent = { addRequest: self.agent.addRequestNoreuse.bind(self.agent) } + self.start() + self.req.end() + return + } + if (self.timeout && self.timeoutTimer) { + clearTimeout(self.timeoutTimer) + self.timeoutTimer = null } + self.emit('error', error) +} - // Check for HTTP or HTTPS Proxy in environment Else default to null +Request.prototype.onRequestResponse = function (response) { + var self = this - if (uri.protocol === 'http:') { - return process.env.HTTP_PROXY || - process.env.http_proxy || null + if (self.timing) { + self.timings.response = now() - self.startTimeNow } - if (uri.protocol === 'https:') { - return process.env.HTTPS_PROXY || - process.env.https_proxy || - process.env.HTTP_PROXY || - process.env.http_proxy || null - } + debug('onRequestResponse', self.uri.href, response.statusCode, response.headers) + response.on('end', function () { + if (self.timing) { + self.timings.end = now() - self.startTimeNow + response.timingStart = self.startTime - // if none of that works, return null - // (What uri protocol are you using then?) + // fill in the blanks for any periods that didn't trigger, such as + // no lookup or connect due to keep alive + if (!self.timings.socket) { + self.timings.socket = 0 + } + if (!self.timings.lookup) { + self.timings.lookup = self.timings.socket + } + if (!self.timings.connect) { + self.timings.connect = self.timings.lookup + } + if (!self.timings.response) { + self.timings.response = self.timings.connect + } - return null -} + debug('elapsed time', self.timings.end) -module.exports = getProxyFromURI + // elapsedTime includes all redirects + self.elapsedTime += Math.round(self.timings.end) + // NOTE: elapsedTime is deprecated in favor of .timings + response.elapsedTime = self.elapsedTime -/***/ }), + // timings is just for the final fetch + response.timings = self.timings -/***/ 477: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + // pre-calculate phase timings as well + response.timingPhases = { + wait: self.timings.socket, + dns: self.timings.lookup - self.timings.socket, + tcp: self.timings.connect - self.timings.lookup, + firstByte: self.timings.response - self.timings.connect, + download: self.timings.end - self.timings.response, + total: self.timings.end + } + } + debug('response end', self.uri.href, response.statusCode, response.headers) + }) -var crypto = __webpack_require__(417); -var BigInteger = __webpack_require__(36).BigInteger; -var ECPointFp = __webpack_require__(396).ECPointFp; -var Buffer = __webpack_require__(601).Buffer; -exports.ECCurves = __webpack_require__(798); + if (self._aborted) { + debug('aborted', self.uri.href) + response.resume() + return + } -// zero prepad -function unstupid(hex,len) -{ - return (hex.length >= len) ? hex : unstupid("0"+hex,len); -} + self.response = response + response.request = self + response.toJSON = responseToJSON -exports.ECKey = function(curve, key, isPublic) -{ - var priv; - var c = curve(); - var n = c.getN(); - var bytes = Math.floor(n.bitLength()/8); + // XXX This is different on 0.10, because SSL is strict by default + if (self.httpModule === https && + self.strictSSL && (!response.hasOwnProperty('socket') || + !response.socket.authorized)) { + debug('strict ssl error', self.uri.href) + var sslErr = response.hasOwnProperty('socket') ? response.socket.authorizationError : self.uri.href + ' does not support SSL' + self.emit('error', new Error('SSL Error: ' + sslErr)) + return + } - if(key) - { - if(isPublic) - { - var curve = c.getCurve(); -// var x = key.slice(1,bytes+1); // skip the 04 for uncompressed format -// var y = key.slice(bytes+1); -// this.P = new ECPointFp(curve, -// curve.fromBigInteger(new BigInteger(x.toString("hex"), 16)), -// curve.fromBigInteger(new BigInteger(y.toString("hex"), 16))); - this.P = curve.decodePointHex(key.toString("hex")); - }else{ - if(key.length != bytes) return false; - priv = new BigInteger(key.toString("hex"), 16); - } - }else{ - var n1 = n.subtract(BigInteger.ONE); - var r = new BigInteger(crypto.randomBytes(n.bitLength())); - priv = r.mod(n1).add(BigInteger.ONE); - this.P = c.getG().multiply(priv); + // Save the original host before any redirect (if it changes, we need to + // remove any authorization headers). Also remember the case of the header + // name because lots of broken servers expect Host instead of host and we + // want the caller to be able to specify this. + self.originalHost = self.getHeader('host') + if (!self.originalHostHeaderName) { + self.originalHostHeaderName = self.hasHeader('host') } - if(this.P) - { -// var pubhex = unstupid(this.P.getX().toBigInteger().toString(16),bytes*2)+unstupid(this.P.getY().toBigInteger().toString(16),bytes*2); -// this.PublicKey = Buffer.from("04"+pubhex,"hex"); - this.PublicKey = Buffer.from(c.getCurve().encodeCompressedPointHex(this.P),"hex"); + if (self.setHost) { + self.removeHeader('host') } - if(priv) - { - this.PrivateKey = Buffer.from(unstupid(priv.toString(16),bytes*2),"hex"); - this.deriveSharedSecret = function(key) - { - if(!key || !key.P) return false; - var S = key.P.multiply(priv); - return Buffer.from(unstupid(S.getX().toBigInteger().toString(16),bytes*2),"hex"); - } + if (self.timeout && self.timeoutTimer) { + clearTimeout(self.timeoutTimer) + self.timeoutTimer = null } -} - - - -/***/ }), - -/***/ 481: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. -var assert = __webpack_require__(976); -var util = __webpack_require__(669); + var targetCookieJar = (self._jar && self._jar.setCookie) ? self._jar : globalCookieJar + var addCookie = function (cookie) { + // set the cookie if it's domain in the href's domain. + try { + targetCookieJar.setCookie(cookie, self.uri.href, {ignoreError: true}) + } catch (e) { + self.emit('error', e) + } + } -function FingerprintFormatError(fp, format) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, FingerprintFormatError); - this.name = 'FingerprintFormatError'; - this.fingerprint = fp; - this.format = format; - this.message = 'Fingerprint format is not supported, or is invalid: '; - if (fp !== undefined) - this.message += ' fingerprint = ' + fp; - if (format !== undefined) - this.message += ' format = ' + format; -} -util.inherits(FingerprintFormatError, Error); + response.caseless = caseless(response.headers) -function InvalidAlgorithmError(alg) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, InvalidAlgorithmError); - this.name = 'InvalidAlgorithmError'; - this.algorithm = alg; - this.message = 'Algorithm "' + alg + '" is not supported'; -} -util.inherits(InvalidAlgorithmError, Error); + if (response.caseless.has('set-cookie') && (!self._disableCookies)) { + var headerName = response.caseless.has('set-cookie') + if (Array.isArray(response.headers[headerName])) { + response.headers[headerName].forEach(addCookie) + } else { + addCookie(response.headers[headerName]) + } + } -function KeyParseError(name, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, KeyParseError); - this.name = 'KeyParseError'; - this.format = format; - this.keyName = name; - this.innerErr = innerErr; - this.message = 'Failed to parse ' + name + ' as a valid ' + format + - ' format key: ' + innerErr.message; -} -util.inherits(KeyParseError, Error); + if (self._redirect.onResponse(response)) { + return // Ignore the rest of the response + } else { + // Be a good stream and emit end when the response is finished. + // Hack to emit end on close because of a core bug that never fires end + response.on('close', function () { + if (!self._ended) { + self.response.emit('end') + } + }) -function SignatureParseError(type, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, SignatureParseError); - this.name = 'SignatureParseError'; - this.type = type; - this.format = format; - this.innerErr = innerErr; - this.message = 'Failed to parse the given data as a ' + type + - ' signature in ' + format + ' format: ' + innerErr.message; -} -util.inherits(SignatureParseError, Error); + response.once('end', function () { + self._ended = true + }) -function CertificateParseError(name, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, CertificateParseError); - this.name = 'CertificateParseError'; - this.format = format; - this.certName = name; - this.innerErr = innerErr; - this.message = 'Failed to parse ' + name + ' as a valid ' + format + - ' format certificate: ' + innerErr.message; -} -util.inherits(CertificateParseError, Error); + var noBody = function (code) { + return ( + self.method === 'HEAD' || + // Informational + (code >= 100 && code < 200) || + // No Content + code === 204 || + // Not Modified + code === 304 + ) + } -function KeyEncryptedError(name, format) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, KeyEncryptedError); - this.name = 'KeyEncryptedError'; - this.format = format; - this.keyName = name; - this.message = 'The ' + format + ' format key ' + name + ' is ' + - 'encrypted (password-protected), and no passphrase was ' + - 'provided in `options`'; -} -util.inherits(KeyEncryptedError, Error); + var responseContent + if (self.gzip && !noBody(response.statusCode)) { + var contentEncoding = response.headers['content-encoding'] || 'identity' + contentEncoding = contentEncoding.trim().toLowerCase() -module.exports = { - FingerprintFormatError: FingerprintFormatError, - InvalidAlgorithmError: InvalidAlgorithmError, - KeyParseError: KeyParseError, - SignatureParseError: SignatureParseError, - KeyEncryptedError: KeyEncryptedError, - CertificateParseError: CertificateParseError -}; + // Be more lenient with decoding compressed responses, since (very rarely) + // servers send slightly invalid gzip responses that are still accepted + // by common browsers. + // Always using Z_SYNC_FLUSH is what cURL does. + var zlibOptions = { + flush: zlib.Z_SYNC_FLUSH, + finishFlush: zlib.Z_SYNC_FLUSH + } + if (contentEncoding === 'gzip') { + responseContent = zlib.createGunzip(zlibOptions) + response.pipe(responseContent) + } else if (contentEncoding === 'deflate') { + responseContent = zlib.createInflate(zlibOptions) + response.pipe(responseContent) + } else { + // Since previous versions didn't check for Content-Encoding header, + // ignore any invalid values to preserve backwards-compatibility + if (contentEncoding !== 'identity') { + debug('ignoring unrecognized Content-Encoding ' + contentEncoding) + } + responseContent = response + } + } else { + responseContent = response + } -/***/ }), + if (self.encoding) { + if (self.dests.length !== 0) { + console.error('Ignoring encoding parameter as this stream is being piped to another stream which makes the encoding option invalid.') + } else { + responseContent.setEncoding(self.encoding) + } + } -/***/ 482: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (self._paused) { + responseContent.pause() + } -"use strict"; + self.responseContent = responseContent + self.emit('response', response) -var crypto_hash_sha512 = __webpack_require__(162).lowlevel.crypto_hash; + self.dests.forEach(function (dest) { + self.pipeDest(dest) + }) -/* - * This file is a 1:1 port from the OpenBSD blowfish.c and bcrypt_pbkdf.c. As a - * result, it retains the original copyright and license. The two files are - * under slightly different (but compatible) licenses, and are here combined in - * one file. - * - * Credit for the actual porting work goes to: - * Devi Mandiri - */ + responseContent.on('data', function (chunk) { + if (self.timing && !self.responseStarted) { + self.responseStartTime = (new Date()).getTime() -/* - * The Blowfish portions are under the following license: - * - * Blowfish block cipher for OpenBSD - * Copyright 1997 Niels Provos - * All rights reserved. - * - * Implementation advice by David Mazieres . - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions - * are met: - * 1. Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * 2. Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * 3. The name of the author may not be used to endorse or promote products - * derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR - * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES - * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. - * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, - * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT - * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, - * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY - * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT - * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF - * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - */ + // NOTE: responseStartTime is deprecated in favor of .timings + response.responseStartTime = self.responseStartTime + } + self._destdata = true + self.emit('data', chunk) + }) + responseContent.once('end', function (chunk) { + self.emit('end', chunk) + }) + responseContent.on('error', function (error) { + self.emit('error', error) + }) + responseContent.on('close', function () { self.emit('close') }) -/* - * The bcrypt_pbkdf portions are under the following license: - * - * Copyright (c) 2013 Ted Unangst - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ + if (self.callback) { + self.readResponseBody(response) + } else { // if no callback + self.on('end', function () { + if (self._aborted) { + debug('aborted', self.uri.href) + return + } + self.emit('complete', response) + }) + } + } + debug('finish init function', self.uri.href) +} -/* - * Performance improvements (Javascript-specific): - * - * Copyright 2016, Joyent Inc - * Author: Alex Wilson - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ +Request.prototype.readResponseBody = function (response) { + var self = this + debug("reading response's body") + var buffers = [] + var bufferLength = 0 + var strings = [] -// Ported from OpenBSD bcrypt_pbkdf.c v1.9 + self.on('data', function (chunk) { + if (!Buffer.isBuffer(chunk)) { + strings.push(chunk) + } else if (chunk.length) { + bufferLength += chunk.length + buffers.push(chunk) + } + }) + self.on('end', function () { + debug('end event', self.uri.href) + if (self._aborted) { + debug('aborted', self.uri.href) + // `buffer` is defined in the parent scope and used in a closure it exists for the life of the request. + // This can lead to leaky behavior if the user retains a reference to the request object. + buffers = [] + bufferLength = 0 + return + } -var BLF_J = 0; + if (bufferLength) { + debug('has body', self.uri.href, bufferLength) + response.body = Buffer.concat(buffers, bufferLength) + if (self.encoding !== null) { + response.body = response.body.toString(self.encoding) + } + // `buffer` is defined in the parent scope and used in a closure it exists for the life of the Request. + // This can lead to leaky behavior if the user retains a reference to the request object. + buffers = [] + bufferLength = 0 + } else if (strings.length) { + // The UTF8 BOM [0xEF,0xBB,0xBF] is converted to [0xFE,0xFF] in the JS UTC16/UCS2 representation. + // Strip this value out when the encoding is set to 'utf8', as upstream consumers won't expect it and it breaks JSON.parse(). + if (self.encoding === 'utf8' && strings[0].length > 0 && strings[0][0] === '\uFEFF') { + strings[0] = strings[0].substring(1) + } + response.body = strings.join('') + } -var Blowfish = function() { - this.S = [ - new Uint32Array([ - 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, - 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, - 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, - 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, - 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, - 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, - 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, - 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, - 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, - 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, - 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, - 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, - 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, - 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, - 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, - 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, - 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, - 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, - 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, - 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, - 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, - 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, - 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, - 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, - 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, - 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, - 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, - 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, - 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, - 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, - 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, - 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, - 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, - 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, - 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, - 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, - 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, - 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, - 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, - 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, - 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, - 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, - 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, - 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, - 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, - 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, - 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, - 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, - 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, - 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, - 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, - 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, - 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, - 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, - 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, - 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, - 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, - 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, - 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, - 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, - 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, - 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, - 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, - 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), - new Uint32Array([ - 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, - 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, - 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, - 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, - 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, - 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, - 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, - 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, - 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, - 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, - 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, - 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, - 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, - 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, - 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, - 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, - 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, - 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, - 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, - 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, - 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, - 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, - 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, - 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, - 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, - 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, - 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, - 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, - 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, - 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, - 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, - 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, - 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, - 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, - 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, - 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, - 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, - 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, - 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, - 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, - 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, - 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, - 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, - 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, - 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, - 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, - 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, - 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, - 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, - 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, - 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, - 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, - 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, - 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, - 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, - 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, - 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, - 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, - 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, - 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, - 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, - 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, - 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, - 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), - new Uint32Array([ - 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, - 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, - 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, - 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, - 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, - 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, - 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, - 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, - 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, - 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, - 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, - 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, - 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, - 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, - 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, - 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, - 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, - 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, - 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, - 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, - 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, - 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, - 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, - 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, - 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, - 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, - 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, - 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, - 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, - 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, - 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, - 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, - 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, - 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, - 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, - 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, - 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, - 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, - 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, - 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, - 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, - 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, - 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, - 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, - 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, - 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, - 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, - 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, - 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, - 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, - 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, - 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, - 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, - 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, - 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, - 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, - 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, - 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, - 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, - 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, - 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, - 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, - 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, - 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), - new Uint32Array([ - 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, - 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, - 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, - 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, - 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, - 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, - 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, - 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, - 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, - 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, - 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, - 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, - 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, - 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, - 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, - 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, - 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, - 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, - 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, - 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, - 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, - 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, - 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, - 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, - 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, - 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, - 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, - 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, - 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, - 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, - 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, - 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, - 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, - 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, - 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, - 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, - 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, - 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, - 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, - 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, - 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, - 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, - 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, - 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, - 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, - 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, - 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, - 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, - 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, - 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, - 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, - 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, - 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, - 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, - 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, - 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, - 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, - 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, - 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, - 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, - 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, - 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, - 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, - 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) - ]; - this.P = new Uint32Array([ - 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, - 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, - 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, - 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, - 0x9216d5d9, 0x8979fb1b]); -}; + if (self._json) { + try { + response.body = JSON.parse(response.body, self._jsonReviver) + } catch (e) { + debug('invalid JSON received', self.uri.href) + } + } + debug('emitting complete', self.uri.href) + if (typeof response.body === 'undefined' && !self._json) { + response.body = self.encoding === null ? Buffer.alloc(0) : '' + } + self.emit('complete', response, response.body) + }) +} -function F(S, x8, i) { - return (((S[0][x8[i+3]] + - S[1][x8[i+2]]) ^ - S[2][x8[i+1]]) + - S[3][x8[i]]); -}; +Request.prototype.abort = function () { + var self = this + self._aborted = true -Blowfish.prototype.encipher = function(x, x8) { - if (x8 === undefined) { - x8 = new Uint8Array(x.buffer); - if (x.byteOffset !== 0) - x8 = x8.subarray(x.byteOffset); + if (self.req) { + self.req.abort() + } else if (self.response) { + self.response.destroy() } - x[0] ^= this.P[0]; - for (var i = 1; i < 16; i += 2) { - x[1] ^= F(this.S, x8, 0) ^ this.P[i]; - x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; + + self.emit('abort') +} + +Request.prototype.pipeDest = function (dest) { + var self = this + var response = self.response + // Called after the response is received + if (dest.headers && !dest.headersSent) { + if (response.caseless.has('content-type')) { + var ctname = response.caseless.has('content-type') + if (dest.setHeader) { + dest.setHeader(ctname, response.headers[ctname]) + } else { + dest.headers[ctname] = response.headers[ctname] + } + } + + if (response.caseless.has('content-length')) { + var clname = response.caseless.has('content-length') + if (dest.setHeader) { + dest.setHeader(clname, response.headers[clname]) + } else { + dest.headers[clname] = response.headers[clname] + } + } } - var t = x[0]; - x[0] = x[1] ^ this.P[17]; - x[1] = t; -}; + if (dest.setHeader && !dest.headersSent) { + for (var i in response.headers) { + // If the response content is being decoded, the Content-Encoding header + // of the response doesn't represent the piped content, so don't pass it. + if (!self.gzip || i !== 'content-encoding') { + dest.setHeader(i, response.headers[i]) + } + } + dest.statusCode = response.statusCode + } + if (self.pipefilter) { + self.pipefilter(response, dest) + } +} -Blowfish.prototype.decipher = function(x) { - var x8 = new Uint8Array(x.buffer); - if (x.byteOffset !== 0) - x8 = x8.subarray(x.byteOffset); - x[0] ^= this.P[17]; - for (var i = 16; i > 0; i -= 2) { - x[1] ^= F(this.S, x8, 0) ^ this.P[i]; - x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; +Request.prototype.qs = function (q, clobber) { + var self = this + var base + if (!clobber && self.uri.query) { + base = self._qs.parse(self.uri.query) + } else { + base = {} } - var t = x[0]; - x[0] = x[1] ^ this.P[0]; - x[1] = t; -}; -function stream2word(data, databytes){ - var i, temp = 0; - for (i = 0; i < 4; i++, BLF_J++) { - if (BLF_J >= databytes) BLF_J = 0; - temp = (temp << 8) | data[BLF_J]; + for (var i in q) { + base[i] = q[i] } - return temp; -}; -Blowfish.prototype.expand0state = function(key, keybytes) { - var d = new Uint32Array(2), i, k; - var d8 = new Uint8Array(d.buffer); + var qs = self._qs.stringify(base) - for (i = 0, BLF_J = 0; i < 18; i++) { - this.P[i] ^= stream2word(key, keybytes); + if (qs === '') { + return self } - BLF_J = 0; - for (i = 0; i < 18; i += 2) { - this.encipher(d, d8); - this.P[i] = d[0]; - this.P[i+1] = d[1]; - } + self.uri = url.parse(self.uri.href.split('?')[0] + '?' + qs) + self.url = self.uri + self.path = self.uri.path + + if (self.uri.host === 'unix') { + self.enableUnixSocket() + } + + return self +} +Request.prototype.form = function (form) { + var self = this + if (form) { + if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { + self.setHeader('content-type', 'application/x-www-form-urlencoded') + } + self.body = (typeof form === 'string') + ? self._qs.rfc3986(form.toString('utf8')) + : self._qs.stringify(form).toString('utf8') + return self + } + // create form-data object + self._form = new FormData() + self._form.on('error', function (err) { + err.message = 'form-data: ' + err.message + self.emit('error', err) + self.abort() + }) + return self._form +} +Request.prototype.multipart = function (multipart) { + var self = this + + self._multipart.onRequest(multipart) - for (i = 0; i < 4; i++) { - for (k = 0; k < 256; k += 2) { - this.encipher(d, d8); - this.S[i][k] = d[0]; - this.S[i][k+1] = d[1]; - } + if (!self._multipart.chunked) { + self.body = self._multipart.body } -}; -Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { - var d = new Uint32Array(2), i, k; + return self +} +Request.prototype.json = function (val) { + var self = this - for (i = 0, BLF_J = 0; i < 18; i++) { - this.P[i] ^= stream2word(key, keybytes); + if (!self.hasHeader('accept')) { + self.setHeader('accept', 'application/json') } - for (i = 0, BLF_J = 0; i < 18; i += 2) { - d[0] ^= stream2word(data, databytes); - d[1] ^= stream2word(data, databytes); - this.encipher(d); - this.P[i] = d[0]; - this.P[i+1] = d[1]; + if (typeof self.jsonReplacer === 'function') { + self._jsonReplacer = self.jsonReplacer } - for (i = 0; i < 4; i++) { - for (k = 0; k < 256; k += 2) { - d[0] ^= stream2word(data, databytes); - d[1] ^= stream2word(data, databytes); - this.encipher(d); - this.S[i][k] = d[0]; - this.S[i][k+1] = d[1]; + self._json = true + if (typeof val === 'boolean') { + if (self.body !== undefined) { + if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { + self.body = safeStringify(self.body, self._jsonReplacer) + } else { + self.body = self._qs.rfc3986(self.body) + } + if (!self.hasHeader('content-type')) { + self.setHeader('content-type', 'application/json') + } + } + } else { + self.body = safeStringify(val, self._jsonReplacer) + if (!self.hasHeader('content-type')) { + self.setHeader('content-type', 'application/json') } } - BLF_J = 0; -}; -Blowfish.prototype.enc = function(data, blocks) { - for (var i = 0; i < blocks; i++) { - this.encipher(data.subarray(i*2)); + if (typeof self.jsonReviver === 'function') { + self._jsonReviver = self.jsonReviver } -}; -Blowfish.prototype.dec = function(data, blocks) { - for (var i = 0; i < blocks; i++) { - this.decipher(data.subarray(i*2)); + return self +} +Request.prototype.getHeader = function (name, headers) { + var self = this + var result, re, match + if (!headers) { + headers = self.headers } -}; + Object.keys(headers).forEach(function (key) { + if (key.length !== name.length) { + return + } + re = new RegExp(name, 'i') + match = key.match(re) + if (match) { + result = headers[key] + } + }) + return result +} +Request.prototype.enableUnixSocket = function () { + // Get the socket & request paths from the URL + var unixParts = this.uri.path.split(':') + var host = unixParts[0] + var path = unixParts[1] + // Apply unix properties to request + this.socketPath = host + this.uri.pathname = path + this.uri.path = path + this.uri.host = host + this.uri.hostname = host + this.uri.isUnix = true +} -var BCRYPT_BLOCKS = 8, - BCRYPT_HASHSIZE = 32; +Request.prototype.auth = function (user, pass, sendImmediately, bearer) { + var self = this -function bcrypt_hash(sha2pass, sha2salt, out) { - var state = new Blowfish(), - cdata = new Uint32Array(BCRYPT_BLOCKS), i, - ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, - 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, - 105,116,101]); //"OxychromaticBlowfishSwatDynamite" + self._auth.onRequest(user, pass, sendImmediately, bearer) - state.expandstate(sha2salt, 64, sha2pass, 64); - for (i = 0; i < 64; i++) { - state.expand0state(sha2salt, 64); - state.expand0state(sha2pass, 64); - } + return self +} +Request.prototype.aws = function (opts, now) { + var self = this - for (i = 0; i < BCRYPT_BLOCKS; i++) - cdata[i] = stream2word(ciphertext, ciphertext.byteLength); - for (i = 0; i < 64; i++) - state.enc(cdata, cdata.byteLength / 8); + if (!now) { + self._aws = opts + return self + } - for (i = 0; i < BCRYPT_BLOCKS; i++) { - out[4*i+3] = cdata[i] >>> 24; - out[4*i+2] = cdata[i] >>> 16; - out[4*i+1] = cdata[i] >>> 8; - out[4*i+0] = cdata[i]; + if (opts.sign_version === 4 || opts.sign_version === '4') { + // use aws4 + var options = { + host: self.uri.host, + path: self.uri.path, + method: self.method, + headers: self.headers, + body: self.body + } + if (opts.service) { + options.service = opts.service + } + var signRes = aws4.sign(options, { + accessKeyId: opts.key, + secretAccessKey: opts.secret, + sessionToken: opts.session + }) + self.setHeader('authorization', signRes.headers.Authorization) + self.setHeader('x-amz-date', signRes.headers['X-Amz-Date']) + if (signRes.headers['X-Amz-Security-Token']) { + self.setHeader('x-amz-security-token', signRes.headers['X-Amz-Security-Token']) + } + } else { + // default: use aws-sign2 + var date = new Date() + self.setHeader('date', date.toUTCString()) + var auth = { + key: opts.key, + secret: opts.secret, + verb: self.method.toUpperCase(), + date: date, + contentType: self.getHeader('content-type') || '', + md5: self.getHeader('content-md5') || '', + amazonHeaders: aws2.canonicalizeHeaders(self.headers) + } + var path = self.uri.path + if (opts.bucket && path) { + auth.resource = '/' + opts.bucket + path + } else if (opts.bucket && !path) { + auth.resource = '/' + opts.bucket + } else if (!opts.bucket && path) { + auth.resource = path + } else if (!opts.bucket && !path) { + auth.resource = '/' + } + auth.resource = aws2.canonicalizeResource(auth.resource) + self.setHeader('authorization', aws2.authorization(auth)) } -}; -function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { - var sha2pass = new Uint8Array(64), - sha2salt = new Uint8Array(64), - out = new Uint8Array(BCRYPT_HASHSIZE), - tmpout = new Uint8Array(BCRYPT_HASHSIZE), - countsalt = new Uint8Array(saltlen+4), - i, j, amt, stride, dest, count, - origkeylen = keylen; + return self +} +Request.prototype.httpSignature = function (opts) { + var self = this + httpSignature.signRequest({ + getHeader: function (header) { + return self.getHeader(header, self.headers) + }, + setHeader: function (header, value) { + self.setHeader(header, value) + }, + method: self.method, + path: self.path + }, opts) + debug('httpSignature authorization', self.getHeader('authorization')) - if (rounds < 1) - return -1; - if (passlen === 0 || saltlen === 0 || keylen === 0 || - keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) - return -1; + return self +} +Request.prototype.hawk = function (opts) { + var self = this + self.setHeader('Authorization', hawk.header(self.uri, self.method, opts)) +} +Request.prototype.oauth = function (_oauth) { + var self = this - stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); - amt = Math.floor((keylen + stride - 1) / stride); + self._oauth.onRequest(_oauth) - for (i = 0; i < saltlen; i++) - countsalt[i] = salt[i]; + return self +} - crypto_hash_sha512(sha2pass, pass, passlen); +Request.prototype.jar = function (jar) { + var self = this + var cookies - for (count = 1; keylen > 0; count++) { - countsalt[saltlen+0] = count >>> 24; - countsalt[saltlen+1] = count >>> 16; - countsalt[saltlen+2] = count >>> 8; - countsalt[saltlen+3] = count; + if (self._redirect.redirectsFollowed === 0) { + self.originalCookieHeader = self.getHeader('cookie') + } - crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); - bcrypt_hash(sha2pass, sha2salt, tmpout); - for (i = out.byteLength; i--;) - out[i] = tmpout[i]; + if (!jar) { + // disable cookies + cookies = false + self._disableCookies = true + } else { + var targetCookieJar = (jar && jar.getCookieString) ? jar : globalCookieJar + var urihref = self.uri.href + // fetch cookie in the Specified host + if (targetCookieJar) { + cookies = targetCookieJar.getCookieString(urihref) + } + } - for (i = 1; i < rounds; i++) { - crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); - bcrypt_hash(sha2pass, sha2salt, tmpout); - for (j = 0; j < out.byteLength; j++) - out[j] ^= tmpout[j]; + // if need cookie and cookie is not empty + if (cookies && cookies.length) { + if (self.originalCookieHeader) { + // Don't overwrite existing Cookie header + self.setHeader('cookie', self.originalCookieHeader + '; ' + cookies) + } else { + self.setHeader('cookie', cookies) } + } + self._jar = jar + return self +} - amt = Math.min(amt, keylen); - for (i = 0; i < amt; i++) { - dest = i * stride + (count - 1); - if (dest >= origkeylen) - break; - key[dest] = out[i]; +// Stream API +Request.prototype.pipe = function (dest, opts) { + var self = this + + if (self.response) { + if (self._destdata) { + self.emit('error', new Error('You cannot pipe after data has been emitted from the response.')) + } else if (self._ended) { + self.emit('error', new Error('You cannot pipe after the response has been ended.')) + } else { + stream.Stream.prototype.pipe.call(self, dest, opts) + self.pipeDest(dest) + return dest } - keylen -= i; + } else { + self.dests.push(dest) + stream.Stream.prototype.pipe.call(self, dest, opts) + return dest } +} +Request.prototype.write = function () { + var self = this + if (self._aborted) { return } - return 0; -}; + if (!self._started) { + self.start() + } + if (self.req) { + return self.req.write.apply(self.req, arguments) + } +} +Request.prototype.end = function (chunk) { + var self = this + if (self._aborted) { return } -module.exports = { - BLOCKS: BCRYPT_BLOCKS, - HASHSIZE: BCRYPT_HASHSIZE, - hash: bcrypt_hash, - pbkdf: bcrypt_pbkdf -}; + if (chunk) { + self.write(chunk) + } + if (!self._started) { + self.start() + } + if (self.req) { + self.req.end() + } +} +Request.prototype.pause = function () { + var self = this + if (!self.responseContent) { + self._paused = true + } else { + self.responseContent.pause.apply(self.responseContent, arguments) + } +} +Request.prototype.resume = function () { + var self = this + if (!self.responseContent) { + self._paused = false + } else { + self.responseContent.resume.apply(self.responseContent, arguments) + } +} +Request.prototype.destroy = function () { + var self = this + if (!self._ended) { + self.end() + } else if (self.response) { + self.response.destroy() + } +} + +Request.defaultProxyHeaderWhiteList = + Tunnel.defaultProxyHeaderWhiteList.slice() + +Request.defaultProxyHeaderExclusiveList = + Tunnel.defaultProxyHeaderExclusiveList.slice() + +// Exports + +Request.prototype.toJSON = requestToJSON +module.exports = Request /***/ }), -/***/ 490: -/***/ (function(module, __unusedexports, __webpack_require__) { +/***/ 461: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -// Copyright 2012 Joyent, Inc. All rights reserved. +"use strict"; -var assert = __webpack_require__(976); -var util = __webpack_require__(669); -var utils = __webpack_require__(329); +var url = __webpack_require__(835) +var tunnel = __webpack_require__(243) + +var defaultProxyHeaderWhiteList = [ + 'accept', + 'accept-charset', + 'accept-encoding', + 'accept-language', + 'accept-ranges', + 'cache-control', + 'content-encoding', + 'content-language', + 'content-location', + 'content-md5', + 'content-range', + 'content-type', + 'connection', + 'date', + 'expect', + 'max-forwards', + 'pragma', + 'referer', + 'te', + 'user-agent', + 'via' +] + +var defaultProxyHeaderExclusiveList = [ + 'proxy-authorization' +] +function constructProxyHost (uriObject) { + var port = uriObject.port + var protocol = uriObject.protocol + var proxyHost = uriObject.hostname + ':' -///--- Globals + if (port) { + proxyHost += port + } else if (protocol === 'https:') { + proxyHost += '443' + } else { + proxyHost += '80' + } -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var HttpSignatureError = utils.HttpSignatureError; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var validateAlgorithm = utils.validateAlgorithm; + return proxyHost +} -var State = { - New: 0, - Params: 1 -}; +function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { + var whiteList = proxyHeaderWhiteList + .reduce(function (set, header) { + set[header.toLowerCase()] = true + return set + }, {}) -var ParamsState = { - Name: 0, - Quote: 1, - Value: 2, - Comma: 3 -}; + return Object.keys(headers) + .filter(function (header) { + return whiteList[header.toLowerCase()] + }) + .reduce(function (set, header) { + set[header] = headers[header] + return set + }, {}) +} +function constructTunnelOptions (request, proxyHeaders) { + var proxy = request.proxy -///--- Specific Errors + var tunnelOptions = { + proxy: { + host: proxy.hostname, + port: +proxy.port, + proxyAuth: proxy.auth, + headers: proxyHeaders + }, + headers: request.headers, + ca: request.ca, + cert: request.cert, + key: request.key, + passphrase: request.passphrase, + pfx: request.pfx, + ciphers: request.ciphers, + rejectUnauthorized: request.rejectUnauthorized, + secureOptions: request.secureOptions, + secureProtocol: request.secureProtocol + } + return tunnelOptions +} -function ExpiredRequestError(message) { - HttpSignatureError.call(this, message, ExpiredRequestError); +function constructTunnelFnName (uri, proxy) { + var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') + var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') + return [uriProtocol, proxyProtocol].join('Over') } -util.inherits(ExpiredRequestError, HttpSignatureError); +function getTunnelFn (request) { + var uri = request.uri + var proxy = request.proxy + var tunnelFnName = constructTunnelFnName(uri, proxy) + return tunnel[tunnelFnName] +} -function InvalidHeaderError(message) { - HttpSignatureError.call(this, message, InvalidHeaderError); +function Tunnel (request) { + this.request = request + this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList + this.proxyHeaderExclusiveList = [] + if (typeof request.tunnel !== 'undefined') { + this.tunnelOverride = request.tunnel + } } -util.inherits(InvalidHeaderError, HttpSignatureError); +Tunnel.prototype.isEnabled = function () { + var self = this + var request = self.request + // Tunnel HTTPS by default. Allow the user to override this setting. + + // If self.tunnelOverride is set (the user specified a value), use it. + if (typeof self.tunnelOverride !== 'undefined') { + return self.tunnelOverride + } -function InvalidParamsError(message) { - HttpSignatureError.call(this, message, InvalidParamsError); + // If the destination is HTTPS, tunnel. + if (request.uri.protocol === 'https:') { + return true + } + + // Otherwise, do not use tunnel. + return false } -util.inherits(InvalidParamsError, HttpSignatureError); +Tunnel.prototype.setup = function (options) { + var self = this + var request = self.request + + options = options || {} + + if (typeof request.proxy === 'string') { + request.proxy = url.parse(request.proxy) + } + + if (!request.proxy || !request.tunnel) { + return false + } -function MissingHeaderError(message) { - HttpSignatureError.call(this, message, MissingHeaderError); -} -util.inherits(MissingHeaderError, HttpSignatureError); + // Setup Proxy Header Exclusive List and White List + if (options.proxyHeaderWhiteList) { + self.proxyHeaderWhiteList = options.proxyHeaderWhiteList + } + if (options.proxyHeaderExclusiveList) { + self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList + } -function StrictParsingError(message) { - HttpSignatureError.call(this, message, StrictParsingError); -} -util.inherits(StrictParsingError, HttpSignatureError); + var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) + var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) -///--- Exported API + // Setup Proxy Headers and Proxy Headers Host + // Only send the Proxy White Listed Header names + var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) + proxyHeaders.host = constructProxyHost(request.uri) -module.exports = { + proxyHeaderExclusiveList.forEach(request.removeHeader, request) - /** - * Parses the 'Authorization' header out of an http.ServerRequest object. - * - * Note that this API will fully validate the Authorization header, and throw - * on any error. It will not however check the signature, or the keyId format - * as those are specific to your environment. You can use the options object - * to pass in extra constraints. - * - * As a response object you can expect this: - * - * { - * "scheme": "Signature", - * "params": { - * "keyId": "foo", - * "algorithm": "rsa-sha256", - * "headers": [ - * "date" or "x-date", - * "digest" - * ], - * "signature": "base64" - * }, - * "signingString": "ready to be passed to crypto.verify()" - * } - * - * @param {Object} request an http.ServerRequest. - * @param {Object} options an optional options object with: - * - clockSkew: allowed clock skew in seconds (default 300). - * - headers: required header names (def: date or x-date) - * - algorithms: algorithms to support (default: all). - * - strict: should enforce latest spec parsing - * (default: false). - * @return {Object} parsed out object (see above). - * @throws {TypeError} on invalid input. - * @throws {InvalidHeaderError} on an invalid Authorization header error. - * @throws {InvalidParamsError} if the params in the scheme are invalid. - * @throws {MissingHeaderError} if the params indicate a header not present, - * either in the request headers from the params, - * or not in the params from a required header - * in options. - * @throws {StrictParsingError} if old attributes are used in strict parsing - * mode. - * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. - */ - parseRequest: function parseRequest(request, options) { - assert.object(request, 'request'); - assert.object(request.headers, 'request.headers'); - if (options === undefined) { - options = {}; - } - if (options.headers === undefined) { - options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; - } - assert.object(options, 'options'); - assert.arrayOfString(options.headers, 'options.headers'); - assert.optionalFinite(options.clockSkew, 'options.clockSkew'); + // Set Agent from Tunnel Data + var tunnelFn = getTunnelFn(request) + var tunnelOptions = constructTunnelOptions(request, proxyHeaders) + request.agent = tunnelFn(tunnelOptions) - var authzHeaderName = options.authorizationHeaderName || 'authorization'; + return true +} - if (!request.headers[authzHeaderName]) { - throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + - 'present in the request'); - } +Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList +Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList +exports.Tunnel = Tunnel - options.clockSkew = options.clockSkew || 300; +/***/ }), - var i = 0; - var state = State.New; - var substate = ParamsState.Name; - var tmpName = ''; - var tmpValue = ''; +/***/ 469: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - var parsed = { - scheme: '', - params: {}, - signingString: '' - }; +"use strict"; - var authz = request.headers[authzHeaderName]; - for (i = 0; i < authz.length; i++) { - var c = authz.charAt(i); - switch (Number(state)) { +var uuid = __webpack_require__(826) +var CombinedStream = __webpack_require__(547) +var isstream = __webpack_require__(382) +var Buffer = __webpack_require__(149).Buffer - case State.New: - if (c !== ' ') parsed.scheme += c; - else state = State.Params; - break; +function Multipart (request) { + this.request = request + this.boundary = uuid() + this.chunked = false + this.body = null +} - case State.Params: - switch (Number(substate)) { +Multipart.prototype.isChunked = function (options) { + var self = this + var chunked = false + var parts = options.data || options - case ParamsState.Name: - var code = c.charCodeAt(0); - // restricted name of A-Z / a-z - if ((code >= 0x41 && code <= 0x5a) || // A-Z - (code >= 0x61 && code <= 0x7a)) { // a-z - tmpName += c; - } else if (c === '=') { - if (tmpName.length === 0) - throw new InvalidHeaderError('bad param format'); - substate = ParamsState.Quote; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; + if (!parts.forEach) { + self.request.emit('error', new Error('Argument error, options.multipart.')) + } - case ParamsState.Quote: - if (c === '"') { - tmpValue = ''; - substate = ParamsState.Value; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; + if (options.chunked !== undefined) { + chunked = options.chunked + } - case ParamsState.Value: - if (c === '"') { - parsed.params[tmpName] = tmpValue; - substate = ParamsState.Comma; - } else { - tmpValue += c; - } - break; + if (self.request.getHeader('transfer-encoding') === 'chunked') { + chunked = true + } - case ParamsState.Comma: - if (c === ',') { - tmpName = ''; - substate = ParamsState.Name; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; + if (!chunked) { + parts.forEach(function (part) { + if (typeof part.body === 'undefined') { + self.request.emit('error', new Error('Body attribute missing in multipart.')) + } + if (isstream(part.body)) { + chunked = true + } + }) + } - default: - throw new Error('Invalid substate'); - } - break; + return chunked +} - default: - throw new Error('Invalid substate'); - } +Multipart.prototype.setHeaders = function (chunked) { + var self = this - } + if (chunked && !self.request.hasHeader('transfer-encoding')) { + self.request.setHeader('transfer-encoding', 'chunked') + } - if (!parsed.params.headers || parsed.params.headers === '') { - if (request.headers['x-date']) { - parsed.params.headers = ['x-date']; - } else { - parsed.params.headers = ['date']; - } + var header = self.request.getHeader('content-type') + + if (!header || header.indexOf('multipart') === -1) { + self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary) + } else { + if (header.indexOf('boundary') !== -1) { + self.boundary = header.replace(/.*boundary=([^\s;]+).*/, '$1') } else { - parsed.params.headers = parsed.params.headers.split(' '); + self.request.setHeader('content-type', header + '; boundary=' + self.boundary) } + } +} - // Minimally validate the parsed object - if (!parsed.scheme || parsed.scheme !== 'Signature') - throw new InvalidHeaderError('scheme was not "Signature"'); +Multipart.prototype.build = function (parts, chunked) { + var self = this + var body = chunked ? new CombinedStream() : [] - if (!parsed.params.keyId) - throw new InvalidHeaderError('keyId was not specified'); + function add (part) { + if (typeof part === 'number') { + part = part.toString() + } + return chunked ? body.append(part) : body.push(Buffer.from(part)) + } - if (!parsed.params.algorithm) - throw new InvalidHeaderError('algorithm was not specified'); + if (self.request.preambleCRLF) { + add('\r\n') + } - if (!parsed.params.signature) - throw new InvalidHeaderError('signature was not specified'); + parts.forEach(function (part) { + var preamble = '--' + self.boundary + '\r\n' + Object.keys(part).forEach(function (key) { + if (key === 'body') { return } + preamble += key + ': ' + part[key] + '\r\n' + }) + preamble += '\r\n' + add(preamble) + add(part.body) + add('\r\n') + }) + add('--' + self.boundary + '--') - // Check the algorithm against the official list - parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); - try { - validateAlgorithm(parsed.params.algorithm); - } catch (e) { - if (e instanceof InvalidAlgorithmError) - throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + - 'supported')); - else - throw (e); - } + if (self.request.postambleCRLF) { + add('\r\n') + } - // Build the signingString - for (i = 0; i < parsed.params.headers.length; i++) { - var h = parsed.params.headers[i].toLowerCase(); - parsed.params.headers[i] = h; + return body +} - if (h === 'request-line') { - if (!options.strict) { - /* - * We allow headers from the older spec drafts if strict parsing isn't - * specified in options. - */ - parsed.signingString += - request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; - } else { - /* Strict parsing doesn't allow older draft headers. */ - throw (new StrictParsingError('request-line is not a valid header ' + - 'with strict parsing enabled.')); - } - } else if (h === '(request-target)') { - parsed.signingString += - '(request-target): ' + request.method.toLowerCase() + ' ' + - request.url; - } else { - var value = request.headers[h]; - if (value === undefined) - throw new MissingHeaderError(h + ' was not in the request'); - parsed.signingString += h + ': ' + value; - } +Multipart.prototype.onRequest = function (options) { + var self = this - if ((i + 1) < parsed.params.headers.length) - parsed.signingString += '\n'; - } + var chunked = self.isChunked(options) + var parts = options.data || options - // Check against the constraints - var date; - if (request.headers.date || request.headers['x-date']) { - if (request.headers['x-date']) { - date = new Date(request.headers['x-date']); - } else { - date = new Date(request.headers.date); - } - var now = new Date(); - var skew = Math.abs(now.getTime() - date.getTime()); + self.setHeaders(chunked) + self.chunked = chunked + self.body = self.build(parts, chunked) +} - if (skew > options.clockSkew * 1000) { - throw new ExpiredRequestError('clock skew of ' + - (skew / 1000) + - 's was greater than ' + - options.clockSkew + 's'); - } - } +exports.Multipart = Multipart - options.headers.forEach(function (hdr) { - // Remember that we already checked any headers in the params - // were in the request, so if this passes we're good. - if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) - throw new MissingHeaderError(hdr + ' was not a signed header'); - }); - if (options.algorithms) { - if (options.algorithms.indexOf(parsed.params.algorithm) === -1) - throw new InvalidParamsError(parsed.params.algorithm + - ' is not a supported algorithm'); - } +/***/ }), - parsed.algorithm = parsed.params.algorithm.toUpperCase(); - parsed.keyId = parsed.params.keyId; - return parsed; - } +/***/ 470: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -}; +"use strict"; +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const command_1 = __webpack_require__(431); +const os = __webpack_require__(87); +const path = __webpack_require__(622); +/** + * The code to exit an action + */ +var ExitCode; +(function (ExitCode) { + /** + * A code indicating that the action was successful + */ + ExitCode[ExitCode["Success"] = 0] = "Success"; + /** + * A code indicating that the action was a failure + */ + ExitCode[ExitCode["Failure"] = 1] = "Failure"; +})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); +//----------------------------------------------------------------------- +// Variables +//----------------------------------------------------------------------- +/** + * Sets env variable for this action and future actions in the job + * @param name the name of the variable to set + * @param val the value of the variable + */ +function exportVariable(name, val) { + process.env[name] = val; + command_1.issueCommand('set-env', { name }, val); +} +exports.exportVariable = exportVariable; +/** + * Registers a secret which will get masked from logs + * @param secret value of the secret + */ +function setSecret(secret) { + command_1.issueCommand('add-mask', {}, secret); +} +exports.setSecret = setSecret; +/** + * Prepends inputPath to the PATH (for this action and future actions) + * @param inputPath + */ +function addPath(inputPath) { + command_1.issueCommand('add-path', {}, inputPath); + process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; +} +exports.addPath = addPath; +/** + * Gets the value of an input. The value is also trimmed. + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns string + */ +function getInput(name, options) { + const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; + if (options && options.required && !val) { + throw new Error(`Input required and not supplied: ${name}`); + } + return val.trim(); +} +exports.getInput = getInput; +/** + * Sets the value of an output. + * + * @param name name of the output to set + * @param value value to store + */ +function setOutput(name, value) { + command_1.issueCommand('set-output', { name }, value); +} +exports.setOutput = setOutput; +//----------------------------------------------------------------------- +// Results +//----------------------------------------------------------------------- +/** + * Sets the action status to failed. + * When the action exits it will be with an exit code of 1 + * @param message add error issue message + */ +function setFailed(message) { + process.exitCode = ExitCode.Failure; + error(message); +} +exports.setFailed = setFailed; +//----------------------------------------------------------------------- +// Logging Commands +//----------------------------------------------------------------------- +/** + * Writes debug message to user log + * @param message debug message + */ +function debug(message) { + command_1.issueCommand('debug', {}, message); +} +exports.debug = debug; +/** + * Adds an error issue + * @param message error issue message + */ +function error(message) { + command_1.issue('error', message); +} +exports.error = error; +/** + * Adds an warning issue + * @param message warning issue message + */ +function warning(message) { + command_1.issue('warning', message); +} +exports.warning = warning; +/** + * Writes info to log with console.log. + * @param message info message + */ +function info(message) { + process.stdout.write(message + os.EOL); +} +exports.info = info; +/** + * Begin an output group. + * + * Output until the next `groupEnd` will be foldable in this group + * + * @param name The name of the output group + */ +function startGroup(name) { + command_1.issue('group', name); +} +exports.startGroup = startGroup; +/** + * End an output group. + */ +function endGroup() { + command_1.issue('endgroup'); +} +exports.endGroup = endGroup; +/** + * Wrap an asynchronous function call in a group. + * + * Returns the same type as the function itself. + * + * @param name The name of the group + * @param fn The function to wrap in the group + */ +function group(name, fn) { + return __awaiter(this, void 0, void 0, function* () { + startGroup(name); + let result; + try { + result = yield fn(); + } + finally { + endGroup(); + } + return result; + }); +} +exports.group = group; +//----------------------------------------------------------------------- +// Wrapper action state +//----------------------------------------------------------------------- +/** + * Saves state for current action, the state can only be retrieved by this action's post job execution. + * + * @param name name of the state to store + * @param value value to store + */ +function saveState(name, value) { + command_1.issueCommand('save-state', { name }, value); +} +exports.saveState = saveState; +/** + * Gets the value of an state set by this action's main execution. + * + * @param name name of the state to get + * @returns string + */ +function getState(name) { + return process.env[`STATE_${name}`] || ''; +} +exports.getState = getState; +//# sourceMappingURL=core.js.map /***/ }), -/***/ 501: +/***/ 477: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2018 Joyent, Inc. - -module.exports = Key; - -var assert = __webpack_require__(976); -var algs = __webpack_require__(778); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(98); -var Signature = __webpack_require__(437); -var DiffieHellman = __webpack_require__(99).DiffieHellman; -var errs = __webpack_require__(481); -var utils = __webpack_require__(57); -var PrivateKey = __webpack_require__(172); -var edCompat; - -try { - edCompat = __webpack_require__(198); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. -var formats = {}; -formats['auto'] = __webpack_require__(466); -formats['pem'] = __webpack_require__(207); -formats['pkcs1'] = __webpack_require__(867); -formats['pkcs8'] = __webpack_require__(603); -formats['rfc4253'] = __webpack_require__(563); -formats['ssh'] = __webpack_require__(991); -formats['ssh-private'] = __webpack_require__(62); -formats['openssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(962); -formats['putty'] = __webpack_require__(314); -formats['ppk'] = formats['putty']; +var assert = __webpack_require__(357); +var Stream = __webpack_require__(413).Stream; +var util = __webpack_require__(669); -function Key(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - assert.optionalString(opts.comment, 'options.comment'); - var algInfo = algs.info[opts.type]; - if (typeof (algInfo) !== 'object') - throw (new InvalidAlgorithmError(opts.type)); +///--- Globals - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; - this.type = opts.type; - this.parts = opts.parts; - this.part = partLookup; - this.comment = undefined; - this.source = opts.source; - /* for speeding up hashing/fingerprint operations */ - this._rfc4253Cache = opts._rfc4253Cache; - this._hashCache = {}; +///--- Internal - var sz; - this.curve = undefined; - if (this.type === 'ecdsa') { - var curve = this.part.curve.data.toString(); - this.curve = curve; - sz = algs.curves[curve].size; - } else if (this.type === 'ed25519' || this.type === 'curve25519') { - sz = 256; - this.curve = 'curve25519'; - } else { - var szPart = this.part[algInfo.sizePart]; - sz = szPart.data.length; - sz = sz * 8 - utils.countZeros(szPart.data); - } - this.size = sz; +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); } -Key.formats = formats; - -Key.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'ssh'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - if (format === 'rfc4253') { - if (this._rfc4253Cache === undefined) - this._rfc4253Cache = formats['rfc4253'].write(this); - return (this._rfc4253Cache); - } - - return (formats[format].write(this, options)); -}; - -Key.prototype.toString = function (format, options) { - return (this.toBuffer(format, options).toString()); -}; - -Key.prototype.hash = function (algo, type) { - assert.string(algo, 'algorithm'); - assert.optionalString(type, 'type'); - if (type === undefined) - type = 'ssh'; - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - var cacheKey = algo + '||' + type; - if (this._hashCache[cacheKey]) - return (this._hashCache[cacheKey]); - - var buf; - if (type === 'ssh') { - buf = this.toBuffer('rfc4253'); - } else if (type === 'spki') { - buf = formats.pkcs8.pkcs8ToBuffer(this); - } else { - throw (new Error('Hash type ' + type + ' not supported')); - } - var hash = crypto.createHash(algo).update(buf).digest(); - this._hashCache[cacheKey] = hash; - return (hash); -}; - -Key.prototype.fingerprint = function (algo, type) { - if (algo === undefined) - algo = 'sha256'; - if (type === undefined) - type = 'ssh'; - assert.string(algo, 'algorithm'); - assert.string(type, 'type'); - var opts = { - type: 'key', - hash: this.hash(algo, type), - algorithm: algo, - hashType: type - }; - return (new Fingerprint(opts)); -}; - -Key.prototype.defaultHashAlgorithm = function () { - var hashAlgo = 'sha1'; - if (this.type === 'rsa') - hashAlgo = 'sha256'; - if (this.type === 'dsa' && this.size > 1024) - hashAlgo = 'sha256'; - if (this.type === 'ed25519') - hashAlgo = 'sha512'; - if (this.type === 'ecdsa') { - if (this.size <= 256) - hashAlgo = 'sha256'; - else if (this.size <= 384) - hashAlgo = 'sha384'; - else - hashAlgo = 'sha512'; - } - return (hashAlgo); -}; - -Key.prototype.createVerify = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Verifier(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldVerify = v.verify.bind(v); - var key = this.toBuffer('pkcs8'); - var curve = this.curve; - var self = this; - v.verify = function (signature, fmt) { - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== self.type) - return (false); - if (signature.hashAlgorithm && - signature.hashAlgorithm !== hashAlgo) - return (false); - if (signature.curve && self.type === 'ecdsa' && - signature.curve !== curve) - return (false); - return (oldVerify(key, signature.toBuffer('asn1'))); - - } else if (typeof (signature) === 'string' || - Buffer.isBuffer(signature)) { - return (oldVerify(key, signature, fmt)); - - /* - * Avoid doing this on valid arguments, walking the prototype - * chain can be quite slow. - */ - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); - - } else { - throw (new TypeError('signature must be a string, ' + - 'Buffer, or Signature object')); - } - }; - return (v); -}; - -Key.prototype.createDiffieHellman = function () { - if (this.type === 'rsa') - throw (new Error('RSA keys do not support Diffie-Hellman')); - - return (new DiffieHellman(this)); -}; -Key.prototype.createDH = Key.prototype.createDiffieHellman; - -Key.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); +} - assert.object(formats[format], 'formats[format]'); +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); +} - try { - var k = formats[format].read(data, options); - if (k instanceof PrivateKey) - k = k.toPublic(); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; +function noop() { + // Why even bother with asserts? +} -Key.isKey = function (obj, ver) { - return (utils.isCompatible(obj, Key, ver)); -}; -/* - * API versions for Key: - * [1,0] -- initial ver, may take Signature for createVerify or may not - * [1,1] -- added pkcs1, pkcs8 formats - * [1,2] -- added auto, ssh-private, openssh formats - * [1,3] -- added defaultHashAlgorithm - * [1,4] -- added ed support, createDH - * [1,5] -- first explicitly tagged version - * [1,6] -- changed ed25519 part names - * [1,7] -- spki hash types - */ -Key.prototype._sshpkApiVersion = [1, 7]; +///--- Exports -Key._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - assert.func(obj.fingerprint); - if (obj.createDH) - return ([1, 4]); - if (obj.defaultHashAlgorithm) - return ([1, 3]); - if (obj.formats['auto']) - return ([1, 2]); - if (obj.formats['pkcs1']) - return ([1, 1]); - return ([1, 0]); +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' + } }; +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; -/***/ }), - -/***/ 503: -/***/ (function(module) { + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } -"use strict"; + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); -module.exports = function generate_allOf(it, $keyword, $ruleType) { - var out = ' '; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $currentBaseId = $it.baseId, - $allSchemasEmpty = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $allSchemasEmpty = false; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; } - } - } - } - if ($breakOnError) { - if ($allSchemasEmpty) { - out += ' if (true) { '; - } else { - out += ' ' + ($closingBraces.slice(0, -1)) + ' '; - } - } - out = it.util.cleanUpCode(out); - return out; -} + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); -/***/ }), + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); -/***/ 507: -/***/ (function(module, __unusedexports, __webpack_require__) { + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); -/*! - * mime-db - * Copyright(c) 2014 Jonathan Ong - * MIT Licensed - */ + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; -/** - * Module exports. - */ + return out; +} -module.exports = __webpack_require__(259) +module.exports = _setExports(process.env.NODE_NDEBUG); /***/ }), -/***/ 515: +/***/ 479: /***/ (function(module) { "use strict"; @@ -15935,1225 +15356,932 @@ module.exports = function generate_if(it, $keyword, $ruleType) { /***/ }), -/***/ 518: -/***/ (function(module) { - -module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 536: -/***/ (function(module) { - -module.exports = {"$id":"header.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 538: +/***/ 496: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -var URI = __webpack_require__(734) - , equal = __webpack_require__(446) - , util = __webpack_require__(280) - , SchemaObject = __webpack_require__(64) - , traverse = __webpack_require__(540); - -module.exports = resolve; - -resolve.normalizeId = normalizeId; -resolve.fullPath = getFullPath; -resolve.url = resolveUrl; -resolve.ids = resolveIds; -resolve.inlineRef = inlineRef; -resolve.schema = resolveSchema; - -/** - * [resolve and compile the references ($ref)] - * @this Ajv - * @param {Function} compile reference to schema compilation funciton (localCompile) - * @param {Object} root object with information about the root schema for the current schema - * @param {String} ref reference to resolve - * @return {Object|Function} schema object (if the schema can be inlined) or validation function - */ -function resolve(compile, root, ref) { - /* jshint validthis: true */ - var refVal = this._refs[ref]; - if (typeof refVal == 'string') { - if (this._refs[refVal]) refVal = this._refs[refVal]; - else return resolve.call(this, compile, root, refVal); - } - - refVal = refVal || this._schemas[ref]; - if (refVal instanceof SchemaObject) { - return inlineRef(refVal.schema, this._opts.inlineRefs) - ? refVal.schema - : refVal.validate || this._compile(refVal); - } - - var res = resolveSchema.call(this, root, ref); - var schema, v, baseId; - if (res) { - schema = res.schema; - root = res.root; - baseId = res.baseId; - } - - if (schema instanceof SchemaObject) { - v = schema.validate || compile.call(this, schema.schema, root, undefined, baseId); - } else if (schema !== undefined) { - v = inlineRef(schema, this._opts.inlineRefs) - ? schema - : compile.call(this, schema, root, undefined, baseId); - } - - return v; -} - - -/** - * Resolve schema, its root and baseId - * @this Ajv - * @param {Object} root root object with properties schema, refVal, refs - * @param {String} ref reference to resolve - * @return {Object} object with properties schema, root, baseId - */ -function resolveSchema(root, ref) { - /* jshint validthis: true */ - var p = URI.parse(ref) - , refPath = _getFullPath(p) - , baseId = getFullPath(this._getId(root.schema)); - if (Object.keys(root.schema).length === 0 || refPath !== baseId) { - var id = normalizeId(refPath); - var refVal = this._refs[id]; - if (typeof refVal == 'string') { - return resolveRecursive.call(this, root, refVal, p); - } else if (refVal instanceof SchemaObject) { - if (!refVal.validate) this._compile(refVal); - root = refVal; - } else { - refVal = this._schemas[id]; - if (refVal instanceof SchemaObject) { - if (!refVal.validate) this._compile(refVal); - if (id == normalizeId(ref)) - return { schema: refVal, root: root, baseId: baseId }; - root = refVal; - } else { - return; - } - } - if (!root.schema) return; - baseId = getFullPath(this._getId(root.schema)); - } - return getJsonPointer.call(this, p, baseId, root.schema, root); -} - - -/* @this Ajv */ -function resolveRecursive(root, ref, parsedRef) { - /* jshint validthis: true */ - var res = resolveSchema.call(this, root, ref); - if (res) { - var schema = res.schema; - var baseId = res.baseId; - root = res.root; - var id = this._getId(schema); - if (id) baseId = resolveUrl(baseId, id); - return getJsonPointer.call(this, parsedRef, baseId, schema, root); - } -} - - -var PREVENT_SCOPE_CHANGE = util.toHash(['properties', 'patternProperties', 'enum', 'dependencies', 'definitions']); -/* @this Ajv */ -function getJsonPointer(parsedRef, baseId, schema, root) { - /* jshint validthis: true */ - parsedRef.fragment = parsedRef.fragment || ''; - if (parsedRef.fragment.slice(0,1) != '/') return; - var parts = parsedRef.fragment.split('/'); - - for (var i = 1; i < parts.length; i++) { - var part = parts[i]; - if (part) { - part = util.unescapeFragment(part); - schema = schema[part]; - if (schema === undefined) break; - var id; - if (!PREVENT_SCOPE_CHANGE[part]) { - id = this._getId(schema); - if (id) baseId = resolveUrl(baseId, id); - if (schema.$ref) { - var $ref = resolveUrl(baseId, schema.$ref); - var res = resolveSchema.call(this, root, $ref); - if (res) { - schema = res.schema; - root = res.root; - baseId = res.baseId; - } - } - } - } - } - if (schema !== undefined && schema !== root.schema) - return { schema: schema, root: root, baseId: baseId }; -} - - -var SIMPLE_INLINED = util.toHash([ - 'type', 'format', 'pattern', - 'maxLength', 'minLength', - 'maxProperties', 'minProperties', - 'maxItems', 'minItems', - 'maximum', 'minimum', - 'uniqueItems', 'multipleOf', - 'required', 'enum' -]); -function inlineRef(schema, limit) { - if (limit === false) return false; - if (limit === undefined || limit === true) return checkNoRef(schema); - else if (limit) return countKeys(schema) <= limit; -} - - -function checkNoRef(schema) { - var item; - if (Array.isArray(schema)) { - for (var i=0; i 0, 'name cannot be empty'); + if (this.type === 'ed25519' && newType === 'curve25519') { + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); - for (cause = err; cause !== null; cause = VError.cause(cause)) { - mod_assertplus.ok(mod_isError(cause)); - if (cause.name == name) { - return (cause); - } - } + pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); - return (null); + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); }; -VError.hasCauseWithName = function (err, name) -{ - return (VError.findCauseByName(err, name) !== null); +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); }; -VError.fullStack = function (err) -{ - mod_assertplus.ok(mod_isError(err), 'err must be an Error'); +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); - var cause = VError.cause(err); + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); - if (cause) { - return (err.stack + '\ncaused by: ' + VError.fullStack(cause)); + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; } - - return (err.stack); + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = Buffer.from(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return (sig); + }; + return (v); }; -VError.errorFromList = function (errors) -{ - mod_assertplus.arrayOfObject(errors, 'errors'); - - if (errors.length === 0) { - return (null); - } +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; - errors.forEach(function (e) { - mod_assertplus.ok(mod_isError(e)); - }); + assert.object(formats[format], 'formats[format]'); - if (errors.length == 1) { - return (errors[0]); + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); } +}; - return (new MultiError(errors)); +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); }; -VError.errorForEach = function (err, func) -{ - mod_assertplus.ok(mod_isError(err), 'err must be an Error'); - mod_assertplus.func(func, 'func'); +PrivateKey.generate = function (type, options) { + if (options === undefined) + options = {}; + assert.object(options, 'options'); - if (err instanceof MultiError) { - err.errors().forEach(function iterError(e) { func(e); }); - } else { - func(err); + switch (type) { + case 'ecdsa': + if (options.curve === undefined) + options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return (generateECDSA(options.curve)); + case 'ed25519': + return (generateED25519()); + default: + throw (new Error('Key generation not supported with key ' + + 'type "' + type + '"')); } }; - /* - * SError is like VError, but stricter about types. You cannot pass "null" or - * "undefined" as string arguments to the formatter. + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + * [1,5] -- changed ed25519 part names and format + * [1,6] -- type arguments for hash() and fingerprint() */ -function SError() -{ - var args, obj, parsed, options; +PrivateKey.prototype._sshpkApiVersion = [1, 6]; - args = Array.prototype.slice.call(arguments, 0); - if (!(this instanceof SError)) { - obj = Object.create(SError.prototype); - SError.apply(obj, arguments); - return (obj); - } +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; - parsed = parseConstructorArguments({ - 'argv': args, - 'strict': true - }); - options = parsed.options; - VError.call(this, options, '%s', parsed.shortmessage); +/***/ }), + +/***/ 512: +/***/ (function(module) { + +module.exports = {"application/1d-interleaved-parityfec":{"source":"iana"},"application/3gpdash-qoe-report+xml":{"source":"iana","compressible":true},"application/3gpp-ims+xml":{"source":"iana","compressible":true},"application/a2l":{"source":"iana"},"application/activemessage":{"source":"iana"},"application/activity+json":{"source":"iana","compressible":true},"application/alto-costmap+json":{"source":"iana","compressible":true},"application/alto-costmapfilter+json":{"source":"iana","compressible":true},"application/alto-directory+json":{"source":"iana","compressible":true},"application/alto-endpointcost+json":{"source":"iana","compressible":true},"application/alto-endpointcostparams+json":{"source":"iana","compressible":true},"application/alto-endpointprop+json":{"source":"iana","compressible":true},"application/alto-endpointpropparams+json":{"source":"iana","compressible":true},"application/alto-error+json":{"source":"iana","compressible":true},"application/alto-networkmap+json":{"source":"iana","compressible":true},"application/alto-networkmapfilter+json":{"source":"iana","compressible":true},"application/aml":{"source":"iana"},"application/andrew-inset":{"source":"iana","extensions":["ez"]},"application/applefile":{"source":"iana"},"application/applixware":{"source":"apache","extensions":["aw"]},"application/atf":{"source":"iana"},"application/atfx":{"source":"iana"},"application/atom+xml":{"source":"iana","compressible":true,"extensions":["atom"]},"application/atomcat+xml":{"source":"iana","compressible":true,"extensions":["atomcat"]},"application/atomdeleted+xml":{"source":"iana","compressible":true},"application/atomicmail":{"source":"iana"},"application/atomsvc+xml":{"source":"iana","compressible":true,"extensions":["atomsvc"]},"application/atsc-dwd+xml":{"source":"iana","compressible":true},"application/atsc-held+xml":{"source":"iana","compressible":true},"application/atsc-rsat+xml":{"source":"iana","compressible":true},"application/atxml":{"source":"iana"},"application/auth-policy+xml":{"source":"iana","compressible":true},"application/bacnet-xdd+zip":{"source":"iana","compressible":false},"application/batch-smtp":{"source":"iana"},"application/bdoc":{"compressible":false,"extensions":["bdoc"]},"application/beep+xml":{"source":"iana","compressible":true},"application/calendar+json":{"source":"iana","compressible":true},"application/calendar+xml":{"source":"iana","compressible":true},"application/call-completion":{"source":"iana"},"application/cals-1840":{"source":"iana"},"application/cbor":{"source":"iana"},"application/cccex":{"source":"iana"},"application/ccmp+xml":{"source":"iana","compressible":true},"application/ccxml+xml":{"source":"iana","compressible":true,"extensions":["ccxml"]},"application/cdfx+xml":{"source":"iana","compressible":true},"application/cdmi-capability":{"source":"iana","extensions":["cdmia"]},"application/cdmi-container":{"source":"iana","extensions":["cdmic"]},"application/cdmi-domain":{"source":"iana","extensions":["cdmid"]},"application/cdmi-object":{"source":"iana","extensions":["cdmio"]},"application/cdmi-queue":{"source":"iana","extensions":["cdmiq"]},"application/cdni":{"source":"iana"},"application/cea":{"source":"iana"},"application/cea-2018+xml":{"source":"iana","compressible":true},"application/cellml+xml":{"source":"iana","compressible":true},"application/cfw":{"source":"iana"},"application/clue_info+xml":{"source":"iana","compressible":true},"application/cms":{"source":"iana"},"application/cnrp+xml":{"source":"iana","compressible":true},"application/coap-group+json":{"source":"iana","compressible":true},"application/coap-payload":{"source":"iana"},"application/commonground":{"source":"iana"},"application/conference-info+xml":{"source":"iana","compressible":true},"application/cose":{"source":"iana"},"application/cose-key":{"source":"iana"},"application/cose-key-set":{"source":"iana"},"application/cpl+xml":{"source":"iana","compressible":true},"application/csrattrs":{"source":"iana"},"application/csta+xml":{"source":"iana","compressible":true},"application/cstadata+xml":{"source":"iana","compressible":true},"application/csvm+json":{"source":"iana","compressible":true},"application/cu-seeme":{"source":"apache","extensions":["cu"]},"application/cwt":{"source":"iana"},"application/cybercash":{"source":"iana"},"application/dart":{"compressible":true},"application/dash+xml":{"source":"iana","compressible":true,"extensions":["mpd"]},"application/dashdelta":{"source":"iana"},"application/davmount+xml":{"source":"iana","compressible":true,"extensions":["davmount"]},"application/dca-rft":{"source":"iana"},"application/dcd":{"source":"iana"},"application/dec-dx":{"source":"iana"},"application/dialog-info+xml":{"source":"iana","compressible":true},"application/dicom":{"source":"iana"},"application/dicom+json":{"source":"iana","compressible":true},"application/dicom+xml":{"source":"iana","compressible":true},"application/dii":{"source":"iana"},"application/dit":{"source":"iana"},"application/dns":{"source":"iana"},"application/dns+json":{"source":"iana","compressible":true},"application/dns-message":{"source":"iana"},"application/docbook+xml":{"source":"apache","compressible":true,"extensions":["dbk"]},"application/dskpp+xml":{"source":"iana","compressible":true},"application/dssc+der":{"source":"iana","extensions":["dssc"]},"application/dssc+xml":{"source":"iana","compressible":true,"extensions":["xdssc"]},"application/dvcs":{"source":"iana"},"application/ecmascript":{"source":"iana","compressible":true,"extensions":["ecma","es"]},"application/edi-consent":{"source":"iana"},"application/edi-x12":{"source":"iana","compressible":false},"application/edifact":{"source":"iana","compressible":false},"application/efi":{"source":"iana"},"application/emergencycalldata.comment+xml":{"source":"iana","compressible":true},"application/emergencycalldata.control+xml":{"source":"iana","compressible":true},"application/emergencycalldata.deviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.ecall.msd":{"source":"iana"},"application/emergencycalldata.providerinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.serviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.subscriberinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.veds+xml":{"source":"iana","compressible":true},"application/emma+xml":{"source":"iana","compressible":true,"extensions":["emma"]},"application/emotionml+xml":{"source":"iana","compressible":true},"application/encaprtp":{"source":"iana"},"application/epp+xml":{"source":"iana","compressible":true},"application/epub+zip":{"source":"iana","compressible":false,"extensions":["epub"]},"application/eshop":{"source":"iana"},"application/exi":{"source":"iana","extensions":["exi"]},"application/expect-ct-report+json":{"source":"iana","compressible":true},"application/fastinfoset":{"source":"iana"},"application/fastsoap":{"source":"iana"},"application/fdt+xml":{"source":"iana","compressible":true},"application/fhir+json":{"source":"iana","compressible":true},"application/fhir+xml":{"source":"iana","compressible":true},"application/fido.trusted-apps+json":{"compressible":true},"application/fits":{"source":"iana"},"application/flexfec":{"source":"iana"},"application/font-sfnt":{"source":"iana"},"application/font-tdpfr":{"source":"iana","extensions":["pfr"]},"application/font-woff":{"source":"iana","compressible":false},"application/framework-attributes+xml":{"source":"iana","compressible":true},"application/geo+json":{"source":"iana","compressible":true,"extensions":["geojson"]},"application/geo+json-seq":{"source":"iana"},"application/geopackage+sqlite3":{"source":"iana"},"application/geoxacml+xml":{"source":"iana","compressible":true},"application/gltf-buffer":{"source":"iana"},"application/gml+xml":{"source":"iana","compressible":true,"extensions":["gml"]},"application/gpx+xml":{"source":"apache","compressible":true,"extensions":["gpx"]},"application/gxf":{"source":"apache","extensions":["gxf"]},"application/gzip":{"source":"iana","compressible":false,"extensions":["gz"]},"application/h224":{"source":"iana"},"application/held+xml":{"source":"iana","compressible":true},"application/hjson":{"extensions":["hjson"]},"application/http":{"source":"iana"},"application/hyperstudio":{"source":"iana","extensions":["stk"]},"application/ibe-key-request+xml":{"source":"iana","compressible":true},"application/ibe-pkg-reply+xml":{"source":"iana","compressible":true},"application/ibe-pp-data":{"source":"iana"},"application/iges":{"source":"iana"},"application/im-iscomposing+xml":{"source":"iana","compressible":true},"application/index":{"source":"iana"},"application/index.cmd":{"source":"iana"},"application/index.obj":{"source":"iana"},"application/index.response":{"source":"iana"},"application/index.vnd":{"source":"iana"},"application/inkml+xml":{"source":"iana","compressible":true,"extensions":["ink","inkml"]},"application/iotp":{"source":"iana"},"application/ipfix":{"source":"iana","extensions":["ipfix"]},"application/ipp":{"source":"iana"},"application/isup":{"source":"iana"},"application/its+xml":{"source":"iana","compressible":true},"application/java-archive":{"source":"apache","compressible":false,"extensions":["jar","war","ear"]},"application/java-serialized-object":{"source":"apache","compressible":false,"extensions":["ser"]},"application/java-vm":{"source":"apache","compressible":false,"extensions":["class"]},"application/javascript":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["js","mjs"]},"application/jf2feed+json":{"source":"iana","compressible":true},"application/jose":{"source":"iana"},"application/jose+json":{"source":"iana","compressible":true},"application/jrd+json":{"source":"iana","compressible":true},"application/json":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["json","map"]},"application/json-patch+json":{"source":"iana","compressible":true},"application/json-seq":{"source":"iana"},"application/json5":{"extensions":["json5"]},"application/jsonml+json":{"source":"apache","compressible":true,"extensions":["jsonml"]},"application/jwk+json":{"source":"iana","compressible":true},"application/jwk-set+json":{"source":"iana","compressible":true},"application/jwt":{"source":"iana"},"application/kpml-request+xml":{"source":"iana","compressible":true},"application/kpml-response+xml":{"source":"iana","compressible":true},"application/ld+json":{"source":"iana","compressible":true,"extensions":["jsonld"]},"application/lgr+xml":{"source":"iana","compressible":true},"application/link-format":{"source":"iana"},"application/load-control+xml":{"source":"iana","compressible":true},"application/lost+xml":{"source":"iana","compressible":true,"extensions":["lostxml"]},"application/lostsync+xml":{"source":"iana","compressible":true},"application/lxf":{"source":"iana"},"application/mac-binhex40":{"source":"iana","extensions":["hqx"]},"application/mac-compactpro":{"source":"apache","extensions":["cpt"]},"application/macwriteii":{"source":"iana"},"application/mads+xml":{"source":"iana","compressible":true,"extensions":["mads"]},"application/manifest+json":{"charset":"UTF-8","compressible":true,"extensions":["webmanifest"]},"application/marc":{"source":"iana","extensions":["mrc"]},"application/marcxml+xml":{"source":"iana","compressible":true,"extensions":["mrcx"]},"application/mathematica":{"source":"iana","extensions":["ma","nb","mb"]},"application/mathml+xml":{"source":"iana","compressible":true,"extensions":["mathml"]},"application/mathml-content+xml":{"source":"iana","compressible":true},"application/mathml-presentation+xml":{"source":"iana","compressible":true},"application/mbms-associated-procedure-description+xml":{"source":"iana","compressible":true},"application/mbms-deregister+xml":{"source":"iana","compressible":true},"application/mbms-envelope+xml":{"source":"iana","compressible":true},"application/mbms-msk+xml":{"source":"iana","compressible":true},"application/mbms-msk-response+xml":{"source":"iana","compressible":true},"application/mbms-protection-description+xml":{"source":"iana","compressible":true},"application/mbms-reception-report+xml":{"source":"iana","compressible":true},"application/mbms-register+xml":{"source":"iana","compressible":true},"application/mbms-register-response+xml":{"source":"iana","compressible":true},"application/mbms-schedule+xml":{"source":"iana","compressible":true},"application/mbms-user-service-description+xml":{"source":"iana","compressible":true},"application/mbox":{"source":"iana","extensions":["mbox"]},"application/media-policy-dataset+xml":{"source":"iana","compressible":true},"application/media_control+xml":{"source":"iana","compressible":true},"application/mediaservercontrol+xml":{"source":"iana","compressible":true,"extensions":["mscml"]},"application/merge-patch+json":{"source":"iana","compressible":true},"application/metalink+xml":{"source":"apache","compressible":true,"extensions":["metalink"]},"application/metalink4+xml":{"source":"iana","compressible":true,"extensions":["meta4"]},"application/mets+xml":{"source":"iana","compressible":true,"extensions":["mets"]},"application/mf4":{"source":"iana"},"application/mikey":{"source":"iana"},"application/mipc":{"source":"iana"},"application/mmt-aei+xml":{"source":"iana","compressible":true},"application/mmt-usd+xml":{"source":"iana","compressible":true},"application/mods+xml":{"source":"iana","compressible":true,"extensions":["mods"]},"application/moss-keys":{"source":"iana"},"application/moss-signature":{"source":"iana"},"application/mosskey-data":{"source":"iana"},"application/mosskey-request":{"source":"iana"},"application/mp21":{"source":"iana","extensions":["m21","mp21"]},"application/mp4":{"source":"iana","extensions":["mp4s","m4p"]},"application/mpeg4-generic":{"source":"iana"},"application/mpeg4-iod":{"source":"iana"},"application/mpeg4-iod-xmt":{"source":"iana"},"application/mrb-consumer+xml":{"source":"iana","compressible":true},"application/mrb-publish+xml":{"source":"iana","compressible":true},"application/msc-ivr+xml":{"source":"iana","compressible":true},"application/msc-mixer+xml":{"source":"iana","compressible":true},"application/msword":{"source":"iana","compressible":false,"extensions":["doc","dot"]},"application/mud+json":{"source":"iana","compressible":true},"application/mxf":{"source":"iana","extensions":["mxf"]},"application/n-quads":{"source":"iana","extensions":["nq"]},"application/n-triples":{"source":"iana","extensions":["nt"]},"application/nasdata":{"source":"iana"},"application/news-checkgroups":{"source":"iana"},"application/news-groupinfo":{"source":"iana"},"application/news-transmission":{"source":"iana"},"application/nlsml+xml":{"source":"iana","compressible":true},"application/node":{"source":"iana"},"application/nss":{"source":"iana"},"application/ocsp-request":{"source":"iana"},"application/ocsp-response":{"source":"iana"},"application/octet-stream":{"source":"iana","compressible":false,"extensions":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"]},"application/oda":{"source":"iana","extensions":["oda"]},"application/odm+xml":{"source":"iana","compressible":true},"application/odx":{"source":"iana"},"application/oebps-package+xml":{"source":"iana","compressible":true,"extensions":["opf"]},"application/ogg":{"source":"iana","compressible":false,"extensions":["ogx"]},"application/omdoc+xml":{"source":"apache","compressible":true,"extensions":["omdoc"]},"application/onenote":{"source":"apache","extensions":["onetoc","onetoc2","onetmp","onepkg"]},"application/oscore":{"source":"iana"},"application/oxps":{"source":"iana","extensions":["oxps"]},"application/p2p-overlay+xml":{"source":"iana","compressible":true},"application/parityfec":{"source":"iana"},"application/passport":{"source":"iana"},"application/patch-ops-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/pdf":{"source":"iana","compressible":false,"extensions":["pdf"]},"application/pdx":{"source":"iana"},"application/pem-certificate-chain":{"source":"iana"},"application/pgp-encrypted":{"source":"iana","compressible":false,"extensions":["pgp"]},"application/pgp-keys":{"source":"iana"},"application/pgp-signature":{"source":"iana","extensions":["asc","sig"]},"application/pics-rules":{"source":"apache","extensions":["prf"]},"application/pidf+xml":{"source":"iana","compressible":true},"application/pidf-diff+xml":{"source":"iana","compressible":true},"application/pkcs10":{"source":"iana","extensions":["p10"]},"application/pkcs12":{"source":"iana"},"application/pkcs7-mime":{"source":"iana","extensions":["p7m","p7c"]},"application/pkcs7-signature":{"source":"iana","extensions":["p7s"]},"application/pkcs8":{"source":"iana","extensions":["p8"]},"application/pkcs8-encrypted":{"source":"iana"},"application/pkix-attr-cert":{"source":"iana","extensions":["ac"]},"application/pkix-cert":{"source":"iana","extensions":["cer"]},"application/pkix-crl":{"source":"iana","extensions":["crl"]},"application/pkix-pkipath":{"source":"iana","extensions":["pkipath"]},"application/pkixcmp":{"source":"iana","extensions":["pki"]},"application/pls+xml":{"source":"iana","compressible":true,"extensions":["pls"]},"application/poc-settings+xml":{"source":"iana","compressible":true},"application/postscript":{"source":"iana","compressible":true,"extensions":["ai","eps","ps"]},"application/ppsp-tracker+json":{"source":"iana","compressible":true},"application/problem+json":{"source":"iana","compressible":true},"application/problem+xml":{"source":"iana","compressible":true},"application/provenance+xml":{"source":"iana","compressible":true},"application/prs.alvestrand.titrax-sheet":{"source":"iana"},"application/prs.cww":{"source":"iana","extensions":["cww"]},"application/prs.hpub+zip":{"source":"iana","compressible":false},"application/prs.nprend":{"source":"iana"},"application/prs.plucker":{"source":"iana"},"application/prs.rdf-xml-crypt":{"source":"iana"},"application/prs.xsf+xml":{"source":"iana","compressible":true},"application/pskc+xml":{"source":"iana","compressible":true,"extensions":["pskcxml"]},"application/qsig":{"source":"iana"},"application/raml+yaml":{"compressible":true,"extensions":["raml"]},"application/raptorfec":{"source":"iana"},"application/rdap+json":{"source":"iana","compressible":true},"application/rdf+xml":{"source":"iana","compressible":true,"extensions":["rdf","owl"]},"application/reginfo+xml":{"source":"iana","compressible":true,"extensions":["rif"]},"application/relax-ng-compact-syntax":{"source":"iana","extensions":["rnc"]},"application/remote-printing":{"source":"iana"},"application/reputon+json":{"source":"iana","compressible":true},"application/resource-lists+xml":{"source":"iana","compressible":true,"extensions":["rl"]},"application/resource-lists-diff+xml":{"source":"iana","compressible":true,"extensions":["rld"]},"application/rfc+xml":{"source":"iana","compressible":true},"application/riscos":{"source":"iana"},"application/rlmi+xml":{"source":"iana","compressible":true},"application/rls-services+xml":{"source":"iana","compressible":true,"extensions":["rs"]},"application/route-apd+xml":{"source":"iana","compressible":true},"application/route-s-tsid+xml":{"source":"iana","compressible":true},"application/route-usd+xml":{"source":"iana","compressible":true},"application/rpki-ghostbusters":{"source":"iana","extensions":["gbr"]},"application/rpki-manifest":{"source":"iana","extensions":["mft"]},"application/rpki-publication":{"source":"iana"},"application/rpki-roa":{"source":"iana","extensions":["roa"]},"application/rpki-updown":{"source":"iana"},"application/rsd+xml":{"source":"apache","compressible":true,"extensions":["rsd"]},"application/rss+xml":{"source":"apache","compressible":true,"extensions":["rss"]},"application/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"application/rtploopback":{"source":"iana"},"application/rtx":{"source":"iana"},"application/samlassertion+xml":{"source":"iana","compressible":true},"application/samlmetadata+xml":{"source":"iana","compressible":true},"application/sbml+xml":{"source":"iana","compressible":true,"extensions":["sbml"]},"application/scaip+xml":{"source":"iana","compressible":true},"application/scim+json":{"source":"iana","compressible":true},"application/scvp-cv-request":{"source":"iana","extensions":["scq"]},"application/scvp-cv-response":{"source":"iana","extensions":["scs"]},"application/scvp-vp-request":{"source":"iana","extensions":["spq"]},"application/scvp-vp-response":{"source":"iana","extensions":["spp"]},"application/sdp":{"source":"iana","extensions":["sdp"]},"application/secevent+jwt":{"source":"iana"},"application/senml+cbor":{"source":"iana"},"application/senml+json":{"source":"iana","compressible":true},"application/senml+xml":{"source":"iana","compressible":true},"application/senml-exi":{"source":"iana"},"application/sensml+cbor":{"source":"iana"},"application/sensml+json":{"source":"iana","compressible":true},"application/sensml+xml":{"source":"iana","compressible":true},"application/sensml-exi":{"source":"iana"},"application/sep+xml":{"source":"iana","compressible":true},"application/sep-exi":{"source":"iana"},"application/session-info":{"source":"iana"},"application/set-payment":{"source":"iana"},"application/set-payment-initiation":{"source":"iana","extensions":["setpay"]},"application/set-registration":{"source":"iana"},"application/set-registration-initiation":{"source":"iana","extensions":["setreg"]},"application/sgml":{"source":"iana"},"application/sgml-open-catalog":{"source":"iana"},"application/shf+xml":{"source":"iana","compressible":true,"extensions":["shf"]},"application/sieve":{"source":"iana","extensions":["siv","sieve"]},"application/simple-filter+xml":{"source":"iana","compressible":true},"application/simple-message-summary":{"source":"iana"},"application/simplesymbolcontainer":{"source":"iana"},"application/sipc":{"source":"iana"},"application/slate":{"source":"iana"},"application/smil":{"source":"iana"},"application/smil+xml":{"source":"iana","compressible":true,"extensions":["smi","smil"]},"application/smpte336m":{"source":"iana"},"application/soap+fastinfoset":{"source":"iana"},"application/soap+xml":{"source":"iana","compressible":true},"application/sparql-query":{"source":"iana","extensions":["rq"]},"application/sparql-results+xml":{"source":"iana","compressible":true,"extensions":["srx"]},"application/spirits-event+xml":{"source":"iana","compressible":true},"application/sql":{"source":"iana"},"application/srgs":{"source":"iana","extensions":["gram"]},"application/srgs+xml":{"source":"iana","compressible":true,"extensions":["grxml"]},"application/sru+xml":{"source":"iana","compressible":true,"extensions":["sru"]},"application/ssdl+xml":{"source":"apache","compressible":true,"extensions":["ssdl"]},"application/ssml+xml":{"source":"iana","compressible":true,"extensions":["ssml"]},"application/stix+json":{"source":"iana","compressible":true},"application/swid+xml":{"source":"iana","compressible":true},"application/tamp-apex-update":{"source":"iana"},"application/tamp-apex-update-confirm":{"source":"iana"},"application/tamp-community-update":{"source":"iana"},"application/tamp-community-update-confirm":{"source":"iana"},"application/tamp-error":{"source":"iana"},"application/tamp-sequence-adjust":{"source":"iana"},"application/tamp-sequence-adjust-confirm":{"source":"iana"},"application/tamp-status-query":{"source":"iana"},"application/tamp-status-response":{"source":"iana"},"application/tamp-update":{"source":"iana"},"application/tamp-update-confirm":{"source":"iana"},"application/tar":{"compressible":true},"application/taxii+json":{"source":"iana","compressible":true},"application/tei+xml":{"source":"iana","compressible":true,"extensions":["tei","teicorpus"]},"application/tetra_isi":{"source":"iana"},"application/thraud+xml":{"source":"iana","compressible":true,"extensions":["tfi"]},"application/timestamp-query":{"source":"iana"},"application/timestamp-reply":{"source":"iana"},"application/timestamped-data":{"source":"iana","extensions":["tsd"]},"application/tlsrpt+gzip":{"source":"iana"},"application/tlsrpt+json":{"source":"iana","compressible":true},"application/tnauthlist":{"source":"iana"},"application/toml":{"compressible":true,"extensions":["toml"]},"application/trickle-ice-sdpfrag":{"source":"iana"},"application/trig":{"source":"iana"},"application/ttml+xml":{"source":"iana","compressible":true},"application/tve-trigger":{"source":"iana"},"application/tzif":{"source":"iana"},"application/tzif-leap":{"source":"iana"},"application/ulpfec":{"source":"iana"},"application/urc-grpsheet+xml":{"source":"iana","compressible":true},"application/urc-ressheet+xml":{"source":"iana","compressible":true},"application/urc-targetdesc+xml":{"source":"iana","compressible":true},"application/urc-uisocketdesc+xml":{"source":"iana","compressible":true},"application/vcard+json":{"source":"iana","compressible":true},"application/vcard+xml":{"source":"iana","compressible":true},"application/vemmi":{"source":"iana"},"application/vividence.scriptfile":{"source":"apache"},"application/vnd.1000minds.decision-model+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose-pc3ch+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-v2x-local-service-information":{"source":"iana"},"application/vnd.3gpp.access-transfer-events+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.bsf+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.gmop+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mc-signalling-ear":{"source":"iana"},"application/vnd.3gpp.mcdata-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-payload":{"source":"iana"},"application/vnd.3gpp.mcdata-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-signalling":{"source":"iana"},"application/vnd.3gpp.mcdata-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-floor-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-signed+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-init-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-transmission-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mid-call+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.pic-bw-large":{"source":"iana","extensions":["plb"]},"application/vnd.3gpp.pic-bw-small":{"source":"iana","extensions":["psb"]},"application/vnd.3gpp.pic-bw-var":{"source":"iana","extensions":["pvb"]},"application/vnd.3gpp.sms":{"source":"iana"},"application/vnd.3gpp.sms+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-ext+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.state-and-event-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.ussd+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.bcmcsinfo+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.sms":{"source":"iana"},"application/vnd.3gpp2.tcap":{"source":"iana","extensions":["tcap"]},"application/vnd.3lightssoftware.imagescal":{"source":"iana"},"application/vnd.3m.post-it-notes":{"source":"iana","extensions":["pwn"]},"application/vnd.accpac.simply.aso":{"source":"iana","extensions":["aso"]},"application/vnd.accpac.simply.imp":{"source":"iana","extensions":["imp"]},"application/vnd.acucobol":{"source":"iana","extensions":["acu"]},"application/vnd.acucorp":{"source":"iana","extensions":["atc","acutc"]},"application/vnd.adobe.air-application-installer-package+zip":{"source":"apache","compressible":false,"extensions":["air"]},"application/vnd.adobe.flash.movie":{"source":"iana"},"application/vnd.adobe.formscentral.fcdt":{"source":"iana","extensions":["fcdt"]},"application/vnd.adobe.fxp":{"source":"iana","extensions":["fxp","fxpl"]},"application/vnd.adobe.partial-upload":{"source":"iana"},"application/vnd.adobe.xdp+xml":{"source":"iana","compressible":true,"extensions":["xdp"]},"application/vnd.adobe.xfdf":{"source":"iana","extensions":["xfdf"]},"application/vnd.aether.imp":{"source":"iana"},"application/vnd.afpc.afplinedata":{"source":"iana"},"application/vnd.afpc.modca":{"source":"iana"},"application/vnd.ah-barcode":{"source":"iana"},"application/vnd.ahead.space":{"source":"iana","extensions":["ahead"]},"application/vnd.airzip.filesecure.azf":{"source":"iana","extensions":["azf"]},"application/vnd.airzip.filesecure.azs":{"source":"iana","extensions":["azs"]},"application/vnd.amadeus+json":{"source":"iana","compressible":true},"application/vnd.amazon.ebook":{"source":"apache","extensions":["azw"]},"application/vnd.amazon.mobi8-ebook":{"source":"iana"},"application/vnd.americandynamics.acc":{"source":"iana","extensions":["acc"]},"application/vnd.amiga.ami":{"source":"iana","extensions":["ami"]},"application/vnd.amundsen.maze+xml":{"source":"iana","compressible":true},"application/vnd.android.ota":{"source":"iana"},"application/vnd.android.package-archive":{"source":"apache","compressible":false,"extensions":["apk"]},"application/vnd.anki":{"source":"iana"},"application/vnd.anser-web-certificate-issue-initiation":{"source":"iana","extensions":["cii"]},"application/vnd.anser-web-funds-transfer-initiation":{"source":"apache","extensions":["fti"]},"application/vnd.antix.game-component":{"source":"iana","extensions":["atx"]},"application/vnd.apache.thrift.binary":{"source":"iana"},"application/vnd.apache.thrift.compact":{"source":"iana"},"application/vnd.apache.thrift.json":{"source":"iana"},"application/vnd.api+json":{"source":"iana","compressible":true},"application/vnd.apothekende.reservation+json":{"source":"iana","compressible":true},"application/vnd.apple.installer+xml":{"source":"iana","compressible":true,"extensions":["mpkg"]},"application/vnd.apple.keynote":{"source":"iana","extensions":["keynote"]},"application/vnd.apple.mpegurl":{"source":"iana","extensions":["m3u8"]},"application/vnd.apple.numbers":{"source":"iana","extensions":["numbers"]},"application/vnd.apple.pages":{"source":"iana","extensions":["pages"]},"application/vnd.apple.pkpass":{"compressible":false,"extensions":["pkpass"]},"application/vnd.arastra.swi":{"source":"iana"},"application/vnd.aristanetworks.swi":{"source":"iana","extensions":["swi"]},"application/vnd.artisan+json":{"source":"iana","compressible":true},"application/vnd.artsquare":{"source":"iana"},"application/vnd.astraea-software.iota":{"source":"iana","extensions":["iota"]},"application/vnd.audiograph":{"source":"iana","extensions":["aep"]},"application/vnd.autopackage":{"source":"iana"},"application/vnd.avalon+json":{"source":"iana","compressible":true},"application/vnd.avistar+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmml+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmpr":{"source":"iana"},"application/vnd.banana-accounting":{"source":"iana"},"application/vnd.bbf.usp.error":{"source":"iana"},"application/vnd.bbf.usp.msg":{"source":"iana"},"application/vnd.bbf.usp.msg+json":{"source":"iana","compressible":true},"application/vnd.bekitzur-stech+json":{"source":"iana","compressible":true},"application/vnd.bint.med-content":{"source":"iana"},"application/vnd.biopax.rdf+xml":{"source":"iana","compressible":true},"application/vnd.blink-idb-value-wrapper":{"source":"iana"},"application/vnd.blueice.multipass":{"source":"iana","extensions":["mpm"]},"application/vnd.bluetooth.ep.oob":{"source":"iana"},"application/vnd.bluetooth.le.oob":{"source":"iana"},"application/vnd.bmi":{"source":"iana","extensions":["bmi"]},"application/vnd.bpf":{"source":"iana"},"application/vnd.bpf3":{"source":"iana"},"application/vnd.businessobjects":{"source":"iana","extensions":["rep"]},"application/vnd.byu.uapi+json":{"source":"iana","compressible":true},"application/vnd.cab-jscript":{"source":"iana"},"application/vnd.canon-cpdl":{"source":"iana"},"application/vnd.canon-lips":{"source":"iana"},"application/vnd.capasystems-pg+json":{"source":"iana","compressible":true},"application/vnd.cendio.thinlinc.clientconf":{"source":"iana"},"application/vnd.century-systems.tcp_stream":{"source":"iana"},"application/vnd.chemdraw+xml":{"source":"iana","compressible":true,"extensions":["cdxml"]},"application/vnd.chess-pgn":{"source":"iana"},"application/vnd.chipnuts.karaoke-mmd":{"source":"iana","extensions":["mmd"]},"application/vnd.ciedi":{"source":"iana"},"application/vnd.cinderella":{"source":"iana","extensions":["cdy"]},"application/vnd.cirpack.isdn-ext":{"source":"iana"},"application/vnd.citationstyles.style+xml":{"source":"iana","compressible":true,"extensions":["csl"]},"application/vnd.claymore":{"source":"iana","extensions":["cla"]},"application/vnd.cloanto.rp9":{"source":"iana","extensions":["rp9"]},"application/vnd.clonk.c4group":{"source":"iana","extensions":["c4g","c4d","c4f","c4p","c4u"]},"application/vnd.cluetrust.cartomobile-config":{"source":"iana","extensions":["c11amc"]},"application/vnd.cluetrust.cartomobile-config-pkg":{"source":"iana","extensions":["c11amz"]},"application/vnd.coffeescript":{"source":"iana"},"application/vnd.collabio.xodocuments.document":{"source":"iana"},"application/vnd.collabio.xodocuments.document-template":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation-template":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet-template":{"source":"iana"},"application/vnd.collection+json":{"source":"iana","compressible":true},"application/vnd.collection.doc+json":{"source":"iana","compressible":true},"application/vnd.collection.next+json":{"source":"iana","compressible":true},"application/vnd.comicbook+zip":{"source":"iana","compressible":false},"application/vnd.comicbook-rar":{"source":"iana"},"application/vnd.commerce-battelle":{"source":"iana"},"application/vnd.commonspace":{"source":"iana","extensions":["csp"]},"application/vnd.contact.cmsg":{"source":"iana","extensions":["cdbcmsg"]},"application/vnd.coreos.ignition+json":{"source":"iana","compressible":true},"application/vnd.cosmocaller":{"source":"iana","extensions":["cmc"]},"application/vnd.crick.clicker":{"source":"iana","extensions":["clkx"]},"application/vnd.crick.clicker.keyboard":{"source":"iana","extensions":["clkk"]},"application/vnd.crick.clicker.palette":{"source":"iana","extensions":["clkp"]},"application/vnd.crick.clicker.template":{"source":"iana","extensions":["clkt"]},"application/vnd.crick.clicker.wordbank":{"source":"iana","extensions":["clkw"]},"application/vnd.criticaltools.wbs+xml":{"source":"iana","compressible":true,"extensions":["wbs"]},"application/vnd.cryptii.pipe+json":{"source":"iana","compressible":true},"application/vnd.crypto-shade-file":{"source":"iana"},"application/vnd.ctc-posml":{"source":"iana","extensions":["pml"]},"application/vnd.ctct.ws+xml":{"source":"iana","compressible":true},"application/vnd.cups-pdf":{"source":"iana"},"application/vnd.cups-postscript":{"source":"iana"},"application/vnd.cups-ppd":{"source":"iana","extensions":["ppd"]},"application/vnd.cups-raster":{"source":"iana"},"application/vnd.cups-raw":{"source":"iana"},"application/vnd.curl":{"source":"iana"},"application/vnd.curl.car":{"source":"apache","extensions":["car"]},"application/vnd.curl.pcurl":{"source":"apache","extensions":["pcurl"]},"application/vnd.cyan.dean.root+xml":{"source":"iana","compressible":true},"application/vnd.cybank":{"source":"iana"},"application/vnd.d2l.coursepackage1p0+zip":{"source":"iana","compressible":false},"application/vnd.dart":{"source":"iana","compressible":true,"extensions":["dart"]},"application/vnd.data-vision.rdz":{"source":"iana","extensions":["rdz"]},"application/vnd.datapackage+json":{"source":"iana","compressible":true},"application/vnd.dataresource+json":{"source":"iana","compressible":true},"application/vnd.debian.binary-package":{"source":"iana"},"application/vnd.dece.data":{"source":"iana","extensions":["uvf","uvvf","uvd","uvvd"]},"application/vnd.dece.ttml+xml":{"source":"iana","compressible":true,"extensions":["uvt","uvvt"]},"application/vnd.dece.unspecified":{"source":"iana","extensions":["uvx","uvvx"]},"application/vnd.dece.zip":{"source":"iana","extensions":["uvz","uvvz"]},"application/vnd.denovo.fcselayout-link":{"source":"iana","extensions":["fe_launch"]},"application/vnd.desmume.movie":{"source":"iana"},"application/vnd.dir-bi.plate-dl-nosuffix":{"source":"iana"},"application/vnd.dm.delegation+xml":{"source":"iana","compressible":true},"application/vnd.dna":{"source":"iana","extensions":["dna"]},"application/vnd.document+json":{"source":"iana","compressible":true},"application/vnd.dolby.mlp":{"source":"apache","extensions":["mlp"]},"application/vnd.dolby.mobile.1":{"source":"iana"},"application/vnd.dolby.mobile.2":{"source":"iana"},"application/vnd.doremir.scorecloud-binary-document":{"source":"iana"},"application/vnd.dpgraph":{"source":"iana","extensions":["dpg"]},"application/vnd.dreamfactory":{"source":"iana","extensions":["dfac"]},"application/vnd.drive+json":{"source":"iana","compressible":true},"application/vnd.ds-keypoint":{"source":"apache","extensions":["kpxx"]},"application/vnd.dtg.local":{"source":"iana"},"application/vnd.dtg.local.flash":{"source":"iana"},"application/vnd.dtg.local.html":{"source":"iana"},"application/vnd.dvb.ait":{"source":"iana","extensions":["ait"]},"application/vnd.dvb.dvbj":{"source":"iana"},"application/vnd.dvb.esgcontainer":{"source":"iana"},"application/vnd.dvb.ipdcdftnotifaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess2":{"source":"iana"},"application/vnd.dvb.ipdcesgpdd":{"source":"iana"},"application/vnd.dvb.ipdcroaming":{"source":"iana"},"application/vnd.dvb.iptv.alfec-base":{"source":"iana"},"application/vnd.dvb.iptv.alfec-enhancement":{"source":"iana"},"application/vnd.dvb.notif-aggregate-root+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-container+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-generic+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-msglist+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-request+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-response+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-init+xml":{"source":"iana","compressible":true},"application/vnd.dvb.pfr":{"source":"iana"},"application/vnd.dvb.service":{"source":"iana","extensions":["svc"]},"application/vnd.dxr":{"source":"iana"},"application/vnd.dynageo":{"source":"iana","extensions":["geo"]},"application/vnd.dzr":{"source":"iana"},"application/vnd.easykaraoke.cdgdownload":{"source":"iana"},"application/vnd.ecdis-update":{"source":"iana"},"application/vnd.ecip.rlp":{"source":"iana"},"application/vnd.ecowin.chart":{"source":"iana","extensions":["mag"]},"application/vnd.ecowin.filerequest":{"source":"iana"},"application/vnd.ecowin.fileupdate":{"source":"iana"},"application/vnd.ecowin.series":{"source":"iana"},"application/vnd.ecowin.seriesrequest":{"source":"iana"},"application/vnd.ecowin.seriesupdate":{"source":"iana"},"application/vnd.efi.img":{"source":"iana"},"application/vnd.efi.iso":{"source":"iana"},"application/vnd.emclient.accessrequest+xml":{"source":"iana","compressible":true},"application/vnd.enliven":{"source":"iana","extensions":["nml"]},"application/vnd.enphase.envoy":{"source":"iana"},"application/vnd.eprints.data+xml":{"source":"iana","compressible":true},"application/vnd.epson.esf":{"source":"iana","extensions":["esf"]},"application/vnd.epson.msf":{"source":"iana","extensions":["msf"]},"application/vnd.epson.quickanime":{"source":"iana","extensions":["qam"]},"application/vnd.epson.salt":{"source":"iana","extensions":["slt"]},"application/vnd.epson.ssf":{"source":"iana","extensions":["ssf"]},"application/vnd.ericsson.quickcall":{"source":"iana"},"application/vnd.espass-espass+zip":{"source":"iana","compressible":false},"application/vnd.eszigno3+xml":{"source":"iana","compressible":true,"extensions":["es3","et3"]},"application/vnd.etsi.aoc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.asic-e+zip":{"source":"iana","compressible":false},"application/vnd.etsi.asic-s+zip":{"source":"iana","compressible":false},"application/vnd.etsi.cug+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvcommand+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-bc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-cod+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-npvr+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvservice+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsync+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvueprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mcid+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mheg5":{"source":"iana"},"application/vnd.etsi.overload-control-policy-dataset+xml":{"source":"iana","compressible":true},"application/vnd.etsi.pstn+xml":{"source":"iana","compressible":true},"application/vnd.etsi.sci+xml":{"source":"iana","compressible":true},"application/vnd.etsi.simservs+xml":{"source":"iana","compressible":true},"application/vnd.etsi.timestamp-token":{"source":"iana"},"application/vnd.etsi.tsl+xml":{"source":"iana","compressible":true},"application/vnd.etsi.tsl.der":{"source":"iana"},"application/vnd.eudora.data":{"source":"iana"},"application/vnd.evolv.ecig.profile":{"source":"iana"},"application/vnd.evolv.ecig.settings":{"source":"iana"},"application/vnd.evolv.ecig.theme":{"source":"iana"},"application/vnd.exstream-empower+zip":{"source":"iana","compressible":false},"application/vnd.exstream-package":{"source":"iana"},"application/vnd.ezpix-album":{"source":"iana","extensions":["ez2"]},"application/vnd.ezpix-package":{"source":"iana","extensions":["ez3"]},"application/vnd.f-secure.mobile":{"source":"iana"},"application/vnd.fastcopy-disk-image":{"source":"iana"},"application/vnd.fdf":{"source":"iana","extensions":["fdf"]},"application/vnd.fdsn.mseed":{"source":"iana","extensions":["mseed"]},"application/vnd.fdsn.seed":{"source":"iana","extensions":["seed","dataless"]},"application/vnd.ffsns":{"source":"iana"},"application/vnd.ficlab.flb+zip":{"source":"iana","compressible":false},"application/vnd.filmit.zfc":{"source":"iana"},"application/vnd.fints":{"source":"iana"},"application/vnd.firemonkeys.cloudcell":{"source":"iana"},"application/vnd.flographit":{"source":"iana","extensions":["gph"]},"application/vnd.fluxtime.clip":{"source":"iana","extensions":["ftc"]},"application/vnd.font-fontforge-sfd":{"source":"iana"},"application/vnd.framemaker":{"source":"iana","extensions":["fm","frame","maker","book"]},"application/vnd.frogans.fnc":{"source":"iana","extensions":["fnc"]},"application/vnd.frogans.ltf":{"source":"iana","extensions":["ltf"]},"application/vnd.fsc.weblaunch":{"source":"iana","extensions":["fsc"]},"application/vnd.fujitsu.oasys":{"source":"iana","extensions":["oas"]},"application/vnd.fujitsu.oasys2":{"source":"iana","extensions":["oa2"]},"application/vnd.fujitsu.oasys3":{"source":"iana","extensions":["oa3"]},"application/vnd.fujitsu.oasysgp":{"source":"iana","extensions":["fg5"]},"application/vnd.fujitsu.oasysprs":{"source":"iana","extensions":["bh2"]},"application/vnd.fujixerox.art-ex":{"source":"iana"},"application/vnd.fujixerox.art4":{"source":"iana"},"application/vnd.fujixerox.ddd":{"source":"iana","extensions":["ddd"]},"application/vnd.fujixerox.docuworks":{"source":"iana","extensions":["xdw"]},"application/vnd.fujixerox.docuworks.binder":{"source":"iana","extensions":["xbd"]},"application/vnd.fujixerox.docuworks.container":{"source":"iana"},"application/vnd.fujixerox.hbpl":{"source":"iana"},"application/vnd.fut-misnet":{"source":"iana"},"application/vnd.futoin+cbor":{"source":"iana"},"application/vnd.futoin+json":{"source":"iana","compressible":true},"application/vnd.fuzzysheet":{"source":"iana","extensions":["fzs"]},"application/vnd.genomatix.tuxedo":{"source":"iana","extensions":["txd"]},"application/vnd.geo+json":{"source":"iana","compressible":true},"application/vnd.geocube+xml":{"source":"iana","compressible":true},"application/vnd.geogebra.file":{"source":"iana","extensions":["ggb"]},"application/vnd.geogebra.tool":{"source":"iana","extensions":["ggt"]},"application/vnd.geometry-explorer":{"source":"iana","extensions":["gex","gre"]},"application/vnd.geonext":{"source":"iana","extensions":["gxt"]},"application/vnd.geoplan":{"source":"iana","extensions":["g2w"]},"application/vnd.geospace":{"source":"iana","extensions":["g3w"]},"application/vnd.gerber":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt-response":{"source":"iana"},"application/vnd.gmx":{"source":"iana","extensions":["gmx"]},"application/vnd.google-apps.document":{"compressible":false,"extensions":["gdoc"]},"application/vnd.google-apps.presentation":{"compressible":false,"extensions":["gslides"]},"application/vnd.google-apps.spreadsheet":{"compressible":false,"extensions":["gsheet"]},"application/vnd.google-earth.kml+xml":{"source":"iana","compressible":true,"extensions":["kml"]},"application/vnd.google-earth.kmz":{"source":"iana","compressible":false,"extensions":["kmz"]},"application/vnd.gov.sk.e-form+xml":{"source":"iana","compressible":true},"application/vnd.gov.sk.e-form+zip":{"source":"iana","compressible":false},"application/vnd.gov.sk.xmldatacontainer+xml":{"source":"iana","compressible":true},"application/vnd.grafeq":{"source":"iana","extensions":["gqf","gqs"]},"application/vnd.gridmp":{"source":"iana"},"application/vnd.groove-account":{"source":"iana","extensions":["gac"]},"application/vnd.groove-help":{"source":"iana","extensions":["ghf"]},"application/vnd.groove-identity-message":{"source":"iana","extensions":["gim"]},"application/vnd.groove-injector":{"source":"iana","extensions":["grv"]},"application/vnd.groove-tool-message":{"source":"iana","extensions":["gtm"]},"application/vnd.groove-tool-template":{"source":"iana","extensions":["tpl"]},"application/vnd.groove-vcard":{"source":"iana","extensions":["vcg"]},"application/vnd.hal+json":{"source":"iana","compressible":true},"application/vnd.hal+xml":{"source":"iana","compressible":true,"extensions":["hal"]},"application/vnd.handheld-entertainment+xml":{"source":"iana","compressible":true,"extensions":["zmm"]},"application/vnd.hbci":{"source":"iana","extensions":["hbci"]},"application/vnd.hc+json":{"source":"iana","compressible":true},"application/vnd.hcl-bireports":{"source":"iana"},"application/vnd.hdt":{"source":"iana"},"application/vnd.heroku+json":{"source":"iana","compressible":true},"application/vnd.hhe.lesson-player":{"source":"iana","extensions":["les"]},"application/vnd.hp-hpgl":{"source":"iana","extensions":["hpgl"]},"application/vnd.hp-hpid":{"source":"iana","extensions":["hpid"]},"application/vnd.hp-hps":{"source":"iana","extensions":["hps"]},"application/vnd.hp-jlyt":{"source":"iana","extensions":["jlt"]},"application/vnd.hp-pcl":{"source":"iana","extensions":["pcl"]},"application/vnd.hp-pclxl":{"source":"iana","extensions":["pclxl"]},"application/vnd.httphone":{"source":"iana"},"application/vnd.hydrostatix.sof-data":{"source":"iana","extensions":["sfd-hdstx"]},"application/vnd.hyper+json":{"source":"iana","compressible":true},"application/vnd.hyper-item+json":{"source":"iana","compressible":true},"application/vnd.hyperdrive+json":{"source":"iana","compressible":true},"application/vnd.hzn-3d-crossword":{"source":"iana"},"application/vnd.ibm.afplinedata":{"source":"iana"},"application/vnd.ibm.electronic-media":{"source":"iana"},"application/vnd.ibm.minipay":{"source":"iana","extensions":["mpy"]},"application/vnd.ibm.modcap":{"source":"iana","extensions":["afp","listafp","list3820"]},"application/vnd.ibm.rights-management":{"source":"iana","extensions":["irm"]},"application/vnd.ibm.secure-container":{"source":"iana","extensions":["sc"]},"application/vnd.iccprofile":{"source":"iana","extensions":["icc","icm"]},"application/vnd.ieee.1905":{"source":"iana"},"application/vnd.igloader":{"source":"iana","extensions":["igl"]},"application/vnd.imagemeter.folder+zip":{"source":"iana","compressible":false},"application/vnd.imagemeter.image+zip":{"source":"iana","compressible":false},"application/vnd.immervision-ivp":{"source":"iana","extensions":["ivp"]},"application/vnd.immervision-ivu":{"source":"iana","extensions":["ivu"]},"application/vnd.ims.imsccv1p1":{"source":"iana"},"application/vnd.ims.imsccv1p2":{"source":"iana"},"application/vnd.ims.imsccv1p3":{"source":"iana"},"application/vnd.ims.lis.v2.result+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolconsumerprofile+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy.id+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings.simple+json":{"source":"iana","compressible":true},"application/vnd.informedcontrol.rms+xml":{"source":"iana","compressible":true},"application/vnd.informix-visionary":{"source":"iana"},"application/vnd.infotech.project":{"source":"iana"},"application/vnd.infotech.project+xml":{"source":"iana","compressible":true},"application/vnd.innopath.wamp.notification":{"source":"iana"},"application/vnd.insors.igm":{"source":"iana","extensions":["igm"]},"application/vnd.intercon.formnet":{"source":"iana","extensions":["xpw","xpx"]},"application/vnd.intergeo":{"source":"iana","extensions":["i2g"]},"application/vnd.intertrust.digibox":{"source":"iana"},"application/vnd.intertrust.nncp":{"source":"iana"},"application/vnd.intu.qbo":{"source":"iana","extensions":["qbo"]},"application/vnd.intu.qfx":{"source":"iana","extensions":["qfx"]},"application/vnd.iptc.g2.catalogitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.conceptitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.knowledgeitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsmessage+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.packageitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.planningitem+xml":{"source":"iana","compressible":true},"application/vnd.ipunplugged.rcprofile":{"source":"iana","extensions":["rcprofile"]},"application/vnd.irepository.package+xml":{"source":"iana","compressible":true,"extensions":["irp"]},"application/vnd.is-xpr":{"source":"iana","extensions":["xpr"]},"application/vnd.isac.fcs":{"source":"iana","extensions":["fcs"]},"application/vnd.iso11783-10+zip":{"source":"iana","compressible":false},"application/vnd.jam":{"source":"iana","extensions":["jam"]},"application/vnd.japannet-directory-service":{"source":"iana"},"application/vnd.japannet-jpnstore-wakeup":{"source":"iana"},"application/vnd.japannet-payment-wakeup":{"source":"iana"},"application/vnd.japannet-registration":{"source":"iana"},"application/vnd.japannet-registration-wakeup":{"source":"iana"},"application/vnd.japannet-setstore-wakeup":{"source":"iana"},"application/vnd.japannet-verification":{"source":"iana"},"application/vnd.japannet-verification-wakeup":{"source":"iana"},"application/vnd.jcp.javame.midlet-rms":{"source":"iana","extensions":["rms"]},"application/vnd.jisp":{"source":"iana","extensions":["jisp"]},"application/vnd.joost.joda-archive":{"source":"iana","extensions":["joda"]},"application/vnd.jsk.isdn-ngn":{"source":"iana"},"application/vnd.kahootz":{"source":"iana","extensions":["ktz","ktr"]},"application/vnd.kde.karbon":{"source":"iana","extensions":["karbon"]},"application/vnd.kde.kchart":{"source":"iana","extensions":["chrt"]},"application/vnd.kde.kformula":{"source":"iana","extensions":["kfo"]},"application/vnd.kde.kivio":{"source":"iana","extensions":["flw"]},"application/vnd.kde.kontour":{"source":"iana","extensions":["kon"]},"application/vnd.kde.kpresenter":{"source":"iana","extensions":["kpr","kpt"]},"application/vnd.kde.kspread":{"source":"iana","extensions":["ksp"]},"application/vnd.kde.kword":{"source":"iana","extensions":["kwd","kwt"]},"application/vnd.kenameaapp":{"source":"iana","extensions":["htke"]},"application/vnd.kidspiration":{"source":"iana","extensions":["kia"]},"application/vnd.kinar":{"source":"iana","extensions":["kne","knp"]},"application/vnd.koan":{"source":"iana","extensions":["skp","skd","skt","skm"]},"application/vnd.kodak-descriptor":{"source":"iana","extensions":["sse"]},"application/vnd.las":{"source":"iana"},"application/vnd.las.las+json":{"source":"iana","compressible":true},"application/vnd.las.las+xml":{"source":"iana","compressible":true,"extensions":["lasxml"]},"application/vnd.laszip":{"source":"iana"},"application/vnd.leap+json":{"source":"iana","compressible":true},"application/vnd.liberty-request+xml":{"source":"iana","compressible":true},"application/vnd.llamagraphics.life-balance.desktop":{"source":"iana","extensions":["lbd"]},"application/vnd.llamagraphics.life-balance.exchange+xml":{"source":"iana","compressible":true,"extensions":["lbe"]},"application/vnd.logipipe.circuit+zip":{"source":"iana","compressible":false},"application/vnd.loom":{"source":"iana"},"application/vnd.lotus-1-2-3":{"source":"iana","extensions":["123"]},"application/vnd.lotus-approach":{"source":"iana","extensions":["apr"]},"application/vnd.lotus-freelance":{"source":"iana","extensions":["pre"]},"application/vnd.lotus-notes":{"source":"iana","extensions":["nsf"]},"application/vnd.lotus-organizer":{"source":"iana","extensions":["org"]},"application/vnd.lotus-screencam":{"source":"iana","extensions":["scm"]},"application/vnd.lotus-wordpro":{"source":"iana","extensions":["lwp"]},"application/vnd.macports.portpkg":{"source":"iana","extensions":["portpkg"]},"application/vnd.mapbox-vector-tile":{"source":"iana"},"application/vnd.marlin.drm.actiontoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.conftoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.license+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.mdcf":{"source":"iana"},"application/vnd.mason+json":{"source":"iana","compressible":true},"application/vnd.maxmind.maxmind-db":{"source":"iana"},"application/vnd.mcd":{"source":"iana","extensions":["mcd"]},"application/vnd.medcalcdata":{"source":"iana","extensions":["mc1"]},"application/vnd.mediastation.cdkey":{"source":"iana","extensions":["cdkey"]},"application/vnd.meridian-slingshot":{"source":"iana"},"application/vnd.mfer":{"source":"iana","extensions":["mwf"]},"application/vnd.mfmp":{"source":"iana","extensions":["mfm"]},"application/vnd.micro+json":{"source":"iana","compressible":true},"application/vnd.micrografx.flo":{"source":"iana","extensions":["flo"]},"application/vnd.micrografx.igx":{"source":"iana","extensions":["igx"]},"application/vnd.microsoft.portable-executable":{"source":"iana"},"application/vnd.microsoft.windows.thumbnail-cache":{"source":"iana"},"application/vnd.miele+json":{"source":"iana","compressible":true},"application/vnd.mif":{"source":"iana","extensions":["mif"]},"application/vnd.minisoft-hp3000-save":{"source":"iana"},"application/vnd.mitsubishi.misty-guard.trustweb":{"source":"iana"},"application/vnd.mobius.daf":{"source":"iana","extensions":["daf"]},"application/vnd.mobius.dis":{"source":"iana","extensions":["dis"]},"application/vnd.mobius.mbk":{"source":"iana","extensions":["mbk"]},"application/vnd.mobius.mqy":{"source":"iana","extensions":["mqy"]},"application/vnd.mobius.msl":{"source":"iana","extensions":["msl"]},"application/vnd.mobius.plc":{"source":"iana","extensions":["plc"]},"application/vnd.mobius.txf":{"source":"iana","extensions":["txf"]},"application/vnd.mophun.application":{"source":"iana","extensions":["mpn"]},"application/vnd.mophun.certificate":{"source":"iana","extensions":["mpc"]},"application/vnd.motorola.flexsuite":{"source":"iana"},"application/vnd.motorola.flexsuite.adsi":{"source":"iana"},"application/vnd.motorola.flexsuite.fis":{"source":"iana"},"application/vnd.motorola.flexsuite.gotap":{"source":"iana"},"application/vnd.motorola.flexsuite.kmr":{"source":"iana"},"application/vnd.motorola.flexsuite.ttc":{"source":"iana"},"application/vnd.motorola.flexsuite.wem":{"source":"iana"},"application/vnd.motorola.iprm":{"source":"iana"},"application/vnd.mozilla.xul+xml":{"source":"iana","compressible":true,"extensions":["xul"]},"application/vnd.ms-3mfdocument":{"source":"iana"},"application/vnd.ms-artgalry":{"source":"iana","extensions":["cil"]},"application/vnd.ms-asf":{"source":"iana"},"application/vnd.ms-cab-compressed":{"source":"iana","extensions":["cab"]},"application/vnd.ms-color.iccprofile":{"source":"apache"},"application/vnd.ms-excel":{"source":"iana","compressible":false,"extensions":["xls","xlm","xla","xlc","xlt","xlw"]},"application/vnd.ms-excel.addin.macroenabled.12":{"source":"iana","extensions":["xlam"]},"application/vnd.ms-excel.sheet.binary.macroenabled.12":{"source":"iana","extensions":["xlsb"]},"application/vnd.ms-excel.sheet.macroenabled.12":{"source":"iana","extensions":["xlsm"]},"application/vnd.ms-excel.template.macroenabled.12":{"source":"iana","extensions":["xltm"]},"application/vnd.ms-fontobject":{"source":"iana","compressible":true,"extensions":["eot"]},"application/vnd.ms-htmlhelp":{"source":"iana","extensions":["chm"]},"application/vnd.ms-ims":{"source":"iana","extensions":["ims"]},"application/vnd.ms-lrm":{"source":"iana","extensions":["lrm"]},"application/vnd.ms-office.activex+xml":{"source":"iana","compressible":true},"application/vnd.ms-officetheme":{"source":"iana","extensions":["thmx"]},"application/vnd.ms-opentype":{"source":"apache","compressible":true},"application/vnd.ms-outlook":{"compressible":false,"extensions":["msg"]},"application/vnd.ms-package.obfuscated-opentype":{"source":"apache"},"application/vnd.ms-pki.seccat":{"source":"apache","extensions":["cat"]},"application/vnd.ms-pki.stl":{"source":"apache","extensions":["stl"]},"application/vnd.ms-playready.initiator+xml":{"source":"iana","compressible":true},"application/vnd.ms-powerpoint":{"source":"iana","compressible":false,"extensions":["ppt","pps","pot"]},"application/vnd.ms-powerpoint.addin.macroenabled.12":{"source":"iana","extensions":["ppam"]},"application/vnd.ms-powerpoint.presentation.macroenabled.12":{"source":"iana","extensions":["pptm"]},"application/vnd.ms-powerpoint.slide.macroenabled.12":{"source":"iana","extensions":["sldm"]},"application/vnd.ms-powerpoint.slideshow.macroenabled.12":{"source":"iana","extensions":["ppsm"]},"application/vnd.ms-powerpoint.template.macroenabled.12":{"source":"iana","extensions":["potm"]},"application/vnd.ms-printdevicecapabilities+xml":{"source":"iana","compressible":true},"application/vnd.ms-printing.printticket+xml":{"source":"apache","compressible":true},"application/vnd.ms-printschematicket+xml":{"source":"iana","compressible":true},"application/vnd.ms-project":{"source":"iana","extensions":["mpp","mpt"]},"application/vnd.ms-tnef":{"source":"iana"},"application/vnd.ms-windows.devicepairing":{"source":"iana"},"application/vnd.ms-windows.nwprinting.oob":{"source":"iana"},"application/vnd.ms-windows.printerpairing":{"source":"iana"},"application/vnd.ms-windows.wsd.oob":{"source":"iana"},"application/vnd.ms-wmdrm.lic-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.lic-resp":{"source":"iana"},"application/vnd.ms-wmdrm.meter-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.meter-resp":{"source":"iana"},"application/vnd.ms-word.document.macroenabled.12":{"source":"iana","extensions":["docm"]},"application/vnd.ms-word.template.macroenabled.12":{"source":"iana","extensions":["dotm"]},"application/vnd.ms-works":{"source":"iana","extensions":["wps","wks","wcm","wdb"]},"application/vnd.ms-wpl":{"source":"iana","extensions":["wpl"]},"application/vnd.ms-xpsdocument":{"source":"iana","compressible":false,"extensions":["xps"]},"application/vnd.msa-disk-image":{"source":"iana"},"application/vnd.mseq":{"source":"iana","extensions":["mseq"]},"application/vnd.msign":{"source":"iana"},"application/vnd.multiad.creator":{"source":"iana"},"application/vnd.multiad.creator.cif":{"source":"iana"},"application/vnd.music-niff":{"source":"iana"},"application/vnd.musician":{"source":"iana","extensions":["mus"]},"application/vnd.muvee.style":{"source":"iana","extensions":["msty"]},"application/vnd.mynfc":{"source":"iana","extensions":["taglet"]},"application/vnd.ncd.control":{"source":"iana"},"application/vnd.ncd.reference":{"source":"iana"},"application/vnd.nearst.inv+json":{"source":"iana","compressible":true},"application/vnd.nervana":{"source":"iana"},"application/vnd.netfpx":{"source":"iana"},"application/vnd.neurolanguage.nlu":{"source":"iana","extensions":["nlu"]},"application/vnd.nimn":{"source":"iana"},"application/vnd.nintendo.nitro.rom":{"source":"iana"},"application/vnd.nintendo.snes.rom":{"source":"iana"},"application/vnd.nitf":{"source":"iana","extensions":["ntf","nitf"]},"application/vnd.noblenet-directory":{"source":"iana","extensions":["nnd"]},"application/vnd.noblenet-sealer":{"source":"iana","extensions":["nns"]},"application/vnd.noblenet-web":{"source":"iana","extensions":["nnw"]},"application/vnd.nokia.catalogs":{"source":"iana"},"application/vnd.nokia.conml+wbxml":{"source":"iana"},"application/vnd.nokia.conml+xml":{"source":"iana","compressible":true},"application/vnd.nokia.iptv.config+xml":{"source":"iana","compressible":true},"application/vnd.nokia.isds-radio-presets":{"source":"iana"},"application/vnd.nokia.landmark+wbxml":{"source":"iana"},"application/vnd.nokia.landmark+xml":{"source":"iana","compressible":true},"application/vnd.nokia.landmarkcollection+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.ac+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.data":{"source":"iana","extensions":["ngdat"]},"application/vnd.nokia.n-gage.symbian.install":{"source":"iana","extensions":["n-gage"]},"application/vnd.nokia.ncd":{"source":"iana"},"application/vnd.nokia.pcd+wbxml":{"source":"iana"},"application/vnd.nokia.pcd+xml":{"source":"iana","compressible":true},"application/vnd.nokia.radio-preset":{"source":"iana","extensions":["rpst"]},"application/vnd.nokia.radio-presets":{"source":"iana","extensions":["rpss"]},"application/vnd.novadigm.edm":{"source":"iana","extensions":["edm"]},"application/vnd.novadigm.edx":{"source":"iana","extensions":["edx"]},"application/vnd.novadigm.ext":{"source":"iana","extensions":["ext"]},"application/vnd.ntt-local.content-share":{"source":"iana"},"application/vnd.ntt-local.file-transfer":{"source":"iana"},"application/vnd.ntt-local.ogw_remote-access":{"source":"iana"},"application/vnd.ntt-local.sip-ta_remote":{"source":"iana"},"application/vnd.ntt-local.sip-ta_tcp_stream":{"source":"iana"},"application/vnd.oasis.opendocument.chart":{"source":"iana","extensions":["odc"]},"application/vnd.oasis.opendocument.chart-template":{"source":"iana","extensions":["otc"]},"application/vnd.oasis.opendocument.database":{"source":"iana","extensions":["odb"]},"application/vnd.oasis.opendocument.formula":{"source":"iana","extensions":["odf"]},"application/vnd.oasis.opendocument.formula-template":{"source":"iana","extensions":["odft"]},"application/vnd.oasis.opendocument.graphics":{"source":"iana","compressible":false,"extensions":["odg"]},"application/vnd.oasis.opendocument.graphics-template":{"source":"iana","extensions":["otg"]},"application/vnd.oasis.opendocument.image":{"source":"iana","extensions":["odi"]},"application/vnd.oasis.opendocument.image-template":{"source":"iana","extensions":["oti"]},"application/vnd.oasis.opendocument.presentation":{"source":"iana","compressible":false,"extensions":["odp"]},"application/vnd.oasis.opendocument.presentation-template":{"source":"iana","extensions":["otp"]},"application/vnd.oasis.opendocument.spreadsheet":{"source":"iana","compressible":false,"extensions":["ods"]},"application/vnd.oasis.opendocument.spreadsheet-template":{"source":"iana","extensions":["ots"]},"application/vnd.oasis.opendocument.text":{"source":"iana","compressible":false,"extensions":["odt"]},"application/vnd.oasis.opendocument.text-master":{"source":"iana","extensions":["odm"]},"application/vnd.oasis.opendocument.text-template":{"source":"iana","extensions":["ott"]},"application/vnd.oasis.opendocument.text-web":{"source":"iana","extensions":["oth"]},"application/vnd.obn":{"source":"iana"},"application/vnd.ocf+cbor":{"source":"iana"},"application/vnd.oftn.l10n+json":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessdownload+xml":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessstreaming+xml":{"source":"iana","compressible":true},"application/vnd.oipf.cspg-hexbinary":{"source":"iana"},"application/vnd.oipf.dae.svg+xml":{"source":"iana","compressible":true},"application/vnd.oipf.dae.xhtml+xml":{"source":"iana","compressible":true},"application/vnd.oipf.mippvcontrolmessage+xml":{"source":"iana","compressible":true},"application/vnd.oipf.pae.gem":{"source":"iana"},"application/vnd.oipf.spdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.oipf.spdlist+xml":{"source":"iana","compressible":true},"application/vnd.oipf.ueprofile+xml":{"source":"iana","compressible":true},"application/vnd.oipf.userprofile+xml":{"source":"iana","compressible":true},"application/vnd.olpc-sugar":{"source":"iana","extensions":["xo"]},"application/vnd.oma-scws-config":{"source":"iana"},"application/vnd.oma-scws-http-request":{"source":"iana"},"application/vnd.oma-scws-http-response":{"source":"iana"},"application/vnd.oma.bcast.associated-procedure-parameter+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.drm-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.imd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.ltkm":{"source":"iana"},"application/vnd.oma.bcast.notification+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.provisioningtrigger":{"source":"iana"},"application/vnd.oma.bcast.sgboot":{"source":"iana"},"application/vnd.oma.bcast.sgdd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sgdu":{"source":"iana"},"application/vnd.oma.bcast.simple-symbol-container":{"source":"iana"},"application/vnd.oma.bcast.smartcard-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sprov+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.stkm":{"source":"iana"},"application/vnd.oma.cab-address-book+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-feature-handler+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-pcc+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-subs-invite+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-user-prefs+xml":{"source":"iana","compressible":true},"application/vnd.oma.dcd":{"source":"iana"},"application/vnd.oma.dcdc":{"source":"iana"},"application/vnd.oma.dd2+xml":{"source":"iana","compressible":true,"extensions":["dd2"]},"application/vnd.oma.drm.risd+xml":{"source":"iana","compressible":true},"application/vnd.oma.group-usage-list+xml":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+json":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+tlv":{"source":"iana"},"application/vnd.oma.pal+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.detailed-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.final-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.groups+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.invocation-descriptor+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.optimized-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.push":{"source":"iana"},"application/vnd.oma.scidm.messages+xml":{"source":"iana","compressible":true},"application/vnd.oma.xcap-directory+xml":{"source":"iana","compressible":true},"application/vnd.omads-email+xml":{"source":"iana","compressible":true},"application/vnd.omads-file+xml":{"source":"iana","compressible":true},"application/vnd.omads-folder+xml":{"source":"iana","compressible":true},"application/vnd.omaloc-supl-init":{"source":"iana"},"application/vnd.onepager":{"source":"iana"},"application/vnd.onepagertamp":{"source":"iana"},"application/vnd.onepagertamx":{"source":"iana"},"application/vnd.onepagertat":{"source":"iana"},"application/vnd.onepagertatp":{"source":"iana"},"application/vnd.onepagertatx":{"source":"iana"},"application/vnd.openblox.game+xml":{"source":"iana","compressible":true},"application/vnd.openblox.game-binary":{"source":"iana"},"application/vnd.openeye.oeb":{"source":"iana"},"application/vnd.openofficeorg.extension":{"source":"apache","extensions":["oxt"]},"application/vnd.openstreetmap.data+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.custom-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.customxmlproperties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawing+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chart+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.extended-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presentation":{"source":"iana","compressible":false,"extensions":["pptx"]},"application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slide":{"source":"iana","extensions":["sldx"]},"application/vnd.openxmlformats-officedocument.presentationml.slide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideshow":{"source":"iana","extensions":["ppsx"]},"application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tags+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.template":{"source":"iana","extensions":["potx"]},"application/vnd.openxmlformats-officedocument.presentationml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":{"source":"iana","compressible":false,"extensions":["xlsx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.template":{"source":"iana","extensions":["xltx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.theme+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.themeoverride+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.vmldrawing":{"source":"iana"},"application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document":{"source":"iana","compressible":false,"extensions":["docx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.template":{"source":"iana","extensions":["dotx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.core-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.relationships+xml":{"source":"iana","compressible":true},"application/vnd.oracle.resource+json":{"source":"iana","compressible":true},"application/vnd.orange.indata":{"source":"iana"},"application/vnd.osa.netdeploy":{"source":"iana"},"application/vnd.osgeo.mapguide.package":{"source":"iana","extensions":["mgp"]},"application/vnd.osgi.bundle":{"source":"iana"},"application/vnd.osgi.dp":{"source":"iana","extensions":["dp"]},"application/vnd.osgi.subsystem":{"source":"iana","extensions":["esa"]},"application/vnd.otps.ct-kip+xml":{"source":"iana","compressible":true},"application/vnd.oxli.countgraph":{"source":"iana"},"application/vnd.pagerduty+json":{"source":"iana","compressible":true},"application/vnd.palm":{"source":"iana","extensions":["pdb","pqa","oprc"]},"application/vnd.panoply":{"source":"iana"},"application/vnd.paos.xml":{"source":"iana"},"application/vnd.patentdive":{"source":"iana"},"application/vnd.patientecommsdoc":{"source":"iana"},"application/vnd.pawaafile":{"source":"iana","extensions":["paw"]},"application/vnd.pcos":{"source":"iana"},"application/vnd.pg.format":{"source":"iana","extensions":["str"]},"application/vnd.pg.osasli":{"source":"iana","extensions":["ei6"]},"application/vnd.piaccess.application-licence":{"source":"iana"},"application/vnd.picsel":{"source":"iana","extensions":["efif"]},"application/vnd.pmi.widget":{"source":"iana","extensions":["wg"]},"application/vnd.poc.group-advertisement+xml":{"source":"iana","compressible":true},"application/vnd.pocketlearn":{"source":"iana","extensions":["plf"]},"application/vnd.powerbuilder6":{"source":"iana","extensions":["pbd"]},"application/vnd.powerbuilder6-s":{"source":"iana"},"application/vnd.powerbuilder7":{"source":"iana"},"application/vnd.powerbuilder7-s":{"source":"iana"},"application/vnd.powerbuilder75":{"source":"iana"},"application/vnd.powerbuilder75-s":{"source":"iana"},"application/vnd.preminet":{"source":"iana"},"application/vnd.previewsystems.box":{"source":"iana","extensions":["box"]},"application/vnd.proteus.magazine":{"source":"iana","extensions":["mgz"]},"application/vnd.psfs":{"source":"iana"},"application/vnd.publishare-delta-tree":{"source":"iana","extensions":["qps"]},"application/vnd.pvi.ptid1":{"source":"iana","extensions":["ptid"]},"application/vnd.pwg-multiplexed":{"source":"iana"},"application/vnd.pwg-xhtml-print+xml":{"source":"iana","compressible":true},"application/vnd.qualcomm.brew-app-res":{"source":"iana"},"application/vnd.quarantainenet":{"source":"iana"},"application/vnd.quark.quarkxpress":{"source":"iana","extensions":["qxd","qxt","qwd","qwt","qxl","qxb"]},"application/vnd.quobject-quoxdocument":{"source":"iana"},"application/vnd.radisys.moml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conn+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-stream+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-base+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-detect+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-sendrecv+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-group+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-speech+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-transform+xml":{"source":"iana","compressible":true},"application/vnd.rainstor.data":{"source":"iana"},"application/vnd.rapid":{"source":"iana"},"application/vnd.rar":{"source":"iana"},"application/vnd.realvnc.bed":{"source":"iana","extensions":["bed"]},"application/vnd.recordare.musicxml":{"source":"iana","extensions":["mxl"]},"application/vnd.recordare.musicxml+xml":{"source":"iana","compressible":true,"extensions":["musicxml"]},"application/vnd.renlearn.rlprint":{"source":"iana"},"application/vnd.restful+json":{"source":"iana","compressible":true},"application/vnd.rig.cryptonote":{"source":"iana","extensions":["cryptonote"]},"application/vnd.rim.cod":{"source":"apache","extensions":["cod"]},"application/vnd.rn-realmedia":{"source":"apache","extensions":["rm"]},"application/vnd.rn-realmedia-vbr":{"source":"apache","extensions":["rmvb"]},"application/vnd.route66.link66+xml":{"source":"iana","compressible":true,"extensions":["link66"]},"application/vnd.rs-274x":{"source":"iana"},"application/vnd.ruckus.download":{"source":"iana"},"application/vnd.s3sms":{"source":"iana"},"application/vnd.sailingtracker.track":{"source":"iana","extensions":["st"]},"application/vnd.sbm.cid":{"source":"iana"},"application/vnd.sbm.mid2":{"source":"iana"},"application/vnd.scribus":{"source":"iana"},"application/vnd.sealed.3df":{"source":"iana"},"application/vnd.sealed.csf":{"source":"iana"},"application/vnd.sealed.doc":{"source":"iana"},"application/vnd.sealed.eml":{"source":"iana"},"application/vnd.sealed.mht":{"source":"iana"},"application/vnd.sealed.net":{"source":"iana"},"application/vnd.sealed.ppt":{"source":"iana"},"application/vnd.sealed.tiff":{"source":"iana"},"application/vnd.sealed.xls":{"source":"iana"},"application/vnd.sealedmedia.softseal.html":{"source":"iana"},"application/vnd.sealedmedia.softseal.pdf":{"source":"iana"},"application/vnd.seemail":{"source":"iana","extensions":["see"]},"application/vnd.sema":{"source":"iana","extensions":["sema"]},"application/vnd.semd":{"source":"iana","extensions":["semd"]},"application/vnd.semf":{"source":"iana","extensions":["semf"]},"application/vnd.shade-save-file":{"source":"iana"},"application/vnd.shana.informed.formdata":{"source":"iana","extensions":["ifm"]},"application/vnd.shana.informed.formtemplate":{"source":"iana","extensions":["itp"]},"application/vnd.shana.informed.interchange":{"source":"iana","extensions":["iif"]},"application/vnd.shana.informed.package":{"source":"iana","extensions":["ipk"]},"application/vnd.shootproof+json":{"source":"iana","compressible":true},"application/vnd.shopkick+json":{"source":"iana","compressible":true},"application/vnd.sigrok.session":{"source":"iana"},"application/vnd.simtech-mindmapper":{"source":"iana","extensions":["twd","twds"]},"application/vnd.siren+json":{"source":"iana","compressible":true},"application/vnd.smaf":{"source":"iana","extensions":["mmf"]},"application/vnd.smart.notebook":{"source":"iana"},"application/vnd.smart.teacher":{"source":"iana","extensions":["teacher"]},"application/vnd.software602.filler.form+xml":{"source":"iana","compressible":true},"application/vnd.software602.filler.form-xml-zip":{"source":"iana"},"application/vnd.solent.sdkm+xml":{"source":"iana","compressible":true,"extensions":["sdkm","sdkd"]},"application/vnd.spotfire.dxp":{"source":"iana","extensions":["dxp"]},"application/vnd.spotfire.sfs":{"source":"iana","extensions":["sfs"]},"application/vnd.sqlite3":{"source":"iana"},"application/vnd.sss-cod":{"source":"iana"},"application/vnd.sss-dtf":{"source":"iana"},"application/vnd.sss-ntf":{"source":"iana"},"application/vnd.stardivision.calc":{"source":"apache","extensions":["sdc"]},"application/vnd.stardivision.draw":{"source":"apache","extensions":["sda"]},"application/vnd.stardivision.impress":{"source":"apache","extensions":["sdd"]},"application/vnd.stardivision.math":{"source":"apache","extensions":["smf"]},"application/vnd.stardivision.writer":{"source":"apache","extensions":["sdw","vor"]},"application/vnd.stardivision.writer-global":{"source":"apache","extensions":["sgl"]},"application/vnd.stepmania.package":{"source":"iana","extensions":["smzip"]},"application/vnd.stepmania.stepchart":{"source":"iana","extensions":["sm"]},"application/vnd.street-stream":{"source":"iana"},"application/vnd.sun.wadl+xml":{"source":"iana","compressible":true,"extensions":["wadl"]},"application/vnd.sun.xml.calc":{"source":"apache","extensions":["sxc"]},"application/vnd.sun.xml.calc.template":{"source":"apache","extensions":["stc"]},"application/vnd.sun.xml.draw":{"source":"apache","extensions":["sxd"]},"application/vnd.sun.xml.draw.template":{"source":"apache","extensions":["std"]},"application/vnd.sun.xml.impress":{"source":"apache","extensions":["sxi"]},"application/vnd.sun.xml.impress.template":{"source":"apache","extensions":["sti"]},"application/vnd.sun.xml.math":{"source":"apache","extensions":["sxm"]},"application/vnd.sun.xml.writer":{"source":"apache","extensions":["sxw"]},"application/vnd.sun.xml.writer.global":{"source":"apache","extensions":["sxg"]},"application/vnd.sun.xml.writer.template":{"source":"apache","extensions":["stw"]},"application/vnd.sus-calendar":{"source":"iana","extensions":["sus","susp"]},"application/vnd.svd":{"source":"iana","extensions":["svd"]},"application/vnd.swiftview-ics":{"source":"iana"},"application/vnd.symbian.install":{"source":"apache","extensions":["sis","sisx"]},"application/vnd.syncml+xml":{"source":"iana","compressible":true,"extensions":["xsm"]},"application/vnd.syncml.dm+wbxml":{"source":"iana","extensions":["bdm"]},"application/vnd.syncml.dm+xml":{"source":"iana","compressible":true,"extensions":["xdm"]},"application/vnd.syncml.dm.notification":{"source":"iana"},"application/vnd.syncml.dmddf+wbxml":{"source":"iana"},"application/vnd.syncml.dmddf+xml":{"source":"iana","compressible":true},"application/vnd.syncml.dmtnds+wbxml":{"source":"iana"},"application/vnd.syncml.dmtnds+xml":{"source":"iana","compressible":true},"application/vnd.syncml.ds.notification":{"source":"iana"},"application/vnd.tableschema+json":{"source":"iana","compressible":true},"application/vnd.tao.intent-module-archive":{"source":"iana","extensions":["tao"]},"application/vnd.tcpdump.pcap":{"source":"iana","extensions":["pcap","cap","dmp"]},"application/vnd.think-cell.ppttc+json":{"source":"iana","compressible":true},"application/vnd.tmd.mediaflex.api+xml":{"source":"iana","compressible":true},"application/vnd.tml":{"source":"iana"},"application/vnd.tmobile-livetv":{"source":"iana","extensions":["tmo"]},"application/vnd.tri.onesource":{"source":"iana"},"application/vnd.trid.tpt":{"source":"iana","extensions":["tpt"]},"application/vnd.triscape.mxs":{"source":"iana","extensions":["mxs"]},"application/vnd.trueapp":{"source":"iana","extensions":["tra"]},"application/vnd.truedoc":{"source":"iana"},"application/vnd.ubisoft.webplayer":{"source":"iana"},"application/vnd.ufdl":{"source":"iana","extensions":["ufd","ufdl"]},"application/vnd.uiq.theme":{"source":"iana","extensions":["utz"]},"application/vnd.umajin":{"source":"iana","extensions":["umj"]},"application/vnd.unity":{"source":"iana","extensions":["unityweb"]},"application/vnd.uoml+xml":{"source":"iana","compressible":true,"extensions":["uoml"]},"application/vnd.uplanet.alert":{"source":"iana"},"application/vnd.uplanet.alert-wbxml":{"source":"iana"},"application/vnd.uplanet.bearer-choice":{"source":"iana"},"application/vnd.uplanet.bearer-choice-wbxml":{"source":"iana"},"application/vnd.uplanet.cacheop":{"source":"iana"},"application/vnd.uplanet.cacheop-wbxml":{"source":"iana"},"application/vnd.uplanet.channel":{"source":"iana"},"application/vnd.uplanet.channel-wbxml":{"source":"iana"},"application/vnd.uplanet.list":{"source":"iana"},"application/vnd.uplanet.list-wbxml":{"source":"iana"},"application/vnd.uplanet.listcmd":{"source":"iana"},"application/vnd.uplanet.listcmd-wbxml":{"source":"iana"},"application/vnd.uplanet.signal":{"source":"iana"},"application/vnd.uri-map":{"source":"iana"},"application/vnd.valve.source.material":{"source":"iana"},"application/vnd.vcx":{"source":"iana","extensions":["vcx"]},"application/vnd.vd-study":{"source":"iana"},"application/vnd.vectorworks":{"source":"iana"},"application/vnd.vel+json":{"source":"iana","compressible":true},"application/vnd.verimatrix.vcas":{"source":"iana"},"application/vnd.veryant.thin":{"source":"iana"},"application/vnd.ves.encrypted":{"source":"iana"},"application/vnd.vidsoft.vidconference":{"source":"iana"},"application/vnd.visio":{"source":"iana","extensions":["vsd","vst","vss","vsw"]},"application/vnd.visionary":{"source":"iana","extensions":["vis"]},"application/vnd.vividence.scriptfile":{"source":"iana"},"application/vnd.vsf":{"source":"iana","extensions":["vsf"]},"application/vnd.wap.sic":{"source":"iana"},"application/vnd.wap.slc":{"source":"iana"},"application/vnd.wap.wbxml":{"source":"iana","extensions":["wbxml"]},"application/vnd.wap.wmlc":{"source":"iana","extensions":["wmlc"]},"application/vnd.wap.wmlscriptc":{"source":"iana","extensions":["wmlsc"]},"application/vnd.webturbo":{"source":"iana","extensions":["wtb"]},"application/vnd.wfa.p2p":{"source":"iana"},"application/vnd.wfa.wsc":{"source":"iana"},"application/vnd.windows.devicepairing":{"source":"iana"},"application/vnd.wmc":{"source":"iana"},"application/vnd.wmf.bootstrap":{"source":"iana"},"application/vnd.wolfram.mathematica":{"source":"iana"},"application/vnd.wolfram.mathematica.package":{"source":"iana"},"application/vnd.wolfram.player":{"source":"iana","extensions":["nbp"]},"application/vnd.wordperfect":{"source":"iana","extensions":["wpd"]},"application/vnd.wqd":{"source":"iana","extensions":["wqd"]},"application/vnd.wrq-hp3000-labelled":{"source":"iana"},"application/vnd.wt.stf":{"source":"iana","extensions":["stf"]},"application/vnd.wv.csp+wbxml":{"source":"iana"},"application/vnd.wv.csp+xml":{"source":"iana","compressible":true},"application/vnd.wv.ssp+xml":{"source":"iana","compressible":true},"application/vnd.xacml+json":{"source":"iana","compressible":true},"application/vnd.xara":{"source":"iana","extensions":["xar"]},"application/vnd.xfdl":{"source":"iana","extensions":["xfdl"]},"application/vnd.xfdl.webform":{"source":"iana"},"application/vnd.xmi+xml":{"source":"iana","compressible":true},"application/vnd.xmpie.cpkg":{"source":"iana"},"application/vnd.xmpie.dpkg":{"source":"iana"},"application/vnd.xmpie.plan":{"source":"iana"},"application/vnd.xmpie.ppkg":{"source":"iana"},"application/vnd.xmpie.xlim":{"source":"iana"},"application/vnd.yamaha.hv-dic":{"source":"iana","extensions":["hvd"]},"application/vnd.yamaha.hv-script":{"source":"iana","extensions":["hvs"]},"application/vnd.yamaha.hv-voice":{"source":"iana","extensions":["hvp"]},"application/vnd.yamaha.openscoreformat":{"source":"iana","extensions":["osf"]},"application/vnd.yamaha.openscoreformat.osfpvg+xml":{"source":"iana","compressible":true,"extensions":["osfpvg"]},"application/vnd.yamaha.remote-setup":{"source":"iana"},"application/vnd.yamaha.smaf-audio":{"source":"iana","extensions":["saf"]},"application/vnd.yamaha.smaf-phrase":{"source":"iana","extensions":["spf"]},"application/vnd.yamaha.through-ngn":{"source":"iana"},"application/vnd.yamaha.tunnel-udpencap":{"source":"iana"},"application/vnd.yaoweme":{"source":"iana"},"application/vnd.yellowriver-custom-menu":{"source":"iana","extensions":["cmp"]},"application/vnd.youtube.yt":{"source":"iana"},"application/vnd.zul":{"source":"iana","extensions":["zir","zirz"]},"application/vnd.zzazz.deck+xml":{"source":"iana","compressible":true,"extensions":["zaz"]},"application/voicexml+xml":{"source":"iana","compressible":true,"extensions":["vxml"]},"application/voucher-cms+json":{"source":"iana","compressible":true},"application/vq-rtcpxr":{"source":"iana"},"application/wasm":{"compressible":true,"extensions":["wasm"]},"application/watcherinfo+xml":{"source":"iana","compressible":true},"application/webpush-options+json":{"source":"iana","compressible":true},"application/whoispp-query":{"source":"iana"},"application/whoispp-response":{"source":"iana"},"application/widget":{"source":"iana","extensions":["wgt"]},"application/winhlp":{"source":"apache","extensions":["hlp"]},"application/wita":{"source":"iana"},"application/wordperfect5.1":{"source":"iana"},"application/wsdl+xml":{"source":"iana","compressible":true,"extensions":["wsdl"]},"application/wspolicy+xml":{"source":"iana","compressible":true,"extensions":["wspolicy"]},"application/x-7z-compressed":{"source":"apache","compressible":false,"extensions":["7z"]},"application/x-abiword":{"source":"apache","extensions":["abw"]},"application/x-ace-compressed":{"source":"apache","extensions":["ace"]},"application/x-amf":{"source":"apache"},"application/x-apple-diskimage":{"source":"apache","extensions":["dmg"]},"application/x-arj":{"compressible":false,"extensions":["arj"]},"application/x-authorware-bin":{"source":"apache","extensions":["aab","x32","u32","vox"]},"application/x-authorware-map":{"source":"apache","extensions":["aam"]},"application/x-authorware-seg":{"source":"apache","extensions":["aas"]},"application/x-bcpio":{"source":"apache","extensions":["bcpio"]},"application/x-bdoc":{"compressible":false,"extensions":["bdoc"]},"application/x-bittorrent":{"source":"apache","extensions":["torrent"]},"application/x-blorb":{"source":"apache","extensions":["blb","blorb"]},"application/x-bzip":{"source":"apache","compressible":false,"extensions":["bz"]},"application/x-bzip2":{"source":"apache","compressible":false,"extensions":["bz2","boz"]},"application/x-cbr":{"source":"apache","extensions":["cbr","cba","cbt","cbz","cb7"]},"application/x-cdlink":{"source":"apache","extensions":["vcd"]},"application/x-cfs-compressed":{"source":"apache","extensions":["cfs"]},"application/x-chat":{"source":"apache","extensions":["chat"]},"application/x-chess-pgn":{"source":"apache","extensions":["pgn"]},"application/x-chrome-extension":{"extensions":["crx"]},"application/x-cocoa":{"source":"nginx","extensions":["cco"]},"application/x-compress":{"source":"apache"},"application/x-conference":{"source":"apache","extensions":["nsc"]},"application/x-cpio":{"source":"apache","extensions":["cpio"]},"application/x-csh":{"source":"apache","extensions":["csh"]},"application/x-deb":{"compressible":false},"application/x-debian-package":{"source":"apache","extensions":["deb","udeb"]},"application/x-dgc-compressed":{"source":"apache","extensions":["dgc"]},"application/x-director":{"source":"apache","extensions":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]},"application/x-doom":{"source":"apache","extensions":["wad"]},"application/x-dtbncx+xml":{"source":"apache","compressible":true,"extensions":["ncx"]},"application/x-dtbook+xml":{"source":"apache","compressible":true,"extensions":["dtb"]},"application/x-dtbresource+xml":{"source":"apache","compressible":true,"extensions":["res"]},"application/x-dvi":{"source":"apache","compressible":false,"extensions":["dvi"]},"application/x-envoy":{"source":"apache","extensions":["evy"]},"application/x-eva":{"source":"apache","extensions":["eva"]},"application/x-font-bdf":{"source":"apache","extensions":["bdf"]},"application/x-font-dos":{"source":"apache"},"application/x-font-framemaker":{"source":"apache"},"application/x-font-ghostscript":{"source":"apache","extensions":["gsf"]},"application/x-font-libgrx":{"source":"apache"},"application/x-font-linux-psf":{"source":"apache","extensions":["psf"]},"application/x-font-pcf":{"source":"apache","extensions":["pcf"]},"application/x-font-snf":{"source":"apache","extensions":["snf"]},"application/x-font-speedo":{"source":"apache"},"application/x-font-sunos-news":{"source":"apache"},"application/x-font-type1":{"source":"apache","extensions":["pfa","pfb","pfm","afm"]},"application/x-font-vfont":{"source":"apache"},"application/x-freearc":{"source":"apache","extensions":["arc"]},"application/x-futuresplash":{"source":"apache","extensions":["spl"]},"application/x-gca-compressed":{"source":"apache","extensions":["gca"]},"application/x-glulx":{"source":"apache","extensions":["ulx"]},"application/x-gnumeric":{"source":"apache","extensions":["gnumeric"]},"application/x-gramps-xml":{"source":"apache","extensions":["gramps"]},"application/x-gtar":{"source":"apache","extensions":["gtar"]},"application/x-gzip":{"source":"apache"},"application/x-hdf":{"source":"apache","extensions":["hdf"]},"application/x-httpd-php":{"compressible":true,"extensions":["php"]},"application/x-install-instructions":{"source":"apache","extensions":["install"]},"application/x-iso9660-image":{"source":"apache","extensions":["iso"]},"application/x-java-archive-diff":{"source":"nginx","extensions":["jardiff"]},"application/x-java-jnlp-file":{"source":"apache","compressible":false,"extensions":["jnlp"]},"application/x-javascript":{"compressible":true},"application/x-latex":{"source":"apache","compressible":false,"extensions":["latex"]},"application/x-lua-bytecode":{"extensions":["luac"]},"application/x-lzh-compressed":{"source":"apache","extensions":["lzh","lha"]},"application/x-makeself":{"source":"nginx","extensions":["run"]},"application/x-mie":{"source":"apache","extensions":["mie"]},"application/x-mobipocket-ebook":{"source":"apache","extensions":["prc","mobi"]},"application/x-mpegurl":{"compressible":false},"application/x-ms-application":{"source":"apache","extensions":["application"]},"application/x-ms-shortcut":{"source":"apache","extensions":["lnk"]},"application/x-ms-wmd":{"source":"apache","extensions":["wmd"]},"application/x-ms-wmz":{"source":"apache","extensions":["wmz"]},"application/x-ms-xbap":{"source":"apache","extensions":["xbap"]},"application/x-msaccess":{"source":"apache","extensions":["mdb"]},"application/x-msbinder":{"source":"apache","extensions":["obd"]},"application/x-mscardfile":{"source":"apache","extensions":["crd"]},"application/x-msclip":{"source":"apache","extensions":["clp"]},"application/x-msdos-program":{"extensions":["exe"]},"application/x-msdownload":{"source":"apache","extensions":["exe","dll","com","bat","msi"]},"application/x-msmediaview":{"source":"apache","extensions":["mvb","m13","m14"]},"application/x-msmetafile":{"source":"apache","extensions":["wmf","wmz","emf","emz"]},"application/x-msmoney":{"source":"apache","extensions":["mny"]},"application/x-mspublisher":{"source":"apache","extensions":["pub"]},"application/x-msschedule":{"source":"apache","extensions":["scd"]},"application/x-msterminal":{"source":"apache","extensions":["trm"]},"application/x-mswrite":{"source":"apache","extensions":["wri"]},"application/x-netcdf":{"source":"apache","extensions":["nc","cdf"]},"application/x-ns-proxy-autoconfig":{"compressible":true,"extensions":["pac"]},"application/x-nzb":{"source":"apache","extensions":["nzb"]},"application/x-perl":{"source":"nginx","extensions":["pl","pm"]},"application/x-pilot":{"source":"nginx","extensions":["prc","pdb"]},"application/x-pkcs12":{"source":"apache","compressible":false,"extensions":["p12","pfx"]},"application/x-pkcs7-certificates":{"source":"apache","extensions":["p7b","spc"]},"application/x-pkcs7-certreqresp":{"source":"apache","extensions":["p7r"]},"application/x-rar-compressed":{"source":"apache","compressible":false,"extensions":["rar"]},"application/x-redhat-package-manager":{"source":"nginx","extensions":["rpm"]},"application/x-research-info-systems":{"source":"apache","extensions":["ris"]},"application/x-sea":{"source":"nginx","extensions":["sea"]},"application/x-sh":{"source":"apache","compressible":true,"extensions":["sh"]},"application/x-shar":{"source":"apache","extensions":["shar"]},"application/x-shockwave-flash":{"source":"apache","compressible":false,"extensions":["swf"]},"application/x-silverlight-app":{"source":"apache","extensions":["xap"]},"application/x-sql":{"source":"apache","extensions":["sql"]},"application/x-stuffit":{"source":"apache","compressible":false,"extensions":["sit"]},"application/x-stuffitx":{"source":"apache","extensions":["sitx"]},"application/x-subrip":{"source":"apache","extensions":["srt"]},"application/x-sv4cpio":{"source":"apache","extensions":["sv4cpio"]},"application/x-sv4crc":{"source":"apache","extensions":["sv4crc"]},"application/x-t3vm-image":{"source":"apache","extensions":["t3"]},"application/x-tads":{"source":"apache","extensions":["gam"]},"application/x-tar":{"source":"apache","compressible":true,"extensions":["tar"]},"application/x-tcl":{"source":"apache","extensions":["tcl","tk"]},"application/x-tex":{"source":"apache","extensions":["tex"]},"application/x-tex-tfm":{"source":"apache","extensions":["tfm"]},"application/x-texinfo":{"source":"apache","extensions":["texinfo","texi"]},"application/x-tgif":{"source":"apache","extensions":["obj"]},"application/x-ustar":{"source":"apache","extensions":["ustar"]},"application/x-virtualbox-hdd":{"compressible":true,"extensions":["hdd"]},"application/x-virtualbox-ova":{"compressible":true,"extensions":["ova"]},"application/x-virtualbox-ovf":{"compressible":true,"extensions":["ovf"]},"application/x-virtualbox-vbox":{"compressible":true,"extensions":["vbox"]},"application/x-virtualbox-vbox-extpack":{"compressible":false,"extensions":["vbox-extpack"]},"application/x-virtualbox-vdi":{"compressible":true,"extensions":["vdi"]},"application/x-virtualbox-vhd":{"compressible":true,"extensions":["vhd"]},"application/x-virtualbox-vmdk":{"compressible":true,"extensions":["vmdk"]},"application/x-wais-source":{"source":"apache","extensions":["src"]},"application/x-web-app-manifest+json":{"compressible":true,"extensions":["webapp"]},"application/x-www-form-urlencoded":{"source":"iana","compressible":true},"application/x-x509-ca-cert":{"source":"apache","extensions":["der","crt","pem"]},"application/x-xfig":{"source":"apache","extensions":["fig"]},"application/x-xliff+xml":{"source":"apache","compressible":true,"extensions":["xlf"]},"application/x-xpinstall":{"source":"apache","compressible":false,"extensions":["xpi"]},"application/x-xz":{"source":"apache","extensions":["xz"]},"application/x-zmachine":{"source":"apache","extensions":["z1","z2","z3","z4","z5","z6","z7","z8"]},"application/x400-bp":{"source":"iana"},"application/xacml+xml":{"source":"iana","compressible":true},"application/xaml+xml":{"source":"apache","compressible":true,"extensions":["xaml"]},"application/xcap-att+xml":{"source":"iana","compressible":true},"application/xcap-caps+xml":{"source":"iana","compressible":true},"application/xcap-diff+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/xcap-el+xml":{"source":"iana","compressible":true},"application/xcap-error+xml":{"source":"iana","compressible":true},"application/xcap-ns+xml":{"source":"iana","compressible":true},"application/xcon-conference-info+xml":{"source":"iana","compressible":true},"application/xcon-conference-info-diff+xml":{"source":"iana","compressible":true},"application/xenc+xml":{"source":"iana","compressible":true,"extensions":["xenc"]},"application/xhtml+xml":{"source":"iana","compressible":true,"extensions":["xhtml","xht"]},"application/xhtml-voice+xml":{"source":"apache","compressible":true},"application/xliff+xml":{"source":"iana","compressible":true},"application/xml":{"source":"iana","compressible":true,"extensions":["xml","xsl","xsd","rng"]},"application/xml-dtd":{"source":"iana","compressible":true,"extensions":["dtd"]},"application/xml-external-parsed-entity":{"source":"iana"},"application/xml-patch+xml":{"source":"iana","compressible":true},"application/xmpp+xml":{"source":"iana","compressible":true},"application/xop+xml":{"source":"iana","compressible":true,"extensions":["xop"]},"application/xproc+xml":{"source":"apache","compressible":true,"extensions":["xpl"]},"application/xslt+xml":{"source":"iana","compressible":true,"extensions":["xslt"]},"application/xspf+xml":{"source":"apache","compressible":true,"extensions":["xspf"]},"application/xv+xml":{"source":"iana","compressible":true,"extensions":["mxml","xhvml","xvml","xvm"]},"application/yang":{"source":"iana","extensions":["yang"]},"application/yang-data+json":{"source":"iana","compressible":true},"application/yang-data+xml":{"source":"iana","compressible":true},"application/yang-patch+json":{"source":"iana","compressible":true},"application/yang-patch+xml":{"source":"iana","compressible":true},"application/yin+xml":{"source":"iana","compressible":true,"extensions":["yin"]},"application/zip":{"source":"iana","compressible":false,"extensions":["zip"]},"application/zlib":{"source":"iana"},"application/zstd":{"source":"iana"},"audio/1d-interleaved-parityfec":{"source":"iana"},"audio/32kadpcm":{"source":"iana"},"audio/3gpp":{"source":"iana","compressible":false,"extensions":["3gpp"]},"audio/3gpp2":{"source":"iana"},"audio/aac":{"source":"iana"},"audio/ac3":{"source":"iana"},"audio/adpcm":{"source":"apache","extensions":["adp"]},"audio/amr":{"source":"iana"},"audio/amr-wb":{"source":"iana"},"audio/amr-wb+":{"source":"iana"},"audio/aptx":{"source":"iana"},"audio/asc":{"source":"iana"},"audio/atrac-advanced-lossless":{"source":"iana"},"audio/atrac-x":{"source":"iana"},"audio/atrac3":{"source":"iana"},"audio/basic":{"source":"iana","compressible":false,"extensions":["au","snd"]},"audio/bv16":{"source":"iana"},"audio/bv32":{"source":"iana"},"audio/clearmode":{"source":"iana"},"audio/cn":{"source":"iana"},"audio/dat12":{"source":"iana"},"audio/dls":{"source":"iana"},"audio/dsr-es201108":{"source":"iana"},"audio/dsr-es202050":{"source":"iana"},"audio/dsr-es202211":{"source":"iana"},"audio/dsr-es202212":{"source":"iana"},"audio/dv":{"source":"iana"},"audio/dvi4":{"source":"iana"},"audio/eac3":{"source":"iana"},"audio/encaprtp":{"source":"iana"},"audio/evrc":{"source":"iana"},"audio/evrc-qcp":{"source":"iana"},"audio/evrc0":{"source":"iana"},"audio/evrc1":{"source":"iana"},"audio/evrcb":{"source":"iana"},"audio/evrcb0":{"source":"iana"},"audio/evrcb1":{"source":"iana"},"audio/evrcnw":{"source":"iana"},"audio/evrcnw0":{"source":"iana"},"audio/evrcnw1":{"source":"iana"},"audio/evrcwb":{"source":"iana"},"audio/evrcwb0":{"source":"iana"},"audio/evrcwb1":{"source":"iana"},"audio/evs":{"source":"iana"},"audio/flexfec":{"source":"iana"},"audio/fwdred":{"source":"iana"},"audio/g711-0":{"source":"iana"},"audio/g719":{"source":"iana"},"audio/g722":{"source":"iana"},"audio/g7221":{"source":"iana"},"audio/g723":{"source":"iana"},"audio/g726-16":{"source":"iana"},"audio/g726-24":{"source":"iana"},"audio/g726-32":{"source":"iana"},"audio/g726-40":{"source":"iana"},"audio/g728":{"source":"iana"},"audio/g729":{"source":"iana"},"audio/g7291":{"source":"iana"},"audio/g729d":{"source":"iana"},"audio/g729e":{"source":"iana"},"audio/gsm":{"source":"iana"},"audio/gsm-efr":{"source":"iana"},"audio/gsm-hr-08":{"source":"iana"},"audio/ilbc":{"source":"iana"},"audio/ip-mr_v2.5":{"source":"iana"},"audio/isac":{"source":"apache"},"audio/l16":{"source":"iana"},"audio/l20":{"source":"iana"},"audio/l24":{"source":"iana","compressible":false},"audio/l8":{"source":"iana"},"audio/lpc":{"source":"iana"},"audio/melp":{"source":"iana"},"audio/melp1200":{"source":"iana"},"audio/melp2400":{"source":"iana"},"audio/melp600":{"source":"iana"},"audio/midi":{"source":"apache","extensions":["mid","midi","kar","rmi"]},"audio/mobile-xmf":{"source":"iana"},"audio/mp3":{"compressible":false,"extensions":["mp3"]},"audio/mp4":{"source":"iana","compressible":false,"extensions":["m4a","mp4a"]},"audio/mp4a-latm":{"source":"iana"},"audio/mpa":{"source":"iana"},"audio/mpa-robust":{"source":"iana"},"audio/mpeg":{"source":"iana","compressible":false,"extensions":["mpga","mp2","mp2a","mp3","m2a","m3a"]},"audio/mpeg4-generic":{"source":"iana"},"audio/musepack":{"source":"apache"},"audio/ogg":{"source":"iana","compressible":false,"extensions":["oga","ogg","spx"]},"audio/opus":{"source":"iana"},"audio/parityfec":{"source":"iana"},"audio/pcma":{"source":"iana"},"audio/pcma-wb":{"source":"iana"},"audio/pcmu":{"source":"iana"},"audio/pcmu-wb":{"source":"iana"},"audio/prs.sid":{"source":"iana"},"audio/qcelp":{"source":"iana"},"audio/raptorfec":{"source":"iana"},"audio/red":{"source":"iana"},"audio/rtp-enc-aescm128":{"source":"iana"},"audio/rtp-midi":{"source":"iana"},"audio/rtploopback":{"source":"iana"},"audio/rtx":{"source":"iana"},"audio/s3m":{"source":"apache","extensions":["s3m"]},"audio/silk":{"source":"apache","extensions":["sil"]},"audio/smv":{"source":"iana"},"audio/smv-qcp":{"source":"iana"},"audio/smv0":{"source":"iana"},"audio/sp-midi":{"source":"iana"},"audio/speex":{"source":"iana"},"audio/t140c":{"source":"iana"},"audio/t38":{"source":"iana"},"audio/telephone-event":{"source":"iana"},"audio/tetra_acelp":{"source":"iana"},"audio/tone":{"source":"iana"},"audio/uemclip":{"source":"iana"},"audio/ulpfec":{"source":"iana"},"audio/usac":{"source":"iana"},"audio/vdvi":{"source":"iana"},"audio/vmr-wb":{"source":"iana"},"audio/vnd.3gpp.iufp":{"source":"iana"},"audio/vnd.4sb":{"source":"iana"},"audio/vnd.audiokoz":{"source":"iana"},"audio/vnd.celp":{"source":"iana"},"audio/vnd.cisco.nse":{"source":"iana"},"audio/vnd.cmles.radio-events":{"source":"iana"},"audio/vnd.cns.anp1":{"source":"iana"},"audio/vnd.cns.inf1":{"source":"iana"},"audio/vnd.dece.audio":{"source":"iana","extensions":["uva","uvva"]},"audio/vnd.digital-winds":{"source":"iana","extensions":["eol"]},"audio/vnd.dlna.adts":{"source":"iana"},"audio/vnd.dolby.heaac.1":{"source":"iana"},"audio/vnd.dolby.heaac.2":{"source":"iana"},"audio/vnd.dolby.mlp":{"source":"iana"},"audio/vnd.dolby.mps":{"source":"iana"},"audio/vnd.dolby.pl2":{"source":"iana"},"audio/vnd.dolby.pl2x":{"source":"iana"},"audio/vnd.dolby.pl2z":{"source":"iana"},"audio/vnd.dolby.pulse.1":{"source":"iana"},"audio/vnd.dra":{"source":"iana","extensions":["dra"]},"audio/vnd.dts":{"source":"iana","extensions":["dts"]},"audio/vnd.dts.hd":{"source":"iana","extensions":["dtshd"]},"audio/vnd.dts.uhd":{"source":"iana"},"audio/vnd.dvb.file":{"source":"iana"},"audio/vnd.everad.plj":{"source":"iana"},"audio/vnd.hns.audio":{"source":"iana"},"audio/vnd.lucent.voice":{"source":"iana","extensions":["lvp"]},"audio/vnd.ms-playready.media.pya":{"source":"iana","extensions":["pya"]},"audio/vnd.nokia.mobile-xmf":{"source":"iana"},"audio/vnd.nortel.vbk":{"source":"iana"},"audio/vnd.nuera.ecelp4800":{"source":"iana","extensions":["ecelp4800"]},"audio/vnd.nuera.ecelp7470":{"source":"iana","extensions":["ecelp7470"]},"audio/vnd.nuera.ecelp9600":{"source":"iana","extensions":["ecelp9600"]},"audio/vnd.octel.sbc":{"source":"iana"},"audio/vnd.presonus.multitrack":{"source":"iana"},"audio/vnd.qcelp":{"source":"iana"},"audio/vnd.rhetorex.32kadpcm":{"source":"iana"},"audio/vnd.rip":{"source":"iana","extensions":["rip"]},"audio/vnd.rn-realaudio":{"compressible":false},"audio/vnd.sealedmedia.softseal.mpeg":{"source":"iana"},"audio/vnd.vmx.cvsd":{"source":"iana"},"audio/vnd.wave":{"compressible":false},"audio/vorbis":{"source":"iana","compressible":false},"audio/vorbis-config":{"source":"iana"},"audio/wav":{"compressible":false,"extensions":["wav"]},"audio/wave":{"compressible":false,"extensions":["wav"]},"audio/webm":{"source":"apache","compressible":false,"extensions":["weba"]},"audio/x-aac":{"source":"apache","compressible":false,"extensions":["aac"]},"audio/x-aiff":{"source":"apache","extensions":["aif","aiff","aifc"]},"audio/x-caf":{"source":"apache","compressible":false,"extensions":["caf"]},"audio/x-flac":{"source":"apache","extensions":["flac"]},"audio/x-m4a":{"source":"nginx","extensions":["m4a"]},"audio/x-matroska":{"source":"apache","extensions":["mka"]},"audio/x-mpegurl":{"source":"apache","extensions":["m3u"]},"audio/x-ms-wax":{"source":"apache","extensions":["wax"]},"audio/x-ms-wma":{"source":"apache","extensions":["wma"]},"audio/x-pn-realaudio":{"source":"apache","extensions":["ram","ra"]},"audio/x-pn-realaudio-plugin":{"source":"apache","extensions":["rmp"]},"audio/x-realaudio":{"source":"nginx","extensions":["ra"]},"audio/x-tta":{"source":"apache"},"audio/x-wav":{"source":"apache","extensions":["wav"]},"audio/xm":{"source":"apache","extensions":["xm"]},"chemical/x-cdx":{"source":"apache","extensions":["cdx"]},"chemical/x-cif":{"source":"apache","extensions":["cif"]},"chemical/x-cmdf":{"source":"apache","extensions":["cmdf"]},"chemical/x-cml":{"source":"apache","extensions":["cml"]},"chemical/x-csml":{"source":"apache","extensions":["csml"]},"chemical/x-pdb":{"source":"apache"},"chemical/x-xyz":{"source":"apache","extensions":["xyz"]},"font/collection":{"source":"iana","extensions":["ttc"]},"font/otf":{"source":"iana","compressible":true,"extensions":["otf"]},"font/sfnt":{"source":"iana"},"font/ttf":{"source":"iana","compressible":true,"extensions":["ttf"]},"font/woff":{"source":"iana","extensions":["woff"]},"font/woff2":{"source":"iana","extensions":["woff2"]},"image/aces":{"source":"iana","extensions":["exr"]},"image/apng":{"compressible":false,"extensions":["apng"]},"image/avci":{"source":"iana"},"image/avcs":{"source":"iana"},"image/bmp":{"source":"iana","compressible":true,"extensions":["bmp"]},"image/cgm":{"source":"iana","extensions":["cgm"]},"image/dicom-rle":{"source":"iana","extensions":["drle"]},"image/emf":{"source":"iana","extensions":["emf"]},"image/fits":{"source":"iana","extensions":["fits"]},"image/g3fax":{"source":"iana","extensions":["g3"]},"image/gif":{"source":"iana","compressible":false,"extensions":["gif"]},"image/heic":{"source":"iana","extensions":["heic"]},"image/heic-sequence":{"source":"iana","extensions":["heics"]},"image/heif":{"source":"iana","extensions":["heif"]},"image/heif-sequence":{"source":"iana","extensions":["heifs"]},"image/hej2k":{"source":"iana","extensions":["hej2"]},"image/hsj2":{"source":"iana","extensions":["hsj2"]},"image/ief":{"source":"iana","extensions":["ief"]},"image/jls":{"source":"iana","extensions":["jls"]},"image/jp2":{"source":"iana","compressible":false,"extensions":["jp2","jpg2"]},"image/jpeg":{"source":"iana","compressible":false,"extensions":["jpeg","jpg","jpe"]},"image/jph":{"source":"iana","extensions":["jph"]},"image/jphc":{"source":"iana","extensions":["jhc"]},"image/jpm":{"source":"iana","compressible":false,"extensions":["jpm"]},"image/jpx":{"source":"iana","compressible":false,"extensions":["jpx","jpf"]},"image/jxr":{"source":"iana","extensions":["jxr"]},"image/jxra":{"source":"iana","extensions":["jxra"]},"image/jxrs":{"source":"iana","extensions":["jxrs"]},"image/jxs":{"source":"iana","extensions":["jxs"]},"image/jxsc":{"source":"iana","extensions":["jxsc"]},"image/jxsi":{"source":"iana","extensions":["jxsi"]},"image/jxss":{"source":"iana","extensions":["jxss"]},"image/ktx":{"source":"iana","extensions":["ktx"]},"image/naplps":{"source":"iana"},"image/pjpeg":{"compressible":false},"image/png":{"source":"iana","compressible":false,"extensions":["png"]},"image/prs.btif":{"source":"iana","extensions":["btif"]},"image/prs.pti":{"source":"iana","extensions":["pti"]},"image/pwg-raster":{"source":"iana"},"image/sgi":{"source":"apache","extensions":["sgi"]},"image/svg+xml":{"source":"iana","compressible":true,"extensions":["svg","svgz"]},"image/t38":{"source":"iana","extensions":["t38"]},"image/tiff":{"source":"iana","compressible":false,"extensions":["tif","tiff"]},"image/tiff-fx":{"source":"iana","extensions":["tfx"]},"image/vnd.adobe.photoshop":{"source":"iana","compressible":true,"extensions":["psd"]},"image/vnd.airzip.accelerator.azv":{"source":"iana","extensions":["azv"]},"image/vnd.cns.inf2":{"source":"iana"},"image/vnd.dece.graphic":{"source":"iana","extensions":["uvi","uvvi","uvg","uvvg"]},"image/vnd.djvu":{"source":"iana","extensions":["djvu","djv"]},"image/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"image/vnd.dwg":{"source":"iana","extensions":["dwg"]},"image/vnd.dxf":{"source":"iana","extensions":["dxf"]},"image/vnd.fastbidsheet":{"source":"iana","extensions":["fbs"]},"image/vnd.fpx":{"source":"iana","extensions":["fpx"]},"image/vnd.fst":{"source":"iana","extensions":["fst"]},"image/vnd.fujixerox.edmics-mmr":{"source":"iana","extensions":["mmr"]},"image/vnd.fujixerox.edmics-rlc":{"source":"iana","extensions":["rlc"]},"image/vnd.globalgraphics.pgb":{"source":"iana"},"image/vnd.microsoft.icon":{"source":"iana","extensions":["ico"]},"image/vnd.mix":{"source":"iana"},"image/vnd.mozilla.apng":{"source":"iana"},"image/vnd.ms-dds":{"extensions":["dds"]},"image/vnd.ms-modi":{"source":"iana","extensions":["mdi"]},"image/vnd.ms-photo":{"source":"apache","extensions":["wdp"]},"image/vnd.net-fpx":{"source":"iana","extensions":["npx"]},"image/vnd.radiance":{"source":"iana"},"image/vnd.sealed.png":{"source":"iana"},"image/vnd.sealedmedia.softseal.gif":{"source":"iana"},"image/vnd.sealedmedia.softseal.jpg":{"source":"iana"},"image/vnd.svf":{"source":"iana"},"image/vnd.tencent.tap":{"source":"iana","extensions":["tap"]},"image/vnd.valve.source.texture":{"source":"iana","extensions":["vtf"]},"image/vnd.wap.wbmp":{"source":"iana","extensions":["wbmp"]},"image/vnd.xiff":{"source":"iana","extensions":["xif"]},"image/vnd.zbrush.pcx":{"source":"iana","extensions":["pcx"]},"image/webp":{"source":"apache","extensions":["webp"]},"image/wmf":{"source":"iana","extensions":["wmf"]},"image/x-3ds":{"source":"apache","extensions":["3ds"]},"image/x-cmu-raster":{"source":"apache","extensions":["ras"]},"image/x-cmx":{"source":"apache","extensions":["cmx"]},"image/x-freehand":{"source":"apache","extensions":["fh","fhc","fh4","fh5","fh7"]},"image/x-icon":{"source":"apache","compressible":true,"extensions":["ico"]},"image/x-jng":{"source":"nginx","extensions":["jng"]},"image/x-mrsid-image":{"source":"apache","extensions":["sid"]},"image/x-ms-bmp":{"source":"nginx","compressible":true,"extensions":["bmp"]},"image/x-pcx":{"source":"apache","extensions":["pcx"]},"image/x-pict":{"source":"apache","extensions":["pic","pct"]},"image/x-portable-anymap":{"source":"apache","extensions":["pnm"]},"image/x-portable-bitmap":{"source":"apache","extensions":["pbm"]},"image/x-portable-graymap":{"source":"apache","extensions":["pgm"]},"image/x-portable-pixmap":{"source":"apache","extensions":["ppm"]},"image/x-rgb":{"source":"apache","extensions":["rgb"]},"image/x-tga":{"source":"apache","extensions":["tga"]},"image/x-xbitmap":{"source":"apache","extensions":["xbm"]},"image/x-xcf":{"compressible":false},"image/x-xpixmap":{"source":"apache","extensions":["xpm"]},"image/x-xwindowdump":{"source":"apache","extensions":["xwd"]},"message/cpim":{"source":"iana"},"message/delivery-status":{"source":"iana"},"message/disposition-notification":{"source":"iana","extensions":["disposition-notification"]},"message/external-body":{"source":"iana"},"message/feedback-report":{"source":"iana"},"message/global":{"source":"iana","extensions":["u8msg"]},"message/global-delivery-status":{"source":"iana","extensions":["u8dsn"]},"message/global-disposition-notification":{"source":"iana","extensions":["u8mdn"]},"message/global-headers":{"source":"iana","extensions":["u8hdr"]},"message/http":{"source":"iana","compressible":false},"message/imdn+xml":{"source":"iana","compressible":true},"message/news":{"source":"iana"},"message/partial":{"source":"iana","compressible":false},"message/rfc822":{"source":"iana","compressible":true,"extensions":["eml","mime"]},"message/s-http":{"source":"iana"},"message/sip":{"source":"iana"},"message/sipfrag":{"source":"iana"},"message/tracking-status":{"source":"iana"},"message/vnd.si.simp":{"source":"iana"},"message/vnd.wfa.wsc":{"source":"iana","extensions":["wsc"]},"model/3mf":{"source":"iana","extensions":["3mf"]},"model/gltf+json":{"source":"iana","compressible":true,"extensions":["gltf"]},"model/gltf-binary":{"source":"iana","compressible":true,"extensions":["glb"]},"model/iges":{"source":"iana","compressible":false,"extensions":["igs","iges"]},"model/mesh":{"source":"iana","compressible":false,"extensions":["msh","mesh","silo"]},"model/stl":{"source":"iana","extensions":["stl"]},"model/vnd.collada+xml":{"source":"iana","compressible":true,"extensions":["dae"]},"model/vnd.dwf":{"source":"iana","extensions":["dwf"]},"model/vnd.flatland.3dml":{"source":"iana"},"model/vnd.gdl":{"source":"iana","extensions":["gdl"]},"model/vnd.gs-gdl":{"source":"apache"},"model/vnd.gs.gdl":{"source":"iana"},"model/vnd.gtw":{"source":"iana","extensions":["gtw"]},"model/vnd.moml+xml":{"source":"iana","compressible":true},"model/vnd.mts":{"source":"iana","extensions":["mts"]},"model/vnd.opengex":{"source":"iana","extensions":["ogex"]},"model/vnd.parasolid.transmit.binary":{"source":"iana","extensions":["x_b"]},"model/vnd.parasolid.transmit.text":{"source":"iana","extensions":["x_t"]},"model/vnd.rosette.annotated-data-model":{"source":"iana"},"model/vnd.usdz+zip":{"source":"iana","compressible":false,"extensions":["usdz"]},"model/vnd.valve.source.compiled-map":{"source":"iana","extensions":["bsp"]},"model/vnd.vtu":{"source":"iana","extensions":["vtu"]},"model/vrml":{"source":"iana","compressible":false,"extensions":["wrl","vrml"]},"model/x3d+binary":{"source":"apache","compressible":false,"extensions":["x3db","x3dbz"]},"model/x3d+fastinfoset":{"source":"iana","extensions":["x3db"]},"model/x3d+vrml":{"source":"apache","compressible":false,"extensions":["x3dv","x3dvz"]},"model/x3d+xml":{"source":"iana","compressible":true,"extensions":["x3d","x3dz"]},"model/x3d-vrml":{"source":"iana","extensions":["x3dv"]},"multipart/alternative":{"source":"iana","compressible":false},"multipart/appledouble":{"source":"iana"},"multipart/byteranges":{"source":"iana"},"multipart/digest":{"source":"iana"},"multipart/encrypted":{"source":"iana","compressible":false},"multipart/form-data":{"source":"iana","compressible":false},"multipart/header-set":{"source":"iana"},"multipart/mixed":{"source":"iana"},"multipart/multilingual":{"source":"iana"},"multipart/parallel":{"source":"iana"},"multipart/related":{"source":"iana","compressible":false},"multipart/report":{"source":"iana"},"multipart/signed":{"source":"iana","compressible":false},"multipart/vnd.bint.med-plus":{"source":"iana"},"multipart/voice-message":{"source":"iana"},"multipart/x-mixed-replace":{"source":"iana"},"text/1d-interleaved-parityfec":{"source":"iana"},"text/cache-manifest":{"source":"iana","compressible":true,"extensions":["appcache","manifest"]},"text/calendar":{"source":"iana","extensions":["ics","ifb"]},"text/calender":{"compressible":true},"text/cmd":{"compressible":true},"text/coffeescript":{"extensions":["coffee","litcoffee"]},"text/css":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["css"]},"text/csv":{"source":"iana","compressible":true,"extensions":["csv"]},"text/csv-schema":{"source":"iana"},"text/directory":{"source":"iana"},"text/dns":{"source":"iana"},"text/ecmascript":{"source":"iana"},"text/encaprtp":{"source":"iana"},"text/enriched":{"source":"iana"},"text/flexfec":{"source":"iana"},"text/fwdred":{"source":"iana"},"text/grammar-ref-list":{"source":"iana"},"text/html":{"source":"iana","compressible":true,"extensions":["html","htm","shtml"]},"text/jade":{"extensions":["jade"]},"text/javascript":{"source":"iana","compressible":true},"text/jcr-cnd":{"source":"iana"},"text/jsx":{"compressible":true,"extensions":["jsx"]},"text/less":{"compressible":true,"extensions":["less"]},"text/markdown":{"source":"iana","compressible":true,"extensions":["markdown","md"]},"text/mathml":{"source":"nginx","extensions":["mml"]},"text/mdx":{"compressible":true,"extensions":["mdx"]},"text/mizar":{"source":"iana"},"text/n3":{"source":"iana","compressible":true,"extensions":["n3"]},"text/parameters":{"source":"iana"},"text/parityfec":{"source":"iana"},"text/plain":{"source":"iana","compressible":true,"extensions":["txt","text","conf","def","list","log","in","ini"]},"text/provenance-notation":{"source":"iana"},"text/prs.fallenstein.rst":{"source":"iana"},"text/prs.lines.tag":{"source":"iana","extensions":["dsc"]},"text/prs.prop.logic":{"source":"iana"},"text/raptorfec":{"source":"iana"},"text/red":{"source":"iana"},"text/rfc822-headers":{"source":"iana"},"text/richtext":{"source":"iana","compressible":true,"extensions":["rtx"]},"text/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"text/rtp-enc-aescm128":{"source":"iana"},"text/rtploopback":{"source":"iana"},"text/rtx":{"source":"iana"},"text/sgml":{"source":"iana","extensions":["sgml","sgm"]},"text/shex":{"extensions":["shex"]},"text/slim":{"extensions":["slim","slm"]},"text/strings":{"source":"iana"},"text/stylus":{"extensions":["stylus","styl"]},"text/t140":{"source":"iana"},"text/tab-separated-values":{"source":"iana","compressible":true,"extensions":["tsv"]},"text/troff":{"source":"iana","extensions":["t","tr","roff","man","me","ms"]},"text/turtle":{"source":"iana","charset":"UTF-8","extensions":["ttl"]},"text/ulpfec":{"source":"iana"},"text/uri-list":{"source":"iana","compressible":true,"extensions":["uri","uris","urls"]},"text/vcard":{"source":"iana","compressible":true,"extensions":["vcard"]},"text/vnd.a":{"source":"iana"},"text/vnd.abc":{"source":"iana"},"text/vnd.ascii-art":{"source":"iana"},"text/vnd.curl":{"source":"iana","extensions":["curl"]},"text/vnd.curl.dcurl":{"source":"apache","extensions":["dcurl"]},"text/vnd.curl.mcurl":{"source":"apache","extensions":["mcurl"]},"text/vnd.curl.scurl":{"source":"apache","extensions":["scurl"]},"text/vnd.debian.copyright":{"source":"iana"},"text/vnd.dmclientscript":{"source":"iana"},"text/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"text/vnd.esmertec.theme-descriptor":{"source":"iana"},"text/vnd.ficlab.flt":{"source":"iana"},"text/vnd.fly":{"source":"iana","extensions":["fly"]},"text/vnd.fmi.flexstor":{"source":"iana","extensions":["flx"]},"text/vnd.gml":{"source":"iana"},"text/vnd.graphviz":{"source":"iana","extensions":["gv"]},"text/vnd.hgl":{"source":"iana"},"text/vnd.in3d.3dml":{"source":"iana","extensions":["3dml"]},"text/vnd.in3d.spot":{"source":"iana","extensions":["spot"]},"text/vnd.iptc.newsml":{"source":"iana"},"text/vnd.iptc.nitf":{"source":"iana"},"text/vnd.latex-z":{"source":"iana"},"text/vnd.motorola.reflex":{"source":"iana"},"text/vnd.ms-mediapackage":{"source":"iana"},"text/vnd.net2phone.commcenter.command":{"source":"iana"},"text/vnd.radisys.msml-basic-layout":{"source":"iana"},"text/vnd.senx.warpscript":{"source":"iana"},"text/vnd.si.uricatalogue":{"source":"iana"},"text/vnd.sosi":{"source":"iana"},"text/vnd.sun.j2me.app-descriptor":{"source":"iana","extensions":["jad"]},"text/vnd.trolltech.linguist":{"source":"iana"},"text/vnd.wap.si":{"source":"iana"},"text/vnd.wap.sl":{"source":"iana"},"text/vnd.wap.wml":{"source":"iana","extensions":["wml"]},"text/vnd.wap.wmlscript":{"source":"iana","extensions":["wmls"]},"text/vtt":{"charset":"UTF-8","compressible":true,"extensions":["vtt"]},"text/x-asm":{"source":"apache","extensions":["s","asm"]},"text/x-c":{"source":"apache","extensions":["c","cc","cxx","cpp","h","hh","dic"]},"text/x-component":{"source":"nginx","extensions":["htc"]},"text/x-fortran":{"source":"apache","extensions":["f","for","f77","f90"]},"text/x-gwt-rpc":{"compressible":true},"text/x-handlebars-template":{"extensions":["hbs"]},"text/x-java-source":{"source":"apache","extensions":["java"]},"text/x-jquery-tmpl":{"compressible":true},"text/x-lua":{"extensions":["lua"]},"text/x-markdown":{"compressible":true,"extensions":["mkd"]},"text/x-nfo":{"source":"apache","extensions":["nfo"]},"text/x-opml":{"source":"apache","extensions":["opml"]},"text/x-org":{"compressible":true,"extensions":["org"]},"text/x-pascal":{"source":"apache","extensions":["p","pas"]},"text/x-processing":{"compressible":true,"extensions":["pde"]},"text/x-sass":{"extensions":["sass"]},"text/x-scss":{"extensions":["scss"]},"text/x-setext":{"source":"apache","extensions":["etx"]},"text/x-sfv":{"source":"apache","extensions":["sfv"]},"text/x-suse-ymp":{"compressible":true,"extensions":["ymp"]},"text/x-uuencode":{"source":"apache","extensions":["uu"]},"text/x-vcalendar":{"source":"apache","extensions":["vcs"]},"text/x-vcard":{"source":"apache","extensions":["vcf"]},"text/xml":{"source":"iana","compressible":true,"extensions":["xml"]},"text/xml-external-parsed-entity":{"source":"iana"},"text/yaml":{"extensions":["yaml","yml"]},"video/1d-interleaved-parityfec":{"source":"iana"},"video/3gpp":{"source":"iana","extensions":["3gp","3gpp"]},"video/3gpp-tt":{"source":"iana"},"video/3gpp2":{"source":"iana","extensions":["3g2"]},"video/bmpeg":{"source":"iana"},"video/bt656":{"source":"iana"},"video/celb":{"source":"iana"},"video/dv":{"source":"iana"},"video/encaprtp":{"source":"iana"},"video/flexfec":{"source":"iana"},"video/h261":{"source":"iana","extensions":["h261"]},"video/h263":{"source":"iana","extensions":["h263"]},"video/h263-1998":{"source":"iana"},"video/h263-2000":{"source":"iana"},"video/h264":{"source":"iana","extensions":["h264"]},"video/h264-rcdo":{"source":"iana"},"video/h264-svc":{"source":"iana"},"video/h265":{"source":"iana"},"video/iso.segment":{"source":"iana"},"video/jpeg":{"source":"iana","extensions":["jpgv"]},"video/jpeg2000":{"source":"iana"},"video/jpm":{"source":"apache","extensions":["jpm","jpgm"]},"video/mj2":{"source":"iana","extensions":["mj2","mjp2"]},"video/mp1s":{"source":"iana"},"video/mp2p":{"source":"iana"},"video/mp2t":{"source":"iana","extensions":["ts"]},"video/mp4":{"source":"iana","compressible":false,"extensions":["mp4","mp4v","mpg4"]},"video/mp4v-es":{"source":"iana"},"video/mpeg":{"source":"iana","compressible":false,"extensions":["mpeg","mpg","mpe","m1v","m2v"]},"video/mpeg4-generic":{"source":"iana"},"video/mpv":{"source":"iana"},"video/nv":{"source":"iana"},"video/ogg":{"source":"iana","compressible":false,"extensions":["ogv"]},"video/parityfec":{"source":"iana"},"video/pointer":{"source":"iana"},"video/quicktime":{"source":"iana","compressible":false,"extensions":["qt","mov"]},"video/raptorfec":{"source":"iana"},"video/raw":{"source":"iana"},"video/rtp-enc-aescm128":{"source":"iana"},"video/rtploopback":{"source":"iana"},"video/rtx":{"source":"iana"},"video/smpte291":{"source":"iana"},"video/smpte292m":{"source":"iana"},"video/ulpfec":{"source":"iana"},"video/vc1":{"source":"iana"},"video/vc2":{"source":"iana"},"video/vnd.cctv":{"source":"iana"},"video/vnd.dece.hd":{"source":"iana","extensions":["uvh","uvvh"]},"video/vnd.dece.mobile":{"source":"iana","extensions":["uvm","uvvm"]},"video/vnd.dece.mp4":{"source":"iana"},"video/vnd.dece.pd":{"source":"iana","extensions":["uvp","uvvp"]},"video/vnd.dece.sd":{"source":"iana","extensions":["uvs","uvvs"]},"video/vnd.dece.video":{"source":"iana","extensions":["uvv","uvvv"]},"video/vnd.directv.mpeg":{"source":"iana"},"video/vnd.directv.mpeg-tts":{"source":"iana"},"video/vnd.dlna.mpeg-tts":{"source":"iana"},"video/vnd.dvb.file":{"source":"iana","extensions":["dvb"]},"video/vnd.fvt":{"source":"iana","extensions":["fvt"]},"video/vnd.hns.video":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.ttsavc":{"source":"iana"},"video/vnd.iptvforum.ttsmpeg2":{"source":"iana"},"video/vnd.motorola.video":{"source":"iana"},"video/vnd.motorola.videop":{"source":"iana"},"video/vnd.mpegurl":{"source":"iana","extensions":["mxu","m4u"]},"video/vnd.ms-playready.media.pyv":{"source":"iana","extensions":["pyv"]},"video/vnd.nokia.interleaved-multimedia":{"source":"iana"},"video/vnd.nokia.mp4vr":{"source":"iana"},"video/vnd.nokia.videovoip":{"source":"iana"},"video/vnd.objectvideo":{"source":"iana"},"video/vnd.radgamettools.bink":{"source":"iana"},"video/vnd.radgamettools.smacker":{"source":"iana"},"video/vnd.sealed.mpeg1":{"source":"iana"},"video/vnd.sealed.mpeg4":{"source":"iana"},"video/vnd.sealed.swf":{"source":"iana"},"video/vnd.sealedmedia.softseal.mov":{"source":"iana"},"video/vnd.uvvu.mp4":{"source":"iana","extensions":["uvu","uvvu"]},"video/vnd.vivo":{"source":"iana","extensions":["viv"]},"video/vnd.youtube.yt":{"source":"iana"},"video/vp8":{"source":"iana"},"video/webm":{"source":"apache","compressible":false,"extensions":["webm"]},"video/x-f4v":{"source":"apache","extensions":["f4v"]},"video/x-fli":{"source":"apache","extensions":["fli"]},"video/x-flv":{"source":"apache","compressible":false,"extensions":["flv"]},"video/x-m4v":{"source":"apache","extensions":["m4v"]},"video/x-matroska":{"source":"apache","compressible":false,"extensions":["mkv","mk3d","mks"]},"video/x-mng":{"source":"apache","extensions":["mng"]},"video/x-ms-asf":{"source":"apache","extensions":["asf","asx"]},"video/x-ms-vob":{"source":"apache","extensions":["vob"]},"video/x-ms-wm":{"source":"apache","extensions":["wm"]},"video/x-ms-wmv":{"source":"apache","compressible":false,"extensions":["wmv"]},"video/x-ms-wmx":{"source":"apache","extensions":["wmx"]},"video/x-ms-wvx":{"source":"apache","extensions":["wvx"]},"video/x-msvideo":{"source":"apache","extensions":["avi"]},"video/x-sgi-movie":{"source":"apache","extensions":["movie"]},"video/x-smv":{"source":"apache","extensions":["smv"]},"x-conference/x-cooltalk":{"source":"apache","extensions":["ice"]},"x-shader/x-fragment":{"compressible":true},"x-shader/x-vertex":{"compressible":true}}; + +/***/ }), + +/***/ 514: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var compileSchema = __webpack_require__(805) + , resolve = __webpack_require__(867) + , Cache = __webpack_require__(921) + , SchemaObject = __webpack_require__(955) + , stableStringify = __webpack_require__(741) + , formats = __webpack_require__(881) + , rules = __webpack_require__(496) + , $dataMetaSchema = __webpack_require__(628) + , util = __webpack_require__(855); + +module.exports = Ajv; + +Ajv.prototype.validate = validate; +Ajv.prototype.compile = compile; +Ajv.prototype.addSchema = addSchema; +Ajv.prototype.addMetaSchema = addMetaSchema; +Ajv.prototype.validateSchema = validateSchema; +Ajv.prototype.getSchema = getSchema; +Ajv.prototype.removeSchema = removeSchema; +Ajv.prototype.addFormat = addFormat; +Ajv.prototype.errorsText = errorsText; + +Ajv.prototype._addSchema = _addSchema; +Ajv.prototype._compile = _compile; + +Ajv.prototype.compileAsync = __webpack_require__(890); +var customKeyword = __webpack_require__(45); +Ajv.prototype.addKeyword = customKeyword.add; +Ajv.prototype.getKeyword = customKeyword.get; +Ajv.prototype.removeKeyword = customKeyword.remove; +Ajv.prototype.validateKeyword = customKeyword.validate; + +var errorClasses = __webpack_require__(844); +Ajv.ValidationError = errorClasses.Validation; +Ajv.MissingRefError = errorClasses.MissingRef; +Ajv.$dataMetaSchema = $dataMetaSchema; + +var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; + +var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; +var META_SUPPORT_DATA = ['/properties']; + +/** + * Creates validator instance. + * Usage: `Ajv(opts)` + * @param {Object} opts optional options + * @return {Object} ajv instance + */ +function Ajv(opts) { + if (!(this instanceof Ajv)) return new Ajv(opts); + opts = this._opts = util.copy(opts) || {}; + setLogger(this); + this._schemas = {}; + this._refs = {}; + this._fragments = {}; + this._formats = formats(opts.format); + + this._cache = opts.cache || new Cache; + this._loadingSchemas = {}; + this._compilations = []; + this.RULES = rules(); + this._getId = chooseGetId(opts); + + opts.loopRequired = opts.loopRequired || Infinity; + if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; + if (opts.serialize === undefined) opts.serialize = stableStringify; + this._metaOpts = getMetaSchemaOptions(this); - return (this); + if (opts.formats) addInitialFormats(this); + addDefaultMetaSchema(this); + if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); + if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); + addInitialSchemas(this); } -/* - * We don't bother setting SError.prototype.name because once constructed, - * SErrors are just like VErrors. - */ -mod_util.inherits(SError, VError); -/* - * Represents a collection of errors for the purpose of consumers that generally - * only deal with one error. Callers can extract the individual errors - * contained in this object, but may also just treat it as a normal single - * error, in which case a summary message will be printed. +/** + * Validate data using schema + * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. + * @this Ajv + * @param {String|Object} schemaKeyRef key, ref or schema object + * @param {Any} data to be validated + * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). */ -function MultiError(errors) -{ - mod_assertplus.array(errors, 'list of errors'); - mod_assertplus.ok(errors.length > 0, 'must be at least one error'); - this.ase_errors = errors; +function validate(schemaKeyRef, data) { + var v; + if (typeof schemaKeyRef == 'string') { + v = this.getSchema(schemaKeyRef); + if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); + } else { + var schemaObj = this._addSchema(schemaKeyRef); + v = schemaObj.validate || this._compile(schemaObj); + } - VError.call(this, { - 'cause': errors[0] - }, 'first of %d error%s', errors.length, errors.length == 1 ? '' : 's'); + var valid = v(data); + if (v.$async !== true) this.errors = v.errors; + return valid; } -mod_util.inherits(MultiError, VError); -MultiError.prototype.name = 'MultiError'; -MultiError.prototype.errors = function me_errors() -{ - return (this.ase_errors.slice(0)); -}; +/** + * Create validating function for passed schema. + * @this Ajv + * @param {Object} schema schema object + * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. + * @return {Function} validating function + */ +function compile(schema, _meta) { + var schemaObj = this._addSchema(schema, undefined, _meta); + return schemaObj.validate || this._compile(schemaObj); +} -/* - * See README.md for reference details. +/** + * Adds schema to the instance. + * @this Ajv + * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. + * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. + * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. + * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. + * @return {Ajv} this for method chaining */ -function WError() -{ - var args, obj, parsed, options; +function addSchema(schema, key, _skipValidation, _meta) { + if (Array.isArray(schema)){ + for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used. + * @param {Object} options optional options with properties `separator` and `dataVar`. + * @return {String} human readable string with all errors descriptions + */ +function errorsText(errors, options) { + errors = errors || this.errors; + if (!errors) return 'No errors'; + options = options || {}; + var separator = options.separator === undefined ? ', ' : options.separator; + var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; -var encode = function encode(str) { - // This code was originally written by Brian White (mscdex) for the io.js core querystring library. - // It has been adapted here for stricter adherence to RFC 3986 - if (str.length === 0) { - return str; - } + var text = ''; + for (var i=0; i= 0x30 && c <= 0x39) // 0-9 - || (c >= 0x41 && c <= 0x5A) // a-z - || (c >= 0x61 && c <= 0x7A) // A-Z - ) { - out += string.charAt(i); - continue; - } - if (c < 0x80) { - out = out + hexTable[c]; - continue; - } +function addDefaultMetaSchema(self) { + var $dataSchema; + if (self._opts.$data) { + $dataSchema = __webpack_require__(339); + self.addMetaSchema($dataSchema, $dataSchema.$id, true); + } + if (self._opts.meta === false) return; + var metaSchema = __webpack_require__(522); + if (self._opts.$data) metaSchema = $dataMetaSchema(metaSchema, META_SUPPORT_DATA); + self.addMetaSchema(metaSchema, META_SCHEMA_ID, true); + self._refs['http://json-schema.org/schema'] = META_SCHEMA_ID; +} - if (c < 0x800) { - out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); - continue; - } - if (c < 0xD800 || c >= 0xE000) { - out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); - continue; - } +function addInitialSchemas(self) { + var optsSchemas = self._opts.schemas; + if (!optsSchemas) return; + if (Array.isArray(optsSchemas)) self.addSchema(optsSchemas); + else for (var key in optsSchemas) self.addSchema(optsSchemas[key], key); +} - i += 1; - c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); - out += hexTable[0xF0 | (c >> 18)] - + hexTable[0x80 | ((c >> 12) & 0x3F)] - + hexTable[0x80 | ((c >> 6) & 0x3F)] - + hexTable[0x80 | (c & 0x3F)]; - } - return out; -}; +function addInitialFormats(self) { + for (var name in self._opts.formats) { + var format = self._opts.formats[name]; + self.addFormat(name, format); + } +} -var compact = function compact(value) { - var queue = [{ obj: { o: value }, prop: 'o' }]; - var refs = []; - for (var i = 0; i < queue.length; ++i) { - var item = queue[i]; - var obj = item.obj[item.prop]; +function checkUnique(self, id) { + if (self._schemas[id] || self._refs[id]) + throw new Error('schema with key or id "' + id + '" already exists'); +} - var keys = Object.keys(obj); - for (var j = 0; j < keys.length; ++j) { - var key = keys[j]; - var val = obj[key]; - if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { - queue.push({ obj: obj, prop: key }); - refs.push(val); - } - } - } - return compactQueue(queue); -}; +function getMetaSchemaOptions(self) { + var metaOpts = util.copy(self._opts); + for (var i=0; i All rights reserved. +CombinedStream.prototype.end = function() { + this._reset(); + this.emit('end'); +}; -var errors = __webpack_require__(294); -var types = __webpack_require__(850); +CombinedStream.prototype.destroy = function() { + this._reset(); + this.emit('close'); +}; -var Reader = __webpack_require__(782); -var Writer = __webpack_require__(402); +CombinedStream.prototype._reset = function() { + this.writable = false; + this._streams = []; + this._currentStream = null; +}; +CombinedStream.prototype._checkDataSize = function() { + this._updateDataSize(); + if (this.dataSize <= this.maxDataSize) { + return; + } -// --- Exports + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; + this._emitError(new Error(message)); +}; -module.exports = { +CombinedStream.prototype._updateDataSize = function() { + this.dataSize = 0; - Reader: Reader, + var self = this; + this._streams.forEach(function(stream) { + if (!stream.dataSize) { + return; + } - Writer: Writer + self.dataSize += stream.dataSize; + }); + if (this._currentStream && this._currentStream.dataSize) { + this.dataSize += this._currentStream.dataSize; + } }; -for (var t in types) { - if (types.hasOwnProperty(t)) - module.exports[t] = types[t]; -} -for (var e in errors) { - if (errors.hasOwnProperty(e)) - module.exports[e] = errors[e]; -} +CombinedStream.prototype._emitError = function(err) { + this._reset(); + this.emit('error', err); +}; /***/ }), -/***/ 601: -/***/ (function(module, __unusedexports, __webpack_require__) { +/***/ 552: +/***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -/* eslint-disable node/no-deprecated-api */ - - - -var buffer = __webpack_require__(407) -var Buffer = buffer.Buffer - -var safer = {} -var key -for (key in buffer) { - if (!buffer.hasOwnProperty(key)) continue - if (key === 'SlowBuffer' || key === 'Buffer') continue - safer[key] = buffer[key] -} +var url = __webpack_require__(835) +var isUrl = /^https?:/ -var Safer = safer.Buffer = {} -for (key in Buffer) { - if (!Buffer.hasOwnProperty(key)) continue - if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue - Safer[key] = Buffer[key] +function Redirect (request) { + this.request = request + this.followRedirect = true + this.followRedirects = true + this.followAllRedirects = false + this.followOriginalHttpMethod = false + this.allowRedirect = function () { return true } + this.maxRedirects = 10 + this.redirects = [] + this.redirectsFollowed = 0 + this.removeRefererHeader = false } -safer.Buffer.prototype = Buffer.prototype +Redirect.prototype.onRequest = function (options) { + var self = this -if (!Safer.from || Safer.from === Uint8Array.from) { - Safer.from = function (value, encodingOrOffset, length) { - if (typeof value === 'number') { - throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) - } - if (value && typeof value.length === 'undefined') { - throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) - } - return Buffer(value, encodingOrOffset, length) + if (options.maxRedirects !== undefined) { + self.maxRedirects = options.maxRedirects } -} - -if (!Safer.alloc) { - Safer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) - } - if (size < 0 || size >= 2 * (1 << 30)) { - throw new RangeError('The value "' + size + '" is invalid for option "size"') - } - var buf = Buffer(size) - if (!fill || fill.length === 0) { - buf.fill(0) - } else if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - return buf + if (typeof options.followRedirect === 'function') { + self.allowRedirect = options.followRedirect } -} - -if (!safer.kStringMaxLength) { - try { - safer.kStringMaxLength = process.binding('buffer').kStringMaxLength - } catch (e) { - // we can't determine kStringMaxLength in environments where process.binding - // is unsupported, so let's not set it + if (options.followRedirect !== undefined) { + self.followRedirects = !!options.followRedirect } -} - -if (!safer.constants) { - safer.constants = { - MAX_LENGTH: safer.kMaxLength + if (options.followAllRedirects !== undefined) { + self.followAllRedirects = options.followAllRedirects } - if (safer.kStringMaxLength) { - safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength + if (self.followRedirects || self.followAllRedirects) { + self.redirects = self.redirects || [] + } + if (options.removeRefererHeader !== undefined) { + self.removeRefererHeader = options.removeRefererHeader + } + if (options.followOriginalHttpMethod !== undefined) { + self.followOriginalHttpMethod = options.followOriginalHttpMethod } } -module.exports = safer - - -/***/ }), - -/***/ 603: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2018 Joyent, Inc. - -module.exports = { - read: read, - readPkcs8: readPkcs8, - write: write, - writePkcs8: writePkcs8, - pkcs8ToBuffer: pkcs8ToBuffer, - - readECDSACurve: readECDSACurve, - writeECDSACurve: writeECDSACurve -}; - -var assert = __webpack_require__(976); -var asn1 = __webpack_require__(856); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var pem = __webpack_require__(207); - -function read(buf, options) { - return (pem.read(buf, options, 'pkcs8')); -} - -function write(key, options) { - return (pem.write(key, options, 'pkcs8')); -} - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function readPkcs8(alg, type, der) { - /* Private keys in pkcs#8 format have a weird extra int */ - if (der.peek() === asn1.Ber.Integer) { - assert.strictEqual(type, 'private', - 'unexpected Integer at start of public key'); - der.readString(asn1.Ber.Integer, true); - } - - der.readSequence(); - var next = der.offset + der.length; - - var oid = der.readOID(); - switch (oid) { - case '1.2.840.113549.1.1.1': - der._offset = next; - if (type === 'public') - return (readPkcs8RSAPublic(der)); - else - return (readPkcs8RSAPrivate(der)); - case '1.2.840.10040.4.1': - if (type === 'public') - return (readPkcs8DSAPublic(der)); - else - return (readPkcs8DSAPrivate(der)); - case '1.2.840.10045.2.1': - if (type === 'public') - return (readPkcs8ECDSAPublic(der)); - else - return (readPkcs8ECDSAPrivate(der)); - case '1.3.101.112': - if (type === 'public') { - return (readPkcs8EdDSAPublic(der)); - } else { - return (readPkcs8EdDSAPrivate(der)); - } - case '1.3.101.110': - if (type === 'public') { - return (readPkcs8X25519Public(der)); - } else { - return (readPkcs8X25519Private(der)); - } - default: - throw (new Error('Unknown key type OID ' + oid)); - } -} - -function readPkcs8RSAPublic(der) { - // bit string sequence - der.readSequence(asn1.Ber.BitString); - der.readByte(); - der.readSequence(); - - // modulus - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'exponent'); - - // now, make the key - var key = { - type: 'rsa', - source: der.originalInput, - parts: [ - { name: 'e', data: e }, - { name: 'n', data: n } - ] - }; - - return (new Key(key)); -} - -function readPkcs8RSAPrivate(der) { - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - - var ver = readMPInt(der, 'version'); - assert.equal(ver[0], 0x0, 'unknown RSA private key version'); - - // modulus then public exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'public exponent'); - var d = readMPInt(der, 'private exponent'); - var p = readMPInt(der, 'prime1'); - var q = readMPInt(der, 'prime2'); - var dmodp = readMPInt(der, 'exponent1'); - var dmodq = readMPInt(der, 'exponent2'); - var iqmp = readMPInt(der, 'iqmp'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'n', data: n }, - { name: 'e', data: e }, - { name: 'd', data: d }, - { name: 'iqmp', data: iqmp }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'dmodp', data: dmodp }, - { name: 'dmodq', data: dmodq } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8DSAPublic(der) { - der.readSequence(); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - // bit string sequence - der.readSequence(asn1.Ber.BitString); - der.readByte(); - - var y = readMPInt(der, 'y'); +Redirect.prototype.redirectTo = function (response) { + var self = this + var request = self.request - // now, make the key - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y } - ] - }; + var redirectTo = null + if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) { + var location = response.caseless.get('location') + request.debug('redirect', location) - return (new Key(key)); + if (self.followAllRedirects) { + redirectTo = location + } else if (self.followRedirects) { + switch (request.method) { + case 'PATCH': + case 'PUT': + case 'POST': + case 'DELETE': + // Do not follow redirects + break + default: + redirectTo = location + break + } + } + } else if (response.statusCode === 401) { + var authHeader = request._auth.onResponse(response) + if (authHeader) { + request.setHeader('authorization', authHeader) + redirectTo = request.uri + } + } + return redirectTo } -function readPkcs8DSAPrivate(der) { - der.readSequence(); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - der.readSequence(asn1.Ber.OctetString); - var x = readMPInt(der, 'x'); +Redirect.prototype.onResponse = function (response) { + var self = this + var request = self.request - /* The pkcs#8 format does not include the public key */ - var y = utils.calculateDSAPublic(g, p, x); + var redirectTo = self.redirectTo(response) + if (!redirectTo || !self.allowRedirect.call(request, response)) { + return false + } - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y }, - { name: 'x', data: x } - ] - }; + request.debug('redirect to', redirectTo) - return (new PrivateKey(key)); -} + // ignore any potential response body. it cannot possibly be useful + // to us at this point. + // response.resume should be defined, but check anyway before calling. Workaround for browserify. + if (response.resume) { + response.resume() + } -function readECDSACurve(der) { - var curveName, curveNames; - var j, c, cd; + if (self.redirectsFollowed >= self.maxRedirects) { + request.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + request.uri.href)) + return false + } + self.redirectsFollowed += 1 - if (der.peek() === asn1.Ber.OID) { - var oid = der.readOID(); + if (!isUrl.test(redirectTo)) { + redirectTo = url.resolve(request.uri.href, redirectTo) + } - curveNames = Object.keys(algs.curves); - for (j = 0; j < curveNames.length; ++j) { - c = curveNames[j]; - cd = algs.curves[c]; - if (cd.pkcs8oid === oid) { - curveName = c; - break; - } - } + var uriPrev = request.uri + request.uri = url.parse(redirectTo) - } else { - // ECParameters sequence - der.readSequence(); - var version = der.readString(asn1.Ber.Integer, true); - assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); + // handle the case where we change protocol from https to http or vice versa + if (request.uri.protocol !== uriPrev.protocol) { + delete request.agent + } - var curve = {}; + self.redirects.push({ statusCode: response.statusCode, redirectUri: redirectTo }) - // FieldID sequence - der.readSequence(); - var fieldTypeOid = der.readOID(); - assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', - 'ECDSA key is not from a prime-field'); - var p = curve.p = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - /* - * p always starts with a 1 bit, so count the zeros to get its - * real size. - */ - curve.size = p.length * 8 - utils.countZeros(p); + if (self.followAllRedirects && request.method !== 'HEAD' && + response.statusCode !== 401 && response.statusCode !== 307) { + request.method = self.followOriginalHttpMethod ? request.method : 'GET' + } + // request.method = 'GET' // Force all redirects to use GET || commented out fixes #215 + delete request.src + delete request.req + delete request._started + if (response.statusCode !== 401 && response.statusCode !== 307) { + // Remove parameters from the previous response, unless this is the second request + // for a server that requires digest authentication. + delete request.body + delete request._form + if (request.headers) { + request.removeHeader('host') + request.removeHeader('content-type') + request.removeHeader('content-length') + if (request.uri.hostname !== request.originalHost.split(':')[0]) { + // Remove authorization if changing hostnames (but not if just + // changing ports or protocols). This matches the behavior of curl: + // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710 + request.removeHeader('authorization') + } + } + } - // Curve sequence - der.readSequence(); - curve.a = utils.mpNormalize( - der.readString(asn1.Ber.OctetString, true)); - curve.b = utils.mpNormalize( - der.readString(asn1.Ber.OctetString, true)); - if (der.peek() === asn1.Ber.BitString) - curve.s = der.readString(asn1.Ber.BitString, true); + if (!self.removeRefererHeader) { + request.setHeader('referer', uriPrev.href) + } - // Combined Gx and Gy - curve.G = der.readString(asn1.Ber.OctetString, true); - assert.strictEqual(curve.G[0], 0x4, - 'uncompressed G is required'); + request.emit('redirect') - curve.n = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - curve.h = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + - 'required'); + request.init() - curveNames = Object.keys(algs.curves); - var ks = Object.keys(curve); - for (j = 0; j < curveNames.length; ++j) { - c = curveNames[j]; - cd = algs.curves[c]; - var equal = true; - for (var i = 0; i < ks.length; ++i) { - var k = ks[i]; - if (cd[k] === undefined) - continue; - if (typeof (cd[k]) === 'object' && - cd[k].equals !== undefined) { - if (!cd[k].equals(curve[k])) { - equal = false; - break; - } - } else if (Buffer.isBuffer(cd[k])) { - if (cd[k].toString('binary') - !== curve[k].toString('binary')) { - equal = false; - break; - } - } else { - if (cd[k] !== curve[k]) { - equal = false; - break; - } - } - } - if (equal) { - curveName = c; - break; - } - } - } - return (curveName); + return true } -function readPkcs8ECDSAPrivate(der) { - var curveName = readECDSACurve(der); - assert.string(curveName, 'a known elliptic curve'); +exports.Redirect = Redirect - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var version = readMPInt(der, 'version'); - assert.equal(version[0], 1, 'unknown version of ECDSA key'); +/***/ }), - var d = der.readString(asn1.Ber.OctetString, true); - var Q; +/***/ 554: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - if (der.peek() == 0xa0) { - der.readSequence(0xa0); - der._offset += der.length; - } - if (der.peek() == 0xa1) { - der.readSequence(0xa1); - Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - } +"use strict"; - if (Q === undefined) { - var pub = utils.publicFromPrivateECDSA(curveName, d); - Q = pub.part.Q.data; - } - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curveName) }, - { name: 'Q', data: Q }, - { name: 'd', data: d } - ] - }; +var caseless = __webpack_require__(254) +var uuid = __webpack_require__(826) +var helpers = __webpack_require__(810) - return (new PrivateKey(key)); +var md5 = helpers.md5 +var toBase64 = helpers.toBase64 + +function Auth (request) { + // define all public properties here + this.request = request + this.hasAuth = false + this.sentAuth = false + this.bearerToken = null + this.user = null + this.pass = null } -function readPkcs8ECDSAPublic(der) { - var curveName = readECDSACurve(der); - assert.string(curveName, 'a known elliptic curve'); +Auth.prototype.basic = function (user, pass, sendImmediately) { + var self = this + if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { + self.request.emit('error', new Error('auth() received invalid user or password')) + } + self.user = user + self.pass = pass + self.hasAuth = true + var header = user + ':' + (pass || '') + if (sendImmediately || typeof sendImmediately === 'undefined') { + var authHeader = 'Basic ' + toBase64(header) + self.sentAuth = true + return authHeader + } +} - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); +Auth.prototype.bearer = function (bearer, sendImmediately) { + var self = this + self.bearerToken = bearer + self.hasAuth = true + if (sendImmediately || typeof sendImmediately === 'undefined') { + if (typeof bearer === 'function') { + bearer = bearer() + } + var authHeader = 'Bearer ' + (bearer || '') + self.sentAuth = true + return authHeader + } +} - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curveName) }, - { name: 'Q', data: Q } - ] - }; +Auth.prototype.digest = function (method, path, authHeader) { + // TODO: More complete implementation of RFC 2617. + // - handle challenge.domain + // - support qop="auth-int" only + // - handle Authentication-Info (not necessarily?) + // - check challenge.stale (not necessarily?) + // - increase nc (not necessarily?) + // For reference: + // http://tools.ietf.org/html/rfc2617#section-3 + // https://github.com/bagder/curl/blob/master/lib/http_digest.c - return (new Key(key)); -} + var self = this -function readPkcs8EdDSAPublic(der) { - if (der.peek() === 0x00) - der.readByte(); + var challenge = {} + var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi + for (;;) { + var match = re.exec(authHeader) + if (!match) { + break + } + challenge[match[1]] = match[2] || match[3] + } - var A = utils.readBitString(der); + /** + * RFC 2617: handle both MD5 and MD5-sess algorithms. + * + * If the algorithm directive's value is "MD5" or unspecified, then HA1 is + * HA1=MD5(username:realm:password) + * If the algorithm directive's value is "MD5-sess", then HA1 is + * HA1=MD5(MD5(username:realm:password):nonce:cnonce) + */ + var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { + var ha1 = md5(user + ':' + realm + ':' + pass) + if (algorithm && algorithm.toLowerCase() === 'md5-sess') { + return md5(ha1 + ':' + nonce + ':' + cnonce) + } else { + return ha1 + } + } - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) } - ] - }; + var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' + var nc = qop && '00000001' + var cnonce = qop && uuid().replace(/-/g, '') + var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) + var ha2 = md5(method + ':' + path) + var digestResponse = qop + ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) + : md5(ha1 + ':' + challenge.nonce + ':' + ha2) + var authValues = { + username: self.user, + realm: challenge.realm, + nonce: challenge.nonce, + uri: path, + qop: qop, + response: digestResponse, + nc: nc, + cnonce: cnonce, + algorithm: challenge.algorithm, + opaque: challenge.opaque + } - return (new Key(key)); + authHeader = [] + for (var k in authValues) { + if (authValues[k]) { + if (k === 'qop' || k === 'nc' || k === 'algorithm') { + authHeader.push(k + '=' + authValues[k]) + } else { + authHeader.push(k + '="' + authValues[k] + '"') + } + } + } + authHeader = 'Digest ' + authHeader.join(', ') + self.sentAuth = true + return authHeader } -function readPkcs8X25519Public(der) { - var A = utils.readBitString(der); - - var key = { - type: 'curve25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) } - ] - }; +Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { + var self = this + var request = self.request - return (new Key(key)); + var authHeader + if (bearer === undefined && user === undefined) { + self.request.emit('error', new Error('no auth mechanism defined')) + } else if (bearer !== undefined) { + authHeader = self.bearer(bearer, sendImmediately) + } else { + authHeader = self.basic(user, pass, sendImmediately) + } + if (authHeader) { + request.setHeader('authorization', authHeader) + } } -function readPkcs8EdDSAPrivate(der) { - if (der.peek() === 0x00) - der.readByte(); +Auth.prototype.onResponse = function (response) { + var self = this + var request = self.request - der.readSequence(asn1.Ber.OctetString); - var k = der.readString(asn1.Ber.OctetString, true); - k = utils.zeroPadToLength(k, 32); + if (!self.hasAuth || self.sentAuth) { return null } - var A; - if (der.peek() === asn1.Ber.BitString) { - A = utils.readBitString(der); - A = utils.zeroPadToLength(A, 32); - } else { - A = utils.calculateED25519Public(k); - } + var c = caseless(response.headers) - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: utils.zeroPadToLength(k, 32) } - ] - }; + var authHeader = c.get('www-authenticate') + var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() + request.debug('reauth', authVerb) - return (new PrivateKey(key)); + switch (authVerb) { + case 'basic': + return self.basic(self.user, self.pass, true) + + case 'bearer': + return self.bearer(self.bearerToken, true) + + case 'digest': + return self.digest(request.method, request.path, authHeader) + } } -function readPkcs8X25519Private(der) { - if (der.peek() === 0x00) - der.readByte(); +exports.Auth = Auth - der.readSequence(asn1.Ber.OctetString); - var k = der.readString(asn1.Ber.OctetString, true); - k = utils.zeroPadToLength(k, 32); - var A = utils.calculateX25519Public(k); +/***/ }), - var key = { - type: 'curve25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: utils.zeroPadToLength(k, 32) } - ] - }; +/***/ 560: +/***/ (function(module) { - return (new PrivateKey(key)); -} +"use strict"; -function pkcs8ToBuffer(key) { - var der = new asn1.BerWriter(); - writePkcs8(der, key); - return (der.buffer); +module.exports = function generate__limitProperties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $op = $keyword == 'maxProperties' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have '; + if ($keyword == 'maxProperties') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' properties\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; } -function writePkcs8(der, key) { - der.startSequence(); - if (PrivateKey.isPrivateKey(key)) { - var sillyInt = Buffer.from([0]); - der.writeBuffer(sillyInt, asn1.Ber.Integer); - } +/***/ }), - der.startSequence(); - switch (key.type) { - case 'rsa': - der.writeOID('1.2.840.113549.1.1.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8RSAPrivate(key, der); - else - writePkcs8RSAPublic(key, der); - break; - case 'dsa': - der.writeOID('1.2.840.10040.4.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8DSAPrivate(key, der); - else - writePkcs8DSAPublic(key, der); - break; - case 'ecdsa': - der.writeOID('1.2.840.10045.2.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8ECDSAPrivate(key, der); - else - writePkcs8ECDSAPublic(key, der); - break; - case 'ed25519': - der.writeOID('1.3.101.112'); - if (PrivateKey.isPrivateKey(key)) - throw (new Error('Ed25519 private keys in pkcs8 ' + - 'format are not supported')); - writePkcs8EdDSAPublic(key, der); - break; - default: - throw (new Error('Unsupported key type: ' + key.type)); - } +/***/ 566: +/***/ (function(module) { + +// API +module.exports = abort; + +/** + * Aborts leftover active jobs + * + * @param {object} state - current state object + */ +function abort(state) +{ + Object.keys(state.jobs).forEach(clean.bind(state)); - der.endSequence(); + // reset leftover jobs + state.jobs = {}; } -function writePkcs8RSAPrivate(key, der) { - der.writeNull(); - der.endSequence(); +/** + * Cleans up leftover job by invoking abort function for the provided job id + * + * @this state + * @param {string|number} key - job id to abort + */ +function clean(key) +{ + if (typeof this.jobs[key] == 'function') + { + this.jobs[key](); + } +} - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - var version = Buffer.from([0]); - der.writeBuffer(version, asn1.Ber.Integer); +/***/ }), - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.writeBuffer(key.part.d.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - if (!key.part.dmodp || !key.part.dmodq) - utils.addRSAMissing(key); - der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); - der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); - der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); +/***/ 575: +/***/ (function(module, __unusedexports, __webpack_require__) { - der.endSequence(); - der.endSequence(); -} +// Copyright 2015 Joyent, Inc. -function writePkcs8RSAPublic(key, der) { - der.writeNull(); - der.endSequence(); +module.exports = Signature; - der.startSequence(asn1.Ber.BitString); - der.writeByte(0x00); +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var errs = __webpack_require__(753); +var utils = __webpack_require__(270); +var asn1 = __webpack_require__(62); +var SSHBuffer = __webpack_require__(940); - der.startSequence(); - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.endSequence(); +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var SignatureParseError = errs.SignatureParseError; - der.endSequence(); +function Signature(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.hashAlgorithm = opts.hashAlgo; + this.curve = opts.curve; + this.parts = opts.parts; + this.part = partLookup; } -function writePkcs8DSAPrivate(key, der) { - der.startSequence(); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.endSequence(); +Signature.prototype.toBuffer = function (format) { + if (format === undefined) + format = 'asn1'; + assert.string(format, 'format'); - der.endSequence(); + var buf; + var stype = 'ssh-' + this.type; - der.startSequence(asn1.Ber.OctetString); - der.writeBuffer(key.part.x.data, asn1.Ber.Integer); - der.endSequence(); -} + switch (this.type) { + case 'rsa': + switch (this.hashAlgorithm) { + case 'sha256': + stype = 'rsa-sha2-256'; + break; + case 'sha512': + stype = 'rsa-sha2-512'; + break; + case 'sha1': + case undefined: + break; + default: + throw (new Error('SSH signature ' + + 'format does not support hash ' + + 'algorithm ' + this.hashAlgorithm)); + } + if (format === 'ssh') { + buf = new SSHBuffer({}); + buf.writeString(stype); + buf.writePart(this.part.sig); + return (buf.toBuffer()); + } else { + return (this.part.sig.data); + } + break; -function writePkcs8DSAPublic(key, der) { - der.startSequence(); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.endSequence(); - der.endSequence(); + case 'ed25519': + if (format === 'ssh') { + buf = new SSHBuffer({}); + buf.writeString(stype); + buf.writePart(this.part.sig); + return (buf.toBuffer()); + } else { + return (this.part.sig.data); + } + break; - der.startSequence(asn1.Ber.BitString); - der.writeByte(0x00); - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.endSequence(); -} + case 'dsa': + case 'ecdsa': + var r, s; + if (format === 'asn1') { + var der = new asn1.BerWriter(); + der.startSequence(); + r = utils.mpNormalize(this.part.r.data); + s = utils.mpNormalize(this.part.s.data); + der.writeBuffer(r, asn1.Ber.Integer); + der.writeBuffer(s, asn1.Ber.Integer); + der.endSequence(); + return (der.buffer); + } else if (format === 'ssh' && this.type === 'dsa') { + buf = new SSHBuffer({}); + buf.writeString('ssh-dss'); + r = this.part.r.data; + if (r.length > 20 && r[0] === 0x00) + r = r.slice(1); + s = this.part.s.data; + if (s.length > 20 && s[0] === 0x00) + s = s.slice(1); + if ((this.hashAlgorithm && + this.hashAlgorithm !== 'sha1') || + r.length + s.length !== 40) { + throw (new Error('OpenSSH only supports ' + + 'DSA signatures with SHA1 hash')); + } + buf.writeBuffer(Buffer.concat([r, s])); + return (buf.toBuffer()); + } else if (format === 'ssh' && this.type === 'ecdsa') { + var inner = new SSHBuffer({}); + r = this.part.r.data; + inner.writeBuffer(r); + inner.writePart(this.part.s); -function writeECDSACurve(key, der) { - var curve = algs.curves[key.curve]; - if (curve.pkcs8oid) { - /* This one has a name in pkcs#8, so just write the oid */ - der.writeOID(curve.pkcs8oid); + buf = new SSHBuffer({}); + /* XXX: find a more proper way to do this? */ + var curve; + if (r[0] === 0x00) + r = r.slice(1); + var sz = r.length * 8; + if (sz === 256) + curve = 'nistp256'; + else if (sz === 384) + curve = 'nistp384'; + else if (sz === 528) + curve = 'nistp521'; + buf.writeString('ecdsa-sha2-' + curve); + buf.writeBuffer(inner.toBuffer()); + return (buf.toBuffer()); + } + throw (new Error('Invalid signature format')); + default: + throw (new Error('Invalid signature data')); + } +}; - } else { - // ECParameters sequence - der.startSequence(); +Signature.prototype.toString = function (format) { + assert.optionalString(format, 'format'); + return (this.toBuffer(format).toString('base64')); +}; - var version = Buffer.from([1]); - der.writeBuffer(version, asn1.Ber.Integer); +Signature.parse = function (data, type, format) { + if (typeof (data) === 'string') + data = Buffer.from(data, 'base64'); + assert.buffer(data, 'data'); + assert.string(format, 'format'); + assert.string(type, 'type'); - // FieldID sequence - der.startSequence(); - der.writeOID('1.2.840.10045.1.1'); // prime-field - der.writeBuffer(curve.p, asn1.Ber.Integer); - der.endSequence(); + var opts = {}; + opts.type = type.toLowerCase(); + opts.parts = []; - // Curve sequence - der.startSequence(); - var a = curve.p; - if (a[0] === 0x0) - a = a.slice(1); - der.writeBuffer(a, asn1.Ber.OctetString); - der.writeBuffer(curve.b, asn1.Ber.OctetString); - der.writeBuffer(curve.s, asn1.Ber.BitString); - der.endSequence(); + try { + assert.ok(data.length > 0, 'signature must not be empty'); + switch (opts.type) { + case 'rsa': + return (parseOneNum(data, type, format, opts)); + case 'ed25519': + return (parseOneNum(data, type, format, opts)); - der.writeBuffer(curve.G, asn1.Ber.OctetString); - der.writeBuffer(curve.n, asn1.Ber.Integer); - var h = curve.h; - if (!h) { - h = Buffer.from([1]); + case 'dsa': + case 'ecdsa': + if (format === 'asn1') + return (parseDSAasn1(data, type, format, opts)); + else if (opts.type === 'dsa') + return (parseDSA(data, type, format, opts)); + else + return (parseECDSA(data, type, format, opts)); + + default: + throw (new InvalidAlgorithmError(type)); } - der.writeBuffer(h, asn1.Ber.Integer); - // ECParameters - der.endSequence(); + } catch (e) { + if (e instanceof InvalidAlgorithmError) + throw (e); + throw (new SignatureParseError(type, format, e)); + } +}; + +function parseOneNum(data, type, format, opts) { + if (format === 'ssh') { + try { + var buf = new SSHBuffer({buffer: data}); + var head = buf.readString(); + } catch (e) { + /* fall through */ + } + if (buf !== undefined) { + var msg = 'SSH signature does not match expected ' + + 'type (expected ' + type + ', got ' + head + ')'; + switch (head) { + case 'ssh-rsa': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha1'; + break; + case 'rsa-sha2-256': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha256'; + break; + case 'rsa-sha2-512': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha512'; + break; + case 'ssh-ed25519': + assert.strictEqual(type, 'ed25519', msg); + opts.hashAlgo = 'sha512'; + break; + default: + throw (new Error('Unknown SSH signature ' + + 'type: ' + head)); + } + var sig = buf.readPart(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + sig.name = 'sig'; + opts.parts.push(sig); + return (new Signature(opts)); + } } + opts.parts.push({name: 'sig', data: data}); + return (new Signature(opts)); } -function writePkcs8ECDSAPublic(key, der) { - writeECDSACurve(key, der); - der.endSequence(); +function parseDSAasn1(data, type, format, opts) { + var der = new asn1.BerReader(data); + der.readSequence(); + var r = der.readString(asn1.Ber.Integer, true); + var s = der.readString(asn1.Ber.Integer, true); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); + opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); + opts.parts.push({name: 's', data: utils.mpNormalize(s)}); + + return (new Signature(opts)); } -function writePkcs8ECDSAPrivate(key, der) { - writeECDSACurve(key, der); - der.endSequence(); +function parseDSA(data, type, format, opts) { + if (data.length != 40) { + var buf = new SSHBuffer({buffer: data}); + var d = buf.readBuffer(); + if (d.toString('ascii') === 'ssh-dss') + d = buf.readBuffer(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + assert.strictEqual(d.length, 40, 'invalid inner length'); + data = d; + } + opts.parts.push({name: 'r', data: data.slice(0, 20)}); + opts.parts.push({name: 's', data: data.slice(20, 40)}); + return (new Signature(opts)); +} - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); +function parseECDSA(data, type, format, opts) { + var buf = new SSHBuffer({buffer: data}); - var version = Buffer.from([1]); - der.writeBuffer(version, asn1.Ber.Integer); + var r, s; + var inner = buf.readBuffer(); + var stype = inner.toString('ascii'); + if (stype.slice(0, 6) === 'ecdsa-') { + var parts = stype.split('-'); + assert.strictEqual(parts[0], 'ecdsa'); + assert.strictEqual(parts[1], 'sha2'); + opts.curve = parts[2]; + switch (opts.curve) { + case 'nistp256': + opts.hashAlgo = 'sha256'; + break; + case 'nistp384': + opts.hashAlgo = 'sha384'; + break; + case 'nistp521': + opts.hashAlgo = 'sha512'; + break; + default: + throw (new Error('Unsupported ECDSA curve: ' + + opts.curve)); + } + inner = buf.readBuffer(); + assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); + buf = new SSHBuffer({buffer: inner}); + r = buf.readPart(); + } else { + r = {data: inner}; + } - der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); + s = buf.readPart(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); - der.startSequence(0xa1); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); - der.endSequence(); + r.name = 'r'; + s.name = 's'; - der.endSequence(); - der.endSequence(); + opts.parts.push(r); + opts.parts.push(s); + return (new Signature(opts)); } -function writePkcs8EdDSAPublic(key, der) { - der.endSequence(); - - utils.writeBitString(der, key.part.A.data); -} +Signature.isSignature = function (obj, ver) { + return (utils.isCompatible(obj, Signature, ver)); +}; -function writePkcs8EdDSAPrivate(key, der) { - der.endSequence(); +/* + * API versions for Signature: + * [1,0] -- initial ver + * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent + * hashAlgorithm property + * [2,1] -- first tagged version + */ +Signature.prototype._sshpkApiVersion = [2, 1]; - var k = utils.mpNormalize(key.part.k.data, true); - der.startSequence(asn1.Ber.OctetString); - der.writeBuffer(k, asn1.Ber.OctetString); - der.endSequence(); -} +Signature._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + if (obj.hasOwnProperty('hashAlgorithm')) + return ([2, 0]); + return ([1, 0]); +}; /***/ }), -/***/ 605: +/***/ 581: /***/ (function(module) { -module.exports = require("http"); +"use strict"; -/***/ }), -/***/ 606: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +var has = Object.prototype.hasOwnProperty; -"use strict"; +var hexTable = (function () { + var array = []; + for (var i = 0; i < 256; ++i) { + array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); + } + return array; +}()); -var url = __webpack_require__(835) -var isUrl = /^https?:/ +var compactQueue = function compactQueue(queue) { + var obj; -function Redirect (request) { - this.request = request - this.followRedirect = true - this.followRedirects = true - this.followAllRedirects = false - this.followOriginalHttpMethod = false - this.allowRedirect = function () { return true } - this.maxRedirects = 10 - this.redirects = [] - this.redirectsFollowed = 0 - this.removeRefererHeader = false -} + while (queue.length) { + var item = queue.pop(); + obj = item.obj[item.prop]; -Redirect.prototype.onRequest = function (options) { - var self = this + if (Array.isArray(obj)) { + var compacted = []; - if (options.maxRedirects !== undefined) { - self.maxRedirects = options.maxRedirects - } - if (typeof options.followRedirect === 'function') { - self.allowRedirect = options.followRedirect - } - if (options.followRedirect !== undefined) { - self.followRedirects = !!options.followRedirect - } - if (options.followAllRedirects !== undefined) { - self.followAllRedirects = options.followAllRedirects - } - if (self.followRedirects || self.followAllRedirects) { - self.redirects = self.redirects || [] - } - if (options.removeRefererHeader !== undefined) { - self.removeRefererHeader = options.removeRefererHeader - } - if (options.followOriginalHttpMethod !== undefined) { - self.followOriginalHttpMethod = options.followOriginalHttpMethod - } -} + for (var j = 0; j < obj.length; ++j) { + if (typeof obj[j] !== 'undefined') { + compacted.push(obj[j]); + } + } + + item.obj[item.prop] = compacted; + } + } + + return obj; +}; + +var arrayToObject = function arrayToObject(source, options) { + var obj = options && options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +var merge = function merge(target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (Array.isArray(target)) { + target.push(source); + } else if (typeof target === 'object') { + if (options.plainObjects || options.allowPrototypes || !has.call(Object.prototype, source)) { + target[source] = true; + } + } else { + return [target, source]; + } -Redirect.prototype.redirectTo = function (response) { - var self = this - var request = self.request + return target; + } - var redirectTo = null - if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) { - var location = response.caseless.get('location') - request.debug('redirect', location) + if (typeof target !== 'object') { + return [target].concat(source); + } - if (self.followAllRedirects) { - redirectTo = location - } else if (self.followRedirects) { - switch (request.method) { - case 'PATCH': - case 'PUT': - case 'POST': - case 'DELETE': - // Do not follow redirects - break - default: - redirectTo = location - break - } + var mergeTarget = target; + if (Array.isArray(target) && !Array.isArray(source)) { + mergeTarget = arrayToObject(target, options); } - } else if (response.statusCode === 401) { - var authHeader = request._auth.onResponse(response) - if (authHeader) { - request.setHeader('authorization', authHeader) - redirectTo = request.uri + + if (Array.isArray(target) && Array.isArray(source)) { + source.forEach(function (item, i) { + if (has.call(target, i)) { + if (target[i] && typeof target[i] === 'object') { + target[i] = merge(target[i], item, options); + } else { + target.push(item); + } + } else { + target[i] = item; + } + }); + return target; } - } - return redirectTo -} -Redirect.prototype.onResponse = function (response) { - var self = this - var request = self.request + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; - var redirectTo = self.redirectTo(response) - if (!redirectTo || !self.allowRedirect.call(request, response)) { - return false - } + if (has.call(acc, key)) { + acc[key] = merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; - request.debug('redirect to', redirectTo) +var assign = function assignSingleSource(target, source) { + return Object.keys(source).reduce(function (acc, key) { + acc[key] = source[key]; + return acc; + }, target); +}; - // ignore any potential response body. it cannot possibly be useful - // to us at this point. - // response.resume should be defined, but check anyway before calling. Workaround for browserify. - if (response.resume) { - response.resume() - } +var decode = function (str) { + try { + return decodeURIComponent(str.replace(/\+/g, ' ')); + } catch (e) { + return str; + } +}; - if (self.redirectsFollowed >= self.maxRedirects) { - request.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + request.uri.href)) - return false - } - self.redirectsFollowed += 1 +var encode = function encode(str) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } - if (!isUrl.test(redirectTo)) { - redirectTo = url.resolve(request.uri.href, redirectTo) - } + var string = typeof str === 'string' ? str : String(str); - var uriPrev = request.uri - request.uri = url.parse(redirectTo) + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); - // handle the case where we change protocol from https to http or vice versa - if (request.uri.protocol !== uriPrev.protocol) { - delete request.agent - } + if ( + c === 0x2D // - + || c === 0x2E // . + || c === 0x5F // _ + || c === 0x7E // ~ + || (c >= 0x30 && c <= 0x39) // 0-9 + || (c >= 0x41 && c <= 0x5A) // a-z + || (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } - self.redirects.push({ statusCode: response.statusCode, redirectUri: redirectTo }) + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } - if (self.followAllRedirects && request.method !== 'HEAD' && - response.statusCode !== 401 && response.statusCode !== 307) { - request.method = self.followOriginalHttpMethod ? request.method : 'GET' - } - // request.method = 'GET' // Force all redirects to use GET || commented out fixes #215 - delete request.src - delete request.req - delete request._started - if (response.statusCode !== 401 && response.statusCode !== 307) { - // Remove parameters from the previous response, unless this is the second request - // for a server that requires digest authentication. - delete request.body - delete request._form - if (request.headers) { - request.removeHeader('host') - request.removeHeader('content-type') - request.removeHeader('content-length') - if (request.uri.hostname !== request.originalHost.split(':')[0]) { - // Remove authorization if changing hostnames (but not if just - // changing ports or protocols). This matches the behavior of curl: - // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710 - request.removeHeader('authorization') - } - } - } + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } - if (!self.removeRefererHeader) { - request.setHeader('referer', uriPrev.href) - } + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } - request.emit('redirect') + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + + hexTable[0x80 | ((c >> 12) & 0x3F)] + + hexTable[0x80 | ((c >> 6) & 0x3F)] + + hexTable[0x80 | (c & 0x3F)]; + } - request.init() + return out; +}; - return true -} +var compact = function compact(value) { + var queue = [{ obj: { o: value }, prop: 'o' }]; + var refs = []; -exports.Redirect = Redirect + for (var i = 0; i < queue.length; ++i) { + var item = queue[i]; + var obj = item.obj[item.prop]; + var keys = Object.keys(obj); + for (var j = 0; j < keys.length; ++j) { + var key = keys[j]; + var val = obj[key]; + if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { + queue.push({ obj: obj, prop: key }); + refs.push(val); + } + } + } -/***/ }), + return compactQueue(queue); +}; -/***/ 607: -/***/ (function(module) { +var isRegExp = function isRegExp(obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; -/** - * Convert array of 16 byte values to UUID string format of the form: - * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX - */ -var byteToHex = []; -for (var i = 0; i < 256; ++i) { - byteToHex[i] = (i + 0x100).toString(16).substr(1); -} +var isBuffer = function isBuffer(obj) { + if (obj === null || typeof obj === 'undefined') { + return false; + } -function bytesToUuid(buf, offset) { - var i = offset || 0; - var bth = byteToHex; - // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 - return ([bth[buf[i++]], bth[buf[i++]], - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], - bth[buf[i++]], bth[buf[i++]], - bth[buf[i++]], bth[buf[i++]]]).join(''); -} + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; -module.exports = bytesToUuid; +module.exports = { + arrayToObject: arrayToObject, + assign: assign, + compact: compact, + decode: decode, + encode: encode, + isBuffer: isBuffer, + isRegExp: isRegExp, + merge: merge +}; /***/ }), -/***/ 611: +/***/ 584: /***/ (function(module) { -// populates missing values -module.exports = function(dst, src) { +// Copyright 2011 Mark Cavage All rights reserved. - Object.keys(src).forEach(function(prop) - { - dst[prop] = dst[prop] || src[prop]; - }); - return dst; -}; +module.exports = { + newInvalidAsn1Error: function (msg) { + var e = new Error(); + e.name = 'InvalidAsn1Error'; + e.message = msg || ''; + return e; + } -/***/ }), +}; -/***/ 612: -/***/ (function(module, exports, __webpack_require__) { -/* eslint-disable node/no-deprecated-api */ -var buffer = __webpack_require__(407) -var Buffer = buffer.Buffer +/***/ }), -// alternative to using Object.keys for old browsers -function copyProps (src, dst) { - for (var key in src) { - dst[key] = src[key] - } -} -if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { - module.exports = buffer -} else { - // Copy properties from require('buffer') - copyProps(buffer, exports) - exports.Buffer = SafeBuffer -} +/***/ 602: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -function SafeBuffer (arg, encodingOrOffset, length) { - return Buffer(arg, encodingOrOffset, length) -} +"use strict"; -SafeBuffer.prototype = Object.create(Buffer.prototype) -// Copy static methods from Buffer -copyProps(Buffer, SafeBuffer) +var tough = __webpack_require__(701) -SafeBuffer.from = function (arg, encodingOrOffset, length) { - if (typeof arg === 'number') { - throw new TypeError('Argument must not be a number') - } - return Buffer(arg, encodingOrOffset, length) -} +var Cookie = tough.Cookie +var CookieJar = tough.CookieJar -SafeBuffer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') +exports.parse = function (str) { + if (str && str.uri) { + str = str.uri } - var buf = Buffer(size) - if (fill !== undefined) { - if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - } else { - buf.fill(0) + if (typeof str !== 'string') { + throw new Error('The cookie function only accepts STRING as param') } - return buf + return Cookie.parse(str, {loose: true}) } -SafeBuffer.allocUnsafe = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return Buffer(size) +// Adapt the sometimes-Async api of tough.CookieJar to our requirements +function RequestJar (store) { + var self = this + self._jar = new CookieJar(store, {looseMode: true}) } - -SafeBuffer.allocUnsafeSlow = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return buffer.SlowBuffer(size) +RequestJar.prototype.setCookie = function (cookieOrStr, uri, options) { + var self = this + return self._jar.setCookieSync(cookieOrStr, uri, options || {}) +} +RequestJar.prototype.getCookieString = function (uri) { + var self = this + return self._jar.getCookieStringSync(uri) +} +RequestJar.prototype.getCookies = function (uri) { + var self = this + return self._jar.getCookiesSync(uri) } +exports.jar = function (store) { + return new RequestJar(store) +} -/***/ }), - -/***/ 614: -/***/ (function(module) { - -module.exports = require("events"); /***/ }), -/***/ 616: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var fs = __webpack_require__(747) -var qs = __webpack_require__(191) -var validate = __webpack_require__(153) -var extend = __webpack_require__(26) +/***/ 603: +/***/ (function(module, __unusedexports, __webpack_require__) { -function Har (request) { - this.request = request -} +// Copyright 2015 Joyent, Inc. -Har.prototype.reducer = function (obj, pair) { - // new property ? - if (obj[pair.name] === undefined) { - obj[pair.name] = pair.value - return obj - } +module.exports = { + read: read, + write: write +}; - // existing? convert to array - var arr = [ - obj[pair.name], - pair.value - ] +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var rfc4253 = __webpack_require__(538); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); - obj[pair.name] = arr +var sshpriv = __webpack_require__(78); - return obj -} +/*JSSTYLED*/ +var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/; +/*JSSTYLED*/ +var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/; -Har.prototype.prep = function (data) { - // construct utility properties - data.queryObj = {} - data.headersObj = {} - data.postData.jsonObj = false - data.postData.paramsObj = false +function read(buf, options) { + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } - // construct query objects - if (data.queryString && data.queryString.length) { - data.queryObj = data.queryString.reduce(this.reducer, {}) - } + var trimmed = buf.trim().replace(/[\\\r]/g, ''); + var m = trimmed.match(SSHKEY_RE); + if (!m) + m = trimmed.match(SSHKEY_RE2); + assert.ok(m, 'key must match regex'); - // construct headers objects - if (data.headers && data.headers.length) { - // loweCase header keys - data.headersObj = data.headers.reduceRight(function (headers, header) { - headers[header.name] = header.value - return headers - }, {}) - } + var type = rfc4253.algToKeyType(m[1]); + var kbuf = Buffer.from(m[2], 'base64'); - // construct Cookie header - if (data.cookies && data.cookies.length) { - var cookies = data.cookies.map(function (cookie) { - return cookie.name + '=' + cookie.value - }) + /* + * This is a bit tricky. If we managed to parse the key and locate the + * key comment with the regex, then do a non-partial read and assert + * that we have consumed all bytes. If we couldn't locate the key + * comment, though, there may be whitespace shenanigans going on that + * have conjoined the comment to the rest of the key. We do a partial + * read in this case to try to make the best out of a sorry situation. + */ + var key; + var ret = {}; + if (m[4]) { + try { + key = rfc4253.read(kbuf); - if (cookies.length) { - data.headersObj.cookie = cookies.join('; ') - } - } + } catch (e) { + m = trimmed.match(SSHKEY_RE2); + assert.ok(m, 'key must match regex'); + kbuf = Buffer.from(m[2], 'base64'); + key = rfc4253.readInternal(ret, 'public', kbuf); + } + } else { + key = rfc4253.readInternal(ret, 'public', kbuf); + } - // prep body - function some (arr) { - return arr.some(function (type) { - return data.postData.mimeType.indexOf(type) === 0 - }) - } + assert.strictEqual(type, key.type); - if (some([ - 'multipart/mixed', - 'multipart/related', - 'multipart/form-data', - 'multipart/alternative'])) { - // reset values - data.postData.mimeType = 'multipart/form-data' - } else if (some([ - 'application/x-www-form-urlencoded'])) { - if (!data.postData.params) { - data.postData.text = '' - } else { - data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) + if (m[4] && m[4].length > 0) { + key.comment = m[4]; - // always overwrite - data.postData.text = qs.stringify(data.postData.paramsObj) - } - } else if (some([ - 'text/json', - 'text/x-json', - 'application/json', - 'application/x-json'])) { - data.postData.mimeType = 'application/json' + } else if (ret.consumed) { + /* + * Now the magic: trying to recover the key comment when it's + * gotten conjoined to the key or otherwise shenanigan'd. + * + * Work out how much base64 we used, then drop all non-base64 + * chars from the beginning up to this point in the the string. + * Then offset in this and try to make up for missing = chars. + */ + var data = m[2] + (m[3] ? m[3] : ''); + var realOffset = Math.ceil(ret.consumed / 3) * 4; + data = data.slice(0, realOffset - 2). /*JSSTYLED*/ + replace(/[^a-zA-Z0-9+\/=]/g, '') + + data.slice(realOffset - 2); - if (data.postData.text) { - try { - data.postData.jsonObj = JSON.parse(data.postData.text) - } catch (e) { - this.request.debug(e) + var padding = ret.consumed % 3; + if (padding > 0 && + data.slice(realOffset - 1, realOffset) !== '=') + realOffset--; + while (data.slice(realOffset, realOffset + 1) === '=') + realOffset++; - // force back to text/plain - data.postData.mimeType = 'text/plain' - } - } - } + /* Finally, grab what we think is the comment & clean it up. */ + var trailer = data.slice(realOffset); + trailer = trailer.replace(/[\r\n]/g, ' '). + replace(/^\s+/, ''); + if (trailer.match(/^[a-zA-Z0-9]/)) + key.comment = trailer; + } - return data + return (key); } -Har.prototype.options = function (options) { - // skip if no har property defined - if (!options.har) { - return options - } +function write(key, options) { + assert.object(key); + if (!Key.isKey(key)) + throw (new Error('Must be a public key')); - var har = {} - extend(har, options.har) + var parts = []; + var alg = rfc4253.keyTypeToAlg(key); + parts.push(alg); - // only process the first entry - if (har.log && har.log.entries) { - har = har.log.entries[0] - } + var buf = rfc4253.write(key); + parts.push(buf.toString('base64')); - // add optional properties to make validation successful - har.url = har.url || options.url || options.uri || options.baseUrl || '/' - har.httpVersion = har.httpVersion || 'HTTP/1.1' - har.queryString = har.queryString || [] - har.headers = har.headers || [] - har.cookies = har.cookies || [] - har.postData = har.postData || {} - har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' + if (key.comment) + parts.push(key.comment); - har.bodySize = 0 - har.headersSize = 0 - har.postData.size = 0 + return (Buffer.from(parts.join(' '))); +} - if (!validate.request(har)) { - return options - } - // clean up and get some utility properties - var req = this.prep(har) +/***/ }), - // construct new options - if (req.url) { - options.url = req.url - } +/***/ 605: +/***/ (function(module) { - if (req.method) { - options.method = req.method - } +module.exports = require("http"); - if (Object.keys(req.queryObj).length) { - options.qs = req.queryObj - } +/***/ }), - if (Object.keys(req.headersObj).length) { - options.headers = req.headersObj - } +/***/ 614: +/***/ (function(module) { - function test (type) { - return req.postData.mimeType.indexOf(type) === 0 - } - if (test('application/x-www-form-urlencoded')) { - options.form = req.postData.paramsObj - } else if (test('application/json')) { - if (req.postData.jsonObj) { - options.body = req.postData.jsonObj - options.json = true - } - } else if (test('multipart/form-data')) { - options.formData = {} +module.exports = require("events"); - req.postData.params.forEach(function (param) { - var attachment = {} +/***/ }), - if (!param.fileName && !param.fileName && !param.contentType) { - options.formData[param.name] = param.value - return - } +/***/ 622: +/***/ (function(module) { - // attempt to read from disk! - if (param.fileName && !param.value) { - attachment.value = fs.createReadStream(param.fileName) - } else if (param.value) { - attachment.value = param.value - } +module.exports = require("path"); - if (param.fileName) { - attachment.options = { - filename: param.fileName, - contentType: param.contentType ? param.contentType : null - } - } +/***/ }), - options.formData[param.name] = attachment - }) - } else { - if (req.postData.text) { - options.body = req.postData.text - } - } +/***/ 624: +/***/ (function(module, __unusedexports, __webpack_require__) { - return options -} +// Copyright 2018 Joyent, Inc. -exports.Har = Har +module.exports = { + read: read, + write: write +}; +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var rfc4253 = __webpack_require__(538); +var Key = __webpack_require__(852); -/***/ }), +var errors = __webpack_require__(753); -/***/ 619: -/***/ (function(module) { +function read(buf, options) { + var lines = buf.toString('ascii').split(/[\r\n]+/); + var found = false; + var parts; + var si = 0; + while (si < lines.length) { + parts = splitHeader(lines[si++]); + if (parts && + parts[0].toLowerCase() === 'putty-user-key-file-2') { + found = true; + break; + } + } + if (!found) { + throw (new Error('No PuTTY format first line found')); + } + var alg = parts[1]; -module.exports = {"$id":"entry.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","time","request","response","cache","timings"],"properties":{"pageref":{"type":"string"},"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"time":{"type":"number","min":0},"request":{"$ref":"request.json#"},"response":{"$ref":"response.json#"},"cache":{"$ref":"cache.json#"},"timings":{"$ref":"timings.json#"},"serverIPAddress":{"type":"string","oneOf":[{"format":"ipv4"},{"format":"ipv6"}]},"connection":{"type":"string"},"comment":{"type":"string"}}}; + parts = splitHeader(lines[si++]); + assert.equal(parts[0].toLowerCase(), 'encryption'); -/***/ }), + parts = splitHeader(lines[si++]); + assert.equal(parts[0].toLowerCase(), 'comment'); + var comment = parts[1]; -/***/ 621: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + parts = splitHeader(lines[si++]); + assert.equal(parts[0].toLowerCase(), 'public-lines'); + var publicLines = parseInt(parts[1], 10); + if (!isFinite(publicLines) || publicLines < 0 || + publicLines > lines.length) { + throw (new Error('Invalid public-lines count')); + } -"use strict"; + var publicBuf = Buffer.from( + lines.slice(si, si + publicLines).join(''), 'base64'); + var keyType = rfc4253.algToKeyType(alg); + var key = rfc4253.read(publicBuf); + if (key.type !== keyType) { + throw (new Error('Outer key algorithm mismatch')); + } + key.comment = comment; + return (key); +} +function splitHeader(line) { + var idx = line.indexOf(':'); + if (idx === -1) + return (null); + var header = line.slice(0, idx); + ++idx; + while (line[idx] === ' ') + ++idx; + var rest = line.slice(idx); + return ([header, rest]); +} -var caseless = __webpack_require__(48) -var uuid = __webpack_require__(926) -var helpers = __webpack_require__(882) +function write(key, options) { + assert.object(key); + if (!Key.isKey(key)) + throw (new Error('Must be a public key')); -var md5 = helpers.md5 -var toBase64 = helpers.toBase64 + var alg = rfc4253.keyTypeToAlg(key); + var buf = rfc4253.write(key); + var comment = key.comment || ''; -function Auth (request) { - // define all public properties here - this.request = request - this.hasAuth = false - this.sentAuth = false - this.bearerToken = null - this.user = null - this.pass = null -} + var b64 = buf.toString('base64'); + var lines = wrap(b64, 64); -Auth.prototype.basic = function (user, pass, sendImmediately) { - var self = this - if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { - self.request.emit('error', new Error('auth() received invalid user or password')) - } - self.user = user - self.pass = pass - self.hasAuth = true - var header = user + ':' + (pass || '') - if (sendImmediately || typeof sendImmediately === 'undefined') { - var authHeader = 'Basic ' + toBase64(header) - self.sentAuth = true - return authHeader - } -} + lines.unshift('Public-Lines: ' + lines.length); + lines.unshift('Comment: ' + comment); + lines.unshift('Encryption: none'); + lines.unshift('PuTTY-User-Key-File-2: ' + alg); -Auth.prototype.bearer = function (bearer, sendImmediately) { - var self = this - self.bearerToken = bearer - self.hasAuth = true - if (sendImmediately || typeof sendImmediately === 'undefined') { - if (typeof bearer === 'function') { - bearer = bearer() - } - var authHeader = 'Bearer ' + (bearer || '') - self.sentAuth = true - return authHeader - } + return (Buffer.from(lines.join('\n') + '\n')); } -Auth.prototype.digest = function (method, path, authHeader) { - // TODO: More complete implementation of RFC 2617. - // - handle challenge.domain - // - support qop="auth-int" only - // - handle Authentication-Info (not necessarily?) - // - check challenge.stale (not necessarily?) - // - increase nc (not necessarily?) - // For reference: - // http://tools.ietf.org/html/rfc2617#section-3 - // https://github.com/bagder/curl/blob/master/lib/http_digest.c - - var self = this +function wrap(txt, len) { + var lines = []; + var pos = 0; + while (pos < txt.length) { + lines.push(txt.slice(pos, pos + 64)); + pos += 64; + } + return (lines); +} - var challenge = {} - var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi - for (;;) { - var match = re.exec(authHeader) - if (!match) { - break - } - challenge[match[1]] = match[2] || match[3] - } - /** - * RFC 2617: handle both MD5 and MD5-sess algorithms. - * - * If the algorithm directive's value is "MD5" or unspecified, then HA1 is - * HA1=MD5(username:realm:password) - * If the algorithm directive's value is "MD5-sess", then HA1 is - * HA1=MD5(MD5(username:realm:password):nonce:cnonce) - */ - var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { - var ha1 = md5(user + ':' + realm + ':' + pass) - if (algorithm && algorithm.toLowerCase() === 'md5-sess') { - return md5(ha1 + ':' + nonce + ':' + cnonce) - } else { - return ha1 - } - } +/***/ }), - var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' - var nc = qop && '00000001' - var cnonce = qop && uuid().replace(/-/g, '') - var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) - var ha2 = md5(method + ':' + path) - var digestResponse = qop - ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) - : md5(ha1 + ':' + challenge.nonce + ':' + ha2) - var authValues = { - username: self.user, - realm: challenge.realm, - nonce: challenge.nonce, - uri: path, - qop: qop, - response: digestResponse, - nc: nc, - cnonce: cnonce, - algorithm: challenge.algorithm, - opaque: challenge.opaque - } +/***/ 627: +/***/ (function(__unusedmodule, exports) { - authHeader = [] - for (var k in authValues) { - if (authValues[k]) { - if (k === 'qop' || k === 'nc' || k === 'algorithm') { - authHeader.push(k + '=' + authValues[k]) - } else { - authHeader.push(k + '="' + authValues[k] + '"') - } - } - } - authHeader = 'Digest ' + authHeader.join(', ') - self.sentAuth = true - return authHeader -} +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ -Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { - var self = this - var request = self.request +/*jshint unused:false */ - var authHeader - if (bearer === undefined && user === undefined) { - self.request.emit('error', new Error('no auth mechanism defined')) - } else if (bearer !== undefined) { - authHeader = self.bearer(bearer, sendImmediately) - } else { - authHeader = self.basic(user, pass, sendImmediately) - } - if (authHeader) { - request.setHeader('authorization', authHeader) - } +function Store() { } +exports.Store = Store; -Auth.prototype.onResponse = function (response) { - var self = this - var request = self.request +// Stores may be synchronous, but are still required to use a +// Continuation-Passing Style API. The CookieJar itself will expose a "*Sync" +// API that converts from synchronous-callbacks to imperative style. +Store.prototype.synchronous = false; - if (!self.hasAuth || self.sentAuth) { return null } +Store.prototype.findCookie = function(domain, path, key, cb) { + throw new Error('findCookie is not implemented'); +}; - var c = caseless(response.headers) +Store.prototype.findCookies = function(domain, path, cb) { + throw new Error('findCookies is not implemented'); +}; - var authHeader = c.get('www-authenticate') - var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() - request.debug('reauth', authVerb) +Store.prototype.putCookie = function(cookie, cb) { + throw new Error('putCookie is not implemented'); +}; - switch (authVerb) { - case 'basic': - return self.basic(self.user, self.pass, true) +Store.prototype.updateCookie = function(oldCookie, newCookie, cb) { + // recommended default implementation: + // return this.putCookie(newCookie, cb); + throw new Error('updateCookie is not implemented'); +}; - case 'bearer': - return self.bearer(self.bearerToken, true) +Store.prototype.removeCookie = function(domain, path, key, cb) { + throw new Error('removeCookie is not implemented'); +}; - case 'digest': - return self.digest(request.method, request.path, authHeader) - } -} +Store.prototype.removeCookies = function(domain, path, cb) { + throw new Error('removeCookies is not implemented'); +}; -exports.Auth = Auth +Store.prototype.getAllCookies = function(cb) { + throw new Error('getAllCookies is not implemented (therefore jar cannot be serialized)'); +}; /***/ }), -/***/ 622: +/***/ 628: /***/ (function(module) { -module.exports = require("path"); +"use strict"; -/***/ }), -/***/ 631: -/***/ (function(module) { +var KEYWORDS = [ + 'multipleOf', + 'maximum', + 'exclusiveMaximum', + 'minimum', + 'exclusiveMinimum', + 'maxLength', + 'minLength', + 'pattern', + 'additionalItems', + 'maxItems', + 'minItems', + 'uniqueItems', + 'maxProperties', + 'minProperties', + 'required', + 'additionalProperties', + 'enum', + 'format', + 'const' +]; -module.exports = require("net"); +module.exports = function (metaSchema, keywordsJsonPointers) { + for (var i=0; i 0) { - var thisPos = stack.indexOf(this) - ~thisPos ? stack.splice(thisPos + 1) : stack.push(this) - ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key) - if (~stack.indexOf(value)) value = cycleReplacer.call(this, key, value) - } - else stack.push(value) - return replacer == null ? value : replacer.call(this, key, value) - } +var qs = __webpack_require__(386) +var querystring = __webpack_require__(191) + +function Querystring (request) { + this.request = request + this.lib = null + this.useQuerystring = null + this.parseOptions = null + this.stringifyOptions = null } +Querystring.prototype.init = function (options) { + if (this.lib) { return } -/***/ }), + this.useQuerystring = options.useQuerystring + this.lib = (this.useQuerystring ? querystring : qs) -/***/ 646: -/***/ (function(module, __unusedexports, __webpack_require__) { + this.parseOptions = options.qsParseOptions || {} + this.stringifyOptions = options.qsStringifyOptions || {} +} -// Copyright 2016 Joyent, Inc. +Querystring.prototype.stringify = function (obj) { + return (this.useQuerystring) + ? this.rfc3986(this.lib.stringify(obj, + this.stringifyOptions.sep || null, + this.stringifyOptions.eq || null, + this.stringifyOptions)) + : this.lib.stringify(obj, this.stringifyOptions) +} -module.exports = Certificate; +Querystring.prototype.parse = function (str) { + return (this.useQuerystring) + ? this.lib.parse(str, + this.parseOptions.sep || null, + this.parseOptions.eq || null, + this.parseOptions) + : this.lib.parse(str, this.parseOptions) +} -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(98); -var Signature = __webpack_require__(437); -var errs = __webpack_require__(481); -var util = __webpack_require__(669); -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var Identity = __webpack_require__(183); +Querystring.prototype.rfc3986 = function (str) { + return str.replace(/[!'()*]/g, function (c) { + return '%' + c.charCodeAt(0).toString(16).toUpperCase() + }) +} -var formats = {}; -formats['openssh'] = __webpack_require__(387); -formats['x509'] = __webpack_require__(843); -formats['pem'] = __webpack_require__(858); +Querystring.prototype.unescape = querystring.unescape -var CertificateParseError = errs.CertificateParseError; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; +exports.Querystring = Querystring -function Certificate(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.subjects, 'options.subjects'); - utils.assertCompatible(opts.subjects[0], Identity, [1, 0], - 'options.subjects'); - utils.assertCompatible(opts.subjectKey, Key, [1, 0], - 'options.subjectKey'); - utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); - if (opts.issuerKey !== undefined) { - utils.assertCompatible(opts.issuerKey, Key, [1, 0], - 'options.issuerKey'); - } - assert.object(opts.signatures, 'options.signatures'); - assert.buffer(opts.serial, 'options.serial'); - assert.date(opts.validFrom, 'options.validFrom'); - assert.date(opts.validUntil, 'optons.validUntil'); - assert.optionalArrayOfString(opts.purposes, 'options.purposes'); +/***/ }), - this._hashCache = {}; +/***/ 631: +/***/ (function(module) { - this.subjects = opts.subjects; - this.issuer = opts.issuer; - this.subjectKey = opts.subjectKey; - this.issuerKey = opts.issuerKey; - this.signatures = opts.signatures; - this.serial = opts.serial; - this.validFrom = opts.validFrom; - this.validUntil = opts.validUntil; - this.purposes = opts.purposes; -} +module.exports = require("net"); -Certificate.formats = formats; +/***/ }), -Certificate.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'x509'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); +/***/ 641: +/***/ (function(module, __unusedexports, __webpack_require__) { - return (formats[format].write(this, options)); -}; +"use strict"; -Certificate.prototype.toString = function (format, options) { - if (format === undefined) - format = 'pem'; - return (this.toBuffer(format, options).toString()); -}; -Certificate.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'certificate', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; +var crypto_hash_sha512 = __webpack_require__(196).lowlevel.crypto_hash; -Certificate.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); +/* + * This file is a 1:1 port from the OpenBSD blowfish.c and bcrypt_pbkdf.c. As a + * result, it retains the original copyright and license. The two files are + * under slightly different (but compatible) licenses, and are here combined in + * one file. + * + * Credit for the actual porting work goes to: + * Devi Mandiri + */ - if (this._hashCache[algo]) - return (this._hashCache[algo]); +/* + * The Blowfish portions are under the following license: + * + * Blowfish block cipher for OpenBSD + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Implementation advice by David Mazieres . + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ - var hash = crypto.createHash(algo). - update(this.toBuffer('x509')).digest(); - this._hashCache[algo] = hash; - return (hash); -}; +/* + * The bcrypt_pbkdf portions are under the following license: + * + * Copyright (c) 2013 Ted Unangst + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ -Certificate.prototype.isExpired = function (when) { - if (when === undefined) - when = new Date(); - return (!((when.getTime() >= this.validFrom.getTime()) && - (when.getTime() < this.validUntil.getTime()))); -}; +/* + * Performance improvements (Javascript-specific): + * + * Copyright 2016, Joyent Inc + * Author: Alex Wilson + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ -Certificate.prototype.isSignedBy = function (issuerCert) { - utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); +// Ported from OpenBSD bcrypt_pbkdf.c v1.9 - if (!this.issuer.equals(issuerCert.subjects[0])) - return (false); - if (this.issuer.purposes && this.issuer.purposes.length > 0 && - this.issuer.purposes.indexOf('ca') === -1) { - return (false); - } +var BLF_J = 0; - return (this.isSignedByKey(issuerCert.subjectKey)); +var Blowfish = function() { + this.S = [ + new Uint32Array([ + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, + 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, + 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, + 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, + 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, + 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, + 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, + 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, + 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, + 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, + 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, + 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, + 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, + 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, + 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, + 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, + 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, + 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, + 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, + 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, + 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, + 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, + 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, + 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, + 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, + 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, + 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, + 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, + 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, + 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, + 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, + 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, + 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, + 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, + 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, + 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, + 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, + 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, + 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, + 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, + 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, + 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, + 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), + new Uint32Array([ + 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, + 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, + 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, + 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, + 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, + 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, + 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, + 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, + 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, + 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, + 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, + 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, + 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, + 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, + 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, + 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, + 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, + 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, + 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, + 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, + 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, + 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, + 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, + 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, + 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, + 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, + 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, + 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, + 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, + 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, + 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, + 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, + 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, + 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, + 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, + 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, + 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, + 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, + 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, + 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, + 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, + 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, + 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), + new Uint32Array([ + 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, + 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, + 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, + 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, + 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, + 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, + 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, + 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, + 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, + 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, + 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, + 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, + 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, + 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, + 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, + 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, + 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, + 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, + 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, + 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, + 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, + 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, + 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, + 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, + 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, + 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, + 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, + 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, + 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, + 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, + 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, + 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, + 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, + 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, + 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, + 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, + 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, + 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, + 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, + 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, + 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, + 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, + 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), + new Uint32Array([ + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, + 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, + 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, + 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, + 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, + 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, + 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, + 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, + 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, + 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, + 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, + 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, + 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, + 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, + 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, + 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, + 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, + 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, + 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, + 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, + 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, + 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, + 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, + 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, + 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, + 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, + 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, + 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, + 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, + 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, + 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, + 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, + 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, + 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, + 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, + 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, + 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, + 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, + 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, + 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, + 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, + 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, + 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) + ]; + this.P = new Uint32Array([ + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, + 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, + 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, + 0x9216d5d9, 0x8979fb1b]); }; -Certificate.prototype.getExtension = function (keyOrOid) { - assert.string(keyOrOid, 'keyOrOid'); - var ext = this.getExtensions().filter(function (maybeExt) { - if (maybeExt.format === 'x509') - return (maybeExt.oid === keyOrOid); - if (maybeExt.format === 'openssh') - return (maybeExt.name === keyOrOid); - return (false); - })[0]; - return (ext); +function F(S, x8, i) { + return (((S[0][x8[i+3]] + + S[1][x8[i+2]]) ^ + S[2][x8[i+1]]) + + S[3][x8[i]]); }; -Certificate.prototype.getExtensions = function () { - var exts = []; - var x509 = this.signatures.x509; - if (x509 && x509.extras && x509.extras.exts) { - x509.extras.exts.forEach(function (ext) { - ext.format = 'x509'; - exts.push(ext); - }); - } - var openssh = this.signatures.openssh; - if (openssh && openssh.exts) { - openssh.exts.forEach(function (ext) { - ext.format = 'openssh'; - exts.push(ext); - }); - } - return (exts); +Blowfish.prototype.encipher = function(x, x8) { + if (x8 === undefined) { + x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + } + x[0] ^= this.P[0]; + for (var i = 1; i < 16; i += 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[17]; + x[1] = t; }; -Certificate.prototype.isSignedByKey = function (issuerKey) { - utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); - - if (this.issuerKey !== undefined) { - return (this.issuerKey. - fingerprint('sha512').matches(issuerKey)); - } - - var fmt = Object.keys(this.signatures)[0]; - var valid = formats[fmt].verify(this, issuerKey); - if (valid) - this.issuerKey = issuerKey; - return (valid); +Blowfish.prototype.decipher = function(x) { + var x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + x[0] ^= this.P[17]; + for (var i = 16; i > 0; i -= 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[0]; + x[1] = t; }; -Certificate.prototype.signWith = function (key) { - utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); - var fmts = Object.keys(formats); - var didOne = false; - for (var i = 0; i < fmts.length; ++i) { - if (fmts[i] !== 'pem') { - var ret = formats[fmts[i]].sign(this, key); - if (ret === true) - didOne = true; - } - } - if (!didOne) { - throw (new Error('Failed to sign the certificate for any ' + - 'available certificate formats')); - } +function stream2word(data, databytes){ + var i, temp = 0; + for (i = 0; i < 4; i++, BLF_J++) { + if (BLF_J >= databytes) BLF_J = 0; + temp = (temp << 8) | data[BLF_J]; + } + return temp; }; -Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { - var subjects; - if (Array.isArray(subjectOrSubjects)) - subjects = subjectOrSubjects; - else - subjects = [subjectOrSubjects]; +Blowfish.prototype.expand0state = function(key, keybytes) { + var d = new Uint32Array(2), i, k; + var d8 = new Uint8Array(d.buffer); - assert.arrayOfObject(subjects); - subjects.forEach(function (subject) { - utils.assertCompatible(subject, Identity, [1, 0], 'subject'); - }); + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + BLF_J = 0; - utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); + for (i = 0; i < 18; i += 2) { + this.encipher(d, d8); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalObject(options.validFrom, 'options.validFrom'); - assert.optionalObject(options.validUntil, 'options.validUntil'); - var validFrom = options.validFrom; - var validUntil = options.validUntil; - if (validFrom === undefined) - validFrom = new Date(); - if (validUntil === undefined) { - assert.optionalNumber(options.lifetime, 'options.lifetime'); - var lifetime = options.lifetime; - if (lifetime === undefined) - lifetime = 10*365*24*3600; - validUntil = new Date(); - validUntil.setTime(validUntil.getTime() + lifetime*1000); - } - assert.optionalBuffer(options.serial, 'options.serial'); - var serial = options.serial; - if (serial === undefined) - serial = Buffer.from('0000000000000001', 'hex'); + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + this.encipher(d, d8); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } +}; - var purposes = options.purposes; - if (purposes === undefined) - purposes = []; +Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { + var d = new Uint32Array(2), i, k; - if (purposes.indexOf('signature') === -1) - purposes.push('signature'); + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } - /* Self-signed certs are always CAs. */ - if (purposes.indexOf('ca') === -1) - purposes.push('ca'); - if (purposes.indexOf('crl') === -1) - purposes.push('crl'); + for (i = 0, BLF_J = 0; i < 18; i += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } - /* - * If we weren't explicitly given any other purposes, do the sensible - * thing and add some basic ones depending on the subject type. - */ - if (purposes.length <= 3) { - var hostSubjects = subjects.filter(function (subject) { - return (subject.type === 'host'); - }); - var userSubjects = subjects.filter(function (subject) { - return (subject.type === 'user'); - }); - if (hostSubjects.length > 0) { - if (purposes.indexOf('serverAuth') === -1) - purposes.push('serverAuth'); - } - if (userSubjects.length > 0) { - if (purposes.indexOf('clientAuth') === -1) - purposes.push('clientAuth'); - } - if (userSubjects.length > 0 || hostSubjects.length > 0) { - if (purposes.indexOf('keyAgreement') === -1) - purposes.push('keyAgreement'); - if (key.type === 'rsa' && - purposes.indexOf('encryption') === -1) - purposes.push('encryption'); - } - } + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } + BLF_J = 0; +}; - var cert = new Certificate({ - subjects: subjects, - issuer: subjects[0], - subjectKey: key.toPublic(), - issuerKey: key.toPublic(), - signatures: {}, - serial: serial, - validFrom: validFrom, - validUntil: validUntil, - purposes: purposes - }); - cert.signWith(key); +Blowfish.prototype.enc = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.encipher(data.subarray(i*2)); + } +}; - return (cert); +Blowfish.prototype.dec = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.decipher(data.subarray(i*2)); + } }; -Certificate.create = - function (subjectOrSubjects, key, issuer, issuerKey, options) { - var subjects; - if (Array.isArray(subjectOrSubjects)) - subjects = subjectOrSubjects; - else - subjects = [subjectOrSubjects]; +var BCRYPT_BLOCKS = 8, + BCRYPT_HASHSIZE = 32; - assert.arrayOfObject(subjects); - subjects.forEach(function (subject) { - utils.assertCompatible(subject, Identity, [1, 0], 'subject'); - }); +function bcrypt_hash(sha2pass, sha2salt, out) { + var state = new Blowfish(), + cdata = new Uint32Array(BCRYPT_BLOCKS), i, + ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, + 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, + 105,116,101]); //"OxychromaticBlowfishSwatDynamite" - utils.assertCompatible(key, Key, [1, 0], 'key'); - if (PrivateKey.isPrivateKey(key)) - key = key.toPublic(); - utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); - utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); + state.expandstate(sha2salt, 64, sha2pass, 64); + for (i = 0; i < 64; i++) { + state.expand0state(sha2salt, 64); + state.expand0state(sha2pass, 64); + } - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalObject(options.validFrom, 'options.validFrom'); - assert.optionalObject(options.validUntil, 'options.validUntil'); - var validFrom = options.validFrom; - var validUntil = options.validUntil; - if (validFrom === undefined) - validFrom = new Date(); - if (validUntil === undefined) { - assert.optionalNumber(options.lifetime, 'options.lifetime'); - var lifetime = options.lifetime; - if (lifetime === undefined) - lifetime = 10*365*24*3600; - validUntil = new Date(); - validUntil.setTime(validUntil.getTime() + lifetime*1000); - } - assert.optionalBuffer(options.serial, 'options.serial'); - var serial = options.serial; - if (serial === undefined) - serial = Buffer.from('0000000000000001', 'hex'); + for (i = 0; i < BCRYPT_BLOCKS; i++) + cdata[i] = stream2word(ciphertext, ciphertext.byteLength); + for (i = 0; i < 64; i++) + state.enc(cdata, cdata.byteLength / 8); - var purposes = options.purposes; - if (purposes === undefined) - purposes = []; + for (i = 0; i < BCRYPT_BLOCKS; i++) { + out[4*i+3] = cdata[i] >>> 24; + out[4*i+2] = cdata[i] >>> 16; + out[4*i+1] = cdata[i] >>> 8; + out[4*i+0] = cdata[i]; + } +}; - if (purposes.indexOf('signature') === -1) - purposes.push('signature'); +function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { + var sha2pass = new Uint8Array(64), + sha2salt = new Uint8Array(64), + out = new Uint8Array(BCRYPT_HASHSIZE), + tmpout = new Uint8Array(BCRYPT_HASHSIZE), + countsalt = new Uint8Array(saltlen+4), + i, j, amt, stride, dest, count, + origkeylen = keylen; - if (options.ca === true) { - if (purposes.indexOf('ca') === -1) - purposes.push('ca'); - if (purposes.indexOf('crl') === -1) - purposes.push('crl'); - } + if (rounds < 1) + return -1; + if (passlen === 0 || saltlen === 0 || keylen === 0 || + keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) + return -1; - var hostSubjects = subjects.filter(function (subject) { - return (subject.type === 'host'); - }); - var userSubjects = subjects.filter(function (subject) { - return (subject.type === 'user'); - }); - if (hostSubjects.length > 0) { - if (purposes.indexOf('serverAuth') === -1) - purposes.push('serverAuth'); - } - if (userSubjects.length > 0) { - if (purposes.indexOf('clientAuth') === -1) - purposes.push('clientAuth'); - } - if (userSubjects.length > 0 || hostSubjects.length > 0) { - if (purposes.indexOf('keyAgreement') === -1) - purposes.push('keyAgreement'); - if (key.type === 'rsa' && - purposes.indexOf('encryption') === -1) - purposes.push('encryption'); - } + stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); + amt = Math.floor((keylen + stride - 1) / stride); - var cert = new Certificate({ - subjects: subjects, - issuer: issuer, - subjectKey: key, - issuerKey: issuerKey.toPublic(), - signatures: {}, - serial: serial, - validFrom: validFrom, - validUntil: validUntil, - purposes: purposes - }); - cert.signWith(issuerKey); + for (i = 0; i < saltlen; i++) + countsalt[i] = salt[i]; - return (cert); -}; + crypto_hash_sha512(sha2pass, pass, passlen); -Certificate.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; + for (count = 1; keylen > 0; count++) { + countsalt[saltlen+0] = count >>> 24; + countsalt[saltlen+1] = count >>> 16; + countsalt[saltlen+2] = count >>> 8; + countsalt[saltlen+3] = count; - assert.object(formats[format], 'formats[format]'); + crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (i = out.byteLength; i--;) + out[i] = tmpout[i]; - try { - var k = formats[format].read(data, options); - return (k); - } catch (e) { - throw (new CertificateParseError(options.filename, format, e)); - } -}; + for (i = 1; i < rounds; i++) { + crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (j = 0; j < out.byteLength; j++) + out[j] ^= tmpout[j]; + } -Certificate.isCertificate = function (obj, ver) { - return (utils.isCompatible(obj, Certificate, ver)); -}; + amt = Math.min(amt, keylen); + for (i = 0; i < amt; i++) { + dest = i * stride + (count - 1); + if (dest >= origkeylen) + break; + key[dest] = out[i]; + } + keylen -= i; + } -/* - * API versions for Certificate: - * [1,0] -- initial ver - * [1,1] -- openssh format now unpacks extensions - */ -Certificate.prototype._sshpkApiVersion = [1, 1]; + return 0; +}; -Certificate._oldVersionDetect = function (obj) { - return ([1, 0]); +module.exports = { + BLOCKS: BCRYPT_BLOCKS, + HASHSIZE: BCRYPT_HASHSIZE, + hash: bcrypt_hash, + pbkdf: bcrypt_pbkdf }; /***/ }), -/***/ 652: +/***/ 643: /***/ (function(module) { "use strict"; -module.exports = function generate_const(it, $keyword, $ruleType) { +module.exports = function generate_items(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -19533,68 +18847,193 @@ module.exports = function generate_const(it, $keyword, $ruleType) { var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - if (!$isData) { - out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';'; - } - out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be equal to constant\' '; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId; + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if (Array.isArray($schema)) { + var $additionalItems = it.schema.additionalItems; + if ($additionalItems === false) { + out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + $closingBraces += '}'; + out += ' else { '; + } } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; + var $passData = $data + '[' + $i + ']'; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); + $it.dataPathArr[$dataNxt] = $i; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; + if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0 : it.util.schemaHasRules($additionalItems, it.RULES.all))) { + $it.schema = $additionalItems; + $it.schemaPath = it.schemaPath + '.additionalItems'; + $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } else if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' }'; } - out += ' }'; if ($breakOnError) { - out += ' else { '; + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } + out = it.util.cleanUpCode(out); return out; } -/***/ }), +/***/ }), + +/***/ 650: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var Key = __webpack_require__(852); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var PrivateKey = __webpack_require__(502); +var Certificate = __webpack_require__(752); +var Identity = __webpack_require__(378); +var errs = __webpack_require__(753); + +module.exports = { + /* top-level classes */ + Key: Key, + parseKey: Key.parse, + Fingerprint: Fingerprint, + parseFingerprint: Fingerprint.parse, + Signature: Signature, + parseSignature: Signature.parse, + PrivateKey: PrivateKey, + parsePrivateKey: PrivateKey.parse, + generatePrivateKey: PrivateKey.generate, + Certificate: Certificate, + parseCertificate: Certificate.parse, + createSelfSignedCertificate: Certificate.createSelfSigned, + createCertificate: Certificate.create, + Identity: Identity, + identityFromDN: Identity.parseDN, + identityForHost: Identity.forHost, + identityForUser: Identity.forUser, + identityForEmail: Identity.forEmail, + identityFromArray: Identity.fromArray, -/***/ 663: -/***/ (function(module) { + /* errors */ + FingerprintFormatError: errs.FingerprintFormatError, + InvalidAlgorithmError: errs.InvalidAlgorithmError, + KeyParseError: errs.KeyParseError, + SignatureParseError: errs.SignatureParseError, + KeyEncryptedError: errs.KeyEncryptedError, + CertificateParseError: errs.CertificateParseError +}; -module.exports = {"$schema":"http://json-schema.org/draft-06/schema#","$id":"http://json-schema.org/draft-06/schema#","title":"Core schema meta-schema","definitions":{"schemaArray":{"type":"array","minItems":1,"items":{"$ref":"#"}},"nonNegativeInteger":{"type":"integer","minimum":0},"nonNegativeIntegerDefault0":{"allOf":[{"$ref":"#/definitions/nonNegativeInteger"},{"default":0}]},"simpleTypes":{"enum":["array","boolean","integer","null","number","object","string"]},"stringArray":{"type":"array","items":{"type":"string"},"uniqueItems":true,"default":[]}},"type":["object","boolean"],"properties":{"$id":{"type":"string","format":"uri-reference"},"$schema":{"type":"string","format":"uri"},"$ref":{"type":"string","format":"uri-reference"},"title":{"type":"string"},"description":{"type":"string"},"default":{},"examples":{"type":"array","items":{}},"multipleOf":{"type":"number","exclusiveMinimum":0},"maximum":{"type":"number"},"exclusiveMaximum":{"type":"number"},"minimum":{"type":"number"},"exclusiveMinimum":{"type":"number"},"maxLength":{"$ref":"#/definitions/nonNegativeInteger"},"minLength":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"pattern":{"type":"string","format":"regex"},"additionalItems":{"$ref":"#"},"items":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/schemaArray"}],"default":{}},"maxItems":{"$ref":"#/definitions/nonNegativeInteger"},"minItems":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"uniqueItems":{"type":"boolean","default":false},"contains":{"$ref":"#"},"maxProperties":{"$ref":"#/definitions/nonNegativeInteger"},"minProperties":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"required":{"$ref":"#/definitions/stringArray"},"additionalProperties":{"$ref":"#"},"definitions":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"properties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"patternProperties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"dependencies":{"type":"object","additionalProperties":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/stringArray"}]}},"propertyNames":{"$ref":"#"},"const":{},"enum":{"type":"array","minItems":1,"uniqueItems":true},"type":{"anyOf":[{"$ref":"#/definitions/simpleTypes"},{"type":"array","items":{"$ref":"#/definitions/simpleTypes"},"minItems":1,"uniqueItems":true}]},"format":{"type":"string"},"allOf":{"$ref":"#/definitions/schemaArray"},"anyOf":{"$ref":"#/definitions/schemaArray"},"oneOf":{"$ref":"#/definitions/schemaArray"},"not":{"$ref":"#"}},"default":{}}; /***/ }), -/***/ 664: +/***/ 653: /***/ (function(module) { "use strict"; -module.exports = function generate_format(it, $keyword, $ruleType) { +module.exports = function generate_oneOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -19603,143 +19042,66 @@ module.exports = function generate_format(it, $keyword, $ruleType) { var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); - if (it.opts.format === false) { - if ($breakOnError) { - out += ' if (true) { '; - } - return out; - } - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $unknownFormats = it.opts.unknownFormats, - $allowUnknown = Array.isArray($unknownFormats); - if ($isData) { - var $format = 'format' + $lvl, - $isObject = 'isObject' + $lvl, - $formatType = 'formatType' + $lvl; - out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; - if (it.async) { - out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; - } - out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; - } - out += ' ('; - if ($unknownFormats != 'ignore') { - out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; - if ($allowUnknown) { - out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; - } - out += ') || '; - } - out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; - if (it.async) { - out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; - } else { - out += ' ' + ($format) + '(' + ($data) + ') '; - } - out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; - } else { - var $format = it.formats[$schema]; - if (!$format) { - if ($unknownFormats == 'ignore') { - it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); - if ($breakOnError) { - out += ' if (true) { '; - } - return out; - } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { - if ($breakOnError) { - out += ' if (true) { '; - } - return out; + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $prevValid = 'prevValid' + $lvl, + $passingSchemas = 'passingSchemas' + $lvl; + out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; } else { - throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); - } - } - var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; - var $formatType = $isObject && $format.type || 'string'; - if ($isObject) { - var $async = $format.async === true; - $format = $format.validate; - } - if ($formatType != $ruleType) { - if ($breakOnError) { - out += ' if (true) { '; + out += ' var ' + ($nextValid) + ' = true; '; } - return out; - } - if ($async) { - if (!it.async) throw new Error('async format in sync schema'); - var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; - out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; - } else { - out += ' if (! '; - var $formatRef = 'formats' + it.util.getProperty($schema); - if ($isObject) $formatRef += '.validate'; - if (typeof $format == 'function') { - out += ' ' + ($formatRef) + '(' + ($data) + ') '; - } else { - out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; + if ($i) { + out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; + $closingBraces += '}'; } - out += ') { '; + out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; } } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ + it.compositeRule = $it.compositeRule = $wasComposite; + out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; - if ($isData) { - out += '' + ($schemaValue); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' } '; + out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; if (it.opts.messages !== false) { - out += ' , message: \'should match format "'; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + (it.util.escapeQuotes($schema)); - } - out += '"\' '; + out += ' , message: \'should match exactly one schema in oneOf\' '; } if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } - var __err = out; - out = $$outStack.pop(); + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; + out += ' throw new ValidationError(vErrors); '; } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; + out += ' validate.errors = vErrors; return false; '; } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - out += ' } '; - if ($breakOnError) { - out += ' else { '; + out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; + if (it.opts.allErrors) { + out += ' } '; } return out; } @@ -19747,215 +19109,459 @@ module.exports = function generate_format(it, $keyword, $ruleType) { /***/ }), -/***/ 667: +/***/ 658: /***/ (function(__unusedmodule, exports, __webpack_require__) { -"use strict"; -/*! - * mime-types - * Copyright(c) 2014 Jonathan Ong - * Copyright(c) 2015 Douglas Christopher Wilson - * MIT Licensed - */ +var aws4 = exports, + url = __webpack_require__(835), + querystring = __webpack_require__(191), + crypto = __webpack_require__(417), + lru = __webpack_require__(985), + credentialsCache = lru(1000) +// http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html +function hmac(key, string, encoding) { + return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding) +} -/** - * Module dependencies. - * @private - */ +function hash(string, encoding) { + return crypto.createHash('sha256').update(string, 'utf8').digest(encoding) +} -var db = __webpack_require__(507) -var extname = __webpack_require__(622).extname +// This function assumes the string has already been percent encoded +function encodeRfc3986(urlEncodedString) { + return urlEncodedString.replace(/[!'()*]/g, function(c) { + return '%' + c.charCodeAt(0).toString(16).toUpperCase() + }) +} -/** - * Module variables. - * @private - */ +// request: { path | body, [host], [method], [headers], [service], [region] } +// credentials: { accessKeyId, secretAccessKey, [sessionToken] } +function RequestSigner(request, credentials) { -var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ -var TEXT_TYPE_REGEXP = /^text\//i + if (typeof request === 'string') request = url.parse(request) -/** - * Module exports. - * @public - */ + var headers = request.headers = (request.headers || {}), + hostParts = this.matchHost(request.hostname || request.host || headers.Host || headers.host) -exports.charset = charset -exports.charsets = { lookup: charset } -exports.contentType = contentType -exports.extension = extension -exports.extensions = Object.create(null) -exports.lookup = lookup -exports.types = Object.create(null) + this.request = request + this.credentials = credentials || this.defaultCredentials() -// Populate the extensions/types maps -populateMaps(exports.extensions, exports.types) + this.service = request.service || hostParts[0] || '' + this.region = request.region || hostParts[1] || 'us-east-1' -/** - * Get the default charset for a MIME type. - * - * @param {string} type - * @return {boolean|string} - */ + // SES uses a different domain from the service name + if (this.service === 'email') this.service = 'ses' -function charset (type) { - if (!type || typeof type !== 'string') { - return false + if (!request.method && request.body) + request.method = 'POST' + + if (!headers.Host && !headers.host) { + headers.Host = request.hostname || request.host || this.createHost() + + // If a port is specified explicitly, use it as is + if (request.port) + headers.Host += ':' + request.port } + if (!request.hostname && !request.host) + request.hostname = headers.Host || headers.host - // TODO: use media-typer - var match = EXTRACT_TYPE_REGEXP.exec(type) - var mime = match && db[match[1].toLowerCase()] + this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT' +} - if (mime && mime.charset) { - return mime.charset +RequestSigner.prototype.matchHost = function(host) { + var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/) + var hostParts = (match || []).slice(1, 3) + + // ES's hostParts are sometimes the other way round, if the value that is expected + // to be region equals ‘es’ switch them back + // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com + if (hostParts[1] === 'es') + hostParts = hostParts.reverse() + + return hostParts +} + +// http://docs.aws.amazon.com/general/latest/gr/rande.html +RequestSigner.prototype.isSingleRegion = function() { + // Special case for S3 and SimpleDB in us-east-1 + if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true + + return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts'] + .indexOf(this.service) >= 0 +} + +RequestSigner.prototype.createHost = function() { + var region = this.isSingleRegion() ? '' : + (this.service === 's3' && this.region !== 'us-east-1' ? '-' : '.') + this.region, + service = this.service === 'ses' ? 'email' : this.service + return service + region + '.amazonaws.com' +} + +RequestSigner.prototype.prepareRequest = function() { + this.parsePath() + + var request = this.request, headers = request.headers, query + + if (request.signQuery) { + + this.parsedPath.query = query = this.parsedPath.query || {} + + if (this.credentials.sessionToken) + query['X-Amz-Security-Token'] = this.credentials.sessionToken + + if (this.service === 's3' && !query['X-Amz-Expires']) + query['X-Amz-Expires'] = 86400 + + if (query['X-Amz-Date']) + this.datetime = query['X-Amz-Date'] + else + query['X-Amz-Date'] = this.getDateTime() + + query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256' + query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString() + query['X-Amz-SignedHeaders'] = this.signedHeaders() + + } else { + + if (!request.doNotModifyHeaders && !this.isCodeCommitGit) { + if (request.body && !headers['Content-Type'] && !headers['content-type']) + headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8' + + if (request.body && !headers['Content-Length'] && !headers['content-length']) + headers['Content-Length'] = Buffer.byteLength(request.body) + + if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token']) + headers['X-Amz-Security-Token'] = this.credentials.sessionToken + + if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256']) + headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex') + + if (headers['X-Amz-Date'] || headers['x-amz-date']) + this.datetime = headers['X-Amz-Date'] || headers['x-amz-date'] + else + headers['X-Amz-Date'] = this.getDateTime() + } + + delete headers.Authorization + delete headers.authorization } +} - // default text/* to utf-8 - if (match && TEXT_TYPE_REGEXP.test(match[1])) { - return 'UTF-8' +RequestSigner.prototype.sign = function() { + if (!this.parsedPath) this.prepareRequest() + + if (this.request.signQuery) { + this.parsedPath.query['X-Amz-Signature'] = this.signature() + } else { + this.request.headers.Authorization = this.authHeader() } - return false + this.request.path = this.formatPath() + + return this.request } -/** - * Create a full Content-Type header given a MIME type or extension. - * - * @param {string} str - * @return {boolean|string} - */ +RequestSigner.prototype.getDateTime = function() { + if (!this.datetime) { + var headers = this.request.headers, + date = new Date(headers.Date || headers.date || new Date) -function contentType (str) { - // TODO: should this even be in this module? - if (!str || typeof str !== 'string') { - return false + this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '') + + // Remove the trailing 'Z' on the timestamp string for CodeCommit git access + if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1) + } + return this.datetime +} + +RequestSigner.prototype.getDate = function() { + return this.getDateTime().substr(0, 8) +} + +RequestSigner.prototype.authHeader = function() { + return [ + 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(), + 'SignedHeaders=' + this.signedHeaders(), + 'Signature=' + this.signature(), + ].join(', ') +} + +RequestSigner.prototype.signature = function() { + var date = this.getDate(), + cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(), + kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey) + if (!kCredentials) { + kDate = hmac('AWS4' + this.credentials.secretAccessKey, date) + kRegion = hmac(kDate, this.region) + kService = hmac(kRegion, this.service) + kCredentials = hmac(kService, 'aws4_request') + credentialsCache.set(cacheKey, kCredentials) + } + return hmac(kCredentials, this.stringToSign(), 'hex') +} + +RequestSigner.prototype.stringToSign = function() { + return [ + 'AWS4-HMAC-SHA256', + this.getDateTime(), + this.credentialString(), + hash(this.canonicalString(), 'hex'), + ].join('\n') +} + +RequestSigner.prototype.canonicalString = function() { + if (!this.parsedPath) this.prepareRequest() + + var pathStr = this.parsedPath.path, + query = this.parsedPath.query, + headers = this.request.headers, + queryStr = '', + normalizePath = this.service !== 's3', + decodePath = this.service === 's3' || this.request.doNotEncodePath, + decodeSlashesInPath = this.service === 's3', + firstValOnly = this.service === 's3', + bodyHash + + if (this.service === 's3' && this.request.signQuery) { + bodyHash = 'UNSIGNED-PAYLOAD' + } else if (this.isCodeCommitGit) { + bodyHash = '' + } else { + bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] || + hash(this.request.body || '', 'hex') + } + + if (query) { + queryStr = encodeRfc3986(querystring.stringify(Object.keys(query).sort().reduce(function(obj, key) { + if (!key) return obj + obj[key] = !Array.isArray(query[key]) ? query[key] : + (firstValOnly ? query[key][0] : query[key].slice().sort()) + return obj + }, {}))) + } + if (pathStr !== '/') { + if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/') + pathStr = pathStr.split('/').reduce(function(path, piece) { + if (normalizePath && piece === '..') { + path.pop() + } else if (!normalizePath || piece !== '.') { + if (decodePath) piece = decodeURIComponent(piece) + path.push(encodeRfc3986(encodeURIComponent(piece))) + } + return path + }, []).join('/') + if (pathStr[0] !== '/') pathStr = '/' + pathStr + if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/') + } + + return [ + this.request.method || 'GET', + pathStr, + queryStr, + this.canonicalHeaders() + '\n', + this.signedHeaders(), + bodyHash, + ].join('\n') +} + +RequestSigner.prototype.canonicalHeaders = function() { + var headers = this.request.headers + function trimAll(header) { + return header.toString().trim().replace(/\s+/g, ' ') + } + return Object.keys(headers) + .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 }) + .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) }) + .join('\n') +} + +RequestSigner.prototype.signedHeaders = function() { + return Object.keys(this.request.headers) + .map(function(key) { return key.toLowerCase() }) + .sort() + .join(';') +} + +RequestSigner.prototype.credentialString = function() { + return [ + this.getDate(), + this.region, + this.service, + 'aws4_request', + ].join('/') +} + +RequestSigner.prototype.defaultCredentials = function() { + var env = process.env + return { + accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY, + secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY, + sessionToken: env.AWS_SESSION_TOKEN, } +} - var mime = str.indexOf('/') === -1 - ? exports.lookup(str) - : str +RequestSigner.prototype.parsePath = function() { + var path = this.request.path || '/', + queryIx = path.indexOf('?'), + query = null - if (!mime) { - return false + if (queryIx >= 0) { + query = querystring.parse(path.slice(queryIx + 1)) + path = path.slice(0, queryIx) } - // TODO: use content-type or other module - if (mime.indexOf('charset') === -1) { - var charset = exports.charset(mime) - if (charset) mime += '; charset=' + charset.toLowerCase() + // S3 doesn't always encode characters > 127 correctly and + // all services don't encode characters > 255 correctly + // So if there are non-reserved chars (and it's not already all % encoded), just encode them all + if (/[^0-9A-Za-z!'()*\-._~%/]/.test(path)) { + path = path.split('/').map(function(piece) { + return encodeURIComponent(decodeURIComponent(piece)) + }).join('/') } - return mime + this.parsedPath = { + path: path, + query: query, + } } -/** - * Get the default extension for a MIME type. - * - * @param {string} type - * @return {boolean|string} - */ +RequestSigner.prototype.formatPath = function() { + var path = this.parsedPath.path, + query = this.parsedPath.query -function extension (type) { - if (!type || typeof type !== 'string') { - return false - } + if (!query) return path - // TODO: use media-typer - var match = EXTRACT_TYPE_REGEXP.exec(type) + // Services don't support empty query string keys + if (query[''] != null) delete query[''] - // get extensions - var exts = match && exports.extensions[match[1].toLowerCase()] + return path + '?' + encodeRfc3986(querystring.stringify(query)) +} - if (!exts || !exts.length) { - return false - } +aws4.RequestSigner = RequestSigner - return exts[0] +aws4.sign = function(request, credentials) { + return new RequestSigner(request, credentials).sign() } -/** - * Lookup the MIME type for a file path/extension. - * - * @param {string} path - * @return {boolean|string} - */ -function lookup (path) { - if (!path || typeof path !== 'string') { - return false - } +/***/ }), - // get the extension ("ext" or ".ext" or full path) - var extension = extname('x.' + path) - .toLowerCase() - .substr(1) +/***/ 662: +/***/ (function(module) { - if (!extension) { - return false - } +"use strict"; - return exports.types[extension] || false +module.exports = function generate_const(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (!$isData) { + out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to constant\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; + } + return out; } -/** - * Populate the extensions and types maps. - * @private - */ -function populateMaps (extensions, types) { - // source preference (least -> most) - var preference = ['nginx', 'apache', undefined, 'iana'] +/***/ }), - Object.keys(db).forEach(function forEachMimeType (type) { - var mime = db[type] - var exts = mime.extensions +/***/ 669: +/***/ (function(module) { - if (!exts || !exts.length) { - return - } +module.exports = require("util"); - // mime -> extensions - extensions[type] = exts +/***/ }), - // extension -> mime - for (var i = 0; i < exts.length; i++) { - var extension = exts[i] +/***/ 671: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (types[extension]) { - var from = preference.indexOf(db[types[extension]].source) - var to = preference.indexOf(mime.source) +"use strict"; - if (types[extension] !== 'application/octet-stream' && - (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { - // skip the remapping - continue - } - } - // set the extension -> mime - types[extension] = type - } - }) +module.exports = { + afterRequest: __webpack_require__(672), + beforeRequest: __webpack_require__(820), + browser: __webpack_require__(222), + cache: __webpack_require__(993), + content: __webpack_require__(162), + cookie: __webpack_require__(326), + creator: __webpack_require__(776), + entry: __webpack_require__(919), + har: __webpack_require__(41), + header: __webpack_require__(883), + log: __webpack_require__(319), + page: __webpack_require__(744), + pageTimings: __webpack_require__(181), + postData: __webpack_require__(740), + query: __webpack_require__(813), + request: __webpack_require__(380), + response: __webpack_require__(226), + timings: __webpack_require__(758) } /***/ }), -/***/ 669: +/***/ 672: /***/ (function(module) { -module.exports = require("util"); +module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), -/***/ 672: +/***/ 673: /***/ (function(module) { "use strict"; -module.exports = function generate_properties(it, $keyword, $ruleType) { +module.exports = function generate_not(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -19966,334 +19572,183 @@ module.exports = function generate_properties(it, $keyword, $ruleType) { var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); - var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; - var $key = 'key' + $lvl, - $idx = 'idx' + $lvl, - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $dataProperties = 'dataProperties' + $lvl; - var $schemaKeys = Object.keys($schema || {}), - $pProperties = it.schema.patternProperties || {}, - $pPropertyKeys = Object.keys($pProperties), - $aProperties = it.schema.additionalProperties, - $someProperties = $schemaKeys.length || $pPropertyKeys.length, - $noAdditional = $aProperties === false, - $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, - $removeAdditional = it.opts.removeAdditional, - $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, - $ownProperties = it.opts.ownProperties, - $currentBaseId = it.baseId; - var $required = it.schema.required; - if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) var $requiredHash = it.util.toHash($required); - out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; - if ($ownProperties) { - out += ' var ' + ($dataProperties) + ' = undefined;'; - } - if ($checkAdditional) { - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - if ($someProperties) { - out += ' var isAdditional' + ($lvl) + ' = !(false '; - if ($schemaKeys.length) { - if ($schemaKeys.length > 8) { - out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; - } else { - var arr1 = $schemaKeys; - if (arr1) { - var $propertyKey, i1 = -1, - l1 = arr1.length - 1; - while (i1 < l1) { - $propertyKey = arr1[i1 += 1]; - out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; - } - } - } - } - if ($pPropertyKeys.length) { - var arr2 = $pPropertyKeys; - if (arr2) { - var $pProperty, $i = -1, - l2 = arr2.length - 1; - while ($i < l2) { - $pProperty = arr2[$i += 1]; - out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; - } - } - } - out += ' ); if (isAdditional' + ($lvl) + ') { '; - } - if ($removeAdditional == 'all') { - out += ' delete ' + ($data) + '[' + ($key) + ']; '; - } else { - var $currentErrorPath = it.errorPath; - var $additionalProperty = '\' + ' + $key + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - } - if ($noAdditional) { - if ($removeAdditional) { - out += ' delete ' + ($data) + '[' + ($key) + ']; '; - } else { - out += ' ' + ($nextValid) + ' = false; '; - var $currErrSchemaPath = $errSchemaPath; - $errSchemaPath = it.errSchemaPath + '/additionalProperties'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is an invalid additional property'; - } else { - out += 'should NOT have additional properties'; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - $errSchemaPath = $currErrSchemaPath; - if ($breakOnError) { - out += ' break; '; - } - } - } else if ($additionalIsSchema) { - if ($removeAdditional == 'failing') { - out += ' var ' + ($errs) + ' = errors; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.schema = $aProperties; - $it.schemaPath = it.schemaPath + '.additionalProperties'; - $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; - $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; - it.compositeRule = $it.compositeRule = $wasComposite; - } else { - $it.schema = $aProperties; - $it.schemaPath = it.schemaPath + '.additionalProperties'; - $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; - $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - } - } - it.errorPath = $currentErrorPath; - } - if ($someProperties) { - out += ' } '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; + if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.createErrors = false; + var $allErrorsOption; + if ($it.opts.allErrors) { + $allErrorsOption = $it.opts.allErrors; + $it.opts.allErrors = false; } - } - var $useDefaults = it.opts.useDefaults && !it.compositeRule; - if ($schemaKeys.length) { - var arr3 = $schemaKeys; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $sch = $schema[$propertyKey]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - var $prop = it.util.getProperty($propertyKey), - $passData = $data + $prop, - $hasDefault = $useDefaults && $sch.default !== undefined; - $it.schema = $sch; - $it.schemaPath = $schemaPath + $prop; - $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); - $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); - $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - $code = it.util.varReplace($code, $nextData, $passData); - var $useData = $passData; - } else { - var $useData = $nextData; - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; - } - if ($hasDefault) { - out += ' ' + ($code) + ' '; - } else { - if ($requiredHash && $requiredHash[$propertyKey]) { - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { ' + ($nextValid) + ' = false; '; - var $currentErrorPath = it.errorPath, - $currErrSchemaPath = $errSchemaPath, - $missingProperty = it.util.escapeQuotes($propertyKey); - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); - } - $errSchemaPath = it.errSchemaPath + '/required'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - $errSchemaPath = $currErrSchemaPath; - it.errorPath = $currentErrorPath; - out += ' } else { '; - } else { - if ($breakOnError) { - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { ' + ($nextValid) + ' = true; } else { '; - } else { - out += ' if (' + ($useData) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ' ) { '; - } - } - out += ' ' + ($code) + ' } '; - } - } - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } + out += ' ' + (it.validate($it)) + ' '; + $it.createErrors = true; + if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (' + ($nextValid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be valid\' '; } - } - } - if ($pPropertyKeys.length) { - var arr4 = $pPropertyKeys; - if (arr4) { - var $pProperty, i4 = -1, - l4 = arr4.length - 1; - while (i4 < l4) { - $pProperty = arr4[i4 += 1]; - var $sch = $pProperties[$pProperty]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $it.schema = $sch; - $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); - $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else ' + ($nextValid) + ' = true; '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; + } + } else { + out += ' var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be valid\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if ($breakOnError) { + out += ' if (false) { '; } } - if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; - } - out = it.util.cleanUpCode(out); return out; } /***/ }), -/***/ 676: +/***/ 680: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2016 Joyent, Inc. + +var x509 = __webpack_require__(866); + +module.exports = { + read: read, + verify: x509.verify, + sign: x509.sign, + write: write +}; + +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); +var Identity = __webpack_require__(378); +var Signature = __webpack_require__(575); +var Certificate = __webpack_require__(752); + +function read(buf, options) { + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } + + var lines = buf.trim().split(/[\r\n]+/g); + + var m; + var si = -1; + while (!m && si < lines.length) { + m = lines[++si].match(/*JSSTYLED*/ + /[-]+[ ]*BEGIN CERTIFICATE[ ]*[-]+/); + } + assert.ok(m, 'invalid PEM header'); + + var m2; + var ei = lines.length; + while (!m2 && ei > 0) { + m2 = lines[--ei].match(/*JSSTYLED*/ + /[-]+[ ]*END CERTIFICATE[ ]*[-]+/); + } + assert.ok(m2, 'invalid PEM footer'); + + lines = lines.slice(si, ei + 1); + + var headers = {}; + while (true) { + lines = lines.slice(1); + m = lines[0].match(/*JSSTYLED*/ + /^([A-Za-z0-9-]+): (.+)$/); + if (!m) + break; + headers[m[1].toLowerCase()] = m[2]; + } + + /* Chop off the first and last lines */ + lines = lines.slice(0, -1).join(''); + buf = Buffer.from(lines, 'base64'); + + return (x509.read(buf, options)); +} + +function write(cert, options) { + var dbuf = x509.write(cert, options); + + var header = 'CERTIFICATE'; + var tmp = dbuf.toString('base64'); + var len = tmp.length + (tmp.length / 64) + + 18 + 16 + header.length*2 + 10; + var buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 64; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); + + return (buf.slice(0, o)); +} + + +/***/ }), + +/***/ 687: /***/ (function(module) { "use strict"; -module.exports = function generate_oneOf(it, $keyword, $ruleType) { +module.exports = function generate_format(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -20302,3604 +19757,3455 @@ module.exports = function generate_oneOf(it, $keyword, $ruleType) { var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $currentBaseId = $it.baseId, - $prevValid = 'prevValid' + $lvl, - $passingSchemas = 'passingSchemas' + $lvl; - out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; + if (it.opts.format === false) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $unknownFormats = it.opts.unknownFormats, + $allowUnknown = Array.isArray($unknownFormats); + if ($isData) { + var $format = 'format' + $lvl, + $isObject = 'isObject' + $lvl, + $formatType = 'formatType' + $lvl; + out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; + if (it.async) { + out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; + } + out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' ('; + if ($unknownFormats != 'ignore') { + out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; + if ($allowUnknown) { + out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; + } + out += ') || '; + } + out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; + if (it.async) { + out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; + } else { + out += ' ' + ($format) + '(' + ($data) + ') '; + } + out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; + } else { + var $format = it.formats[$schema]; + if (!$format) { + if ($unknownFormats == 'ignore') { + it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; } else { - out += ' var ' + ($nextValid) + ' = true; '; + throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); } - if ($i) { - out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; - $closingBraces += '}'; + } + var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; + var $formatType = $isObject && $format.type || 'string'; + if ($isObject) { + var $async = $format.async === true; + $format = $format.validate; + } + if ($formatType != $ruleType) { + if ($breakOnError) { + out += ' if (true) { '; } - out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; + return out; + } + if ($async) { + if (!it.async) throw new Error('async format in sync schema'); + var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; + out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; + } else { + out += ' if (! '; + var $formatRef = 'formats' + it.util.getProperty($schema); + if ($isObject) $formatRef += '.validate'; + if (typeof $format == 'function') { + out += ' ' + ($formatRef) + '(' + ($data) + ') '; + } else { + out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; + } + out += ') { '; } } - it.compositeRule = $it.compositeRule = $wasComposite; - out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; + out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; if (it.opts.messages !== false) { - out += ' , message: \'should match exactly one schema in oneOf\' '; + out += ' , message: \'should match format "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; } if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + var __err = out; + out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { - out += ' throw new ValidationError(vErrors); '; + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - out += ' validate.errors = vErrors; return false; '; + out += ' validate.errors = [' + (__err) + ']; return false; '; } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; - if (it.opts.allErrors) { - out += ' } '; + out += ' } '; + if ($breakOnError) { + out += ' else { '; } return out; } -/***/ }), +/***/ }), + +/***/ 691: +/***/ (function(module) { + +"use strict"; + + +// https://mathiasbynens.be/notes/javascript-encoding +// https://github.com/bestiejs/punycode.js - punycode.ucs2.decode +module.exports = function ucs2length(str) { + var length = 0 + , len = str.length + , pos = 0 + , value; + while (pos < len) { + length++; + value = str.charCodeAt(pos++); + if (value >= 0xD800 && value <= 0xDBFF && pos < len) { + // high surrogate, and there is a next character + value = str.charCodeAt(pos); + if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate + } + } + return length; +}; + + +/***/ }), + +/***/ 697: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +/* + * extsprintf.js: extended POSIX-style sprintf + */ + +var mod_assert = __webpack_require__(357); +var mod_util = __webpack_require__(669); + +/* + * Public interface + */ +exports.sprintf = jsSprintf; +exports.printf = jsPrintf; +exports.fprintf = jsFprintf; + +/* + * Stripped down version of s[n]printf(3c). We make a best effort to throw an + * exception when given a format string we don't understand, rather than + * ignoring it, so that we won't break existing programs if/when we go implement + * the rest of this. + * + * This implementation currently supports specifying + * - field alignment ('-' flag), + * - zero-pad ('0' flag) + * - always show numeric sign ('+' flag), + * - field width + * - conversions for strings, decimal integers, and floats (numbers). + * - argument size specifiers. These are all accepted but ignored, since + * Javascript has no notion of the physical size of an argument. + * + * Everything else is currently unsupported, most notably precision, unsigned + * numbers, non-decimal numbers, and characters. + */ +function jsSprintf(fmt) +{ + var regex = [ + '([^%]*)', /* normal text */ + '%', /* start of format */ + '([\'\\-+ #0]*?)', /* flags (optional) */ + '([1-9]\\d*)?', /* width (optional) */ + '(\\.([1-9]\\d*))?', /* precision (optional) */ + '[lhjztL]*?', /* length mods (ignored) */ + '([diouxXfFeEgGaAcCsSp%jr])' /* conversion */ + ].join(''); + + var re = new RegExp(regex); + var args = Array.prototype.slice.call(arguments, 1); + var flags, width, precision, conversion; + var left, pad, sign, arg, match; + var ret = ''; + var argn = 1; + + mod_assert.equal('string', typeof (fmt)); + + while ((match = re.exec(fmt)) !== null) { + ret += match[1]; + fmt = fmt.substring(match[0].length); + + flags = match[2] || ''; + width = match[3] || 0; + precision = match[4] || ''; + conversion = match[6]; + left = false; + sign = false; + pad = ' '; + + if (conversion == '%') { + ret += '%'; + continue; + } + + if (args.length === 0) + throw (new Error('too few args to sprintf')); + + arg = args.shift(); + argn++; + + if (flags.match(/[\' #]/)) + throw (new Error( + 'unsupported flags: ' + flags)); + + if (precision.length > 0) + throw (new Error( + 'non-zero precision not supported')); + + if (flags.match(/-/)) + left = true; + + if (flags.match(/0/)) + pad = '0'; + + if (flags.match(/\+/)) + sign = true; + + switch (conversion) { + case 's': + if (arg === undefined || arg === null) + throw (new Error('argument ' + argn + + ': attempted to print undefined or null ' + + 'as a string')); + ret += doPad(pad, width, left, arg.toString()); + break; + + case 'd': + arg = Math.floor(arg); + /*jsl:fallthru*/ + case 'f': + sign = sign && arg > 0 ? '+' : ''; + ret += sign + doPad(pad, width, left, + arg.toString()); + break; + + case 'x': + ret += doPad(pad, width, left, arg.toString(16)); + break; + + case 'j': /* non-standard */ + if (width === 0) + width = 10; + ret += mod_util.inspect(arg, false, width); + break; + + case 'r': /* non-standard */ + ret += dumpException(arg); + break; + + default: + throw (new Error('unsupported conversion: ' + + conversion)); + } + } + + ret += fmt; + return (ret); +} + +function jsPrintf() { + var args = Array.prototype.slice.call(arguments); + args.unshift(process.stdout); + jsFprintf.apply(null, args); +} + +function jsFprintf(stream) { + var args = Array.prototype.slice.call(arguments, 1); + return (stream.write(jsSprintf.apply(this, args))); +} + +function doPad(chr, width, left, str) +{ + var ret = str; + + while (ret.length < width) { + if (left) + ret += chr; + else + ret = chr + ret; + } + + return (ret); +} + +/* + * This function dumps long stack traces for exceptions having a cause() method. + * See node-verror for an example. + */ +function dumpException(ex) +{ + var ret; + + if (!(ex instanceof Error)) + throw (new Error(jsSprintf('invalid type for %%r: %j', ex))); + + /* Note that V8 prepends "ex.stack" with ex.toString(). */ + ret = 'EXCEPTION: ' + ex.constructor.name + ': ' + ex.stack; + + if (ex.cause && typeof (ex.cause) === 'function') { + var cex = ex.cause(); + if (cex) { + ret += '\nCaused by: ' + dumpException(cex); + } + } + + return (ret); +} + + +/***/ }), + +/***/ 701: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +var net = __webpack_require__(631); +var urlParse = __webpack_require__(835).parse; +var util = __webpack_require__(669); +var pubsuffix = __webpack_require__(519); +var Store = __webpack_require__(627).Store; +var MemoryCookieStore = __webpack_require__(349).MemoryCookieStore; +var pathMatch = __webpack_require__(54).pathMatch; +var VERSION = __webpack_require__(158).version; + +var punycode; +try { + punycode = __webpack_require__(213); +} catch(e) { + console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); +} -/***/ 686: -/***/ (function(module) { +// From RFC6265 S4.1.1 +// note that it excludes \x3B ";" +var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; -module.exports = {"$id":"beforeRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; +var CONTROL_CHARS = /[\x00-\x1F]/; -/***/ }), +// From Chromium // '\r', '\n' and '\0' should be treated as a terminator in +// the "relaxed" mode, see: +// https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 +var TERMINATORS = ['\n', '\r', '\0']; -/***/ 696: -/***/ (function(module) { +// RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' +// Note ';' is \x3B +var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; -module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; +// date-time parsing constants (RFC6265 S5.1.1) -/***/ }), +var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; -/***/ 698: -/***/ (function(module) { +var MONTH_TO_NUM = { + jan:0, feb:1, mar:2, apr:3, may:4, jun:5, + jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 +}; +var NUM_TO_MONTH = [ + 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' +]; +var NUM_TO_DAY = [ + 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' +]; -module.exports = defer; +var MAX_TIME = 2147483647000; // 31-bit max +var MIN_TIME = 0; // 31-bit min -/** - * Runs provided function on next iteration of the event loop +/* + * Parses a Natural number (i.e., non-negative integer) with either the + * *DIGIT ( non-digit *OCTET ) + * or + * *DIGIT + * grammar (RFC6265 S5.1.1). * - * @param {function} fn - function to run + * The "trailingOK" boolean controls if the grammar accepts a + * "( non-digit *OCTET )" trailer. */ -function defer(fn) -{ - var nextTick = typeof setImmediate == 'function' - ? setImmediate - : ( - typeof process == 'object' && typeof process.nextTick == 'function' - ? process.nextTick - : null - ); +function parseDigits(token, minDigits, maxDigits, trailingOK) { + var count = 0; + while (count < token.length) { + var c = token.charCodeAt(count); + // "non-digit = %x00-2F / %x3A-FF" + if (c <= 0x2F || c >= 0x3A) { + break; + } + count++; + } - if (nextTick) - { - nextTick(fn); + // constrain to a minimum and maximum number of digits. + if (count < minDigits || count > maxDigits) { + return null; } - else - { - setTimeout(fn, 0); + + if (!trailingOK && count != token.length) { + return null; } + + return parseInt(token.substr(0,count), 10); } +function parseTime(token) { + var parts = token.split(':'); + var result = [0,0,0]; -/***/ }), + /* RF6256 S5.1.1: + * time = hms-time ( non-digit *OCTET ) + * hms-time = time-field ":" time-field ":" time-field + * time-field = 1*2DIGIT + */ -/***/ 703: -/***/ (function(module) { + if (parts.length !== 3) { + return null; + } -"use strict"; + for (var i = 0; i < 3; i++) { + // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be + // followed by "( non-digit *OCTET )" so therefore the last time-field can + // have a trailer + var trailingOK = (i == 2); + var num = parseDigits(parts[i], 1, 2, trailingOK); + if (num === null) { + return null; + } + result[i] = num; + } -module.exports = function generate_dependencies(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $schemaDeps = {}, - $propertyDeps = {}, - $ownProperties = it.opts.ownProperties; - for ($property in $schema) { - var $sch = $schema[$property]; - var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps; - $deps[$property] = $sch; + return result; +} + +function parseMonth(token) { + token = String(token).substr(0,3).toLowerCase(); + var num = MONTH_TO_NUM[token]; + return num >= 0 ? num : null; +} + +/* + * RFC6265 S5.1.1 date parser (see RFC for full grammar) + */ +function parseDate(str) { + if (!str) { + return; } - out += 'var ' + ($errs) + ' = errors;'; - var $currentErrorPath = it.errorPath; - out += 'var missing' + ($lvl) + ';'; - for (var $property in $propertyDeps) { - $deps = $propertyDeps[$property]; - if ($deps.length) { - out += ' if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; - } - if ($breakOnError) { - out += ' && ( '; - var arr1 = $deps; - if (arr1) { - var $propertyKey, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $propertyKey = arr1[$i += 1]; - if ($i) { - out += ' || '; - } - var $prop = it.util.getProperty($propertyKey), - $useData = $data + $prop; - out += ' ( ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; - } - } - out += ')) { '; - var $propertyPath = 'missing' + $lvl, - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should have '; - if ($deps.length == 1) { - out += 'property ' + (it.util.escapeQuotes($deps[0])); - } else { - out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); - } - out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - } else { - out += ' ) { '; - var arr2 = $deps; - if (arr2) { - var $propertyKey, i2 = -1, - l2 = arr2.length - 1; - while (i2 < l2) { - $propertyKey = arr2[i2 += 1]; - var $prop = it.util.getProperty($propertyKey), - $missingProperty = it.util.escapeQuotes($propertyKey), - $useData = $data + $prop; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); - } - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should have '; - if ($deps.length == 1) { - out += 'property ' + (it.util.escapeQuotes($deps[0])); - } else { - out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); - } - out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; - } - } + + /* RFC6265 S5.1.1: + * 2. Process each date-token sequentially in the order the date-tokens + * appear in the cookie-date + */ + var tokens = str.split(DATE_DELIM); + if (!tokens) { + return; + } + + var hour = null; + var minute = null; + var second = null; + var dayOfMonth = null; + var month = null; + var year = null; + + for (var i=0; i 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; + + /* 2.3. If the found-month flag is not set and the date-token matches the + * month production, set the found-month flag and set the month-value to + * the month denoted by the date-token. Skip the remaining sub-steps and + * continue to the next date-token. + */ + if (month === null) { + result = parseMonth(token); + if (result !== null) { + month = result; + continue; } - out += ') { '; - $it.schema = $sch; - $it.schemaPath = $schemaPath + it.util.getProperty($property); - $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; + } + + /* 2.4. If the found-year flag is not set and the date-token matches the + * year production, set the found-year flag and set the year-value to the + * number denoted by the date-token. Skip the remaining sub-steps and + * continue to the next date-token. + */ + if (year === null) { + // "year = 2*4DIGIT ( non-digit *OCTET )" + result = parseDigits(token, 2, 4, true); + if (result !== null) { + year = result; + /* From S5.1.1: + * 3. If the year-value is greater than or equal to 70 and less + * than or equal to 99, increment the year-value by 1900. + * 4. If the year-value is greater than or equal to 0 and less + * than or equal to 69, increment the year-value by 2000. + */ + if (year >= 70 && year <= 99) { + year += 1900; + } else if (year >= 0 && year <= 69) { + year += 2000; + } } } } - if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + + /* RFC 6265 S5.1.1 + * "5. Abort these steps and fail to parse the cookie-date if: + * * at least one of the found-day-of-month, found-month, found- + * year, or found-time flags is not set, + * * the day-of-month-value is less than 1 or greater than 31, + * * the year-value is less than 1601, + * * the hour-value is greater than 23, + * * the minute-value is greater than 59, or + * * the second-value is greater than 59. + * (Note that leap seconds cannot be represented in this syntax.)" + * + * So, in order as above: + */ + if ( + dayOfMonth === null || month === null || year === null || second === null || + dayOfMonth < 1 || dayOfMonth > 31 || + year < 1601 || + hour > 23 || + minute > 59 || + second > 59 + ) { + return; } - out = it.util.cleanUpCode(out); - return out; + + return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); } +function formatDate(date) { + var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; + var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; + var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; + var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; + return NUM_TO_DAY[date.getUTCDay()] + ', ' + + d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ + h+':'+m+':'+s+' GMT'; +} -/***/ }), +// S5.1.2 Canonicalized Host Names +function canonicalDomain(str) { + if (str == null) { + return null; + } + str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . -/***/ 729: -/***/ (function(module) { + // convert to IDN if any non-ASCII characters + if (punycode && /[^\u0001-\u007f]/.test(str)) { + str = punycode.toASCII(str); + } -// API -module.exports = state; + return str.toLowerCase(); +} -/** - * Creates initial state object - * for iteration over list - * - * @param {array|object} list - list to iterate over - * @param {function|null} sortMethod - function to use for keys sort, - * or `null` to keep them as is - * @returns {object} - initial state object - */ -function state(list, sortMethod) -{ - var isNamedList = !Array.isArray(list) - , initState = - { - index : 0, - keyedList: isNamedList || sortMethod ? Object.keys(list) : null, - jobs : {}, - results : isNamedList ? {} : [], - size : isNamedList ? Object.keys(list).length : list.length - } - ; +// S5.1.3 Domain Matching +function domainMatch(str, domStr, canonicalize) { + if (str == null || domStr == null) { + return null; + } + if (canonicalize !== false) { + str = canonicalDomain(str); + domStr = canonicalDomain(domStr); + } - if (sortMethod) - { - // sort array keys based on it's values - // sort object's keys just on own merit - initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) - { - return sortMethod(list[a], list[b]); - }); + /* + * "The domain string and the string are identical. (Note that both the + * domain string and the string will have been canonicalized to lower case at + * this point)" + */ + if (str == domStr) { + return true; + } + + /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ + + /* "* The string is a host name (i.e., not an IP address)." */ + if (net.isIP(str)) { + return false; + } + + /* "* The domain string is a suffix of the string" */ + var idx = str.indexOf(domStr); + if (idx <= 0) { + return false; // it's a non-match (-1) or prefix (0) + } + + // e.g "a.b.c".indexOf("b.c") === 2 + // 5 === 3+2 + if (str.length !== domStr.length + idx) { // it's not a suffix + return false; + } + + /* "* The last character of the string that is not included in the domain + * string is a %x2E (".") character." */ + if (str.substr(idx-1,1) !== '.') { + return false; } - return initState; + return true; } -/***/ }), +// RFC6265 S5.1.4 Paths and Path-Match -/***/ 734: -/***/ (function(__unusedmodule, exports) { +/* + * "The user agent MUST use an algorithm equivalent to the following algorithm + * to compute the default-path of a cookie:" + * + * Assumption: the path (and not query part or absolute uri) is passed in. + */ +function defaultPath(path) { + // "2. If the uri-path is empty or if the first character of the uri-path is not + // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. + if (!path || path.substr(0,1) !== "/") { + return "/"; + } -/** @license URI.js v4.2.1 (c) 2011 Gary Court. License: http://github.com/garycourt/uri-js */ -(function (global, factory) { - true ? factory(exports) : - undefined; -}(this, (function (exports) { 'use strict'; + // "3. If the uri-path contains no more than one %x2F ("/") character, output + // %x2F ("/") and skip the remaining step." + if (path === "/") { + return path; + } -function merge() { - for (var _len = arguments.length, sets = Array(_len), _key = 0; _key < _len; _key++) { - sets[_key] = arguments[_key]; - } + var rightSlash = path.lastIndexOf("/"); + if (rightSlash === 0) { + return "/"; + } - if (sets.length > 1) { - sets[0] = sets[0].slice(0, -1); - var xl = sets.length - 1; - for (var x = 1; x < xl; ++x) { - sets[x] = sets[x].slice(1, -1); - } - sets[xl] = sets[xl].slice(1); - return sets.join(''); - } else { - return sets[0]; - } -} -function subexp(str) { - return "(?:" + str + ")"; -} -function typeOf(o) { - return o === undefined ? "undefined" : o === null ? "null" : Object.prototype.toString.call(o).split(" ").pop().split("]").shift().toLowerCase(); -} -function toUpperCase(str) { - return str.toUpperCase(); -} -function toArray(obj) { - return obj !== undefined && obj !== null ? obj instanceof Array ? obj : typeof obj.length !== "number" || obj.split || obj.setInterval || obj.call ? [obj] : Array.prototype.slice.call(obj) : []; + // "4. Output the characters of the uri-path from the first character up to, + // but not including, the right-most %x2F ("/")." + return path.slice(0, rightSlash); } -function assign(target, source) { - var obj = target; - if (source) { - for (var key in source) { - obj[key] = source[key]; - } + +function trimTerminator(str) { + for (var t = 0; t < TERMINATORS.length; t++) { + var terminatorIdx = str.indexOf(TERMINATORS[t]); + if (terminatorIdx !== -1) { + str = str.substr(0,terminatorIdx); } - return obj; + } + + return str; } -function buildExps(isIRI) { - var ALPHA$$ = "[A-Za-z]", - CR$ = "[\\x0D]", - DIGIT$$ = "[0-9]", - DQUOTE$$ = "[\\x22]", - HEXDIG$$ = merge(DIGIT$$, "[A-Fa-f]"), - //case-insensitive - LF$$ = "[\\x0A]", - SP$$ = "[\\x20]", - PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)), - //expanded - GEN_DELIMS$$ = "[\\:\\/\\?\\#\\[\\]\\@]", - SUB_DELIMS$$ = "[\\!\\$\\&\\'\\(\\)\\*\\+\\,\\;\\=]", - RESERVED$$ = merge(GEN_DELIMS$$, SUB_DELIMS$$), - UCSCHAR$$ = isIRI ? "[\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF]" : "[]", - //subset, excludes bidi control characters - IPRIVATE$$ = isIRI ? "[\\uE000-\\uF8FF]" : "[]", - //subset - UNRESERVED$$ = merge(ALPHA$$, DIGIT$$, "[\\-\\.\\_\\~]", UCSCHAR$$), - SCHEME$ = subexp(ALPHA$$ + merge(ALPHA$$, DIGIT$$, "[\\+\\-\\.]") + "*"), - USERINFO$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]")) + "*"), - DEC_OCTET$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("[1-9]" + DIGIT$$) + "|" + DIGIT$$), - DEC_OCTET_RELAXED$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("0?[1-9]" + DIGIT$$) + "|0?0?" + DIGIT$$), - //relaxed parsing rules - IPV4ADDRESS$ = subexp(DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$), - H16$ = subexp(HEXDIG$$ + "{1,4}"), - LS32$ = subexp(subexp(H16$ + "\\:" + H16$) + "|" + IPV4ADDRESS$), - IPV6ADDRESS1$ = subexp(subexp(H16$ + "\\:") + "{6}" + LS32$), - // 6( h16 ":" ) ls32 - IPV6ADDRESS2$ = subexp("\\:\\:" + subexp(H16$ + "\\:") + "{5}" + LS32$), - // "::" 5( h16 ":" ) ls32 - IPV6ADDRESS3$ = subexp(subexp(H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{4}" + LS32$), - //[ h16 ] "::" 4( h16 ":" ) ls32 - IPV6ADDRESS4$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,1}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{3}" + LS32$), - //[ *1( h16 ":" ) h16 ] "::" 3( h16 ":" ) ls32 - IPV6ADDRESS5$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,2}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{2}" + LS32$), - //[ *2( h16 ":" ) h16 ] "::" 2( h16 ":" ) ls32 - IPV6ADDRESS6$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,3}" + H16$) + "?\\:\\:" + H16$ + "\\:" + LS32$), - //[ *3( h16 ":" ) h16 ] "::" h16 ":" ls32 - IPV6ADDRESS7$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,4}" + H16$) + "?\\:\\:" + LS32$), - //[ *4( h16 ":" ) h16 ] "::" ls32 - IPV6ADDRESS8$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,5}" + H16$) + "?\\:\\:" + H16$), - //[ *5( h16 ":" ) h16 ] "::" h16 - IPV6ADDRESS9$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,6}" + H16$) + "?\\:\\:"), - //[ *6( h16 ":" ) h16 ] "::" - IPV6ADDRESS$ = subexp([IPV6ADDRESS1$, IPV6ADDRESS2$, IPV6ADDRESS3$, IPV6ADDRESS4$, IPV6ADDRESS5$, IPV6ADDRESS6$, IPV6ADDRESS7$, IPV6ADDRESS8$, IPV6ADDRESS9$].join("|")), - ZONEID$ = subexp(subexp(UNRESERVED$$ + "|" + PCT_ENCODED$) + "+"), - //RFC 6874 - IPV6ADDRZ$ = subexp(IPV6ADDRESS$ + "\\%25" + ZONEID$), - //RFC 6874 - IPV6ADDRZ_RELAXED$ = subexp(IPV6ADDRESS$ + subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + ZONEID$), - //RFC 6874, with relaxed parsing rules - IPVFUTURE$ = subexp("[vV]" + HEXDIG$$ + "+\\." + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]") + "+"), - IP_LITERAL$ = subexp("\\[" + subexp(IPV6ADDRZ_RELAXED$ + "|" + IPV6ADDRESS$ + "|" + IPVFUTURE$) + "\\]"), - //RFC 6874 - REG_NAME$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$)) + "*"), - HOST$ = subexp(IP_LITERAL$ + "|" + IPV4ADDRESS$ + "(?!" + REG_NAME$ + ")" + "|" + REG_NAME$), - PORT$ = subexp(DIGIT$$ + "*"), - AUTHORITY$ = subexp(subexp(USERINFO$ + "@") + "?" + HOST$ + subexp("\\:" + PORT$) + "?"), - PCHAR$ = subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@]")), - SEGMENT$ = subexp(PCHAR$ + "*"), - SEGMENT_NZ$ = subexp(PCHAR$ + "+"), - SEGMENT_NZ_NC$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\@]")) + "+"), - PATH_ABEMPTY$ = subexp(subexp("\\/" + SEGMENT$) + "*"), - PATH_ABSOLUTE$ = subexp("\\/" + subexp(SEGMENT_NZ$ + PATH_ABEMPTY$) + "?"), - //simplified - PATH_NOSCHEME$ = subexp(SEGMENT_NZ_NC$ + PATH_ABEMPTY$), - //simplified - PATH_ROOTLESS$ = subexp(SEGMENT_NZ$ + PATH_ABEMPTY$), - //simplified - PATH_EMPTY$ = "(?!" + PCHAR$ + ")", - PATH$ = subexp(PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), - QUERY$ = subexp(subexp(PCHAR$ + "|" + merge("[\\/\\?]", IPRIVATE$$)) + "*"), - FRAGMENT$ = subexp(subexp(PCHAR$ + "|[\\/\\?]") + "*"), - HIER_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), - URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), - RELATIVE_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$), - RELATIVE$ = subexp(RELATIVE_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), - URI_REFERENCE$ = subexp(URI$ + "|" + RELATIVE$), - ABSOLUTE_URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?"), - GENERIC_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", - RELATIVE_REF$ = "^(){0}" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", - ABSOLUTE_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?$", - SAMEDOC_REF$ = "^" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", - AUTHORITY_REF$ = "^" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?$"; - return { - NOT_SCHEME: new RegExp(merge("[^]", ALPHA$$, DIGIT$$, "[\\+\\-\\.]"), "g"), - NOT_USERINFO: new RegExp(merge("[^\\%\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), - NOT_HOST: new RegExp(merge("[^\\%\\[\\]\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), - NOT_PATH: new RegExp(merge("[^\\%\\/\\:\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), - NOT_PATH_NOSCHEME: new RegExp(merge("[^\\%\\/\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), - NOT_QUERY: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]", IPRIVATE$$), "g"), - NOT_FRAGMENT: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]"), "g"), - ESCAPE: new RegExp(merge("[^]", UNRESERVED$$, SUB_DELIMS$$), "g"), - UNRESERVED: new RegExp(UNRESERVED$$, "g"), - OTHER_CHARS: new RegExp(merge("[^\\%]", UNRESERVED$$, RESERVED$$), "g"), - PCT_ENCODED: new RegExp(PCT_ENCODED$, "g"), - IPV4ADDRESS: new RegExp("^(" + IPV4ADDRESS$ + ")$"), - IPV6ADDRESS: new RegExp("^\\[?(" + IPV6ADDRESS$ + ")" + subexp(subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + "(" + ZONEID$ + ")") + "?\\]?$") //RFC 6874, with relaxed parsing rules - }; +function parseCookiePair(cookiePair, looseMode) { + cookiePair = trimTerminator(cookiePair); + + var firstEq = cookiePair.indexOf('='); + if (looseMode) { + if (firstEq === 0) { // '=' is immediately at start + cookiePair = cookiePair.substr(1); + firstEq = cookiePair.indexOf('='); // might still need to split on '=' + } + } else { // non-loose mode + if (firstEq <= 0) { // no '=' or is at start + return; // needs to have non-empty "cookie-name" + } + } + + var cookieName, cookieValue; + if (firstEq <= 0) { + cookieName = ""; + cookieValue = cookiePair.trim(); + } else { + cookieName = cookiePair.substr(0, firstEq).trim(); + cookieValue = cookiePair.substr(firstEq+1).trim(); + } + + if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { + return; + } + + var c = new Cookie(); + c.key = cookieName; + c.value = cookieValue; + return c; } -var URI_PROTOCOL = buildExps(false); -var IRI_PROTOCOL = buildExps(true); +function parse(str, options) { + if (!options || typeof options !== 'object') { + options = {}; + } + str = str.trim(); -var slicedToArray = function () { - function sliceIterator(arr, i) { - var _arr = []; - var _n = true; - var _d = false; - var _e = undefined; + // We use a regex to parse the "name-value-pair" part of S5.2 + var firstSemi = str.indexOf(';'); // S5.2 step 1 + var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); + var c = parseCookiePair(cookiePair, !!options.loose); + if (!c) { + return; + } - try { - for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { - _arr.push(_s.value); + if (firstSemi === -1) { + return c; + } - if (i && _arr.length === i) break; - } - } catch (err) { - _d = true; - _e = err; - } finally { - try { - if (!_n && _i["return"]) _i["return"](); - } finally { - if (_d) throw _e; - } - } + // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string + // (including the %x3B (";") in question)." plus later on in the same section + // "discard the first ";" and trim". + var unparsed = str.slice(firstSemi + 1).trim(); - return _arr; + // "If the unparsed-attributes string is empty, skip the rest of these + // steps." + if (unparsed.length === 0) { + return c; } - return function (arr, i) { - if (Array.isArray(arr)) { - return arr; - } else if (Symbol.iterator in Object(arr)) { - return sliceIterator(arr, i); - } else { - throw new TypeError("Invalid attempt to destructure non-iterable instance"); + /* + * S5.2 says that when looping over the items "[p]rocess the attribute-name + * and attribute-value according to the requirements in the following + * subsections" for every item. Plus, for many of the individual attributes + * in S5.3 it says to use the "attribute-value of the last attribute in the + * cookie-attribute-list". Therefore, in this implementation, we overwrite + * the previous value. + */ + var cookie_avs = unparsed.split(';'); + while (cookie_avs.length) { + var av = cookie_avs.shift().trim(); + if (av.length === 0) { // happens if ";;" appears + continue; } - }; -}(); + var av_sep = av.indexOf('='); + var av_key, av_value; + if (av_sep === -1) { + av_key = av; + av_value = null; + } else { + av_key = av.substr(0,av_sep); + av_value = av.substr(av_sep+1); + } + av_key = av_key.trim().toLowerCase(); + if (av_value) { + av_value = av_value.trim(); + } + switch(av_key) { + case 'expires': // S5.2.1 + if (av_value) { + var exp = parseDate(av_value); + // "If the attribute-value failed to parse as a cookie date, ignore the + // cookie-av." + if (exp) { + // over and underflow not realistically a concern: V8's getTime() seems to + // store something larger than a 32-bit time_t (even with 32-bit node) + c.expires = exp; + } + } + break; + case 'max-age': // S5.2.2 + if (av_value) { + // "If the first character of the attribute-value is not a DIGIT or a "-" + // character ...[or]... If the remainder of attribute-value contains a + // non-DIGIT character, ignore the cookie-av." + if (/^-?[0-9]+$/.test(av_value)) { + var delta = parseInt(av_value, 10); + // "If delta-seconds is less than or equal to zero (0), let expiry-time + // be the earliest representable date and time." + c.setMaxAge(delta); + } + } + break; + case 'domain': // S5.2.3 + // "If the attribute-value is empty, the behavior is undefined. However, + // the user agent SHOULD ignore the cookie-av entirely." + if (av_value) { + // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E + // (".") character." + var domain = av_value.trim().replace(/^\./, ''); + if (domain) { + // "Convert the cookie-domain to lower case." + c.domain = domain.toLowerCase(); + } + } + break; + case 'path': // S5.2.4 + /* + * "If the attribute-value is empty or if the first character of the + * attribute-value is not %x2F ("/"): + * Let cookie-path be the default-path. + * Otherwise: + * Let cookie-path be the attribute-value." + * + * We'll represent the default-path as null since it depends on the + * context of the parsing. + */ + c.path = av_value && av_value[0] === "/" ? av_value : null; + break; + case 'secure': // S5.2.5 + /* + * "If the attribute-name case-insensitively matches the string "Secure", + * the user agent MUST append an attribute to the cookie-attribute-list + * with an attribute-name of Secure and an empty attribute-value." + */ + c.secure = true; + break; + case 'httponly': // S5.2.6 -- effectively the same as 'secure' + c.httpOnly = true; + break; + default: + c.extensions = c.extensions || []; + c.extensions.push(av); + break; + } + } + return c; +} +// avoid the V8 deoptimization monster! +function jsonParse(str) { + var obj; + try { + obj = JSON.parse(str); + } catch (e) { + return e; + } + return obj; +} -var toConsumableArray = function (arr) { - if (Array.isArray(arr)) { - for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i]; +function fromJSON(str) { + if (!str) { + return null; + } - return arr2; + var obj; + if (typeof str === 'string') { + obj = jsonParse(str); + if (obj instanceof Error) { + return null; + } } else { - return Array.from(arr); + // assume it's an Object + obj = str; } -}; -/** Highest positive signed 32-bit float value */ + var c = new Cookie(); + for (var i=0; i= 0x80 (not a basic code point)', - 'invalid-input': 'Invalid input' -}; +function cookieCompare(a,b) { + var cmp = 0; -/** Convenience shortcuts */ -var baseMinusTMin = base - tMin; -var floor = Math.floor; -var stringFromCharCode = String.fromCharCode; + // descending for length: b CMP a + var aPathLen = a.path ? a.path.length : 0; + var bPathLen = b.path ? b.path.length : 0; + cmp = bPathLen - aPathLen; + if (cmp !== 0) { + return cmp; + } -/*--------------------------------------------------------------------------*/ + // ascending for time: a CMP b + var aTime = a.creation ? a.creation.getTime() : MAX_TIME; + var bTime = b.creation ? b.creation.getTime() : MAX_TIME; + cmp = aTime - bTime; + if (cmp !== 0) { + return cmp; + } -/** - * A generic error utility function. - * @private - * @param {String} type The error type. - * @returns {Error} Throws a `RangeError` with the applicable error message. - */ -function error$1(type) { - throw new RangeError(errors[type]); + // break ties for the same millisecond (precision of JavaScript's clock) + cmp = a.creationIndex - b.creationIndex; + + return cmp; } -/** - * A generic `Array#map` utility function. - * @private - * @param {Array} array The array to iterate over. - * @param {Function} callback The function that gets called for every array - * item. - * @returns {Array} A new array of values returned by the callback function. - */ -function map(array, fn) { - var result = []; - var length = array.length; - while (length--) { - result[length] = fn(array[length]); - } - return result; +// Gives the permutation of all possible pathMatch()es of a given path. The +// array is in longest-to-shortest order. Handy for indexing. +function permutePath(path) { + if (path === '/') { + return ['/']; + } + if (path.lastIndexOf('/') === path.length-1) { + path = path.substr(0,path.length-1); + } + var permutations = [path]; + while (path.length > 1) { + var lindex = path.lastIndexOf('/'); + if (lindex === 0) { + break; + } + path = path.substr(0,lindex); + permutations.push(path); + } + permutations.push('/'); + return permutations; } -/** - * A simple `Array#map`-like wrapper to work with domain name strings or email - * addresses. - * @private - * @param {String} domain The domain name or email address. - * @param {Function} callback The function that gets called for every - * character. - * @returns {Array} A new string of characters returned by the callback - * function. - */ -function mapDomain(string, fn) { - var parts = string.split('@'); - var result = ''; - if (parts.length > 1) { - // In email addresses, only the domain name should be punycoded. Leave - // the local part (i.e. everything up to `@`) intact. - result = parts[0] + '@'; - string = parts[1]; - } - // Avoid `split(regex)` for IE8 compatibility. See #17. - string = string.replace(regexSeparators, '\x2E'); - var labels = string.split('.'); - var encoded = map(labels, fn).join('.'); - return result + encoded; +function getCookieContext(url) { + if (url instanceof Object) { + return url; + } + // NOTE: decodeURI will throw on malformed URIs (see GH-32). + // Therefore, we will just skip decoding for such URIs. + try { + url = decodeURI(url); + } + catch(err) { + // Silently swallow error + } + + return urlParse(url); } -/** - * Creates an array containing the numeric code points of each Unicode - * character in the string. While JavaScript uses UCS-2 internally, - * this function will convert a pair of surrogate halves (each of which - * UCS-2 exposes as separate characters) into a single code point, - * matching UTF-16. - * @see `punycode.ucs2.encode` - * @see - * @memberOf punycode.ucs2 - * @name decode - * @param {String} string The Unicode input string (UCS-2). - * @returns {Array} The new array of code points. - */ -function ucs2decode(string) { - var output = []; - var counter = 0; - var length = string.length; - while (counter < length) { - var value = string.charCodeAt(counter++); - if (value >= 0xD800 && value <= 0xDBFF && counter < length) { - // It's a high surrogate, and there is a next character. - var extra = string.charCodeAt(counter++); - if ((extra & 0xFC00) == 0xDC00) { - // Low surrogate. - output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); - } else { - // It's an unmatched surrogate; only append this code unit, in case the - // next code unit is the high surrogate of a surrogate pair. - output.push(value); - counter--; - } - } else { - output.push(value); - } - } - return output; +function Cookie(options) { + options = options || {}; + + Object.keys(options).forEach(function(prop) { + if (Cookie.prototype.hasOwnProperty(prop) && + Cookie.prototype[prop] !== options[prop] && + prop.substr(0,1) !== '_') + { + this[prop] = options[prop]; + } + }, this); + + this.creation = this.creation || new Date(); + + // used to break creation ties in cookieCompare(): + Object.defineProperty(this, 'creationIndex', { + configurable: false, + enumerable: false, // important for assert.deepEqual checks + writable: true, + value: ++Cookie.cookiesCreated + }); } -/** - * Creates a string based on an array of numeric code points. - * @see `punycode.ucs2.decode` - * @memberOf punycode.ucs2 - * @name encode - * @param {Array} codePoints The array of numeric code points. - * @returns {String} The new Unicode string (UCS-2). - */ -var ucs2encode = function ucs2encode(array) { - return String.fromCodePoint.apply(String, toConsumableArray(array)); -}; +Cookie.cookiesCreated = 0; // incremented each time a cookie is created -/** - * Converts a basic code point into a digit/integer. - * @see `digitToBasic()` - * @private - * @param {Number} codePoint The basic numeric code point value. - * @returns {Number} The numeric value of a basic code point (for use in - * representing integers) in the range `0` to `base - 1`, or `base` if - * the code point does not represent a value. - */ -var basicToDigit = function basicToDigit(codePoint) { - if (codePoint - 0x30 < 0x0A) { - return codePoint - 0x16; - } - if (codePoint - 0x41 < 0x1A) { - return codePoint - 0x41; - } - if (codePoint - 0x61 < 0x1A) { - return codePoint - 0x61; - } - return base; -}; +Cookie.parse = parse; +Cookie.fromJSON = fromJSON; -/** - * Converts a digit/integer into a basic code point. - * @see `basicToDigit()` - * @private - * @param {Number} digit The numeric value of a basic code point. - * @returns {Number} The basic code point whose value (when used for - * representing integers) is `digit`, which needs to be in the range - * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is - * used; else, the lowercase form is used. The behavior is undefined - * if `flag` is non-zero and `digit` has no uppercase form. - */ -var digitToBasic = function digitToBasic(digit, flag) { - // 0..25 map to ASCII a..z or A..Z - // 26..35 map to ASCII 0..9 - return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); -}; +Cookie.prototype.key = ""; +Cookie.prototype.value = ""; -/** - * Bias adaptation function as per section 3.4 of RFC 3492. - * https://tools.ietf.org/html/rfc3492#section-3.4 - * @private - */ -var adapt = function adapt(delta, numPoints, firstTime) { - var k = 0; - delta = firstTime ? floor(delta / damp) : delta >> 1; - delta += floor(delta / numPoints); - for (; /* no initialization */delta > baseMinusTMin * tMax >> 1; k += base) { - delta = floor(delta / baseMinusTMin); - } - return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); -}; +// the order in which the RFC has them: +Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity +Cookie.prototype.maxAge = null; // takes precedence over expires for TTL +Cookie.prototype.domain = null; +Cookie.prototype.path = null; +Cookie.prototype.secure = false; +Cookie.prototype.httpOnly = false; +Cookie.prototype.extensions = null; -/** - * Converts a Punycode string of ASCII-only symbols to a string of Unicode - * symbols. - * @memberOf punycode - * @param {String} input The Punycode string of ASCII-only symbols. - * @returns {String} The resulting string of Unicode symbols. - */ -var decode = function decode(input) { - // Don't use UCS-2. - var output = []; - var inputLength = input.length; - var i = 0; - var n = initialN; - var bias = initialBias; +// set by the CookieJar: +Cookie.prototype.hostOnly = null; // boolean when set +Cookie.prototype.pathIsDefault = null; // boolean when set +Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse +Cookie.prototype.lastAccessed = null; // Date when set +Object.defineProperty(Cookie.prototype, 'creationIndex', { + configurable: true, + enumerable: false, + writable: true, + value: 0 +}); - // Handle the basic code points: let `basic` be the number of input code - // points before the last delimiter, or `0` if there is none, then copy - // the first basic code points to the output. +Cookie.serializableProperties = Object.keys(Cookie.prototype) + .filter(function(prop) { + return !( + Cookie.prototype[prop] instanceof Function || + prop === 'creationIndex' || + prop.substr(0,1) === '_' + ); + }); - var basic = input.lastIndexOf(delimiter); - if (basic < 0) { - basic = 0; - } +Cookie.prototype.inspect = function inspect() { + var now = Date.now(); + return 'Cookie="'+this.toString() + + '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + + '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + + '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + + '"'; +}; - for (var j = 0; j < basic; ++j) { - // if it's not a basic code point - if (input.charCodeAt(j) >= 0x80) { - error$1('not-basic'); - } - output.push(input.charCodeAt(j)); - } +// Use the new custom inspection symbol to add the custom inspect function if +// available. +if (util.inspect.custom) { + Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; +} - // Main decoding loop: start just after the last delimiter if any basic code - // points were copied; start at the beginning otherwise. +Cookie.prototype.toJSON = function() { + var obj = {}; - for (var index = basic > 0 ? basic + 1 : 0; index < inputLength;) /* no final expression */{ + var props = Cookie.serializableProperties; + for (var i=0; i= inputLength) { - error$1('invalid-input'); - } + return obj; +}; - var digit = basicToDigit(input.charCodeAt(index++)); +Cookie.prototype.clone = function() { + return fromJSON(this.toJSON()); +}; - if (digit >= base || digit > floor((maxInt - i) / w)) { - error$1('overflow'); - } +Cookie.prototype.validate = function validate() { + if (!COOKIE_OCTETS.test(this.value)) { + return false; + } + if (this.expires != Infinity && !(this.expires instanceof Date) && !parseDate(this.expires)) { + return false; + } + if (this.maxAge != null && this.maxAge <= 0) { + return false; // "Max-Age=" non-zero-digit *DIGIT + } + if (this.path != null && !PATH_VALUE.test(this.path)) { + return false; + } - i += digit * w; - var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + var cdomain = this.cdomain(); + if (cdomain) { + if (cdomain.match(/\.$/)) { + return false; // S4.1.2.3 suggests that this is bad. domainMatch() tests confirm this + } + var suffix = pubsuffix.getPublicSuffix(cdomain); + if (suffix == null) { // it's a public suffix + return false; + } + } + return true; +}; - if (digit < t) { - break; - } +Cookie.prototype.setExpires = function setExpires(exp) { + if (exp instanceof Date) { + this.expires = exp; + } else { + this.expires = parseDate(exp) || "Infinity"; + } +}; - var baseMinusT = base - t; - if (w > floor(maxInt / baseMinusT)) { - error$1('overflow'); - } +Cookie.prototype.setMaxAge = function setMaxAge(age) { + if (age === Infinity || age === -Infinity) { + this.maxAge = age.toString(); // so JSON.stringify() works + } else { + this.maxAge = age; + } +}; - w *= baseMinusT; - } +// gives Cookie header format +Cookie.prototype.cookieString = function cookieString() { + var val = this.value; + if (val == null) { + val = ''; + } + if (this.key === '') { + return val; + } + return this.key+'='+val; +}; - var out = output.length + 1; - bias = adapt(i - oldi, out, oldi == 0); +// gives Set-Cookie header format +Cookie.prototype.toString = function toString() { + var str = this.cookieString(); - // `i` was supposed to wrap around from `out` to `0`, - // incrementing `n` each time, so we'll fix that now: - if (floor(i / out) > maxInt - n) { - error$1('overflow'); - } + if (this.expires != Infinity) { + if (this.expires instanceof Date) { + str += '; Expires='+formatDate(this.expires); + } else { + str += '; Expires='+this.expires; + } + } - n += floor(i / out); - i %= out; + if (this.maxAge != null && this.maxAge != Infinity) { + str += '; Max-Age='+this.maxAge; + } - // Insert `n` at position `i` of the output. - output.splice(i++, 0, n); - } + if (this.domain && !this.hostOnly) { + str += '; Domain='+this.domain; + } + if (this.path) { + str += '; Path='+this.path; + } - return String.fromCodePoint.apply(String, output); + if (this.secure) { + str += '; Secure'; + } + if (this.httpOnly) { + str += '; HttpOnly'; + } + if (this.extensions) { + this.extensions.forEach(function(ext) { + str += '; '+ext; + }); + } + + return str; }; -/** - * Converts a string of Unicode symbols (e.g. a domain name label) to a - * Punycode string of ASCII-only symbols. - * @memberOf punycode - * @param {String} input The string of Unicode symbols. - * @returns {String} The resulting Punycode string of ASCII-only symbols. - */ -var encode = function encode(input) { - var output = []; +// TTL() partially replaces the "expiry-time" parts of S5.3 step 3 (setCookie() +// elsewhere) +// S5.3 says to give the "latest representable date" for which we use Infinity +// For "expired" we use 0 +Cookie.prototype.TTL = function TTL(now) { + /* RFC6265 S4.1.2.2 If a cookie has both the Max-Age and the Expires + * attribute, the Max-Age attribute has precedence and controls the + * expiration date of the cookie. + * (Concurs with S5.3 step 3) + */ + if (this.maxAge != null) { + return this.maxAge<=0 ? 0 : this.maxAge*1000; + } - // Convert the input in UCS-2 to an array of Unicode code points. - input = ucs2decode(input); + var expires = this.expires; + if (expires != Infinity) { + if (!(expires instanceof Date)) { + expires = parseDate(expires) || Infinity; + } - // Cache the length. - var inputLength = input.length; + if (expires == Infinity) { + return Infinity; + } - // Initialize the state. - var n = initialN; - var delta = 0; - var bias = initialBias; + return expires.getTime() - (now || Date.now()); + } - // Handle the basic code points. - var _iteratorNormalCompletion = true; - var _didIteratorError = false; - var _iteratorError = undefined; + return Infinity; +}; - try { - for (var _iterator = input[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) { - var _currentValue2 = _step.value; +// expiryTime() replaces the "expiry-time" parts of S5.3 step 3 (setCookie() +// elsewhere) +Cookie.prototype.expiryTime = function expiryTime(now) { + if (this.maxAge != null) { + var relativeTo = now || this.creation || new Date(); + var age = (this.maxAge <= 0) ? -Infinity : this.maxAge*1000; + return relativeTo.getTime() + age; + } - if (_currentValue2 < 0x80) { - output.push(stringFromCharCode(_currentValue2)); - } - } - } catch (err) { - _didIteratorError = true; - _iteratorError = err; - } finally { - try { - if (!_iteratorNormalCompletion && _iterator.return) { - _iterator.return(); - } - } finally { - if (_didIteratorError) { - throw _iteratorError; - } - } - } + if (this.expires == Infinity) { + return Infinity; + } + return this.expires.getTime(); +}; - var basicLength = output.length; - var handledCPCount = basicLength; +// expiryDate() replaces the "expiry-time" parts of S5.3 step 3 (setCookie() +// elsewhere), except it returns a Date +Cookie.prototype.expiryDate = function expiryDate(now) { + var millisec = this.expiryTime(now); + if (millisec == Infinity) { + return new Date(MAX_TIME); + } else if (millisec == -Infinity) { + return new Date(MIN_TIME); + } else { + return new Date(millisec); + } +}; - // `handledCPCount` is the number of code points that have been handled; - // `basicLength` is the number of basic code points. +// This replaces the "persistent-flag" parts of S5.3 step 3 +Cookie.prototype.isPersistent = function isPersistent() { + return (this.maxAge != null || this.expires != Infinity); +}; - // Finish the basic string with a delimiter unless it's empty. - if (basicLength) { - output.push(delimiter); - } +// Mostly S5.1.2 and S5.2.3: +Cookie.prototype.cdomain = +Cookie.prototype.canonicalizedDomain = function canonicalizedDomain() { + if (this.domain == null) { + return null; + } + return canonicalDomain(this.domain); +}; + +function CookieJar(store, options) { + if (typeof options === "boolean") { + options = {rejectPublicSuffixes: options}; + } else if (options == null) { + options = {}; + } + if (options.rejectPublicSuffixes != null) { + this.rejectPublicSuffixes = options.rejectPublicSuffixes; + } + if (options.looseMode != null) { + this.enableLooseMode = options.looseMode; + } - // Main encoding loop: - while (handledCPCount < inputLength) { + if (!store) { + store = new MemoryCookieStore(); + } + this.store = store; +} +CookieJar.prototype.store = null; +CookieJar.prototype.rejectPublicSuffixes = true; +CookieJar.prototype.enableLooseMode = false; +var CAN_BE_SYNC = []; - // All non-basic code points < n have been handled already. Find the next - // larger one: - var m = maxInt; - var _iteratorNormalCompletion2 = true; - var _didIteratorError2 = false; - var _iteratorError2 = undefined; +CAN_BE_SYNC.push('setCookie'); +CookieJar.prototype.setCookie = function(cookie, url, options, cb) { + var err; + var context = getCookieContext(url); + if (options instanceof Function) { + cb = options; + options = {}; + } - try { - for (var _iterator2 = input[Symbol.iterator](), _step2; !(_iteratorNormalCompletion2 = (_step2 = _iterator2.next()).done); _iteratorNormalCompletion2 = true) { - var currentValue = _step2.value; + var host = canonicalDomain(context.hostname); + var loose = this.enableLooseMode; + if (options.loose != null) { + loose = options.loose; + } - if (currentValue >= n && currentValue < m) { - m = currentValue; - } - } + // S5.3 step 1 + if (!(cookie instanceof Cookie)) { + cookie = Cookie.parse(cookie, { loose: loose }); + } + if (!cookie) { + err = new Error("Cookie failed to parse"); + return cb(options.ignoreError ? null : err); + } - // Increase `delta` enough to advance the decoder's state to , - // but guard against overflow. - } catch (err) { - _didIteratorError2 = true; - _iteratorError2 = err; - } finally { - try { - if (!_iteratorNormalCompletion2 && _iterator2.return) { - _iterator2.return(); - } - } finally { - if (_didIteratorError2) { - throw _iteratorError2; - } - } - } + // S5.3 step 2 + var now = options.now || new Date(); // will assign later to save effort in the face of errors - var handledCPCountPlusOne = handledCPCount + 1; - if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { - error$1('overflow'); - } + // S5.3 step 3: NOOP; persistent-flag and expiry-time is handled by getCookie() - delta += (m - n) * handledCPCountPlusOne; - n = m; + // S5.3 step 4: NOOP; domain is null by default - var _iteratorNormalCompletion3 = true; - var _didIteratorError3 = false; - var _iteratorError3 = undefined; + // S5.3 step 5: public suffixes + if (this.rejectPublicSuffixes && cookie.domain) { + var suffix = pubsuffix.getPublicSuffix(cookie.cdomain()); + if (suffix == null) { // e.g. "com" + err = new Error("Cookie has domain set to a public suffix"); + return cb(options.ignoreError ? null : err); + } + } - try { - for (var _iterator3 = input[Symbol.iterator](), _step3; !(_iteratorNormalCompletion3 = (_step3 = _iterator3.next()).done); _iteratorNormalCompletion3 = true) { - var _currentValue = _step3.value; + // S5.3 step 6: + if (cookie.domain) { + if (!domainMatch(host, cookie.cdomain(), false)) { + err = new Error("Cookie not in this host's domain. Cookie:"+cookie.cdomain()+" Request:"+host); + return cb(options.ignoreError ? null : err); + } - if (_currentValue < n && ++delta > maxInt) { - error$1('overflow'); - } - if (_currentValue == n) { - // Represent delta as a generalized variable-length integer. - var q = delta; - for (var k = base;; /* no condition */k += base) { - var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; - if (q < t) { - break; - } - var qMinusT = q - t; - var baseMinusT = base - t; - output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); - q = floor(qMinusT / baseMinusT); - } + if (cookie.hostOnly == null) { // don't reset if already set + cookie.hostOnly = false; + } - output.push(stringFromCharCode(digitToBasic(q, 0))); - bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); - delta = 0; - ++handledCPCount; - } - } - } catch (err) { - _didIteratorError3 = true; - _iteratorError3 = err; - } finally { - try { - if (!_iteratorNormalCompletion3 && _iterator3.return) { - _iterator3.return(); - } - } finally { - if (_didIteratorError3) { - throw _iteratorError3; - } - } - } + } else { + cookie.hostOnly = true; + cookie.domain = host; + } - ++delta; - ++n; - } - return output.join(''); -}; + //S5.2.4 If the attribute-value is empty or if the first character of the + //attribute-value is not %x2F ("/"): + //Let cookie-path be the default-path. + if (!cookie.path || cookie.path[0] !== '/') { + cookie.path = defaultPath(context.pathname); + cookie.pathIsDefault = true; + } -/** - * Converts a Punycode string representing a domain name or an email address - * to Unicode. Only the Punycoded parts of the input will be converted, i.e. - * it doesn't matter if you call it on a string that has already been - * converted to Unicode. - * @memberOf punycode - * @param {String} input The Punycoded domain name or email address to - * convert to Unicode. - * @returns {String} The Unicode representation of the given Punycode - * string. - */ -var toUnicode = function toUnicode(input) { - return mapDomain(input, function (string) { - return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; - }); -}; + // S5.3 step 8: NOOP; secure attribute + // S5.3 step 9: NOOP; httpOnly attribute -/** - * Converts a Unicode string representing a domain name or an email address to - * Punycode. Only the non-ASCII parts of the domain name will be converted, - * i.e. it doesn't matter if you call it with a domain that's already in - * ASCII. - * @memberOf punycode - * @param {String} input The domain name or email address to convert, as a - * Unicode string. - * @returns {String} The Punycode representation of the given domain name or - * email address. - */ -var toASCII = function toASCII(input) { - return mapDomain(input, function (string) { - return regexNonASCII.test(string) ? 'xn--' + encode(string) : string; - }); -}; + // S5.3 step 10 + if (options.http === false && cookie.httpOnly) { + err = new Error("Cookie is HttpOnly and this isn't an HTTP API"); + return cb(options.ignoreError ? null : err); + } -/*--------------------------------------------------------------------------*/ + var store = this.store; -/** Define the public API */ -var punycode = { - /** - * A string representing the current Punycode.js version number. - * @memberOf punycode - * @type String - */ - 'version': '2.1.0', - /** - * An object of methods to convert from JavaScript's internal character - * representation (UCS-2) to Unicode code points, and back. - * @see - * @memberOf punycode - * @type Object - */ - 'ucs2': { - 'decode': ucs2decode, - 'encode': ucs2encode - }, - 'decode': decode, - 'encode': encode, - 'toASCII': toASCII, - 'toUnicode': toUnicode -}; + if (!store.updateCookie) { + store.updateCookie = function(oldCookie, newCookie, cb) { + this.putCookie(newCookie, cb); + }; + } -/** - * URI.js - * - * @fileoverview An RFC 3986 compliant, scheme extendable URI parsing/validating/resolving library for JavaScript. - * @author Gary Court - * @see http://github.com/garycourt/uri-js - */ -/** - * Copyright 2011 Gary Court. All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, are - * permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * THIS SOFTWARE IS PROVIDED BY GARY COURT ``AS IS'' AND ANY EXPRESS OR IMPLIED - * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND - * FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL GARY COURT OR - * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR - * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON - * ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF - * ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - * - * The views and conclusions contained in the software and documentation are those of the - * authors and should not be interpreted as representing official policies, either expressed - * or implied, of Gary Court. - */ -var SCHEMES = {}; -function pctEncChar(chr) { - var c = chr.charCodeAt(0); - var e = void 0; - if (c < 16) e = "%0" + c.toString(16).toUpperCase();else if (c < 128) e = "%" + c.toString(16).toUpperCase();else if (c < 2048) e = "%" + (c >> 6 | 192).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase();else e = "%" + (c >> 12 | 224).toString(16).toUpperCase() + "%" + (c >> 6 & 63 | 128).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase(); - return e; -} -function pctDecChars(str) { - var newStr = ""; - var i = 0; - var il = str.length; - while (i < il) { - var c = parseInt(str.substr(i + 1, 2), 16); - if (c < 128) { - newStr += String.fromCharCode(c); - i += 3; - } else if (c >= 194 && c < 224) { - if (il - i >= 6) { - var c2 = parseInt(str.substr(i + 4, 2), 16); - newStr += String.fromCharCode((c & 31) << 6 | c2 & 63); - } else { - newStr += str.substr(i, 6); - } - i += 6; - } else if (c >= 224) { - if (il - i >= 9) { - var _c = parseInt(str.substr(i + 4, 2), 16); - var c3 = parseInt(str.substr(i + 7, 2), 16); - newStr += String.fromCharCode((c & 15) << 12 | (_c & 63) << 6 | c3 & 63); - } else { - newStr += str.substr(i, 9); - } - i += 9; - } else { - newStr += str.substr(i, 3); - i += 3; - } - } - return newStr; -} -function _normalizeComponentEncoding(components, protocol) { - function decodeUnreserved(str) { - var decStr = pctDecChars(str); - return !decStr.match(protocol.UNRESERVED) ? str : decStr; + function withCookie(err, oldCookie) { + if (err) { + return cb(err); } - if (components.scheme) components.scheme = String(components.scheme).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_SCHEME, ""); - if (components.userinfo !== undefined) components.userinfo = String(components.userinfo).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_USERINFO, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); - if (components.host !== undefined) components.host = String(components.host).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_HOST, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); - if (components.path !== undefined) components.path = String(components.path).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(components.scheme ? protocol.NOT_PATH : protocol.NOT_PATH_NOSCHEME, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); - if (components.query !== undefined) components.query = String(components.query).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_QUERY, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); - if (components.fragment !== undefined) components.fragment = String(components.fragment).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_FRAGMENT, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); - return components; -} -function _stripLeadingZeros(str) { - return str.replace(/^0*(.*)/, "$1") || "0"; -} -function _normalizeIPv4(host, protocol) { - var matches = host.match(protocol.IPV4ADDRESS) || []; + var next = function(err) { + if (err) { + return cb(err); + } else { + cb(null, cookie); + } + }; - var _matches = slicedToArray(matches, 2), - address = _matches[1]; + if (oldCookie) { + // S5.3 step 11 - "If the cookie store contains a cookie with the same name, + // domain, and path as the newly created cookie:" + if (options.http === false && oldCookie.httpOnly) { // step 11.2 + err = new Error("old Cookie is HttpOnly and this isn't an HTTP API"); + return cb(options.ignoreError ? null : err); + } + cookie.creation = oldCookie.creation; // step 11.3 + cookie.creationIndex = oldCookie.creationIndex; // preserve tie-breaker + cookie.lastAccessed = now; + // Step 11.4 (delete cookie) is implied by just setting the new one: + store.updateCookie(oldCookie, cookie, next); // step 12 - if (address) { - return address.split(".").map(_stripLeadingZeros).join("."); } else { - return host; + cookie.creation = cookie.lastAccessed = now; + store.putCookie(cookie, next); // step 12 } -} -function _normalizeIPv6(host, protocol) { - var matches = host.match(protocol.IPV6ADDRESS) || []; + } - var _matches2 = slicedToArray(matches, 3), - address = _matches2[1], - zone = _matches2[2]; + store.findCookie(cookie.domain, cookie.path, cookie.key, withCookie); +}; - if (address) { - var _address$toLowerCase$ = address.toLowerCase().split('::').reverse(), - _address$toLowerCase$2 = slicedToArray(_address$toLowerCase$, 2), - last = _address$toLowerCase$2[0], - first = _address$toLowerCase$2[1]; +// RFC6365 S5.4 +CAN_BE_SYNC.push('getCookies'); +CookieJar.prototype.getCookies = function(url, options, cb) { + var context = getCookieContext(url); + if (options instanceof Function) { + cb = options; + options = {}; + } - var firstFields = first ? first.split(":").map(_stripLeadingZeros) : []; - var lastFields = last.split(":").map(_stripLeadingZeros); - var isLastFieldIPv4Address = protocol.IPV4ADDRESS.test(lastFields[lastFields.length - 1]); - var fieldCount = isLastFieldIPv4Address ? 7 : 8; - var lastFieldsStart = lastFields.length - fieldCount; - var fields = Array(fieldCount); - for (var x = 0; x < fieldCount; ++x) { - fields[x] = firstFields[x] || lastFields[lastFieldsStart + x] || ''; - } - if (isLastFieldIPv4Address) { - fields[fieldCount - 1] = _normalizeIPv4(fields[fieldCount - 1], protocol); - } - var allZeroFields = fields.reduce(function (acc, field, index) { - if (!field || field === "0") { - var lastLongest = acc[acc.length - 1]; - if (lastLongest && lastLongest.index + lastLongest.length === index) { - lastLongest.length++; - } else { - acc.push({ index: index, length: 1 }); - } - } - return acc; - }, []); - var longestZeroFields = allZeroFields.sort(function (a, b) { - return b.length - a.length; - })[0]; - var newHost = void 0; - if (longestZeroFields && longestZeroFields.length > 1) { - var newFirst = fields.slice(0, longestZeroFields.index); - var newLast = fields.slice(longestZeroFields.index + longestZeroFields.length); - newHost = newFirst.join(":") + "::" + newLast.join(":"); - } else { - newHost = fields.join(":"); - } - if (zone) { - newHost += "%" + zone; - } - return newHost; - } else { - return host; - } -} -var URI_PARSE = /^(?:([^:\/?#]+):)?(?:\/\/((?:([^\/?#@]*)@)?(\[[^\/?#\]]+\]|[^\/?#:]*)(?:\:(\d*))?))?([^?#]*)(?:\?([^#]*))?(?:#((?:.|\n|\r)*))?/i; -var NO_MATCH_IS_UNDEFINED = "".match(/(){0}/)[1] === undefined; -function parse(uriString) { - var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var host = canonicalDomain(context.hostname); + var path = context.pathname || '/'; - var components = {}; - var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; - if (options.reference === "suffix") uriString = (options.scheme ? options.scheme + ":" : "") + "//" + uriString; - var matches = uriString.match(URI_PARSE); - if (matches) { - if (NO_MATCH_IS_UNDEFINED) { - //store each component - components.scheme = matches[1]; - components.userinfo = matches[3]; - components.host = matches[4]; - components.port = parseInt(matches[5], 10); - components.path = matches[6] || ""; - components.query = matches[7]; - components.fragment = matches[8]; - //fix port number - if (isNaN(components.port)) { - components.port = matches[5]; - } - } else { - //IE FIX for improper RegExp matching - //store each component - components.scheme = matches[1] || undefined; - components.userinfo = uriString.indexOf("@") !== -1 ? matches[3] : undefined; - components.host = uriString.indexOf("//") !== -1 ? matches[4] : undefined; - components.port = parseInt(matches[5], 10); - components.path = matches[6] || ""; - components.query = uriString.indexOf("?") !== -1 ? matches[7] : undefined; - components.fragment = uriString.indexOf("#") !== -1 ? matches[8] : undefined; - //fix port number - if (isNaN(components.port)) { - components.port = uriString.match(/\/\/(?:.|\n)*\:(?:\/|\?|\#|$)/) ? matches[4] : undefined; - } - } - if (components.host) { - //normalize IP hosts - components.host = _normalizeIPv6(_normalizeIPv4(components.host, protocol), protocol); - } - //determine reference type - if (components.scheme === undefined && components.userinfo === undefined && components.host === undefined && components.port === undefined && !components.path && components.query === undefined) { - components.reference = "same-document"; - } else if (components.scheme === undefined) { - components.reference = "relative"; - } else if (components.fragment === undefined) { - components.reference = "absolute"; - } else { - components.reference = "uri"; - } - //check for reference errors - if (options.reference && options.reference !== "suffix" && options.reference !== components.reference) { - components.error = components.error || "URI is not a " + options.reference + " reference."; - } - //find scheme handler - var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; - //check if scheme can't handle IRIs - if (!options.unicodeSupport && (!schemeHandler || !schemeHandler.unicodeSupport)) { - //if host component is a domain name - if (components.host && (options.domainHost || schemeHandler && schemeHandler.domainHost)) { - //convert Unicode IDN -> ASCII IDN - try { - components.host = punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()); - } catch (e) { - components.error = components.error || "Host's domain name can not be converted to ASCII via punycode: " + e; - } - } - //convert IRI -> URI - _normalizeComponentEncoding(components, URI_PROTOCOL); - } else { - //normalize encodings - _normalizeComponentEncoding(components, protocol); - } - //perform scheme specific parsing - if (schemeHandler && schemeHandler.parse) { - schemeHandler.parse(components, options); - } + var secure = options.secure; + if (secure == null && context.protocol && + (context.protocol == 'https:' || context.protocol == 'wss:')) + { + secure = true; + } + + var http = options.http; + if (http == null) { + http = true; + } + + var now = options.now || Date.now(); + var expireCheck = options.expire !== false; + var allPaths = !!options.allPaths; + var store = this.store; + + function matchingCookie(c) { + // "Either: + // The cookie's host-only-flag is true and the canonicalized + // request-host is identical to the cookie's domain. + // Or: + // The cookie's host-only-flag is false and the canonicalized + // request-host domain-matches the cookie's domain." + if (c.hostOnly) { + if (c.domain != host) { + return false; + } } else { - components.error = components.error || "URI can not be parsed."; + if (!domainMatch(host, c.domain, false)) { + return false; + } } - return components; -} -function _recomposeAuthority(components, options) { - var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; - var uriTokens = []; - if (components.userinfo !== undefined) { - uriTokens.push(components.userinfo); - uriTokens.push("@"); - } - if (components.host !== undefined) { - //normalize IP hosts, add brackets and escape zone separator for IPv6 - uriTokens.push(_normalizeIPv6(_normalizeIPv4(String(components.host), protocol), protocol).replace(protocol.IPV6ADDRESS, function (_, $1, $2) { - return "[" + $1 + ($2 ? "%25" + $2 : "") + "]"; - })); + // "The request-uri's path path-matches the cookie's path." + if (!allPaths && !pathMatch(path, c.path)) { + return false; } - if (typeof components.port === "number") { - uriTokens.push(":"); - uriTokens.push(components.port.toString(10)); + + // "If the cookie's secure-only-flag is true, then the request-uri's + // scheme must denote a "secure" protocol" + if (c.secure && !secure) { + return false; } - return uriTokens.length ? uriTokens.join("") : undefined; -} -var RDS1 = /^\.\.?\//; -var RDS2 = /^\/\.(\/|$)/; -var RDS3 = /^\/\.\.(\/|$)/; -var RDS5 = /^\/?(?:.|\n)*?(?=\/|$)/; -function removeDotSegments(input) { - var output = []; - while (input.length) { - if (input.match(RDS1)) { - input = input.replace(RDS1, ""); - } else if (input.match(RDS2)) { - input = input.replace(RDS2, "/"); - } else if (input.match(RDS3)) { - input = input.replace(RDS3, "/"); - output.pop(); - } else if (input === "." || input === "..") { - input = ""; - } else { - var im = input.match(RDS5); - if (im) { - var s = im[0]; - input = input.slice(s.length); - output.push(s); - } else { - throw new Error("Unexpected dot segment condition"); - } - } + // "If the cookie's http-only-flag is true, then exclude the cookie if the + // cookie-string is being generated for a "non-HTTP" API" + if (c.httpOnly && !http) { + return false; } - return output.join(""); -} -function serialize(components) { - var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + // deferred from S5.3 + // non-RFC: allow retention of expired cookies by choice + if (expireCheck && c.expiryTime() <= now) { + store.removeCookie(c.domain, c.path, c.key, function(){}); // result ignored + return false; + } - var protocol = options.iri ? IRI_PROTOCOL : URI_PROTOCOL; - var uriTokens = []; - //find scheme handler - var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; - //perform scheme specific serialization - if (schemeHandler && schemeHandler.serialize) schemeHandler.serialize(components, options); - if (components.host) { - //if host component is an IPv6 address - if (protocol.IPV6ADDRESS.test(components.host)) {} - //TODO: normalize IPv6 address as per RFC 5952 + return true; + } - //if host component is a domain name - else if (options.domainHost || schemeHandler && schemeHandler.domainHost) { - //convert IDN via punycode - try { - components.host = !options.iri ? punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()) : punycode.toUnicode(components.host); - } catch (e) { - components.error = components.error || "Host's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; - } - } - } - //normalize encoding - _normalizeComponentEncoding(components, protocol); - if (options.reference !== "suffix" && components.scheme) { - uriTokens.push(components.scheme); - uriTokens.push(":"); - } - var authority = _recomposeAuthority(components, options); - if (authority !== undefined) { - if (options.reference !== "suffix") { - uriTokens.push("//"); - } - uriTokens.push(authority); - if (components.path && components.path.charAt(0) !== "/") { - uriTokens.push("/"); - } - } - if (components.path !== undefined) { - var s = components.path; - if (!options.absolutePath && (!schemeHandler || !schemeHandler.absolutePath)) { - s = removeDotSegments(s); - } - if (authority === undefined) { - s = s.replace(/^\/\//, "/%2F"); //don't allow the path to start with "//" - } - uriTokens.push(s); - } - if (components.query !== undefined) { - uriTokens.push("?"); - uriTokens.push(components.query); + store.findCookies(host, allPaths ? null : path, function(err,cookies) { + if (err) { + return cb(err); } - if (components.fragment !== undefined) { - uriTokens.push("#"); - uriTokens.push(components.fragment); + + cookies = cookies.filter(matchingCookie); + + // sorting of S5.4 part 2 + if (options.sort !== false) { + cookies = cookies.sort(cookieCompare); } - return uriTokens.join(""); //merge tokens into a string -} -function resolveComponents(base, relative) { - var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; - var skipNormalization = arguments[3]; + // S5.4 part 3 + var now = new Date(); + cookies.forEach(function(c) { + c.lastAccessed = now; + }); + // TODO persist lastAccessed - var target = {}; - if (!skipNormalization) { - base = parse(serialize(base, options), options); //normalize base components - relative = parse(serialize(relative, options), options); //normalize relative components + cb(null,cookies); + }); +}; + +CAN_BE_SYNC.push('getCookieString'); +CookieJar.prototype.getCookieString = function(/*..., cb*/) { + var args = Array.prototype.slice.call(arguments,0); + var cb = args.pop(); + var next = function(err,cookies) { + if (err) { + cb(err); + } else { + cb(null, cookies + .sort(cookieCompare) + .map(function(c){ + return c.cookieString(); + }) + .join('; ')); } - options = options || {}; - if (!options.tolerant && relative.scheme) { - target.scheme = relative.scheme; - //target.authority = relative.authority; - target.userinfo = relative.userinfo; - target.host = relative.host; - target.port = relative.port; - target.path = removeDotSegments(relative.path || ""); - target.query = relative.query; + }; + args.push(next); + this.getCookies.apply(this,args); +}; + +CAN_BE_SYNC.push('getSetCookieStrings'); +CookieJar.prototype.getSetCookieStrings = function(/*..., cb*/) { + var args = Array.prototype.slice.call(arguments,0); + var cb = args.pop(); + var next = function(err,cookies) { + if (err) { + cb(err); } else { - if (relative.userinfo !== undefined || relative.host !== undefined || relative.port !== undefined) { - //target.authority = relative.authority; - target.userinfo = relative.userinfo; - target.host = relative.host; - target.port = relative.port; - target.path = removeDotSegments(relative.path || ""); - target.query = relative.query; - } else { - if (!relative.path) { - target.path = base.path; - if (relative.query !== undefined) { - target.query = relative.query; - } else { - target.query = base.query; - } - } else { - if (relative.path.charAt(0) === "/") { - target.path = removeDotSegments(relative.path); - } else { - if ((base.userinfo !== undefined || base.host !== undefined || base.port !== undefined) && !base.path) { - target.path = "/" + relative.path; - } else if (!base.path) { - target.path = relative.path; - } else { - target.path = base.path.slice(0, base.path.lastIndexOf("/") + 1) + relative.path; - } - target.path = removeDotSegments(target.path); - } - target.query = relative.query; - } - //target.authority = base.authority; - target.userinfo = base.userinfo; - target.host = base.host; - target.port = base.port; - } - target.scheme = base.scheme; + cb(null, cookies.map(function(c){ + return c.toString(); + })); } - target.fragment = relative.fragment; - return target; -} + }; + args.push(next); + this.getCookies.apply(this,args); +}; -function resolve(baseURI, relativeURI, options) { - var schemelessOptions = assign({ scheme: 'null' }, options); - return serialize(resolveComponents(parse(baseURI, schemelessOptions), parse(relativeURI, schemelessOptions), schemelessOptions, true), schemelessOptions); -} +CAN_BE_SYNC.push('serialize'); +CookieJar.prototype.serialize = function(cb) { + var type = this.store.constructor.name; + if (type === 'Object') { + type = null; + } -function normalize(uri, options) { - if (typeof uri === "string") { - uri = serialize(parse(uri, options), options); - } else if (typeOf(uri) === "object") { - uri = parse(serialize(uri, options), options); - } - return uri; -} + // update README.md "Serialization Format" if you change this, please! + var serialized = { + // The version of tough-cookie that serialized this jar. Generally a good + // practice since future versions can make data import decisions based on + // known past behavior. When/if this matters, use `semver`. + version: 'tough-cookie@'+VERSION, -function equal(uriA, uriB, options) { - if (typeof uriA === "string") { - uriA = serialize(parse(uriA, options), options); - } else if (typeOf(uriA) === "object") { - uriA = serialize(uriA, options); - } - if (typeof uriB === "string") { - uriB = serialize(parse(uriB, options), options); - } else if (typeOf(uriB) === "object") { - uriB = serialize(uriB, options); - } - return uriA === uriB; -} + // add the store type, to make humans happy: + storeType: type, -function escapeComponent(str, options) { - return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.ESCAPE : IRI_PROTOCOL.ESCAPE, pctEncChar); -} + // CookieJar configuration: + rejectPublicSuffixes: !!this.rejectPublicSuffixes, -function unescapeComponent(str, options) { - return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.PCT_ENCODED : IRI_PROTOCOL.PCT_ENCODED, pctDecChars); -} + // this gets filled from getAllCookies: + cookies: [] + }; -var handler = { - scheme: "http", - domainHost: true, - parse: function parse(components, options) { - //report missing host - if (!components.host) { - components.error = components.error || "HTTP URIs must have a host."; - } - return components; - }, - serialize: function serialize(components, options) { - //normalize the default port - if (components.port === (String(components.scheme).toLowerCase() !== "https" ? 80 : 443) || components.port === "") { - components.port = undefined; - } - //normalize the empty path - if (!components.path) { - components.path = "/"; - } - //NOTE: We do not parse query strings for HTTP URIs - //as WWW Form Url Encoded query strings are part of the HTML4+ spec, - //and not the HTTP spec. - return components; + if (!(this.store.getAllCookies && + typeof this.store.getAllCookies === 'function')) + { + return cb(new Error('store does not support getAllCookies and cannot be serialized')); + } + + this.store.getAllCookies(function(err,cookies) { + if (err) { + return cb(err); } + + serialized.cookies = cookies.map(function(cookie) { + // convert to serialized 'raw' cookies + cookie = (cookie instanceof Cookie) ? cookie.toJSON() : cookie; + + // Remove the index so new ones get assigned during deserialization + delete cookie.creationIndex; + + return cookie; + }); + + return cb(null, serialized); + }); }; -var handler$1 = { - scheme: "https", - domainHost: handler.domainHost, - parse: handler.parse, - serialize: handler.serialize +// well-known name that JSON.stringify calls +CookieJar.prototype.toJSON = function() { + return this.serializeSync(); }; -var O = {}; -var isIRI = true; -//RFC 3986 -var UNRESERVED$$ = "[A-Za-z0-9\\-\\.\\_\\~" + (isIRI ? "\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF" : "") + "]"; -var HEXDIG$$ = "[0-9A-Fa-f]"; //case-insensitive -var PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)); //expanded -//RFC 5322, except these symbols as per RFC 6068: @ : / ? # [ ] & ; = -//const ATEXT$$ = "[A-Za-z0-9\\!\\#\\$\\%\\&\\'\\*\\+\\-\\/\\=\\?\\^\\_\\`\\{\\|\\}\\~]"; -//const WSP$$ = "[\\x20\\x09]"; -//const OBS_QTEXT$$ = "[\\x01-\\x08\\x0B\\x0C\\x0E-\\x1F\\x7F]"; //(%d1-8 / %d11-12 / %d14-31 / %d127) -//const QTEXT$$ = merge("[\\x21\\x23-\\x5B\\x5D-\\x7E]", OBS_QTEXT$$); //%d33 / %d35-91 / %d93-126 / obs-qtext -//const VCHAR$$ = "[\\x21-\\x7E]"; -//const WSP$$ = "[\\x20\\x09]"; -//const OBS_QP$ = subexp("\\\\" + merge("[\\x00\\x0D\\x0A]", OBS_QTEXT$$)); //%d0 / CR / LF / obs-qtext -//const FWS$ = subexp(subexp(WSP$$ + "*" + "\\x0D\\x0A") + "?" + WSP$$ + "+"); -//const QUOTED_PAIR$ = subexp(subexp("\\\\" + subexp(VCHAR$$ + "|" + WSP$$)) + "|" + OBS_QP$); -//const QUOTED_STRING$ = subexp('\\"' + subexp(FWS$ + "?" + QCONTENT$) + "*" + FWS$ + "?" + '\\"'); -var ATEXT$$ = "[A-Za-z0-9\\!\\$\\%\\'\\*\\+\\-\\^\\_\\`\\{\\|\\}\\~]"; -var QTEXT$$ = "[\\!\\$\\%\\'\\(\\)\\*\\+\\,\\-\\.0-9\\<\\>A-Z\\x5E-\\x7E]"; -var VCHAR$$ = merge(QTEXT$$, "[\\\"\\\\]"); -var SOME_DELIMS$$ = "[\\!\\$\\'\\(\\)\\*\\+\\,\\;\\:\\@]"; -var UNRESERVED = new RegExp(UNRESERVED$$, "g"); -var PCT_ENCODED = new RegExp(PCT_ENCODED$, "g"); -var NOT_LOCAL_PART = new RegExp(merge("[^]", ATEXT$$, "[\\.]", '[\\"]', VCHAR$$), "g"); -var NOT_HFNAME = new RegExp(merge("[^]", UNRESERVED$$, SOME_DELIMS$$), "g"); -var NOT_HFVALUE = NOT_HFNAME; -function decodeUnreserved(str) { - var decStr = pctDecChars(str); - return !decStr.match(UNRESERVED) ? str : decStr; -} -var handler$2 = { - scheme: "mailto", - parse: function parse$$1(components, options) { - var mailtoComponents = components; - var to = mailtoComponents.to = mailtoComponents.path ? mailtoComponents.path.split(",") : []; - mailtoComponents.path = undefined; - if (mailtoComponents.query) { - var unknownHeaders = false; - var headers = {}; - var hfields = mailtoComponents.query.split("&"); - for (var x = 0, xl = hfields.length; x < xl; ++x) { - var hfield = hfields[x].split("="); - switch (hfield[0]) { - case "to": - var toAddrs = hfield[1].split(","); - for (var _x = 0, _xl = toAddrs.length; _x < _xl; ++_x) { - to.push(toAddrs[_x]); - } - break; - case "subject": - mailtoComponents.subject = unescapeComponent(hfield[1], options); - break; - case "body": - mailtoComponents.body = unescapeComponent(hfield[1], options); - break; - default: - unknownHeaders = true; - headers[unescapeComponent(hfield[0], options)] = unescapeComponent(hfield[1], options); - break; - } - } - if (unknownHeaders) mailtoComponents.headers = headers; - } - mailtoComponents.query = undefined; - for (var _x2 = 0, _xl2 = to.length; _x2 < _xl2; ++_x2) { - var addr = to[_x2].split("@"); - addr[0] = unescapeComponent(addr[0]); - if (!options.unicodeSupport) { - //convert Unicode IDN -> ASCII IDN - try { - addr[1] = punycode.toASCII(unescapeComponent(addr[1], options).toLowerCase()); - } catch (e) { - mailtoComponents.error = mailtoComponents.error || "Email address's domain name can not be converted to ASCII via punycode: " + e; - } - } else { - addr[1] = unescapeComponent(addr[1], options).toLowerCase(); - } - to[_x2] = addr.join("@"); - } - return mailtoComponents; - }, - serialize: function serialize$$1(mailtoComponents, options) { - var components = mailtoComponents; - var to = toArray(mailtoComponents.to); - if (to) { - for (var x = 0, xl = to.length; x < xl; ++x) { - var toAddr = String(to[x]); - var atIdx = toAddr.lastIndexOf("@"); - var localPart = toAddr.slice(0, atIdx).replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_LOCAL_PART, pctEncChar); - var domain = toAddr.slice(atIdx + 1); - //convert IDN via punycode - try { - domain = !options.iri ? punycode.toASCII(unescapeComponent(domain, options).toLowerCase()) : punycode.toUnicode(domain); - } catch (e) { - components.error = components.error || "Email address's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; - } - to[x] = localPart + "@" + domain; - } - components.path = to.join(","); - } - var headers = mailtoComponents.headers = mailtoComponents.headers || {}; - if (mailtoComponents.subject) headers["subject"] = mailtoComponents.subject; - if (mailtoComponents.body) headers["body"] = mailtoComponents.body; - var fields = []; - for (var name in headers) { - if (headers[name] !== O[name]) { - fields.push(name.replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFNAME, pctEncChar) + "=" + headers[name].replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFVALUE, pctEncChar)); - } - } - if (fields.length) { - components.query = fields.join("&"); - } - return components; +// use the class method CookieJar.deserialize instead of calling this directly +CAN_BE_SYNC.push('_importCookies'); +CookieJar.prototype._importCookies = function(serialized, cb) { + var jar = this; + var cookies = serialized.cookies; + if (!cookies || !Array.isArray(cookies)) { + return cb(new Error('serialized jar has no cookies array')); + } + cookies = cookies.slice(); // do not modify the original + + function putNext(err) { + if (err) { + return cb(err); } -}; -var URN_PARSE = /^([^\:]+)\:(.*)/; -//RFC 2141 -var handler$3 = { - scheme: "urn", - parse: function parse$$1(components, options) { - var matches = components.path && components.path.match(URN_PARSE); - var urnComponents = components; - if (matches) { - var scheme = options.scheme || urnComponents.scheme || "urn"; - var nid = matches[1].toLowerCase(); - var nss = matches[2]; - var urnScheme = scheme + ":" + (options.nid || nid); - var schemeHandler = SCHEMES[urnScheme]; - urnComponents.nid = nid; - urnComponents.nss = nss; - urnComponents.path = undefined; - if (schemeHandler) { - urnComponents = schemeHandler.parse(urnComponents, options); - } - } else { - urnComponents.error = urnComponents.error || "URN can not be parsed."; - } - return urnComponents; - }, - serialize: function serialize$$1(urnComponents, options) { - var scheme = options.scheme || urnComponents.scheme || "urn"; - var nid = urnComponents.nid; - var urnScheme = scheme + ":" + (options.nid || nid); - var schemeHandler = SCHEMES[urnScheme]; - if (schemeHandler) { - urnComponents = schemeHandler.serialize(urnComponents, options); - } - var uriComponents = urnComponents; - var nss = urnComponents.nss; - uriComponents.path = (nid || options.nid) + ":" + nss; - return uriComponents; + if (!cookies.length) { + return cb(err, jar); + } + + var cookie; + try { + cookie = fromJSON(cookies.shift()); + } catch (e) { + return cb(e); + } + + if (cookie === null) { + return putNext(null); // skip this cookie } + + jar.store.putCookie(cookie, putNext); + } + + putNext(); }; -var UUID = /^[0-9A-Fa-f]{8}(?:\-[0-9A-Fa-f]{4}){3}\-[0-9A-Fa-f]{12}$/; -//RFC 4122 -var handler$4 = { - scheme: "urn:uuid", - parse: function parse(urnComponents, options) { - var uuidComponents = urnComponents; - uuidComponents.uuid = uuidComponents.nss; - uuidComponents.nss = undefined; - if (!options.tolerant && (!uuidComponents.uuid || !uuidComponents.uuid.match(UUID))) { - uuidComponents.error = uuidComponents.error || "UUID is not valid."; - } - return uuidComponents; - }, - serialize: function serialize(uuidComponents, options) { - var urnComponents = uuidComponents; - //normalize UUID - urnComponents.nss = (uuidComponents.uuid || "").toLowerCase(); - return urnComponents; +CookieJar.deserialize = function(strOrObj, store, cb) { + if (arguments.length !== 3) { + // store is optional + cb = store; + store = null; + } + + var serialized; + if (typeof strOrObj === 'string') { + serialized = jsonParse(strOrObj); + if (serialized instanceof Error) { + return cb(serialized); + } + } else { + serialized = strOrObj; + } + + var jar = new CookieJar(store, serialized.rejectPublicSuffixes); + jar._importCookies(serialized, function(err) { + if (err) { + return cb(err); } + cb(null, jar); + }); }; -SCHEMES[handler.scheme] = handler; -SCHEMES[handler$1.scheme] = handler$1; -SCHEMES[handler$2.scheme] = handler$2; -SCHEMES[handler$3.scheme] = handler$3; -SCHEMES[handler$4.scheme] = handler$4; +CookieJar.deserializeSync = function(strOrObj, store) { + var serialized = typeof strOrObj === 'string' ? + JSON.parse(strOrObj) : strOrObj; + var jar = new CookieJar(store, serialized.rejectPublicSuffixes); -exports.SCHEMES = SCHEMES; -exports.pctEncChar = pctEncChar; -exports.pctDecChars = pctDecChars; -exports.parse = parse; -exports.removeDotSegments = removeDotSegments; -exports.serialize = serialize; -exports.resolveComponents = resolveComponents; -exports.resolve = resolve; -exports.normalize = normalize; -exports.equal = equal; -exports.escapeComponent = escapeComponent; -exports.unescapeComponent = unescapeComponent; + // catch this mistake early: + if (!jar.store.synchronous) { + throw new Error('CookieJar store is not synchronous; use async API instead.'); + } -Object.defineProperty(exports, '__esModule', { value: true }); + jar._importCookiesSync(serialized); + return jar; +}; +CookieJar.fromJSON = CookieJar.deserializeSync; -}))); -//# sourceMappingURL=uri.all.js.map +CAN_BE_SYNC.push('clone'); +CookieJar.prototype.clone = function(newStore, cb) { + if (arguments.length === 1) { + cb = newStore; + newStore = null; + } + this.serialize(function(err,serialized) { + if (err) { + return cb(err); + } + CookieJar.deserialize(newStore, serialized, cb); + }); +}; -/***/ }), +// Use a closure to provide a true imperative API for synchronous stores. +function syncWrap(method) { + return function() { + if (!this.store.synchronous) { + throw new Error('CookieJar store is not synchronous; use async API instead.'); + } -/***/ 736: -/***/ (function(module) { + var args = Array.prototype.slice.call(arguments); + var syncErr, syncResult; + args.push(function syncCb(err, result) { + syncErr = err; + syncResult = result; + }); + this[method].apply(this, args); + + if (syncErr) { + throw syncErr; + } + return syncResult; + }; +} + +// wrap all declared CAN_BE_SYNC methods in the sync wrapper +CAN_BE_SYNC.forEach(function(method) { + CookieJar.prototype[method+'Sync'] = syncWrap(method); +}); + +exports.CookieJar = CookieJar; +exports.Cookie = Cookie; +exports.Store = Store; +exports.MemoryCookieStore = MemoryCookieStore; +exports.parseDate = parseDate; +exports.formatDate = formatDate; +exports.parse = parse; +exports.fromJSON = fromJSON; +exports.domainMatch = domainMatch; +exports.defaultPath = defaultPath; +exports.pathMatch = pathMatch; +exports.getPublicSuffix = pubsuffix.getPublicSuffix; +exports.cookieCompare = cookieCompare; +exports.permuteDomain = __webpack_require__(383).permuteDomain; +exports.permutePath = permutePath; +exports.canonicalDomain = canonicalDomain; -module.exports = {"$id":"cookie.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"path":{"type":"string"},"domain":{"type":"string"},"expires":{"type":["string","null"],"format":"date-time"},"httpOnly":{"type":"boolean"},"secure":{"type":"boolean"},"comment":{"type":"string"}}}; /***/ }), -/***/ 739: +/***/ 703: /***/ (function(module) { -"use strict"; - -module.exports = function generate__limit(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $isMax = $keyword == 'maximum', - $exclusiveKeyword = $isMax ? 'exclusiveMaximum' : 'exclusiveMinimum', - $schemaExcl = it.schema[$exclusiveKeyword], - $isDataExcl = it.opts.$data && $schemaExcl && $schemaExcl.$data, - $op = $isMax ? '<' : '>', - $notOp = $isMax ? '>' : '<', - $errorKeyword = undefined; - if ($isDataExcl) { - var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), - $exclusive = 'exclusive' + $lvl, - $exclType = 'exclType' + $lvl, - $exclIsNumber = 'exclIsNumber' + $lvl, - $opExpr = 'op' + $lvl, - $opStr = '\' + ' + $opExpr + ' + \''; - out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; - $schemaValueExcl = 'schemaExcl' + $lvl; - out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; - var $errorKeyword = $exclusiveKeyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; - if ($schema === undefined) { - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $schemaValue = $schemaValueExcl; - $isData = $isDataExcl; - } - } else { - var $exclIsNumber = typeof $schemaExcl == 'number', - $opStr = $op; - if ($exclIsNumber && $isData) { - var $opExpr = '\'' + $opStr + '\''; - out += ' if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; - } else { - if ($exclIsNumber && $schema === undefined) { - $exclusive = true; - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $schemaValue = $schemaExcl; - $notOp += '='; - } else { - if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); - if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { - $exclusive = true; - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $notOp += '='; - } else { - $exclusive = false; - $opStr += '='; - } - } - var $opExpr = '\'' + $opStr + '\''; - out += ' if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; - } - } - $errorKeyword = $errorKeyword || $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be ' + ($opStr) + ' '; - if ($isData) { - out += '\' + ' + ($schemaValue); - } else { - out += '' + ($schemaValue) + '\''; - } - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; +/** + * JSONSchema Validator - Validates JavaScript objects using JSON Schemas + * (http://www.json.com/json-schema-proposal/) + * + * Copyright (c) 2007 Kris Zyp SitePen (www.sitepen.com) + * Licensed under the MIT (MIT-LICENSE.txt) license. +To use the validator call the validate function with an instance object and an optional schema object. +If a schema is provided, it will be used to validate. If the instance object refers to a schema (self-validating), +that schema will be used to validate and the schema parameter is not necessary (if both exist, +both validations will occur). +The validate method will return an array of validation errors. If there are no errors, then an +empty list will be returned. A validation error will have two properties: +"property" which indicates which property had the error +"message" which indicates what the error was + */ +(function (root, factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as an anonymous module. + define([], function () { + return factory(); + }); + } else if ( true && module.exports) { + // Node. Does not work with strict CommonJS, but + // only CommonJS-like environments that support module.exports, + // like Node. + module.exports = factory(); + } else { + // Browser globals + root.jsonSchema = factory(); + } +}(this, function () {// setup primitive classes to be JSON Schema types +var exports = validate +exports.Integer = {type:"integer"}; +var primitiveConstructors = { + String: String, + Boolean: Boolean, + Number: Number, + Object: Object, + Array: Array, + Date: Date +} +exports.validate = validate; +function validate(/*Any*/instance,/*Object*/schema) { + // Summary: + // To use the validator call JSONSchema.validate with an instance object and an optional schema object. + // If a schema is provided, it will be used to validate. If the instance object refers to a schema (self-validating), + // that schema will be used to validate and the schema parameter is not necessary (if both exist, + // both validations will occur). + // The validate method will return an object with two properties: + // valid: A boolean indicating if the instance is valid by the schema + // errors: An array of validation errors. If there are no errors, then an + // empty list will be returned. A validation error will have two properties: + // property: which indicates which property had the error + // message: which indicates what the error was + // + return validate(instance, schema, {changing: false});//, coerce: false, existingOnly: false}); + }; +exports.checkPropertyChange = function(/*Any*/value,/*Object*/schema, /*String*/property) { + // Summary: + // The checkPropertyChange method will check to see if an value can legally be in property with the given schema + // This is slightly different than the validate method in that it will fail if the schema is readonly and it will + // not check for self-validation, it is assumed that the passed in value is already internally valid. + // The checkPropertyChange method will return the same object type as validate, see JSONSchema.validate for + // information. + // + return validate(value, schema, {changing: property || "property"}); + }; +var validate = exports._validate = function(/*Any*/instance,/*Object*/schema,/*Object*/options) { + + if (!options) options = {}; + var _changing = options.changing; + + function getType(schema){ + return schema.type || (primitiveConstructors[schema.name] == schema && schema.name.toLowerCase()); + } + var errors = []; + // validate a value against a property definition + function checkProp(value, schema, path,i){ + + var l; + path += path ? typeof i == 'number' ? '[' + i + ']' : typeof i == 'undefined' ? '' : '.' + i : i; + function addError(message){ + errors.push({property:path,message:message}); + } + + if((typeof schema != 'object' || schema instanceof Array) && (path || typeof schema != 'function') && !(schema && getType(schema))){ + if(typeof schema == 'function'){ + if(!(value instanceof schema)){ + addError("is not an instance of the class/constructor " + schema.name); + } + }else if(schema){ + addError("Invalid schema/property definition " + schema); + } + return null; + } + if(_changing && schema.readonly){ + addError("is a readonly field, it can not be changed"); + } + if(schema['extends']){ // if it extends another schema, it must pass that schema as well + checkProp(value,schema['extends'],path,i); + } + // validate a value against a type definition + function checkType(type,value){ + if(type){ + if(typeof type == 'string' && type != 'any' && + (type == 'null' ? value !== null : typeof value != type) && + !(value instanceof Array && type == 'array') && + !(value instanceof Date && type == 'date') && + !(type == 'integer' && value%1===0)){ + return [{property:path,message:(typeof value) + " value found, but a " + type + " is required"}]; + } + if(type instanceof Array){ + var unionErrors=[]; + for(var j = 0; j < type.length; j++){ // a union type + if(!(unionErrors=checkType(type[j],value)).length){ + break; + } + } + if(unionErrors.length){ + return unionErrors; + } + }else if(typeof type == 'object'){ + var priorErrors = errors; + errors = []; + checkProp(value,type,path); + var theseErrors = errors; + errors = priorErrors; + return theseErrors; + } + } + return []; + } + if(value === undefined){ + if(schema.required){ + addError("is missing and it is required"); + } + }else{ + errors = errors.concat(checkType(getType(schema),value)); + if(schema.disallow && !checkType(schema.disallow,value).length){ + addError(" disallowed value was matched"); + } + if(value !== null){ + if(value instanceof Array){ + if(schema.items){ + var itemsIsArray = schema.items instanceof Array; + var propDef = schema.items; + for (i = 0, l = value.length; i < l; i += 1) { + if (itemsIsArray) + propDef = schema.items[i]; + if (options.coerce) + value[i] = options.coerce(value[i], propDef); + errors.concat(checkProp(value[i],propDef,path,i)); + } + } + if(schema.minItems && value.length < schema.minItems){ + addError("There must be a minimum of " + schema.minItems + " in the array"); + } + if(schema.maxItems && value.length > schema.maxItems){ + addError("There must be a maximum of " + schema.maxItems + " in the array"); + } + }else if(schema.properties || schema.additionalProperties){ + errors.concat(checkObj(value, schema.properties, path, schema.additionalProperties)); + } + if(schema.pattern && typeof value == 'string' && !value.match(schema.pattern)){ + addError("does not match the regex pattern " + schema.pattern); + } + if(schema.maxLength && typeof value == 'string' && value.length > schema.maxLength){ + addError("may only be " + schema.maxLength + " characters long"); + } + if(schema.minLength && typeof value == 'string' && value.length < schema.minLength){ + addError("must be at least " + schema.minLength + " characters long"); + } + if(typeof schema.minimum !== undefined && typeof value == typeof schema.minimum && + schema.minimum > value){ + addError("must have a minimum value of " + schema.minimum); + } + if(typeof schema.maximum !== undefined && typeof value == typeof schema.maximum && + schema.maximum < value){ + addError("must have a maximum value of " + schema.maximum); + } + if(schema['enum']){ + var enumer = schema['enum']; + l = enumer.length; + var found; + for(var j = 0; j < l; j++){ + if(enumer[j]===value){ + found=1; + break; + } + } + if(!found){ + addError("does not have a value in the enumeration " + enumer.join(", ")); + } + } + if(typeof schema.maxDecimal == 'number' && + (value.toString().match(new RegExp("\\.[0-9]{" + (schema.maxDecimal + 1) + ",}")))){ + addError("may only have " + schema.maxDecimal + " digits of decimal places"); + } + } + } + return null; + } + // validate an object against a schema + function checkObj(instance,objTypeDef,path,additionalProp){ + + if(typeof objTypeDef =='object'){ + if(typeof instance != 'object' || instance instanceof Array){ + errors.push({property:path,message:"an object is required"}); + } + + for(var i in objTypeDef){ + if(objTypeDef.hasOwnProperty(i)){ + var value = instance[i]; + // skip _not_ specified properties + if (value === undefined && options.existingOnly) continue; + var propDef = objTypeDef[i]; + // set default + if(value === undefined && propDef["default"]){ + value = instance[i] = propDef["default"]; + } + if(options.coerce && i in instance){ + value = instance[i] = options.coerce(value, propDef); + } + checkProp(value,propDef,path,i); + } + } + } + for(i in instance){ + if(instance.hasOwnProperty(i) && !(i.charAt(0) == '_' && i.charAt(1) == '_') && objTypeDef && !objTypeDef[i] && additionalProp===false){ + if (options.filter) { + delete instance[i]; + continue; + } else { + errors.push({property:path,message:(typeof value) + "The property " + i + + " is not defined in the schema and the schema does not allow additional properties"}); + } + } + var requires = objTypeDef && objTypeDef[i] && objTypeDef[i].requires; + if(requires && !(requires in instance)){ + errors.push({property:path,message:"the presence of the property " + i + " requires that " + requires + " also be present"}); + } + value = instance[i]; + if(additionalProp && (!(objTypeDef && typeof objTypeDef == 'object') || !(i in objTypeDef))){ + if(options.coerce){ + value = instance[i] = options.coerce(value, additionalProp); + } + checkProp(value,additionalProp,path,i); + } + if(!_changing && value && value.$schema){ + errors = errors.concat(checkProp(value,value.$schema,path,i)); + } + } + return errors; + } + if(schema){ + checkProp(instance,schema,'',_changing || ''); + } + if(!_changing && instance && instance.$schema){ + checkProp(instance,instance.$schema,'',''); + } + return {valid:!errors.length,errors:errors}; +}; +exports.mustBeValid = function(result){ + // summary: + // This checks to ensure that the result is valid and will throw an appropriate error message if it is not + // result: the result returned from checkPropertyChange or validate + if(!result.valid){ + throw new TypeError(result.errors.map(function(error){return "for property " + error.property + ': ' + error.message;}).join(", \n")); + } +} + +return exports; +})); + + +/***/ }), + +/***/ 704: +/***/ (function(module, exports) { + +exports = module.exports = stringify +exports.getSerialize = serializer + +function stringify(obj, replacer, spaces, cycleReplacer) { + return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces) +} + +function serializer(replacer, cycleReplacer) { + var stack = [], keys = [] + + if (cycleReplacer == null) cycleReplacer = function(key, value) { + if (stack[0] === value) return "[Circular ~]" + return "[Circular ~." + keys.slice(0, stack.indexOf(value)).join(".") + "]" } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; + + return function(key, value) { + if (stack.length > 0) { + var thisPos = stack.indexOf(this) + ~thisPos ? stack.splice(thisPos + 1) : stack.push(this) + ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key) + if (~stack.indexOf(value)) value = cycleReplacer.call(this, key, value) } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else { '; + else stack.push(value) + + return replacer == null ? value : replacer.call(this, key, value) } - return out; } /***/ }), -/***/ 740: +/***/ 707: /***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; +// Copyright 2018 Joyent, Inc. +module.exports = { + read: read, + readPkcs8: readPkcs8, + write: write, + writePkcs8: writePkcs8, + pkcs8ToBuffer: pkcs8ToBuffer, -var resolve = __webpack_require__(538) - , util = __webpack_require__(280) - , errorClasses = __webpack_require__(462) - , stableStringify = __webpack_require__(281); + readECDSACurve: readECDSACurve, + writeECDSACurve: writeECDSACurve +}; -var validateGenerator = __webpack_require__(779); +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); -/** - * Functions below are used inside compiled validations function - */ +function read(buf, options) { + return (pem.read(buf, options, 'pkcs8')); +} -var ucs2length = util.ucs2length; -var equal = __webpack_require__(446); +function write(key, options) { + return (pem.write(key, options, 'pkcs8')); +} -// this error is thrown by async schemas to return validation errors via exception -var ValidationError = errorClasses.Validation; +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); +} -module.exports = compile; +function readPkcs8(alg, type, der) { + /* Private keys in pkcs#8 format have a weird extra int */ + if (der.peek() === asn1.Ber.Integer) { + assert.strictEqual(type, 'private', + 'unexpected Integer at start of public key'); + der.readString(asn1.Ber.Integer, true); + } + der.readSequence(); + var next = der.offset + der.length; -/** - * Compiles schema to validation function - * @this Ajv - * @param {Object} schema schema object - * @param {Object} root object with information about the root schema for this schema - * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution - * @param {String} baseId base ID for IDs in the schema - * @return {Function} validation function - */ -function compile(schema, root, localRefs, baseId) { - /* jshint validthis: true, evil: true */ - /* eslint no-shadow: 0 */ - var self = this - , opts = this._opts - , refVal = [ undefined ] - , refs = {} - , patterns = [] - , patternsHash = {} - , defaults = [] - , defaultsHash = {} - , customRules = []; + var oid = der.readOID(); + switch (oid) { + case '1.2.840.113549.1.1.1': + der._offset = next; + if (type === 'public') + return (readPkcs8RSAPublic(der)); + else + return (readPkcs8RSAPrivate(der)); + case '1.2.840.10040.4.1': + if (type === 'public') + return (readPkcs8DSAPublic(der)); + else + return (readPkcs8DSAPrivate(der)); + case '1.2.840.10045.2.1': + if (type === 'public') + return (readPkcs8ECDSAPublic(der)); + else + return (readPkcs8ECDSAPrivate(der)); + case '1.3.101.112': + if (type === 'public') { + return (readPkcs8EdDSAPublic(der)); + } else { + return (readPkcs8EdDSAPrivate(der)); + } + case '1.3.101.110': + if (type === 'public') { + return (readPkcs8X25519Public(der)); + } else { + return (readPkcs8X25519Private(der)); + } + default: + throw (new Error('Unknown key type OID ' + oid)); + } +} - root = root || { schema: schema, refVal: refVal, refs: refs }; +function readPkcs8RSAPublic(der) { + // bit string sequence + der.readSequence(asn1.Ber.BitString); + der.readByte(); + der.readSequence(); - var c = checkCompiling.call(this, schema, root, baseId); - var compilation = this._compilations[c.index]; - if (c.compiling) return (compilation.callValidate = callValidate); + // modulus + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'exponent'); - var formats = this._formats; - var RULES = this.RULES; + // now, make the key + var key = { + type: 'rsa', + source: der.originalInput, + parts: [ + { name: 'e', data: e }, + { name: 'n', data: n } + ] + }; - try { - var v = localCompile(schema, root, localRefs, baseId); - compilation.validate = v; - var cv = compilation.callValidate; - if (cv) { - cv.schema = v.schema; - cv.errors = null; - cv.refs = v.refs; - cv.refVal = v.refVal; - cv.root = v.root; - cv.$async = v.$async; - if (opts.sourceCode) cv.source = v.source; - } - return v; - } finally { - endCompiling.call(this, schema, root, baseId); - } + return (new Key(key)); +} - /* @this {*} - custom context, see passContext option */ - function callValidate() { - /* jshint validthis: true */ - var validate = compilation.validate; - var result = validate.apply(this, arguments); - callValidate.errors = validate.errors; - return result; - } +function readPkcs8RSAPrivate(der) { + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); - function localCompile(_schema, _root, localRefs, baseId) { - var isRoot = !_root || (_root && _root.schema == _schema); - if (_root.schema != root.schema) - return compile.call(self, _schema, _root, localRefs, baseId); + var ver = readMPInt(der, 'version'); + assert.equal(ver[0], 0x0, 'unknown RSA private key version'); - var $async = _schema.$async === true; + // modulus then public exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'public exponent'); + var d = readMPInt(der, 'private exponent'); + var p = readMPInt(der, 'prime1'); + var q = readMPInt(der, 'prime2'); + var dmodp = readMPInt(der, 'exponent1'); + var dmodq = readMPInt(der, 'exponent2'); + var iqmp = readMPInt(der, 'iqmp'); - var sourceCode = validateGenerator({ - isTop: true, - schema: _schema, - isRoot: isRoot, - baseId: baseId, - root: _root, - schemaPath: '', - errSchemaPath: '#', - errorPath: '""', - MissingRefError: errorClasses.MissingRef, - RULES: RULES, - validate: validateGenerator, - util: util, - resolve: resolve, - resolveRef: resolveRef, - usePattern: usePattern, - useDefault: useDefault, - useCustomRule: useCustomRule, - opts: opts, - formats: formats, - logger: self.logger, - self: self - }); + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'n', data: n }, + { name: 'e', data: e }, + { name: 'd', data: d }, + { name: 'iqmp', data: iqmp }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'dmodp', data: dmodp }, + { name: 'dmodq', data: dmodq } + ] + }; - sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) - + vars(defaults, defaultCode) + vars(customRules, customRuleCode) - + sourceCode; + return (new PrivateKey(key)); +} - if (opts.processCode) sourceCode = opts.processCode(sourceCode); - // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); - var validate; - try { - var makeValidate = new Function( - 'self', - 'RULES', - 'formats', - 'root', - 'refVal', - 'defaults', - 'customRules', - 'equal', - 'ucs2length', - 'ValidationError', - sourceCode - ); +function readPkcs8DSAPublic(der) { + der.readSequence(); - validate = makeValidate( - self, - RULES, - formats, - root, - refVal, - defaults, - customRules, - equal, - ucs2length, - ValidationError - ); + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); - refVal[0] = validate; - } catch(e) { - self.logger.error('Error compiling schema, function code:', sourceCode); - throw e; - } + // bit string sequence + der.readSequence(asn1.Ber.BitString); + der.readByte(); - validate.schema = _schema; - validate.errors = null; - validate.refs = refs; - validate.refVal = refVal; - validate.root = isRoot ? validate : _root; - if ($async) validate.$async = true; - if (opts.sourceCode === true) { - validate.source = { - code: sourceCode, - patterns: patterns, - defaults: defaults - }; - } + var y = readMPInt(der, 'y'); - return validate; - } + // now, make the key + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y } + ] + }; - function resolveRef(baseId, ref, isRoot) { - ref = resolve.url(baseId, ref); - var refIndex = refs[ref]; - var _refVal, refCode; - if (refIndex !== undefined) { - _refVal = refVal[refIndex]; - refCode = 'refVal[' + refIndex + ']'; - return resolvedRef(_refVal, refCode); - } - if (!isRoot && root.refs) { - var rootRefId = root.refs[ref]; - if (rootRefId !== undefined) { - _refVal = root.refVal[rootRefId]; - refCode = addLocalRef(ref, _refVal); - return resolvedRef(_refVal, refCode); - } - } + return (new Key(key)); +} - refCode = addLocalRef(ref); - var v = resolve.call(self, localCompile, root, ref); - if (v === undefined) { - var localSchema = localRefs && localRefs[ref]; - if (localSchema) { - v = resolve.inlineRef(localSchema, opts.inlineRefs) - ? localSchema - : compile.call(self, localSchema, root, localRefs, baseId); - } - } +function readPkcs8DSAPrivate(der) { + der.readSequence(); + + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + + der.readSequence(asn1.Ber.OctetString); + var x = readMPInt(der, 'x'); + + /* The pkcs#8 format does not include the public key */ + var y = utils.calculateDSAPublic(g, p, x); + + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y }, + { name: 'x', data: x } + ] + }; + + return (new PrivateKey(key)); +} + +function readECDSACurve(der) { + var curveName, curveNames; + var j, c, cd; + + if (der.peek() === asn1.Ber.OID) { + var oid = der.readOID(); + + curveNames = Object.keys(algs.curves); + for (j = 0; j < curveNames.length; ++j) { + c = curveNames[j]; + cd = algs.curves[c]; + if (cd.pkcs8oid === oid) { + curveName = c; + break; + } + } + + } else { + // ECParameters sequence + der.readSequence(); + var version = der.readString(asn1.Ber.Integer, true); + assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); + + var curve = {}; + + // FieldID sequence + der.readSequence(); + var fieldTypeOid = der.readOID(); + assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', + 'ECDSA key is not from a prime-field'); + var p = curve.p = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + /* + * p always starts with a 1 bit, so count the zeros to get its + * real size. + */ + curve.size = p.length * 8 - utils.countZeros(p); + + // Curve sequence + der.readSequence(); + curve.a = utils.mpNormalize( + der.readString(asn1.Ber.OctetString, true)); + curve.b = utils.mpNormalize( + der.readString(asn1.Ber.OctetString, true)); + if (der.peek() === asn1.Ber.BitString) + curve.s = der.readString(asn1.Ber.BitString, true); + + // Combined Gx and Gy + curve.G = der.readString(asn1.Ber.OctetString, true); + assert.strictEqual(curve.G[0], 0x4, + 'uncompressed G is required'); + + curve.n = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + curve.h = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + + 'required'); + + curveNames = Object.keys(algs.curves); + var ks = Object.keys(curve); + for (j = 0; j < curveNames.length; ++j) { + c = curveNames[j]; + cd = algs.curves[c]; + var equal = true; + for (var i = 0; i < ks.length; ++i) { + var k = ks[i]; + if (cd[k] === undefined) + continue; + if (typeof (cd[k]) === 'object' && + cd[k].equals !== undefined) { + if (!cd[k].equals(curve[k])) { + equal = false; + break; + } + } else if (Buffer.isBuffer(cd[k])) { + if (cd[k].toString('binary') + !== curve[k].toString('binary')) { + equal = false; + break; + } + } else { + if (cd[k] !== curve[k]) { + equal = false; + break; + } + } + } + if (equal) { + curveName = c; + break; + } + } + } + return (curveName); +} + +function readPkcs8ECDSAPrivate(der) { + var curveName = readECDSACurve(der); + assert.string(curveName, 'a known elliptic curve'); + + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); - if (v === undefined) { - removeLocalRef(ref); - } else { - replaceLocalRef(ref, v); - return resolvedRef(v, refCode); - } - } + var version = readMPInt(der, 'version'); + assert.equal(version[0], 1, 'unknown version of ECDSA key'); - function addLocalRef(ref, v) { - var refId = refVal.length; - refVal[refId] = v; - refs[ref] = refId; - return 'refVal' + refId; - } + var d = der.readString(asn1.Ber.OctetString, true); + var Q; - function removeLocalRef(ref) { - delete refs[ref]; - } + if (der.peek() == 0xa0) { + der.readSequence(0xa0); + der._offset += der.length; + } + if (der.peek() == 0xa1) { + der.readSequence(0xa1); + Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); + } - function replaceLocalRef(ref, v) { - var refId = refs[ref]; - refVal[refId] = v; - } + if (Q === undefined) { + var pub = utils.publicFromPrivateECDSA(curveName, d); + Q = pub.part.Q.data; + } - function resolvedRef(refVal, code) { - return typeof refVal == 'object' || typeof refVal == 'boolean' - ? { code: code, schema: refVal, inline: true } - : { code: code, $async: refVal && !!refVal.$async }; - } + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curveName) }, + { name: 'Q', data: Q }, + { name: 'd', data: d } + ] + }; - function usePattern(regexStr) { - var index = patternsHash[regexStr]; - if (index === undefined) { - index = patternsHash[regexStr] = patterns.length; - patterns[index] = regexStr; - } - return 'pattern' + index; - } + return (new PrivateKey(key)); +} - function useDefault(value) { - switch (typeof value) { - case 'boolean': - case 'number': - return '' + value; - case 'string': - return util.toQuotedString(value); - case 'object': - if (value === null) return 'null'; - var valueStr = stableStringify(value); - var index = defaultsHash[valueStr]; - if (index === undefined) { - index = defaultsHash[valueStr] = defaults.length; - defaults[index] = value; - } - return 'default' + index; - } - } +function readPkcs8ECDSAPublic(der) { + var curveName = readECDSACurve(der); + assert.string(curveName, 'a known elliptic curve'); - function useCustomRule(rule, schema, parentSchema, it) { - if (self._opts.validateSchema !== false) { - var deps = rule.definition.dependencies; - if (deps && !deps.every(function(keyword) { - return Object.prototype.hasOwnProperty.call(parentSchema, keyword); - })) - throw new Error('parent schema must have all required keywords: ' + deps.join(',')); + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); - var validateSchema = rule.definition.validateSchema; - if (validateSchema) { - var valid = validateSchema(schema); - if (!valid) { - var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); - if (self._opts.validateSchema == 'log') self.logger.error(message); - else throw new Error(message); - } - } - } + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curveName) }, + { name: 'Q', data: Q } + ] + }; - var compile = rule.definition.compile - , inline = rule.definition.inline - , macro = rule.definition.macro; + return (new Key(key)); +} - var validate; - if (compile) { - validate = compile.call(self, schema, parentSchema, it); - } else if (macro) { - validate = macro.call(self, schema, parentSchema, it); - if (opts.validateSchema !== false) self.validateSchema(validate, true); - } else if (inline) { - validate = inline.call(self, it, rule.keyword, schema, parentSchema); - } else { - validate = rule.definition.validate; - if (!validate) return; - } +function readPkcs8EdDSAPublic(der) { + if (der.peek() === 0x00) + der.readByte(); - if (validate === undefined) - throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); + var A = utils.readBitString(der); - var index = customRules.length; - customRules[index] = validate; + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) } + ] + }; - return { - code: 'customRule' + index, - validate: validate - }; - } + return (new Key(key)); } +function readPkcs8X25519Public(der) { + var A = utils.readBitString(der); -/** - * Checks if the schema is currently compiled - * @this Ajv - * @param {Object} schema schema to compile - * @param {Object} root root object - * @param {String} baseId base schema ID - * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) - */ -function checkCompiling(schema, root, baseId) { - /* jshint validthis: true */ - var index = compIndex.call(this, schema, root, baseId); - if (index >= 0) return { index: index, compiling: true }; - index = this._compilations.length; - this._compilations[index] = { - schema: schema, - root: root, - baseId: baseId - }; - return { index: index, compiling: false }; + var key = { + type: 'curve25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) } + ] + }; + + return (new Key(key)); } +function readPkcs8EdDSAPrivate(der) { + if (der.peek() === 0x00) + der.readByte(); -/** - * Removes the schema from the currently compiled list - * @this Ajv - * @param {Object} schema schema to compile - * @param {Object} root root object - * @param {String} baseId base schema ID - */ -function endCompiling(schema, root, baseId) { - /* jshint validthis: true */ - var i = compIndex.call(this, schema, root, baseId); - if (i >= 0) this._compilations.splice(i, 1); -} + der.readSequence(asn1.Ber.OctetString); + var k = der.readString(asn1.Ber.OctetString, true); + k = utils.zeroPadToLength(k, 32); + var A; + if (der.peek() === asn1.Ber.BitString) { + A = utils.readBitString(der); + A = utils.zeroPadToLength(A, 32); + } else { + A = utils.calculateED25519Public(k); + } -/** - * Index of schema compilation in the currently compiled list - * @this Ajv - * @param {Object} schema schema to compile - * @param {Object} root root object - * @param {String} baseId base schema ID - * @return {Integer} compilation index - */ -function compIndex(schema, root, baseId) { - /* jshint validthis: true */ - for (var i=0; i' : '<'; - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - if (it.opts.unicode === false) { - out += ' ' + ($data) + '.length '; - } else { - out += ' ucs2length(' + ($data) + ') '; - } - out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT be '; - if ($keyword == 'maxLength') { - out += 'longer'; - } else { - out += 'shorter'; - } - out += ' than '; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + ($schema); - } - out += ' characters\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); } +function writePkcs8ECDSAPrivate(key, der) { + writeECDSACurve(key, der); + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + + var version = Buffer.from([1]); + der.writeBuffer(version, asn1.Ber.Integer); -/***/ }), + der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); -/***/ 768: -/***/ (function(module) { + der.startSequence(0xa1); + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); + der.endSequence(); -// API -module.exports = abort; + der.endSequence(); + der.endSequence(); +} -/** - * Aborts leftover active jobs - * - * @param {object} state - current state object - */ -function abort(state) -{ - Object.keys(state.jobs).forEach(clean.bind(state)); +function writePkcs8EdDSAPublic(key, der) { + der.endSequence(); - // reset leftover jobs - state.jobs = {}; + utils.writeBitString(der, key.part.A.data); } -/** - * Cleans up leftover job by invoking abort function for the provided job id - * - * @this state - * @param {string|number} key - job id to abort - */ -function clean(key) -{ - if (typeof this.jobs[key] == 'function') - { - this.jobs[key](); - } +function writePkcs8EdDSAPrivate(key, der) { + der.endSequence(); + + var k = utils.mpNormalize(key.part.k.data, true); + der.startSequence(asn1.Ber.OctetString); + der.writeBuffer(k, asn1.Ber.OctetString); + der.endSequence(); } /***/ }), -/***/ 769: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 721: +/***/ (function(module) { -var aws4 = exports, - url = __webpack_require__(835), - querystring = __webpack_require__(191), - crypto = __webpack_require__(417), - lru = __webpack_require__(258), - credentialsCache = lru(1000) +"use strict"; -// http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html -function hmac(key, string, encoding) { - return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding) +function formatHostname (hostname) { + // canonicalize the hostname, so that 'oogle.com' won't match 'google.com' + return hostname.replace(/^\.*/, '.').toLowerCase() } -function hash(string, encoding) { - return crypto.createHash('sha256').update(string, 'utf8').digest(encoding) -} +function parseNoProxyZone (zone) { + zone = zone.trim().toLowerCase() -// This function assumes the string has already been percent encoded -function encodeRfc3986(urlEncodedString) { - return urlEncodedString.replace(/[!'()*]/g, function(c) { - return '%' + c.charCodeAt(0).toString(16).toUpperCase() - }) -} + var zoneParts = zone.split(':', 2) + var zoneHost = formatHostname(zoneParts[0]) + var zonePort = zoneParts[1] + var hasPort = zone.indexOf(':') > -1 -// request: { path | body, [host], [method], [headers], [service], [region] } -// credentials: { accessKeyId, secretAccessKey, [sessionToken] } -function RequestSigner(request, credentials) { + return {hostname: zoneHost, port: zonePort, hasPort: hasPort} +} - if (typeof request === 'string') request = url.parse(request) +function uriInNoProxy (uri, noProxy) { + var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') + var hostname = formatHostname(uri.hostname) + var noProxyList = noProxy.split(',') - var headers = request.headers = (request.headers || {}), - hostParts = this.matchHost(request.hostname || request.host || headers.Host || headers.host) + // iterate through the noProxyList until it finds a match. + return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { + var isMatchedAt = hostname.indexOf(noProxyZone.hostname) + var hostnameMatched = ( + isMatchedAt > -1 && + (isMatchedAt === hostname.length - noProxyZone.hostname.length) + ) - this.request = request - this.credentials = credentials || this.defaultCredentials() + if (noProxyZone.hasPort) { + return (port === noProxyZone.port) && hostnameMatched + } - this.service = request.service || hostParts[0] || '' - this.region = request.region || hostParts[1] || 'us-east-1' + return hostnameMatched + }) +} - // SES uses a different domain from the service name - if (this.service === 'email') this.service = 'ses' +function getProxyFromURI (uri) { + // Decide the proper request proxy to use based on the request URI object and the + // environmental variables (NO_PROXY, HTTP_PROXY, etc.) + // respect NO_PROXY environment variables (see: http://lynx.isc.org/current/breakout/lynx_help/keystrokes/environments.html) - if (!request.method && request.body) - request.method = 'POST' + var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' - if (!headers.Host && !headers.host) { - headers.Host = request.hostname || request.host || this.createHost() + // if the noProxy is a wildcard then return null - // If a port is specified explicitly, use it as is - if (request.port) - headers.Host += ':' + request.port + if (noProxy === '*') { + return null } - if (!request.hostname && !request.host) - request.hostname = headers.Host || headers.host - this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT' -} + // if the noProxy is not empty and the uri is found return null -RequestSigner.prototype.matchHost = function(host) { - var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/) - var hostParts = (match || []).slice(1, 3) + if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { + return null + } - // ES's hostParts are sometimes the other way round, if the value that is expected - // to be region equals ‘es’ switch them back - // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com - if (hostParts[1] === 'es') - hostParts = hostParts.reverse() + // Check for HTTP or HTTPS Proxy in environment Else default to null - return hostParts -} + if (uri.protocol === 'http:') { + return process.env.HTTP_PROXY || + process.env.http_proxy || null + } -// http://docs.aws.amazon.com/general/latest/gr/rande.html -RequestSigner.prototype.isSingleRegion = function() { - // Special case for S3 and SimpleDB in us-east-1 - if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true + if (uri.protocol === 'https:') { + return process.env.HTTPS_PROXY || + process.env.https_proxy || + process.env.HTTP_PROXY || + process.env.http_proxy || null + } - return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts'] - .indexOf(this.service) >= 0 -} + // if none of that works, return null + // (What uri protocol are you using then?) -RequestSigner.prototype.createHost = function() { - var region = this.isSingleRegion() ? '' : - (this.service === 's3' && this.region !== 'us-east-1' ? '-' : '.') + this.region, - service = this.service === 'ses' ? 'email' : this.service - return service + region + '.amazonaws.com' + return null } -RequestSigner.prototype.prepareRequest = function() { - this.parsePath() - - var request = this.request, headers = request.headers, query +module.exports = getProxyFromURI - if (request.signQuery) { - this.parsedPath.query = query = this.parsedPath.query || {} +/***/ }), - if (this.credentials.sessionToken) - query['X-Amz-Security-Token'] = this.credentials.sessionToken +/***/ 722: +/***/ (function(module) { - if (this.service === 's3' && !query['X-Amz-Expires']) - query['X-Amz-Expires'] = 86400 +/** + * Convert array of 16 byte values to UUID string format of the form: + * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + */ +var byteToHex = []; +for (var i = 0; i < 256; ++i) { + byteToHex[i] = (i + 0x100).toString(16).substr(1); +} - if (query['X-Amz-Date']) - this.datetime = query['X-Amz-Date'] - else - query['X-Amz-Date'] = this.getDateTime() +function bytesToUuid(buf, offset) { + var i = offset || 0; + var bth = byteToHex; + // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 + return ([bth[buf[i++]], bth[buf[i++]], + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], + bth[buf[i++]], bth[buf[i++]], + bth[buf[i++]], bth[buf[i++]]]).join(''); +} - query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256' - query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString() - query['X-Amz-SignedHeaders'] = this.signedHeaders() +module.exports = bytesToUuid; - } else { - if (!request.doNotModifyHeaders && !this.isCodeCommitGit) { - if (request.body && !headers['Content-Type'] && !headers['content-type']) - headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8' +/***/ }), - if (request.body && !headers['Content-Length'] && !headers['content-length']) - headers['Content-Length'] = Buffer.byteLength(request.body) +/***/ 729: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token']) - headers['X-Amz-Security-Token'] = this.credentials.sessionToken +// Basic Javascript Elliptic Curve implementation +// Ported loosely from BouncyCastle's Java EC code +// Only Fp curves implemented for now - if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256']) - headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex') +// Requires jsbn.js and jsbn2.js +var BigInteger = __webpack_require__(242).BigInteger +var Barrett = BigInteger.prototype.Barrett - if (headers['X-Amz-Date'] || headers['x-amz-date']) - this.datetime = headers['X-Amz-Date'] || headers['x-amz-date'] - else - headers['X-Amz-Date'] = this.getDateTime() - } +// ---------------- +// ECFieldElementFp - delete headers.Authorization - delete headers.authorization - } +// constructor +function ECFieldElementFp(q,x) { + this.x = x; + // TODO if(x.compareTo(q) >= 0) error + this.q = q; } -RequestSigner.prototype.sign = function() { - if (!this.parsedPath) this.prepareRequest() - - if (this.request.signQuery) { - this.parsedPath.query['X-Amz-Signature'] = this.signature() - } else { - this.request.headers.Authorization = this.authHeader() - } - - this.request.path = this.formatPath() - - return this.request +function feFpEquals(other) { + if(other == this) return true; + return (this.q.equals(other.q) && this.x.equals(other.x)); } -RequestSigner.prototype.getDateTime = function() { - if (!this.datetime) { - var headers = this.request.headers, - date = new Date(headers.Date || headers.date || new Date) - - this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '') - - // Remove the trailing 'Z' on the timestamp string for CodeCommit git access - if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1) - } - return this.datetime +function feFpToBigInteger() { + return this.x; } -RequestSigner.prototype.getDate = function() { - return this.getDateTime().substr(0, 8) +function feFpNegate() { + return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); } -RequestSigner.prototype.authHeader = function() { - return [ - 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(), - 'SignedHeaders=' + this.signedHeaders(), - 'Signature=' + this.signature(), - ].join(', ') +function feFpAdd(b) { + return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); } -RequestSigner.prototype.signature = function() { - var date = this.getDate(), - cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(), - kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey) - if (!kCredentials) { - kDate = hmac('AWS4' + this.credentials.secretAccessKey, date) - kRegion = hmac(kDate, this.region) - kService = hmac(kRegion, this.service) - kCredentials = hmac(kService, 'aws4_request') - credentialsCache.set(cacheKey, kCredentials) - } - return hmac(kCredentials, this.stringToSign(), 'hex') +function feFpSubtract(b) { + return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); } -RequestSigner.prototype.stringToSign = function() { - return [ - 'AWS4-HMAC-SHA256', - this.getDateTime(), - this.credentialString(), - hash(this.canonicalString(), 'hex'), - ].join('\n') +function feFpMultiply(b) { + return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); } -RequestSigner.prototype.canonicalString = function() { - if (!this.parsedPath) this.prepareRequest() +function feFpSquare() { + return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); +} - var pathStr = this.parsedPath.path, - query = this.parsedPath.query, - headers = this.request.headers, - queryStr = '', - normalizePath = this.service !== 's3', - decodePath = this.service === 's3' || this.request.doNotEncodePath, - decodeSlashesInPath = this.service === 's3', - firstValOnly = this.service === 's3', - bodyHash +function feFpDivide(b) { + return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); +} - if (this.service === 's3' && this.request.signQuery) { - bodyHash = 'UNSIGNED-PAYLOAD' - } else if (this.isCodeCommitGit) { - bodyHash = '' - } else { - bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] || - hash(this.request.body || '', 'hex') - } +ECFieldElementFp.prototype.equals = feFpEquals; +ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; +ECFieldElementFp.prototype.negate = feFpNegate; +ECFieldElementFp.prototype.add = feFpAdd; +ECFieldElementFp.prototype.subtract = feFpSubtract; +ECFieldElementFp.prototype.multiply = feFpMultiply; +ECFieldElementFp.prototype.square = feFpSquare; +ECFieldElementFp.prototype.divide = feFpDivide; - if (query) { - queryStr = encodeRfc3986(querystring.stringify(Object.keys(query).sort().reduce(function(obj, key) { - if (!key) return obj - obj[key] = !Array.isArray(query[key]) ? query[key] : - (firstValOnly ? query[key][0] : query[key].slice().sort()) - return obj - }, {}))) - } - if (pathStr !== '/') { - if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/') - pathStr = pathStr.split('/').reduce(function(path, piece) { - if (normalizePath && piece === '..') { - path.pop() - } else if (!normalizePath || piece !== '.') { - if (decodePath) piece = decodeURIComponent(piece) - path.push(encodeRfc3986(encodeURIComponent(piece))) - } - return path - }, []).join('/') - if (pathStr[0] !== '/') pathStr = '/' + pathStr - if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/') - } +// ---------------- +// ECPointFp - return [ - this.request.method || 'GET', - pathStr, - queryStr, - this.canonicalHeaders() + '\n', - this.signedHeaders(), - bodyHash, - ].join('\n') +// constructor +function ECPointFp(curve,x,y,z) { + this.curve = curve; + this.x = x; + this.y = y; + // Projective coordinates: either zinv == null or z * zinv == 1 + // z and zinv are just BigIntegers, not fieldElements + if(z == null) { + this.z = BigInteger.ONE; + } + else { + this.z = z; + } + this.zinv = null; + //TODO: compression flag } -RequestSigner.prototype.canonicalHeaders = function() { - var headers = this.request.headers - function trimAll(header) { - return header.toString().trim().replace(/\s+/g, ' ') - } - return Object.keys(headers) - .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 }) - .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) }) - .join('\n') +function pointFpGetX() { + if(this.zinv == null) { + this.zinv = this.z.modInverse(this.curve.q); + } + var r = this.x.toBigInteger().multiply(this.zinv); + this.curve.reduce(r); + return this.curve.fromBigInteger(r); } -RequestSigner.prototype.signedHeaders = function() { - return Object.keys(this.request.headers) - .map(function(key) { return key.toLowerCase() }) - .sort() - .join(';') +function pointFpGetY() { + if(this.zinv == null) { + this.zinv = this.z.modInverse(this.curve.q); + } + var r = this.y.toBigInteger().multiply(this.zinv); + this.curve.reduce(r); + return this.curve.fromBigInteger(r); } -RequestSigner.prototype.credentialString = function() { - return [ - this.getDate(), - this.region, - this.service, - 'aws4_request', - ].join('/') +function pointFpEquals(other) { + if(other == this) return true; + if(this.isInfinity()) return other.isInfinity(); + if(other.isInfinity()) return this.isInfinity(); + var u, v; + // u = Y2 * Z1 - Y1 * Z2 + u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); + if(!u.equals(BigInteger.ZERO)) return false; + // v = X2 * Z1 - X1 * Z2 + v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); + return v.equals(BigInteger.ZERO); } -RequestSigner.prototype.defaultCredentials = function() { - var env = process.env - return { - accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY, - secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY, - sessionToken: env.AWS_SESSION_TOKEN, - } +function pointFpIsInfinity() { + if((this.x == null) && (this.y == null)) return true; + return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); } -RequestSigner.prototype.parsePath = function() { - var path = this.request.path || '/', - queryIx = path.indexOf('?'), - query = null - - if (queryIx >= 0) { - query = querystring.parse(path.slice(queryIx + 1)) - path = path.slice(0, queryIx) - } - - // S3 doesn't always encode characters > 127 correctly and - // all services don't encode characters > 255 correctly - // So if there are non-reserved chars (and it's not already all % encoded), just encode them all - if (/[^0-9A-Za-z!'()*\-._~%/]/.test(path)) { - path = path.split('/').map(function(piece) { - return encodeURIComponent(decodeURIComponent(piece)) - }).join('/') - } - - this.parsedPath = { - path: path, - query: query, - } +function pointFpNegate() { + return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); } -RequestSigner.prototype.formatPath = function() { - var path = this.parsedPath.path, - query = this.parsedPath.query - - if (!query) return path - - // Services don't support empty query string keys - if (query[''] != null) delete query[''] +function pointFpAdd(b) { + if(this.isInfinity()) return b; + if(b.isInfinity()) return this; - return path + '?' + encodeRfc3986(querystring.stringify(query)) -} + // u = Y2 * Z1 - Y1 * Z2 + var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); + // v = X2 * Z1 - X1 * Z2 + var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); -aws4.RequestSigner = RequestSigner + if(BigInteger.ZERO.equals(v)) { + if(BigInteger.ZERO.equals(u)) { + return this.twice(); // this == b, so double + } + return this.curve.getInfinity(); // this = -b, so infinity + } -aws4.sign = function(request, credentials) { - return new RequestSigner(request, credentials).sign() -} + var THREE = new BigInteger("3"); + var x1 = this.x.toBigInteger(); + var y1 = this.y.toBigInteger(); + var x2 = b.x.toBigInteger(); + var y2 = b.y.toBigInteger(); + var v2 = v.square(); + var v3 = v2.multiply(v); + var x1v2 = x1.multiply(v2); + var zu2 = u.square().multiply(this.z); -/***/ }), + // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) + var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); + // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 + var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); + // z3 = v^3 * z1 * z2 + var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); -/***/ 772: -/***/ (function(module, __unusedexports, __webpack_require__) { + return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); +} -// Copyright 2015 Joyent, Inc. +function pointFpTwice() { + if(this.isInfinity()) return this; + if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); -var assert = __webpack_require__(976); -var crypto = __webpack_require__(417); -var sshpk = __webpack_require__(133); -var utils = __webpack_require__(329); + // TODO: optimized handling of constants + var THREE = new BigInteger("3"); + var x1 = this.x.toBigInteger(); + var y1 = this.y.toBigInteger(); -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var HttpSignatureError = utils.HttpSignatureError; -var validateAlgorithm = utils.validateAlgorithm; + var y1z1 = y1.multiply(this.z); + var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); + var a = this.curve.a.toBigInteger(); -///--- Exported API + // w = 3 * x1^2 + a * z1^2 + var w = x1.square().multiply(THREE); + if(!BigInteger.ZERO.equals(a)) { + w = w.add(this.z.square().multiply(a)); + } + w = w.mod(this.curve.q); + //this.curve.reduce(w); + // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) + var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); + // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 + var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); + // z3 = 8 * (y1 * z1)^3 + var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); -module.exports = { - /** - * Verify RSA/DSA signature against public key. You are expected to pass in - * an object that was returned from `parse()`. - * - * @param {Object} parsedSignature the object you got from `parse`. - * @param {String} pubkey RSA/DSA private key PEM. - * @return {Boolean} true if valid, false otherwise. - * @throws {TypeError} if you pass in bad arguments. - * @throws {InvalidAlgorithmError} - */ - verifySignature: function verifySignature(parsedSignature, pubkey) { - assert.object(parsedSignature, 'parsedSignature'); - if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) - pubkey = sshpk.parseKey(pubkey); - assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); + return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); +} - var alg = validateAlgorithm(parsedSignature.algorithm); - if (alg[0] === 'hmac' || alg[0] !== pubkey.type) - return (false); +// Simple NAF (Non-Adjacent Form) multiplication algorithm +// TODO: modularize the multiplication algorithm +function pointFpMultiply(k) { + if(this.isInfinity()) return this; + if(k.signum() == 0) return this.curve.getInfinity(); - var v = pubkey.createVerify(alg[1]); - v.update(parsedSignature.signingString); - return (v.verify(parsedSignature.params.signature, 'base64')); - }, + var e = k; + var h = e.multiply(new BigInteger("3")); - /** - * Verify HMAC against shared secret. You are expected to pass in an object - * that was returned from `parse()`. - * - * @param {Object} parsedSignature the object you got from `parse`. - * @param {String} secret HMAC shared secret. - * @return {Boolean} true if valid, false otherwise. - * @throws {TypeError} if you pass in bad arguments. - * @throws {InvalidAlgorithmError} - */ - verifyHMAC: function verifyHMAC(parsedSignature, secret) { - assert.object(parsedSignature, 'parsedHMAC'); - assert.string(secret, 'secret'); + var neg = this.negate(); + var R = this; - var alg = validateAlgorithm(parsedSignature.algorithm); - if (alg[0] !== 'hmac') - return (false); + var i; + for(i = h.bitLength() - 2; i > 0; --i) { + R = R.twice(); - var hashAlg = alg[1].toUpperCase(); + var hBit = h.testBit(i); + var eBit = e.testBit(i); - var hmac = crypto.createHmac(hashAlg, secret); - hmac.update(parsedSignature.signingString); + if (hBit != eBit) { + R = R.add(hBit ? this : neg); + } + } - /* - * Now double-hash to avoid leaking timing information - there's - * no easy constant-time compare in JS, so we use this approach - * instead. See for more info: - * https://www.isecpartners.com/blog/2011/february/double-hmac- - * verification.aspx - */ - var h1 = crypto.createHmac(hashAlg, secret); - h1.update(hmac.digest()); - h1 = h1.digest(); - var h2 = crypto.createHmac(hashAlg, secret); - h2.update(new Buffer(parsedSignature.params.signature, 'base64')); - h2 = h2.digest(); + return R; +} - /* Node 0.8 returns strings from .digest(). */ - if (typeof (h1) === 'string') - return (h1 === h2); - /* And node 0.10 lacks the .equals() method on Buffers. */ - if (Buffer.isBuffer(h1) && !h1.equals) - return (h1.toString('binary') === h2.toString('binary')); +// Compute this*j + x*k (simultaneous multiplication) +function pointFpMultiplyTwo(j,x,k) { + var i; + if(j.bitLength() > k.bitLength()) + i = j.bitLength() - 1; + else + i = k.bitLength() - 1; - return (h1.equals(h2)); + var R = this.curve.getInfinity(); + var both = this.add(x); + while(i >= 0) { + R = R.twice(); + if(j.testBit(i)) { + if(k.testBit(i)) { + R = R.add(both); + } + else { + R = R.add(this); + } + } + else { + if(k.testBit(i)) { + R = R.add(x); + } + } + --i; } -}; + return R; +} -/***/ }), - -/***/ 778: -/***/ (function(module, __unusedexports, __webpack_require__) { +ECPointFp.prototype.getX = pointFpGetX; +ECPointFp.prototype.getY = pointFpGetY; +ECPointFp.prototype.equals = pointFpEquals; +ECPointFp.prototype.isInfinity = pointFpIsInfinity; +ECPointFp.prototype.negate = pointFpNegate; +ECPointFp.prototype.add = pointFpAdd; +ECPointFp.prototype.twice = pointFpTwice; +ECPointFp.prototype.multiply = pointFpMultiply; +ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; -// Copyright 2015 Joyent, Inc. +// ---------------- +// ECCurveFp -var Buffer = __webpack_require__(601).Buffer; +// constructor +function ECCurveFp(q,a,b) { + this.q = q; + this.a = this.fromBigInteger(a); + this.b = this.fromBigInteger(b); + this.infinity = new ECPointFp(this, null, null); + this.reducer = new Barrett(this.q); +} -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['A'], - sizePart: 'A' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; +function curveFpGetQ() { + return this.q; +} -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['A', 'k'] - } -}; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; +function curveFpGetA() { + return this.a; +} -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true -}; +function curveFpGetB() { + return this.b; +} -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf - */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: Buffer.from(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: Buffer.from(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: Buffer.from(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: Buffer.from(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; +function curveFpEquals(other) { + if(other == this) return true; + return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); +} -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves -}; +function curveFpGetInfinity() { + return this.infinity; +} +function curveFpFromBigInteger(x) { + return new ECFieldElementFp(this.q, x); +} -/***/ }), +function curveReduce(x) { + this.reducer.reduce(x); +} -/***/ 779: -/***/ (function(module) { +// for now, work with hex strings because they're easier in JS +function curveFpDecodePointHex(s) { + switch(parseInt(s.substr(0,2), 16)) { // first byte + case 0: + return this.infinity; + case 2: + case 3: + // point compression not supported yet + return null; + case 4: + case 6: + case 7: + var len = (s.length - 2) / 2; + var xHex = s.substr(2, len); + var yHex = s.substr(len+2, len); -"use strict"; + return new ECPointFp(this, + this.fromBigInteger(new BigInteger(xHex, 16)), + this.fromBigInteger(new BigInteger(yHex, 16))); -module.exports = function generate_validate(it, $keyword, $ruleType) { - var out = ''; - var $async = it.schema.$async === true, - $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'), - $id = it.self._getId(it.schema); - if (it.opts.strictKeywords) { - var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); - if ($unknownKwd) { - var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; - if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); - else throw new Error($keywordsMsg); - } - } - if (it.isTop) { - out += ' var validate = '; - if ($async) { - it.async = true; - out += 'async '; - } - out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; - if ($id && (it.opts.sourceCode || it.opts.processCode)) { - out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; - } - } - if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { - var $keyword = 'false schema'; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - if (it.schema === false) { - if (it.isTop) { - $breakOnError = true; - } else { - out += ' var ' + ($valid) + ' = false; '; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'boolean schema is false\' '; - } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - } else { - if (it.isTop) { - if ($async) { - out += ' return data; '; - } else { - out += ' validate.errors = null; return true; '; - } - } else { - out += ' var ' + ($valid) + ' = true; '; - } - } - if (it.isTop) { - out += ' }; return validate; '; - } - return out; - } - if (it.isTop) { - var $top = it.isTop, - $lvl = it.level = 0, - $dataLvl = it.dataLevel = 0, - $data = 'data'; - it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); - it.baseId = it.baseId || it.rootId; - delete it.isTop; - it.dataPathArr = [undefined]; - if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { - var $defaultMsg = 'default is ignored in the schema root'; - if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); - else throw new Error($defaultMsg); - } - out += ' var vErrors = null; '; - out += ' var errors = 0; '; - out += ' if (rootData === undefined) rootData = data; '; - } else { - var $lvl = it.level, - $dataLvl = it.dataLevel, - $data = 'data' + ($dataLvl || ''); - if ($id) it.baseId = it.resolve.url(it.baseId, $id); - if ($async && !it.async) throw new Error('async schema in sync schema'); - out += ' var errs_' + ($lvl) + ' = errors;'; - } - var $valid = 'valid' + $lvl, - $breakOnError = !it.opts.allErrors, - $closingBraces1 = '', - $closingBraces2 = ''; - var $errorKeyword; - var $typeSchema = it.schema.type, - $typeIsArray = Array.isArray($typeSchema); - if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { - if ($typeIsArray) { - if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); - } else if ($typeSchema != 'null') { - $typeSchema = [$typeSchema, 'null']; - $typeIsArray = true; + default: // unsupported + return null; } - } - if ($typeIsArray && $typeSchema.length == 1) { - $typeSchema = $typeSchema[0]; - $typeIsArray = false; - } - if (it.schema.$ref && $refKeywords) { - if (it.opts.extendRefs == 'fail') { - throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); - } else if (it.opts.extendRefs !== true) { - $refKeywords = false; - it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); +} + +function curveFpEncodePointHex(p) { + if (p.isInfinity()) return "00"; + var xHex = p.getX().toBigInteger().toString(16); + var yHex = p.getY().toBigInteger().toString(16); + var oLen = this.getQ().toString(16).length; + if ((oLen % 2) != 0) oLen++; + while (xHex.length < oLen) { + xHex = "0" + xHex; + } + while (yHex.length < oLen) { + yHex = "0" + yHex; + } + return "04" + xHex + yHex; +} + +ECCurveFp.prototype.getQ = curveFpGetQ; +ECCurveFp.prototype.getA = curveFpGetA; +ECCurveFp.prototype.getB = curveFpGetB; +ECCurveFp.prototype.equals = curveFpEquals; +ECCurveFp.prototype.getInfinity = curveFpGetInfinity; +ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; +ECCurveFp.prototype.reduce = curveReduce; +//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; +ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; + +// from: https://github.com/kaielvin/jsbn-ec-point-compression +ECCurveFp.prototype.decodePointHex = function(s) +{ + var yIsEven; + switch(parseInt(s.substr(0,2), 16)) { // first byte + case 0: + return this.infinity; + case 2: + yIsEven = false; + case 3: + if(yIsEven == undefined) yIsEven = true; + var len = s.length - 2; + var xHex = s.substr(2, len); + var x = this.fromBigInteger(new BigInteger(xHex,16)); + var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); + var beta = alpha.sqrt(); + + if (beta == null) throw "Invalid point compression"; + + var betaValue = beta.toBigInteger(); + if (betaValue.testBit(0) != yIsEven) + { + // Use the other root + beta = this.fromBigInteger(this.getQ().subtract(betaValue)); } - } - if (it.schema.$comment && it.opts.$comment) { - out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); - } - if ($typeSchema) { - if (it.opts.coerceTypes) { - var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); + return new ECPointFp(this,x,beta); + case 4: + case 6: + case 7: + var len = (s.length - 2) / 2; + var xHex = s.substr(2, len); + var yHex = s.substr(len+2, len); + + return new ECPointFp(this, + this.fromBigInteger(new BigInteger(xHex, 16)), + this.fromBigInteger(new BigInteger(yHex, 16))); + + default: // unsupported + return null; } - var $rulesGroup = it.RULES.types[$typeSchema]; - if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { - var $schemaPath = it.schemaPath + '.type', - $errSchemaPath = it.errSchemaPath + '/type'; - var $schemaPath = it.schemaPath + '.type', - $errSchemaPath = it.errSchemaPath + '/type', - $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; - out += ' if (' + (it.util[$method]($typeSchema, $data, true)) + ') { '; - if ($coerceToTypes) { - var $dataType = 'dataType' + $lvl, - $coerced = 'coerced' + $lvl; - out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; '; - if (it.opts.coerceTypes == 'array') { - out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ')) ' + ($dataType) + ' = \'array\'; '; - } - out += ' var ' + ($coerced) + ' = undefined; '; - var $bracesCoercion = ''; - var arr1 = $coerceToTypes; - if (arr1) { - var $type, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $type = arr1[$i += 1]; - if ($i) { - out += ' if (' + ($coerced) + ' === undefined) { '; - $bracesCoercion += '}'; - } - if (it.opts.coerceTypes == 'array' && $type != 'array') { - out += ' if (' + ($dataType) + ' == \'array\' && ' + ($data) + '.length == 1) { ' + ($coerced) + ' = ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; } '; - } - if ($type == 'string') { - out += ' if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; - } else if ($type == 'number' || $type == 'integer') { - out += ' if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; - if ($type == 'integer') { - out += ' && !(' + ($data) + ' % 1)'; - } - out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; - } else if ($type == 'boolean') { - out += ' if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; - } else if ($type == 'null') { - out += ' if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; - } else if (it.opts.coerceTypes == 'array' && $type == 'array') { - out += ' if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; - } - } - } - out += ' ' + ($bracesCoercion) + ' if (' + ($coerced) + ' === undefined) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be '; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; - var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', - $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; - out += ' ' + ($data) + ' = ' + ($coerced) + '; '; - if (!$dataLvl) { - out += 'if (' + ($parentData) + ' !== undefined)'; +} +ECCurveFp.prototype.encodeCompressedPointHex = function(p) +{ + if (p.isInfinity()) return "00"; + var xHex = p.getX().toBigInteger().toString(16); + var oLen = this.getQ().toString(16).length; + if ((oLen % 2) != 0) oLen++; + while (xHex.length < oLen) + xHex = "0" + xHex; + var yPrefix; + if(p.getY().toBigInteger().isEven()) yPrefix = "02"; + else yPrefix = "03"; + + return yPrefix + xHex; +} + + +ECFieldElementFp.prototype.getR = function() +{ + if(this.r != undefined) return this.r; + + this.r = null; + var bitLength = this.q.bitLength(); + if (bitLength > 128) + { + var firstWord = this.q.shiftRight(bitLength - 64); + if (firstWord.intValue() == -1) + { + this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); } - out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; - } else { - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be '; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); + } + return this.r; +} +ECFieldElementFp.prototype.modMult = function(x1,x2) +{ + return this.modReduce(x1.multiply(x2)); +} +ECFieldElementFp.prototype.modReduce = function(x) +{ + if (this.getR() != null) + { + var qLen = q.bitLength(); + while (x.bitLength() > (qLen + 1)) + { + var u = x.shiftRight(qLen); + var v = x.subtract(u.shiftLeft(qLen)); + if (!this.getR().equals(BigInteger.ONE)) + { + u = u.multiply(this.getR()); } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; + x = u.add(v); } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + while (x.compareTo(q) >= 0) + { + x = x.subtract(q); } - } - out += ' } '; } - } - if (it.schema.$ref && !$refKeywords) { - out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; - if ($breakOnError) { - out += ' } if (errors === '; - if ($top) { - out += '0'; - } else { - out += 'errs_' + ($lvl); - } - out += ') { '; - $closingBraces2 += '}'; + else + { + x = x.mod(q); } - } else { - var arr2 = it.RULES; - if (arr2) { - var $rulesGroup, i2 = -1, - l2 = arr2.length - 1; - while (i2 < l2) { - $rulesGroup = arr2[i2 += 1]; - if ($shouldUseGroup($rulesGroup)) { - if ($rulesGroup.type) { - out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data)) + ') { '; - } - if (it.opts.useDefaults) { - if ($rulesGroup.type == 'object' && it.schema.properties) { - var $schema = it.schema.properties, - $schemaKeys = Object.keys($schema); - var arr3 = $schemaKeys; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $sch = $schema[$propertyKey]; - if ($sch.default !== undefined) { - var $passData = $data + it.util.getProperty($propertyKey); - if (it.compositeRule) { - if (it.opts.strictDefaults) { - var $defaultMsg = 'default is ignored for: ' + $passData; - if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); - else throw new Error($defaultMsg); - } - } else { - out += ' if (' + ($passData) + ' === undefined '; - if (it.opts.useDefaults == 'empty') { - out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; - } - out += ' ) ' + ($passData) + ' = '; - if (it.opts.useDefaults == 'shared') { - out += ' ' + (it.useDefault($sch.default)) + ' '; - } else { - out += ' ' + (JSON.stringify($sch.default)) + ' '; - } - out += '; '; - } - } - } - } - } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { - var arr4 = it.schema.items; - if (arr4) { - var $sch, $i = -1, - l4 = arr4.length - 1; - while ($i < l4) { - $sch = arr4[$i += 1]; - if ($sch.default !== undefined) { - var $passData = $data + '[' + $i + ']'; - if (it.compositeRule) { - if (it.opts.strictDefaults) { - var $defaultMsg = 'default is ignored for: ' + $passData; - if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); - else throw new Error($defaultMsg); - } - } else { - out += ' if (' + ($passData) + ' === undefined '; - if (it.opts.useDefaults == 'empty') { - out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; - } - out += ' ) ' + ($passData) + ' = '; - if (it.opts.useDefaults == 'shared') { - out += ' ' + (it.useDefault($sch.default)) + ' '; - } else { - out += ' ' + (JSON.stringify($sch.default)) + ' '; - } - out += '; '; - } - } - } - } - } - } - var arr5 = $rulesGroup.rules; - if (arr5) { - var $rule, i5 = -1, - l5 = arr5.length - 1; - while (i5 < l5) { - $rule = arr5[i5 += 1]; - if ($shouldUseRule($rule)) { - var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); - if ($code) { - out += ' ' + ($code) + ' '; - if ($breakOnError) { - $closingBraces1 += '}'; - } - } - } - } - } - if ($breakOnError) { - out += ' ' + ($closingBraces1) + ' '; - $closingBraces1 = ''; - } - if ($rulesGroup.type) { - out += ' } '; - if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { - out += ' else { '; - var $schemaPath = it.schemaPath + '.type', - $errSchemaPath = it.errSchemaPath + '/type'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be '; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - } - } - if ($breakOnError) { - out += ' if (errors === '; - if ($top) { - out += '0'; - } else { - out += 'errs_' + ($lvl); - } - out += ') { '; - $closingBraces2 += '}'; - } - } - } + return x; +} +ECFieldElementFp.prototype.sqrt = function() +{ + if (!this.q.testBit(0)) throw "unsupported"; + + // p mod 4 == 3 + if (this.q.testBit(1)) + { + var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); + return z.square().equals(this) ? z : null; } - } - if ($breakOnError) { - out += ' ' + ($closingBraces2) + ' '; - } - if ($top) { - if ($async) { - out += ' if (errors === 0) return data; '; - out += ' else throw new ValidationError(vErrors); '; - } else { - out += ' validate.errors = vErrors; '; - out += ' return errors === 0; '; + + // p mod 4 == 1 + var qMinusOne = this.q.subtract(BigInteger.ONE); + + var legendreExponent = qMinusOne.shiftRight(1); + if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) + { + return null; } - out += ' }; return validate;'; - } else { - out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; - } - out = it.util.cleanUpCode(out); - if ($top) { - out = it.util.finalCleanUpCode(out, $async); - } - function $shouldUseGroup($rulesGroup) { - var rules = $rulesGroup.rules; - for (var i = 0; i < rules.length; i++) - if ($shouldUseRule(rules[i])) return true; - } + var u = qMinusOne.shiftRight(2); + var k = u.shiftLeft(1).add(BigInteger.ONE); - function $shouldUseRule($rule) { - return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); - } + var Q = this.x; + var fourQ = modDouble(modDouble(Q)); - function $ruleImplementsSomeKeyword($rule) { - var impl = $rule.implements; - for (var i = 0; i < impl.length; i++) - if (it.schema[impl[i]] !== undefined) return true; - } - return out; + var U, V; + do + { + var P; + do + { + P = new BigInteger(this.q.bitLength(), new SecureRandom()); + } + while (P.compareTo(this.q) >= 0 + || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); + + var result = this.lucasSequence(P, Q, k); + U = result[0]; + V = result[1]; + + if (this.modMult(V, V).equals(fourQ)) + { + // Integer division by 2, mod q + if (V.testBit(0)) + { + V = V.add(q); + } + + V = V.shiftRight(1); + + return new ECFieldElementFp(q,V); + } + } + while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); + + return null; } +ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) +{ + var n = k.bitLength(); + var s = k.getLowestSetBit(); + var Uh = BigInteger.ONE; + var Vl = BigInteger.TWO; + var Vh = P; + var Ql = BigInteger.ONE; + var Qh = BigInteger.ONE; -/***/ }), + for (var j = n - 1; j >= s + 1; --j) + { + Ql = this.modMult(Ql, Qh); -/***/ 780: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (k.testBit(j)) + { + Qh = this.modMult(Ql, Q); + Uh = this.modMult(Uh, Vh); + Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); + } + else + { + Qh = Ql; + Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); + Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); + } + } -// Unique ID creation requires a high quality random # generator. In node.js -// this is pretty straight-forward - we use the crypto API. + Ql = this.modMult(Ql, Qh); + Qh = this.modMult(Ql, Q); + Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); + Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Ql = this.modMult(Ql, Qh); -var crypto = __webpack_require__(417); + for (var j = 1; j <= s; ++j) + { + Uh = this.modMult(Uh, Vl); + Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); + Ql = this.modMult(Ql, Ql); + } -module.exports = function nodeRNG() { - return crypto.randomBytes(16); -}; + return [ Uh, Vl ]; +} + +var exports = { + ECCurveFp: ECCurveFp, + ECPointFp: ECPointFp, + ECFieldElementFp: ECFieldElementFp +} + +module.exports = exports /***/ }), -/***/ 782: +/***/ 733: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. var assert = __webpack_require__(357); -var Buffer = __webpack_require__(601).Buffer; +var Buffer = __webpack_require__(215).Buffer; -var ASN1 = __webpack_require__(850); -var errors = __webpack_require__(294); +var ASN1 = __webpack_require__(362); +var errors = __webpack_require__(584); // --- Globals @@ -24159,889 +23465,1165 @@ module.exports = Reader; /***/ }), -/***/ 783: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 740: +/***/ (function(module) { + +module.exports = {"$id":"postData.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["mimeType"],"properties":{"mimeType":{"type":"string"},"text":{"type":"string"},"params":{"type":"array","required":["name"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"fileName":{"type":"string"},"contentType":{"type":"string"},"comment":{"type":"string"}}},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 741: +/***/ (function(module) { "use strict"; -/*! - * Copyright (c) 2018, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ -var psl = __webpack_require__(823); -function getPublicSuffix(domain) { - return psl.get(domain); -} +module.exports = function (data, opts) { + if (!opts) opts = {}; + if (typeof opts === 'function') opts = { cmp: opts }; + var cycles = (typeof opts.cycles === 'boolean') ? opts.cycles : false; -exports.getPublicSuffix = getPublicSuffix; + var cmp = opts.cmp && (function (f) { + return function (node) { + return function (a, b) { + var aobj = { key: a, value: node[a] }; + var bobj = { key: b, value: node[b] }; + return f(aobj, bobj); + }; + }; + })(opts.cmp); + + var seen = []; + return (function stringify (node) { + if (node && node.toJSON && typeof node.toJSON === 'function') { + node = node.toJSON(); + } + + if (node === undefined) return; + if (typeof node == 'number') return isFinite(node) ? '' + node : 'null'; + if (typeof node !== 'object') return JSON.stringify(node); + + var i, out; + if (Array.isArray(node)) { + out = '['; + for (i = 0; i < node.length; i++) { + if (i) out += ','; + out += stringify(node[i]) || 'null'; + } + return out + ']'; + } + + if (node === null) return 'null'; + + if (seen.indexOf(node) !== -1) { + if (cycles) return JSON.stringify('__cycle__'); + throw new TypeError('Converting circular structure to JSON'); + } + + var seenIndex = seen.push(node) - 1; + var keys = Object.keys(node).sort(cmp && cmp(node)); + out = ''; + for (i = 0; i < keys.length; i++) { + var key = keys[i]; + var value = stringify(node[key]); + + if (!value) continue; + if (out) out += ','; + out += JSON.stringify(key) + ':' + value; + } + seen.splice(seenIndex, 1); + return '{' + out + '}'; + })(data); +}; + + +/***/ }), + +/***/ 742: +/***/ (function(module) { + +// Generated by CoffeeScript 1.12.2 +(function() { + var getNanoSeconds, hrtime, loadTime, moduleLoadTime, nodeLoadTime, upTime; + + if ((typeof performance !== "undefined" && performance !== null) && performance.now) { + module.exports = function() { + return performance.now(); + }; + } else if ((typeof process !== "undefined" && process !== null) && process.hrtime) { + module.exports = function() { + return (getNanoSeconds() - nodeLoadTime) / 1e6; + }; + hrtime = process.hrtime; + getNanoSeconds = function() { + var hr; + hr = hrtime(); + return hr[0] * 1e9 + hr[1]; + }; + moduleLoadTime = getNanoSeconds(); + upTime = process.uptime() * 1e9; + nodeLoadTime = moduleLoadTime - upTime; + } else if (Date.now) { + module.exports = function() { + return Date.now() - loadTime; + }; + loadTime = Date.now(); + } else { + module.exports = function() { + return new Date().getTime() - loadTime; + }; + loadTime = new Date().getTime(); + } + +}).call(this); + +//# sourceMappingURL=performance-now.js.map + + +/***/ }), + +/***/ 744: +/***/ (function(module) { +module.exports = {"$id":"page.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","id","title","pageTimings"],"properties":{"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"id":{"type":"string","unique":true},"title":{"type":"string"},"pageTimings":{"$ref":"pageTimings.json#"},"comment":{"type":"string"}}}; /***/ }), -/***/ 785: +/***/ 747: /***/ (function(module) { +module.exports = require("fs"); + +/***/ }), + +/***/ 750: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + "use strict"; +/*eslint no-var:0, prefer-arrow-callback: 0, object-shorthand: 0 */ -module.exports = function generate_items(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $idx = 'i' + $lvl, - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $currentBaseId = it.baseId; - out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; - if (Array.isArray($schema)) { - var $additionalItems = it.schema.additionalItems; - if ($additionalItems === false) { - out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; - var $currErrSchemaPath = $errSchemaPath; - $errSchemaPath = it.errSchemaPath + '/additionalItems'; - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; - } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - $errSchemaPath = $currErrSchemaPath; - if ($breakOnError) { - $closingBraces += '}'; - out += ' else { '; - } + + +var Punycode = __webpack_require__(213); + + +var internals = {}; + + +// +// Read rules from file. +// +internals.rules = __webpack_require__(50).map(function (rule) { + + return { + rule: rule, + suffix: rule.replace(/^(\*\.|\!)/, ''), + punySuffix: -1, + wildcard: rule.charAt(0) === '*', + exception: rule.charAt(0) === '!' + }; +}); + + +// +// Check is given string ends with `suffix`. +// +internals.endsWith = function (str, suffix) { + + return str.indexOf(suffix, str.length - suffix.length) !== -1; +}; + + +// +// Find rule for a given domain. +// +internals.findRule = function (domain) { + + var punyDomain = Punycode.toASCII(domain); + return internals.rules.reduce(function (memo, rule) { + + if (rule.punySuffix === -1){ + rule.punySuffix = Punycode.toASCII(rule.suffix); } - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; - var $passData = $data + '[' + $i + ']'; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); - $it.dataPathArr[$dataNxt] = $i; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } + if (!internals.endsWith(punyDomain, '.' + rule.punySuffix) && punyDomain !== rule.punySuffix) { + return memo; } - if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0 : it.util.schemaHasRules($additionalItems, it.RULES.all))) { - $it.schema = $additionalItems; - $it.schemaPath = it.schemaPath + '.additionalItems'; - $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; - out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); - var $passData = $data + '[' + $idx + ']'; - $it.dataPathArr[$dataNxt] = $idx; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - out += ' } } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } + // This has been commented out as it never seems to run. This is because + // sub tlds always appear after their parents and we never find a shorter + // match. + //if (memo) { + // var memoSuffix = Punycode.toASCII(memo.suffix); + // if (memoSuffix.length >= punySuffix.length) { + // return memo; + // } + //} + return rule; + }, null); +}; + + +// +// Error codes and messages. +// +exports.errorCodes = { + DOMAIN_TOO_SHORT: 'Domain name too short.', + DOMAIN_TOO_LONG: 'Domain name too long. It should be no more than 255 chars.', + LABEL_STARTS_WITH_DASH: 'Domain name label can not start with a dash.', + LABEL_ENDS_WITH_DASH: 'Domain name label can not end with a dash.', + LABEL_TOO_LONG: 'Domain name label should be at most 63 chars long.', + LABEL_TOO_SHORT: 'Domain name label should be at least 1 character long.', + LABEL_INVALID_CHARS: 'Domain name label can only contain alphanumeric characters or dashes.' +}; + + +// +// Validate domain name and throw if not valid. +// +// From wikipedia: +// +// Hostnames are composed of series of labels concatenated with dots, as are all +// domain names. Each label must be between 1 and 63 characters long, and the +// entire hostname (including the delimiting dots) has a maximum of 255 chars. +// +// Allowed chars: +// +// * `a-z` +// * `0-9` +// * `-` but not as a starting or ending character +// * `.` as a separator for the textual portions of a domain name +// +// * http://en.wikipedia.org/wiki/Domain_name +// * http://en.wikipedia.org/wiki/Hostname +// +internals.validate = function (input) { + + // Before we can validate we need to take care of IDNs with unicode chars. + var ascii = Punycode.toASCII(input); + + if (ascii.length < 1) { + return 'DOMAIN_TOO_SHORT'; + } + if (ascii.length > 255) { + return 'DOMAIN_TOO_LONG'; + } + + // Check each part's length and allowed chars. + var labels = ascii.split('.'); + var label; + + for (var i = 0; i < labels.length; ++i) { + label = labels[i]; + if (!label.length) { + return 'LABEL_TOO_SHORT'; } - } else if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); - var $passData = $data + '[' + $idx + ']'; - $it.dataPathArr[$dataNxt] = $idx; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + if (label.length > 63) { + return 'LABEL_TOO_LONG'; + } + if (label.charAt(0) === '-') { + return 'LABEL_STARTS_WITH_DASH'; + } + if (label.charAt(label.length - 1) === '-') { + return 'LABEL_ENDS_WITH_DASH'; + } + if (!/^[a-z0-9\-]+$/.test(label)) { + return 'LABEL_INVALID_CHARS'; + } + } +}; + + +// +// Public API +// + + +// +// Parse domain. +// +exports.parse = function (input) { + + if (typeof input !== 'string') { + throw new TypeError('Domain name must be a string.'); + } + + // Force domain to lowercase. + var domain = input.slice(0).toLowerCase(); + + // Handle FQDN. + // TODO: Simply remove trailing dot? + if (domain.charAt(domain.length - 1) === '.') { + domain = domain.slice(0, domain.length - 1); + } + + // Validate and sanitise input. + var error = internals.validate(domain); + if (error) { + return { + input: input, + error: { + message: exports.errorCodes[error], + code: error + } + }; + } + + var parsed = { + input: input, + tld: null, + sld: null, + domain: null, + subdomain: null, + listed: false + }; + + var domainParts = domain.split('.'); + + // Non-Internet TLD + if (domainParts[domainParts.length - 1] === 'local') { + return parsed; + } + + var handlePunycode = function () { + + if (!/xn--/.test(domain)) { + return parsed; } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; + if (parsed.domain) { + parsed.domain = Punycode.toASCII(parsed.domain); } - out += ' }'; - } - if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + if (parsed.subdomain) { + parsed.subdomain = Punycode.toASCII(parsed.subdomain); + } + return parsed; + }; + + var rule = internals.findRule(domain); + + // Unlisted tld. + if (!rule) { + if (domainParts.length < 2) { + return parsed; + } + parsed.tld = domainParts.pop(); + parsed.sld = domainParts.pop(); + parsed.domain = [parsed.sld, parsed.tld].join('.'); + if (domainParts.length) { + parsed.subdomain = domainParts.pop(); + } + return handlePunycode(); } - out = it.util.cleanUpCode(out); - return out; -} + // At this point we know the public suffix is listed. + parsed.listed = true; -/***/ }), + var tldParts = rule.suffix.split('.'); + var privateParts = domainParts.slice(0, domainParts.length - tldParts.length); -/***/ 788: -/***/ (function(module, __unusedexports, __webpack_require__) { + if (rule.exception) { + privateParts.push(tldParts.shift()); + } -"use strict"; + parsed.tld = tldParts.join('.'); + if (!privateParts.length) { + return handlePunycode(); + } -var compileSchema = __webpack_require__(740) - , resolve = __webpack_require__(538) - , Cache = __webpack_require__(68) - , SchemaObject = __webpack_require__(64) - , stableStringify = __webpack_require__(281) - , formats = __webpack_require__(264) - , rules = __webpack_require__(376) - , $dataMetaSchema = __webpack_require__(853) - , util = __webpack_require__(280); + if (rule.wildcard) { + tldParts.unshift(privateParts.pop()); + parsed.tld = tldParts.join('.'); + } -module.exports = Ajv; + if (!privateParts.length) { + return handlePunycode(); + } -Ajv.prototype.validate = validate; -Ajv.prototype.compile = compile; -Ajv.prototype.addSchema = addSchema; -Ajv.prototype.addMetaSchema = addMetaSchema; -Ajv.prototype.validateSchema = validateSchema; -Ajv.prototype.getSchema = getSchema; -Ajv.prototype.removeSchema = removeSchema; -Ajv.prototype.addFormat = addFormat; -Ajv.prototype.errorsText = errorsText; + parsed.sld = privateParts.pop(); + parsed.domain = [parsed.sld, parsed.tld].join('.'); -Ajv.prototype._addSchema = _addSchema; -Ajv.prototype._compile = _compile; + if (privateParts.length) { + parsed.subdomain = privateParts.join('.'); + } -Ajv.prototype.compileAsync = __webpack_require__(49); -var customKeyword = __webpack_require__(904); -Ajv.prototype.addKeyword = customKeyword.add; -Ajv.prototype.getKeyword = customKeyword.get; -Ajv.prototype.removeKeyword = customKeyword.remove; -Ajv.prototype.validateKeyword = customKeyword.validate; + return handlePunycode(); +}; -var errorClasses = __webpack_require__(462); -Ajv.ValidationError = errorClasses.Validation; -Ajv.MissingRefError = errorClasses.MissingRef; -Ajv.$dataMetaSchema = $dataMetaSchema; -var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; +// +// Get domain. +// +exports.get = function (domain) { -var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; -var META_SUPPORT_DATA = ['/properties']; + if (!domain) { + return null; + } + return exports.parse(domain).domain || null; +}; -/** - * Creates validator instance. - * Usage: `Ajv(opts)` - * @param {Object} opts optional options - * @return {Object} ajv instance - */ -function Ajv(opts) { - if (!(this instanceof Ajv)) return new Ajv(opts); - opts = this._opts = util.copy(opts) || {}; - setLogger(this); - this._schemas = {}; - this._refs = {}; - this._fragments = {}; - this._formats = formats(opts.format); - this._cache = opts.cache || new Cache; - this._loadingSchemas = {}; - this._compilations = []; - this.RULES = rules(); - this._getId = chooseGetId(opts); +// +// Check whether domain belongs to a known public suffix. +// +exports.isValid = function (domain) { - opts.loopRequired = opts.loopRequired || Infinity; - if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; - if (opts.serialize === undefined) opts.serialize = stableStringify; - this._metaOpts = getMetaSchemaOptions(this); + var parsed = exports.parse(domain); + return Boolean(parsed.domain && parsed.listed); +}; - if (opts.formats) addInitialFormats(this); - addDefaultMetaSchema(this); - if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); - if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); - addInitialSchemas(this); -} +/***/ }), + +/***/ 751: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var defer = __webpack_require__(500); +// API +module.exports = async; /** - * Validate data using schema - * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. - * @this Ajv - * @param {String|Object} schemaKeyRef key, ref or schema object - * @param {Any} data to be validated - * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). + * Runs provided callback asynchronously + * even if callback itself is not + * + * @param {function} callback - callback to invoke + * @returns {function} - augmented callback */ -function validate(schemaKeyRef, data) { - var v; - if (typeof schemaKeyRef == 'string') { - v = this.getSchema(schemaKeyRef); - if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); - } else { - var schemaObj = this._addSchema(schemaKeyRef); - v = schemaObj.validate || this._compile(schemaObj); - } +function async(callback) +{ + var isAsync = false; - var valid = v(data); - if (v.$async !== true) this.errors = v.errors; - return valid; + // check if async happened + defer(function() { isAsync = true; }); + + return function async_callback(err, result) + { + if (isAsync) + { + callback(err, result); + } + else + { + defer(function nextTick_callback() + { + callback(err, result); + }); + } + }; } -/** - * Create validating function for passed schema. - * @this Ajv - * @param {Object} schema schema object - * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. - * @return {Function} validating function - */ -function compile(schema, _meta) { - var schemaObj = this._addSchema(schema, undefined, _meta); - return schemaObj.validate || this._compile(schemaObj); -} +/***/ }), +/***/ 752: +/***/ (function(module, __unusedexports, __webpack_require__) { -/** - * Adds schema to the instance. - * @this Ajv - * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. - * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. - * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. - * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. - * @return {Ajv} this for method chaining - */ -function addSchema(schema, key, _skipValidation, _meta) { - if (Array.isArray(schema)){ - for (var i=0; i= this.validFrom.getTime()) && + (when.getTime() < this.validUntil.getTime()))); +}; + +Certificate.prototype.isSignedBy = function (issuerCert) { + utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); + + if (!this.issuer.equals(issuerCert.subjects[0])) + return (false); + if (this.issuer.purposes && this.issuer.purposes.length > 0 && + this.issuer.purposes.indexOf('ca') === -1) { + return (false); + } + + return (this.isSignedByKey(issuerCert.subjectKey)); +}; + +Certificate.prototype.getExtension = function (keyOrOid) { + assert.string(keyOrOid, 'keyOrOid'); + var ext = this.getExtensions().filter(function (maybeExt) { + if (maybeExt.format === 'x509') + return (maybeExt.oid === keyOrOid); + if (maybeExt.format === 'openssh') + return (maybeExt.name === keyOrOid); + return (false); + })[0]; + return (ext); +}; + +Certificate.prototype.getExtensions = function () { + var exts = []; + var x509 = this.signatures.x509; + if (x509 && x509.extras && x509.extras.exts) { + x509.extras.exts.forEach(function (ext) { + ext.format = 'x509'; + exts.push(ext); + }); + } + var openssh = this.signatures.openssh; + if (openssh && openssh.exts) { + openssh.exts.forEach(function (ext) { + ext.format = 'openssh'; + exts.push(ext); + }); + } + return (exts); +}; + +Certificate.prototype.isSignedByKey = function (issuerKey) { + utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); + + if (this.issuerKey !== undefined) { + return (this.issuerKey. + fingerprint('sha512').matches(issuerKey)); + } + + var fmt = Object.keys(this.signatures)[0]; + var valid = formats[fmt].verify(this, issuerKey); + if (valid) + this.issuerKey = issuerKey; + return (valid); +}; + +Certificate.prototype.signWith = function (key) { + utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); + var fmts = Object.keys(formats); + var didOne = false; + for (var i = 0; i < fmts.length; ++i) { + if (fmts[i] !== 'pem') { + var ret = formats[fmts[i]].sign(this, key); + if (ret === true) + didOne = true; + } + } + if (!didOne) { + throw (new Error('Failed to sign the certificate for any ' + + 'available certificate formats')); + } +}; + +Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { + var subjects; + if (Array.isArray(subjectOrSubjects)) + subjects = subjectOrSubjects; + else + subjects = [subjectOrSubjects]; + + assert.arrayOfObject(subjects); + subjects.forEach(function (subject) { + utils.assertCompatible(subject, Identity, [1, 0], 'subject'); + }); + + utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); + + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalObject(options.validFrom, 'options.validFrom'); + assert.optionalObject(options.validUntil, 'options.validUntil'); + var validFrom = options.validFrom; + var validUntil = options.validUntil; + if (validFrom === undefined) + validFrom = new Date(); + if (validUntil === undefined) { + assert.optionalNumber(options.lifetime, 'options.lifetime'); + var lifetime = options.lifetime; + if (lifetime === undefined) + lifetime = 10*365*24*3600; + validUntil = new Date(); + validUntil.setTime(validUntil.getTime() + lifetime*1000); + } + assert.optionalBuffer(options.serial, 'options.serial'); + var serial = options.serial; + if (serial === undefined) + serial = Buffer.from('0000000000000001', 'hex'); + + var purposes = options.purposes; + if (purposes === undefined) + purposes = []; + + if (purposes.indexOf('signature') === -1) + purposes.push('signature'); + + /* Self-signed certs are always CAs. */ + if (purposes.indexOf('ca') === -1) + purposes.push('ca'); + if (purposes.indexOf('crl') === -1) + purposes.push('crl'); + + /* + * If we weren't explicitly given any other purposes, do the sensible + * thing and add some basic ones depending on the subject type. + */ + if (purposes.length <= 3) { + var hostSubjects = subjects.filter(function (subject) { + return (subject.type === 'host'); + }); + var userSubjects = subjects.filter(function (subject) { + return (subject.type === 'user'); + }); + if (hostSubjects.length > 0) { + if (purposes.indexOf('serverAuth') === -1) + purposes.push('serverAuth'); + } + if (userSubjects.length > 0) { + if (purposes.indexOf('clientAuth') === -1) + purposes.push('clientAuth'); + } + if (userSubjects.length > 0 || hostSubjects.length > 0) { + if (purposes.indexOf('keyAgreement') === -1) + purposes.push('keyAgreement'); + if (key.type === 'rsa' && + purposes.indexOf('encryption') === -1) + purposes.push('encryption'); + } + } + + var cert = new Certificate({ + subjects: subjects, + issuer: subjects[0], + subjectKey: key.toPublic(), + issuerKey: key.toPublic(), + signatures: {}, + serial: serial, + validFrom: validFrom, + validUntil: validUntil, + purposes: purposes + }); + cert.signWith(key); -function _getSchemaFragment(self, ref) { - var res = resolve.schema.call(self, { schema: {} }, ref); - if (res) { - var schema = res.schema - , root = res.root - , baseId = res.baseId; - var v = compileSchema.call(self, schema, root, undefined, baseId); - self._fragments[ref] = new SchemaObject({ - ref: ref, - fragment: true, - schema: schema, - root: root, - baseId: baseId, - validate: v - }); - return v; - } -} + return (cert); +}; +Certificate.create = + function (subjectOrSubjects, key, issuer, issuerKey, options) { + var subjects; + if (Array.isArray(subjectOrSubjects)) + subjects = subjectOrSubjects; + else + subjects = [subjectOrSubjects]; -function _getSchemaObj(self, keyRef) { - keyRef = resolve.normalizeId(keyRef); - return self._schemas[keyRef] || self._refs[keyRef] || self._fragments[keyRef]; -} + assert.arrayOfObject(subjects); + subjects.forEach(function (subject) { + utils.assertCompatible(subject, Identity, [1, 0], 'subject'); + }); + utils.assertCompatible(key, Key, [1, 0], 'key'); + if (PrivateKey.isPrivateKey(key)) + key = key.toPublic(); + utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); + utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); -/** - * Remove cached schema(s). - * If no parameter is passed all schemas but meta-schemas are removed. - * If RegExp is passed all schemas with key/id matching pattern but meta-schemas are removed. - * Even if schema is referenced by other schemas it still can be removed as other schemas have local references. - * @this Ajv - * @param {String|Object|RegExp} schemaKeyRef key, ref, pattern to match key/ref or schema object - * @return {Ajv} this for method chaining - */ -function removeSchema(schemaKeyRef) { - if (schemaKeyRef instanceof RegExp) { - _removeAllSchemas(this, this._schemas, schemaKeyRef); - _removeAllSchemas(this, this._refs, schemaKeyRef); - return this; - } - switch (typeof schemaKeyRef) { - case 'undefined': - _removeAllSchemas(this, this._schemas); - _removeAllSchemas(this, this._refs); - this._cache.clear(); - return this; - case 'string': - var schemaObj = _getSchemaObj(this, schemaKeyRef); - if (schemaObj) this._cache.del(schemaObj.cacheKey); - delete this._schemas[schemaKeyRef]; - delete this._refs[schemaKeyRef]; - return this; - case 'object': - var serialize = this._opts.serialize; - var cacheKey = serialize ? serialize(schemaKeyRef) : schemaKeyRef; - this._cache.del(cacheKey); - var id = this._getId(schemaKeyRef); - if (id) { - id = resolve.normalizeId(id); - delete this._schemas[id]; - delete this._refs[id]; - } - } - return this; -} + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalObject(options.validFrom, 'options.validFrom'); + assert.optionalObject(options.validUntil, 'options.validUntil'); + var validFrom = options.validFrom; + var validUntil = options.validUntil; + if (validFrom === undefined) + validFrom = new Date(); + if (validUntil === undefined) { + assert.optionalNumber(options.lifetime, 'options.lifetime'); + var lifetime = options.lifetime; + if (lifetime === undefined) + lifetime = 10*365*24*3600; + validUntil = new Date(); + validUntil.setTime(validUntil.getTime() + lifetime*1000); + } + assert.optionalBuffer(options.serial, 'options.serial'); + var serial = options.serial; + if (serial === undefined) + serial = Buffer.from('0000000000000001', 'hex'); + var purposes = options.purposes; + if (purposes === undefined) + purposes = []; -function _removeAllSchemas(self, schemas, regex) { - for (var keyRef in schemas) { - var schemaObj = schemas[keyRef]; - if (!schemaObj.meta && (!regex || regex.test(keyRef))) { - self._cache.del(schemaObj.cacheKey); - delete schemas[keyRef]; - } - } -} + if (purposes.indexOf('signature') === -1) + purposes.push('signature'); + if (options.ca === true) { + if (purposes.indexOf('ca') === -1) + purposes.push('ca'); + if (purposes.indexOf('crl') === -1) + purposes.push('crl'); + } -/* @this Ajv */ -function _addSchema(schema, skipValidation, meta, shouldAddSchema) { - if (typeof schema != 'object' && typeof schema != 'boolean') - throw new Error('schema should be object or boolean'); - var serialize = this._opts.serialize; - var cacheKey = serialize ? serialize(schema) : schema; - var cached = this._cache.get(cacheKey); - if (cached) return cached; + var hostSubjects = subjects.filter(function (subject) { + return (subject.type === 'host'); + }); + var userSubjects = subjects.filter(function (subject) { + return (subject.type === 'user'); + }); + if (hostSubjects.length > 0) { + if (purposes.indexOf('serverAuth') === -1) + purposes.push('serverAuth'); + } + if (userSubjects.length > 0) { + if (purposes.indexOf('clientAuth') === -1) + purposes.push('clientAuth'); + } + if (userSubjects.length > 0 || hostSubjects.length > 0) { + if (purposes.indexOf('keyAgreement') === -1) + purposes.push('keyAgreement'); + if (key.type === 'rsa' && + purposes.indexOf('encryption') === -1) + purposes.push('encryption'); + } - shouldAddSchema = shouldAddSchema || this._opts.addUsedSchema !== false; + var cert = new Certificate({ + subjects: subjects, + issuer: issuer, + subjectKey: key, + issuerKey: issuerKey.toPublic(), + signatures: {}, + serial: serial, + validFrom: validFrom, + validUntil: validUntil, + purposes: purposes + }); + cert.signWith(issuerKey); - var id = resolve.normalizeId(this._getId(schema)); - if (id && shouldAddSchema) checkUnique(this, id); + return (cert); +}; - var willValidate = this._opts.validateSchema !== false && !skipValidation; - var recursiveMeta; - if (willValidate && !(recursiveMeta = id && id == resolve.normalizeId(schema.$schema))) - this.validateSchema(schema, true); +Certificate.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; - var localRefs = resolve.ids.call(this, schema); + assert.object(formats[format], 'formats[format]'); - var schemaObj = new SchemaObject({ - id: id, - schema: schema, - localRefs: localRefs, - cacheKey: cacheKey, - meta: meta - }); + try { + var k = formats[format].read(data, options); + return (k); + } catch (e) { + throw (new CertificateParseError(options.filename, format, e)); + } +}; - if (id[0] != '#' && shouldAddSchema) this._refs[id] = schemaObj; - this._cache.put(cacheKey, schemaObj); +Certificate.isCertificate = function (obj, ver) { + return (utils.isCompatible(obj, Certificate, ver)); +}; - if (willValidate && recursiveMeta) this.validateSchema(schema, true); +/* + * API versions for Certificate: + * [1,0] -- initial ver + * [1,1] -- openssh format now unpacks extensions + */ +Certificate.prototype._sshpkApiVersion = [1, 1]; - return schemaObj; -} +Certificate._oldVersionDetect = function (obj) { + return ([1, 0]); +}; -/* @this Ajv */ -function _compile(schemaObj, root) { - if (schemaObj.compiling) { - schemaObj.validate = callValidate; - callValidate.schema = schemaObj.schema; - callValidate.errors = null; - callValidate.root = root ? root : callValidate; - if (schemaObj.schema.$async === true) - callValidate.$async = true; - return callValidate; - } - schemaObj.compiling = true; +/***/ }), - var currentOpts; - if (schemaObj.meta) { - currentOpts = this._opts; - this._opts = this._metaOpts; - } +/***/ 753: +/***/ (function(module, __unusedexports, __webpack_require__) { - var v; - try { v = compileSchema.call(this, schemaObj.schema, root, schemaObj.localRefs); } - catch(e) { - delete schemaObj.validate; - throw e; - } - finally { - schemaObj.compiling = false; - if (schemaObj.meta) this._opts = currentOpts; - } +// Copyright 2015 Joyent, Inc. - schemaObj.validate = v; - schemaObj.refs = v.refs; - schemaObj.refVal = v.refVal; - schemaObj.root = v.root; - return v; +var assert = __webpack_require__(477); +var util = __webpack_require__(669); +function FingerprintFormatError(fp, format) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, FingerprintFormatError); + this.name = 'FingerprintFormatError'; + this.fingerprint = fp; + this.format = format; + this.message = 'Fingerprint format is not supported, or is invalid: '; + if (fp !== undefined) + this.message += ' fingerprint = ' + fp; + if (format !== undefined) + this.message += ' format = ' + format; +} +util.inherits(FingerprintFormatError, Error); - /* @this {*} - custom context, see passContext option */ - function callValidate() { - /* jshint validthis: true */ - var _validate = schemaObj.validate; - var result = _validate.apply(this, arguments); - callValidate.errors = _validate.errors; - return result; - } +function InvalidAlgorithmError(alg) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, InvalidAlgorithmError); + this.name = 'InvalidAlgorithmError'; + this.algorithm = alg; + this.message = 'Algorithm "' + alg + '" is not supported'; } +util.inherits(InvalidAlgorithmError, Error); +function KeyParseError(name, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, KeyParseError); + this.name = 'KeyParseError'; + this.format = format; + this.keyName = name; + this.innerErr = innerErr; + this.message = 'Failed to parse ' + name + ' as a valid ' + format + + ' format key: ' + innerErr.message; +} +util.inherits(KeyParseError, Error); -function chooseGetId(opts) { - switch (opts.schemaId) { - case 'auto': return _get$IdOrId; - case 'id': return _getId; - default: return _get$Id; - } +function SignatureParseError(type, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, SignatureParseError); + this.name = 'SignatureParseError'; + this.type = type; + this.format = format; + this.innerErr = innerErr; + this.message = 'Failed to parse the given data as a ' + type + + ' signature in ' + format + ' format: ' + innerErr.message; } +util.inherits(SignatureParseError, Error); -/* @this Ajv */ -function _getId(schema) { - if (schema.$id) this.logger.warn('schema $id ignored', schema.$id); - return schema.id; +function CertificateParseError(name, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, CertificateParseError); + this.name = 'CertificateParseError'; + this.format = format; + this.certName = name; + this.innerErr = innerErr; + this.message = 'Failed to parse ' + name + ' as a valid ' + format + + ' format certificate: ' + innerErr.message; } +util.inherits(CertificateParseError, Error); -/* @this Ajv */ -function _get$Id(schema) { - if (schema.id) this.logger.warn('schema id ignored', schema.id); - return schema.$id; +function KeyEncryptedError(name, format) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, KeyEncryptedError); + this.name = 'KeyEncryptedError'; + this.format = format; + this.keyName = name; + this.message = 'The ' + format + ' format key ' + name + ' is ' + + 'encrypted (password-protected), and no passphrase was ' + + 'provided in `options`'; } +util.inherits(KeyEncryptedError, Error); +module.exports = { + FingerprintFormatError: FingerprintFormatError, + InvalidAlgorithmError: InvalidAlgorithmError, + KeyParseError: KeyParseError, + SignatureParseError: SignatureParseError, + KeyEncryptedError: KeyEncryptedError, + CertificateParseError: CertificateParseError +}; -function _get$IdOrId(schema) { - if (schema.$id && schema.id && schema.$id != schema.id) - throw new Error('schema $id is different from id'); - return schema.$id || schema.id; -} +/***/ }), -/** - * Convert array of error message objects to string - * @this Ajv - * @param {Array} errors optional array of validation errors, if not passed errors from the instance are used. - * @param {Object} options optional options with properties `separator` and `dataVar`. - * @return {String} human readable string with all errors descriptions - */ -function errorsText(errors, options) { - errors = errors || this.errors; - if (!errors) return 'No errors'; - options = options || {}; - var separator = options.separator === undefined ? ', ' : options.separator; - var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; +/***/ 755: +/***/ (function(module, __unusedexports, __webpack_require__) { - var text = ''; - for (var i=0; i= 0; --i) { + var obj; + var root = chain[i]; -function getMetaSchemaOptions(self) { - var metaOpts = util.copy(self._opts); - for (var i=0; i= 0 + && (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = leaf; + } else { + obj[cleanRoot] = leaf; + } + } + + leaf = obj; + } + return leaf; +}; -function setLogger(self) { - var logger = self._opts.logger; - if (logger === false) { - self.logger = {log: noop, warn: noop, error: noop}; - } else { - if (logger === undefined) logger = console; - if (!(typeof logger == 'object' && logger.log && logger.warn && logger.error)) - throw new Error('logger must implement log, warn and error methods'); - self.logger = logger; - } -} +var parseKeys = function parseQueryStringKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; -function noop() {} + // The regex chunks + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; -/***/ }), + // Get the parent -/***/ 798: -/***/ (function(module, __unusedexports, __webpack_require__) { + var segment = brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; -// Named EC curves + // Stash the parent if it exists -// Requires ec.js, jsbn.js, and jsbn2.js -var BigInteger = __webpack_require__(36).BigInteger -var ECCurveFp = __webpack_require__(396).ECCurveFp + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys + // that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(parent); + } -// ---------------- -// X9ECParameters + // Loop through children appending to the array until we hit depth -// constructor -function X9ECParameters(curve,g,n,h) { - this.curve = curve; - this.g = g; - this.n = n; - this.h = h; -} + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } -function x9getCurve() { - return this.curve; -} + // If there's a remainder, just add whatever is left -function x9getG() { - return this.g; -} + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } -function x9getN() { - return this.n; -} + return parseObject(keys, val, options); +}; -function x9getH() { - return this.h; -} +module.exports = function (str, opts) { + var options = opts ? utils.assign({}, opts) : {}; -X9ECParameters.prototype.getCurve = x9getCurve; -X9ECParameters.prototype.getG = x9getG; -X9ECParameters.prototype.getN = x9getN; -X9ECParameters.prototype.getH = x9getH; + if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } -// ---------------- -// SECNamedCurves + options.ignoreQueryPrefix = options.ignoreQueryPrefix === true; + options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; + options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; + options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; + options.parseArrays = options.parseArrays !== false; + options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; + options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; + options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; + options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; + options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; + options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; -function fromHex(s) { return new BigInteger(s, 16); } + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } -function secp128r1() { - // p = 2^128 - 2^97 - 1 - var p = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF"); - var a = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFC"); - var b = fromHex("E87579C11079F43DD824993C2CEE5ED3"); - //byte[] S = Hex.decode("000E0D4D696E6768756151750CC03A4473D03679"); - var n = fromHex("FFFFFFFE0000000075A30D1B9038A115"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "161FF7528B899B2D0C28607CA52C5B86" - + "CF5AC8395BAFEB13C02DA292DDED7A83"); - return new X9ECParameters(curve, G, n, h); -} + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; -function secp160k1() { - // p = 2^160 - 2^32 - 2^14 - 2^12 - 2^9 - 2^8 - 2^7 - 2^3 - 2^2 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFAC73"); - var a = BigInteger.ZERO; - var b = fromHex("7"); - //byte[] S = null; - var n = fromHex("0100000000000000000001B8FA16DFAB9ACA16B6B3"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "3B4C382CE37AA192A4019E763036F4F5DD4D7EBB" - + "938CF935318FDCED6BC28286531733C3F03C4FEE"); - return new X9ECParameters(curve, G, n, h); -} + // Iterate over the keys and setup the new object -function secp160r1() { - // p = 2^160 - 2^31 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF"); - var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFC"); - var b = fromHex("1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45"); - //byte[] S = Hex.decode("1053CDE42C14D696E67687561517533BF3F83345"); - var n = fromHex("0100000000000000000001F4C8F927AED3CA752257"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "4A96B5688EF573284664698968C38BB913CBFC82" - + "23A628553168947D59DCC912042351377AC5FB32"); - return new X9ECParameters(curve, G, n, h); -} + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = utils.merge(obj, newObj, options); + } -function secp192k1() { - // p = 2^192 - 2^32 - 2^12 - 2^8 - 2^7 - 2^6 - 2^3 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFEE37"); - var a = BigInteger.ZERO; - var b = fromHex("3"); - //byte[] S = null; - var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFE26F2FC170F69466A74DEFD8D"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "DB4FF10EC057E9AE26B07D0280B7F4341DA5D1B1EAE06C7D" - + "9B2F2F6D9C5628A7844163D015BE86344082AA88D95E2F9D"); - return new X9ECParameters(curve, G, n, h); -} + return utils.compact(obj); +}; -function secp192r1() { - // p = 2^192 - 2^64 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF"); - var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC"); - var b = fromHex("64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1"); - //byte[] S = Hex.decode("3045AE6FC8422F64ED579528D38120EAE12196D5"); - var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012" - + "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811"); - return new X9ECParameters(curve, G, n, h); -} -function secp224r1() { - // p = 2^224 - 2^96 + 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001"); - var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE"); - var b = fromHex("B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4"); - //byte[] S = Hex.decode("BD71344799D5C7FCDC45B59FA3B9AB8F6A948BC5"); - var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21" - + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34"); - return new X9ECParameters(curve, G, n, h); -} +/***/ }), -function secp256r1() { - // p = 2^224 (2^32 - 1) + 2^192 + 2^96 - 1 - var p = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF"); - var a = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC"); - var b = fromHex("5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B"); - //byte[] S = Hex.decode("C49D360886E704936A6678E1139D26B7819F7E90"); - var n = fromHex("FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296" - + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5"); - return new X9ECParameters(curve, G, n, h); -} +/***/ 758: +/***/ (function(module) { -// TODO: make this into a proper hashtable -function getSECCurveByName(name) { - if(name == "secp128r1") return secp128r1(); - if(name == "secp160k1") return secp160k1(); - if(name == "secp160r1") return secp160r1(); - if(name == "secp192k1") return secp192k1(); - if(name == "secp192r1") return secp192r1(); - if(name == "secp224r1") return secp224r1(); - if(name == "secp256r1") return secp256r1(); - return null; -} +module.exports = {"$id":"timings.json#","$schema":"http://json-schema.org/draft-06/schema#","required":["send","wait","receive"],"properties":{"dns":{"type":"number","min":-1},"connect":{"type":"number","min":-1},"blocked":{"type":"number","min":-1},"send":{"type":"number","min":-1},"wait":{"type":"number","min":-1},"receive":{"type":"number","min":-1},"ssl":{"type":"number","min":-1},"comment":{"type":"string"}}}; -module.exports = { - "secp128r1":secp128r1, - "secp160k1":secp160k1, - "secp160r1":secp160r1, - "secp192k1":secp192k1, - "secp192r1":secp192r1, - "secp224r1":secp224r1, - "secp256r1":secp256r1 -} +/***/ }), + +/***/ 761: +/***/ (function(module) { +module.exports = require("zlib"); /***/ }), -/***/ 801: +/***/ 772: /***/ (function(module) { "use strict"; -module.exports = function generate_anyOf(it, $keyword, $ruleType) { +module.exports = function generate__limitLength(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -25049,68 +24631,76 @@ module.exports = function generate_anyOf(it, $keyword, $ruleType) { var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; + var $errorKeyword; var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $noEmptySchema = $schema.every(function($sch) { - return (it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all)); - }); - if ($noEmptySchema) { - var $currentBaseId = $it.baseId; - out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; - $closingBraces += '}'; - } - } - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should match some schema in anyOf\' '; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $op = $keyword == 'maxLength' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + if (it.opts.unicode === false) { + out += ' ' + ($data) + '.length '; + } else { + out += ' ucs2length(' + ($data) + ') '; + } + out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be '; + if ($keyword == 'maxLength') { + out += 'longer'; + } else { + out += 'shorter'; } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); } - out += ' } '; - } else { - out += ' {} '; + out += ' characters\' '; } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError(vErrors); '; + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); } else { - out += ' validate.errors = vErrors; return false; '; + out += '' + ($schema); } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } - out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - if (it.opts.allErrors) { - out += ' } '; - } - out = it.util.cleanUpCode(out); + out += ' } '; } else { - if ($breakOnError) { - out += ' if (true) { '; + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; } return out; } @@ -25118,8627 +24708,8979 @@ module.exports = function generate_anyOf(it, $keyword, $ruleType) { /***/ }), -/***/ 813: -/***/ (function(module) { - -module.exports = {"_args":[["tough-cookie@2.4.3","/Users/Ibrahim/Desktop/action"]],"_from":"tough-cookie@2.4.3","_id":"tough-cookie@2.4.3","_inBundle":false,"_integrity":"sha512-Q5srk/4vDM54WJsJio3XNn6K2sCG+CQ8G5Wz6bZhRZoAe/+TxjWB/GlFAnYEbkYVlON9FMk/fE3h2RLpPXo4lQ==","_location":"/tough-cookie","_phantomChildren":{},"_requested":{"type":"version","registry":true,"raw":"tough-cookie@2.4.3","name":"tough-cookie","escapedName":"tough-cookie","rawSpec":"2.4.3","saveSpec":null,"fetchSpec":"2.4.3"},"_requiredBy":["/request"],"_resolved":"https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.4.3.tgz","_spec":"2.4.3","_where":"/Users/Ibrahim/Desktop/action","author":{"name":"Jeremy Stashewsky","email":"jstash@gmail.com"},"bugs":{"url":"https://github.com/salesforce/tough-cookie/issues"},"contributors":[{"name":"Alexander Savin"},{"name":"Ian Livingstone"},{"name":"Ivan Nikulin"},{"name":"Lalit Kapoor"},{"name":"Sam Thompson"},{"name":"Sebastian Mayr"}],"dependencies":{"psl":"^1.1.24","punycode":"^1.4.1"},"description":"RFC6265 Cookies and Cookie Jar for node.js","devDependencies":{"async":"^1.4.2","nyc":"^11.6.0","string.prototype.repeat":"^0.2.0","vows":"^0.8.1"},"engines":{"node":">=0.8"},"files":["lib"],"homepage":"https://github.com/salesforce/tough-cookie","keywords":["HTTP","cookie","cookies","set-cookie","cookiejar","jar","RFC6265","RFC2965"],"license":"BSD-3-Clause","main":"./lib/cookie","name":"tough-cookie","repository":{"type":"git","url":"git://github.com/salesforce/tough-cookie.git"},"scripts":{"cover":"nyc --reporter=lcov --reporter=html vows test/*_test.js","test":"vows test/*_test.js"},"version":"2.4.3"}; - -/***/ }), - -/***/ 819: +/***/ 776: /***/ (function(module) { -module.exports = isTypedArray -isTypedArray.strict = isStrictTypedArray -isTypedArray.loose = isLooseTypedArray - -var toString = Object.prototype.toString -var names = { - '[object Int8Array]': true - , '[object Int16Array]': true - , '[object Int32Array]': true - , '[object Uint8Array]': true - , '[object Uint8ClampedArray]': true - , '[object Uint16Array]': true - , '[object Uint32Array]': true - , '[object Float32Array]': true - , '[object Float64Array]': true -} - -function isTypedArray(arr) { - return ( - isStrictTypedArray(arr) - || isLooseTypedArray(arr) - ) -} - -function isStrictTypedArray(arr) { - return ( - arr instanceof Int8Array - || arr instanceof Int16Array - || arr instanceof Int32Array - || arr instanceof Uint8Array - || arr instanceof Uint8ClampedArray - || arr instanceof Uint16Array - || arr instanceof Uint32Array - || arr instanceof Float32Array - || arr instanceof Float64Array - ) -} - -function isLooseTypedArray(arr) { - return names[toString.call(arr)] -} - +module.exports = {"$id":"creator.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), -/***/ 823: +/***/ 779: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -/*eslint no-var:0, prefer-arrow-callback: 0, object-shorthand: 0 */ - - - -var Punycode = __webpack_require__(213); - - -var internals = {}; - - -// -// Read rules from file. -// -internals.rules = __webpack_require__(761).map(function (rule) { - - return { - rule: rule, - suffix: rule.replace(/^(\*\.|\!)/, ''), - punySuffix: -1, - wildcard: rule.charAt(0) === '*', - exception: rule.charAt(0) === '!' - }; -}); - +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ -// -// Check is given string ends with `suffix`. -// -internals.endsWith = function (str, suffix) { - return str.indexOf(suffix, str.length - suffix.length) !== -1; -}; +/** + * Module dependencies. + * @private + */ -// -// Find rule for a given domain. -// -internals.findRule = function (domain) { +var db = __webpack_require__(972) +var extname = __webpack_require__(622).extname - var punyDomain = Punycode.toASCII(domain); - return internals.rules.reduce(function (memo, rule) { +/** + * Module variables. + * @private + */ - if (rule.punySuffix === -1){ - rule.punySuffix = Punycode.toASCII(rule.suffix); - } - if (!internals.endsWith(punyDomain, '.' + rule.punySuffix) && punyDomain !== rule.punySuffix) { - return memo; - } - // This has been commented out as it never seems to run. This is because - // sub tlds always appear after their parents and we never find a shorter - // match. - //if (memo) { - // var memoSuffix = Punycode.toASCII(memo.suffix); - // if (memoSuffix.length >= punySuffix.length) { - // return memo; - // } - //} - return rule; - }, null); -}; +var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ +var TEXT_TYPE_REGEXP = /^text\//i +/** + * Module exports. + * @public + */ -// -// Error codes and messages. -// -exports.errorCodes = { - DOMAIN_TOO_SHORT: 'Domain name too short.', - DOMAIN_TOO_LONG: 'Domain name too long. It should be no more than 255 chars.', - LABEL_STARTS_WITH_DASH: 'Domain name label can not start with a dash.', - LABEL_ENDS_WITH_DASH: 'Domain name label can not end with a dash.', - LABEL_TOO_LONG: 'Domain name label should be at most 63 chars long.', - LABEL_TOO_SHORT: 'Domain name label should be at least 1 character long.', - LABEL_INVALID_CHARS: 'Domain name label can only contain alphanumeric characters or dashes.' -}; +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) -// -// Validate domain name and throw if not valid. -// -// From wikipedia: -// -// Hostnames are composed of series of labels concatenated with dots, as are all -// domain names. Each label must be between 1 and 63 characters long, and the -// entire hostname (including the delimiting dots) has a maximum of 255 chars. -// -// Allowed chars: -// -// * `a-z` -// * `0-9` -// * `-` but not as a starting or ending character -// * `.` as a separator for the textual portions of a domain name -// -// * http://en.wikipedia.org/wiki/Domain_name -// * http://en.wikipedia.org/wiki/Hostname -// -internals.validate = function (input) { +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ - // Before we can validate we need to take care of IDNs with unicode chars. - var ascii = Punycode.toASCII(input); +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } - if (ascii.length < 1) { - return 'DOMAIN_TOO_SHORT'; + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset } - if (ascii.length > 255) { - return 'DOMAIN_TOO_LONG'; + + // default text/* to utf-8 + if (match && TEXT_TYPE_REGEXP.test(match[1])) { + return 'UTF-8' } - // Check each part's length and allowed chars. - var labels = ascii.split('.'); - var label; + return false +} - for (var i = 0; i < labels.length; ++i) { - label = labels[i]; - if (!label.length) { - return 'LABEL_TOO_SHORT'; - } - if (label.length > 63) { - return 'LABEL_TOO_LONG'; - } - if (label.charAt(0) === '-') { - return 'LABEL_STARTS_WITH_DASH'; - } - if (label.charAt(label.length - 1) === '-') { - return 'LABEL_ENDS_WITH_DASH'; - } - if (!/^[a-z0-9\-]+$/.test(label)) { - return 'LABEL_INVALID_CHARS'; - } +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false } -}; + var mime = str.indexOf('/') === -1 + ? exports.lookup(str) + : str -// -// Public API -// + if (!mime) { + return false + } + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } -// -// Parse domain. -// -exports.parse = function (input) { + return mime +} - if (typeof input !== 'string') { - throw new TypeError('Domain name must be a string.'); +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false } - // Force domain to lowercase. - var domain = input.slice(0).toLowerCase(); + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) - // Handle FQDN. - // TODO: Simply remove trailing dot? - if (domain.charAt(domain.length - 1) === '.') { - domain = domain.slice(0, domain.length - 1); - } + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] - // Validate and sanitise input. - var error = internals.validate(domain); - if (error) { - return { - input: input, - error: { - message: exports.errorCodes[error], - code: error - } - }; + if (!exts || !exts.length) { + return false } - var parsed = { - input: input, - tld: null, - sld: null, - domain: null, - subdomain: null, - listed: false - }; + return exts[0] +} - var domainParts = domain.split('.'); +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ - // Non-Internet TLD - if (domainParts[domainParts.length - 1] === 'local') { - return parsed; +function lookup (path) { + if (!path || typeof path !== 'string') { + return false } - var handlePunycode = function () { + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .substr(1) - if (!/xn--/.test(domain)) { - return parsed; - } - if (parsed.domain) { - parsed.domain = Punycode.toASCII(parsed.domain); - } - if (parsed.subdomain) { - parsed.subdomain = Punycode.toASCII(parsed.subdomain); - } - return parsed; - }; + if (!extension) { + return false + } - var rule = internals.findRule(domain); + return exports.types[extension] || false +} - // Unlisted tld. - if (!rule) { - if (domainParts.length < 2) { - return parsed; - } - parsed.tld = domainParts.pop(); - parsed.sld = domainParts.pop(); - parsed.domain = [parsed.sld, parsed.tld].join('.'); - if (domainParts.length) { - parsed.subdomain = domainParts.pop(); +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + // source preference (least -> most) + var preference = ['nginx', 'apache', undefined, 'iana'] + + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return } - return handlePunycode(); - } - // At this point we know the public suffix is listed. - parsed.listed = true; + // mime -> extensions + extensions[type] = exts - var tldParts = rule.suffix.split('.'); - var privateParts = domainParts.slice(0, domainParts.length - tldParts.length); + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] - if (rule.exception) { - privateParts.push(tldParts.shift()); - } + if (types[extension]) { + var from = preference.indexOf(db[types[extension]].source) + var to = preference.indexOf(mime.source) - parsed.tld = tldParts.join('.'); + if (types[extension] !== 'application/octet-stream' && + (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { + // skip the remapping + continue + } + } - if (!privateParts.length) { - return handlePunycode(); - } + // set the extension -> mime + types[extension] = type + } + }) +} - if (rule.wildcard) { - tldParts.unshift(privateParts.pop()); - parsed.tld = tldParts.join('.'); - } - if (!privateParts.length) { - return handlePunycode(); - } +/***/ }), - parsed.sld = privateParts.pop(); - parsed.domain = [parsed.sld, parsed.tld].join('.'); +/***/ 789: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (privateParts.length) { - parsed.subdomain = privateParts.join('.'); - } +// Copyright 2015 Joyent, Inc. - return handlePunycode(); -}; +var parser = __webpack_require__(342); +var signer = __webpack_require__(64); +var verify = __webpack_require__(428); +var utils = __webpack_require__(909); -// -// Get domain. -// -exports.get = function (domain) { - if (!domain) { - return null; - } - return exports.parse(domain).domain || null; -}; +///--- API +module.exports = { -// -// Check whether domain belongs to a known public suffix. -// -exports.isValid = function (domain) { + parse: parser.parseRequest, + parseRequest: parser.parseRequest, - var parsed = exports.parse(domain); - return Boolean(parsed.domain && parsed.listed); + sign: signer.signRequest, + signRequest: signer.signRequest, + createSigner: signer.createSigner, + isSigner: signer.isSigner, + + sshKeyToPEM: utils.sshKeyToPEM, + sshKeyFingerprint: utils.fingerprint, + pemToRsaSSHKey: utils.pemToRsaSSHKey, + + verify: verify.verifySignature, + verifySignature: verify.verifySignature, + verifyHMAC: verify.verifyHMAC }; /***/ }), -/***/ 825: +/***/ 792: /***/ (function(module, __unusedexports, __webpack_require__) { -var iterate = __webpack_require__(454) - , initState = __webpack_require__(729) - , terminator = __webpack_require__(272) - ; +module.exports = ForeverAgent +ForeverAgent.SSL = ForeverAgentSSL -// Public API -module.exports = parallel; +var util = __webpack_require__(669) + , Agent = __webpack_require__(605).Agent + , net = __webpack_require__(631) + , tls = __webpack_require__(16) + , AgentSSL = __webpack_require__(211).Agent + +function getConnectionName(host, port) { + var name = '' + if (typeof host === 'string') { + name = host + ':' + port + } else { + // For node.js v012.0 and iojs-v1.5.1, host is an object. And any existing localAddress is part of the connection name. + name = host.host + ':' + host.port + ':' + (host.localAddress ? (host.localAddress + ':') : ':') + } + return name +} -/** - * Runs iterator over provided array elements in parallel - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function parallel(list, iterator, callback) -{ - var state = initState(list); +function ForeverAgent(options) { + var self = this + self.options = options || {} + self.requests = {} + self.sockets = {} + self.freeSockets = {} + self.maxSockets = self.options.maxSockets || Agent.defaultMaxSockets + self.minSockets = self.options.minSockets || ForeverAgent.defaultMinSockets + self.on('free', function(socket, host, port) { + var name = getConnectionName(host, port) - while (state.index < (state['keyedList'] || list).length) - { - iterate(list, iterator, state, function(error, result) - { - if (error) - { - callback(error, result); - return; + if (self.requests[name] && self.requests[name].length) { + self.requests[name].shift().onSocket(socket) + } else if (self.sockets[name].length < self.minSockets) { + if (!self.freeSockets[name]) self.freeSockets[name] = [] + self.freeSockets[name].push(socket) + + // if an error happens while we don't use the socket anyway, meh, throw the socket away + var onIdleError = function() { + socket.destroy() } + socket._onIdleError = onIdleError + socket.on('error', onIdleError) + } else { + // If there are no pending requests just destroy the + // socket and it will get removed from the pool. This + // gets us out of timeout issues and allows us to + // default to Connection:keep-alive. + socket.destroy() + } + }) - // looks like it's the last one - if (Object.keys(state.jobs).length === 0) - { - callback(null, state.results); - return; +} +util.inherits(ForeverAgent, Agent) + +ForeverAgent.defaultMinSockets = 5 + + +ForeverAgent.prototype.createConnection = net.createConnection +ForeverAgent.prototype.addRequestNoreuse = Agent.prototype.addRequest +ForeverAgent.prototype.addRequest = function(req, host, port) { + var name = getConnectionName(host, port) + + if (typeof host !== 'string') { + var options = host + port = options.port + host = options.host + } + + if (this.freeSockets[name] && this.freeSockets[name].length > 0 && !req.useChunkedEncodingByDefault) { + var idleSocket = this.freeSockets[name].pop() + idleSocket.removeListener('error', idleSocket._onIdleError) + delete idleSocket._onIdleError + req._reusedSocket = true + req.onSocket(idleSocket) + } else { + this.addRequestNoreuse(req, host, port) + } +} + +ForeverAgent.prototype.removeSocket = function(s, name, host, port) { + if (this.sockets[name]) { + var index = this.sockets[name].indexOf(s) + if (index !== -1) { + this.sockets[name].splice(index, 1) + } + } else if (this.sockets[name] && this.sockets[name].length === 0) { + // don't leak + delete this.sockets[name] + delete this.requests[name] + } + + if (this.freeSockets[name]) { + var index = this.freeSockets[name].indexOf(s) + if (index !== -1) { + this.freeSockets[name].splice(index, 1) + if (this.freeSockets[name].length === 0) { + delete this.freeSockets[name] } - }); + } + } - state.index++; + if (this.requests[name] && this.requests[name].length) { + // If we have pending requests and a socket gets closed a new one + // needs to be created to take over in the pool for the one that closed. + this.createSocket(name, host, port).emit('free') } +} - return terminator.bind(state, callback); +function ForeverAgentSSL (options) { + ForeverAgent.call(this, options) } +util.inherits(ForeverAgentSSL, ForeverAgent) +ForeverAgentSSL.prototype.createConnection = createConnectionSSL +ForeverAgentSSL.prototype.addRequestNoreuse = AgentSSL.prototype.addRequest -/***/ }), +function createConnectionSSL (port, host, options) { + if (typeof port === 'object') { + options = port; + } else if (typeof host === 'object') { + options = host; + } else if (typeof options === 'object') { + options = options; + } else { + options = {}; + } -/***/ 835: -/***/ (function(module) { + if (typeof port === 'number') { + options.port = port; + } -module.exports = require("url"); + if (typeof host === 'string') { + options.host = host; + } -/***/ }), + return tls.connect(options); +} -/***/ 843: -/***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2017 Joyent, Inc. +/***/ }), -module.exports = { - read: read, - verify: verify, - sign: sign, - signAsync: signAsync, - write: write -}; +/***/ 805: +/***/ (function(module, __unusedexports, __webpack_require__) { -var assert = __webpack_require__(976); -var asn1 = __webpack_require__(856); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var pem = __webpack_require__(207); -var Identity = __webpack_require__(183); -var Signature = __webpack_require__(437); -var Certificate = __webpack_require__(646); -var pkcs8 = __webpack_require__(603); +"use strict"; -/* - * This file is based on RFC5280 (X.509). - */ -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} +var resolve = __webpack_require__(867) + , util = __webpack_require__(855) + , errorClasses = __webpack_require__(844) + , stableStringify = __webpack_require__(741); -function verify(cert, key) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); +var validateGenerator = __webpack_require__(967); - var algParts = sig.algo.split('-'); - if (algParts[0] !== key.type) - return (false); +/** + * Functions below are used inside compiled validations function + */ - var blob = sig.cache; - if (blob === undefined) { - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - blob = der.buffer; - } +var ucs2length = util.ucs2length; +var equal = __webpack_require__(832); - var verifier = key.createVerify(algParts[1]); - verifier.write(blob); - return (verifier.verify(sig.signature)); -} +// this error is thrown by async schemas to return validation errors via exception +var ValidationError = errorClasses.Validation; -function Local(i) { - return (asn1.Ber.Context | asn1.Ber.Constructor | i); -} +module.exports = compile; -function Context(i) { - return (asn1.Ber.Context | i); -} -var SIGN_ALGS = { - 'rsa-md5': '1.2.840.113549.1.1.4', - 'rsa-sha1': '1.2.840.113549.1.1.5', - 'rsa-sha256': '1.2.840.113549.1.1.11', - 'rsa-sha384': '1.2.840.113549.1.1.12', - 'rsa-sha512': '1.2.840.113549.1.1.13', - 'dsa-sha1': '1.2.840.10040.4.3', - 'dsa-sha256': '2.16.840.1.101.3.4.3.2', - 'ecdsa-sha1': '1.2.840.10045.4.1', - 'ecdsa-sha256': '1.2.840.10045.4.3.2', - 'ecdsa-sha384': '1.2.840.10045.4.3.3', - 'ecdsa-sha512': '1.2.840.10045.4.3.4', - 'ed25519-sha512': '1.3.101.112' -}; -Object.keys(SIGN_ALGS).forEach(function (k) { - SIGN_ALGS[SIGN_ALGS[k]] = k; -}); -SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; -SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; +/** + * Compiles schema to validation function + * @this Ajv + * @param {Object} schema schema object + * @param {Object} root object with information about the root schema for this schema + * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution + * @param {String} baseId base ID for IDs in the schema + * @return {Function} validation function + */ +function compile(schema, root, localRefs, baseId) { + /* jshint validthis: true, evil: true */ + /* eslint no-shadow: 0 */ + var self = this + , opts = this._opts + , refVal = [ undefined ] + , refs = {} + , patterns = [] + , patternsHash = {} + , defaults = [] + , defaultsHash = {} + , customRules = []; -var EXTS = { - 'issuerKeyId': '2.5.29.35', - 'altName': '2.5.29.17', - 'basicConstraints': '2.5.29.19', - 'keyUsage': '2.5.29.15', - 'extKeyUsage': '2.5.29.37' -}; + root = root || { schema: schema, refVal: refVal, refs: refs }; -function read(buf, options) { - if (typeof (buf) === 'string') { - buf = Buffer.from(buf, 'binary'); - } - assert.buffer(buf, 'buf'); + var c = checkCompiling.call(this, schema, root, baseId); + var compilation = this._compilations[c.index]; + if (c.compiling) return (compilation.callValidate = callValidate); - var der = new asn1.BerReader(buf); + var formats = this._formats; + var RULES = this.RULES; - der.readSequence(); - if (Math.abs(der.length - der.remain) > 1) { - throw (new Error('DER sequence does not contain whole byte ' + - 'stream')); - } + try { + var v = localCompile(schema, root, localRefs, baseId); + compilation.validate = v; + var cv = compilation.callValidate; + if (cv) { + cv.schema = v.schema; + cv.errors = null; + cv.refs = v.refs; + cv.refVal = v.refVal; + cv.root = v.root; + cv.$async = v.$async; + if (opts.sourceCode) cv.source = v.source; + } + return v; + } finally { + endCompiling.call(this, schema, root, baseId); + } - var tbsStart = der.offset; - der.readSequence(); - var sigOffset = der.offset + der.length; - var tbsEnd = sigOffset; + /* @this {*} - custom context, see passContext option */ + function callValidate() { + /* jshint validthis: true */ + var validate = compilation.validate; + var result = validate.apply(this, arguments); + callValidate.errors = validate.errors; + return result; + } - if (der.peek() === Local(0)) { - der.readSequence(Local(0)); - var version = der.readInt(); - assert.ok(version <= 3, - 'only x.509 versions up to v3 supported'); - } + function localCompile(_schema, _root, localRefs, baseId) { + var isRoot = !_root || (_root && _root.schema == _schema); + if (_root.schema != root.schema) + return compile.call(self, _schema, _root, localRefs, baseId); - var cert = {}; - cert.signatures = {}; - var sig = (cert.signatures.x509 = {}); - sig.extras = {}; + var $async = _schema.$async === true; - cert.serial = readMPInt(der, 'serial'); + var sourceCode = validateGenerator({ + isTop: true, + schema: _schema, + isRoot: isRoot, + baseId: baseId, + root: _root, + schemaPath: '', + errSchemaPath: '#', + errorPath: '""', + MissingRefError: errorClasses.MissingRef, + RULES: RULES, + validate: validateGenerator, + util: util, + resolve: resolve, + resolveRef: resolveRef, + usePattern: usePattern, + useDefault: useDefault, + useCustomRule: useCustomRule, + opts: opts, + formats: formats, + logger: self.logger, + self: self + }); - der.readSequence(); - var after = der.offset + der.length; - var certAlgOid = der.readOID(); - var certAlg = SIGN_ALGS[certAlgOid]; - if (certAlg === undefined) - throw (new Error('unknown signature algorithm ' + certAlgOid)); + sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) + + vars(defaults, defaultCode) + vars(customRules, customRuleCode) + + sourceCode; - der._offset = after; - cert.issuer = Identity.parseAsn1(der); + if (opts.processCode) sourceCode = opts.processCode(sourceCode); + // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); + var validate; + try { + var makeValidate = new Function( + 'self', + 'RULES', + 'formats', + 'root', + 'refVal', + 'defaults', + 'customRules', + 'equal', + 'ucs2length', + 'ValidationError', + sourceCode + ); - der.readSequence(); - cert.validFrom = readDate(der); - cert.validUntil = readDate(der); + validate = makeValidate( + self, + RULES, + formats, + root, + refVal, + defaults, + customRules, + equal, + ucs2length, + ValidationError + ); - cert.subjects = [Identity.parseAsn1(der)]; + refVal[0] = validate; + } catch(e) { + self.logger.error('Error compiling schema, function code:', sourceCode); + throw e; + } - der.readSequence(); - after = der.offset + der.length; - cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); - der._offset = after; + validate.schema = _schema; + validate.errors = null; + validate.refs = refs; + validate.refVal = refVal; + validate.root = isRoot ? validate : _root; + if ($async) validate.$async = true; + if (opts.sourceCode === true) { + validate.source = { + code: sourceCode, + patterns: patterns, + defaults: defaults + }; + } - /* issuerUniqueID */ - if (der.peek() === Local(1)) { - der.readSequence(Local(1)); - sig.extras.issuerUniqueID = - buf.slice(der.offset, der.offset + der.length); - der._offset += der.length; - } + return validate; + } - /* subjectUniqueID */ - if (der.peek() === Local(2)) { - der.readSequence(Local(2)); - sig.extras.subjectUniqueID = - buf.slice(der.offset, der.offset + der.length); - der._offset += der.length; - } + function resolveRef(baseId, ref, isRoot) { + ref = resolve.url(baseId, ref); + var refIndex = refs[ref]; + var _refVal, refCode; + if (refIndex !== undefined) { + _refVal = refVal[refIndex]; + refCode = 'refVal[' + refIndex + ']'; + return resolvedRef(_refVal, refCode); + } + if (!isRoot && root.refs) { + var rootRefId = root.refs[ref]; + if (rootRefId !== undefined) { + _refVal = root.refVal[rootRefId]; + refCode = addLocalRef(ref, _refVal); + return resolvedRef(_refVal, refCode); + } + } - /* extensions */ - if (der.peek() === Local(3)) { - der.readSequence(Local(3)); - var extEnd = der.offset + der.length; - der.readSequence(); + refCode = addLocalRef(ref); + var v = resolve.call(self, localCompile, root, ref); + if (v === undefined) { + var localSchema = localRefs && localRefs[ref]; + if (localSchema) { + v = resolve.inlineRef(localSchema, opts.inlineRefs) + ? localSchema + : compile.call(self, localSchema, root, localRefs, baseId); + } + } - while (der.offset < extEnd) - readExtension(cert, buf, der); + if (v === undefined) { + removeLocalRef(ref); + } else { + replaceLocalRef(ref, v); + return resolvedRef(v, refCode); + } + } - assert.strictEqual(der.offset, extEnd); - } + function addLocalRef(ref, v) { + var refId = refVal.length; + refVal[refId] = v; + refs[ref] = refId; + return 'refVal' + refId; + } - assert.strictEqual(der.offset, sigOffset); + function removeLocalRef(ref) { + delete refs[ref]; + } - der.readSequence(); - after = der.offset + der.length; - var sigAlgOid = der.readOID(); - var sigAlg = SIGN_ALGS[sigAlgOid]; - if (sigAlg === undefined) - throw (new Error('unknown signature algorithm ' + sigAlgOid)); - der._offset = after; + function replaceLocalRef(ref, v) { + var refId = refs[ref]; + refVal[refId] = v; + } - var sigData = der.readString(asn1.Ber.BitString, true); - if (sigData[0] === 0) - sigData = sigData.slice(1); - var algParts = sigAlg.split('-'); + function resolvedRef(refVal, code) { + return typeof refVal == 'object' || typeof refVal == 'boolean' + ? { code: code, schema: refVal, inline: true } + : { code: code, $async: refVal && !!refVal.$async }; + } - sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); - sig.signature.hashAlgorithm = algParts[1]; - sig.algo = sigAlg; - sig.cache = buf.slice(tbsStart, tbsEnd); + function usePattern(regexStr) { + var index = patternsHash[regexStr]; + if (index === undefined) { + index = patternsHash[regexStr] = patterns.length; + patterns[index] = regexStr; + } + return 'pattern' + index; + } - return (new Certificate(cert)); -} + function useDefault(value) { + switch (typeof value) { + case 'boolean': + case 'number': + return '' + value; + case 'string': + return util.toQuotedString(value); + case 'object': + if (value === null) return 'null'; + var valueStr = stableStringify(value); + var index = defaultsHash[valueStr]; + if (index === undefined) { + index = defaultsHash[valueStr] = defaults.length; + defaults[index] = value; + } + return 'default' + index; + } + } -function readDate(der) { - if (der.peek() === asn1.Ber.UTCTime) { - return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); - } else if (der.peek() === asn1.Ber.GeneralizedTime) { - return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); - } else { - throw (new Error('Unsupported date format')); - } -} + function useCustomRule(rule, schema, parentSchema, it) { + if (self._opts.validateSchema !== false) { + var deps = rule.definition.dependencies; + if (deps && !deps.every(function(keyword) { + return Object.prototype.hasOwnProperty.call(parentSchema, keyword); + })) + throw new Error('parent schema must have all required keywords: ' + deps.join(',')); -function writeDate(der, date) { - if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { - der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); - } else { - der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); - } -} + var validateSchema = rule.definition.validateSchema; + if (validateSchema) { + var valid = validateSchema(schema); + if (!valid) { + var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); + if (self._opts.validateSchema == 'log') self.logger.error(message); + else throw new Error(message); + } + } + } -/* RFC5280, section 4.2.1.6 (GeneralName type) */ -var ALTNAME = { - OtherName: Local(0), - RFC822Name: Context(1), - DNSName: Context(2), - X400Address: Local(3), - DirectoryName: Local(4), - EDIPartyName: Local(5), - URI: Context(6), - IPAddress: Context(7), - OID: Context(8) -}; + var compile = rule.definition.compile + , inline = rule.definition.inline + , macro = rule.definition.macro; -/* RFC5280, section 4.2.1.12 (KeyPurposeId) */ -var EXTPURPOSE = { - 'serverAuth': '1.3.6.1.5.5.7.3.1', - 'clientAuth': '1.3.6.1.5.5.7.3.2', - 'codeSigning': '1.3.6.1.5.5.7.3.3', + var validate; + if (compile) { + validate = compile.call(self, schema, parentSchema, it); + } else if (macro) { + validate = macro.call(self, schema, parentSchema, it); + if (opts.validateSchema !== false) self.validateSchema(validate, true); + } else if (inline) { + validate = inline.call(self, it, rule.keyword, schema, parentSchema); + } else { + validate = rule.definition.validate; + if (!validate) return; + } - /* See https://github.com/joyent/oid-docs/blob/master/root.md */ - 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', - 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' -}; -var EXTPURPOSE_REV = {}; -Object.keys(EXTPURPOSE).forEach(function (k) { - EXTPURPOSE_REV[EXTPURPOSE[k]] = k; -}); + if (validate === undefined) + throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); -var KEYUSEBITS = [ - 'signature', 'identity', 'keyEncryption', - 'encryption', 'keyAgreement', 'ca', 'crl' -]; + var index = customRules.length; + customRules[index] = validate; -function readExtension(cert, buf, der) { - der.readSequence(); - var after = der.offset + der.length; - var extId = der.readOID(); - var id; - var sig = cert.signatures.x509; - if (!sig.extras.exts) - sig.extras.exts = []; + return { + code: 'customRule' + index, + validate: validate + }; + } +} - var critical; - if (der.peek() === asn1.Ber.Boolean) - critical = der.readBoolean(); - switch (extId) { - case (EXTS.basicConstraints): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var bcEnd = der.offset + der.length; - var ca = false; - if (der.peek() === asn1.Ber.Boolean) - ca = der.readBoolean(); - if (cert.purposes === undefined) - cert.purposes = []; - if (ca === true) - cert.purposes.push('ca'); - var bc = { oid: extId, critical: critical }; - if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) - bc.pathLen = der.readInt(); - sig.extras.exts.push(bc); - break; - case (EXTS.extKeyUsage): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - if (cert.purposes === undefined) - cert.purposes = []; - var ekEnd = der.offset + der.length; - while (der.offset < ekEnd) { - var oid = der.readOID(); - cert.purposes.push(EXTPURPOSE_REV[oid] || oid); - } - /* - * This is a bit of a hack: in the case where we have a cert - * that's only allowed to do serverAuth or clientAuth (and not - * the other), we want to make sure all our Subjects are of - * the right type. But we already parsed our Subjects and - * decided if they were hosts or users earlier (since it appears - * first in the cert). - * - * So we go through and mutate them into the right kind here if - * it doesn't match. This might not be hugely beneficial, as it - * seems that single-purpose certs are not often seen in the - * wild. - */ - if (cert.purposes.indexOf('serverAuth') !== -1 && - cert.purposes.indexOf('clientAuth') === -1) { - cert.subjects.forEach(function (ide) { - if (ide.type !== 'host') { - ide.type = 'host'; - ide.hostname = ide.uid || - ide.email || - ide.components[0].value; - } - }); - } else if (cert.purposes.indexOf('clientAuth') !== -1 && - cert.purposes.indexOf('serverAuth') === -1) { - cert.subjects.forEach(function (ide) { - if (ide.type !== 'user') { - ide.type = 'user'; - ide.uid = ide.hostname || - ide.email || - ide.components[0].value; - } - }); - } - sig.extras.exts.push({ oid: extId, critical: critical }); - break; - case (EXTS.keyUsage): - der.readSequence(asn1.Ber.OctetString); - var bits = der.readString(asn1.Ber.BitString, true); - var setBits = readBitField(bits, KEYUSEBITS); - setBits.forEach(function (bit) { - if (cert.purposes === undefined) - cert.purposes = []; - if (cert.purposes.indexOf(bit) === -1) - cert.purposes.push(bit); - }); - sig.extras.exts.push({ oid: extId, critical: critical, - bits: bits }); - break; - case (EXTS.altName): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var aeEnd = der.offset + der.length; - while (der.offset < aeEnd) { - switch (der.peek()) { - case ALTNAME.OtherName: - case ALTNAME.EDIPartyName: - der.readSequence(); - der._offset += der.length; - break; - case ALTNAME.OID: - der.readOID(ALTNAME.OID); - break; - case ALTNAME.RFC822Name: - /* RFC822 specifies email addresses */ - var email = der.readString(ALTNAME.RFC822Name); - id = Identity.forEmail(email); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - case ALTNAME.DirectoryName: - der.readSequence(ALTNAME.DirectoryName); - id = Identity.parseAsn1(der); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - case ALTNAME.DNSName: - var host = der.readString( - ALTNAME.DNSName); - id = Identity.forHost(host); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - default: - der.readString(der.peek()); - break; - } - } - sig.extras.exts.push({ oid: extId, critical: critical }); - break; - default: - sig.extras.exts.push({ - oid: extId, - critical: critical, - data: der.readString(asn1.Ber.OctetString, true) - }); - break; - } +/** + * Checks if the schema is currently compiled + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) + */ +function checkCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var index = compIndex.call(this, schema, root, baseId); + if (index >= 0) return { index: index, compiling: true }; + index = this._compilations.length; + this._compilations[index] = { + schema: schema, + root: root, + baseId: baseId + }; + return { index: index, compiling: false }; +} - der._offset = after; + +/** + * Removes the schema from the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + */ +function endCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var i = compIndex.call(this, schema, root, baseId); + if (i >= 0) this._compilations.splice(i, 1); } -var UTCTIME_RE = - /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; -function utcTimeToDate(t) { - var m = t.match(UTCTIME_RE); - assert.ok(m, 'timestamps must be in UTC'); - var d = new Date(); - var thisYear = d.getUTCFullYear(); - var century = Math.floor(thisYear / 100) * 100; +/** + * Index of schema compilation in the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Integer} compilation index + */ +function compIndex(schema, root, baseId) { + /* jshint validthis: true */ + for (var i=0; i= 60) - year += (century - 1); - else - year += century; - d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); - d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); - if (m[6] && m[6].length > 0) - d.setUTCSeconds(parseInt(m[6], 10)); - return (d); + +function patternCode(i, patterns) { + return 'var pattern' + i + ' = new RegExp(' + util.toQuotedString(patterns[i]) + ');'; } -var GTIME_RE = - /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; -function gTimeToDate(t) { - var m = t.match(GTIME_RE); - assert.ok(m); - var d = new Date(); - d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, - parseInt(m[3], 10)); - d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); - if (m[6] && m[6].length > 0) - d.setUTCSeconds(parseInt(m[6], 10)); - return (d); +function defaultCode(i) { + return 'var default' + i + ' = defaults[' + i + '];'; } -function zeroPad(n, m) { - if (m === undefined) - m = 2; - var s = '' + n; - while (s.length < m) - s = '0' + s; - return (s); + +function refValCode(i, refVal) { + return refVal[i] === undefined ? '' : 'var refVal' + i + ' = refVal[' + i + '];'; } -function dateToUTCTime(d) { - var s = ''; - s += zeroPad(d.getUTCFullYear() % 100); - s += zeroPad(d.getUTCMonth() + 1); - s += zeroPad(d.getUTCDate()); - s += zeroPad(d.getUTCHours()); - s += zeroPad(d.getUTCMinutes()); - s += zeroPad(d.getUTCSeconds()); - s += 'Z'; - return (s); + +function customRuleCode(i) { + return 'var customRule' + i + ' = customRules[' + i + '];'; } -function dateToGTime(d) { - var s = ''; - s += zeroPad(d.getUTCFullYear(), 4); - s += zeroPad(d.getUTCMonth() + 1); - s += zeroPad(d.getUTCDate()); - s += zeroPad(d.getUTCHours()); - s += zeroPad(d.getUTCMinutes()); - s += zeroPad(d.getUTCSeconds()); - s += 'Z'; - return (s); + +function vars(arr, statement) { + if (!arr.length) return ''; + var code = ''; + for (var i=0; i 0 || subject.type === 'host' || - (cert.purposes !== undefined && cert.purposes.length > 0) || - (sig.extras && sig.extras.exts)) { - der.startSequence(Local(3)); - der.startSequence(); + var rnds = options.random || (options.rng || rng)(); - var exts = []; - if (cert.purposes !== undefined && cert.purposes.length > 0) { - exts.push({ - oid: EXTS.basicConstraints, - critical: true - }); - exts.push({ - oid: EXTS.keyUsage, - critical: true - }); - exts.push({ - oid: EXTS.extKeyUsage, - critical: true - }); - } - exts.push({ oid: EXTS.altName }); - if (sig.extras && sig.extras.exts) - exts = sig.extras.exts; + // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` + rnds[6] = (rnds[6] & 0x0f) | 0x40; + rnds[8] = (rnds[8] & 0x3f) | 0x80; - for (var i = 0; i < exts.length; ++i) { - der.startSequence(); - der.writeOID(exts[i].oid); + // Copy bytes to buffer, if provided + if (buf) { + for (var ii = 0; ii < 16; ++ii) { + buf[i + ii] = rnds[ii]; + } + } - if (exts[i].critical !== undefined) - der.writeBoolean(exts[i].critical); + return buf || bytesToUuid(rnds); +} - if (exts[i].oid === EXTS.altName) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - if (subject.type === 'host') { - der.writeString(subject.hostname, - Context(2)); - } - for (var j = 0; j < altNames.length; ++j) { - if (altNames[j].type === 'host') { - der.writeString( - altNames[j].hostname, - ALTNAME.DNSName); - } else if (altNames[j].type === - 'email') { - der.writeString( - altNames[j].email, - ALTNAME.RFC822Name); - } else { - /* - * Encode anything else as a - * DN style name for now. - */ - der.startSequence( - ALTNAME.DirectoryName); - altNames[j].toAsn1(der); - der.endSequence(); - } - } - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.basicConstraints) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - var ca = (cert.purposes.indexOf('ca') !== -1); - var pathLen = exts[i].pathLen; - der.writeBoolean(ca); - if (pathLen !== undefined) - der.writeInt(pathLen); - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.extKeyUsage) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - cert.purposes.forEach(function (purpose) { - if (purpose === 'ca') - return; - if (KEYUSEBITS.indexOf(purpose) !== -1) - return; - var oid = purpose; - if (EXTPURPOSE[purpose] !== undefined) - oid = EXTPURPOSE[purpose]; - der.writeOID(oid); - }); - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.keyUsage) { - der.startSequence(asn1.Ber.OctetString); - /* - * If we parsed this certificate from a byte - * stream (i.e. we didn't generate it in sshpk) - * then we'll have a ".bits" property on the - * ext with the original raw byte contents. - * - * If we have this, use it here instead of - * regenerating it. This guarantees we output - * the same data we parsed, so signatures still - * validate. - */ - if (exts[i].bits !== undefined) { - der.writeBuffer(exts[i].bits, - asn1.Ber.BitString); - } else { - var bits = writeBitField(cert.purposes, - KEYUSEBITS); - der.writeBuffer(bits, - asn1.Ber.BitString); - } - der.endSequence(); - } else { - der.writeBuffer(exts[i].data, - asn1.Ber.OctetString); - } +module.exports = v4; + + +/***/ }), + +/***/ 830: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; +// Copyright 2010-2012 Mikeal Rogers +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + + + +var extend = __webpack_require__(374) +var cookies = __webpack_require__(602) +var helpers = __webpack_require__(810) + +var paramsHaveRequestBody = helpers.paramsHaveRequestBody + +// organize params for patch, post, put, head, del +function initParams (uri, options, callback) { + if (typeof options === 'function') { + callback = options + } + + var params = {} + if (typeof options === 'object') { + extend(params, options, {uri: uri}) + } else if (typeof uri === 'string') { + extend(params, {uri: uri}) + } else { + extend(params, uri) + } + + params.callback = callback || params.callback + return params +} + +function request (uri, options, callback) { + if (typeof uri === 'undefined') { + throw new Error('undefined is not a valid uri or options object.') + } + + var params = initParams(uri, options, callback) + + if (params.method === 'HEAD' && paramsHaveRequestBody(params)) { + throw new Error('HTTP HEAD requests MUST NOT include a request body.') + } + + return new request.Request(params) +} + +function verbFunc (verb) { + var method = verb.toUpperCase() + return function (uri, options, callback) { + var params = initParams(uri, options, callback) + params.method = method + return request(params, params.callback) + } +} + +// define like this to please codeintel/intellisense IDEs +request.get = verbFunc('get') +request.head = verbFunc('head') +request.options = verbFunc('options') +request.post = verbFunc('post') +request.put = verbFunc('put') +request.patch = verbFunc('patch') +request.del = verbFunc('delete') +request['delete'] = verbFunc('delete') + +request.jar = function (store) { + return cookies.jar(store) +} + +request.cookie = function (str) { + return cookies.parse(str) +} + +function wrapRequestMethod (method, options, requester, verb) { + return function (uri, opts, callback) { + var params = initParams(uri, opts, callback) + + var target = {} + extend(true, target, options, params) - der.endSequence(); - } + target.pool = params.pool || options.pool - der.endSequence(); - der.endSequence(); - } + if (verb) { + target.method = verb.toUpperCase() + } - der.endSequence(); + if (typeof requester === 'function') { + method = requester + } + + return method(target, target.callback) + } } -/* - * Reads an ASN.1 BER bitfield out of the Buffer produced by doing - * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw - * contents of the BitString tag, which is a count of unused bits followed by - * the bits as a right-padded byte string. - * - * `bits` is the Buffer, `bitIndex` should contain an array of string names - * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. - * - * Returns an array of Strings, the names of the bits that were set to 1. - */ -function readBitField(bits, bitIndex) { - var bitLen = 8 * (bits.length - 1) - bits[0]; - var setBits = {}; - for (var i = 0; i < bitLen; ++i) { - var byteN = 1 + Math.floor(i / 8); - var bit = 7 - (i % 8); - var mask = 1 << bit; - var bitVal = ((bits[byteN] & mask) !== 0); - var name = bitIndex[i]; - if (bitVal && typeof (name) === 'string') { - setBits[name] = true; - } - } - return (Object.keys(setBits)); +request.defaults = function (options, requester) { + var self = this + + options = options || {} + + if (typeof options === 'function') { + requester = options + options = {} + } + + var defaults = wrapRequestMethod(self, options, requester) + + var verbs = ['get', 'head', 'post', 'put', 'patch', 'del', 'delete'] + verbs.forEach(function (verb) { + defaults[verb] = wrapRequestMethod(self[verb], options, requester, verb) + }) + + defaults.cookie = wrapRequestMethod(self.cookie, options, requester) + defaults.jar = self.jar + defaults.defaults = self.defaults + return defaults } -/* - * `setBits` is an array of strings, containing the names for each bit that - * sould be set to 1. `bitIndex` is same as in `readBitField()`. - * - * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. - */ -function writeBitField(setBits, bitIndex) { - var bitLen = bitIndex.length; - var blen = Math.ceil(bitLen / 8); - var unused = blen * 8 - bitLen; - var bits = Buffer.alloc(1 + blen); // zero-filled - bits[0] = unused; - for (var i = 0; i < bitLen; ++i) { - var byteN = 1 + Math.floor(i / 8); - var bit = 7 - (i % 8); - var mask = 1 << bit; - var name = bitIndex[i]; - if (name === undefined) - continue; - var bitVal = (setBits.indexOf(name) !== -1); - if (bitVal) { - bits[byteN] |= mask; - } - } - return (bits); +request.forever = function (agentOptions, optionsArg) { + var options = {} + if (optionsArg) { + extend(options, optionsArg) + } + if (agentOptions) { + options.agentOptions = agentOptions + } + + options.forever = true + return request.defaults(options) } +// Exports + +module.exports = request +request.Request = __webpack_require__(455) +request.initParams = initParams + +// Backwards compatibility for request.debug +Object.defineProperty(request, 'debug', { + enumerable: true, + get: function () { + return request.Request.debug + }, + set: function (debug) { + request.Request.debug = debug + } +}) + /***/ }), -/***/ 847: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 832: +/***/ (function(module) { "use strict"; -var url = __webpack_require__(835) -var tunnel = __webpack_require__(94) +var isArray = Array.isArray; +var keyList = Object.keys; +var hasProp = Object.prototype.hasOwnProperty; -var defaultProxyHeaderWhiteList = [ - 'accept', - 'accept-charset', - 'accept-encoding', - 'accept-language', - 'accept-ranges', - 'cache-control', - 'content-encoding', - 'content-language', - 'content-location', - 'content-md5', - 'content-range', - 'content-type', - 'connection', - 'date', - 'expect', - 'max-forwards', - 'pragma', - 'referer', - 'te', - 'user-agent', - 'via' -] +module.exports = function equal(a, b) { + if (a === b) return true; -var defaultProxyHeaderExclusiveList = [ - 'proxy-authorization' -] + if (a && b && typeof a == 'object' && typeof b == 'object') { + var arrA = isArray(a) + , arrB = isArray(b) + , i + , length + , key; -function constructProxyHost (uriObject) { - var port = uriObject.port - var protocol = uriObject.protocol - var proxyHost = uriObject.hostname + ':' + if (arrA && arrB) { + length = a.length; + if (length != b.length) return false; + for (i = length; i-- !== 0;) + if (!equal(a[i], b[i])) return false; + return true; + } - if (port) { - proxyHost += port - } else if (protocol === 'https:') { - proxyHost += '443' - } else { - proxyHost += '80' - } + if (arrA != arrB) return false; - return proxyHost -} + var dateA = a instanceof Date + , dateB = b instanceof Date; + if (dateA != dateB) return false; + if (dateA && dateB) return a.getTime() == b.getTime(); -function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { - var whiteList = proxyHeaderWhiteList - .reduce(function (set, header) { - set[header.toLowerCase()] = true - return set - }, {}) + var regexpA = a instanceof RegExp + , regexpB = b instanceof RegExp; + if (regexpA != regexpB) return false; + if (regexpA && regexpB) return a.toString() == b.toString(); - return Object.keys(headers) - .filter(function (header) { - return whiteList[header.toLowerCase()] - }) - .reduce(function (set, header) { - set[header] = headers[header] - return set - }, {}) -} + var keys = keyList(a); + length = keys.length; -function constructTunnelOptions (request, proxyHeaders) { - var proxy = request.proxy + if (length !== keyList(b).length) + return false; - var tunnelOptions = { - proxy: { - host: proxy.hostname, - port: +proxy.port, - proxyAuth: proxy.auth, - headers: proxyHeaders - }, - headers: request.headers, - ca: request.ca, - cert: request.cert, - key: request.key, - passphrase: request.passphrase, - pfx: request.pfx, - ciphers: request.ciphers, - rejectUnauthorized: request.rejectUnauthorized, - secureOptions: request.secureOptions, - secureProtocol: request.secureProtocol + for (i = length; i-- !== 0;) + if (!hasProp.call(b, keys[i])) return false; + + for (i = length; i-- !== 0;) { + key = keys[i]; + if (!equal(a[key], b[key])) return false; + } + + return true; } - return tunnelOptions -} + return a!==a && b!==b; +}; -function constructTunnelFnName (uri, proxy) { - var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') - var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') - return [uriProtocol, proxyProtocol].join('Over') + +/***/ }), + +/***/ 835: +/***/ (function(module) { + +module.exports = require("url"); + +/***/ }), + +/***/ 844: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var resolve = __webpack_require__(867); + +module.exports = { + Validation: errorSubclass(ValidationError), + MissingRef: errorSubclass(MissingRefError) +}; + + +function ValidationError(errors) { + this.message = 'validation failed'; + this.errors = errors; + this.ajv = this.validation = true; } -function getTunnelFn (request) { - var uri = request.uri - var proxy = request.proxy - var tunnelFnName = constructTunnelFnName(uri, proxy) - return tunnel[tunnelFnName] + +MissingRefError.message = function (baseId, ref) { + return 'can\'t resolve reference ' + ref + ' from id ' + baseId; +}; + + +function MissingRefError(baseId, ref, message) { + this.message = message || MissingRefError.message(baseId, ref); + this.missingRef = resolve.url(baseId, ref); + this.missingSchema = resolve.normalizeId(resolve.fullPath(this.missingRef)); } -function Tunnel (request) { - this.request = request - this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList - this.proxyHeaderExclusiveList = [] - if (typeof request.tunnel !== 'undefined') { - this.tunnelOverride = request.tunnel - } + +function errorSubclass(Subclass) { + Subclass.prototype = Object.create(Error.prototype); + Subclass.prototype.constructor = Subclass; + return Subclass; } -Tunnel.prototype.isEnabled = function () { - var self = this - var request = self.request - // Tunnel HTTPS by default. Allow the user to override this setting. - // If self.tunnelOverride is set (the user specified a value), use it. - if (typeof self.tunnelOverride !== 'undefined') { - return self.tunnelOverride - } +/***/ }), - // If the destination is HTTPS, tunnel. - if (request.uri.protocol === 'https:') { - return true - } +/***/ 846: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - // Otherwise, do not use tunnel. - return false -} +var Ajv = __webpack_require__(514) +var HARError = __webpack_require__(814) +var schemas = __webpack_require__(671) -Tunnel.prototype.setup = function (options) { - var self = this - var request = self.request +var ajv - options = options || {} +function createAjvInstance () { + var ajv = new Ajv({ + allErrors: true + }) + ajv.addMetaSchema(__webpack_require__(337)) + ajv.addSchema(schemas) - if (typeof request.proxy === 'string') { - request.proxy = url.parse(request.proxy) - } + return ajv +} - if (!request.proxy || !request.tunnel) { - return false - } +function validate (name, data) { + data = data || {} - // Setup Proxy Header Exclusive List and White List - if (options.proxyHeaderWhiteList) { - self.proxyHeaderWhiteList = options.proxyHeaderWhiteList - } - if (options.proxyHeaderExclusiveList) { - self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList - } + // validator config + ajv = ajv || createAjvInstance() - var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) - var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) + var validate = ajv.getSchema(name + '.json') - // Setup Proxy Headers and Proxy Headers Host - // Only send the Proxy White Listed Header names - var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) - proxyHeaders.host = constructProxyHost(request.uri) + return new Promise(function (resolve, reject) { + var valid = validate(data) - proxyHeaderExclusiveList.forEach(request.removeHeader, request) + !valid ? reject(new HARError(validate.errors)) : resolve(data) + }) +} - // Set Agent from Tunnel Data - var tunnelFn = getTunnelFn(request) - var tunnelOptions = constructTunnelOptions(request, proxyHeaders) - request.agent = tunnelFn(tunnelOptions) +exports.afterRequest = function (data) { + return validate('afterRequest', data) +} - return true +exports.beforeRequest = function (data) { + return validate('beforeRequest', data) } -Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList -Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList -exports.Tunnel = Tunnel +exports.browser = function (data) { + return validate('browser', data) +} +exports.cache = function (data) { + return validate('cache', data) +} -/***/ }), +exports.content = function (data) { + return validate('content', data) +} -/***/ 850: -/***/ (function(module) { +exports.cookie = function (data) { + return validate('cookie', data) +} -// Copyright 2011 Mark Cavage All rights reserved. +exports.creator = function (data) { + return validate('creator', data) +} +exports.entry = function (data) { + return validate('entry', data) +} -module.exports = { - EOC: 0, - Boolean: 1, - Integer: 2, - BitString: 3, - OctetString: 4, - Null: 5, - OID: 6, - ObjectDescriptor: 7, - External: 8, - Real: 9, // float - Enumeration: 10, - PDV: 11, - Utf8String: 12, - RelativeOID: 13, - Sequence: 16, - Set: 17, - NumericString: 18, - PrintableString: 19, - T61String: 20, - VideotexString: 21, - IA5String: 22, - UTCTime: 23, - GeneralizedTime: 24, - GraphicString: 25, - VisibleString: 26, - GeneralString: 28, - UniversalString: 29, - CharacterString: 30, - BMPString: 31, - Constructor: 32, - Context: 128 -}; +exports.har = function (data) { + return validate('har', data) +} +exports.header = function (data) { + return validate('header', data) +} -/***/ }), +exports.log = function (data) { + return validate('log', data) +} -/***/ 853: -/***/ (function(module) { +exports.page = function (data) { + return validate('page', data) +} -"use strict"; +exports.pageTimings = function (data) { + return validate('pageTimings', data) +} +exports.postData = function (data) { + return validate('postData', data) +} -var KEYWORDS = [ - 'multipleOf', - 'maximum', - 'exclusiveMaximum', - 'minimum', - 'exclusiveMinimum', - 'maxLength', - 'minLength', - 'pattern', - 'additionalItems', - 'maxItems', - 'minItems', - 'uniqueItems', - 'maxProperties', - 'minProperties', - 'required', - 'additionalProperties', - 'enum', - 'format', - 'const' -]; +exports.query = function (data) { + return validate('query', data) +} -module.exports = function (metaSchema, keywordsJsonPointers) { - for (var i=0; i All rights reserved. +// Copyright 2018 Joyent, Inc. -// If you have no idea what ASN.1 or BER is, see this: -// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc +module.exports = Key; + +var assert = __webpack_require__(477); +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var DiffieHellman = __webpack_require__(290).DiffieHellman; +var errs = __webpack_require__(753); +var utils = __webpack_require__(270); +var PrivateKey = __webpack_require__(502); +var edCompat; + +try { + edCompat = __webpack_require__(363); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; -var Ber = __webpack_require__(592); +var formats = {}; +formats['auto'] = __webpack_require__(241); +formats['pem'] = __webpack_require__(268); +formats['pkcs1'] = __webpack_require__(449); +formats['pkcs8'] = __webpack_require__(707); +formats['rfc4253'] = __webpack_require__(538); +formats['ssh'] = __webpack_require__(603); +formats['ssh-private'] = __webpack_require__(78); +formats['openssh'] = formats['ssh-private']; +formats['dnssec'] = __webpack_require__(982); +formats['putty'] = __webpack_require__(624); +formats['ppk'] = formats['putty']; +function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); + var algInfo = algs.info[opts.type]; + if (typeof (algInfo) !== 'object') + throw (new InvalidAlgorithmError(opts.type)); -// --- Exported API + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } -module.exports = { + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; - Ber: Ber, + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; - BerReader: Ber.Reader, + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519' || this.type === 'curve25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; +} - BerWriter: Ber.Writer +Key.formats = formats; -}; +Key.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return (this._rfc4253Cache); + } -/***/ }), + return (formats[format].write(this, options)); +}; -/***/ 858: -/***/ (function(module, __unusedexports, __webpack_require__) { +Key.prototype.toString = function (format, options) { + return (this.toBuffer(format, options).toString()); +}; -// Copyright 2016 Joyent, Inc. +Key.prototype.hash = function (algo, type) { + assert.string(algo, 'algorithm'); + assert.optionalString(type, 'type'); + if (type === undefined) + type = 'ssh'; + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); -var x509 = __webpack_require__(843); + var cacheKey = algo + '||' + type; + if (this._hashCache[cacheKey]) + return (this._hashCache[cacheKey]); -module.exports = { - read: read, - verify: x509.verify, - sign: x509.sign, - write: write + var buf; + if (type === 'ssh') { + buf = this.toBuffer('rfc4253'); + } else if (type === 'spki') { + buf = formats.pkcs8.pkcs8ToBuffer(this); + } else { + throw (new Error('Hash type ' + type + ' not supported')); + } + var hash = crypto.createHash(algo).update(buf).digest(); + this._hashCache[cacheKey] = hash; + return (hash); }; -var assert = __webpack_require__(976); -var asn1 = __webpack_require__(856); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var pem = __webpack_require__(207); -var Identity = __webpack_require__(183); -var Signature = __webpack_require__(437); -var Certificate = __webpack_require__(646); +Key.prototype.fingerprint = function (algo, type) { + if (algo === undefined) + algo = 'sha256'; + if (type === undefined) + type = 'ssh'; + assert.string(algo, 'algorithm'); + assert.string(type, 'type'); + var opts = { + type: 'key', + hash: this.hash(algo, type), + algorithm: algo, + hashType: type + }; + return (new Fingerprint(opts)); +}; -function read(buf, options) { - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); +Key.prototype.defaultHashAlgorithm = function () { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') + hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; } + return (hashAlgo); +}; - var lines = buf.trim().split(/[\r\n]+/g); +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); - var m; - var si = -1; - while (!m && si < lines.length) { - m = lines[++si].match(/*JSSTYLED*/ - /[-]+[ ]*BEGIN CERTIFICATE[ ]*[-]+/); - } - assert.ok(m, 'invalid PEM header'); + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); - var m2; - var ei = lines.length; - while (!m2 && ei > 0) { - m2 = lines[--ei].match(/*JSSTYLED*/ - /[-]+[ ]*END CERTIFICATE[ ]*[-]+/); + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; } - assert.ok(m2, 'invalid PEM footer'); - - lines = lines.slice(si, ei + 1); - - var headers = {}; - while (true) { - lines = lines.slice(1); - m = lines[0].match(/*JSSTYLED*/ - /^([A-Za-z0-9-]+): (.+)$/); - if (!m) - break; - headers[m[1].toLowerCase()] = m[2]; + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + if (signature.curve && self.type === 'ecdsa' && + signature.curve !== curve) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); - /* Chop off the first and last lines */ - lines = lines.slice(0, -1).join(''); - buf = Buffer.from(lines, 'base64'); + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); - return (x509.read(buf, options)); -} + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); -function write(cert, options) { - var dbuf = x509.write(cert, options); + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; - var header = 'CERTIFICATE'; - var tmp = dbuf.toString('base64'); - var len = tmp.length + (tmp.length / 64) + - 18 + 16 + header.length*2 + 10; - var buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 64; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); - return (buf.slice(0, o)); -} + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; -/***/ }), + assert.object(formats[format], 'formats[format]'); -/***/ 864: -/***/ (function(module) { + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; -module.exports = {"$schema":"http://json-schema.org/draft-07/schema#","$id":"http://json-schema.org/draft-07/schema#","title":"Core schema meta-schema","definitions":{"schemaArray":{"type":"array","minItems":1,"items":{"$ref":"#"}},"nonNegativeInteger":{"type":"integer","minimum":0},"nonNegativeIntegerDefault0":{"allOf":[{"$ref":"#/definitions/nonNegativeInteger"},{"default":0}]},"simpleTypes":{"enum":["array","boolean","integer","null","number","object","string"]},"stringArray":{"type":"array","items":{"type":"string"},"uniqueItems":true,"default":[]}},"type":["object","boolean"],"properties":{"$id":{"type":"string","format":"uri-reference"},"$schema":{"type":"string","format":"uri"},"$ref":{"type":"string","format":"uri-reference"},"$comment":{"type":"string"},"title":{"type":"string"},"description":{"type":"string"},"default":true,"readOnly":{"type":"boolean","default":false},"examples":{"type":"array","items":true},"multipleOf":{"type":"number","exclusiveMinimum":0},"maximum":{"type":"number"},"exclusiveMaximum":{"type":"number"},"minimum":{"type":"number"},"exclusiveMinimum":{"type":"number"},"maxLength":{"$ref":"#/definitions/nonNegativeInteger"},"minLength":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"pattern":{"type":"string","format":"regex"},"additionalItems":{"$ref":"#"},"items":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/schemaArray"}],"default":true},"maxItems":{"$ref":"#/definitions/nonNegativeInteger"},"minItems":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"uniqueItems":{"type":"boolean","default":false},"contains":{"$ref":"#"},"maxProperties":{"$ref":"#/definitions/nonNegativeInteger"},"minProperties":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"required":{"$ref":"#/definitions/stringArray"},"additionalProperties":{"$ref":"#"},"definitions":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"properties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"patternProperties":{"type":"object","additionalProperties":{"$ref":"#"},"propertyNames":{"format":"regex"},"default":{}},"dependencies":{"type":"object","additionalProperties":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/stringArray"}]}},"propertyNames":{"$ref":"#"},"const":true,"enum":{"type":"array","items":true,"minItems":1,"uniqueItems":true},"type":{"anyOf":[{"$ref":"#/definitions/simpleTypes"},{"type":"array","items":{"$ref":"#/definitions/simpleTypes"},"minItems":1,"uniqueItems":true}]},"format":{"type":"string"},"contentMediaType":{"type":"string"},"contentEncoding":{"type":"string"},"if":{"$ref":"#"},"then":{"$ref":"#"},"else":{"$ref":"#"},"allOf":{"$ref":"#/definitions/schemaArray"},"anyOf":{"$ref":"#/definitions/schemaArray"},"oneOf":{"$ref":"#/definitions/schemaArray"},"not":{"$ref":"#"}},"default":true}; +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; -/***/ }), +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + * [1,6] -- changed ed25519 part names + * [1,7] -- spki hash types + */ +Key.prototype._sshpkApiVersion = [1, 7]; -/***/ 867: -/***/ (function(module, __unusedexports, __webpack_require__) { +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; -// Copyright 2015 Joyent, Inc. -module.exports = { - read: read, - readPkcs1: readPkcs1, - write: write, - writePkcs1: writePkcs1 -}; +/***/ }), -var assert = __webpack_require__(976); -var asn1 = __webpack_require__(856); -var Buffer = __webpack_require__(601).Buffer; -var algs = __webpack_require__(778); -var utils = __webpack_require__(57); +/***/ 853: +/***/ (function(__unusedmodule, exports) { -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var pem = __webpack_require__(207); +/** @license URI.js v4.2.1 (c) 2011 Gary Court. License: http://github.com/garycourt/uri-js */ +(function (global, factory) { + true ? factory(exports) : + undefined; +}(this, (function (exports) { 'use strict'; -var pkcs8 = __webpack_require__(603); -var readECDSACurve = pkcs8.readECDSACurve; +function merge() { + for (var _len = arguments.length, sets = Array(_len), _key = 0; _key < _len; _key++) { + sets[_key] = arguments[_key]; + } -function read(buf, options) { - return (pem.read(buf, options, 'pkcs1')); + if (sets.length > 1) { + sets[0] = sets[0].slice(0, -1); + var xl = sets.length - 1; + for (var x = 1; x < xl; ++x) { + sets[x] = sets[x].slice(1, -1); + } + sets[xl] = sets[xl].slice(1); + return sets.join(''); + } else { + return sets[0]; + } } - -function write(key, options) { - return (pem.write(key, options, 'pkcs1')); +function subexp(str) { + return "(?:" + str + ")"; } - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); +function typeOf(o) { + return o === undefined ? "undefined" : o === null ? "null" : Object.prototype.toString.call(o).split(" ").pop().split("]").shift().toLowerCase(); +} +function toUpperCase(str) { + return str.toUpperCase(); +} +function toArray(obj) { + return obj !== undefined && obj !== null ? obj instanceof Array ? obj : typeof obj.length !== "number" || obj.split || obj.setInterval || obj.call ? [obj] : Array.prototype.slice.call(obj) : []; +} +function assign(target, source) { + var obj = target; + if (source) { + for (var key in source) { + obj[key] = source[key]; + } + } + return obj; } -function readPkcs1(alg, type, der) { - switch (alg) { - case 'RSA': - if (type === 'public') - return (readPkcs1RSAPublic(der)); - else if (type === 'private') - return (readPkcs1RSAPrivate(der)); - throw (new Error('Unknown key type: ' + type)); - case 'DSA': - if (type === 'public') - return (readPkcs1DSAPublic(der)); - else if (type === 'private') - return (readPkcs1DSAPrivate(der)); - throw (new Error('Unknown key type: ' + type)); - case 'EC': - case 'ECDSA': - if (type === 'private') - return (readPkcs1ECDSAPrivate(der)); - else if (type === 'public') - return (readPkcs1ECDSAPublic(der)); - throw (new Error('Unknown key type: ' + type)); - case 'EDDSA': - case 'EdDSA': - if (type === 'private') - return (readPkcs1EdDSAPrivate(der)); - throw (new Error(type + ' keys not supported with EdDSA')); - default: - throw (new Error('Unknown key algo: ' + alg)); - } +function buildExps(isIRI) { + var ALPHA$$ = "[A-Za-z]", + CR$ = "[\\x0D]", + DIGIT$$ = "[0-9]", + DQUOTE$$ = "[\\x22]", + HEXDIG$$ = merge(DIGIT$$, "[A-Fa-f]"), + //case-insensitive + LF$$ = "[\\x0A]", + SP$$ = "[\\x20]", + PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)), + //expanded + GEN_DELIMS$$ = "[\\:\\/\\?\\#\\[\\]\\@]", + SUB_DELIMS$$ = "[\\!\\$\\&\\'\\(\\)\\*\\+\\,\\;\\=]", + RESERVED$$ = merge(GEN_DELIMS$$, SUB_DELIMS$$), + UCSCHAR$$ = isIRI ? "[\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF]" : "[]", + //subset, excludes bidi control characters + IPRIVATE$$ = isIRI ? "[\\uE000-\\uF8FF]" : "[]", + //subset + UNRESERVED$$ = merge(ALPHA$$, DIGIT$$, "[\\-\\.\\_\\~]", UCSCHAR$$), + SCHEME$ = subexp(ALPHA$$ + merge(ALPHA$$, DIGIT$$, "[\\+\\-\\.]") + "*"), + USERINFO$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]")) + "*"), + DEC_OCTET$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("[1-9]" + DIGIT$$) + "|" + DIGIT$$), + DEC_OCTET_RELAXED$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("0?[1-9]" + DIGIT$$) + "|0?0?" + DIGIT$$), + //relaxed parsing rules + IPV4ADDRESS$ = subexp(DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$), + H16$ = subexp(HEXDIG$$ + "{1,4}"), + LS32$ = subexp(subexp(H16$ + "\\:" + H16$) + "|" + IPV4ADDRESS$), + IPV6ADDRESS1$ = subexp(subexp(H16$ + "\\:") + "{6}" + LS32$), + // 6( h16 ":" ) ls32 + IPV6ADDRESS2$ = subexp("\\:\\:" + subexp(H16$ + "\\:") + "{5}" + LS32$), + // "::" 5( h16 ":" ) ls32 + IPV6ADDRESS3$ = subexp(subexp(H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{4}" + LS32$), + //[ h16 ] "::" 4( h16 ":" ) ls32 + IPV6ADDRESS4$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,1}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{3}" + LS32$), + //[ *1( h16 ":" ) h16 ] "::" 3( h16 ":" ) ls32 + IPV6ADDRESS5$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,2}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{2}" + LS32$), + //[ *2( h16 ":" ) h16 ] "::" 2( h16 ":" ) ls32 + IPV6ADDRESS6$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,3}" + H16$) + "?\\:\\:" + H16$ + "\\:" + LS32$), + //[ *3( h16 ":" ) h16 ] "::" h16 ":" ls32 + IPV6ADDRESS7$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,4}" + H16$) + "?\\:\\:" + LS32$), + //[ *4( h16 ":" ) h16 ] "::" ls32 + IPV6ADDRESS8$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,5}" + H16$) + "?\\:\\:" + H16$), + //[ *5( h16 ":" ) h16 ] "::" h16 + IPV6ADDRESS9$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,6}" + H16$) + "?\\:\\:"), + //[ *6( h16 ":" ) h16 ] "::" + IPV6ADDRESS$ = subexp([IPV6ADDRESS1$, IPV6ADDRESS2$, IPV6ADDRESS3$, IPV6ADDRESS4$, IPV6ADDRESS5$, IPV6ADDRESS6$, IPV6ADDRESS7$, IPV6ADDRESS8$, IPV6ADDRESS9$].join("|")), + ZONEID$ = subexp(subexp(UNRESERVED$$ + "|" + PCT_ENCODED$) + "+"), + //RFC 6874 + IPV6ADDRZ$ = subexp(IPV6ADDRESS$ + "\\%25" + ZONEID$), + //RFC 6874 + IPV6ADDRZ_RELAXED$ = subexp(IPV6ADDRESS$ + subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + ZONEID$), + //RFC 6874, with relaxed parsing rules + IPVFUTURE$ = subexp("[vV]" + HEXDIG$$ + "+\\." + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]") + "+"), + IP_LITERAL$ = subexp("\\[" + subexp(IPV6ADDRZ_RELAXED$ + "|" + IPV6ADDRESS$ + "|" + IPVFUTURE$) + "\\]"), + //RFC 6874 + REG_NAME$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$)) + "*"), + HOST$ = subexp(IP_LITERAL$ + "|" + IPV4ADDRESS$ + "(?!" + REG_NAME$ + ")" + "|" + REG_NAME$), + PORT$ = subexp(DIGIT$$ + "*"), + AUTHORITY$ = subexp(subexp(USERINFO$ + "@") + "?" + HOST$ + subexp("\\:" + PORT$) + "?"), + PCHAR$ = subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@]")), + SEGMENT$ = subexp(PCHAR$ + "*"), + SEGMENT_NZ$ = subexp(PCHAR$ + "+"), + SEGMENT_NZ_NC$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\@]")) + "+"), + PATH_ABEMPTY$ = subexp(subexp("\\/" + SEGMENT$) + "*"), + PATH_ABSOLUTE$ = subexp("\\/" + subexp(SEGMENT_NZ$ + PATH_ABEMPTY$) + "?"), + //simplified + PATH_NOSCHEME$ = subexp(SEGMENT_NZ_NC$ + PATH_ABEMPTY$), + //simplified + PATH_ROOTLESS$ = subexp(SEGMENT_NZ$ + PATH_ABEMPTY$), + //simplified + PATH_EMPTY$ = "(?!" + PCHAR$ + ")", + PATH$ = subexp(PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), + QUERY$ = subexp(subexp(PCHAR$ + "|" + merge("[\\/\\?]", IPRIVATE$$)) + "*"), + FRAGMENT$ = subexp(subexp(PCHAR$ + "|[\\/\\?]") + "*"), + HIER_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), + URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), + RELATIVE_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$), + RELATIVE$ = subexp(RELATIVE_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), + URI_REFERENCE$ = subexp(URI$ + "|" + RELATIVE$), + ABSOLUTE_URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?"), + GENERIC_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", + RELATIVE_REF$ = "^(){0}" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", + ABSOLUTE_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?$", + SAMEDOC_REF$ = "^" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", + AUTHORITY_REF$ = "^" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?$"; + return { + NOT_SCHEME: new RegExp(merge("[^]", ALPHA$$, DIGIT$$, "[\\+\\-\\.]"), "g"), + NOT_USERINFO: new RegExp(merge("[^\\%\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_HOST: new RegExp(merge("[^\\%\\[\\]\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_PATH: new RegExp(merge("[^\\%\\/\\:\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_PATH_NOSCHEME: new RegExp(merge("[^\\%\\/\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), + NOT_QUERY: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]", IPRIVATE$$), "g"), + NOT_FRAGMENT: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]"), "g"), + ESCAPE: new RegExp(merge("[^]", UNRESERVED$$, SUB_DELIMS$$), "g"), + UNRESERVED: new RegExp(UNRESERVED$$, "g"), + OTHER_CHARS: new RegExp(merge("[^\\%]", UNRESERVED$$, RESERVED$$), "g"), + PCT_ENCODED: new RegExp(PCT_ENCODED$, "g"), + IPV4ADDRESS: new RegExp("^(" + IPV4ADDRESS$ + ")$"), + IPV6ADDRESS: new RegExp("^\\[?(" + IPV6ADDRESS$ + ")" + subexp(subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + "(" + ZONEID$ + ")") + "?\\]?$") //RFC 6874, with relaxed parsing rules + }; } +var URI_PROTOCOL = buildExps(false); + +var IRI_PROTOCOL = buildExps(true); + +var slicedToArray = function () { + function sliceIterator(arr, i) { + var _arr = []; + var _n = true; + var _d = false; + var _e = undefined; + + try { + for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); + + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"]) _i["return"](); + } finally { + if (_d) throw _e; + } + } -function readPkcs1RSAPublic(der) { - // modulus and exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'exponent'); + return _arr; + } - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'e', data: e }, - { name: 'n', data: n } - ] - }; + return function (arr, i) { + if (Array.isArray(arr)) { + return arr; + } else if (Symbol.iterator in Object(arr)) { + return sliceIterator(arr, i); + } else { + throw new TypeError("Invalid attempt to destructure non-iterable instance"); + } + }; +}(); - return (new Key(key)); -} -function readPkcs1RSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version[0], 0); - // modulus then public exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'public exponent'); - var d = readMPInt(der, 'private exponent'); - var p = readMPInt(der, 'prime1'); - var q = readMPInt(der, 'prime2'); - var dmodp = readMPInt(der, 'exponent1'); - var dmodq = readMPInt(der, 'exponent2'); - var iqmp = readMPInt(der, 'iqmp'); - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'n', data: n }, - { name: 'e', data: e }, - { name: 'd', data: d }, - { name: 'iqmp', data: iqmp }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'dmodp', data: dmodp }, - { name: 'dmodq', data: dmodq } - ] - }; - return (new PrivateKey(key)); -} -function readPkcs1DSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 0); - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - var y = readMPInt(der, 'y'); - var x = readMPInt(der, 'x'); - // now, make the key - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y }, - { name: 'x', data: x } - ] - }; - return (new PrivateKey(key)); -} -function readPkcs1EdDSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 1); - // private key - var k = der.readString(asn1.Ber.OctetString, true); - der.readSequence(0xa0); - var oid = der.readOID(); - assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); - der.readSequence(0xa1); - var A = utils.readBitString(der); +var toConsumableArray = function (arr) { + if (Array.isArray(arr)) { + for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i]; - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: k } - ] - }; + return arr2; + } else { + return Array.from(arr); + } +}; - return (new PrivateKey(key)); -} +/** Highest positive signed 32-bit float value */ -function readPkcs1DSAPublic(der) { - var y = readMPInt(der, 'y'); - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); +var maxInt = 2147483647; // aka. 0x7FFFFFFF or 2^31-1 - var key = { - type: 'dsa', - parts: [ - { name: 'y', data: y }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g } - ] - }; +/** Bootstring parameters */ +var base = 36; +var tMin = 1; +var tMax = 26; +var skew = 38; +var damp = 700; +var initialBias = 72; +var initialN = 128; // 0x80 +var delimiter = '-'; // '\x2D' - return (new Key(key)); -} +/** Regular expressions */ +var regexPunycode = /^xn--/; +var regexNonASCII = /[^\0-\x7E]/; // non-ASCII chars +var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g; // RFC 3490 separators -function readPkcs1ECDSAPublic(der) { - der.readSequence(); +/** Error messages */ +var errors = { + 'overflow': 'Overflow: input needs wider integers to process', + 'not-basic': 'Illegal input >= 0x80 (not a basic code point)', + 'invalid-input': 'Invalid input' +}; - var oid = der.readOID(); - assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); +/** Convenience shortcuts */ +var baseMinusTMin = base - tMin; +var floor = Math.floor; +var stringFromCharCode = String.fromCharCode; - var curveOid = der.readOID(); +/*--------------------------------------------------------------------------*/ - var curve; - var curves = Object.keys(algs.curves); - for (var j = 0; j < curves.length; ++j) { - var c = curves[j]; - var cd = algs.curves[c]; - if (cd.pkcs8oid === curveOid) { - curve = c; - break; - } - } - assert.string(curve, 'a known ECDSA named curve'); +/** + * A generic error utility function. + * @private + * @param {String} type The error type. + * @returns {Error} Throws a `RangeError` with the applicable error message. + */ +function error$1(type) { + throw new RangeError(errors[type]); +} - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); +/** + * A generic `Array#map` utility function. + * @private + * @param {Array} array The array to iterate over. + * @param {Function} callback The function that gets called for every array + * item. + * @returns {Array} A new array of values returned by the callback function. + */ +function map(array, fn) { + var result = []; + var length = array.length; + while (length--) { + result[length] = fn(array[length]); + } + return result; +} - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curve) }, - { name: 'Q', data: Q } - ] - }; +/** + * A simple `Array#map`-like wrapper to work with domain name strings or email + * addresses. + * @private + * @param {String} domain The domain name or email address. + * @param {Function} callback The function that gets called for every + * character. + * @returns {Array} A new string of characters returned by the callback + * function. + */ +function mapDomain(string, fn) { + var parts = string.split('@'); + var result = ''; + if (parts.length > 1) { + // In email addresses, only the domain name should be punycoded. Leave + // the local part (i.e. everything up to `@`) intact. + result = parts[0] + '@'; + string = parts[1]; + } + // Avoid `split(regex)` for IE8 compatibility. See #17. + string = string.replace(regexSeparators, '\x2E'); + var labels = string.split('.'); + var encoded = map(labels, fn).join('.'); + return result + encoded; +} - return (new Key(key)); +/** + * Creates an array containing the numeric code points of each Unicode + * character in the string. While JavaScript uses UCS-2 internally, + * this function will convert a pair of surrogate halves (each of which + * UCS-2 exposes as separate characters) into a single code point, + * matching UTF-16. + * @see `punycode.ucs2.encode` + * @see + * @memberOf punycode.ucs2 + * @name decode + * @param {String} string The Unicode input string (UCS-2). + * @returns {Array} The new array of code points. + */ +function ucs2decode(string) { + var output = []; + var counter = 0; + var length = string.length; + while (counter < length) { + var value = string.charCodeAt(counter++); + if (value >= 0xD800 && value <= 0xDBFF && counter < length) { + // It's a high surrogate, and there is a next character. + var extra = string.charCodeAt(counter++); + if ((extra & 0xFC00) == 0xDC00) { + // Low surrogate. + output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); + } else { + // It's an unmatched surrogate; only append this code unit, in case the + // next code unit is the high surrogate of a surrogate pair. + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; } -function readPkcs1ECDSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 1); +/** + * Creates a string based on an array of numeric code points. + * @see `punycode.ucs2.decode` + * @memberOf punycode.ucs2 + * @name encode + * @param {Array} codePoints The array of numeric code points. + * @returns {String} The new Unicode string (UCS-2). + */ +var ucs2encode = function ucs2encode(array) { + return String.fromCodePoint.apply(String, toConsumableArray(array)); +}; - // private key - var d = der.readString(asn1.Ber.OctetString, true); +/** + * Converts a basic code point into a digit/integer. + * @see `digitToBasic()` + * @private + * @param {Number} codePoint The basic numeric code point value. + * @returns {Number} The numeric value of a basic code point (for use in + * representing integers) in the range `0` to `base - 1`, or `base` if + * the code point does not represent a value. + */ +var basicToDigit = function basicToDigit(codePoint) { + if (codePoint - 0x30 < 0x0A) { + return codePoint - 0x16; + } + if (codePoint - 0x41 < 0x1A) { + return codePoint - 0x41; + } + if (codePoint - 0x61 < 0x1A) { + return codePoint - 0x61; + } + return base; +}; - der.readSequence(0xa0); - var curve = readECDSACurve(der); - assert.string(curve, 'a known elliptic curve'); +/** + * Converts a digit/integer into a basic code point. + * @see `basicToDigit()` + * @private + * @param {Number} digit The numeric value of a basic code point. + * @returns {Number} The basic code point whose value (when used for + * representing integers) is `digit`, which needs to be in the range + * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is + * used; else, the lowercase form is used. The behavior is undefined + * if `flag` is non-zero and `digit` has no uppercase form. + */ +var digitToBasic = function digitToBasic(digit, flag) { + // 0..25 map to ASCII a..z or A..Z + // 26..35 map to ASCII 0..9 + return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); +}; - der.readSequence(0xa1); - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); +/** + * Bias adaptation function as per section 3.4 of RFC 3492. + * https://tools.ietf.org/html/rfc3492#section-3.4 + * @private + */ +var adapt = function adapt(delta, numPoints, firstTime) { + var k = 0; + delta = firstTime ? floor(delta / damp) : delta >> 1; + delta += floor(delta / numPoints); + for (; /* no initialization */delta > baseMinusTMin * tMax >> 1; k += base) { + delta = floor(delta / baseMinusTMin); + } + return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); +}; - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curve) }, - { name: 'Q', data: Q }, - { name: 'd', data: d } - ] - }; +/** + * Converts a Punycode string of ASCII-only symbols to a string of Unicode + * symbols. + * @memberOf punycode + * @param {String} input The Punycode string of ASCII-only symbols. + * @returns {String} The resulting string of Unicode symbols. + */ +var decode = function decode(input) { + // Don't use UCS-2. + var output = []; + var inputLength = input.length; + var i = 0; + var n = initialN; + var bias = initialBias; - return (new PrivateKey(key)); -} + // Handle the basic code points: let `basic` be the number of input code + // points before the last delimiter, or `0` if there is none, then copy + // the first basic code points to the output. -function writePkcs1(der, key) { - der.startSequence(); + var basic = input.lastIndexOf(delimiter); + if (basic < 0) { + basic = 0; + } - switch (key.type) { - case 'rsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1RSAPrivate(der, key); - else - writePkcs1RSAPublic(der, key); - break; - case 'dsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1DSAPrivate(der, key); - else - writePkcs1DSAPublic(der, key); - break; - case 'ecdsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1ECDSAPrivate(der, key); - else - writePkcs1ECDSAPublic(der, key); - break; - case 'ed25519': - if (PrivateKey.isPrivateKey(key)) - writePkcs1EdDSAPrivate(der, key); - else - writePkcs1EdDSAPublic(der, key); - break; - default: - throw (new Error('Unknown key algo: ' + key.type)); + for (var j = 0; j < basic; ++j) { + // if it's not a basic code point + if (input.charCodeAt(j) >= 0x80) { + error$1('not-basic'); + } + output.push(input.charCodeAt(j)); } - der.endSequence(); -} + // Main decoding loop: start just after the last delimiter if any basic code + // points were copied; start at the beginning otherwise. -function writePkcs1RSAPublic(der, key) { - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); -} + for (var index = basic > 0 ? basic + 1 : 0; index < inputLength;) /* no final expression */{ -function writePkcs1RSAPrivate(der, key) { - var ver = Buffer.from([0]); - der.writeBuffer(ver, asn1.Ber.Integer); + // `index` is the index of the next character to be consumed. + // Decode a generalized variable-length integer into `delta`, + // which gets added to `i`. The overflow checking is easier + // if we increase `i` as we go, then subtract off its starting + // value at the end to obtain `delta`. + var oldi = i; + for (var w = 1, k = base;; /* no condition */k += base) { - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.writeBuffer(key.part.d.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - if (!key.part.dmodp || !key.part.dmodq) - utils.addRSAMissing(key); - der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); - der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); - der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); -} + if (index >= inputLength) { + error$1('invalid-input'); + } -function writePkcs1DSAPrivate(der, key) { - var ver = Buffer.from([0]); - der.writeBuffer(ver, asn1.Ber.Integer); + var digit = basicToDigit(input.charCodeAt(index++)); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.writeBuffer(key.part.x.data, asn1.Ber.Integer); -} + if (digit >= base || digit > floor((maxInt - i) / w)) { + error$1('overflow'); + } -function writePkcs1DSAPublic(der, key) { - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); -} + i += digit * w; + var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; -function writePkcs1ECDSAPublic(der, key) { - der.startSequence(); + if (digit < t) { + break; + } - der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ - var curve = key.part.curve.data.toString(); - var curveOid = algs.curves[curve].pkcs8oid; - assert.string(curveOid, 'a known ECDSA named curve'); - der.writeOID(curveOid); + var baseMinusT = base - t; + if (w > floor(maxInt / baseMinusT)) { + error$1('overflow'); + } - der.endSequence(); + w *= baseMinusT; + } - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); -} + var out = output.length + 1; + bias = adapt(i - oldi, out, oldi == 0); -function writePkcs1ECDSAPrivate(der, key) { - var ver = Buffer.from([1]); - der.writeBuffer(ver, asn1.Ber.Integer); + // `i` was supposed to wrap around from `out` to `0`, + // incrementing `n` each time, so we'll fix that now: + if (floor(i / out) > maxInt - n) { + error$1('overflow'); + } - der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); + n += floor(i / out); + i %= out; - der.startSequence(0xa0); - var curve = key.part.curve.data.toString(); - var curveOid = algs.curves[curve].pkcs8oid; - assert.string(curveOid, 'a known ECDSA named curve'); - der.writeOID(curveOid); - der.endSequence(); + // Insert `n` at position `i` of the output. + output.splice(i++, 0, n); + } - der.startSequence(0xa1); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); - der.endSequence(); -} + return String.fromCodePoint.apply(String, output); +}; + +/** + * Converts a string of Unicode symbols (e.g. a domain name label) to a + * Punycode string of ASCII-only symbols. + * @memberOf punycode + * @param {String} input The string of Unicode symbols. + * @returns {String} The resulting Punycode string of ASCII-only symbols. + */ +var encode = function encode(input) { + var output = []; -function writePkcs1EdDSAPrivate(der, key) { - var ver = Buffer.from([1]); - der.writeBuffer(ver, asn1.Ber.Integer); + // Convert the input in UCS-2 to an array of Unicode code points. + input = ucs2decode(input); - der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); + // Cache the length. + var inputLength = input.length; - der.startSequence(0xa0); - der.writeOID('1.3.101.112'); - der.endSequence(); + // Initialize the state. + var n = initialN; + var delta = 0; + var bias = initialBias; - der.startSequence(0xa1); - utils.writeBitString(der, key.part.A.data); - der.endSequence(); -} + // Handle the basic code points. + var _iteratorNormalCompletion = true; + var _didIteratorError = false; + var _iteratorError = undefined; -function writePkcs1EdDSAPublic(der, key) { - throw (new Error('Public keys are not supported for EdDSA PKCS#1')); -} + try { + for (var _iterator = input[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) { + var _currentValue2 = _step.value; + if (_currentValue2 < 0x80) { + output.push(stringFromCharCode(_currentValue2)); + } + } + } catch (err) { + _didIteratorError = true; + _iteratorError = err; + } finally { + try { + if (!_iteratorNormalCompletion && _iterator.return) { + _iterator.return(); + } + } finally { + if (_didIteratorError) { + throw _iteratorError; + } + } + } -/***/ }), + var basicLength = output.length; + var handledCPCount = basicLength; -/***/ 882: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + // `handledCPCount` is the number of code points that have been handled; + // `basicLength` is the number of basic code points. -"use strict"; + // Finish the basic string with a delimiter unless it's empty. + if (basicLength) { + output.push(delimiter); + } + // Main encoding loop: + while (handledCPCount < inputLength) { -var jsonSafeStringify = __webpack_require__(639) -var crypto = __webpack_require__(417) -var Buffer = __webpack_require__(612).Buffer + // All non-basic code points < n have been handled already. Find the next + // larger one: + var m = maxInt; + var _iteratorNormalCompletion2 = true; + var _didIteratorError2 = false; + var _iteratorError2 = undefined; -var defer = typeof setImmediate === 'undefined' - ? process.nextTick - : setImmediate + try { + for (var _iterator2 = input[Symbol.iterator](), _step2; !(_iteratorNormalCompletion2 = (_step2 = _iterator2.next()).done); _iteratorNormalCompletion2 = true) { + var currentValue = _step2.value; -function paramsHaveRequestBody (params) { - return ( - params.body || - params.requestBodyStream || - (params.json && typeof params.json !== 'boolean') || - params.multipart - ) -} + if (currentValue >= n && currentValue < m) { + m = currentValue; + } + } -function safeStringify (obj, replacer) { - var ret - try { - ret = JSON.stringify(obj, replacer) - } catch (e) { - ret = jsonSafeStringify(obj, replacer) - } - return ret -} + // Increase `delta` enough to advance the decoder's state to , + // but guard against overflow. + } catch (err) { + _didIteratorError2 = true; + _iteratorError2 = err; + } finally { + try { + if (!_iteratorNormalCompletion2 && _iterator2.return) { + _iterator2.return(); + } + } finally { + if (_didIteratorError2) { + throw _iteratorError2; + } + } + } -function md5 (str) { - return crypto.createHash('md5').update(str).digest('hex') -} + var handledCPCountPlusOne = handledCPCount + 1; + if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { + error$1('overflow'); + } -function isReadStream (rs) { - return rs.readable && rs.path && rs.mode -} + delta += (m - n) * handledCPCountPlusOne; + n = m; -function toBase64 (str) { - return Buffer.from(str || '', 'utf8').toString('base64') -} + var _iteratorNormalCompletion3 = true; + var _didIteratorError3 = false; + var _iteratorError3 = undefined; -function copy (obj) { - var o = {} - Object.keys(obj).forEach(function (i) { - o[i] = obj[i] - }) - return o -} + try { + for (var _iterator3 = input[Symbol.iterator](), _step3; !(_iteratorNormalCompletion3 = (_step3 = _iterator3.next()).done); _iteratorNormalCompletion3 = true) { + var _currentValue = _step3.value; -function version () { - var numbers = process.version.replace('v', '').split('.') - return { - major: parseInt(numbers[0], 10), - minor: parseInt(numbers[1], 10), - patch: parseInt(numbers[2], 10) - } -} + if (_currentValue < n && ++delta > maxInt) { + error$1('overflow'); + } + if (_currentValue == n) { + // Represent delta as a generalized variable-length integer. + var q = delta; + for (var k = base;; /* no condition */k += base) { + var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + if (q < t) { + break; + } + var qMinusT = q - t; + var baseMinusT = base - t; + output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); + q = floor(qMinusT / baseMinusT); + } -exports.paramsHaveRequestBody = paramsHaveRequestBody -exports.safeStringify = safeStringify -exports.md5 = md5 -exports.isReadStream = isReadStream -exports.toBase64 = toBase64 -exports.copy = copy -exports.version = version -exports.defer = defer + output.push(stringFromCharCode(digitToBasic(q, 0))); + bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); + delta = 0; + ++handledCPCount; + } + } + } catch (err) { + _didIteratorError3 = true; + _iteratorError3 = err; + } finally { + try { + if (!_iteratorNormalCompletion3 && _iterator3.return) { + _iterator3.return(); + } + } finally { + if (_didIteratorError3) { + throw _iteratorError3; + } + } + } + ++delta; + ++n; + } + return output.join(''); +}; -/***/ }), +/** + * Converts a Punycode string representing a domain name or an email address + * to Unicode. Only the Punycoded parts of the input will be converted, i.e. + * it doesn't matter if you call it on a string that has already been + * converted to Unicode. + * @memberOf punycode + * @param {String} input The Punycoded domain name or email address to + * convert to Unicode. + * @returns {String} The Unicode representation of the given Punycode + * string. + */ +var toUnicode = function toUnicode(input) { + return mapDomain(input, function (string) { + return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; + }); +}; -/***/ 885: -/***/ (function(module, __unusedexports, __webpack_require__) { +/** + * Converts a Unicode string representing a domain name or an email address to + * Punycode. Only the non-ASCII parts of the domain name will be converted, + * i.e. it doesn't matter if you call it with a domain that's already in + * ASCII. + * @memberOf punycode + * @param {String} input The domain name or email address to convert, as a + * Unicode string. + * @returns {String} The Punycode representation of the given domain name or + * email address. + */ +var toASCII = function toASCII(input) { + return mapDomain(input, function (string) { + return regexNonASCII.test(string) ? 'xn--' + encode(string) : string; + }); +}; +/*--------------------------------------------------------------------------*/ -/*! - * Copyright 2010 LearnBoost +/** Define the public API */ +var punycode = { + /** + * A string representing the current Punycode.js version number. + * @memberOf punycode + * @type String + */ + 'version': '2.1.0', + /** + * An object of methods to convert from JavaScript's internal character + * representation (UCS-2) to Unicode code points, and back. + * @see + * @memberOf punycode + * @type Object + */ + 'ucs2': { + 'decode': ucs2decode, + 'encode': ucs2encode + }, + 'decode': decode, + 'encode': encode, + 'toASCII': toASCII, + 'toUnicode': toUnicode +}; + +/** + * URI.js * - * Licensed under the Apache License, Version 2.0 (the "License"); - * you may not use this file except in compliance with the License. - * You may obtain a copy of the License at + * @fileoverview An RFC 3986 compliant, scheme extendable URI parsing/validating/resolving library for JavaScript. + * @author Gary Court + * @see http://github.com/garycourt/uri-js + */ +/** + * Copyright 2011 Gary Court. All rights reserved. * - * http://www.apache.org/licenses/LICENSE-2.0 + * Redistribution and use in source and binary forms, with or without modification, are + * permitted provided that the following conditions are met: * - * Unless required by applicable law or agreed to in writing, software - * distributed under the License is distributed on an "AS IS" BASIS, - * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - * See the License for the specific language governing permissions and - * limitations under the License. + * 1. Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY GARY COURT ``AS IS'' AND ANY EXPRESS OR IMPLIED + * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND + * FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL GARY COURT OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR + * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON + * ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF + * ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + * + * The views and conclusions contained in the software and documentation are those of the + * authors and should not be interpreted as representing official policies, either expressed + * or implied, of Gary Court. */ +var SCHEMES = {}; +function pctEncChar(chr) { + var c = chr.charCodeAt(0); + var e = void 0; + if (c < 16) e = "%0" + c.toString(16).toUpperCase();else if (c < 128) e = "%" + c.toString(16).toUpperCase();else if (c < 2048) e = "%" + (c >> 6 | 192).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase();else e = "%" + (c >> 12 | 224).toString(16).toUpperCase() + "%" + (c >> 6 & 63 | 128).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase(); + return e; +} +function pctDecChars(str) { + var newStr = ""; + var i = 0; + var il = str.length; + while (i < il) { + var c = parseInt(str.substr(i + 1, 2), 16); + if (c < 128) { + newStr += String.fromCharCode(c); + i += 3; + } else if (c >= 194 && c < 224) { + if (il - i >= 6) { + var c2 = parseInt(str.substr(i + 4, 2), 16); + newStr += String.fromCharCode((c & 31) << 6 | c2 & 63); + } else { + newStr += str.substr(i, 6); + } + i += 6; + } else if (c >= 224) { + if (il - i >= 9) { + var _c = parseInt(str.substr(i + 4, 2), 16); + var c3 = parseInt(str.substr(i + 7, 2), 16); + newStr += String.fromCharCode((c & 15) << 12 | (_c & 63) << 6 | c3 & 63); + } else { + newStr += str.substr(i, 9); + } + i += 9; + } else { + newStr += str.substr(i, 3); + i += 3; + } + } + return newStr; +} +function _normalizeComponentEncoding(components, protocol) { + function decodeUnreserved(str) { + var decStr = pctDecChars(str); + return !decStr.match(protocol.UNRESERVED) ? str : decStr; + } + if (components.scheme) components.scheme = String(components.scheme).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_SCHEME, ""); + if (components.userinfo !== undefined) components.userinfo = String(components.userinfo).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_USERINFO, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.host !== undefined) components.host = String(components.host).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_HOST, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.path !== undefined) components.path = String(components.path).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(components.scheme ? protocol.NOT_PATH : protocol.NOT_PATH_NOSCHEME, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.query !== undefined) components.query = String(components.query).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_QUERY, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + if (components.fragment !== undefined) components.fragment = String(components.fragment).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_FRAGMENT, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); + return components; +} -/** - * Module dependencies. - */ +function _stripLeadingZeros(str) { + return str.replace(/^0*(.*)/, "$1") || "0"; +} +function _normalizeIPv4(host, protocol) { + var matches = host.match(protocol.IPV4ADDRESS) || []; -var crypto = __webpack_require__(417) - , parse = __webpack_require__(835).parse - ; + var _matches = slicedToArray(matches, 2), + address = _matches[1]; -/** - * Valid keys. - */ + if (address) { + return address.split(".").map(_stripLeadingZeros).join("."); + } else { + return host; + } +} +function _normalizeIPv6(host, protocol) { + var matches = host.match(protocol.IPV6ADDRESS) || []; -var keys = - [ 'acl' - , 'location' - , 'logging' - , 'notification' - , 'partNumber' - , 'policy' - , 'requestPayment' - , 'torrent' - , 'uploadId' - , 'uploads' - , 'versionId' - , 'versioning' - , 'versions' - , 'website' - ] + var _matches2 = slicedToArray(matches, 3), + address = _matches2[1], + zone = _matches2[2]; -/** - * Return an "Authorization" header value with the given `options` - * in the form of "AWS :" - * - * @param {Object} options - * @return {String} - * @api private - */ + if (address) { + var _address$toLowerCase$ = address.toLowerCase().split('::').reverse(), + _address$toLowerCase$2 = slicedToArray(_address$toLowerCase$, 2), + last = _address$toLowerCase$2[0], + first = _address$toLowerCase$2[1]; -function authorization (options) { - return 'AWS ' + options.key + ':' + sign(options) + var firstFields = first ? first.split(":").map(_stripLeadingZeros) : []; + var lastFields = last.split(":").map(_stripLeadingZeros); + var isLastFieldIPv4Address = protocol.IPV4ADDRESS.test(lastFields[lastFields.length - 1]); + var fieldCount = isLastFieldIPv4Address ? 7 : 8; + var lastFieldsStart = lastFields.length - fieldCount; + var fields = Array(fieldCount); + for (var x = 0; x < fieldCount; ++x) { + fields[x] = firstFields[x] || lastFields[lastFieldsStart + x] || ''; + } + if (isLastFieldIPv4Address) { + fields[fieldCount - 1] = _normalizeIPv4(fields[fieldCount - 1], protocol); + } + var allZeroFields = fields.reduce(function (acc, field, index) { + if (!field || field === "0") { + var lastLongest = acc[acc.length - 1]; + if (lastLongest && lastLongest.index + lastLongest.length === index) { + lastLongest.length++; + } else { + acc.push({ index: index, length: 1 }); + } + } + return acc; + }, []); + var longestZeroFields = allZeroFields.sort(function (a, b) { + return b.length - a.length; + })[0]; + var newHost = void 0; + if (longestZeroFields && longestZeroFields.length > 1) { + var newFirst = fields.slice(0, longestZeroFields.index); + var newLast = fields.slice(longestZeroFields.index + longestZeroFields.length); + newHost = newFirst.join(":") + "::" + newLast.join(":"); + } else { + newHost = fields.join(":"); + } + if (zone) { + newHost += "%" + zone; + } + return newHost; + } else { + return host; + } +} +var URI_PARSE = /^(?:([^:\/?#]+):)?(?:\/\/((?:([^\/?#@]*)@)?(\[[^\/?#\]]+\]|[^\/?#:]*)(?:\:(\d*))?))?([^?#]*)(?:\?([^#]*))?(?:#((?:.|\n|\r)*))?/i; +var NO_MATCH_IS_UNDEFINED = "".match(/(){0}/)[1] === undefined; +function parse(uriString) { + var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + + var components = {}; + var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; + if (options.reference === "suffix") uriString = (options.scheme ? options.scheme + ":" : "") + "//" + uriString; + var matches = uriString.match(URI_PARSE); + if (matches) { + if (NO_MATCH_IS_UNDEFINED) { + //store each component + components.scheme = matches[1]; + components.userinfo = matches[3]; + components.host = matches[4]; + components.port = parseInt(matches[5], 10); + components.path = matches[6] || ""; + components.query = matches[7]; + components.fragment = matches[8]; + //fix port number + if (isNaN(components.port)) { + components.port = matches[5]; + } + } else { + //IE FIX for improper RegExp matching + //store each component + components.scheme = matches[1] || undefined; + components.userinfo = uriString.indexOf("@") !== -1 ? matches[3] : undefined; + components.host = uriString.indexOf("//") !== -1 ? matches[4] : undefined; + components.port = parseInt(matches[5], 10); + components.path = matches[6] || ""; + components.query = uriString.indexOf("?") !== -1 ? matches[7] : undefined; + components.fragment = uriString.indexOf("#") !== -1 ? matches[8] : undefined; + //fix port number + if (isNaN(components.port)) { + components.port = uriString.match(/\/\/(?:.|\n)*\:(?:\/|\?|\#|$)/) ? matches[4] : undefined; + } + } + if (components.host) { + //normalize IP hosts + components.host = _normalizeIPv6(_normalizeIPv4(components.host, protocol), protocol); + } + //determine reference type + if (components.scheme === undefined && components.userinfo === undefined && components.host === undefined && components.port === undefined && !components.path && components.query === undefined) { + components.reference = "same-document"; + } else if (components.scheme === undefined) { + components.reference = "relative"; + } else if (components.fragment === undefined) { + components.reference = "absolute"; + } else { + components.reference = "uri"; + } + //check for reference errors + if (options.reference && options.reference !== "suffix" && options.reference !== components.reference) { + components.error = components.error || "URI is not a " + options.reference + " reference."; + } + //find scheme handler + var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; + //check if scheme can't handle IRIs + if (!options.unicodeSupport && (!schemeHandler || !schemeHandler.unicodeSupport)) { + //if host component is a domain name + if (components.host && (options.domainHost || schemeHandler && schemeHandler.domainHost)) { + //convert Unicode IDN -> ASCII IDN + try { + components.host = punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()); + } catch (e) { + components.error = components.error || "Host's domain name can not be converted to ASCII via punycode: " + e; + } + } + //convert IRI -> URI + _normalizeComponentEncoding(components, URI_PROTOCOL); + } else { + //normalize encodings + _normalizeComponentEncoding(components, protocol); + } + //perform scheme specific parsing + if (schemeHandler && schemeHandler.parse) { + schemeHandler.parse(components, options); + } + } else { + components.error = components.error || "URI can not be parsed."; + } + return components; } -module.exports = authorization -module.exports.authorization = authorization - -/** - * Simple HMAC-SHA1 Wrapper - * - * @param {Object} options - * @return {String} - * @api private - */ +function _recomposeAuthority(components, options) { + var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; + var uriTokens = []; + if (components.userinfo !== undefined) { + uriTokens.push(components.userinfo); + uriTokens.push("@"); + } + if (components.host !== undefined) { + //normalize IP hosts, add brackets and escape zone separator for IPv6 + uriTokens.push(_normalizeIPv6(_normalizeIPv4(String(components.host), protocol), protocol).replace(protocol.IPV6ADDRESS, function (_, $1, $2) { + return "[" + $1 + ($2 ? "%25" + $2 : "") + "]"; + })); + } + if (typeof components.port === "number") { + uriTokens.push(":"); + uriTokens.push(components.port.toString(10)); + } + return uriTokens.length ? uriTokens.join("") : undefined; +} -function hmacSha1 (options) { - return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64') +var RDS1 = /^\.\.?\//; +var RDS2 = /^\/\.(\/|$)/; +var RDS3 = /^\/\.\.(\/|$)/; +var RDS5 = /^\/?(?:.|\n)*?(?=\/|$)/; +function removeDotSegments(input) { + var output = []; + while (input.length) { + if (input.match(RDS1)) { + input = input.replace(RDS1, ""); + } else if (input.match(RDS2)) { + input = input.replace(RDS2, "/"); + } else if (input.match(RDS3)) { + input = input.replace(RDS3, "/"); + output.pop(); + } else if (input === "." || input === "..") { + input = ""; + } else { + var im = input.match(RDS5); + if (im) { + var s = im[0]; + input = input.slice(s.length); + output.push(s); + } else { + throw new Error("Unexpected dot segment condition"); + } + } + } + return output.join(""); } -module.exports.hmacSha1 = hmacSha1 +function serialize(components) { + var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; -/** - * Create a base64 sha1 HMAC for `options`. - * - * @param {Object} options - * @return {String} - * @api private - */ + var protocol = options.iri ? IRI_PROTOCOL : URI_PROTOCOL; + var uriTokens = []; + //find scheme handler + var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; + //perform scheme specific serialization + if (schemeHandler && schemeHandler.serialize) schemeHandler.serialize(components, options); + if (components.host) { + //if host component is an IPv6 address + if (protocol.IPV6ADDRESS.test(components.host)) {} + //TODO: normalize IPv6 address as per RFC 5952 -function sign (options) { - options.message = stringToSign(options) - return hmacSha1(options) + //if host component is a domain name + else if (options.domainHost || schemeHandler && schemeHandler.domainHost) { + //convert IDN via punycode + try { + components.host = !options.iri ? punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()) : punycode.toUnicode(components.host); + } catch (e) { + components.error = components.error || "Host's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; + } + } + } + //normalize encoding + _normalizeComponentEncoding(components, protocol); + if (options.reference !== "suffix" && components.scheme) { + uriTokens.push(components.scheme); + uriTokens.push(":"); + } + var authority = _recomposeAuthority(components, options); + if (authority !== undefined) { + if (options.reference !== "suffix") { + uriTokens.push("//"); + } + uriTokens.push(authority); + if (components.path && components.path.charAt(0) !== "/") { + uriTokens.push("/"); + } + } + if (components.path !== undefined) { + var s = components.path; + if (!options.absolutePath && (!schemeHandler || !schemeHandler.absolutePath)) { + s = removeDotSegments(s); + } + if (authority === undefined) { + s = s.replace(/^\/\//, "/%2F"); //don't allow the path to start with "//" + } + uriTokens.push(s); + } + if (components.query !== undefined) { + uriTokens.push("?"); + uriTokens.push(components.query); + } + if (components.fragment !== undefined) { + uriTokens.push("#"); + uriTokens.push(components.fragment); + } + return uriTokens.join(""); //merge tokens into a string } -module.exports.sign = sign -/** - * Create a base64 sha1 HMAC for `options`. - * - * Specifically to be used with S3 presigned URLs - * - * @param {Object} options - * @return {String} - * @api private - */ +function resolveComponents(base, relative) { + var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + var skipNormalization = arguments[3]; -function signQuery (options) { - options.message = queryStringToSign(options) - return hmacSha1(options) + var target = {}; + if (!skipNormalization) { + base = parse(serialize(base, options), options); //normalize base components + relative = parse(serialize(relative, options), options); //normalize relative components + } + options = options || {}; + if (!options.tolerant && relative.scheme) { + target.scheme = relative.scheme; + //target.authority = relative.authority; + target.userinfo = relative.userinfo; + target.host = relative.host; + target.port = relative.port; + target.path = removeDotSegments(relative.path || ""); + target.query = relative.query; + } else { + if (relative.userinfo !== undefined || relative.host !== undefined || relative.port !== undefined) { + //target.authority = relative.authority; + target.userinfo = relative.userinfo; + target.host = relative.host; + target.port = relative.port; + target.path = removeDotSegments(relative.path || ""); + target.query = relative.query; + } else { + if (!relative.path) { + target.path = base.path; + if (relative.query !== undefined) { + target.query = relative.query; + } else { + target.query = base.query; + } + } else { + if (relative.path.charAt(0) === "/") { + target.path = removeDotSegments(relative.path); + } else { + if ((base.userinfo !== undefined || base.host !== undefined || base.port !== undefined) && !base.path) { + target.path = "/" + relative.path; + } else if (!base.path) { + target.path = relative.path; + } else { + target.path = base.path.slice(0, base.path.lastIndexOf("/") + 1) + relative.path; + } + target.path = removeDotSegments(target.path); + } + target.query = relative.query; + } + //target.authority = base.authority; + target.userinfo = base.userinfo; + target.host = base.host; + target.port = base.port; + } + target.scheme = base.scheme; + } + target.fragment = relative.fragment; + return target; } -module.exports.signQuery= signQuery - -/** - * Return a string for sign() with the given `options`. - * - * Spec: - * - * \n - * \n - * \n - * \n - * [headers\n] - * - * - * @param {Object} options - * @return {String} - * @api private - */ -function stringToSign (options) { - var headers = options.amazonHeaders || '' - if (headers) headers += '\n' - var r = - [ options.verb - , options.md5 - , options.contentType - , options.date ? options.date.toUTCString() : '' - , headers + options.resource - ] - return r.join('\n') +function resolve(baseURI, relativeURI, options) { + var schemelessOptions = assign({ scheme: 'null' }, options); + return serialize(resolveComponents(parse(baseURI, schemelessOptions), parse(relativeURI, schemelessOptions), schemelessOptions, true), schemelessOptions); } -module.exports.stringToSign = stringToSign - -/** - * Return a string for sign() with the given `options`, but is meant exclusively - * for S3 presigned URLs - * - * Spec: - * - * \n - * - * - * @param {Object} options - * @return {String} - * @api private - */ -function queryStringToSign (options){ - return 'GET\n\n\n' + options.date + '\n' + options.resource +function normalize(uri, options) { + if (typeof uri === "string") { + uri = serialize(parse(uri, options), options); + } else if (typeOf(uri) === "object") { + uri = parse(serialize(uri, options), options); + } + return uri; } -module.exports.queryStringToSign = queryStringToSign - -/** - * Perform the following: - * - * - ignore non-amazon headers - * - lowercase fields - * - sort lexicographically - * - trim whitespace between ":" - * - join with newline - * - * @param {Object} headers - * @return {String} - * @api private - */ -function canonicalizeHeaders (headers) { - var buf = [] - , fields = Object.keys(headers) - ; - for (var i = 0, len = fields.length; i < len; ++i) { - var field = fields[i] - , val = headers[field] - , field = field.toLowerCase() - ; - if (0 !== field.indexOf('x-amz')) continue - buf.push(field + ':' + val) - } - return buf.sort().join('\n') +function equal(uriA, uriB, options) { + if (typeof uriA === "string") { + uriA = serialize(parse(uriA, options), options); + } else if (typeOf(uriA) === "object") { + uriA = serialize(uriA, options); + } + if (typeof uriB === "string") { + uriB = serialize(parse(uriB, options), options); + } else if (typeOf(uriB) === "object") { + uriB = serialize(uriB, options); + } + return uriA === uriB; } -module.exports.canonicalizeHeaders = canonicalizeHeaders - -/** - * Perform the following: - * - * - ignore non sub-resources - * - sort lexicographically - * - * @param {String} resource - * @return {String} - * @api private - */ - -function canonicalizeResource (resource) { - var url = parse(resource, true) - , path = url.pathname - , buf = [] - ; - - Object.keys(url.query).forEach(function(key){ - if (!~keys.indexOf(key)) return - var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key]) - buf.push(key + val) - }) - return path + (buf.length ? '?' + buf.sort().join('&') : '') +function escapeComponent(str, options) { + return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.ESCAPE : IRI_PROTOCOL.ESCAPE, pctEncChar); } -module.exports.canonicalizeResource = canonicalizeResource - - -/***/ }), - -/***/ 890: -/***/ (function(module) { - -module.exports = {"$id":"postData.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["mimeType"],"properties":{"mimeType":{"type":"string"},"text":{"type":"string"},"params":{"type":"array","required":["name"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"fileName":{"type":"string"},"contentType":{"type":"string"},"comment":{"type":"string"}}},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 895: -/***/ (function(__unusedmodule, exports) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ -/*jshint unused:false */ - -function Store() { +function unescapeComponent(str, options) { + return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.PCT_ENCODED : IRI_PROTOCOL.PCT_ENCODED, pctDecChars); } -exports.Store = Store; - -// Stores may be synchronous, but are still required to use a -// Continuation-Passing Style API. The CookieJar itself will expose a "*Sync" -// API that converts from synchronous-callbacks to imperative style. -Store.prototype.synchronous = false; - -Store.prototype.findCookie = function(domain, path, key, cb) { - throw new Error('findCookie is not implemented'); -}; -Store.prototype.findCookies = function(domain, path, cb) { - throw new Error('findCookies is not implemented'); +var handler = { + scheme: "http", + domainHost: true, + parse: function parse(components, options) { + //report missing host + if (!components.host) { + components.error = components.error || "HTTP URIs must have a host."; + } + return components; + }, + serialize: function serialize(components, options) { + //normalize the default port + if (components.port === (String(components.scheme).toLowerCase() !== "https" ? 80 : 443) || components.port === "") { + components.port = undefined; + } + //normalize the empty path + if (!components.path) { + components.path = "/"; + } + //NOTE: We do not parse query strings for HTTP URIs + //as WWW Form Url Encoded query strings are part of the HTML4+ spec, + //and not the HTTP spec. + return components; + } }; -Store.prototype.putCookie = function(cookie, cb) { - throw new Error('putCookie is not implemented'); +var handler$1 = { + scheme: "https", + domainHost: handler.domainHost, + parse: handler.parse, + serialize: handler.serialize }; -Store.prototype.updateCookie = function(oldCookie, newCookie, cb) { - // recommended default implementation: - // return this.putCookie(newCookie, cb); - throw new Error('updateCookie is not implemented'); +var O = {}; +var isIRI = true; +//RFC 3986 +var UNRESERVED$$ = "[A-Za-z0-9\\-\\.\\_\\~" + (isIRI ? "\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF" : "") + "]"; +var HEXDIG$$ = "[0-9A-Fa-f]"; //case-insensitive +var PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)); //expanded +//RFC 5322, except these symbols as per RFC 6068: @ : / ? # [ ] & ; = +//const ATEXT$$ = "[A-Za-z0-9\\!\\#\\$\\%\\&\\'\\*\\+\\-\\/\\=\\?\\^\\_\\`\\{\\|\\}\\~]"; +//const WSP$$ = "[\\x20\\x09]"; +//const OBS_QTEXT$$ = "[\\x01-\\x08\\x0B\\x0C\\x0E-\\x1F\\x7F]"; //(%d1-8 / %d11-12 / %d14-31 / %d127) +//const QTEXT$$ = merge("[\\x21\\x23-\\x5B\\x5D-\\x7E]", OBS_QTEXT$$); //%d33 / %d35-91 / %d93-126 / obs-qtext +//const VCHAR$$ = "[\\x21-\\x7E]"; +//const WSP$$ = "[\\x20\\x09]"; +//const OBS_QP$ = subexp("\\\\" + merge("[\\x00\\x0D\\x0A]", OBS_QTEXT$$)); //%d0 / CR / LF / obs-qtext +//const FWS$ = subexp(subexp(WSP$$ + "*" + "\\x0D\\x0A") + "?" + WSP$$ + "+"); +//const QUOTED_PAIR$ = subexp(subexp("\\\\" + subexp(VCHAR$$ + "|" + WSP$$)) + "|" + OBS_QP$); +//const QUOTED_STRING$ = subexp('\\"' + subexp(FWS$ + "?" + QCONTENT$) + "*" + FWS$ + "?" + '\\"'); +var ATEXT$$ = "[A-Za-z0-9\\!\\$\\%\\'\\*\\+\\-\\^\\_\\`\\{\\|\\}\\~]"; +var QTEXT$$ = "[\\!\\$\\%\\'\\(\\)\\*\\+\\,\\-\\.0-9\\<\\>A-Z\\x5E-\\x7E]"; +var VCHAR$$ = merge(QTEXT$$, "[\\\"\\\\]"); +var SOME_DELIMS$$ = "[\\!\\$\\'\\(\\)\\*\\+\\,\\;\\:\\@]"; +var UNRESERVED = new RegExp(UNRESERVED$$, "g"); +var PCT_ENCODED = new RegExp(PCT_ENCODED$, "g"); +var NOT_LOCAL_PART = new RegExp(merge("[^]", ATEXT$$, "[\\.]", '[\\"]', VCHAR$$), "g"); +var NOT_HFNAME = new RegExp(merge("[^]", UNRESERVED$$, SOME_DELIMS$$), "g"); +var NOT_HFVALUE = NOT_HFNAME; +function decodeUnreserved(str) { + var decStr = pctDecChars(str); + return !decStr.match(UNRESERVED) ? str : decStr; +} +var handler$2 = { + scheme: "mailto", + parse: function parse$$1(components, options) { + var mailtoComponents = components; + var to = mailtoComponents.to = mailtoComponents.path ? mailtoComponents.path.split(",") : []; + mailtoComponents.path = undefined; + if (mailtoComponents.query) { + var unknownHeaders = false; + var headers = {}; + var hfields = mailtoComponents.query.split("&"); + for (var x = 0, xl = hfields.length; x < xl; ++x) { + var hfield = hfields[x].split("="); + switch (hfield[0]) { + case "to": + var toAddrs = hfield[1].split(","); + for (var _x = 0, _xl = toAddrs.length; _x < _xl; ++_x) { + to.push(toAddrs[_x]); + } + break; + case "subject": + mailtoComponents.subject = unescapeComponent(hfield[1], options); + break; + case "body": + mailtoComponents.body = unescapeComponent(hfield[1], options); + break; + default: + unknownHeaders = true; + headers[unescapeComponent(hfield[0], options)] = unescapeComponent(hfield[1], options); + break; + } + } + if (unknownHeaders) mailtoComponents.headers = headers; + } + mailtoComponents.query = undefined; + for (var _x2 = 0, _xl2 = to.length; _x2 < _xl2; ++_x2) { + var addr = to[_x2].split("@"); + addr[0] = unescapeComponent(addr[0]); + if (!options.unicodeSupport) { + //convert Unicode IDN -> ASCII IDN + try { + addr[1] = punycode.toASCII(unescapeComponent(addr[1], options).toLowerCase()); + } catch (e) { + mailtoComponents.error = mailtoComponents.error || "Email address's domain name can not be converted to ASCII via punycode: " + e; + } + } else { + addr[1] = unescapeComponent(addr[1], options).toLowerCase(); + } + to[_x2] = addr.join("@"); + } + return mailtoComponents; + }, + serialize: function serialize$$1(mailtoComponents, options) { + var components = mailtoComponents; + var to = toArray(mailtoComponents.to); + if (to) { + for (var x = 0, xl = to.length; x < xl; ++x) { + var toAddr = String(to[x]); + var atIdx = toAddr.lastIndexOf("@"); + var localPart = toAddr.slice(0, atIdx).replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_LOCAL_PART, pctEncChar); + var domain = toAddr.slice(atIdx + 1); + //convert IDN via punycode + try { + domain = !options.iri ? punycode.toASCII(unescapeComponent(domain, options).toLowerCase()) : punycode.toUnicode(domain); + } catch (e) { + components.error = components.error || "Email address's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; + } + to[x] = localPart + "@" + domain; + } + components.path = to.join(","); + } + var headers = mailtoComponents.headers = mailtoComponents.headers || {}; + if (mailtoComponents.subject) headers["subject"] = mailtoComponents.subject; + if (mailtoComponents.body) headers["body"] = mailtoComponents.body; + var fields = []; + for (var name in headers) { + if (headers[name] !== O[name]) { + fields.push(name.replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFNAME, pctEncChar) + "=" + headers[name].replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFVALUE, pctEncChar)); + } + } + if (fields.length) { + components.query = fields.join("&"); + } + return components; + } }; -Store.prototype.removeCookie = function(domain, path, key, cb) { - throw new Error('removeCookie is not implemented'); +var URN_PARSE = /^([^\:]+)\:(.*)/; +//RFC 2141 +var handler$3 = { + scheme: "urn", + parse: function parse$$1(components, options) { + var matches = components.path && components.path.match(URN_PARSE); + var urnComponents = components; + if (matches) { + var scheme = options.scheme || urnComponents.scheme || "urn"; + var nid = matches[1].toLowerCase(); + var nss = matches[2]; + var urnScheme = scheme + ":" + (options.nid || nid); + var schemeHandler = SCHEMES[urnScheme]; + urnComponents.nid = nid; + urnComponents.nss = nss; + urnComponents.path = undefined; + if (schemeHandler) { + urnComponents = schemeHandler.parse(urnComponents, options); + } + } else { + urnComponents.error = urnComponents.error || "URN can not be parsed."; + } + return urnComponents; + }, + serialize: function serialize$$1(urnComponents, options) { + var scheme = options.scheme || urnComponents.scheme || "urn"; + var nid = urnComponents.nid; + var urnScheme = scheme + ":" + (options.nid || nid); + var schemeHandler = SCHEMES[urnScheme]; + if (schemeHandler) { + urnComponents = schemeHandler.serialize(urnComponents, options); + } + var uriComponents = urnComponents; + var nss = urnComponents.nss; + uriComponents.path = (nid || options.nid) + ":" + nss; + return uriComponents; + } }; -Store.prototype.removeCookies = function(domain, path, cb) { - throw new Error('removeCookies is not implemented'); +var UUID = /^[0-9A-Fa-f]{8}(?:\-[0-9A-Fa-f]{4}){3}\-[0-9A-Fa-f]{12}$/; +//RFC 4122 +var handler$4 = { + scheme: "urn:uuid", + parse: function parse(urnComponents, options) { + var uuidComponents = urnComponents; + uuidComponents.uuid = uuidComponents.nss; + uuidComponents.nss = undefined; + if (!options.tolerant && (!uuidComponents.uuid || !uuidComponents.uuid.match(UUID))) { + uuidComponents.error = uuidComponents.error || "UUID is not valid."; + } + return uuidComponents; + }, + serialize: function serialize(uuidComponents, options) { + var urnComponents = uuidComponents; + //normalize UUID + urnComponents.nss = (uuidComponents.uuid || "").toLowerCase(); + return urnComponents; + } }; -Store.prototype.getAllCookies = function(cb) { - throw new Error('getAllCookies is not implemented (therefore jar cannot be serialized)'); -}; +SCHEMES[handler.scheme] = handler; +SCHEMES[handler$1.scheme] = handler$1; +SCHEMES[handler$2.scheme] = handler$2; +SCHEMES[handler$3.scheme] = handler$3; +SCHEMES[handler$4.scheme] = handler$4; +exports.SCHEMES = SCHEMES; +exports.pctEncChar = pctEncChar; +exports.pctDecChars = pctDecChars; +exports.parse = parse; +exports.removeDotSegments = removeDotSegments; +exports.serialize = serialize; +exports.resolveComponents = resolveComponents; +exports.resolve = resolve; +exports.normalize = normalize; +exports.equal = equal; +exports.escapeComponent = escapeComponent; +exports.unescapeComponent = unescapeComponent; -/***/ }), +Object.defineProperty(exports, '__esModule', { value: true }); -/***/ 903: -/***/ (function(module) { +}))); +//# sourceMappingURL=uri.all.js.map -module.exports = require("zlib"); /***/ }), -/***/ 904: +/***/ 855: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -var IDENTIFIER = /^[a-z_$][a-z0-9_$-]*$/i; -var customRuleCode = __webpack_require__(471); -var definitionSchema = __webpack_require__(424); module.exports = { - add: addKeyword, - get: getKeyword, - remove: removeKeyword, - validate: validateKeyword + copy: copy, + checkDataType: checkDataType, + checkDataTypes: checkDataTypes, + coerceToTypes: coerceToTypes, + toHash: toHash, + getProperty: getProperty, + escapeQuotes: escapeQuotes, + equal: __webpack_require__(832), + ucs2length: __webpack_require__(691), + varOccurences: varOccurences, + varReplace: varReplace, + cleanUpCode: cleanUpCode, + finalCleanUpCode: finalCleanUpCode, + schemaHasRules: schemaHasRules, + schemaHasRulesExcept: schemaHasRulesExcept, + schemaUnknownRules: schemaUnknownRules, + toQuotedString: toQuotedString, + getPathExpr: getPathExpr, + getPath: getPath, + getData: getData, + unescapeFragment: unescapeFragment, + unescapeJsonPointer: unescapeJsonPointer, + escapeFragment: escapeFragment, + escapeJsonPointer: escapeJsonPointer }; -/** - * Define custom keyword - * @this Ajv - * @param {String} keyword custom keyword, should be unique (including different from all standard, custom and macro keywords). - * @param {Object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`. - * @return {Ajv} this for method chaining - */ -function addKeyword(keyword, definition) { - /* jshint validthis: true */ - /* eslint no-shadow: 0 */ - var RULES = this.RULES; - if (RULES.keywords[keyword]) - throw new Error('Keyword ' + keyword + ' is already defined'); - - if (!IDENTIFIER.test(keyword)) - throw new Error('Keyword ' + keyword + ' is not a valid identifier'); - - if (definition) { - this.validateKeyword(definition, true); +function copy(o, to) { + to = to || {}; + for (var key in o) to[key] = o[key]; + return to; +} - var dataType = definition.type; - if (Array.isArray(dataType)) { - for (var i=0; i 0 && !req.useChunkedEncodingByDefault) { - var idleSocket = this.freeSockets[name].pop() - idleSocket.removeListener('error', idleSocket._onIdleError) - delete idleSocket._onIdleError - req._reusedSocket = true - req.onSocket(idleSocket) - } else { - this.addRequestNoreuse(req, host, port) - } + matches = out.match(ROOTDATA_REGEXP); + if (!matches || matches.length !== 3) return out; + return out.replace(REMOVE_ROOTDATA, ''); } -ForeverAgent.prototype.removeSocket = function(s, name, host, port) { - if (this.sockets[name]) { - var index = this.sockets[name].indexOf(s) - if (index !== -1) { - this.sockets[name].splice(index, 1) - } - } else if (this.sockets[name] && this.sockets[name].length === 0) { - // don't leak - delete this.sockets[name] - delete this.requests[name] - } - - if (this.freeSockets[name]) { - var index = this.freeSockets[name].indexOf(s) - if (index !== -1) { - this.freeSockets[name].splice(index, 1) - if (this.freeSockets[name].length === 0) { - delete this.freeSockets[name] - } - } - } - if (this.requests[name] && this.requests[name].length) { - // If we have pending requests and a socket gets closed a new one - // needs to be created to take over in the pool for the one that closed. - this.createSocket(name, host, port).emit('free') - } +function schemaHasRules(schema, rules) { + if (typeof schema == 'boolean') return !schema; + for (var key in schema) if (rules[key]) return true; } -function ForeverAgentSSL (options) { - ForeverAgent.call(this, options) -} -util.inherits(ForeverAgentSSL, ForeverAgent) -ForeverAgentSSL.prototype.createConnection = createConnectionSSL -ForeverAgentSSL.prototype.addRequestNoreuse = AgentSSL.prototype.addRequest +function schemaHasRulesExcept(schema, rules, exceptKeyword) { + if (typeof schema == 'boolean') return !schema && exceptKeyword != 'not'; + for (var key in schema) if (key != exceptKeyword && rules[key]) return true; +} -function createConnectionSSL (port, host, options) { - if (typeof port === 'object') { - options = port; - } else if (typeof host === 'object') { - options = host; - } else if (typeof options === 'object') { - options = options; - } else { - options = {}; - } - if (typeof port === 'number') { - options.port = port; - } +function schemaUnknownRules(schema, rules) { + if (typeof schema == 'boolean') return; + for (var key in schema) if (!rules[key]) return key; +} - if (typeof host === 'string') { - options.host = host; - } - return tls.connect(options); +function toQuotedString(str) { + return '\'' + escapeQuotes(str) + '\''; } -/***/ }), +function getPathExpr(currentPath, expr, jsonPointers, isNumber) { + var path = jsonPointers // false by default + ? '\'/\' + ' + expr + (isNumber ? '' : '.replace(/~/g, \'~0\').replace(/\\//g, \'~1\')') + : (isNumber ? '\'[\' + ' + expr + ' + \']\'' : '\'[\\\'\' + ' + expr + ' + \'\\\']\''); + return joinPaths(currentPath, path); +} -/***/ 932: -/***/ (function(module, __unusedexports, __webpack_require__) { -var CombinedStream = __webpack_require__(254); -var util = __webpack_require__(669); -var path = __webpack_require__(622); -var http = __webpack_require__(605); -var https = __webpack_require__(211); -var parseUrl = __webpack_require__(835).parse; -var fs = __webpack_require__(747); -var mime = __webpack_require__(667); -var asynckit = __webpack_require__(74); -var populate = __webpack_require__(611); +function getPath(currentPath, prop, jsonPointers) { + var path = jsonPointers // false by default + ? toQuotedString('/' + escapeJsonPointer(prop)) + : toQuotedString(getProperty(prop)); + return joinPaths(currentPath, path); +} -// Public API -module.exports = FormData; -// make it a Stream -util.inherits(FormData, CombinedStream); +var JSON_POINTER = /^\/(?:[^~]|~0|~1)*$/; +var RELATIVE_JSON_POINTER = /^([0-9]+)(#|\/(?:[^~]|~0|~1)*)?$/; +function getData($data, lvl, paths) { + var up, jsonPointer, data, matches; + if ($data === '') return 'rootData'; + if ($data[0] == '/') { + if (!JSON_POINTER.test($data)) throw new Error('Invalid JSON-pointer: ' + $data); + jsonPointer = $data; + data = 'rootData'; + } else { + matches = $data.match(RELATIVE_JSON_POINTER); + if (!matches) throw new Error('Invalid JSON-pointer: ' + $data); + up = +matches[1]; + jsonPointer = matches[2]; + if (jsonPointer == '#') { + if (up >= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); + return paths[lvl - up]; + } -/** - * Create readable "multipart/form-data" streams. - * Can be used to submit forms - * and file uploads to other web applications. - * - * @constructor - * @param {Object} options - Properties to be added/overriden for FormData and CombinedStream - */ -function FormData(options) { - if (!(this instanceof FormData)) { - return new FormData(); + if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); + data = 'data' + ((lvl - up) || ''); + if (!jsonPointer) return data; } - this._overheadLength = 0; - this._valueLength = 0; - this._valuesToMeasure = []; - - CombinedStream.call(this); - - options = options || {}; - for (var option in options) { - this[option] = options[option]; + var expr = data; + var segments = jsonPointer.split('/'); + for (var i=0; i 0 : it.util.schemaHasRules($propertySch, it.RULES.all)))) { + $required[$required.length] = $property; + } + } + } + } else { + var $required = $schema; + } } -}; + if ($isData || $required.length) { + var $currentErrorPath = it.errorPath, + $loopRequired = $isData || $required.length >= it.opts.loopRequired, + $ownProperties = it.opts.ownProperties; + if ($breakOnError) { + out += ' var missing' + ($lvl) + '; '; + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + out += ' var ' + ($valid) + ' = true; '; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += '; if (!' + ($valid) + ') break; } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } else { + out += ' if ( '; + var arr2 = $required; + if (arr2) { + var $propertyKey, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $propertyKey = arr2[$i += 1]; + if ($i) { + out += ' || '; + } + var $prop = it.util.getProperty($propertyKey), + $useData = $data + $prop; + out += ' ( ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; + } + } + out += ') { '; + var $propertyPath = 'missing' + $lvl, + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } + } else { + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + if ($isData) { + out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; + if ($isData) { + out += ' } '; + } + } else { + var arr3 = $required; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $prop = it.util.getProperty($propertyKey), + $missingProperty = it.util.escapeQuotes($propertyKey), + $useData = $data + $prop; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; + } + } + } + } + it.errorPath = $currentErrorPath; + } else if ($breakOnError) { + out += ' if (true) {'; + } + return out; +} -FormData.prototype._lengthRetriever = function(value, callback) { - if (value.hasOwnProperty('fd')) { +/***/ }), - // take read range into a account - // `end` = Infinity –> read file till the end - // - // TODO: Looks like there is bug in Node fs.createReadStream - // it doesn't respect `end` options without `start` options - // Fix it when node fixes it. - // https://github.com/joyent/node/issues/7819 - if (value.end != undefined && value.end != Infinity && value.start != undefined) { +/***/ 866: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = { + read: read, + verify: verify, + sign: sign, + signAsync: signAsync, + write: write +}; + +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); +var Identity = __webpack_require__(378); +var Signature = __webpack_require__(575); +var Certificate = __webpack_require__(752); +var pkcs8 = __webpack_require__(707); - // when end specified - // no need to calculate range - // inclusive, starts with 0 - callback(null, value.end + 1 - (value.start ? value.start : 0)); +/* + * This file is based on RFC5280 (X.509). + */ - // not that fast snoopy - } else { - // still need to fetch file size from fs - fs.stat(value.path, function(err, stat) { +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); +} - var fileSize; +function verify(cert, key) { + var sig = cert.signatures.x509; + assert.object(sig, 'x509 signature'); - if (err) { - callback(err); - return; - } + var algParts = sig.algo.split('-'); + if (algParts[0] !== key.type) + return (false); - // update final size based on the range options - fileSize = stat.size - (value.start ? value.start : 0); - callback(null, fileSize); - }); - } + var blob = sig.cache; + if (blob === undefined) { + var der = new asn1.BerWriter(); + writeTBSCert(cert, der); + blob = der.buffer; + } - // or http response - } else if (value.hasOwnProperty('httpVersion')) { - callback(null, +value.headers['content-length']); + var verifier = key.createVerify(algParts[1]); + verifier.write(blob); + return (verifier.verify(sig.signature)); +} - // or request stream http://github.com/mikeal/request - } else if (value.hasOwnProperty('httpModule')) { - // wait till response come back - value.on('response', function(response) { - value.pause(); - callback(null, +response.headers['content-length']); - }); - value.resume(); +function Local(i) { + return (asn1.Ber.Context | asn1.Ber.Constructor | i); +} - // something else - } else { - callback('Unknown stream'); - } +function Context(i) { + return (asn1.Ber.Context | i); +} + +var SIGN_ALGS = { + 'rsa-md5': '1.2.840.113549.1.1.4', + 'rsa-sha1': '1.2.840.113549.1.1.5', + 'rsa-sha256': '1.2.840.113549.1.1.11', + 'rsa-sha384': '1.2.840.113549.1.1.12', + 'rsa-sha512': '1.2.840.113549.1.1.13', + 'dsa-sha1': '1.2.840.10040.4.3', + 'dsa-sha256': '2.16.840.1.101.3.4.3.2', + 'ecdsa-sha1': '1.2.840.10045.4.1', + 'ecdsa-sha256': '1.2.840.10045.4.3.2', + 'ecdsa-sha384': '1.2.840.10045.4.3.3', + 'ecdsa-sha512': '1.2.840.10045.4.3.4', + 'ed25519-sha512': '1.3.101.112' }; +Object.keys(SIGN_ALGS).forEach(function (k) { + SIGN_ALGS[SIGN_ALGS[k]] = k; +}); +SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; +SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; -FormData.prototype._multiPartHeader = function(field, value, options) { - // custom header specified (as string)? - // it becomes responsible for boundary - // (e.g. to handle extra CRLFs on .NET servers) - if (typeof options.header == 'string') { - return options.header; - } +var EXTS = { + 'issuerKeyId': '2.5.29.35', + 'altName': '2.5.29.17', + 'basicConstraints': '2.5.29.19', + 'keyUsage': '2.5.29.15', + 'extKeyUsage': '2.5.29.37' +}; - var contentDisposition = this._getContentDisposition(value, options); - var contentType = this._getContentType(value, options); +function read(buf, options) { + if (typeof (buf) === 'string') { + buf = Buffer.from(buf, 'binary'); + } + assert.buffer(buf, 'buf'); - var contents = ''; - var headers = { - // add custom disposition as third element or keep it two elements if not - 'Content-Disposition': ['form-data', 'name="' + field + '"'].concat(contentDisposition || []), - // if no content type. allow it to be empty array - 'Content-Type': [].concat(contentType || []) - }; + var der = new asn1.BerReader(buf); - // allow custom headers. - if (typeof options.header == 'object') { - populate(headers, options.header); - } + der.readSequence(); + if (Math.abs(der.length - der.remain) > 1) { + throw (new Error('DER sequence does not contain whole byte ' + + 'stream')); + } - var header; - for (var prop in headers) { - if (!headers.hasOwnProperty(prop)) continue; - header = headers[prop]; + var tbsStart = der.offset; + der.readSequence(); + var sigOffset = der.offset + der.length; + var tbsEnd = sigOffset; - // skip nullish headers. - if (header == null) { - continue; - } + if (der.peek() === Local(0)) { + der.readSequence(Local(0)); + var version = der.readInt(); + assert.ok(version <= 3, + 'only x.509 versions up to v3 supported'); + } - // convert all headers to arrays. - if (!Array.isArray(header)) { - header = [header]; - } + var cert = {}; + cert.signatures = {}; + var sig = (cert.signatures.x509 = {}); + sig.extras = {}; - // add non-empty headers. - if (header.length) { - contents += prop + ': ' + header.join('; ') + FormData.LINE_BREAK; - } - } + cert.serial = readMPInt(der, 'serial'); - return '--' + this.getBoundary() + FormData.LINE_BREAK + contents + FormData.LINE_BREAK; -}; + der.readSequence(); + var after = der.offset + der.length; + var certAlgOid = der.readOID(); + var certAlg = SIGN_ALGS[certAlgOid]; + if (certAlg === undefined) + throw (new Error('unknown signature algorithm ' + certAlgOid)); -FormData.prototype._getContentDisposition = function(value, options) { + der._offset = after; + cert.issuer = Identity.parseAsn1(der); - var filename - , contentDisposition - ; + der.readSequence(); + cert.validFrom = readDate(der); + cert.validUntil = readDate(der); - if (typeof options.filepath === 'string') { - // custom filepath for relative paths - filename = path.normalize(options.filepath).replace(/\\/g, '/'); - } else if (options.filename || value.name || value.path) { - // custom filename take precedence - // formidable and the browser add a name property - // fs- and request- streams have path property - filename = path.basename(options.filename || value.name || value.path); - } else if (value.readable && value.hasOwnProperty('httpVersion')) { - // or try http response - filename = path.basename(value.client._httpMessage.path); - } + cert.subjects = [Identity.parseAsn1(der)]; - if (filename) { - contentDisposition = 'filename="' + filename + '"'; - } + der.readSequence(); + after = der.offset + der.length; + cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); + der._offset = after; - return contentDisposition; -}; + /* issuerUniqueID */ + if (der.peek() === Local(1)) { + der.readSequence(Local(1)); + sig.extras.issuerUniqueID = + buf.slice(der.offset, der.offset + der.length); + der._offset += der.length; + } -FormData.prototype._getContentType = function(value, options) { + /* subjectUniqueID */ + if (der.peek() === Local(2)) { + der.readSequence(Local(2)); + sig.extras.subjectUniqueID = + buf.slice(der.offset, der.offset + der.length); + der._offset += der.length; + } - // use custom content-type above all - var contentType = options.contentType; + /* extensions */ + if (der.peek() === Local(3)) { + der.readSequence(Local(3)); + var extEnd = der.offset + der.length; + der.readSequence(); - // or try `name` from formidable, browser - if (!contentType && value.name) { - contentType = mime.lookup(value.name); - } + while (der.offset < extEnd) + readExtension(cert, buf, der); - // or try `path` from fs-, request- streams - if (!contentType && value.path) { - contentType = mime.lookup(value.path); - } + assert.strictEqual(der.offset, extEnd); + } - // or if it's http-reponse - if (!contentType && value.readable && value.hasOwnProperty('httpVersion')) { - contentType = value.headers['content-type']; - } + assert.strictEqual(der.offset, sigOffset); - // or guess it from the filepath or filename - if (!contentType && (options.filepath || options.filename)) { - contentType = mime.lookup(options.filepath || options.filename); - } + der.readSequence(); + after = der.offset + der.length; + var sigAlgOid = der.readOID(); + var sigAlg = SIGN_ALGS[sigAlgOid]; + if (sigAlg === undefined) + throw (new Error('unknown signature algorithm ' + sigAlgOid)); + der._offset = after; - // fallback to the default content type if `value` is not simple value - if (!contentType && typeof value == 'object') { - contentType = FormData.DEFAULT_CONTENT_TYPE; - } + var sigData = der.readString(asn1.Ber.BitString, true); + if (sigData[0] === 0) + sigData = sigData.slice(1); + var algParts = sigAlg.split('-'); - return contentType; -}; + sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); + sig.signature.hashAlgorithm = algParts[1]; + sig.algo = sigAlg; + sig.cache = buf.slice(tbsStart, tbsEnd); -FormData.prototype._multiPartFooter = function() { - return function(next) { - var footer = FormData.LINE_BREAK; + return (new Certificate(cert)); +} - var lastPart = (this._streams.length === 0); - if (lastPart) { - footer += this._lastBoundary(); - } +function readDate(der) { + if (der.peek() === asn1.Ber.UTCTime) { + return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); + } else if (der.peek() === asn1.Ber.GeneralizedTime) { + return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); + } else { + throw (new Error('Unsupported date format')); + } +} - next(footer); - }.bind(this); +function writeDate(der, date) { + if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { + der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); + } else { + der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); + } +} + +/* RFC5280, section 4.2.1.6 (GeneralName type) */ +var ALTNAME = { + OtherName: Local(0), + RFC822Name: Context(1), + DNSName: Context(2), + X400Address: Local(3), + DirectoryName: Local(4), + EDIPartyName: Local(5), + URI: Context(6), + IPAddress: Context(7), + OID: Context(8) }; -FormData.prototype._lastBoundary = function() { - return '--' + this.getBoundary() + '--' + FormData.LINE_BREAK; +/* RFC5280, section 4.2.1.12 (KeyPurposeId) */ +var EXTPURPOSE = { + 'serverAuth': '1.3.6.1.5.5.7.3.1', + 'clientAuth': '1.3.6.1.5.5.7.3.2', + 'codeSigning': '1.3.6.1.5.5.7.3.3', + + /* See https://github.com/joyent/oid-docs/blob/master/root.md */ + 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', + 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' }; +var EXTPURPOSE_REV = {}; +Object.keys(EXTPURPOSE).forEach(function (k) { + EXTPURPOSE_REV[EXTPURPOSE[k]] = k; +}); -FormData.prototype.getHeaders = function(userHeaders) { - var header; - var formHeaders = { - 'content-type': 'multipart/form-data; boundary=' + this.getBoundary() - }; +var KEYUSEBITS = [ + 'signature', 'identity', 'keyEncryption', + 'encryption', 'keyAgreement', 'ca', 'crl' +]; - for (header in userHeaders) { - if (userHeaders.hasOwnProperty(header)) { - formHeaders[header.toLowerCase()] = userHeaders[header]; - } - } +function readExtension(cert, buf, der) { + der.readSequence(); + var after = der.offset + der.length; + var extId = der.readOID(); + var id; + var sig = cert.signatures.x509; + if (!sig.extras.exts) + sig.extras.exts = []; - return formHeaders; -}; + var critical; + if (der.peek() === asn1.Ber.Boolean) + critical = der.readBoolean(); -FormData.prototype.getBoundary = function() { - if (!this._boundary) { - this._generateBoundary(); - } + switch (extId) { + case (EXTS.basicConstraints): + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + var bcEnd = der.offset + der.length; + var ca = false; + if (der.peek() === asn1.Ber.Boolean) + ca = der.readBoolean(); + if (cert.purposes === undefined) + cert.purposes = []; + if (ca === true) + cert.purposes.push('ca'); + var bc = { oid: extId, critical: critical }; + if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) + bc.pathLen = der.readInt(); + sig.extras.exts.push(bc); + break; + case (EXTS.extKeyUsage): + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + if (cert.purposes === undefined) + cert.purposes = []; + var ekEnd = der.offset + der.length; + while (der.offset < ekEnd) { + var oid = der.readOID(); + cert.purposes.push(EXTPURPOSE_REV[oid] || oid); + } + /* + * This is a bit of a hack: in the case where we have a cert + * that's only allowed to do serverAuth or clientAuth (and not + * the other), we want to make sure all our Subjects are of + * the right type. But we already parsed our Subjects and + * decided if they were hosts or users earlier (since it appears + * first in the cert). + * + * So we go through and mutate them into the right kind here if + * it doesn't match. This might not be hugely beneficial, as it + * seems that single-purpose certs are not often seen in the + * wild. + */ + if (cert.purposes.indexOf('serverAuth') !== -1 && + cert.purposes.indexOf('clientAuth') === -1) { + cert.subjects.forEach(function (ide) { + if (ide.type !== 'host') { + ide.type = 'host'; + ide.hostname = ide.uid || + ide.email || + ide.components[0].value; + } + }); + } else if (cert.purposes.indexOf('clientAuth') !== -1 && + cert.purposes.indexOf('serverAuth') === -1) { + cert.subjects.forEach(function (ide) { + if (ide.type !== 'user') { + ide.type = 'user'; + ide.uid = ide.hostname || + ide.email || + ide.components[0].value; + } + }); + } + sig.extras.exts.push({ oid: extId, critical: critical }); + break; + case (EXTS.keyUsage): + der.readSequence(asn1.Ber.OctetString); + var bits = der.readString(asn1.Ber.BitString, true); + var setBits = readBitField(bits, KEYUSEBITS); + setBits.forEach(function (bit) { + if (cert.purposes === undefined) + cert.purposes = []; + if (cert.purposes.indexOf(bit) === -1) + cert.purposes.push(bit); + }); + sig.extras.exts.push({ oid: extId, critical: critical, + bits: bits }); + break; + case (EXTS.altName): + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + var aeEnd = der.offset + der.length; + while (der.offset < aeEnd) { + switch (der.peek()) { + case ALTNAME.OtherName: + case ALTNAME.EDIPartyName: + der.readSequence(); + der._offset += der.length; + break; + case ALTNAME.OID: + der.readOID(ALTNAME.OID); + break; + case ALTNAME.RFC822Name: + /* RFC822 specifies email addresses */ + var email = der.readString(ALTNAME.RFC822Name); + id = Identity.forEmail(email); + if (!cert.subjects[0].equals(id)) + cert.subjects.push(id); + break; + case ALTNAME.DirectoryName: + der.readSequence(ALTNAME.DirectoryName); + id = Identity.parseAsn1(der); + if (!cert.subjects[0].equals(id)) + cert.subjects.push(id); + break; + case ALTNAME.DNSName: + var host = der.readString( + ALTNAME.DNSName); + id = Identity.forHost(host); + if (!cert.subjects[0].equals(id)) + cert.subjects.push(id); + break; + default: + der.readString(der.peek()); + break; + } + } + sig.extras.exts.push({ oid: extId, critical: critical }); + break; + default: + sig.extras.exts.push({ + oid: extId, + critical: critical, + data: der.readString(asn1.Ber.OctetString, true) + }); + break; + } - return this._boundary; -}; + der._offset = after; +} -FormData.prototype._generateBoundary = function() { - // This generates a 50 character boundary similar to those used by Firefox. - // They are optimized for boyer-moore parsing. - var boundary = '--------------------------'; - for (var i = 0; i < 24; i++) { - boundary += Math.floor(Math.random() * 10).toString(16); - } +var UTCTIME_RE = + /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; +function utcTimeToDate(t) { + var m = t.match(UTCTIME_RE); + assert.ok(m, 'timestamps must be in UTC'); + var d = new Date(); - this._boundary = boundary; -}; + var thisYear = d.getUTCFullYear(); + var century = Math.floor(thisYear / 100) * 100; -// Note: getLengthSync DOESN'T calculate streams length -// As workaround one can calculate file size manually -// and add it as knownLength option -FormData.prototype.getLengthSync = function() { - var knownLength = this._overheadLength + this._valueLength; + var year = parseInt(m[1], 10); + if (thisYear % 100 < 50 && year >= 60) + year += (century - 1); + else + year += century; + d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); + d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); + if (m[6] && m[6].length > 0) + d.setUTCSeconds(parseInt(m[6], 10)); + return (d); +} - // Don't get confused, there are 3 "internal" streams for each keyval pair - // so it basically checks if there is any value added to the form - if (this._streams.length) { - knownLength += this._lastBoundary().length; - } +var GTIME_RE = + /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; +function gTimeToDate(t) { + var m = t.match(GTIME_RE); + assert.ok(m); + var d = new Date(); - // https://github.com/form-data/form-data/issues/40 - if (!this.hasKnownLength()) { - // Some async length retrievers are present - // therefore synchronous length calculation is false. - // Please use getLength(callback) to get proper length - this._error(new Error('Cannot calculate proper length in synchronous way.')); - } + d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, + parseInt(m[3], 10)); + d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); + if (m[6] && m[6].length > 0) + d.setUTCSeconds(parseInt(m[6], 10)); + return (d); +} - return knownLength; -}; +function zeroPad(n, m) { + if (m === undefined) + m = 2; + var s = '' + n; + while (s.length < m) + s = '0' + s; + return (s); +} -// Public API to check if length of added values is known -// https://github.com/form-data/form-data/issues/196 -// https://github.com/form-data/form-data/issues/262 -FormData.prototype.hasKnownLength = function() { - var hasKnownLength = true; +function dateToUTCTime(d) { + var s = ''; + s += zeroPad(d.getUTCFullYear() % 100); + s += zeroPad(d.getUTCMonth() + 1); + s += zeroPad(d.getUTCDate()); + s += zeroPad(d.getUTCHours()); + s += zeroPad(d.getUTCMinutes()); + s += zeroPad(d.getUTCSeconds()); + s += 'Z'; + return (s); +} - if (this._valuesToMeasure.length) { - hasKnownLength = false; - } +function dateToGTime(d) { + var s = ''; + s += zeroPad(d.getUTCFullYear(), 4); + s += zeroPad(d.getUTCMonth() + 1); + s += zeroPad(d.getUTCDate()); + s += zeroPad(d.getUTCHours()); + s += zeroPad(d.getUTCMinutes()); + s += zeroPad(d.getUTCSeconds()); + s += 'Z'; + return (s); +} - return hasKnownLength; -}; +function sign(cert, key) { + if (cert.signatures.x509 === undefined) + cert.signatures.x509 = {}; + var sig = cert.signatures.x509; -FormData.prototype.getLength = function(cb) { - var knownLength = this._overheadLength + this._valueLength; + sig.algo = key.type + '-' + key.defaultHashAlgorithm(); + if (SIGN_ALGS[sig.algo] === undefined) + return (false); - if (this._streams.length) { - knownLength += this._lastBoundary().length; - } + var der = new asn1.BerWriter(); + writeTBSCert(cert, der); + var blob = der.buffer; + sig.cache = blob; - if (!this._valuesToMeasure.length) { - process.nextTick(cb.bind(this, null, knownLength)); - return; - } + var signer = key.createSign(); + signer.write(blob); + cert.signatures.x509.signature = signer.sign(); - asynckit.parallel(this._valuesToMeasure, this._lengthRetriever, function(err, values) { - if (err) { - cb(err); - return; - } + return (true); +} - values.forEach(function(length) { - knownLength += length; - }); +function signAsync(cert, signer, done) { + if (cert.signatures.x509 === undefined) + cert.signatures.x509 = {}; + var sig = cert.signatures.x509; - cb(null, knownLength); - }); -}; + var der = new asn1.BerWriter(); + writeTBSCert(cert, der); + var blob = der.buffer; + sig.cache = blob; -FormData.prototype.submit = function(params, cb) { - var request - , options - , defaults = {method: 'post'} - ; + signer(blob, function (err, signature) { + if (err) { + done(err); + return; + } + sig.algo = signature.type + '-' + signature.hashAlgorithm; + if (SIGN_ALGS[sig.algo] === undefined) { + done(new Error('Invalid signing algorithm "' + + sig.algo + '"')); + return; + } + sig.signature = signature; + done(); + }); +} - // parse provided url if it's string - // or treat it as options object - if (typeof params == 'string') { +function write(cert, options) { + var sig = cert.signatures.x509; + assert.object(sig, 'x509 signature'); - params = parseUrl(params); - options = populate({ - port: params.port, - path: params.pathname, - host: params.hostname, - protocol: params.protocol - }, defaults); + var der = new asn1.BerWriter(); + der.startSequence(); + if (sig.cache) { + der._ensure(sig.cache.length); + sig.cache.copy(der._buf, der._offset); + der._offset += sig.cache.length; + } else { + writeTBSCert(cert, der); + } - // use custom params - } else { + der.startSequence(); + der.writeOID(SIGN_ALGS[sig.algo]); + if (sig.algo.match(/^rsa-/)) + der.writeNull(); + der.endSequence(); - options = populate(params, defaults); - // if no port provided use default one - if (!options.port) { - options.port = options.protocol == 'https:' ? 443 : 80; - } - } + var sigData = sig.signature.toBuffer('asn1'); + var data = Buffer.alloc(sigData.length + 1); + data[0] = 0; + sigData.copy(data, 1); + der.writeBuffer(data, asn1.Ber.BitString); + der.endSequence(); - // put that good code in getHeaders to some use - options.headers = this.getHeaders(params.headers); + return (der.buffer); +} - // https if specified, fallback to http in any other case - if (options.protocol == 'https:') { - request = https.request(options); - } else { - request = http.request(options); - } +function writeTBSCert(cert, der) { + var sig = cert.signatures.x509; + assert.object(sig, 'x509 signature'); - // get content length and fire away - this.getLength(function(err, length) { - if (err) { - this._error(err); - return; - } + der.startSequence(); - // add content length - request.setHeader('Content-Length', length); + der.startSequence(Local(0)); + der.writeInt(2); + der.endSequence(); - this.pipe(request); - if (cb) { - request.on('error', cb); - request.on('response', cb.bind(this, null)); - } - }.bind(this)); + der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); - return request; -}; + der.startSequence(); + der.writeOID(SIGN_ALGS[sig.algo]); + if (sig.algo.match(/^rsa-/)) + der.writeNull(); + der.endSequence(); -FormData.prototype._error = function(err) { - if (!this.error) { - this.error = err; - this.pause(); - this.emit('error', err); - } -}; + cert.issuer.toAsn1(der); -FormData.prototype.toString = function () { - return '[object FormData]'; -}; + der.startSequence(); + writeDate(der, cert.validFrom); + writeDate(der, cert.validUntil); + der.endSequence(); + var subject = cert.subjects[0]; + var altNames = cert.subjects.slice(1); + subject.toAsn1(der); -/***/ }), + pkcs8.writePkcs8(der, cert.subjectKey); -/***/ 937: -/***/ (function(__unusedmodule, exports, __webpack_require__) { + if (sig.extras && sig.extras.issuerUniqueID) { + der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); + } -/* - * lib/jsprim.js: utilities for primitive JavaScript types - */ + if (sig.extras && sig.extras.subjectUniqueID) { + der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); + } -var mod_assert = __webpack_require__(976); -var mod_util = __webpack_require__(669); + if (altNames.length > 0 || subject.type === 'host' || + (cert.purposes !== undefined && cert.purposes.length > 0) || + (sig.extras && sig.extras.exts)) { + der.startSequence(Local(3)); + der.startSequence(); -var mod_extsprintf = __webpack_require__(988); -var mod_verror = __webpack_require__(546); -var mod_jsonschema = __webpack_require__(954); + var exts = []; + if (cert.purposes !== undefined && cert.purposes.length > 0) { + exts.push({ + oid: EXTS.basicConstraints, + critical: true + }); + exts.push({ + oid: EXTS.keyUsage, + critical: true + }); + exts.push({ + oid: EXTS.extKeyUsage, + critical: true + }); + } + exts.push({ oid: EXTS.altName }); + if (sig.extras && sig.extras.exts) + exts = sig.extras.exts; -/* - * Public interface - */ -exports.deepCopy = deepCopy; -exports.deepEqual = deepEqual; -exports.isEmpty = isEmpty; -exports.hasKey = hasKey; -exports.forEachKey = forEachKey; -exports.pluck = pluck; -exports.flattenObject = flattenObject; -exports.flattenIter = flattenIter; -exports.validateJsonObject = validateJsonObjectJS; -exports.validateJsonObjectJS = validateJsonObjectJS; -exports.randElt = randElt; -exports.extraProperties = extraProperties; -exports.mergeObjects = mergeObjects; + for (var i = 0; i < exts.length; ++i) { + der.startSequence(); + der.writeOID(exts[i].oid); -exports.startsWith = startsWith; -exports.endsWith = endsWith; + if (exts[i].critical !== undefined) + der.writeBoolean(exts[i].critical); -exports.parseInteger = parseInteger; + if (exts[i].oid === EXTS.altName) { + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + if (subject.type === 'host') { + der.writeString(subject.hostname, + Context(2)); + } + for (var j = 0; j < altNames.length; ++j) { + if (altNames[j].type === 'host') { + der.writeString( + altNames[j].hostname, + ALTNAME.DNSName); + } else if (altNames[j].type === + 'email') { + der.writeString( + altNames[j].email, + ALTNAME.RFC822Name); + } else { + /* + * Encode anything else as a + * DN style name for now. + */ + der.startSequence( + ALTNAME.DirectoryName); + altNames[j].toAsn1(der); + der.endSequence(); + } + } + der.endSequence(); + der.endSequence(); + } else if (exts[i].oid === EXTS.basicConstraints) { + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + var ca = (cert.purposes.indexOf('ca') !== -1); + var pathLen = exts[i].pathLen; + der.writeBoolean(ca); + if (pathLen !== undefined) + der.writeInt(pathLen); + der.endSequence(); + der.endSequence(); + } else if (exts[i].oid === EXTS.extKeyUsage) { + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + cert.purposes.forEach(function (purpose) { + if (purpose === 'ca') + return; + if (KEYUSEBITS.indexOf(purpose) !== -1) + return; + var oid = purpose; + if (EXTPURPOSE[purpose] !== undefined) + oid = EXTPURPOSE[purpose]; + der.writeOID(oid); + }); + der.endSequence(); + der.endSequence(); + } else if (exts[i].oid === EXTS.keyUsage) { + der.startSequence(asn1.Ber.OctetString); + /* + * If we parsed this certificate from a byte + * stream (i.e. we didn't generate it in sshpk) + * then we'll have a ".bits" property on the + * ext with the original raw byte contents. + * + * If we have this, use it here instead of + * regenerating it. This guarantees we output + * the same data we parsed, so signatures still + * validate. + */ + if (exts[i].bits !== undefined) { + der.writeBuffer(exts[i].bits, + asn1.Ber.BitString); + } else { + var bits = writeBitField(cert.purposes, + KEYUSEBITS); + der.writeBuffer(bits, + asn1.Ber.BitString); + } + der.endSequence(); + } else { + der.writeBuffer(exts[i].data, + asn1.Ber.OctetString); + } -exports.iso8601 = iso8601; -exports.rfc1123 = rfc1123; -exports.parseDateTime = parseDateTime; + der.endSequence(); + } -exports.hrtimediff = hrtimeDiff; -exports.hrtimeDiff = hrtimeDiff; -exports.hrtimeAccum = hrtimeAccum; -exports.hrtimeAdd = hrtimeAdd; -exports.hrtimeNanosec = hrtimeNanosec; -exports.hrtimeMicrosec = hrtimeMicrosec; -exports.hrtimeMillisec = hrtimeMillisec; + der.endSequence(); + der.endSequence(); + } + der.endSequence(); +} /* - * Deep copy an acyclic *basic* Javascript object. This only handles basic - * scalars (strings, numbers, booleans) and arbitrarily deep arrays and objects - * containing these. This does *not* handle instances of other classes. + * Reads an ASN.1 BER bitfield out of the Buffer produced by doing + * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw + * contents of the BitString tag, which is a count of unused bits followed by + * the bits as a right-padded byte string. + * + * `bits` is the Buffer, `bitIndex` should contain an array of string names + * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. + * + * Returns an array of Strings, the names of the bits that were set to 1. */ -function deepCopy(obj) -{ - var ret, key; - var marker = '__deepCopy'; - - if (obj && obj[marker]) - throw (new Error('attempted deep copy of cyclic object')); - - if (obj && obj.constructor == Object) { - ret = {}; - obj[marker] = true; - - for (key in obj) { - if (key == marker) - continue; - - ret[key] = deepCopy(obj[key]); +function readBitField(bits, bitIndex) { + var bitLen = 8 * (bits.length - 1) - bits[0]; + var setBits = {}; + for (var i = 0; i < bitLen; ++i) { + var byteN = 1 + Math.floor(i / 8); + var bit = 7 - (i % 8); + var mask = 1 << bit; + var bitVal = ((bits[byteN] & mask) !== 0); + var name = bitIndex[i]; + if (bitVal && typeof (name) === 'string') { + setBits[name] = true; } + } + return (Object.keys(setBits)); +} - delete (obj[marker]); - return (ret); +/* + * `setBits` is an array of strings, containing the names for each bit that + * sould be set to 1. `bitIndex` is same as in `readBitField()`. + * + * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. + */ +function writeBitField(setBits, bitIndex) { + var bitLen = bitIndex.length; + var blen = Math.ceil(bitLen / 8); + var unused = blen * 8 - bitLen; + var bits = Buffer.alloc(1 + blen); // zero-filled + bits[0] = unused; + for (var i = 0; i < bitLen; ++i) { + var byteN = 1 + Math.floor(i / 8); + var bit = 7 - (i % 8); + var mask = 1 << bit; + var name = bitIndex[i]; + if (name === undefined) + continue; + var bitVal = (setBits.indexOf(name) !== -1); + if (bitVal) { + bits[byteN] |= mask; + } } + return (bits); +} - if (obj && obj.constructor == Array) { - ret = []; - obj[marker] = true; - for (key = 0; key < obj.length; key++) - ret.push(deepCopy(obj[key])); +/***/ }), - delete (obj[marker]); - return (ret); - } +/***/ 867: +/***/ (function(module, __unusedexports, __webpack_require__) { - /* - * It must be a primitive type -- just return it. - */ - return (obj); -} +"use strict"; -function deepEqual(obj1, obj2) -{ - if (typeof (obj1) != typeof (obj2)) - return (false); - if (obj1 === null || obj2 === null || typeof (obj1) != 'object') - return (obj1 === obj2); +var URI = __webpack_require__(853) + , equal = __webpack_require__(832) + , util = __webpack_require__(855) + , SchemaObject = __webpack_require__(955) + , traverse = __webpack_require__(340); - if (obj1.constructor != obj2.constructor) - return (false); +module.exports = resolve; - var k; - for (k in obj1) { - if (!obj2.hasOwnProperty(k)) - return (false); +resolve.normalizeId = normalizeId; +resolve.fullPath = getFullPath; +resolve.url = resolveUrl; +resolve.ids = resolveIds; +resolve.inlineRef = inlineRef; +resolve.schema = resolveSchema; - if (!deepEqual(obj1[k], obj2[k])) - return (false); - } +/** + * [resolve and compile the references ($ref)] + * @this Ajv + * @param {Function} compile reference to schema compilation funciton (localCompile) + * @param {Object} root object with information about the root schema for the current schema + * @param {String} ref reference to resolve + * @return {Object|Function} schema object (if the schema can be inlined) or validation function + */ +function resolve(compile, root, ref) { + /* jshint validthis: true */ + var refVal = this._refs[ref]; + if (typeof refVal == 'string') { + if (this._refs[refVal]) refVal = this._refs[refVal]; + else return resolve.call(this, compile, root, refVal); + } - for (k in obj2) { - if (!obj1.hasOwnProperty(k)) - return (false); - } + refVal = refVal || this._schemas[ref]; + if (refVal instanceof SchemaObject) { + return inlineRef(refVal.schema, this._opts.inlineRefs) + ? refVal.schema + : refVal.validate || this._compile(refVal); + } - return (true); -} + var res = resolveSchema.call(this, root, ref); + var schema, v, baseId; + if (res) { + schema = res.schema; + root = res.root; + baseId = res.baseId; + } -function isEmpty(obj) -{ - var key; - for (key in obj) - return (false); - return (true); -} + if (schema instanceof SchemaObject) { + v = schema.validate || compile.call(this, schema.schema, root, undefined, baseId); + } else if (schema !== undefined) { + v = inlineRef(schema, this._opts.inlineRefs) + ? schema + : compile.call(this, schema, root, undefined, baseId); + } -function hasKey(obj, key) -{ - mod_assert.equal(typeof (key), 'string'); - return (Object.prototype.hasOwnProperty.call(obj, key)); + return v; } -function forEachKey(obj, callback) -{ - for (var key in obj) { - if (hasKey(obj, key)) { - callback(key, obj[key]); - } - } -} -function pluck(obj, key) -{ - mod_assert.equal(typeof (key), 'string'); - return (pluckv(obj, key)); +/** + * Resolve schema, its root and baseId + * @this Ajv + * @param {Object} root root object with properties schema, refVal, refs + * @param {String} ref reference to resolve + * @return {Object} object with properties schema, root, baseId + */ +function resolveSchema(root, ref) { + /* jshint validthis: true */ + var p = URI.parse(ref) + , refPath = _getFullPath(p) + , baseId = getFullPath(this._getId(root.schema)); + if (Object.keys(root.schema).length === 0 || refPath !== baseId) { + var id = normalizeId(refPath); + var refVal = this._refs[id]; + if (typeof refVal == 'string') { + return resolveRecursive.call(this, root, refVal, p); + } else if (refVal instanceof SchemaObject) { + if (!refVal.validate) this._compile(refVal); + root = refVal; + } else { + refVal = this._schemas[id]; + if (refVal instanceof SchemaObject) { + if (!refVal.validate) this._compile(refVal); + if (id == normalizeId(ref)) + return { schema: refVal, root: root, baseId: baseId }; + root = refVal; + } else { + return; + } + } + if (!root.schema) return; + baseId = getFullPath(this._getId(root.schema)); + } + return getJsonPointer.call(this, p, baseId, root.schema, root); } -function pluckv(obj, key) -{ - if (obj === null || typeof (obj) !== 'object') - return (undefined); - - if (obj.hasOwnProperty(key)) - return (obj[key]); - - var i = key.indexOf('.'); - if (i == -1) - return (undefined); - - var key1 = key.substr(0, i); - if (!obj.hasOwnProperty(key1)) - return (undefined); - return (pluckv(obj[key1], key.substr(i + 1))); +/* @this Ajv */ +function resolveRecursive(root, ref, parsedRef) { + /* jshint validthis: true */ + var res = resolveSchema.call(this, root, ref); + if (res) { + var schema = res.schema; + var baseId = res.baseId; + root = res.root; + var id = this._getId(schema); + if (id) baseId = resolveUrl(baseId, id); + return getJsonPointer.call(this, parsedRef, baseId, schema, root); + } } -/* - * Invoke callback(row) for each entry in the array that would be returned by - * flattenObject(data, depth). This is just like flattenObject(data, - * depth).forEach(callback), except that the intermediate array is never - * created. - */ -function flattenIter(data, depth, callback) -{ - doFlattenIter(data, depth, [], callback); -} -function doFlattenIter(data, depth, accum, callback) -{ - var each; - var key; +var PREVENT_SCOPE_CHANGE = util.toHash(['properties', 'patternProperties', 'enum', 'dependencies', 'definitions']); +/* @this Ajv */ +function getJsonPointer(parsedRef, baseId, schema, root) { + /* jshint validthis: true */ + parsedRef.fragment = parsedRef.fragment || ''; + if (parsedRef.fragment.slice(0,1) != '/') return; + var parts = parsedRef.fragment.split('/'); - if (depth === 0) { - each = accum.slice(0); - each.push(data); - callback(each); - return; - } + for (var i = 1; i < parts.length; i++) { + var part = parts[i]; + if (part) { + part = util.unescapeFragment(part); + schema = schema[part]; + if (schema === undefined) break; + var id; + if (!PREVENT_SCOPE_CHANGE[part]) { + id = this._getId(schema); + if (id) baseId = resolveUrl(baseId, id); + if (schema.$ref) { + var $ref = resolveUrl(baseId, schema.$ref); + var res = resolveSchema.call(this, root, $ref); + if (res) { + schema = res.schema; + root = res.root; + baseId = res.baseId; + } + } + } + } + } + if (schema !== undefined && schema !== root.schema) + return { schema: schema, root: root, baseId: baseId }; +} - mod_assert.ok(data !== null); - mod_assert.equal(typeof (data), 'object'); - mod_assert.equal(typeof (depth), 'number'); - mod_assert.ok(depth >= 0); - for (key in data) { - each = accum.slice(0); - each.push(key); - doFlattenIter(data[key], depth - 1, each, callback); - } +var SIMPLE_INLINED = util.toHash([ + 'type', 'format', 'pattern', + 'maxLength', 'minLength', + 'maxProperties', 'minProperties', + 'maxItems', 'minItems', + 'maximum', 'minimum', + 'uniqueItems', 'multipleOf', + 'required', 'enum' +]); +function inlineRef(schema, limit) { + if (limit === false) return false; + if (limit === undefined || limit === true) return checkNoRef(schema); + else if (limit) return countKeys(schema) <= limit; } -function flattenObject(data, depth) -{ - if (depth === 0) - return ([ data ]); - - mod_assert.ok(data !== null); - mod_assert.equal(typeof (data), 'object'); - mod_assert.equal(typeof (depth), 'number'); - mod_assert.ok(depth >= 0); - var rv = []; - var key; +function checkNoRef(schema) { + var item; + if (Array.isArray(schema)) { + for (var i=0; i= 2, 'options.base >= 2'); - mod_assert.ok(options.base <= 36, 'options.base <= 36'); - mod_assert.bool(options.allowSign, 'options.allowSign'); - mod_assert.bool(options.allowPrefix, 'options.allowPrefix'); - mod_assert.bool(options.allowTrailing, - 'options.allowTrailing'); - mod_assert.bool(options.allowImprecise, - 'options.allowImprecise'); - mod_assert.bool(options.trimWhitespace, - 'options.trimWhitespace'); - mod_assert.bool(options.leadingZeroIsOctal, - 'options.leadingZeroIsOctal'); +var util = __webpack_require__(855); - if (options.leadingZeroIsOctal) { - mod_assert.ok(!baseOverride, - '"base" and "leadingZeroIsOctal" are ' + - 'mutually exclusive'); - } - } +var DATE = /^(\d\d\d\d)-(\d\d)-(\d\d)$/; +var DAYS = [0,31,28,31,30,31,30,31,31,30,31,30,31]; +var TIME = /^(\d\d):(\d\d):(\d\d)(\.\d+)?(z|[+-]\d\d:\d\d)?$/i; +var HOSTNAME = /^[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[-0-9a-z]{0,61}[0-9a-z])?)*$/i; +var URI = /^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*)(?:\?(?:[a-z0-9\-._~!$&'()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i; +var URIREF = /^(?:[a-z][a-z0-9+\-.]*:)?(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'"()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?(?:\?(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i; +// uri-template: https://tools.ietf.org/html/rfc6570 +var URITEMPLATE = /^(?:(?:[^\x00-\x20"'<>%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; +// For the source: https://gist.github.com/dperini/729294 +// For test cases: https://mathiasbynens.be/demo/url-regex +// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. +// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; +var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; +var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; +var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; +var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; +var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; - var c; - var pbase = -1; - var base = options.base; - var start; - var mult = 1; - var value = 0; - var idx = 0; - var len = str.length; - /* Trim any whitespace on the left side. */ - if (options.trimWhitespace) { - while (idx < len && isSpace(str.charCodeAt(idx))) { - ++idx; - } - } +module.exports = formats; - /* Check the number for a leading sign. */ - if (options.allowSign) { - if (str[idx] === '-') { - idx += 1; - mult = -1; - } else if (str[idx] === '+') { - idx += 1; - } - } +function formats(mode) { + mode = mode == 'full' ? 'full' : 'fast'; + return util.copy(formats[mode]); +} - /* Parse the base-indicating prefix if there is one. */ - if (str[idx] === '0') { - if (options.allowPrefix) { - pbase = prefixToBase(str.charCodeAt(idx + 1)); - if (pbase !== -1 && (!baseOverride || pbase === base)) { - base = pbase; - idx += 2; - } - } - if (pbase === -1 && options.leadingZeroIsOctal) { - base = 8; - } - } +formats.fast = { + // date: http://tools.ietf.org/html/rfc3339#section-5.6 + date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, + // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 + time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d:\d\d)?$/i, + 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d:\d\d)$/i, + // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js + uri: /^(?:[a-z][a-z0-9+-.]*:)(?:\/?\/)?[^\s]*$/i, + 'uri-reference': /^(?:(?:[a-z][a-z0-9+-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, + 'uri-template': URITEMPLATE, + url: URL, + // email (sources from jsen validator): + // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 + // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') + email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, + hostname: HOSTNAME, + // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + // uuid: http://tools.ietf.org/html/rfc4122 + uuid: UUID, + // JSON-pointer: https://tools.ietf.org/html/rfc6901 + // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; - /* Parse the actual digits. */ - for (start = idx; idx < len; ++idx) { - c = translateDigit(str.charCodeAt(idx)); - if (c !== -1 && c < base) { - value *= base; - value += c; - } else { - break; - } - } - /* If we didn't parse any digits, we have an invalid number. */ - if (start === idx) { - return (new Error('invalid number: ' + JSON.stringify(str))); - } +formats.full = { + date: date, + time: time, + 'date-time': date_time, + uri: uri, + 'uri-reference': URIREF, + 'uri-template': URITEMPLATE, + url: URL, + email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, + hostname: hostname, + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + uuid: UUID, + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; - /* Trim any whitespace on the right side. */ - if (options.trimWhitespace) { - while (idx < len && isSpace(str.charCodeAt(idx))) { - ++idx; - } - } - /* Check for trailing characters. */ - if (idx < len && !options.allowTrailing) { - return (new Error('trailing characters after number: ' + - JSON.stringify(str.slice(idx)))); - } +function isLeapYear(year) { + // https://tools.ietf.org/html/rfc3339#appendix-C + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +} - /* If our value is 0, we return now, to avoid returning -0. */ - if (value === 0) { - return (0); - } - /* Calculate our final value. */ - var result = value * mult; +function date(str) { + // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 + var matches = str.match(DATE); + if (!matches) return false; - /* - * If the string represents a value that cannot be precisely represented - * by JavaScript, then we want to check that: - * - * - We never increased the value past MAX_SAFE_INTEGER - * - We don't make the result negative and below MIN_SAFE_INTEGER - * - * Because we only ever increment the value during parsing, there's no - * chance of moving past MAX_SAFE_INTEGER and then dropping below it - * again, losing precision in the process. This means that we only need - * to do our checks here, at the end. - */ - if (!options.allowImprecise && - (value > MAX_SAFE_INTEGER || result < MIN_SAFE_INTEGER)) { - return (new Error('number is outside of the supported range: ' + - JSON.stringify(str.slice(start, idx)))); - } + var year = +matches[1]; + var month = +matches[2]; + var day = +matches[3]; - return (result); + return month >= 1 && month <= 12 && day >= 1 && + day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); } -/* - * Interpret a character code as a base-36 digit. - */ -function translateDigit(d) -{ - if (d >= CP_0 && d <= CP_9) { - /* '0' to '9' -> 0 to 9 */ - return (d - PI_CONV_DEC); - } else if (d >= CP_A && d <= CP_Z) { - /* 'A' - 'Z' -> 10 to 35 */ - return (d - PI_CONV_UC); - } else if (d >= CP_a && d <= CP_z) { - /* 'a' - 'z' -> 10 to 35 */ - return (d - PI_CONV_LC); - } else { - /* Invalid character code */ - return (-1); - } +function time(str, full) { + var matches = str.match(TIME); + if (!matches) return false; + + var hour = matches[1]; + var minute = matches[2]; + var second = matches[3]; + var timeZone = matches[5]; + return ((hour <= 23 && minute <= 59 && second <= 59) || + (hour == 23 && minute == 59 && second == 60)) && + (!full || timeZone); } -/* - * Test if a value matches the ECMAScript definition of trimmable whitespace. - */ -function isSpace(c) -{ - return (c === 0x20) || - (c >= 0x0009 && c <= 0x000d) || - (c === 0x00a0) || - (c === 0x1680) || - (c === 0x180e) || - (c >= 0x2000 && c <= 0x200a) || - (c === 0x2028) || - (c === 0x2029) || - (c === 0x202f) || - (c === 0x205f) || - (c === 0x3000) || - (c === 0xfeff); +var DATE_TIME_SEPARATOR = /t|\s/i; +function date_time(str) { + // http://tools.ietf.org/html/rfc3339#section-5.6 + var dateTime = str.split(DATE_TIME_SEPARATOR); + return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); } -/* - * Determine which base a character indicates (e.g., 'x' indicates hex). - */ -function prefixToBase(c) -{ - if (c === CP_b || c === CP_B) { - /* 0b/0B (binary) */ - return (2); - } else if (c === CP_o || c === CP_O) { - /* 0o/0O (octal) */ - return (8); - } else if (c === CP_t || c === CP_T) { - /* 0t/0T (decimal) */ - return (10); - } else if (c === CP_x || c === CP_X) { - /* 0x/0X (hexadecimal) */ - return (16); - } else { - /* Not a meaningful character */ - return (-1); - } +function hostname(str) { + // https://tools.ietf.org/html/rfc1034#section-3.5 + // https://tools.ietf.org/html/rfc1123#section-2 + return str.length <= 255 && HOSTNAME.test(str); } -function validateJsonObjectJS(schema, input) -{ - var report = mod_jsonschema.validate(input, schema); +var NOT_URI_FRAGMENT = /\/|:/; +function uri(str) { + // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." + return NOT_URI_FRAGMENT.test(str) && URI.test(str); +} - if (report.errors.length === 0) - return (null); - /* Currently, we only do anything useful with the first error. */ - var error = report.errors[0]; +var Z_ANCHOR = /[^\\]\\Z/; +function regex(str) { + if (Z_ANCHOR.test(str)) return false; + try { + new RegExp(str); + return true; + } catch(e) { + return false; + } +} - /* The failed property is given by a URI with an irrelevant prefix. */ - var propname = error['property']; - var reason = error['message'].toLowerCase(); - var i, j; - /* - * There's at least one case where the property error message is - * confusing at best. We work around this here. - */ - if ((i = reason.indexOf('the property ')) != -1 && - (j = reason.indexOf(' is not defined in the schema and the ' + - 'schema does not allow additional properties')) != -1) { - i += 'the property '.length; - if (propname === '') - propname = reason.substr(i, j - i); - else - propname = propname + '.' + reason.substr(i, j - i); +/***/ }), - reason = 'unsupported property'; - } +/***/ 883: +/***/ (function(module) { - var rv = new mod_verror.VError('property "%s": %s', propname, reason); - rv.jsv_details = error; - return (rv); -} +module.exports = {"$id":"header.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"comment":{"type":"string"}}}; -function randElt(arr) -{ - mod_assert.ok(Array.isArray(arr) && arr.length > 0, - 'randElt argument must be a non-empty array'); +/***/ }), - return (arr[Math.floor(Math.random() * arr.length)]); -} +/***/ 886: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -function assertHrtime(a) +var crypto = __webpack_require__(417); +var BigInteger = __webpack_require__(242).BigInteger; +var ECPointFp = __webpack_require__(729).ECPointFp; +var Buffer = __webpack_require__(215).Buffer; +exports.ECCurves = __webpack_require__(959); + +// zero prepad +function unstupid(hex,len) { - mod_assert.ok(a[0] >= 0 && a[1] >= 0, - 'negative numbers not allowed in hrtimes'); - mod_assert.ok(a[1] < 1e9, 'nanoseconds column overflow'); + return (hex.length >= len) ? hex : unstupid("0"+hex,len); } -/* - * Compute the time elapsed between hrtime readings A and B, where A is later - * than B. hrtime readings come from Node's process.hrtime(). There is no - * defined way to represent negative deltas, so it's illegal to diff B from A - * where the time denoted by B is later than the time denoted by A. If this - * becomes valuable, we can define a representation and extend the - * implementation to support it. - */ -function hrtimeDiff(a, b) +exports.ECKey = function(curve, key, isPublic) { - assertHrtime(a); - assertHrtime(b); - mod_assert.ok(a[0] > b[0] || (a[0] == b[0] && a[1] >= b[1]), - 'negative differences not allowed'); + var priv; + var c = curve(); + var n = c.getN(); + var bytes = Math.floor(n.bitLength()/8); - var rv = [ a[0] - b[0], 0 ]; + if(key) + { + if(isPublic) + { + var curve = c.getCurve(); +// var x = key.slice(1,bytes+1); // skip the 04 for uncompressed format +// var y = key.slice(bytes+1); +// this.P = new ECPointFp(curve, +// curve.fromBigInteger(new BigInteger(x.toString("hex"), 16)), +// curve.fromBigInteger(new BigInteger(y.toString("hex"), 16))); + this.P = curve.decodePointHex(key.toString("hex")); + }else{ + if(key.length != bytes) return false; + priv = new BigInteger(key.toString("hex"), 16); + } + }else{ + var n1 = n.subtract(BigInteger.ONE); + var r = new BigInteger(crypto.randomBytes(n.bitLength())); + priv = r.mod(n1).add(BigInteger.ONE); + this.P = c.getG().multiply(priv); + } + if(this.P) + { +// var pubhex = unstupid(this.P.getX().toBigInteger().toString(16),bytes*2)+unstupid(this.P.getY().toBigInteger().toString(16),bytes*2); +// this.PublicKey = Buffer.from("04"+pubhex,"hex"); + this.PublicKey = Buffer.from(c.getCurve().encodeCompressedPointHex(this.P),"hex"); + } + if(priv) + { + this.PrivateKey = Buffer.from(unstupid(priv.toString(16),bytes*2),"hex"); + this.deriveSharedSecret = function(key) + { + if(!key || !key.P) return false; + var S = key.P.multiply(priv); + return Buffer.from(unstupid(S.getX().toBigInteger().toString(16),bytes*2),"hex"); + } + } +} - if (a[1] >= b[1]) { - rv[1] = a[1] - b[1]; - } else { - rv[0]--; - rv[1] = 1e9 - (b[1] - a[1]); - } - return (rv); -} -/* - * Convert a hrtime reading from the array format returned by Node's - * process.hrtime() into a scalar number of nanoseconds. - */ -function hrtimeNanosec(a) -{ - assertHrtime(a); +/***/ }), - return (Math.floor(a[0] * 1e9 + a[1])); -} +/***/ 890: +/***/ (function(module, __unusedexports, __webpack_require__) { -/* - * Convert a hrtime reading from the array format returned by Node's - * process.hrtime() into a scalar number of microseconds. - */ -function hrtimeMicrosec(a) -{ - assertHrtime(a); +"use strict"; - return (Math.floor(a[0] * 1e6 + a[1] / 1e3)); -} -/* - * Convert a hrtime reading from the array format returned by Node's - * process.hrtime() into a scalar number of milliseconds. - */ -function hrtimeMillisec(a) -{ - assertHrtime(a); +var MissingRefError = __webpack_require__(844).MissingRef; - return (Math.floor(a[0] * 1e3 + a[1] / 1e6)); -} +module.exports = compileAsync; -/* - * Add two hrtime readings A and B, overwriting A with the result of the - * addition. This function is useful for accumulating several hrtime intervals - * into a counter. Returns A. + +/** + * Creates validating function for passed schema with asynchronous loading of missing schemas. + * `loadSchema` option should be a function that accepts schema uri and returns promise that resolves with the schema. + * @this Ajv + * @param {Object} schema schema object + * @param {Boolean} meta optional true to compile meta-schema; this parameter can be skipped + * @param {Function} callback an optional node-style callback, it is called with 2 parameters: error (or null) and validating function. + * @return {Promise} promise that resolves with a validating function. */ -function hrtimeAccum(a, b) -{ - assertHrtime(a); - assertHrtime(b); +function compileAsync(schema, meta, callback) { + /* eslint no-shadow: 0 */ + /* global Promise */ + /* jshint validthis: true */ + var self = this; + if (typeof this._opts.loadSchema != 'function') + throw new Error('options.loadSchema should be a function'); - /* - * Accumulate the nanosecond component. - */ - a[1] += b[1]; - if (a[1] >= 1e9) { - /* - * The nanosecond component overflowed, so carry to the seconds - * field. - */ - a[0]++; - a[1] -= 1e9; - } + if (typeof meta == 'function') { + callback = meta; + meta = undefined; + } - /* - * Accumulate the seconds component. - */ - a[0] += b[0]; + var p = loadMetaSchemaOf(schema).then(function () { + var schemaObj = self._addSchema(schema, undefined, meta); + return schemaObj.validate || _compileAsync(schemaObj); + }); - return (a); -} + if (callback) { + p.then( + function(v) { callback(null, v); }, + callback + ); + } -/* - * Add two hrtime readings A and B, returning the result as a new hrtime array. - * Does not modify either input argument. - */ -function hrtimeAdd(a, b) -{ - assertHrtime(a); + return p; - var rv = [ a[0], a[1] ]; - return (hrtimeAccum(rv, b)); -} + function loadMetaSchemaOf(sch) { + var $schema = sch.$schema; + return $schema && !self.getSchema($schema) + ? compileAsync.call(self, { $ref: $schema }, true) + : Promise.resolve(); + } -/* - * Check an object for unexpected properties. Accepts the object to check, and - * an array of allowed property names (strings). Returns an array of key names - * that were found on the object, but did not appear in the list of allowed - * properties. If no properties were found, the returned array will be of - * zero length. - */ -function extraProperties(obj, allowed) -{ - mod_assert.ok(typeof (obj) === 'object' && obj !== null, - 'obj argument must be a non-null object'); - mod_assert.ok(Array.isArray(allowed), - 'allowed argument must be an array of strings'); - for (var i = 0; i < allowed.length; i++) { - mod_assert.ok(typeof (allowed[i]) === 'string', - 'allowed argument must be an array of strings'); - } + function _compileAsync(schemaObj) { + try { return self._compile(schemaObj); } + catch(e) { + if (e instanceof MissingRefError) return loadMissingSchema(e); + throw e; + } - return (Object.keys(obj).filter(function (key) { - return (allowed.indexOf(key) === -1); - })); -} -/* - * Given three sets of properties "provided" (may be undefined), "overrides" - * (required), and "defaults" (may be undefined), construct an object containing - * the union of these sets with "overrides" overriding "provided", and - * "provided" overriding "defaults". None of the input objects are modified. - */ -function mergeObjects(provided, overrides, defaults) -{ - var rv, k; + function loadMissingSchema(e) { + var ref = e.missingSchema; + if (added(ref)) throw new Error('Schema ' + ref + ' is loaded but ' + e.missingRef + ' cannot be resolved'); - rv = {}; - if (defaults) { - for (k in defaults) - rv[k] = defaults[k]; - } + var schemaPromise = self._loadingSchemas[ref]; + if (!schemaPromise) { + schemaPromise = self._loadingSchemas[ref] = self._opts.loadSchema(ref); + schemaPromise.then(removePromise, removePromise); + } - if (provided) { - for (k in provided) - rv[k] = provided[k]; - } + return schemaPromise.then(function (sch) { + if (!added(ref)) { + return loadMetaSchemaOf(sch).then(function () { + if (!added(ref)) self.addSchema(sch, ref, undefined, meta); + }); + } + }).then(function() { + return _compileAsync(schemaObj); + }); - if (overrides) { - for (k in overrides) - rv[k] = overrides[k]; - } + function removePromise() { + delete self._loadingSchemas[ref]; + } - return (rv); + function added(ref) { + return self._refs[ref] || self._schemas[ref]; + } + } + } } /***/ }), -/***/ 944: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 892: +/***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. +var iterate = __webpack_require__(157) + , initState = __webpack_require__(147) + , terminator = __webpack_require__(939) + ; + +// Public API +module.exports = serialOrdered; +// sorting helpers +module.exports.ascending = ascending; +module.exports.descending = descending; + +/** + * Runs iterator over provided sorted array elements in series * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator */ +function serialOrdered(list, iterator, sortMethod, callback) +{ + var state = initState(list, sortMethod); + + iterate(list, iterator, state, function iteratorHandler(error, result) + { + if (error) + { + callback(error, result); + return; + } + + state.index++; + + // are we there yet? + if (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, iteratorHandler); + return; + } + + // done here + callback(null, state.results); + }); -var net = __webpack_require__(631); -var urlParse = __webpack_require__(835).parse; -var util = __webpack_require__(669); -var pubsuffix = __webpack_require__(783); -var Store = __webpack_require__(895).Store; -var MemoryCookieStore = __webpack_require__(415).MemoryCookieStore; -var pathMatch = __webpack_require__(560).pathMatch; -var VERSION = __webpack_require__(813).version; + return terminator.bind(state, callback); +} -var punycode; -try { - punycode = __webpack_require__(213); -} catch(e) { - console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); +/* + * -- Sort methods + */ + +/** + * sort helper to sort array elements in ascending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function ascending(a, b) +{ + return a < b ? -1 : a > b ? 1 : 0; } -// From RFC6265 S4.1.1 -// note that it excludes \x3B ";" -var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; +/** + * sort helper to sort array elements in descending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function descending(a, b) +{ + return -1 * ascending(a, b); +} -var CONTROL_CHARS = /[\x00-\x1F]/; -// From Chromium // '\r', '\n' and '\0' should be treated as a terminator in -// the "relaxed" mode, see: -// https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 -var TERMINATORS = ['\n', '\r', '\0']; +/***/ }), -// RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' -// Note ';' is \x3B -var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; +/***/ 893: +/***/ (function(module, __unusedexports, __webpack_require__) { -// date-time parsing constants (RFC6265 S5.1.1) +// Copyright 2017 Joyent, Inc. -var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; +module.exports = { + read: read, + verify: verify, + sign: sign, + signAsync: signAsync, + write: write, -var MONTH_TO_NUM = { - jan:0, feb:1, mar:2, apr:3, may:4, jun:5, - jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 + /* Internal private API */ + fromBuffer: fromBuffer, + toBuffer: toBuffer }; -var NUM_TO_MONTH = [ - 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' -]; -var NUM_TO_DAY = [ - 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' -]; -var MAX_TIME = 2147483647000; // 31-bit max -var MIN_TIME = 0; // 31-bit min +var assert = __webpack_require__(477); +var SSHBuffer = __webpack_require__(940); +var crypto = __webpack_require__(417); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var Identity = __webpack_require__(378); +var rfc4253 = __webpack_require__(538); +var Signature = __webpack_require__(575); +var utils = __webpack_require__(270); +var Certificate = __webpack_require__(752); -/* - * Parses a Natural number (i.e., non-negative integer) with either the - * *DIGIT ( non-digit *OCTET ) - * or - * *DIGIT - * grammar (RFC6265 S5.1.1). - * - * The "trailingOK" boolean controls if the grammar accepts a - * "( non-digit *OCTET )" trailer. - */ -function parseDigits(token, minDigits, maxDigits, trailingOK) { - var count = 0; - while (count < token.length) { - var c = token.charCodeAt(count); - // "non-digit = %x00-2F / %x3A-FF" - if (c <= 0x2F || c >= 0x3A) { - break; - } - count++; - } +function verify(cert, key) { + /* + * We always give an issuerKey, so if our verify() is being called then + * there was no signature. Return false. + */ + return (false); +} - // constrain to a minimum and maximum number of digits. - if (count < minDigits || count > maxDigits) { - return null; - } +var TYPES = { + 'user': 1, + 'host': 2 +}; +Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; }); - if (!trailingOK && count != token.length) { - return null; - } +var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/; - return parseInt(token.substr(0,count), 10); +function read(buf, options) { + if (Buffer.isBuffer(buf)) + buf = buf.toString('ascii'); + var parts = buf.trim().split(/[ \t\n]+/g); + if (parts.length < 2 || parts.length > 3) + throw (new Error('Not a valid SSH certificate line')); + + var algo = parts[0]; + var data = parts[1]; + + data = Buffer.from(data, 'base64'); + return (fromBuffer(data, algo)); } -function parseTime(token) { - var parts = token.split(':'); - var result = [0,0,0]; +function fromBuffer(data, algo, partial) { + var sshbuf = new SSHBuffer({ buffer: data }); + var innerAlgo = sshbuf.readString(); + if (algo !== undefined && innerAlgo !== algo) + throw (new Error('SSH certificate algorithm mismatch')); + if (algo === undefined) + algo = innerAlgo; - /* RF6256 S5.1.1: - * time = hms-time ( non-digit *OCTET ) - * hms-time = time-field ":" time-field ":" time-field - * time-field = 1*2DIGIT - */ + var cert = {}; + cert.signatures = {}; + cert.signatures.openssh = {}; - if (parts.length !== 3) { - return null; - } + cert.signatures.openssh.nonce = sshbuf.readBuffer(); - for (var i = 0; i < 3; i++) { - // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be - // followed by "( non-digit *OCTET )" so therefore the last time-field can - // have a trailer - var trailingOK = (i == 2); - var num = parseDigits(parts[i], 1, 2, trailingOK); - if (num === null) { - return null; - } - result[i] = num; - } + var key = {}; + var parts = (key.parts = []); + key.type = getAlg(algo); - return result; -} + var partCount = algs.info[key.type].parts.length; + while (parts.length < partCount) + parts.push(sshbuf.readPart()); + assert.ok(parts.length >= 1, 'key must have at least one part'); -function parseMonth(token) { - token = String(token).substr(0,3).toLowerCase(); - var num = MONTH_TO_NUM[token]; - return num >= 0 ? num : null; -} + var algInfo = algs.info[key.type]; + if (key.type === 'ecdsa') { + var res = ECDSA_ALGO.exec(algo); + assert.ok(res !== null); + assert.strictEqual(res[1], parts[0].data.toString()); + } -/* - * RFC6265 S5.1.1 date parser (see RFC for full grammar) - */ -function parseDate(str) { - if (!str) { - return; - } + for (var i = 0; i < algInfo.parts.length; ++i) { + parts[i].name = algInfo.parts[i]; + if (parts[i].name !== 'curve' && + algInfo.normalize !== false) { + var p = parts[i]; + p.data = utils.mpNormalize(p.data); + } + } - /* RFC6265 S5.1.1: - * 2. Process each date-token sequentially in the order the date-tokens - * appear in the cookie-date - */ - var tokens = str.split(DATE_DELIM); - if (!tokens) { - return; - } + cert.subjectKey = new Key(key); - var hour = null; - var minute = null; - var second = null; - var dayOfMonth = null; - var month = null; - var year = null; + cert.serial = sshbuf.readInt64(); - for (var i=0; i= 70 && year <= 99) { - year += 1900; - } else if (year >= 0 && year <= 69) { - year += 2000; - } - } - } - } + var exts = []; + var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); + var ext; + while (!extbuf.atEnd()) { + ext = { critical: true }; + ext.name = extbuf.readString(); + ext.data = extbuf.readBuffer(); + exts.push(ext); + } + extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); + while (!extbuf.atEnd()) { + ext = { critical: false }; + ext.name = extbuf.readString(); + ext.data = extbuf.readBuffer(); + exts.push(ext); + } + cert.signatures.openssh.exts = exts; - /* RFC 6265 S5.1.1 - * "5. Abort these steps and fail to parse the cookie-date if: - * * at least one of the found-day-of-month, found-month, found- - * year, or found-time flags is not set, - * * the day-of-month-value is less than 1 or greater than 31, - * * the year-value is less than 1601, - * * the hour-value is greater than 23, - * * the minute-value is greater than 59, or - * * the second-value is greater than 59. - * (Note that leap seconds cannot be represented in this syntax.)" - * - * So, in order as above: - */ - if ( - dayOfMonth === null || month === null || year === null || second === null || - dayOfMonth < 1 || dayOfMonth > 31 || - year < 1601 || - hour > 23 || - minute > 59 || - second > 59 - ) { - return; - } + /* reserved */ + sshbuf.readBuffer(); - return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); + var signingKeyBuf = sshbuf.readBuffer(); + cert.issuerKey = rfc4253.read(signingKeyBuf); + + /* + * OpenSSH certs don't give the identity of the issuer, just their + * public key. So, we use an Identity that matches anything. The + * isSignedBy() function will later tell you if the key matches. + */ + cert.issuer = Identity.forHost('**'); + + var sigBuf = sshbuf.readBuffer(); + cert.signatures.openssh.signature = + Signature.parse(sigBuf, cert.issuerKey.type, 'ssh'); + + if (partial !== undefined) { + partial.remainder = sshbuf.remainder(); + partial.consumed = sshbuf._offset; + } + + return (new Certificate(cert)); } -function formatDate(date) { - var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; - var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; - var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; - var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; - return NUM_TO_DAY[date.getUTCDay()] + ', ' + - d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ - h+':'+m+':'+s+' GMT'; +function int64ToDate(buf) { + var i = buf.readUInt32BE(0) * 4294967296; + i += buf.readUInt32BE(4); + var d = new Date(); + d.setTime(i * 1000); + d.sourceInt64 = buf; + return (d); } -// S5.1.2 Canonicalized Host Names -function canonicalDomain(str) { - if (str == null) { - return null; - } - str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . +function dateToInt64(date) { + if (date.sourceInt64 !== undefined) + return (date.sourceInt64); + var i = Math.round(date.getTime() / 1000); + var upper = Math.floor(i / 4294967296); + var lower = Math.floor(i % 4294967296); + var buf = Buffer.alloc(8); + buf.writeUInt32BE(upper, 0); + buf.writeUInt32BE(lower, 4); + return (buf); +} - // convert to IDN if any non-ASCII characters - if (punycode && /[^\u0001-\u007f]/.test(str)) { - str = punycode.toASCII(str); - } +function sign(cert, key) { + if (cert.signatures.openssh === undefined) + cert.signatures.openssh = {}; + try { + var blob = toBuffer(cert, true); + } catch (e) { + delete (cert.signatures.openssh); + return (false); + } + var sig = cert.signatures.openssh; + var hashAlgo = undefined; + if (key.type === 'rsa' || key.type === 'dsa') + hashAlgo = 'sha1'; + var signer = key.createSign(hashAlgo); + signer.write(blob); + sig.signature = signer.sign(); + return (true); +} - return str.toLowerCase(); +function signAsync(cert, signer, done) { + if (cert.signatures.openssh === undefined) + cert.signatures.openssh = {}; + try { + var blob = toBuffer(cert, true); + } catch (e) { + delete (cert.signatures.openssh); + done(e); + return; + } + var sig = cert.signatures.openssh; + + signer(blob, function (err, signature) { + if (err) { + done(err); + return; + } + try { + /* + * This will throw if the signature isn't of a + * type/algo that can be used for SSH. + */ + signature.toBuffer('ssh'); + } catch (e) { + done(e); + return; + } + sig.signature = signature; + done(); + }); } -// S5.1.3 Domain Matching -function domainMatch(str, domStr, canonicalize) { - if (str == null || domStr == null) { - return null; - } - if (canonicalize !== false) { - str = canonicalDomain(str); - domStr = canonicalDomain(domStr); - } +function write(cert, options) { + if (options === undefined) + options = {}; - /* - * "The domain string and the string are identical. (Note that both the - * domain string and the string will have been canonicalized to lower case at - * this point)" - */ - if (str == domStr) { - return true; - } + var blob = toBuffer(cert); + var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64'); + if (options.comment) + out = out + ' ' + options.comment; + return (out); +} - /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ - /* "* The string is a host name (i.e., not an IP address)." */ - if (net.isIP(str)) { - return false; - } +function toBuffer(cert, noSig) { + assert.object(cert.signatures.openssh, 'signature for openssh format'); + var sig = cert.signatures.openssh; - /* "* The domain string is a suffix of the string" */ - var idx = str.indexOf(domStr); - if (idx <= 0) { - return false; // it's a non-match (-1) or prefix (0) - } + if (sig.nonce === undefined) + sig.nonce = crypto.randomBytes(16); + var buf = new SSHBuffer({}); + buf.writeString(getCertType(cert.subjectKey)); + buf.writeBuffer(sig.nonce); + + var key = cert.subjectKey; + var algInfo = algs.info[key.type]; + algInfo.parts.forEach(function (part) { + buf.writePart(key.part[part]); + }); + + buf.writeInt64(cert.serial); + + var type = cert.subjects[0].type; + assert.notStrictEqual(type, 'unknown'); + cert.subjects.forEach(function (id) { + assert.strictEqual(id.type, type); + }); + type = TYPES[type]; + buf.writeInt(type); + + if (sig.keyId === undefined) { + sig.keyId = cert.subjects[0].type + '_' + + (cert.subjects[0].uid || cert.subjects[0].hostname); + } + buf.writeString(sig.keyId); - // e.g "a.b.c".indexOf("b.c") === 2 - // 5 === 3+2 - if (str.length !== domStr.length + idx) { // it's not a suffix - return false; - } + var sub = new SSHBuffer({}); + cert.subjects.forEach(function (id) { + if (type === TYPES.host) + sub.writeString(id.hostname); + else if (type === TYPES.user) + sub.writeString(id.uid); + }); + buf.writeBuffer(sub.toBuffer()); - /* "* The last character of the string that is not included in the domain - * string is a %x2E (".") character." */ - if (str.substr(idx-1,1) !== '.') { - return false; - } + buf.writeInt64(dateToInt64(cert.validFrom)); + buf.writeInt64(dateToInt64(cert.validUntil)); - return true; -} + var exts = sig.exts; + if (exts === undefined) + exts = []; + var extbuf = new SSHBuffer({}); + exts.forEach(function (ext) { + if (ext.critical !== true) + return; + extbuf.writeString(ext.name); + extbuf.writeBuffer(ext.data); + }); + buf.writeBuffer(extbuf.toBuffer()); -// RFC6265 S5.1.4 Paths and Path-Match + extbuf = new SSHBuffer({}); + exts.forEach(function (ext) { + if (ext.critical === true) + return; + extbuf.writeString(ext.name); + extbuf.writeBuffer(ext.data); + }); + buf.writeBuffer(extbuf.toBuffer()); -/* - * "The user agent MUST use an algorithm equivalent to the following algorithm - * to compute the default-path of a cookie:" - * - * Assumption: the path (and not query part or absolute uri) is passed in. - */ -function defaultPath(path) { - // "2. If the uri-path is empty or if the first character of the uri-path is not - // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. - if (!path || path.substr(0,1) !== "/") { - return "/"; - } + /* reserved */ + buf.writeBuffer(Buffer.alloc(0)); - // "3. If the uri-path contains no more than one %x2F ("/") character, output - // %x2F ("/") and skip the remaining step." - if (path === "/") { - return path; - } + sub = rfc4253.write(cert.issuerKey); + buf.writeBuffer(sub); - var rightSlash = path.lastIndexOf("/"); - if (rightSlash === 0) { - return "/"; - } + if (!noSig) + buf.writeBuffer(sig.signature.toBuffer('ssh')); - // "4. Output the characters of the uri-path from the first character up to, - // but not including, the right-most %x2F ("/")." - return path.slice(0, rightSlash); + return (buf.toBuffer()); } -function trimTerminator(str) { - for (var t = 0; t < TERMINATORS.length; t++) { - var terminatorIdx = str.indexOf(TERMINATORS[t]); - if (terminatorIdx !== -1) { - str = str.substr(0,terminatorIdx); - } - } - - return str; +function getAlg(certType) { + if (certType === 'ssh-rsa-cert-v01@openssh.com') + return ('rsa'); + if (certType === 'ssh-dss-cert-v01@openssh.com') + return ('dsa'); + if (certType.match(ECDSA_ALGO)) + return ('ecdsa'); + if (certType === 'ssh-ed25519-cert-v01@openssh.com') + return ('ed25519'); + throw (new Error('Unsupported cert type ' + certType)); } -function parseCookiePair(cookiePair, looseMode) { - cookiePair = trimTerminator(cookiePair); +function getCertType(key) { + if (key.type === 'rsa') + return ('ssh-rsa-cert-v01@openssh.com'); + if (key.type === 'dsa') + return ('ssh-dss-cert-v01@openssh.com'); + if (key.type === 'ecdsa') + return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com'); + if (key.type === 'ed25519') + return ('ssh-ed25519-cert-v01@openssh.com'); + throw (new Error('Unsupported key type ' + key.type)); +} - var firstEq = cookiePair.indexOf('='); - if (looseMode) { - if (firstEq === 0) { // '=' is immediately at start - cookiePair = cookiePair.substr(1); - firstEq = cookiePair.indexOf('='); // might still need to split on '=' - } - } else { // non-loose mode - if (firstEq <= 0) { // no '=' or is at start - return; // needs to have non-empty "cookie-name" - } - } - var cookieName, cookieValue; - if (firstEq <= 0) { - cookieName = ""; - cookieValue = cookiePair.trim(); - } else { - cookieName = cookiePair.substr(0, firstEq).trim(); - cookieValue = cookiePair.substr(firstEq+1).trim(); - } +/***/ }), - if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { - return; - } +/***/ 894: +/***/ (function(module, __unusedexports, __webpack_require__) { - var c = new Cookie(); - c.key = cookieName; - c.value = cookieValue; - return c; -} +"use strict"; -function parse(str, options) { - if (!options || typeof options !== 'object') { - options = {}; - } - str = str.trim(); - // We use a regex to parse the "name-value-pair" part of S5.2 - var firstSemi = str.indexOf(';'); // S5.2 step 1 - var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); - var c = parseCookiePair(cookiePair, !!options.loose); - if (!c) { - return; - } +//all requires must be explicit because browserify won't work with dynamic requires +module.exports = { + '$ref': __webpack_require__(266), + allOf: __webpack_require__(107), + anyOf: __webpack_require__(902), + '$comment': __webpack_require__(28), + const: __webpack_require__(662), + contains: __webpack_require__(154), + dependencies: __webpack_require__(233), + 'enum': __webpack_require__(281), + format: __webpack_require__(687), + 'if': __webpack_require__(479), + items: __webpack_require__(643), + maximum: __webpack_require__(341), + minimum: __webpack_require__(341), + maxItems: __webpack_require__(85), + minItems: __webpack_require__(85), + maxLength: __webpack_require__(772), + minLength: __webpack_require__(772), + maxProperties: __webpack_require__(560), + minProperties: __webpack_require__(560), + multipleOf: __webpack_require__(397), + not: __webpack_require__(673), + oneOf: __webpack_require__(653), + pattern: __webpack_require__(542), + properties: __webpack_require__(343), + propertyNames: __webpack_require__(35), + required: __webpack_require__(858), + uniqueItems: __webpack_require__(899), + validate: __webpack_require__(967) +}; - if (firstSemi === -1) { - return c; - } - // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string - // (including the %x3B (";") in question)." plus later on in the same section - // "discard the first ";" and trim". - var unparsed = str.slice(firstSemi + 1).trim(); +/***/ }), - // "If the unparsed-attributes string is empty, skip the rest of these - // steps." - if (unparsed.length === 0) { - return c; - } +/***/ 897: +/***/ (function(module, __unusedexports, __webpack_require__) { - /* - * S5.2 says that when looping over the items "[p]rocess the attribute-name - * and attribute-value according to the requirements in the following - * subsections" for every item. Plus, for many of the individual attributes - * in S5.3 it says to use the "attribute-value of the last attribute in the - * cookie-attribute-list". Therefore, in this implementation, we overwrite - * the previous value. - */ - var cookie_avs = unparsed.split(';'); - while (cookie_avs.length) { - var av = cookie_avs.shift().trim(); - if (av.length === 0) { // happens if ";;" appears - continue; - } - var av_sep = av.indexOf('='); - var av_key, av_value; +"use strict"; - if (av_sep === -1) { - av_key = av; - av_value = null; - } else { - av_key = av.substr(0,av_sep); - av_value = av.substr(av_sep+1); - } - av_key = av_key.trim().toLowerCase(); +var utils = __webpack_require__(581); +var formats = __webpack_require__(13); - if (av_value) { - av_value = av_value.trim(); +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { // eslint-disable-line func-name-matching + return prefix + '[]'; + }, + indices: function indices(prefix, key) { // eslint-disable-line func-name-matching + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { // eslint-disable-line func-name-matching + return prefix; } +}; - switch(av_key) { - case 'expires': // S5.2.1 - if (av_value) { - var exp = parseDate(av_value); - // "If the attribute-value failed to parse as a cookie date, ignore the - // cookie-av." - if (exp) { - // over and underflow not realistically a concern: V8's getTime() seems to - // store something larger than a 32-bit time_t (even with 32-bit node) - c.expires = exp; - } - } - break; +var toISO = Date.prototype.toISOString; - case 'max-age': // S5.2.2 - if (av_value) { - // "If the first character of the attribute-value is not a DIGIT or a "-" - // character ...[or]... If the remainder of attribute-value contains a - // non-DIGIT character, ignore the cookie-av." - if (/^-?[0-9]+$/.test(av_value)) { - var delta = parseInt(av_value, 10); - // "If delta-seconds is less than or equal to zero (0), let expiry-time - // be the earliest representable date and time." - c.setMaxAge(delta); - } - } - break; +var defaults = { + delimiter: '&', + encode: true, + encoder: utils.encode, + encodeValuesOnly: false, + serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching + return toISO.call(date); + }, + skipNulls: false, + strictNullHandling: false +}; - case 'domain': // S5.2.3 - // "If the attribute-value is empty, the behavior is undefined. However, - // the user agent SHOULD ignore the cookie-av entirely." - if (av_value) { - // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E - // (".") character." - var domain = av_value.trim().replace(/^\./, ''); - if (domain) { - // "Convert the cookie-domain to lower case." - c.domain = domain.toLowerCase(); +var stringify = function stringify( // eslint-disable-line func-name-matching + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder) : prefix; } - } - break; - - case 'path': // S5.2.4 - /* - * "If the attribute-value is empty or if the first character of the - * attribute-value is not %x2F ("/"): - * Let cookie-path be the default-path. - * Otherwise: - * Let cookie-path be the attribute-value." - * - * We'll represent the default-path as null since it depends on the - * context of the parsing. - */ - c.path = av_value && av_value[0] === "/" ? av_value : null; - break; - case 'secure': // S5.2.5 - /* - * "If the attribute-name case-insensitively matches the string "Secure", - * the user agent MUST append an attribute to the cookie-attribute-list - * with an attribute-name of Secure and an empty attribute-value." - */ - c.secure = true; - break; - - case 'httponly': // S5.2.6 -- effectively the same as 'secure' - c.httpOnly = true; - break; - - default: - c.extensions = c.extensions || []; - c.extensions.push(av); - break; + obj = ''; } - } - - return c; -} - -// avoid the V8 deoptimization monster! -function jsonParse(str) { - var obj; - try { - obj = JSON.parse(str); - } catch (e) { - return e; - } - return obj; -} - -function fromJSON(str) { - if (!str) { - return null; - } - var obj; - if (typeof str === 'string') { - obj = jsonParse(str); - if (obj instanceof Error) { - return null; + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder); + return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; } - } else { - // assume it's an Object - obj = str; - } - var c = new Cookie(); - for (var i=0; i 1) { - var lindex = path.lastIndexOf('/'); - if (lindex === 0) { - break; + if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); } - path = path.substr(0,lindex); - permutations.push(path); - } - permutations.push('/'); - return permutations; -} - -function getCookieContext(url) { - if (url instanceof Object) { - return url; - } - // NOTE: decodeURI will throw on malformed URIs (see GH-32). - // Therefore, we will just skip decoding for such URIs. - try { - url = decodeURI(url); - } - catch(err) { - // Silently swallow error - } - - return urlParse(url); -} -function Cookie(options) { - options = options || {}; + var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; + var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; + var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; + var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; + var sort = typeof options.sort === 'function' ? options.sort : null; + var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; + var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; + var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; + if (typeof options.format === 'undefined') { + options.format = formats['default']; + } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { + throw new TypeError('Unknown format option provided.'); + } + var formatter = formats.formatters[options.format]; + var objKeys; + var filter; - Object.keys(options).forEach(function(prop) { - if (Cookie.prototype.hasOwnProperty(prop) && - Cookie.prototype[prop] !== options[prop] && - prop.substr(0,1) !== '_') - { - this[prop] = options[prop]; + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (Array.isArray(options.filter)) { + filter = options.filter; + objKeys = filter; } - }, this); - this.creation = this.creation || new Date(); + var keys = []; - // used to break creation ties in cookieCompare(): - Object.defineProperty(this, 'creationIndex', { - configurable: false, - enumerable: false, // important for assert.deepEqual checks - writable: true, - value: ++Cookie.cookiesCreated - }); -} + if (typeof obj !== 'object' || obj === null) { + return ''; + } -Cookie.cookiesCreated = 0; // incremented each time a cookie is created + var arrayFormat; + if (options.arrayFormat in arrayPrefixGenerators) { + arrayFormat = options.arrayFormat; + } else if ('indices' in options) { + arrayFormat = options.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } -Cookie.parse = parse; -Cookie.fromJSON = fromJSON; + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; -Cookie.prototype.key = ""; -Cookie.prototype.value = ""; + if (!objKeys) { + objKeys = Object.keys(obj); + } -// the order in which the RFC has them: -Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity -Cookie.prototype.maxAge = null; // takes precedence over expires for TTL -Cookie.prototype.domain = null; -Cookie.prototype.path = null; -Cookie.prototype.secure = false; -Cookie.prototype.httpOnly = false; -Cookie.prototype.extensions = null; + if (sort) { + objKeys.sort(sort); + } -// set by the CookieJar: -Cookie.prototype.hostOnly = null; // boolean when set -Cookie.prototype.pathIsDefault = null; // boolean when set -Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse -Cookie.prototype.lastAccessed = null; // Date when set -Object.defineProperty(Cookie.prototype, 'creationIndex', { - configurable: true, - enumerable: false, - writable: true, - value: 0 -}); + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; -Cookie.serializableProperties = Object.keys(Cookie.prototype) - .filter(function(prop) { - return !( - Cookie.prototype[prop] instanceof Function || - prop === 'creationIndex' || - prop.substr(0,1) === '_' - ); - }); + if (skipNulls && obj[key] === null) { + continue; + } -Cookie.prototype.inspect = function inspect() { - var now = Date.now(); - return 'Cookie="'+this.toString() + - '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + - '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + - '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + - '"'; + keys = keys.concat(stringify( + obj[key], + key, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encode ? encoder : null, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + + var joined = keys.join(delimiter); + var prefix = options.addQueryPrefix === true ? '?' : ''; + + return joined.length > 0 ? prefix + joined : ''; }; -// Use the new custom inspection symbol to add the custom inspect function if -// available. -if (util.inspect.custom) { - Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; -} -Cookie.prototype.toJSON = function() { - var obj = {}; +/***/ }), - var props = Cookie.serializableProperties; - for (var i=0; i 1) { '; + var $itemType = it.schema.items && it.schema.items.type, + $typeIsArray = Array.isArray($itemType); + if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { + out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; + } else { + out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; + var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); + out += ' if (' + (it.util[$method]($itemType, 'item', true)) + ') continue; '; + if ($typeIsArray) { + out += ' if (typeof item == \'string\') item = \'"\' + item; '; } - } else if (prop === 'maxAge') { - if (this[prop] !== null) { - // again, intentionally not === - obj[prop] = (this[prop] == Infinity || this[prop] == -Infinity) ? - this[prop].toString() : this[prop]; + out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; + } + out += ' } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } + out += ' } '; } else { - if (this[prop] !== Cookie.prototype[prop]) { - obj[prop] = this[prop]; + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; } } + return out; +} - return obj; -}; -Cookie.prototype.clone = function() { - return fromJSON(this.toJSON()); -}; +/***/ }), -Cookie.prototype.validate = function validate() { - if (!COOKIE_OCTETS.test(this.value)) { - return false; - } - if (this.expires != Infinity && !(this.expires instanceof Date) && !parseDate(this.expires)) { - return false; - } - if (this.maxAge != null && this.maxAge <= 0) { - return false; // "Max-Age=" non-zero-digit *DIGIT - } - if (this.path != null && !PATH_VALUE.test(this.path)) { - return false; - } +/***/ 902: +/***/ (function(module) { - var cdomain = this.cdomain(); - if (cdomain) { - if (cdomain.match(/\.$/)) { - return false; // S4.1.2.3 suggests that this is bad. domainMatch() tests confirm this +"use strict"; + +module.exports = function generate_anyOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $noEmptySchema = $schema.every(function($sch) { + return (it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all)); + }); + if ($noEmptySchema) { + var $currentBaseId = $it.baseId; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; + $closingBraces += '}'; + } } - var suffix = pubsuffix.getPublicSuffix(cdomain); - if (suffix == null) { // it's a public suffix - return false; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should match some schema in anyOf\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; } - } - return true; -}; - -Cookie.prototype.setExpires = function setExpires(exp) { - if (exp instanceof Date) { - this.expires = exp; + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; + } + out = it.util.cleanUpCode(out); } else { - this.expires = parseDate(exp) || "Infinity"; + if ($breakOnError) { + out += ' if (true) { '; + } } -}; + return out; +} -Cookie.prototype.setMaxAge = function setMaxAge(age) { - if (age === Infinity || age === -Infinity) { - this.maxAge = age.toString(); // so JSON.stringify() works - } else { - this.maxAge = age; - } + +/***/ }), + +/***/ 909: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2012 Joyent, Inc. All rights reserved. + +var assert = __webpack_require__(477); +var sshpk = __webpack_require__(650); +var util = __webpack_require__(669); + +var HASH_ALGOS = { + 'sha1': true, + 'sha256': true, + 'sha512': true }; -// gives Cookie header format -Cookie.prototype.cookieString = function cookieString() { - var val = this.value; - if (val == null) { - val = ''; - } - if (this.key === '') { - return val; - } - return this.key+'='+val; +var PK_ALGOS = { + 'rsa': true, + 'dsa': true, + 'ecdsa': true }; -// gives Set-Cookie header format -Cookie.prototype.toString = function toString() { - var str = this.cookieString(); +function HttpSignatureError(message, caller) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, caller || HttpSignatureError); - if (this.expires != Infinity) { - if (this.expires instanceof Date) { - str += '; Expires='+formatDate(this.expires); - } else { - str += '; Expires='+this.expires; - } - } + this.message = message; + this.name = caller.name; +} +util.inherits(HttpSignatureError, Error); - if (this.maxAge != null && this.maxAge != Infinity) { - str += '; Max-Age='+this.maxAge; - } +function InvalidAlgorithmError(message) { + HttpSignatureError.call(this, message, InvalidAlgorithmError); +} +util.inherits(InvalidAlgorithmError, HttpSignatureError); - if (this.domain && !this.hostOnly) { - str += '; Domain='+this.domain; - } - if (this.path) { - str += '; Path='+this.path; - } +function validateAlgorithm(algorithm) { + var alg = algorithm.toLowerCase().split('-'); - if (this.secure) { - str += '; Secure'; - } - if (this.httpOnly) { - str += '; HttpOnly'; - } - if (this.extensions) { - this.extensions.forEach(function(ext) { - str += '; '+ext; - }); + if (alg.length !== 2) { + throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' is not a ' + + 'valid algorithm')); } - return str; -}; - -// TTL() partially replaces the "expiry-time" parts of S5.3 step 3 (setCookie() -// elsewhere) -// S5.3 says to give the "latest representable date" for which we use Infinity -// For "expired" we use 0 -Cookie.prototype.TTL = function TTL(now) { - /* RFC6265 S4.1.2.2 If a cookie has both the Max-Age and the Expires - * attribute, the Max-Age attribute has precedence and controls the - * expiration date of the cookie. - * (Concurs with S5.3 step 3) - */ - if (this.maxAge != null) { - return this.maxAge<=0 ? 0 : this.maxAge*1000; + if (alg[0] !== 'hmac' && !PK_ALGOS[alg[0]]) { + throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' type keys ' + + 'are not supported')); } - var expires = this.expires; - if (expires != Infinity) { - if (!(expires instanceof Date)) { - expires = parseDate(expires) || Infinity; - } + if (!HASH_ALGOS[alg[1]]) { + throw (new InvalidAlgorithmError(alg[1].toUpperCase() + ' is not a ' + + 'supported hash algorithm')); + } - if (expires == Infinity) { - return Infinity; - } + return (alg); +} - return expires.getTime() - (now || Date.now()); - } +///--- API - return Infinity; -}; +module.exports = { -// expiryTime() replaces the "expiry-time" parts of S5.3 step 3 (setCookie() -// elsewhere) -Cookie.prototype.expiryTime = function expiryTime(now) { - if (this.maxAge != null) { - var relativeTo = now || this.creation || new Date(); - var age = (this.maxAge <= 0) ? -Infinity : this.maxAge*1000; - return relativeTo.getTime() + age; - } + HASH_ALGOS: HASH_ALGOS, + PK_ALGOS: PK_ALGOS, - if (this.expires == Infinity) { - return Infinity; - } - return this.expires.getTime(); -}; + HttpSignatureError: HttpSignatureError, + InvalidAlgorithmError: InvalidAlgorithmError, -// expiryDate() replaces the "expiry-time" parts of S5.3 step 3 (setCookie() -// elsewhere), except it returns a Date -Cookie.prototype.expiryDate = function expiryDate(now) { - var millisec = this.expiryTime(now); - if (millisec == Infinity) { - return new Date(MAX_TIME); - } else if (millisec == -Infinity) { - return new Date(MIN_TIME); - } else { - return new Date(millisec); - } -}; + validateAlgorithm: validateAlgorithm, -// This replaces the "persistent-flag" parts of S5.3 step 3 -Cookie.prototype.isPersistent = function isPersistent() { - return (this.maxAge != null || this.expires != Infinity); -}; + /** + * Converts an OpenSSH public key (rsa only) to a PKCS#8 PEM file. + * + * The intent of this module is to interoperate with OpenSSL only, + * specifically the node crypto module's `verify` method. + * + * @param {String} key an OpenSSH public key. + * @return {String} PEM encoded form of the RSA public key. + * @throws {TypeError} on bad input. + * @throws {Error} on invalid ssh key formatted data. + */ + sshKeyToPEM: function sshKeyToPEM(key) { + assert.string(key, 'ssh_key'); -// Mostly S5.1.2 and S5.2.3: -Cookie.prototype.cdomain = -Cookie.prototype.canonicalizedDomain = function canonicalizedDomain() { - if (this.domain == null) { - return null; - } - return canonicalDomain(this.domain); -}; + var k = sshpk.parseKey(key, 'ssh'); + return (k.toString('pem')); + }, -function CookieJar(store, options) { - if (typeof options === "boolean") { - options = {rejectPublicSuffixes: options}; - } else if (options == null) { - options = {}; - } - if (options.rejectPublicSuffixes != null) { - this.rejectPublicSuffixes = options.rejectPublicSuffixes; - } - if (options.looseMode != null) { - this.enableLooseMode = options.looseMode; - } - if (!store) { - store = new MemoryCookieStore(); - } - this.store = store; -} -CookieJar.prototype.store = null; -CookieJar.prototype.rejectPublicSuffixes = true; -CookieJar.prototype.enableLooseMode = false; -var CAN_BE_SYNC = []; + /** + * Generates an OpenSSH fingerprint from an ssh public key. + * + * @param {String} key an OpenSSH public key. + * @return {String} key fingerprint. + * @throws {TypeError} on bad input. + * @throws {Error} if what you passed doesn't look like an ssh public key. + */ + fingerprint: function fingerprint(key) { + assert.string(key, 'ssh_key'); -CAN_BE_SYNC.push('setCookie'); -CookieJar.prototype.setCookie = function(cookie, url, options, cb) { - var err; - var context = getCookieContext(url); - if (options instanceof Function) { - cb = options; - options = {}; - } + var k = sshpk.parseKey(key, 'ssh'); + return (k.fingerprint('md5').toString('hex')); + }, - var host = canonicalDomain(context.hostname); - var loose = this.enableLooseMode; - if (options.loose != null) { - loose = options.loose; - } + /** + * Converts a PKGCS#8 PEM file to an OpenSSH public key (rsa) + * + * The reverse of the above function. + */ + pemToRsaSSHKey: function pemToRsaSSHKey(pem, comment) { + assert.equal('string', typeof (pem), 'typeof pem'); - // S5.3 step 1 - if (!(cookie instanceof Cookie)) { - cookie = Cookie.parse(cookie, { loose: loose }); - } - if (!cookie) { - err = new Error("Cookie failed to parse"); - return cb(options.ignoreError ? null : err); + var k = sshpk.parseKey(pem, 'pem'); + k.comment = comment; + return (k.toString('ssh')); } +}; - // S5.3 step 2 - var now = options.now || new Date(); // will assign later to save effort in the face of errors - // S5.3 step 3: NOOP; persistent-flag and expiry-time is handled by getCookie() +/***/ }), - // S5.3 step 4: NOOP; domain is null by default +/***/ 919: +/***/ (function(module) { - // S5.3 step 5: public suffixes - if (this.rejectPublicSuffixes && cookie.domain) { - var suffix = pubsuffix.getPublicSuffix(cookie.cdomain()); - if (suffix == null) { // e.g. "com" - err = new Error("Cookie has domain set to a public suffix"); - return cb(options.ignoreError ? null : err); - } - } +module.exports = {"$id":"entry.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","time","request","response","cache","timings"],"properties":{"pageref":{"type":"string"},"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"time":{"type":"number","min":0},"request":{"$ref":"request.json#"},"response":{"$ref":"response.json#"},"cache":{"$ref":"cache.json#"},"timings":{"$ref":"timings.json#"},"serverIPAddress":{"type":"string","oneOf":[{"format":"ipv4"},{"format":"ipv6"}]},"connection":{"type":"string"},"comment":{"type":"string"}}}; - // S5.3 step 6: - if (cookie.domain) { - if (!domainMatch(host, cookie.cdomain(), false)) { - err = new Error("Cookie not in this host's domain. Cookie:"+cookie.cdomain()+" Request:"+host); - return cb(options.ignoreError ? null : err); - } +/***/ }), - if (cookie.hostOnly == null) { // don't reset if already set - cookie.hostOnly = false; - } +/***/ 921: +/***/ (function(module) { - } else { - cookie.hostOnly = true; - cookie.domain = host; - } +"use strict"; - //S5.2.4 If the attribute-value is empty or if the first character of the - //attribute-value is not %x2F ("/"): - //Let cookie-path be the default-path. - if (!cookie.path || cookie.path[0] !== '/') { - cookie.path = defaultPath(context.pathname); - cookie.pathIsDefault = true; - } - // S5.3 step 8: NOOP; secure attribute - // S5.3 step 9: NOOP; httpOnly attribute - // S5.3 step 10 - if (options.http === false && cookie.httpOnly) { - err = new Error("Cookie is HttpOnly and this isn't an HTTP API"); - return cb(options.ignoreError ? null : err); - } +var Cache = module.exports = function Cache() { + this._cache = {}; +}; - var store = this.store; - if (!store.updateCookie) { - store.updateCookie = function(oldCookie, newCookie, cb) { - this.putCookie(newCookie, cb); - }; - } +Cache.prototype.put = function Cache_put(key, value) { + this._cache[key] = value; +}; - function withCookie(err, oldCookie) { - if (err) { - return cb(err); - } - var next = function(err) { - if (err) { - return cb(err); - } else { - cb(null, cookie); - } - }; +Cache.prototype.get = function Cache_get(key) { + return this._cache[key]; +}; - if (oldCookie) { - // S5.3 step 11 - "If the cookie store contains a cookie with the same name, - // domain, and path as the newly created cookie:" - if (options.http === false && oldCookie.httpOnly) { // step 11.2 - err = new Error("old Cookie is HttpOnly and this isn't an HTTP API"); - return cb(options.ignoreError ? null : err); - } - cookie.creation = oldCookie.creation; // step 11.3 - cookie.creationIndex = oldCookie.creationIndex; // preserve tie-breaker - cookie.lastAccessed = now; - // Step 11.4 (delete cookie) is implied by just setting the new one: - store.updateCookie(oldCookie, cookie, next); // step 12 - } else { - cookie.creation = cookie.lastAccessed = now; - store.putCookie(cookie, next); // step 12 - } - } +Cache.prototype.del = function Cache_del(key) { + delete this._cache[key]; +}; - store.findCookie(cookie.domain, cookie.path, cookie.key, withCookie); + +Cache.prototype.clear = function Cache_clear() { + this._cache = {}; }; -// RFC6365 S5.4 -CAN_BE_SYNC.push('getCookies'); -CookieJar.prototype.getCookies = function(url, options, cb) { - var context = getCookieContext(url); - if (options instanceof Function) { - cb = options; - options = {}; - } - var host = canonicalDomain(context.hostname); - var path = context.pathname || '/'; +/***/ }), - var secure = options.secure; - if (secure == null && context.protocol && - (context.protocol == 'https:' || context.protocol == 'wss:')) - { - secure = true; - } +/***/ 928: +/***/ (function(module, __unusedexports, __webpack_require__) { - var http = options.http; - if (http == null) { - http = true; +var CombinedStream = __webpack_require__(547); +var util = __webpack_require__(669); +var path = __webpack_require__(622); +var http = __webpack_require__(605); +var https = __webpack_require__(211); +var parseUrl = __webpack_require__(835).parse; +var fs = __webpack_require__(747); +var mime = __webpack_require__(779); +var asynckit = __webpack_require__(334); +var populate = __webpack_require__(69); + +// Public API +module.exports = FormData; + +// make it a Stream +util.inherits(FormData, CombinedStream); + +/** + * Create readable "multipart/form-data" streams. + * Can be used to submit forms + * and file uploads to other web applications. + * + * @constructor + * @param {Object} options - Properties to be added/overriden for FormData and CombinedStream + */ +function FormData(options) { + if (!(this instanceof FormData)) { + return new FormData(); } - var now = options.now || Date.now(); - var expireCheck = options.expire !== false; - var allPaths = !!options.allPaths; - var store = this.store; + this._overheadLength = 0; + this._valueLength = 0; + this._valuesToMeasure = []; - function matchingCookie(c) { - // "Either: - // The cookie's host-only-flag is true and the canonicalized - // request-host is identical to the cookie's domain. - // Or: - // The cookie's host-only-flag is false and the canonicalized - // request-host domain-matches the cookie's domain." - if (c.hostOnly) { - if (c.domain != host) { - return false; - } - } else { - if (!domainMatch(host, c.domain, false)) { - return false; - } - } + CombinedStream.call(this); - // "The request-uri's path path-matches the cookie's path." - if (!allPaths && !pathMatch(path, c.path)) { - return false; - } + options = options || {}; + for (var option in options) { + this[option] = options[option]; + } +} - // "If the cookie's secure-only-flag is true, then the request-uri's - // scheme must denote a "secure" protocol" - if (c.secure && !secure) { - return false; - } +FormData.LINE_BREAK = '\r\n'; +FormData.DEFAULT_CONTENT_TYPE = 'application/octet-stream'; - // "If the cookie's http-only-flag is true, then exclude the cookie if the - // cookie-string is being generated for a "non-HTTP" API" - if (c.httpOnly && !http) { - return false; - } +FormData.prototype.append = function(field, value, options) { - // deferred from S5.3 - // non-RFC: allow retention of expired cookies by choice - if (expireCheck && c.expiryTime() <= now) { - store.removeCookie(c.domain, c.path, c.key, function(){}); // result ignored - return false; - } + options = options || {}; - return true; + // allow filename as single option + if (typeof options == 'string') { + options = {filename: options}; } - store.findCookies(host, allPaths ? null : path, function(err,cookies) { - if (err) { - return cb(err); - } + var append = CombinedStream.prototype.append.bind(this); - cookies = cookies.filter(matchingCookie); + // all that streamy business can't handle numbers + if (typeof value == 'number') { + value = '' + value; + } - // sorting of S5.4 part 2 - if (options.sort !== false) { - cookies = cookies.sort(cookieCompare); - } + // https://github.com/felixge/node-form-data/issues/38 + if (util.isArray(value)) { + // Please convert your array into string + // the way web server expects it + this._error(new Error('Arrays are not supported.')); + return; + } - // S5.4 part 3 - var now = new Date(); - cookies.forEach(function(c) { - c.lastAccessed = now; - }); - // TODO persist lastAccessed + var header = this._multiPartHeader(field, value, options); + var footer = this._multiPartFooter(); - cb(null,cookies); - }); -}; + append(header); + append(value); + append(footer); -CAN_BE_SYNC.push('getCookieString'); -CookieJar.prototype.getCookieString = function(/*..., cb*/) { - var args = Array.prototype.slice.call(arguments,0); - var cb = args.pop(); - var next = function(err,cookies) { - if (err) { - cb(err); - } else { - cb(null, cookies - .sort(cookieCompare) - .map(function(c){ - return c.cookieString(); - }) - .join('; ')); - } - }; - args.push(next); - this.getCookies.apply(this,args); + // pass along options.knownLength + this._trackLength(header, value, options); }; -CAN_BE_SYNC.push('getSetCookieStrings'); -CookieJar.prototype.getSetCookieStrings = function(/*..., cb*/) { - var args = Array.prototype.slice.call(arguments,0); - var cb = args.pop(); - var next = function(err,cookies) { - if (err) { - cb(err); - } else { - cb(null, cookies.map(function(c){ - return c.toString(); - })); - } - }; - args.push(next); - this.getCookies.apply(this,args); -}; +FormData.prototype._trackLength = function(header, value, options) { + var valueLength = 0; -CAN_BE_SYNC.push('serialize'); -CookieJar.prototype.serialize = function(cb) { - var type = this.store.constructor.name; - if (type === 'Object') { - type = null; + // used w/ getLengthSync(), when length is known. + // e.g. for streaming directly from a remote server, + // w/ a known file a size, and not wanting to wait for + // incoming file to finish to get its size. + if (options.knownLength != null) { + valueLength += +options.knownLength; + } else if (Buffer.isBuffer(value)) { + valueLength = value.length; + } else if (typeof value === 'string') { + valueLength = Buffer.byteLength(value); } - // update README.md "Serialization Format" if you change this, please! - var serialized = { - // The version of tough-cookie that serialized this jar. Generally a good - // practice since future versions can make data import decisions based on - // known past behavior. When/if this matters, use `semver`. - version: 'tough-cookie@'+VERSION, - - // add the store type, to make humans happy: - storeType: type, - - // CookieJar configuration: - rejectPublicSuffixes: !!this.rejectPublicSuffixes, + this._valueLength += valueLength; - // this gets filled from getAllCookies: - cookies: [] - }; + // @check why add CRLF? does this account for custom/multiple CRLFs? + this._overheadLength += + Buffer.byteLength(header) + + FormData.LINE_BREAK.length; - if (!(this.store.getAllCookies && - typeof this.store.getAllCookies === 'function')) - { - return cb(new Error('store does not support getAllCookies and cannot be serialized')); + // empty or either doesn't have path or not an http response + if (!value || ( !value.path && !(value.readable && value.hasOwnProperty('httpVersion')) )) { + return; } - this.store.getAllCookies(function(err,cookies) { - if (err) { - return cb(err); - } + // no need to bother with the length + if (!options.knownLength) { + this._valuesToMeasure.push(value); + } +}; - serialized.cookies = cookies.map(function(cookie) { - // convert to serialized 'raw' cookies - cookie = (cookie instanceof Cookie) ? cookie.toJSON() : cookie; +FormData.prototype._lengthRetriever = function(value, callback) { - // Remove the index so new ones get assigned during deserialization - delete cookie.creationIndex; + if (value.hasOwnProperty('fd')) { - return cookie; - }); + // take read range into a account + // `end` = Infinity –> read file till the end + // + // TODO: Looks like there is bug in Node fs.createReadStream + // it doesn't respect `end` options without `start` options + // Fix it when node fixes it. + // https://github.com/joyent/node/issues/7819 + if (value.end != undefined && value.end != Infinity && value.start != undefined) { - return cb(null, serialized); - }); -}; + // when end specified + // no need to calculate range + // inclusive, starts with 0 + callback(null, value.end + 1 - (value.start ? value.start : 0)); -// well-known name that JSON.stringify calls -CookieJar.prototype.toJSON = function() { - return this.serializeSync(); -}; + // not that fast snoopy + } else { + // still need to fetch file size from fs + fs.stat(value.path, function(err, stat) { -// use the class method CookieJar.deserialize instead of calling this directly -CAN_BE_SYNC.push('_importCookies'); -CookieJar.prototype._importCookies = function(serialized, cb) { - var jar = this; - var cookies = serialized.cookies; - if (!cookies || !Array.isArray(cookies)) { - return cb(new Error('serialized jar has no cookies array')); - } - cookies = cookies.slice(); // do not modify the original + var fileSize; - function putNext(err) { - if (err) { - return cb(err); - } + if (err) { + callback(err); + return; + } - if (!cookies.length) { - return cb(err, jar); + // update final size based on the range options + fileSize = stat.size - (value.start ? value.start : 0); + callback(null, fileSize); + }); } - var cookie; - try { - cookie = fromJSON(cookies.shift()); - } catch (e) { - return cb(e); - } + // or http response + } else if (value.hasOwnProperty('httpVersion')) { + callback(null, +value.headers['content-length']); - if (cookie === null) { - return putNext(null); // skip this cookie - } + // or request stream http://github.com/mikeal/request + } else if (value.hasOwnProperty('httpModule')) { + // wait till response come back + value.on('response', function(response) { + value.pause(); + callback(null, +response.headers['content-length']); + }); + value.resume(); - jar.store.putCookie(cookie, putNext); + // something else + } else { + callback('Unknown stream'); } - - putNext(); }; -CookieJar.deserialize = function(strOrObj, store, cb) { - if (arguments.length !== 3) { - // store is optional - cb = store; - store = null; - } - - var serialized; - if (typeof strOrObj === 'string') { - serialized = jsonParse(strOrObj); - if (serialized instanceof Error) { - return cb(serialized); - } - } else { - serialized = strOrObj; +FormData.prototype._multiPartHeader = function(field, value, options) { + // custom header specified (as string)? + // it becomes responsible for boundary + // (e.g. to handle extra CRLFs on .NET servers) + if (typeof options.header == 'string') { + return options.header; } - var jar = new CookieJar(store, serialized.rejectPublicSuffixes); - jar._importCookies(serialized, function(err) { - if (err) { - return cb(err); - } - cb(null, jar); - }); -}; + var contentDisposition = this._getContentDisposition(value, options); + var contentType = this._getContentType(value, options); -CookieJar.deserializeSync = function(strOrObj, store) { - var serialized = typeof strOrObj === 'string' ? - JSON.parse(strOrObj) : strOrObj; - var jar = new CookieJar(store, serialized.rejectPublicSuffixes); + var contents = ''; + var headers = { + // add custom disposition as third element or keep it two elements if not + 'Content-Disposition': ['form-data', 'name="' + field + '"'].concat(contentDisposition || []), + // if no content type. allow it to be empty array + 'Content-Type': [].concat(contentType || []) + }; - // catch this mistake early: - if (!jar.store.synchronous) { - throw new Error('CookieJar store is not synchronous; use async API instead.'); + // allow custom headers. + if (typeof options.header == 'object') { + populate(headers, options.header); } - jar._importCookiesSync(serialized); - return jar; -}; -CookieJar.fromJSON = CookieJar.deserializeSync; - -CAN_BE_SYNC.push('clone'); -CookieJar.prototype.clone = function(newStore, cb) { - if (arguments.length === 1) { - cb = newStore; - newStore = null; - } + var header; + for (var prop in headers) { + if (!headers.hasOwnProperty(prop)) continue; + header = headers[prop]; - this.serialize(function(err,serialized) { - if (err) { - return cb(err); + // skip nullish headers. + if (header == null) { + continue; + } + + // convert all headers to arrays. + if (!Array.isArray(header)) { + header = [header]; } - CookieJar.deserialize(newStore, serialized, cb); - }); -}; -// Use a closure to provide a true imperative API for synchronous stores. -function syncWrap(method) { - return function() { - if (!this.store.synchronous) { - throw new Error('CookieJar store is not synchronous; use async API instead.'); + // add non-empty headers. + if (header.length) { + contents += prop + ': ' + header.join('; ') + FormData.LINE_BREAK; } + } - var args = Array.prototype.slice.call(arguments); - var syncErr, syncResult; - args.push(function syncCb(err, result) { - syncErr = err; - syncResult = result; - }); - this[method].apply(this, args); + return '--' + this.getBoundary() + FormData.LINE_BREAK + contents + FormData.LINE_BREAK; +}; - if (syncErr) { - throw syncErr; - } - return syncResult; - }; -} +FormData.prototype._getContentDisposition = function(value, options) { -// wrap all declared CAN_BE_SYNC methods in the sync wrapper -CAN_BE_SYNC.forEach(function(method) { - CookieJar.prototype[method+'Sync'] = syncWrap(method); -}); + var filename + , contentDisposition + ; -exports.CookieJar = CookieJar; -exports.Cookie = Cookie; -exports.Store = Store; -exports.MemoryCookieStore = MemoryCookieStore; -exports.parseDate = parseDate; -exports.formatDate = formatDate; -exports.parse = parse; -exports.fromJSON = fromJSON; -exports.domainMatch = domainMatch; -exports.defaultPath = defaultPath; -exports.pathMatch = pathMatch; -exports.getPublicSuffix = pubsuffix.getPublicSuffix; -exports.cookieCompare = cookieCompare; -exports.permuteDomain = __webpack_require__(293).permuteDomain; -exports.permutePath = permutePath; -exports.canonicalDomain = canonicalDomain; + if (typeof options.filepath === 'string') { + // custom filepath for relative paths + filename = path.normalize(options.filepath).replace(/\\/g, '/'); + } else if (options.filename || value.name || value.path) { + // custom filename take precedence + // formidable and the browser add a name property + // fs- and request- streams have path property + filename = path.basename(options.filename || value.name || value.path); + } else if (value.readable && value.hasOwnProperty('httpVersion')) { + // or try http response + filename = path.basename(value.client._httpMessage.path); + } + if (filename) { + contentDisposition = 'filename="' + filename + '"'; + } -/***/ }), + return contentDisposition; +}; -/***/ 949: -/***/ (function(module) { +FormData.prototype._getContentType = function(value, options) { -"use strict"; + // use custom content-type above all + var contentType = options.contentType; -module.exports = function generate__limitProperties(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; + // or try `name` from formidable, browser + if (!contentType && value.name) { + contentType = mime.lookup(value.name); } - var $op = $keyword == 'maxProperties' ? '>' : '<'; - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + + // or try `path` from fs-, request- streams + if (!contentType && value.path) { + contentType = mime.lookup(value.path); } - out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have '; - if ($keyword == 'maxProperties') { - out += 'more'; - } else { - out += 'fewer'; - } - out += ' than '; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + ($schema); - } - out += ' properties\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; + + // or if it's http-reponse + if (!contentType && value.readable && value.hasOwnProperty('httpVersion')) { + contentType = value.headers['content-type']; } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + + // or guess it from the filepath or filename + if (!contentType && (options.filepath || options.filename)) { + contentType = mime.lookup(options.filepath || options.filename); } - out += '} '; - if ($breakOnError) { - out += ' else { '; + + // fallback to the default content type if `value` is not simple value + if (!contentType && typeof value == 'object') { + contentType = FormData.DEFAULT_CONTENT_TYPE; } - return out; -} + return contentType; +}; -/***/ }), +FormData.prototype._multiPartFooter = function() { + return function(next) { + var footer = FormData.LINE_BREAK; -/***/ 954: -/***/ (function(module) { + var lastPart = (this._streams.length === 0); + if (lastPart) { + footer += this._lastBoundary(); + } -/** - * JSONSchema Validator - Validates JavaScript objects using JSON Schemas - * (http://www.json.com/json-schema-proposal/) - * - * Copyright (c) 2007 Kris Zyp SitePen (www.sitepen.com) - * Licensed under the MIT (MIT-LICENSE.txt) license. -To use the validator call the validate function with an instance object and an optional schema object. -If a schema is provided, it will be used to validate. If the instance object refers to a schema (self-validating), -that schema will be used to validate and the schema parameter is not necessary (if both exist, -both validations will occur). -The validate method will return an array of validation errors. If there are no errors, then an -empty list will be returned. A validation error will have two properties: -"property" which indicates which property had the error -"message" which indicates what the error was - */ -(function (root, factory) { - if (typeof define === 'function' && define.amd) { - // AMD. Register as an anonymous module. - define([], function () { - return factory(); - }); - } else if ( true && module.exports) { - // Node. Does not work with strict CommonJS, but - // only CommonJS-like environments that support module.exports, - // like Node. - module.exports = factory(); - } else { - // Browser globals - root.jsonSchema = factory(); - } -}(this, function () {// setup primitive classes to be JSON Schema types -var exports = validate -exports.Integer = {type:"integer"}; -var primitiveConstructors = { - String: String, - Boolean: Boolean, - Number: Number, - Object: Object, - Array: Array, - Date: Date -} -exports.validate = validate; -function validate(/*Any*/instance,/*Object*/schema) { - // Summary: - // To use the validator call JSONSchema.validate with an instance object and an optional schema object. - // If a schema is provided, it will be used to validate. If the instance object refers to a schema (self-validating), - // that schema will be used to validate and the schema parameter is not necessary (if both exist, - // both validations will occur). - // The validate method will return an object with two properties: - // valid: A boolean indicating if the instance is valid by the schema - // errors: An array of validation errors. If there are no errors, then an - // empty list will be returned. A validation error will have two properties: - // property: which indicates which property had the error - // message: which indicates what the error was - // - return validate(instance, schema, {changing: false});//, coerce: false, existingOnly: false}); - }; -exports.checkPropertyChange = function(/*Any*/value,/*Object*/schema, /*String*/property) { - // Summary: - // The checkPropertyChange method will check to see if an value can legally be in property with the given schema - // This is slightly different than the validate method in that it will fail if the schema is readonly and it will - // not check for self-validation, it is assumed that the passed in value is already internally valid. - // The checkPropertyChange method will return the same object type as validate, see JSONSchema.validate for - // information. - // - return validate(value, schema, {changing: property || "property"}); - }; -var validate = exports._validate = function(/*Any*/instance,/*Object*/schema,/*Object*/options) { - - if (!options) options = {}; - var _changing = options.changing; - - function getType(schema){ - return schema.type || (primitiveConstructors[schema.name] == schema && schema.name.toLowerCase()); - } - var errors = []; - // validate a value against a property definition - function checkProp(value, schema, path,i){ - - var l; - path += path ? typeof i == 'number' ? '[' + i + ']' : typeof i == 'undefined' ? '' : '.' + i : i; - function addError(message){ - errors.push({property:path,message:message}); - } - - if((typeof schema != 'object' || schema instanceof Array) && (path || typeof schema != 'function') && !(schema && getType(schema))){ - if(typeof schema == 'function'){ - if(!(value instanceof schema)){ - addError("is not an instance of the class/constructor " + schema.name); - } - }else if(schema){ - addError("Invalid schema/property definition " + schema); - } - return null; - } - if(_changing && schema.readonly){ - addError("is a readonly field, it can not be changed"); - } - if(schema['extends']){ // if it extends another schema, it must pass that schema as well - checkProp(value,schema['extends'],path,i); - } - // validate a value against a type definition - function checkType(type,value){ - if(type){ - if(typeof type == 'string' && type != 'any' && - (type == 'null' ? value !== null : typeof value != type) && - !(value instanceof Array && type == 'array') && - !(value instanceof Date && type == 'date') && - !(type == 'integer' && value%1===0)){ - return [{property:path,message:(typeof value) + " value found, but a " + type + " is required"}]; - } - if(type instanceof Array){ - var unionErrors=[]; - for(var j = 0; j < type.length; j++){ // a union type - if(!(unionErrors=checkType(type[j],value)).length){ - break; - } - } - if(unionErrors.length){ - return unionErrors; - } - }else if(typeof type == 'object'){ - var priorErrors = errors; - errors = []; - checkProp(value,type,path); - var theseErrors = errors; - errors = priorErrors; - return theseErrors; - } - } - return []; - } - if(value === undefined){ - if(schema.required){ - addError("is missing and it is required"); - } - }else{ - errors = errors.concat(checkType(getType(schema),value)); - if(schema.disallow && !checkType(schema.disallow,value).length){ - addError(" disallowed value was matched"); - } - if(value !== null){ - if(value instanceof Array){ - if(schema.items){ - var itemsIsArray = schema.items instanceof Array; - var propDef = schema.items; - for (i = 0, l = value.length; i < l; i += 1) { - if (itemsIsArray) - propDef = schema.items[i]; - if (options.coerce) - value[i] = options.coerce(value[i], propDef); - errors.concat(checkProp(value[i],propDef,path,i)); - } - } - if(schema.minItems && value.length < schema.minItems){ - addError("There must be a minimum of " + schema.minItems + " in the array"); - } - if(schema.maxItems && value.length > schema.maxItems){ - addError("There must be a maximum of " + schema.maxItems + " in the array"); - } - }else if(schema.properties || schema.additionalProperties){ - errors.concat(checkObj(value, schema.properties, path, schema.additionalProperties)); - } - if(schema.pattern && typeof value == 'string' && !value.match(schema.pattern)){ - addError("does not match the regex pattern " + schema.pattern); - } - if(schema.maxLength && typeof value == 'string' && value.length > schema.maxLength){ - addError("may only be " + schema.maxLength + " characters long"); - } - if(schema.minLength && typeof value == 'string' && value.length < schema.minLength){ - addError("must be at least " + schema.minLength + " characters long"); - } - if(typeof schema.minimum !== undefined && typeof value == typeof schema.minimum && - schema.minimum > value){ - addError("must have a minimum value of " + schema.minimum); - } - if(typeof schema.maximum !== undefined && typeof value == typeof schema.maximum && - schema.maximum < value){ - addError("must have a maximum value of " + schema.maximum); - } - if(schema['enum']){ - var enumer = schema['enum']; - l = enumer.length; - var found; - for(var j = 0; j < l; j++){ - if(enumer[j]===value){ - found=1; - break; - } - } - if(!found){ - addError("does not have a value in the enumeration " + enumer.join(", ")); - } - } - if(typeof schema.maxDecimal == 'number' && - (value.toString().match(new RegExp("\\.[0-9]{" + (schema.maxDecimal + 1) + ",}")))){ - addError("may only have " + schema.maxDecimal + " digits of decimal places"); - } - } - } - return null; - } - // validate an object against a schema - function checkObj(instance,objTypeDef,path,additionalProp){ - - if(typeof objTypeDef =='object'){ - if(typeof instance != 'object' || instance instanceof Array){ - errors.push({property:path,message:"an object is required"}); - } - - for(var i in objTypeDef){ - if(objTypeDef.hasOwnProperty(i)){ - var value = instance[i]; - // skip _not_ specified properties - if (value === undefined && options.existingOnly) continue; - var propDef = objTypeDef[i]; - // set default - if(value === undefined && propDef["default"]){ - value = instance[i] = propDef["default"]; - } - if(options.coerce && i in instance){ - value = instance[i] = options.coerce(value, propDef); - } - checkProp(value,propDef,path,i); - } - } - } - for(i in instance){ - if(instance.hasOwnProperty(i) && !(i.charAt(0) == '_' && i.charAt(1) == '_') && objTypeDef && !objTypeDef[i] && additionalProp===false){ - if (options.filter) { - delete instance[i]; - continue; - } else { - errors.push({property:path,message:(typeof value) + "The property " + i + - " is not defined in the schema and the schema does not allow additional properties"}); - } - } - var requires = objTypeDef && objTypeDef[i] && objTypeDef[i].requires; - if(requires && !(requires in instance)){ - errors.push({property:path,message:"the presence of the property " + i + " requires that " + requires + " also be present"}); - } - value = instance[i]; - if(additionalProp && (!(objTypeDef && typeof objTypeDef == 'object') || !(i in objTypeDef))){ - if(options.coerce){ - value = instance[i] = options.coerce(value, additionalProp); - } - checkProp(value,additionalProp,path,i); - } - if(!_changing && value && value.$schema){ - errors = errors.concat(checkProp(value,value.$schema,path,i)); - } - } - return errors; - } - if(schema){ - checkProp(instance,schema,'',_changing || ''); - } - if(!_changing && instance && instance.$schema){ - checkProp(instance,instance.$schema,'',''); - } - return {valid:!errors.length,errors:errors}; -}; -exports.mustBeValid = function(result){ - // summary: - // This checks to ensure that the result is valid and will throw an appropriate error message if it is not - // result: the result returned from checkPropertyChange or validate - if(!result.valid){ - throw new TypeError(result.errors.map(function(error){return "for property " + error.property + ': ' + error.message;}).join(", \n")); - } -} - -return exports; -})); + next(footer); + }.bind(this); +}; +FormData.prototype._lastBoundary = function() { + return '--' + this.getBoundary() + '--' + FormData.LINE_BREAK; +}; -/***/ }), +FormData.prototype.getHeaders = function(userHeaders) { + var header; + var formHeaders = { + 'content-type': 'multipart/form-data; boundary=' + this.getBoundary() + }; -/***/ 958: -/***/ (function(module, __unusedexports, __webpack_require__) { + for (header in userHeaders) { + if (userHeaders.hasOwnProperty(header)) { + formHeaders[header.toLowerCase()] = userHeaders[header]; + } + } -"use strict"; -// Copyright 2010-2012 Mikeal Rogers -// -// Licensed under the Apache License, Version 2.0 (the "License"); -// you may not use this file except in compliance with the License. -// You may obtain a copy of the License at -// -// http://www.apache.org/licenses/LICENSE-2.0 -// -// Unless required by applicable law or agreed to in writing, software -// distributed under the License is distributed on an "AS IS" BASIS, -// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -// See the License for the specific language governing permissions and -// limitations under the License. + return formHeaders; +}; + +FormData.prototype.getBoundary = function() { + if (!this._boundary) { + this._generateBoundary(); + } + return this._boundary; +}; +FormData.prototype._generateBoundary = function() { + // This generates a 50 character boundary similar to those used by Firefox. + // They are optimized for boyer-moore parsing. + var boundary = '--------------------------'; + for (var i = 0; i < 24; i++) { + boundary += Math.floor(Math.random() * 10).toString(16); + } -var extend = __webpack_require__(26) -var cookies = __webpack_require__(569) -var helpers = __webpack_require__(882) + this._boundary = boundary; +}; -var paramsHaveRequestBody = helpers.paramsHaveRequestBody +// Note: getLengthSync DOESN'T calculate streams length +// As workaround one can calculate file size manually +// and add it as knownLength option +FormData.prototype.getLengthSync = function() { + var knownLength = this._overheadLength + this._valueLength; -// organize params for patch, post, put, head, del -function initParams (uri, options, callback) { - if (typeof options === 'function') { - callback = options + // Don't get confused, there are 3 "internal" streams for each keyval pair + // so it basically checks if there is any value added to the form + if (this._streams.length) { + knownLength += this._lastBoundary().length; } - var params = {} - if (typeof options === 'object') { - extend(params, options, {uri: uri}) - } else if (typeof uri === 'string') { - extend(params, {uri: uri}) - } else { - extend(params, uri) + // https://github.com/form-data/form-data/issues/40 + if (!this.hasKnownLength()) { + // Some async length retrievers are present + // therefore synchronous length calculation is false. + // Please use getLength(callback) to get proper length + this._error(new Error('Cannot calculate proper length in synchronous way.')); } - params.callback = callback || params.callback - return params -} + return knownLength; +}; -function request (uri, options, callback) { - if (typeof uri === 'undefined') { - throw new Error('undefined is not a valid uri or options object.') +// Public API to check if length of added values is known +// https://github.com/form-data/form-data/issues/196 +// https://github.com/form-data/form-data/issues/262 +FormData.prototype.hasKnownLength = function() { + var hasKnownLength = true; + + if (this._valuesToMeasure.length) { + hasKnownLength = false; } - var params = initParams(uri, options, callback) + return hasKnownLength; +}; - if (params.method === 'HEAD' && paramsHaveRequestBody(params)) { - throw new Error('HTTP HEAD requests MUST NOT include a request body.') - } +FormData.prototype.getLength = function(cb) { + var knownLength = this._overheadLength + this._valueLength; - return new request.Request(params) -} + if (this._streams.length) { + knownLength += this._lastBoundary().length; + } -function verbFunc (verb) { - var method = verb.toUpperCase() - return function (uri, options, callback) { - var params = initParams(uri, options, callback) - params.method = method - return request(params, params.callback) + if (!this._valuesToMeasure.length) { + process.nextTick(cb.bind(this, null, knownLength)); + return; } -} -// define like this to please codeintel/intellisense IDEs -request.get = verbFunc('get') -request.head = verbFunc('head') -request.options = verbFunc('options') -request.post = verbFunc('post') -request.put = verbFunc('put') -request.patch = verbFunc('patch') -request.del = verbFunc('delete') -request['delete'] = verbFunc('delete') + asynckit.parallel(this._valuesToMeasure, this._lengthRetriever, function(err, values) { + if (err) { + cb(err); + return; + } -request.jar = function (store) { - return cookies.jar(store) -} + values.forEach(function(length) { + knownLength += length; + }); -request.cookie = function (str) { - return cookies.parse(str) -} + cb(null, knownLength); + }); +}; -function wrapRequestMethod (method, options, requester, verb) { - return function (uri, opts, callback) { - var params = initParams(uri, opts, callback) +FormData.prototype.submit = function(params, cb) { + var request + , options + , defaults = {method: 'post'} + ; - var target = {} - extend(true, target, options, params) + // parse provided url if it's string + // or treat it as options object + if (typeof params == 'string') { - target.pool = params.pool || options.pool + params = parseUrl(params); + options = populate({ + port: params.port, + path: params.pathname, + host: params.hostname, + protocol: params.protocol + }, defaults); - if (verb) { - target.method = verb.toUpperCase() - } + // use custom params + } else { - if (typeof requester === 'function') { - method = requester + options = populate(params, defaults); + // if no port provided use default one + if (!options.port) { + options.port = options.protocol == 'https:' ? 443 : 80; } - - return method(target, target.callback) } -} -request.defaults = function (options, requester) { - var self = this - - options = options || {} + // put that good code in getHeaders to some use + options.headers = this.getHeaders(params.headers); - if (typeof options === 'function') { - requester = options - options = {} + // https if specified, fallback to http in any other case + if (options.protocol == 'https:') { + request = https.request(options); + } else { + request = http.request(options); } - var defaults = wrapRequestMethod(self, options, requester) - - var verbs = ['get', 'head', 'post', 'put', 'patch', 'del', 'delete'] - verbs.forEach(function (verb) { - defaults[verb] = wrapRequestMethod(self[verb], options, requester, verb) - }) - - defaults.cookie = wrapRequestMethod(self.cookie, options, requester) - defaults.jar = self.jar - defaults.defaults = self.defaults - return defaults -} - -request.forever = function (agentOptions, optionsArg) { - var options = {} - if (optionsArg) { - extend(options, optionsArg) - } - if (agentOptions) { - options.agentOptions = agentOptions - } + // get content length and fire away + this.getLength(function(err, length) { + if (err) { + this._error(err); + return; + } - options.forever = true - return request.defaults(options) -} + // add content length + request.setHeader('Content-Length', length); -// Exports + this.pipe(request); + if (cb) { + request.on('error', cb); + request.on('response', cb.bind(this, null)); + } + }.bind(this)); -module.exports = request -request.Request = __webpack_require__(970) -request.initParams = initParams + return request; +}; -// Backwards compatibility for request.debug -Object.defineProperty(request, 'debug', { - enumerable: true, - get: function () { - return request.Request.debug - }, - set: function (debug) { - request.Request.debug = debug +FormData.prototype._error = function(err) { + if (!this.error) { + this.error = err; + this.pause(); + this.emit('error', err); } -}) +}; + +FormData.prototype.toString = function () { + return '[object FormData]'; +}; /***/ }), -/***/ 962: +/***/ 939: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2017 Joyent, Inc. - -module.exports = { - read: read, - write: write -}; +var abort = __webpack_require__(566) + , async = __webpack_require__(751) + ; -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); -var utils = __webpack_require__(57); -var SSHBuffer = __webpack_require__(981); -var Dhe = __webpack_require__(99); +// API +module.exports = terminator; -var supportedAlgos = { - 'rsa-sha1' : 5, - 'rsa-sha256' : 8, - 'rsa-sha512' : 10, - 'ecdsa-p256-sha256' : 13, - 'ecdsa-p384-sha384' : 14 - /* - * ed25519 is hypothetically supported with id 15 - * but the common tools available don't appear to be - * capable of generating/using ed25519 keys - */ -}; +/** + * Terminates jobs in the attached state context + * + * @this AsyncKitState# + * @param {function} callback - final callback to invoke after termination + */ +function terminator(callback) +{ + if (!Object.keys(this.jobs).length) + { + return; + } -var supportedAlgosById = {}; -Object.keys(supportedAlgos).forEach(function (k) { - supportedAlgosById[supportedAlgos[k]] = k.toUpperCase(); -}); + // fast forward iteration index + this.index = this.size; -function read(buf, options) { - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); - } - var lines = buf.split('\n'); - if (lines[0].match(/^Private-key-format\: v1/)) { - var algElems = lines[1].split(' '); - var algoNum = parseInt(algElems[1], 10); - var algoName = algElems[2]; - if (!supportedAlgosById[algoNum]) - throw (new Error('Unsupported algorithm: ' + algoName)); - return (readDNSSECPrivateKey(algoNum, lines.slice(2))); - } + // abort jobs + abort(this); - // skip any comment-lines - var line = 0; - /* JSSTYLED */ - while (lines[line].match(/^\;/)) - line++; - // we should now have *one single* line left with our KEY on it. - if ((lines[line].match(/\. IN KEY /) || - lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) { - return (readRFC3110(lines[line])); - } - throw (new Error('Cannot parse dnssec key')); + // send back results we have so far + async(callback)(null, this.results); } -function readRFC3110(keyString) { - var elems = keyString.split(' '); - //unused var flags = parseInt(elems[3], 10); - //unused var protocol = parseInt(elems[4], 10); - var algorithm = parseInt(elems[5], 10); - if (!supportedAlgosById[algorithm]) - throw (new Error('Unsupported algorithm: ' + algorithm)); - var base64key = elems.slice(6, elems.length).join(); - var keyBuffer = Buffer.from(base64key, 'base64'); - if (supportedAlgosById[algorithm].match(/^RSA-/)) { - // join the rest of the body into a single base64-blob - var publicExponentLen = keyBuffer.readUInt8(0); - if (publicExponentLen != 3 && publicExponentLen != 1) - throw (new Error('Cannot parse dnssec key: ' + - 'unsupported exponent length')); - var publicExponent = keyBuffer.slice(1, publicExponentLen+1); - publicExponent = utils.mpNormalize(publicExponent); - var modulus = keyBuffer.slice(1+publicExponentLen); - modulus = utils.mpNormalize(modulus); - // now, make the key - var rsaKey = { - type: 'rsa', - parts: [] - }; - rsaKey.parts.push({ name: 'e', data: publicExponent}); - rsaKey.parts.push({ name: 'n', data: modulus}); - return (new Key(rsaKey)); - } - if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' || - supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') { - var curve = 'nistp384'; - var size = 384; - if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) { - curve = 'nistp256'; - size = 256; - } +/***/ }), - var ecdsaKey = { - type: 'ecdsa', - curve: curve, - size: size, - parts: [ - {name: 'curve', data: Buffer.from(curve) }, - {name: 'Q', data: utils.ecNormalize(keyBuffer) } - ] - }; - return (new Key(ecdsaKey)); - } - throw (new Error('Unsupported algorithm: ' + - supportedAlgosById[algorithm])); -} +/***/ 940: +/***/ (function(module, __unusedexports, __webpack_require__) { -function elementToBuf(e) { - return (Buffer.from(e.split(' ')[1], 'base64')); -} +// Copyright 2015 Joyent, Inc. -function readDNSSECRSAPrivateKey(elements) { - var rsaParams = {}; - elements.forEach(function (element) { - if (element.split(' ')[0] === 'Modulus:') - rsaParams['n'] = elementToBuf(element); - else if (element.split(' ')[0] === 'PublicExponent:') - rsaParams['e'] = elementToBuf(element); - else if (element.split(' ')[0] === 'PrivateExponent:') - rsaParams['d'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Prime1:') - rsaParams['p'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Prime2:') - rsaParams['q'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Exponent1:') - rsaParams['dmodp'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Exponent2:') - rsaParams['dmodq'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Coefficient:') - rsaParams['iqmp'] = elementToBuf(element); - }); - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'e', data: utils.mpNormalize(rsaParams['e'])}, - { name: 'n', data: utils.mpNormalize(rsaParams['n'])}, - { name: 'd', data: utils.mpNormalize(rsaParams['d'])}, - { name: 'p', data: utils.mpNormalize(rsaParams['p'])}, - { name: 'q', data: utils.mpNormalize(rsaParams['q'])}, - { name: 'dmodp', - data: utils.mpNormalize(rsaParams['dmodp'])}, - { name: 'dmodq', - data: utils.mpNormalize(rsaParams['dmodq'])}, - { name: 'iqmp', - data: utils.mpNormalize(rsaParams['iqmp'])} - ] - }; - return (new PrivateKey(key)); -} +module.exports = SSHBuffer; -function readDNSSECPrivateKey(alg, elements) { - if (supportedAlgosById[alg].match(/^RSA-/)) { - return (readDNSSECRSAPrivateKey(elements)); - } - if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' || - supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { - var d = Buffer.from(elements[0].split(' ')[1], 'base64'); - var curve = 'nistp384'; - var size = 384; - if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { - curve = 'nistp256'; - size = 256; - } - // DNSSEC generates the public-key on the fly (go calculate it) - var publicKey = utils.publicFromPrivateECDSA(curve, d); - var Q = publicKey.part['Q'].data; - var ecdsaKey = { - type: 'ecdsa', - curve: curve, - size: size, - parts: [ - {name: 'curve', data: Buffer.from(curve) }, - {name: 'd', data: d }, - {name: 'Q', data: Q } - ] - }; - return (new PrivateKey(ecdsaKey)); - } - throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg])); -} +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; -function dnssecTimestamp(date) { - var year = date.getFullYear() + ''; //stringify - var month = (date.getMonth() + 1); - var timestampStr = year + month + date.getUTCDate(); - timestampStr += '' + date.getUTCHours() + date.getUTCMinutes(); - timestampStr += date.getUTCSeconds(); - return (timestampStr); -} +function SSHBuffer(opts) { + assert.object(opts, 'options'); + if (opts.buffer !== undefined) + assert.buffer(opts.buffer, 'options.buffer'); -function rsaAlgFromOptions(opts) { - if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1') - return ('5 (RSASHA1)'); - else if (opts.hashAlgo === 'sha256') - return ('8 (RSASHA256)'); - else if (opts.hashAlgo === 'sha512') - return ('10 (RSASHA512)'); - else - throw (new Error('Unknown or unsupported hash: ' + - opts.hashAlgo)); + this._size = opts.buffer ? opts.buffer.length : 1024; + this._buffer = opts.buffer || Buffer.alloc(this._size); + this._offset = 0; } -function writeRSA(key, options) { - // if we're missing parts, add them. - if (!key.part.dmodp || !key.part.dmodq) { - utils.addRSAMissing(key); - } - - var out = ''; - out += 'Private-key-format: v1.3\n'; - out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n'; - var n = utils.mpDenormalize(key.part['n'].data); - out += 'Modulus: ' + n.toString('base64') + '\n'; - var e = utils.mpDenormalize(key.part['e'].data); - out += 'PublicExponent: ' + e.toString('base64') + '\n'; - var d = utils.mpDenormalize(key.part['d'].data); - out += 'PrivateExponent: ' + d.toString('base64') + '\n'; - var p = utils.mpDenormalize(key.part['p'].data); - out += 'Prime1: ' + p.toString('base64') + '\n'; - var q = utils.mpDenormalize(key.part['q'].data); - out += 'Prime2: ' + q.toString('base64') + '\n'; - var dmodp = utils.mpDenormalize(key.part['dmodp'].data); - out += 'Exponent1: ' + dmodp.toString('base64') + '\n'; - var dmodq = utils.mpDenormalize(key.part['dmodq'].data); - out += 'Exponent2: ' + dmodq.toString('base64') + '\n'; - var iqmp = utils.mpDenormalize(key.part['iqmp'].data); - out += 'Coefficient: ' + iqmp.toString('base64') + '\n'; - // Assume that we're valid as-of now - var timestamp = new Date(); - out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; - return (Buffer.from(out, 'ascii')); -} +SSHBuffer.prototype.toBuffer = function () { + return (this._buffer.slice(0, this._offset)); +}; -function writeECDSA(key, options) { - var out = ''; - out += 'Private-key-format: v1.3\n'; +SSHBuffer.prototype.atEnd = function () { + return (this._offset >= this._buffer.length); +}; - if (key.curve === 'nistp256') { - out += 'Algorithm: 13 (ECDSAP256SHA256)\n'; - } else if (key.curve === 'nistp384') { - out += 'Algorithm: 14 (ECDSAP384SHA384)\n'; - } else { - throw (new Error('Unsupported curve')); - } - var base64Key = key.part['d'].data.toString('base64'); - out += 'PrivateKey: ' + base64Key + '\n'; +SSHBuffer.prototype.remainder = function () { + return (this._buffer.slice(this._offset)); +}; - // Assume that we're valid as-of now - var timestamp = new Date(); - out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; +SSHBuffer.prototype.skip = function (n) { + this._offset += n; +}; - return (Buffer.from(out, 'ascii')); -} +SSHBuffer.prototype.expand = function () { + this._size *= 2; + var buf = Buffer.alloc(this._size); + this._buffer.copy(buf, 0); + this._buffer = buf; +}; -function write(key, options) { - if (PrivateKey.isPrivateKey(key)) { - if (key.type === 'rsa') { - return (writeRSA(key, options)); - } else if (key.type === 'ecdsa') { - return (writeECDSA(key, options)); - } else { - throw (new Error('Unsupported algorithm: ' + key.type)); - } - } else if (Key.isKey(key)) { - /* - * RFC3110 requires a keyname, and a keytype, which we - * don't really have a mechanism for specifying such - * additional metadata. - */ - throw (new Error('Format "dnssec" only supports ' + - 'writing private keys')); - } else { - throw (new Error('key is not a Key or PrivateKey')); - } -} +SSHBuffer.prototype.readPart = function () { + return ({data: this.readBuffer()}); +}; +SSHBuffer.prototype.readBuffer = function () { + var len = this._buffer.readUInt32BE(this._offset); + this._offset += 4; + assert.ok(this._offset + len <= this._buffer.length, + 'length out of bounds at +0x' + this._offset.toString(16) + + ' (data truncated?)'); + var buf = this._buffer.slice(this._offset, this._offset + len); + this._offset += len; + return (buf); +}; -/***/ }), +SSHBuffer.prototype.readString = function () { + return (this.readBuffer().toString()); +}; -/***/ 970: -/***/ (function(module, __unusedexports, __webpack_require__) { +SSHBuffer.prototype.readCString = function () { + var offset = this._offset; + while (offset < this._buffer.length && + this._buffer[offset] !== 0x00) + offset++; + assert.ok(offset < this._buffer.length, 'c string does not terminate'); + var str = this._buffer.slice(this._offset, offset).toString(); + this._offset = offset + 1; + return (str); +}; -"use strict"; +SSHBuffer.prototype.readInt = function () { + var v = this._buffer.readUInt32BE(this._offset); + this._offset += 4; + return (v); +}; +SSHBuffer.prototype.readInt64 = function () { + assert.ok(this._offset + 8 < this._buffer.length, + 'buffer not long enough to read Int64'); + var v = this._buffer.slice(this._offset, this._offset + 8); + this._offset += 8; + return (v); +}; -var http = __webpack_require__(605) -var https = __webpack_require__(211) -var url = __webpack_require__(835) -var util = __webpack_require__(669) -var stream = __webpack_require__(413) -var zlib = __webpack_require__(903) -var aws2 = __webpack_require__(885) -var aws4 = __webpack_require__(769) -var httpSignature = __webpack_require__(115) -var mime = __webpack_require__(667) -var caseless = __webpack_require__(48) -var ForeverAgent = __webpack_require__(929) -var FormData = __webpack_require__(932) -var extend = __webpack_require__(26) -var isstream = __webpack_require__(414) -var isTypedArray = __webpack_require__(819).strict -var helpers = __webpack_require__(882) -var cookies = __webpack_require__(569) -var getProxyFromURI = __webpack_require__(474) -var Querystring = __webpack_require__(112).Querystring -var Har = __webpack_require__(616).Har -var Auth = __webpack_require__(621).Auth -var OAuth = __webpack_require__(461).OAuth -var hawk = __webpack_require__(982) -var Multipart = __webpack_require__(582).Multipart -var Redirect = __webpack_require__(606).Redirect -var Tunnel = __webpack_require__(847).Tunnel -var now = __webpack_require__(905) -var Buffer = __webpack_require__(612).Buffer +SSHBuffer.prototype.readChar = function () { + var v = this._buffer[this._offset++]; + return (v); +}; -var safeStringify = helpers.safeStringify -var isReadStream = helpers.isReadStream -var toBase64 = helpers.toBase64 -var defer = helpers.defer -var copy = helpers.copy -var version = helpers.version -var globalCookieJar = cookies.jar() +SSHBuffer.prototype.writeBuffer = function (buf) { + while (this._offset + 4 + buf.length > this._size) + this.expand(); + this._buffer.writeUInt32BE(buf.length, this._offset); + this._offset += 4; + buf.copy(this._buffer, this._offset); + this._offset += buf.length; +}; -var globalPool = {} +SSHBuffer.prototype.writeString = function (str) { + this.writeBuffer(Buffer.from(str, 'utf8')); +}; -function filterForNonReserved (reserved, options) { - // Filter out properties that are not reserved. - // Reserved values are passed in at call site. +SSHBuffer.prototype.writeCString = function (str) { + while (this._offset + 1 + str.length > this._size) + this.expand(); + this._buffer.write(str, this._offset); + this._offset += str.length; + this._buffer[this._offset++] = 0; +}; - var object = {} - for (var i in options) { - var notReserved = (reserved.indexOf(i) === -1) - if (notReserved) { - object[i] = options[i] - } - } - return object -} +SSHBuffer.prototype.writeInt = function (v) { + while (this._offset + 4 > this._size) + this.expand(); + this._buffer.writeUInt32BE(v, this._offset); + this._offset += 4; +}; -function filterOutReservedFunctions (reserved, options) { - // Filter out properties that are functions and are reserved. - // Reserved values are passed in at call site. +SSHBuffer.prototype.writeInt64 = function (v) { + assert.buffer(v, 'value'); + if (v.length > 8) { + var lead = v.slice(0, v.length - 8); + for (var i = 0; i < lead.length; ++i) { + assert.strictEqual(lead[i], 0, + 'must fit in 64 bits of precision'); + } + v = v.slice(v.length - 8, v.length); + } + while (this._offset + 8 > this._size) + this.expand(); + v.copy(this._buffer, this._offset); + this._offset += 8; +}; - var object = {} - for (var i in options) { - var isReserved = !(reserved.indexOf(i) === -1) - var isFunction = (typeof options[i] === 'function') - if (!(isReserved && isFunction)) { - object[i] = options[i] - } - } - return object -} +SSHBuffer.prototype.writeChar = function (v) { + while (this._offset + 1 > this._size) + this.expand(); + this._buffer[this._offset++] = v; +}; -// Return a simpler request object to allow serialization -function requestToJSON () { - var self = this - return { - uri: self.uri, - method: self.method, - headers: self.headers - } -} +SSHBuffer.prototype.writePart = function (p) { + this.writeBuffer(p.data); +}; -// Return a simpler response object to allow serialization -function responseToJSON () { - var self = this - return { - statusCode: self.statusCode, - body: self.body, - headers: self.headers, - request: requestToJSON.call(self.request) - } -} +SSHBuffer.prototype.write = function (buf) { + while (this._offset + buf.length > this._size) + this.expand(); + buf.copy(this._buffer, this._offset); + this._offset += buf.length; +}; -function Request (options) { - // if given the method property in options, set property explicitMethod to true - // extend the Request instance with any non-reserved properties - // remove any reserved functions from the options object - // set Request instance to be readable and writable - // call init +/***/ }), - var self = this +/***/ 942: +/***/ (function(module, __unusedexports, __webpack_require__) { - // start with HAR, then override with additional options - if (options.har) { - self._har = new Har(self) - options = self._har.options(options) - } - stream.Stream.call(self) - var reserved = Object.keys(Request.prototype) - var nonReserved = filterForNonReserved(reserved, options) +/*! + * Copyright 2010 LearnBoost + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ - extend(self, nonReserved) - options = filterOutReservedFunctions(reserved, options) +/** + * Module dependencies. + */ - self.readable = true - self.writable = true - if (options.method) { - self.explicitMethod = true - } - self._qs = new Querystring(self) - self._auth = new Auth(self) - self._oauth = new OAuth(self) - self._multipart = new Multipart(self) - self._redirect = new Redirect(self) - self._tunnel = new Tunnel(self) - self.init(options) -} +var crypto = __webpack_require__(417) + , parse = __webpack_require__(835).parse + ; -util.inherits(Request, stream.Stream) +/** + * Valid keys. + */ -// Debugging -Request.debug = process.env.NODE_DEBUG && /\brequest\b/.test(process.env.NODE_DEBUG) -function debug () { - if (Request.debug) { - console.error('REQUEST %s', util.format.apply(util, arguments)) - } -} -Request.prototype.debug = debug +var keys = + [ 'acl' + , 'location' + , 'logging' + , 'notification' + , 'partNumber' + , 'policy' + , 'requestPayment' + , 'torrent' + , 'uploadId' + , 'uploads' + , 'versionId' + , 'versioning' + , 'versions' + , 'website' + ] -Request.prototype.init = function (options) { - // init() contains all the code to setup the request object. - // the actual outgoing request is not started until start() is called - // this function is called from both the constructor and on redirect. - var self = this - if (!options) { - options = {} - } - self.headers = self.headers ? copy(self.headers) : {} +/** + * Return an "Authorization" header value with the given `options` + * in the form of "AWS :" + * + * @param {Object} options + * @return {String} + * @api private + */ - // Delete headers with value undefined since they break - // ClientRequest.OutgoingMessage.setHeader in node 0.12 - for (var headerName in self.headers) { - if (typeof self.headers[headerName] === 'undefined') { - delete self.headers[headerName] - } - } +function authorization (options) { + return 'AWS ' + options.key + ':' + sign(options) +} - caseless.httpify(self, self.headers) +module.exports = authorization +module.exports.authorization = authorization - if (!self.method) { - self.method = options.method || 'GET' - } - if (!self.localAddress) { - self.localAddress = options.localAddress - } +/** + * Simple HMAC-SHA1 Wrapper + * + * @param {Object} options + * @return {String} + * @api private + */ - self._qs.init(options) +function hmacSha1 (options) { + return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64') +} - debug(options) - if (!self.pool && self.pool !== false) { - self.pool = globalPool - } - self.dests = self.dests || [] - self.__isRequestRequest = true +module.exports.hmacSha1 = hmacSha1 - // Protect against double callback - if (!self._callback && self.callback) { - self._callback = self.callback - self.callback = function () { - if (self._callbackCalled) { - return // Print a warning maybe? - } - self._callbackCalled = true - self._callback.apply(self, arguments) - } - self.on('error', self.callback.bind()) - self.on('complete', self.callback.bind(self, null)) - } +/** + * Create a base64 sha1 HMAC for `options`. + * + * @param {Object} options + * @return {String} + * @api private + */ - // People use this property instead all the time, so support it - if (!self.uri && self.url) { - self.uri = self.url - delete self.url - } +function sign (options) { + options.message = stringToSign(options) + return hmacSha1(options) +} +module.exports.sign = sign - // If there's a baseUrl, then use it as the base URL (i.e. uri must be - // specified as a relative path and is appended to baseUrl). - if (self.baseUrl) { - if (typeof self.baseUrl !== 'string') { - return self.emit('error', new Error('options.baseUrl must be a string')) - } +/** + * Create a base64 sha1 HMAC for `options`. + * + * Specifically to be used with S3 presigned URLs + * + * @param {Object} options + * @return {String} + * @api private + */ - if (typeof self.uri !== 'string') { - return self.emit('error', new Error('options.uri must be a string when using options.baseUrl')) - } +function signQuery (options) { + options.message = queryStringToSign(options) + return hmacSha1(options) +} +module.exports.signQuery= signQuery - if (self.uri.indexOf('//') === 0 || self.uri.indexOf('://') !== -1) { - return self.emit('error', new Error('options.uri must be a path when using options.baseUrl')) - } +/** + * Return a string for sign() with the given `options`. + * + * Spec: + * + * \n + * \n + * \n + * \n + * [headers\n] + * + * + * @param {Object} options + * @return {String} + * @api private + */ - // Handle all cases to make sure that there's only one slash between - // baseUrl and uri. - var baseUrlEndsWithSlash = self.baseUrl.lastIndexOf('/') === self.baseUrl.length - 1 - var uriStartsWithSlash = self.uri.indexOf('/') === 0 +function stringToSign (options) { + var headers = options.amazonHeaders || '' + if (headers) headers += '\n' + var r = + [ options.verb + , options.md5 + , options.contentType + , options.date ? options.date.toUTCString() : '' + , headers + options.resource + ] + return r.join('\n') +} +module.exports.stringToSign = stringToSign - if (baseUrlEndsWithSlash && uriStartsWithSlash) { - self.uri = self.baseUrl + self.uri.slice(1) - } else if (baseUrlEndsWithSlash || uriStartsWithSlash) { - self.uri = self.baseUrl + self.uri - } else if (self.uri === '') { - self.uri = self.baseUrl - } else { - self.uri = self.baseUrl + '/' + self.uri - } - delete self.baseUrl - } +/** + * Return a string for sign() with the given `options`, but is meant exclusively + * for S3 presigned URLs + * + * Spec: + * + * \n + * + * + * @param {Object} options + * @return {String} + * @api private + */ - // A URI is needed by this point, emit error if we haven't been able to get one - if (!self.uri) { - return self.emit('error', new Error('options.uri is a required argument')) - } +function queryStringToSign (options){ + return 'GET\n\n\n' + options.date + '\n' + options.resource +} +module.exports.queryStringToSign = queryStringToSign - // If a string URI/URL was given, parse it into a URL object - if (typeof self.uri === 'string') { - self.uri = url.parse(self.uri) - } +/** + * Perform the following: + * + * - ignore non-amazon headers + * - lowercase fields + * - sort lexicographically + * - trim whitespace between ":" + * - join with newline + * + * @param {Object} headers + * @return {String} + * @api private + */ - // Some URL objects are not from a URL parsed string and need href added - if (!self.uri.href) { - self.uri.href = url.format(self.uri) +function canonicalizeHeaders (headers) { + var buf = [] + , fields = Object.keys(headers) + ; + for (var i = 0, len = fields.length; i < len; ++i) { + var field = fields[i] + , val = headers[field] + , field = field.toLowerCase() + ; + if (0 !== field.indexOf('x-amz')) continue + buf.push(field + ':' + val) } + return buf.sort().join('\n') +} +module.exports.canonicalizeHeaders = canonicalizeHeaders - // DEPRECATED: Warning for users of the old Unix Sockets URL Scheme - if (self.uri.protocol === 'unix:') { - return self.emit('error', new Error('`unix://` URL scheme is no longer supported. Please use the format `http://unix:SOCKET:PATH`')) - } +/** + * Perform the following: + * + * - ignore non sub-resources + * - sort lexicographically + * + * @param {String} resource + * @return {String} + * @api private + */ - // Support Unix Sockets - if (self.uri.host === 'unix') { - self.enableUnixSocket() - } +function canonicalizeResource (resource) { + var url = parse(resource, true) + , path = url.pathname + , buf = [] + ; - if (self.strictSSL === false) { - self.rejectUnauthorized = false - } + Object.keys(url.query).forEach(function(key){ + if (!~keys.indexOf(key)) return + var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key]) + buf.push(key + val) + }) - if (!self.uri.pathname) { self.uri.pathname = '/' } + return path + (buf.length ? '?' + buf.sort().join('&') : '') +} +module.exports.canonicalizeResource = canonicalizeResource - if (!(self.uri.host || (self.uri.hostname && self.uri.port)) && !self.uri.isUnix) { - // Invalid URI: it may generate lot of bad errors, like 'TypeError: Cannot call method `indexOf` of undefined' in CookieJar - // Detect and reject it as soon as possible - var faultyUri = url.format(self.uri) - var message = 'Invalid URI "' + faultyUri + '"' - if (Object.keys(options).length === 0) { - // No option ? This can be the sign of a redirect - // As this is a case where the user cannot do anything (they didn't call request directly with this URL) - // they should be warned that it can be caused by a redirection (can save some hair) - message += '. This can be caused by a crappy redirection.' - } - // This error was fatal - self.abort() - return self.emit('error', new Error(message)) - } - if (!self.hasOwnProperty('proxy')) { - self.proxy = getProxyFromURI(self.uri) - } +/***/ }), - self.tunnel = self._tunnel.isEnabled() - if (self.proxy) { - self._tunnel.setup(options) - } +/***/ 944: +/***/ (function(module) { - self._redirect.onRequest(options) +module.exports = isTypedArray +isTypedArray.strict = isStrictTypedArray +isTypedArray.loose = isLooseTypedArray - self.setHost = false - if (!self.hasHeader('host')) { - var hostHeaderName = self.originalHostHeaderName || 'host' - self.setHeader(hostHeaderName, self.uri.host) - // Drop :port suffix from Host header if known protocol. - if (self.uri.port) { - if ((self.uri.port === '80' && self.uri.protocol === 'http:') || - (self.uri.port === '443' && self.uri.protocol === 'https:')) { - self.setHeader(hostHeaderName, self.uri.hostname) - } - } - self.setHost = true - } +var toString = Object.prototype.toString +var names = { + '[object Int8Array]': true + , '[object Int16Array]': true + , '[object Int32Array]': true + , '[object Uint8Array]': true + , '[object Uint8ClampedArray]': true + , '[object Uint16Array]': true + , '[object Uint32Array]': true + , '[object Float32Array]': true + , '[object Float64Array]': true +} - self.jar(self._jar || options.jar) +function isTypedArray(arr) { + return ( + isStrictTypedArray(arr) + || isLooseTypedArray(arr) + ) +} - if (!self.uri.port) { - if (self.uri.protocol === 'http:') { self.uri.port = 80 } else if (self.uri.protocol === 'https:') { self.uri.port = 443 } - } +function isStrictTypedArray(arr) { + return ( + arr instanceof Int8Array + || arr instanceof Int16Array + || arr instanceof Int32Array + || arr instanceof Uint8Array + || arr instanceof Uint8ClampedArray + || arr instanceof Uint16Array + || arr instanceof Uint32Array + || arr instanceof Float32Array + || arr instanceof Float64Array + ) +} - if (self.proxy && !self.tunnel) { - self.port = self.proxy.port - self.host = self.proxy.hostname - } else { - self.port = self.uri.port - self.host = self.uri.hostname - } +function isLooseTypedArray(arr) { + return names[toString.call(arr)] +} - if (options.form) { - self.form(options.form) - } - if (options.formData) { - var formData = options.formData - var requestForm = self.form() - var appendFormValue = function (key, value) { - if (value && value.hasOwnProperty('value') && value.hasOwnProperty('options')) { - requestForm.append(key, value.value, value.options) - } else { - requestForm.append(key, value) - } - } - for (var formKey in formData) { - if (formData.hasOwnProperty(formKey)) { - var formValue = formData[formKey] - if (formValue instanceof Array) { - for (var j = 0; j < formValue.length; j++) { - appendFormValue(formKey, formValue[j]) - } - } else { - appendFormValue(formKey, formValue) - } - } - } - } +/***/ }), - if (options.qs) { - self.qs(options.qs) - } +/***/ 952: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (self.uri.path) { - self.path = self.uri.path - } else { - self.path = self.uri.pathname + (self.uri.search || '') - } +"use strict"; - if (self.path.length === 0) { - self.path = '/' - } - // Auth must happen last in case signing is dependent on other headers - if (options.aws) { - self.aws(options.aws) - } +var metaSchema = __webpack_require__(522); - if (options.hawk) { - self.hawk(options.hawk) +module.exports = { + $id: 'https://github.com/epoberezkin/ajv/blob/master/lib/definition_schema.js', + definitions: { + simpleTypes: metaSchema.definitions.simpleTypes + }, + type: 'object', + dependencies: { + schema: ['validate'], + $data: ['validate'], + statements: ['inline'], + valid: {not: {required: ['macro']}} + }, + properties: { + type: metaSchema.properties.type, + schema: {type: 'boolean'}, + statements: {type: 'boolean'}, + dependencies: { + type: 'array', + items: {type: 'string'} + }, + metaSchema: {type: 'object'}, + modifying: {type: 'boolean'}, + valid: {type: 'boolean'}, + $data: {type: 'boolean'}, + async: {type: 'boolean'}, + errors: { + anyOf: [ + {type: 'boolean'}, + {const: 'full'} + ] + } } +}; - if (options.httpSignature) { - self.httpSignature(options.httpSignature) - } - if (options.auth) { - if (Object.prototype.hasOwnProperty.call(options.auth, 'username')) { - options.auth.user = options.auth.username - } - if (Object.prototype.hasOwnProperty.call(options.auth, 'password')) { - options.auth.pass = options.auth.password - } +/***/ }), - self.auth( - options.auth.user, - options.auth.pass, - options.auth.sendImmediately, - options.auth.bearer - ) - } +/***/ 955: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (self.gzip && !self.hasHeader('accept-encoding')) { - self.setHeader('accept-encoding', 'gzip, deflate') - } +"use strict"; - if (self.uri.auth && !self.hasHeader('authorization')) { - var uriAuthPieces = self.uri.auth.split(':').map(function (item) { return self._qs.unescape(item) }) - self.auth(uriAuthPieces[0], uriAuthPieces.slice(1).join(':'), true) - } - if (!self.tunnel && self.proxy && self.proxy.auth && !self.hasHeader('proxy-authorization')) { - var proxyAuthPieces = self.proxy.auth.split(':').map(function (item) { return self._qs.unescape(item) }) - var authHeader = 'Basic ' + toBase64(proxyAuthPieces.join(':')) - self.setHeader('proxy-authorization', authHeader) - } +var util = __webpack_require__(855); - if (self.proxy && !self.tunnel) { - self.path = (self.uri.protocol + '//' + self.uri.host + self.path) - } +module.exports = SchemaObject; - if (options.json) { - self.json(options.json) - } - if (options.multipart) { - self.multipart(options.multipart) - } +function SchemaObject(obj) { + util.copy(obj, this); +} - if (options.time) { - self.timing = true - // NOTE: elapsedTime is deprecated in favor of .timings - self.elapsedTime = self.elapsedTime || 0 - } +/***/ }), - function setContentLength () { - if (isTypedArray(self.body)) { - self.body = Buffer.from(self.body) - } +/***/ 956: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (!self.hasHeader('content-length')) { - var length - if (typeof self.body === 'string') { - length = Buffer.byteLength(self.body) - } else if (Array.isArray(self.body)) { - length = self.body.reduce(function (a, b) { return a + b.length }, 0) - } else { - length = self.body.length - } +/* + * verror.js: richer JavaScript errors + */ - if (length) { - self.setHeader('content-length', length) - } else { - self.emit('error', new Error('Argument error, options.body.')) - } - } - } - if (self.body && !isstream(self.body)) { - setContentLength() - } +var mod_assertplus = __webpack_require__(477); +var mod_util = __webpack_require__(669); - if (options.oauth) { - self.oauth(options.oauth) - } else if (self._oauth.params && self.hasHeader('authorization')) { - self.oauth(self._oauth.params) - } +var mod_extsprintf = __webpack_require__(697); +var mod_isError = __webpack_require__(286).isError; +var sprintf = mod_extsprintf.sprintf; - var protocol = self.proxy && !self.tunnel ? self.proxy.protocol : self.uri.protocol - var defaultModules = {'http:': http, 'https:': https} - var httpModules = self.httpModules || {} +/* + * Public interface + */ - self.httpModule = httpModules[protocol] || defaultModules[protocol] +/* So you can 'var VError = require('verror')' */ +module.exports = VError; +/* For compatibility */ +VError.VError = VError; +/* Other exported classes */ +VError.SError = SError; +VError.WError = WError; +VError.MultiError = MultiError; - if (!self.httpModule) { - return self.emit('error', new Error('Invalid protocol: ' + protocol)) - } +/* + * Common function used to parse constructor arguments for VError, WError, and + * SError. Named arguments to this function: + * + * strict force strict interpretation of sprintf arguments, even + * if the options in "argv" don't say so + * + * argv error's constructor arguments, which are to be + * interpreted as described in README.md. For quick + * reference, "argv" has one of the following forms: + * + * [ sprintf_args... ] (argv[0] is a string) + * [ cause, sprintf_args... ] (argv[0] is an Error) + * [ options, sprintf_args... ] (argv[0] is an object) + * + * This function normalizes these forms, producing an object with the following + * properties: + * + * options equivalent to "options" in third form. This will never + * be a direct reference to what the caller passed in + * (i.e., it may be a shallow copy), so it can be freely + * modified. + * + * shortmessage result of sprintf(sprintf_args), taking options.strict + * into account as described in README.md. + */ +function parseConstructorArguments(args) +{ + var argv, options, sprintf_args, shortmessage, k; - if (options.ca) { - self.ca = options.ca - } + mod_assertplus.object(args, 'args'); + mod_assertplus.bool(args.strict, 'args.strict'); + mod_assertplus.array(args.argv, 'args.argv'); + argv = args.argv; - if (!self.agent) { - if (options.agentOptions) { - self.agentOptions = options.agentOptions - } + /* + * First, figure out which form of invocation we've been given. + */ + if (argv.length === 0) { + options = {}; + sprintf_args = []; + } else if (mod_isError(argv[0])) { + options = { 'cause': argv[0] }; + sprintf_args = argv.slice(1); + } else if (typeof (argv[0]) === 'object') { + options = {}; + for (k in argv[0]) { + options[k] = argv[0][k]; + } + sprintf_args = argv.slice(1); + } else { + mod_assertplus.string(argv[0], + 'first argument to VError, SError, or WError ' + + 'constructor must be a string, object, or Error'); + options = {}; + sprintf_args = argv; + } - if (options.agentClass) { - self.agentClass = options.agentClass - } else if (options.forever) { - var v = version() - // use ForeverAgent in node 0.10- only - if (v.major === 0 && v.minor <= 10) { - self.agentClass = protocol === 'http:' ? ForeverAgent : ForeverAgent.SSL - } else { - self.agentClass = self.httpModule.Agent - self.agentOptions = self.agentOptions || {} - self.agentOptions.keepAlive = true - } - } else { - self.agentClass = self.httpModule.Agent - } - } + /* + * Now construct the error's message. + * + * extsprintf (which we invoke here with our caller's arguments in order + * to construct this Error's message) is strict in its interpretation of + * values to be processed by the "%s" specifier. The value passed to + * extsprintf must actually be a string or something convertible to a + * String using .toString(). Passing other values (notably "null" and + * "undefined") is considered a programmer error. The assumption is + * that if you actually want to print the string "null" or "undefined", + * then that's easy to do that when you're calling extsprintf; on the + * other hand, if you did NOT want that (i.e., there's actually a bug + * where the program assumes some variable is non-null and tries to + * print it, which might happen when constructing a packet or file in + * some specific format), then it's better to stop immediately than + * produce bogus output. + * + * However, sometimes the bug is only in the code calling VError, and a + * programmer might prefer to have the error message contain "null" or + * "undefined" rather than have the bug in the error path crash the + * program (making the first bug harder to identify). For that reason, + * by default VError converts "null" or "undefined" arguments to their + * string representations and passes those to extsprintf. Programmers + * desiring the strict behavior can use the SError class or pass the + * "strict" option to the VError constructor. + */ + mod_assertplus.object(options); + if (!options.strict && !args.strict) { + sprintf_args = sprintf_args.map(function (a) { + return (a === null ? 'null' : + a === undefined ? 'undefined' : a); + }); + } - if (self.pool === false) { - self.agent = false - } else { - self.agent = self.agent || self.getNewAgent() - } + if (sprintf_args.length === 0) { + shortmessage = ''; + } else { + shortmessage = sprintf.apply(null, sprintf_args); + } - self.on('pipe', function (src) { - if (self.ntick && self._started) { - self.emit('error', new Error('You cannot pipe to this stream after the outbound request has started.')) - } - self.src = src - if (isReadStream(src)) { - if (!self.hasHeader('content-type')) { - self.setHeader('content-type', mime.lookup(src.path)) - } - } else { - if (src.headers) { - for (var i in src.headers) { - if (!self.hasHeader(i)) { - self.setHeader(i, src.headers[i]) - } - } - } - if (self._json && !self.hasHeader('content-type')) { - self.setHeader('content-type', 'application/json') - } - if (src.method && !self.explicitMethod) { - self.method = src.method - } - } + return ({ + 'options': options, + 'shortmessage': shortmessage + }); +} - // self.on('pipe', function () { - // console.error('You have already piped to this stream. Pipeing twice is likely to break the request.') - // }) - }) +/* + * See README.md for reference documentation. + */ +function VError() +{ + var args, obj, parsed, cause, ctor, message, k; - defer(function () { - if (self._aborted) { - return - } + args = Array.prototype.slice.call(arguments, 0); - var end = function () { - if (self._form) { - if (!self._auth.hasAuth) { - self._form.pipe(self) - } else if (self._auth.hasAuth && self._auth.sentAuth) { - self._form.pipe(self) - } - } - if (self._multipart && self._multipart.chunked) { - self._multipart.body.pipe(self) - } - if (self.body) { - if (isstream(self.body)) { - self.body.pipe(self) - } else { - setContentLength() - if (Array.isArray(self.body)) { - self.body.forEach(function (part) { - self.write(part) - }) - } else { - self.write(self.body) - } - self.end() - } - } else if (self.requestBodyStream) { - console.warn('options.requestBodyStream is deprecated, please pass the request object to stream.pipe.') - self.requestBodyStream.pipe(self) - } else if (!self.src) { - if (self._auth.hasAuth && !self._auth.sentAuth) { - self.end() - return - } - if (self.method !== 'GET' && typeof self.method !== 'undefined') { - self.setHeader('content-length', 0) - } - self.end() - } - } + /* + * This is a regrettable pattern, but JavaScript's built-in Error class + * is defined to work this way, so we allow the constructor to be called + * without "new". + */ + if (!(this instanceof VError)) { + obj = Object.create(VError.prototype); + VError.apply(obj, arguments); + return (obj); + } - if (self._form && !self.hasHeader('content-length')) { - // Before ending the request, we had to compute the length of the whole form, asyncly - self.setHeader(self._form.getHeaders(), true) - self._form.getLength(function (err, length) { - if (!err && !isNaN(length)) { - self.setHeader('content-length', length) - } - end() - }) - } else { - end() - } + /* + * For convenience and backwards compatibility, we support several + * different calling forms. Normalize them here. + */ + parsed = parseConstructorArguments({ + 'argv': args, + 'strict': false + }); - self.ntick = true - }) -} + /* + * If we've been given a name, apply it now. + */ + if (parsed.options.name) { + mod_assertplus.string(parsed.options.name, + 'error\'s "name" must be a string'); + this.name = parsed.options.name; + } -Request.prototype.getNewAgent = function () { - var self = this - var Agent = self.agentClass - var options = {} - if (self.agentOptions) { - for (var i in self.agentOptions) { - options[i] = self.agentOptions[i] - } - } - if (self.ca) { - options.ca = self.ca - } - if (self.ciphers) { - options.ciphers = self.ciphers - } - if (self.secureProtocol) { - options.secureProtocol = self.secureProtocol - } - if (self.secureOptions) { - options.secureOptions = self.secureOptions - } - if (typeof self.rejectUnauthorized !== 'undefined') { - options.rejectUnauthorized = self.rejectUnauthorized - } + /* + * For debugging, we keep track of the original short message (attached + * this Error particularly) separately from the complete message (which + * includes the messages of our cause chain). + */ + this.jse_shortmsg = parsed.shortmessage; + message = parsed.shortmessage; - if (self.cert && self.key) { - options.key = self.key - options.cert = self.cert - } + /* + * If we've been given a cause, record a reference to it and update our + * message appropriately. + */ + cause = parsed.options.cause; + if (cause) { + mod_assertplus.ok(mod_isError(cause), 'cause is not an Error'); + this.jse_cause = cause; - if (self.pfx) { - options.pfx = self.pfx - } + if (!parsed.options.skipCauseMessage) { + message += ': ' + cause.message; + } + } - if (self.passphrase) { - options.passphrase = self.passphrase - } + /* + * If we've been given an object with properties, shallow-copy that + * here. We don't want to use a deep copy in case there are non-plain + * objects here, but we don't want to use the original object in case + * the caller modifies it later. + */ + this.jse_info = {}; + if (parsed.options.info) { + for (k in parsed.options.info) { + this.jse_info[k] = parsed.options.info[k]; + } + } - var poolKey = '' + this.message = message; + Error.call(this, message); - // different types of agents are in different pools - if (Agent !== self.httpModule.Agent) { - poolKey += Agent.name - } + if (Error.captureStackTrace) { + ctor = parsed.options.constructorOpt || this.constructor; + Error.captureStackTrace(this, ctor); + } - // ca option is only relevant if proxy or destination are https - var proxy = self.proxy - if (typeof proxy === 'string') { - proxy = url.parse(proxy) - } - var isHttps = (proxy && proxy.protocol === 'https:') || this.uri.protocol === 'https:' + return (this); +} - if (isHttps) { - if (options.ca) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.ca - } +mod_util.inherits(VError, Error); +VError.prototype.name = 'VError'; - if (typeof options.rejectUnauthorized !== 'undefined') { - if (poolKey) { - poolKey += ':' - } - poolKey += options.rejectUnauthorized - } +VError.prototype.toString = function ve_toString() +{ + var str = (this.hasOwnProperty('name') && this.name || + this.constructor.name || this.constructor.prototype.name); + if (this.message) + str += ': ' + this.message; - if (options.cert) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.cert.toString('ascii') + options.key.toString('ascii') - } + return (str); +}; - if (options.pfx) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.pfx.toString('ascii') - } +/* + * This method is provided for compatibility. New callers should use + * VError.cause() instead. That method also uses the saner `null` return value + * when there is no cause. + */ +VError.prototype.cause = function ve_cause() +{ + var cause = VError.cause(this); + return (cause === null ? undefined : cause); +}; - if (options.ciphers) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.ciphers - } +/* + * Static methods + * + * These class-level methods are provided so that callers can use them on + * instances of Errors that are not VErrors. New interfaces should be provided + * only using static methods to eliminate the class of programming mistake where + * people fail to check whether the Error object has the corresponding methods. + */ - if (options.secureProtocol) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.secureProtocol - } +VError.cause = function (err) +{ + mod_assertplus.ok(mod_isError(err), 'err must be an Error'); + return (mod_isError(err.jse_cause) ? err.jse_cause : null); +}; - if (options.secureOptions) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.secureOptions - } - } +VError.info = function (err) +{ + var rv, cause, k; - if (self.pool === globalPool && !poolKey && Object.keys(options).length === 0 && self.httpModule.globalAgent) { - // not doing anything special. Use the globalAgent - return self.httpModule.globalAgent - } + mod_assertplus.ok(mod_isError(err), 'err must be an Error'); + cause = VError.cause(err); + if (cause !== null) { + rv = VError.info(cause); + } else { + rv = {}; + } - // we're using a stored agent. Make sure it's protocol-specific - poolKey = self.uri.protocol + poolKey + if (typeof (err.jse_info) == 'object' && err.jse_info !== null) { + for (k in err.jse_info) { + rv[k] = err.jse_info[k]; + } + } - // generate a new agent for this setting if none yet exists - if (!self.pool[poolKey]) { - self.pool[poolKey] = new Agent(options) - // properly set maxSockets on new agents - if (self.pool.maxSockets) { - self.pool[poolKey].maxSockets = self.pool.maxSockets - } - } + return (rv); +}; - return self.pool[poolKey] -} +VError.findCauseByName = function (err, name) +{ + var cause; -Request.prototype.start = function () { - // start() is called once we are ready to send the outgoing HTTP request. - // this is usually called on the first write(), end() or on nextTick() - var self = this + mod_assertplus.ok(mod_isError(err), 'err must be an Error'); + mod_assertplus.string(name, 'name'); + mod_assertplus.ok(name.length > 0, 'name cannot be empty'); - if (self.timing) { - // All timings will be relative to this request's startTime. In order to do this, - // we need to capture the wall-clock start time (via Date), immediately followed - // by the high-resolution timer (via now()). While these two won't be set - // at the _exact_ same time, they should be close enough to be able to calculate - // high-resolution, monotonically non-decreasing timestamps relative to startTime. - var startTime = new Date().getTime() - var startTimeNow = now() - } + for (cause = err; cause !== null; cause = VError.cause(cause)) { + mod_assertplus.ok(mod_isError(cause)); + if (cause.name == name) { + return (cause); + } + } - if (self._aborted) { - return - } + return (null); +}; - self._started = true - self.method = self.method || 'GET' - self.href = self.uri.href +VError.hasCauseWithName = function (err, name) +{ + return (VError.findCauseByName(err, name) !== null); +}; - if (self.src && self.src.stat && self.src.stat.size && !self.hasHeader('content-length')) { - self.setHeader('content-length', self.src.stat.size) - } - if (self._aws) { - self.aws(self._aws, true) - } +VError.fullStack = function (err) +{ + mod_assertplus.ok(mod_isError(err), 'err must be an Error'); - // We have a method named auth, which is completely different from the http.request - // auth option. If we don't remove it, we're gonna have a bad time. - var reqOptions = copy(self) - delete reqOptions.auth + var cause = VError.cause(err); - debug('make request', self.uri.href) + if (cause) { + return (err.stack + '\ncaused by: ' + VError.fullStack(cause)); + } - // node v6.8.0 now supports a `timeout` value in `http.request()`, but we - // should delete it for now since we handle timeouts manually for better - // consistency with node versions before v6.8.0 - delete reqOptions.timeout + return (err.stack); +}; - try { - self.req = self.httpModule.request(reqOptions) - } catch (err) { - self.emit('error', err) - return - } +VError.errorFromList = function (errors) +{ + mod_assertplus.arrayOfObject(errors, 'errors'); - if (self.timing) { - self.startTime = startTime - self.startTimeNow = startTimeNow + if (errors.length === 0) { + return (null); + } - // Timing values will all be relative to startTime (by comparing to startTimeNow - // so we have an accurate clock) - self.timings = {} - } + errors.forEach(function (e) { + mod_assertplus.ok(mod_isError(e)); + }); - var timeout - if (self.timeout && !self.timeoutTimer) { - if (self.timeout < 0) { - timeout = 0 - } else if (typeof self.timeout === 'number' && isFinite(self.timeout)) { - timeout = self.timeout - } - } + if (errors.length == 1) { + return (errors[0]); + } - self.req.on('response', self.onRequestResponse.bind(self)) - self.req.on('error', self.onRequestError.bind(self)) - self.req.on('drain', function () { - self.emit('drain') - }) + return (new MultiError(errors)); +}; - self.req.on('socket', function (socket) { - // `._connecting` was the old property which was made public in node v6.1.0 - var isConnecting = socket._connecting || socket.connecting - if (self.timing) { - self.timings.socket = now() - self.startTimeNow +VError.errorForEach = function (err, func) +{ + mod_assertplus.ok(mod_isError(err), 'err must be an Error'); + mod_assertplus.func(func, 'func'); - if (isConnecting) { - var onLookupTiming = function () { - self.timings.lookup = now() - self.startTimeNow - } + if (err instanceof MultiError) { + err.errors().forEach(function iterError(e) { func(e); }); + } else { + func(err); + } +}; - var onConnectTiming = function () { - self.timings.connect = now() - self.startTimeNow - } - socket.once('lookup', onLookupTiming) - socket.once('connect', onConnectTiming) +/* + * SError is like VError, but stricter about types. You cannot pass "null" or + * "undefined" as string arguments to the formatter. + */ +function SError() +{ + var args, obj, parsed, options; - // clean up timing event listeners if needed on error - self.req.once('error', function () { - socket.removeListener('lookup', onLookupTiming) - socket.removeListener('connect', onConnectTiming) - }) - } - } + args = Array.prototype.slice.call(arguments, 0); + if (!(this instanceof SError)) { + obj = Object.create(SError.prototype); + SError.apply(obj, arguments); + return (obj); + } - var setReqTimeout = function () { - // This timeout sets the amount of time to wait *between* bytes sent - // from the server once connected. - // - // In particular, it's useful for erroring if the server fails to send - // data halfway through streaming a response. - self.req.setTimeout(timeout, function () { - if (self.req) { - self.abort() - var e = new Error('ESOCKETTIMEDOUT') - e.code = 'ESOCKETTIMEDOUT' - e.connect = false - self.emit('error', e) - } - }) - } - if (timeout !== undefined) { - // Only start the connection timer if we're actually connecting a new - // socket, otherwise if we're already connected (because this is a - // keep-alive connection) do not bother. This is important since we won't - // get a 'connect' event for an already connected socket. - if (isConnecting) { - var onReqSockConnect = function () { - socket.removeListener('connect', onReqSockConnect) - clearTimeout(self.timeoutTimer) - self.timeoutTimer = null - setReqTimeout() - } + parsed = parseConstructorArguments({ + 'argv': args, + 'strict': true + }); - socket.on('connect', onReqSockConnect) + options = parsed.options; + VError.call(this, options, '%s', parsed.shortmessage); - self.req.on('error', function (err) { // eslint-disable-line handle-callback-err - socket.removeListener('connect', onReqSockConnect) - }) + return (this); +} - // Set a timeout in memory - this block will throw if the server takes more - // than `timeout` to write the HTTP status and headers (corresponding to - // the on('response') event on the client). NB: this measures wall-clock - // time, not the time between bytes sent by the server. - self.timeoutTimer = setTimeout(function () { - socket.removeListener('connect', onReqSockConnect) - self.abort() - var e = new Error('ETIMEDOUT') - e.code = 'ETIMEDOUT' - e.connect = true - self.emit('error', e) - }, timeout) - } else { - // We're already connected - setReqTimeout() - } - } - self.emit('socket', socket) - }) +/* + * We don't bother setting SError.prototype.name because once constructed, + * SErrors are just like VErrors. + */ +mod_util.inherits(SError, VError); - self.emit('request', self.req) -} -Request.prototype.onRequestError = function (error) { - var self = this - if (self._aborted) { - return - } - if (self.req && self.req._reusedSocket && error.code === 'ECONNRESET' && - self.agent.addRequestNoreuse) { - self.agent = { addRequest: self.agent.addRequestNoreuse.bind(self.agent) } - self.start() - self.req.end() - return - } - if (self.timeout && self.timeoutTimer) { - clearTimeout(self.timeoutTimer) - self.timeoutTimer = null - } - self.emit('error', error) -} +/* + * Represents a collection of errors for the purpose of consumers that generally + * only deal with one error. Callers can extract the individual errors + * contained in this object, but may also just treat it as a normal single + * error, in which case a summary message will be printed. + */ +function MultiError(errors) +{ + mod_assertplus.array(errors, 'list of errors'); + mod_assertplus.ok(errors.length > 0, 'must be at least one error'); + this.ase_errors = errors; -Request.prototype.onRequestResponse = function (response) { - var self = this + VError.call(this, { + 'cause': errors[0] + }, 'first of %d error%s', errors.length, errors.length == 1 ? '' : 's'); +} - if (self.timing) { - self.timings.response = now() - self.startTimeNow - } +mod_util.inherits(MultiError, VError); +MultiError.prototype.name = 'MultiError'; - debug('onRequestResponse', self.uri.href, response.statusCode, response.headers) - response.on('end', function () { - if (self.timing) { - self.timings.end = now() - self.startTimeNow - response.timingStart = self.startTime +MultiError.prototype.errors = function me_errors() +{ + return (this.ase_errors.slice(0)); +}; - // fill in the blanks for any periods that didn't trigger, such as - // no lookup or connect due to keep alive - if (!self.timings.socket) { - self.timings.socket = 0 - } - if (!self.timings.lookup) { - self.timings.lookup = self.timings.socket - } - if (!self.timings.connect) { - self.timings.connect = self.timings.lookup - } - if (!self.timings.response) { - self.timings.response = self.timings.connect - } - debug('elapsed time', self.timings.end) +/* + * See README.md for reference details. + */ +function WError() +{ + var args, obj, parsed, options; - // elapsedTime includes all redirects - self.elapsedTime += Math.round(self.timings.end) + args = Array.prototype.slice.call(arguments, 0); + if (!(this instanceof WError)) { + obj = Object.create(WError.prototype); + WError.apply(obj, args); + return (obj); + } - // NOTE: elapsedTime is deprecated in favor of .timings - response.elapsedTime = self.elapsedTime + parsed = parseConstructorArguments({ + 'argv': args, + 'strict': false + }); - // timings is just for the final fetch - response.timings = self.timings + options = parsed.options; + options['skipCauseMessage'] = true; + VError.call(this, options, '%s', parsed.shortmessage); - // pre-calculate phase timings as well - response.timingPhases = { - wait: self.timings.socket, - dns: self.timings.lookup - self.timings.socket, - tcp: self.timings.connect - self.timings.lookup, - firstByte: self.timings.response - self.timings.connect, - download: self.timings.end - self.timings.response, - total: self.timings.end - } - } - debug('response end', self.uri.href, response.statusCode, response.headers) - }) + return (this); +} - if (self._aborted) { - debug('aborted', self.uri.href) - response.resume() - return - } +mod_util.inherits(WError, VError); +WError.prototype.name = 'WError'; - self.response = response - response.request = self - response.toJSON = responseToJSON +WError.prototype.toString = function we_toString() +{ + var str = (this.hasOwnProperty('name') && this.name || + this.constructor.name || this.constructor.prototype.name); + if (this.message) + str += ': ' + this.message; + if (this.jse_cause && this.jse_cause.message) + str += '; caused by ' + this.jse_cause.toString(); - // XXX This is different on 0.10, because SSL is strict by default - if (self.httpModule === https && - self.strictSSL && (!response.hasOwnProperty('socket') || - !response.socket.authorized)) { - debug('strict ssl error', self.uri.href) - var sslErr = response.hasOwnProperty('socket') ? response.socket.authorizationError : self.uri.href + ' does not support SSL' - self.emit('error', new Error('SSL Error: ' + sslErr)) - return - } + return (str); +}; - // Save the original host before any redirect (if it changes, we need to - // remove any authorization headers). Also remember the case of the header - // name because lots of broken servers expect Host instead of host and we - // want the caller to be able to specify this. - self.originalHost = self.getHeader('host') - if (!self.originalHostHeaderName) { - self.originalHostHeaderName = self.hasHeader('host') - } - if (self.setHost) { - self.removeHeader('host') - } - if (self.timeout && self.timeoutTimer) { - clearTimeout(self.timeoutTimer) - self.timeoutTimer = null - } +/* + * For purely historical reasons, WError's cause() function allows you to set + * the cause. + */ +WError.prototype.cause = function we_cause(c) +{ + if (mod_isError(c)) + this.jse_cause = c; - var targetCookieJar = (self._jar && self._jar.setCookie) ? self._jar : globalCookieJar - var addCookie = function (cookie) { - // set the cookie if it's domain in the href's domain. - try { - targetCookieJar.setCookie(cookie, self.uri.href, {ignoreError: true}) - } catch (e) { - self.emit('error', e) - } - } + return (this.jse_cause); +}; - response.caseless = caseless(response.headers) - if (response.caseless.has('set-cookie') && (!self._disableCookies)) { - var headerName = response.caseless.has('set-cookie') - if (Array.isArray(response.headers[headerName])) { - response.headers[headerName].forEach(addCookie) - } else { - addCookie(response.headers[headerName]) - } - } +/***/ }), - if (self._redirect.onResponse(response)) { - return // Ignore the rest of the response - } else { - // Be a good stream and emit end when the response is finished. - // Hack to emit end on close because of a core bug that never fires end - response.on('close', function () { - if (!self._ended) { - self.response.emit('end') - } - }) +/***/ 959: +/***/ (function(module, __unusedexports, __webpack_require__) { - response.once('end', function () { - self._ended = true - }) +// Named EC curves - var noBody = function (code) { - return ( - self.method === 'HEAD' || - // Informational - (code >= 100 && code < 200) || - // No Content - code === 204 || - // Not Modified - code === 304 - ) - } +// Requires ec.js, jsbn.js, and jsbn2.js +var BigInteger = __webpack_require__(242).BigInteger +var ECCurveFp = __webpack_require__(729).ECCurveFp - var responseContent - if (self.gzip && !noBody(response.statusCode)) { - var contentEncoding = response.headers['content-encoding'] || 'identity' - contentEncoding = contentEncoding.trim().toLowerCase() - // Be more lenient with decoding compressed responses, since (very rarely) - // servers send slightly invalid gzip responses that are still accepted - // by common browsers. - // Always using Z_SYNC_FLUSH is what cURL does. - var zlibOptions = { - flush: zlib.Z_SYNC_FLUSH, - finishFlush: zlib.Z_SYNC_FLUSH - } +// ---------------- +// X9ECParameters - if (contentEncoding === 'gzip') { - responseContent = zlib.createGunzip(zlibOptions) - response.pipe(responseContent) - } else if (contentEncoding === 'deflate') { - responseContent = zlib.createInflate(zlibOptions) - response.pipe(responseContent) - } else { - // Since previous versions didn't check for Content-Encoding header, - // ignore any invalid values to preserve backwards-compatibility - if (contentEncoding !== 'identity') { - debug('ignoring unrecognized Content-Encoding ' + contentEncoding) - } - responseContent = response - } - } else { - responseContent = response - } +// constructor +function X9ECParameters(curve,g,n,h) { + this.curve = curve; + this.g = g; + this.n = n; + this.h = h; +} - if (self.encoding) { - if (self.dests.length !== 0) { - console.error('Ignoring encoding parameter as this stream is being piped to another stream which makes the encoding option invalid.') - } else { - responseContent.setEncoding(self.encoding) - } - } +function x9getCurve() { + return this.curve; +} - if (self._paused) { - responseContent.pause() - } +function x9getG() { + return this.g; +} - self.responseContent = responseContent +function x9getN() { + return this.n; +} - self.emit('response', response) +function x9getH() { + return this.h; +} - self.dests.forEach(function (dest) { - self.pipeDest(dest) - }) +X9ECParameters.prototype.getCurve = x9getCurve; +X9ECParameters.prototype.getG = x9getG; +X9ECParameters.prototype.getN = x9getN; +X9ECParameters.prototype.getH = x9getH; - responseContent.on('data', function (chunk) { - if (self.timing && !self.responseStarted) { - self.responseStartTime = (new Date()).getTime() +// ---------------- +// SECNamedCurves - // NOTE: responseStartTime is deprecated in favor of .timings - response.responseStartTime = self.responseStartTime - } - self._destdata = true - self.emit('data', chunk) - }) - responseContent.once('end', function (chunk) { - self.emit('end', chunk) - }) - responseContent.on('error', function (error) { - self.emit('error', error) - }) - responseContent.on('close', function () { self.emit('close') }) +function fromHex(s) { return new BigInteger(s, 16); } - if (self.callback) { - self.readResponseBody(response) - } else { // if no callback - self.on('end', function () { - if (self._aborted) { - debug('aborted', self.uri.href) - return - } - self.emit('complete', response) - }) - } - } - debug('finish init function', self.uri.href) +function secp128r1() { + // p = 2^128 - 2^97 - 1 + var p = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF"); + var a = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFC"); + var b = fromHex("E87579C11079F43DD824993C2CEE5ED3"); + //byte[] S = Hex.decode("000E0D4D696E6768756151750CC03A4473D03679"); + var n = fromHex("FFFFFFFE0000000075A30D1B9038A115"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "161FF7528B899B2D0C28607CA52C5B86" + + "CF5AC8395BAFEB13C02DA292DDED7A83"); + return new X9ECParameters(curve, G, n, h); } -Request.prototype.readResponseBody = function (response) { - var self = this - debug("reading response's body") - var buffers = [] - var bufferLength = 0 - var strings = [] - - self.on('data', function (chunk) { - if (!Buffer.isBuffer(chunk)) { - strings.push(chunk) - } else if (chunk.length) { - bufferLength += chunk.length - buffers.push(chunk) - } - }) - self.on('end', function () { - debug('end event', self.uri.href) - if (self._aborted) { - debug('aborted', self.uri.href) - // `buffer` is defined in the parent scope and used in a closure it exists for the life of the request. - // This can lead to leaky behavior if the user retains a reference to the request object. - buffers = [] - bufferLength = 0 - return - } +function secp160k1() { + // p = 2^160 - 2^32 - 2^14 - 2^12 - 2^9 - 2^8 - 2^7 - 2^3 - 2^2 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFAC73"); + var a = BigInteger.ZERO; + var b = fromHex("7"); + //byte[] S = null; + var n = fromHex("0100000000000000000001B8FA16DFAB9ACA16B6B3"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "3B4C382CE37AA192A4019E763036F4F5DD4D7EBB" + + "938CF935318FDCED6BC28286531733C3F03C4FEE"); + return new X9ECParameters(curve, G, n, h); +} - if (bufferLength) { - debug('has body', self.uri.href, bufferLength) - response.body = Buffer.concat(buffers, bufferLength) - if (self.encoding !== null) { - response.body = response.body.toString(self.encoding) - } - // `buffer` is defined in the parent scope and used in a closure it exists for the life of the Request. - // This can lead to leaky behavior if the user retains a reference to the request object. - buffers = [] - bufferLength = 0 - } else if (strings.length) { - // The UTF8 BOM [0xEF,0xBB,0xBF] is converted to [0xFE,0xFF] in the JS UTC16/UCS2 representation. - // Strip this value out when the encoding is set to 'utf8', as upstream consumers won't expect it and it breaks JSON.parse(). - if (self.encoding === 'utf8' && strings[0].length > 0 && strings[0][0] === '\uFEFF') { - strings[0] = strings[0].substring(1) - } - response.body = strings.join('') - } +function secp160r1() { + // p = 2^160 - 2^31 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF"); + var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFC"); + var b = fromHex("1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45"); + //byte[] S = Hex.decode("1053CDE42C14D696E67687561517533BF3F83345"); + var n = fromHex("0100000000000000000001F4C8F927AED3CA752257"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "4A96B5688EF573284664698968C38BB913CBFC82" + + "23A628553168947D59DCC912042351377AC5FB32"); + return new X9ECParameters(curve, G, n, h); +} - if (self._json) { - try { - response.body = JSON.parse(response.body, self._jsonReviver) - } catch (e) { - debug('invalid JSON received', self.uri.href) - } - } - debug('emitting complete', self.uri.href) - if (typeof response.body === 'undefined' && !self._json) { - response.body = self.encoding === null ? Buffer.alloc(0) : '' - } - self.emit('complete', response, response.body) - }) +function secp192k1() { + // p = 2^192 - 2^32 - 2^12 - 2^8 - 2^7 - 2^6 - 2^3 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFEE37"); + var a = BigInteger.ZERO; + var b = fromHex("3"); + //byte[] S = null; + var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFE26F2FC170F69466A74DEFD8D"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "DB4FF10EC057E9AE26B07D0280B7F4341DA5D1B1EAE06C7D" + + "9B2F2F6D9C5628A7844163D015BE86344082AA88D95E2F9D"); + return new X9ECParameters(curve, G, n, h); } -Request.prototype.abort = function () { - var self = this - self._aborted = true +function secp192r1() { + // p = 2^192 - 2^64 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF"); + var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC"); + var b = fromHex("64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1"); + //byte[] S = Hex.decode("3045AE6FC8422F64ED579528D38120EAE12196D5"); + var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012" + + "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811"); + return new X9ECParameters(curve, G, n, h); +} - if (self.req) { - self.req.abort() - } else if (self.response) { - self.response.destroy() - } +function secp224r1() { + // p = 2^224 - 2^96 + 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001"); + var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE"); + var b = fromHex("B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4"); + //byte[] S = Hex.decode("BD71344799D5C7FCDC45B59FA3B9AB8F6A948BC5"); + var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21" + + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34"); + return new X9ECParameters(curve, G, n, h); +} - self.emit('abort') +function secp256r1() { + // p = 2^224 (2^32 - 1) + 2^192 + 2^96 - 1 + var p = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF"); + var a = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC"); + var b = fromHex("5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B"); + //byte[] S = Hex.decode("C49D360886E704936A6678E1139D26B7819F7E90"); + var n = fromHex("FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296" + + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5"); + return new X9ECParameters(curve, G, n, h); } -Request.prototype.pipeDest = function (dest) { - var self = this - var response = self.response - // Called after the response is received - if (dest.headers && !dest.headersSent) { - if (response.caseless.has('content-type')) { - var ctname = response.caseless.has('content-type') - if (dest.setHeader) { - dest.setHeader(ctname, response.headers[ctname]) - } else { - dest.headers[ctname] = response.headers[ctname] - } - } +// TODO: make this into a proper hashtable +function getSECCurveByName(name) { + if(name == "secp128r1") return secp128r1(); + if(name == "secp160k1") return secp160k1(); + if(name == "secp160r1") return secp160r1(); + if(name == "secp192k1") return secp192k1(); + if(name == "secp192r1") return secp192r1(); + if(name == "secp224r1") return secp224r1(); + if(name == "secp256r1") return secp256r1(); + return null; +} - if (response.caseless.has('content-length')) { - var clname = response.caseless.has('content-length') - if (dest.setHeader) { - dest.setHeader(clname, response.headers[clname]) - } else { - dest.headers[clname] = response.headers[clname] - } - } - } - if (dest.setHeader && !dest.headersSent) { - for (var i in response.headers) { - // If the response content is being decoded, the Content-Encoding header - // of the response doesn't represent the piped content, so don't pass it. - if (!self.gzip || i !== 'content-encoding') { - dest.setHeader(i, response.headers[i]) - } - } - dest.statusCode = response.statusCode - } - if (self.pipefilter) { - self.pipefilter(response, dest) - } +module.exports = { + "secp128r1":secp128r1, + "secp160k1":secp160k1, + "secp160r1":secp160r1, + "secp192k1":secp192k1, + "secp192r1":secp192r1, + "secp224r1":secp224r1, + "secp256r1":secp256r1 } -Request.prototype.qs = function (q, clobber) { - var self = this - var base - if (!clobber && self.uri.query) { - base = self._qs.parse(self.uri.query) - } else { - base = {} - } - for (var i in q) { - base[i] = q[i] - } +/***/ }), - var qs = self._qs.stringify(base) +/***/ 964: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - if (qs === '') { - return self - } +"use strict"; - self.uri = url.parse(self.uri.href.split('?')[0] + '?' + qs) - self.url = self.uri - self.path = self.uri.path - if (self.uri.host === 'unix') { - self.enableUnixSocket() - } +var crypto = __webpack_require__(417) - return self +function randomString (size) { + var bits = (size + 1) * 6 + var buffer = crypto.randomBytes(Math.ceil(bits / 8)) + var string = buffer.toString('base64').replace(/\+/g, '-').replace(/\//g, '_').replace(/=/g, '') + return string.slice(0, size) } -Request.prototype.form = function (form) { - var self = this - if (form) { - if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { - self.setHeader('content-type', 'application/x-www-form-urlencoded') - } - self.body = (typeof form === 'string') - ? self._qs.rfc3986(form.toString('utf8')) - : self._qs.stringify(form).toString('utf8') - return self - } - // create form-data object - self._form = new FormData() - self._form.on('error', function (err) { - err.message = 'form-data: ' + err.message - self.emit('error', err) - self.abort() - }) - return self._form + +function calculatePayloadHash (payload, algorithm, contentType) { + var hash = crypto.createHash(algorithm) + hash.update('hawk.1.payload\n') + hash.update((contentType ? contentType.split(';')[0].trim().toLowerCase() : '') + '\n') + hash.update(payload || '') + hash.update('\n') + return hash.digest('base64') } -Request.prototype.multipart = function (multipart) { - var self = this - self._multipart.onRequest(multipart) +exports.calculateMac = function (credentials, opts) { + var normalized = 'hawk.1.header\n' + + opts.ts + '\n' + + opts.nonce + '\n' + + (opts.method || '').toUpperCase() + '\n' + + opts.resource + '\n' + + opts.host.toLowerCase() + '\n' + + opts.port + '\n' + + (opts.hash || '') + '\n' - if (!self._multipart.chunked) { - self.body = self._multipart.body + if (opts.ext) { + normalized = normalized + opts.ext.replace('\\', '\\\\').replace('\n', '\\n') } - return self + normalized = normalized + '\n' + + if (opts.app) { + normalized = normalized + opts.app + '\n' + (opts.dlg || '') + '\n' + } + + var hmac = crypto.createHmac(credentials.algorithm, credentials.key).update(normalized) + var digest = hmac.digest('base64') + return digest } -Request.prototype.json = function (val) { - var self = this - if (!self.hasHeader('accept')) { - self.setHeader('accept', 'application/json') +exports.header = function (uri, method, opts) { + var timestamp = opts.timestamp || Math.floor((Date.now() + (opts.localtimeOffsetMsec || 0)) / 1000) + var credentials = opts.credentials + if (!credentials || !credentials.id || !credentials.key || !credentials.algorithm) { + return '' } - if (typeof self.jsonReplacer === 'function') { - self._jsonReplacer = self.jsonReplacer + if (['sha1', 'sha256'].indexOf(credentials.algorithm) === -1) { + return '' } - self._json = true - if (typeof val === 'boolean') { - if (self.body !== undefined) { - if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { - self.body = safeStringify(self.body, self._jsonReplacer) - } else { - self.body = self._qs.rfc3986(self.body) - } - if (!self.hasHeader('content-type')) { - self.setHeader('content-type', 'application/json') - } - } - } else { - self.body = safeStringify(val, self._jsonReplacer) - if (!self.hasHeader('content-type')) { - self.setHeader('content-type', 'application/json') - } + var artifacts = { + ts: timestamp, + nonce: opts.nonce || randomString(6), + method: method, + resource: uri.pathname + (uri.search || ''), + host: uri.hostname, + port: uri.port || (uri.protocol === 'http:' ? 80 : 443), + hash: opts.hash, + ext: opts.ext, + app: opts.app, + dlg: opts.dlg } - if (typeof self.jsonReviver === 'function') { - self._jsonReviver = self.jsonReviver + if (!artifacts.hash && (opts.payload || opts.payload === '')) { + artifacts.hash = calculatePayloadHash(opts.payload, credentials.algorithm, opts.contentType) } - return self -} -Request.prototype.getHeader = function (name, headers) { - var self = this - var result, re, match - if (!headers) { - headers = self.headers + var mac = exports.calculateMac(credentials, artifacts) + + var hasExt = artifacts.ext !== null && artifacts.ext !== undefined && artifacts.ext !== '' + var header = 'Hawk id="' + credentials.id + + '", ts="' + artifacts.ts + + '", nonce="' + artifacts.nonce + + (artifacts.hash ? '", hash="' + artifacts.hash : '') + + (hasExt ? '", ext="' + artifacts.ext.replace(/\\/g, '\\\\').replace(/"/g, '\\"') : '') + + '", mac="' + mac + '"' + + if (artifacts.app) { + header = header + ', app="' + artifacts.app + (artifacts.dlg ? '", dlg="' + artifacts.dlg : '') + '"' } - Object.keys(headers).forEach(function (key) { - if (key.length !== name.length) { - return - } - re = new RegExp(name, 'i') - match = key.match(re) - if (match) { - result = headers[key] - } - }) - return result -} -Request.prototype.enableUnixSocket = function () { - // Get the socket & request paths from the URL - var unixParts = this.uri.path.split(':') - var host = unixParts[0] - var path = unixParts[1] - // Apply unix properties to request - this.socketPath = host - this.uri.pathname = path - this.uri.path = path - this.uri.host = host - this.uri.hostname = host - this.uri.isUnix = true + + return header } -Request.prototype.auth = function (user, pass, sendImmediately, bearer) { - var self = this - self._auth.onRequest(user, pass, sendImmediately, bearer) +/***/ }), - return self -} -Request.prototype.aws = function (opts, now) { - var self = this +/***/ 967: +/***/ (function(module) { - if (!now) { - self._aws = opts - return self - } +"use strict"; - if (opts.sign_version === 4 || opts.sign_version === '4') { - // use aws4 - var options = { - host: self.uri.host, - path: self.uri.path, - method: self.method, - headers: self.headers, - body: self.body +module.exports = function generate_validate(it, $keyword, $ruleType) { + var out = ''; + var $async = it.schema.$async === true, + $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'), + $id = it.self._getId(it.schema); + if (it.opts.strictKeywords) { + var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); + if ($unknownKwd) { + var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; + if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); + else throw new Error($keywordsMsg); } - if (opts.service) { - options.service = opts.service + } + if (it.isTop) { + out += ' var validate = '; + if ($async) { + it.async = true; + out += 'async '; } - var signRes = aws4.sign(options, { - accessKeyId: opts.key, - secretAccessKey: opts.secret, - sessionToken: opts.session - }) - self.setHeader('authorization', signRes.headers.Authorization) - self.setHeader('x-amz-date', signRes.headers['X-Amz-Date']) - if (signRes.headers['X-Amz-Security-Token']) { - self.setHeader('x-amz-security-token', signRes.headers['X-Amz-Security-Token']) + out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; + if ($id && (it.opts.sourceCode || it.opts.processCode)) { + out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; + } + } + if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { + var $keyword = 'false schema'; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + if (it.schema === false) { + if (it.isTop) { + $breakOnError = true; + } else { + out += ' var ' + ($valid) + ' = false; '; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'boolean schema is false\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } else { + if (it.isTop) { + if ($async) { + out += ' return data; '; + } else { + out += ' validate.errors = null; return true; '; + } + } else { + out += ' var ' + ($valid) + ' = true; '; + } + } + if (it.isTop) { + out += ' }; return validate; '; + } + return out; + } + if (it.isTop) { + var $top = it.isTop, + $lvl = it.level = 0, + $dataLvl = it.dataLevel = 0, + $data = 'data'; + it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); + it.baseId = it.baseId || it.rootId; + delete it.isTop; + it.dataPathArr = [undefined]; + if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored in the schema root'; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); } + out += ' var vErrors = null; '; + out += ' var errors = 0; '; + out += ' if (rootData === undefined) rootData = data; '; } else { - // default: use aws-sign2 - var date = new Date() - self.setHeader('date', date.toUTCString()) - var auth = { - key: opts.key, - secret: opts.secret, - verb: self.method.toUpperCase(), - date: date, - contentType: self.getHeader('content-type') || '', - md5: self.getHeader('content-md5') || '', - amazonHeaders: aws2.canonicalizeHeaders(self.headers) + var $lvl = it.level, + $dataLvl = it.dataLevel, + $data = 'data' + ($dataLvl || ''); + if ($id) it.baseId = it.resolve.url(it.baseId, $id); + if ($async && !it.async) throw new Error('async schema in sync schema'); + out += ' var errs_' + ($lvl) + ' = errors;'; + } + var $valid = 'valid' + $lvl, + $breakOnError = !it.opts.allErrors, + $closingBraces1 = '', + $closingBraces2 = ''; + var $errorKeyword; + var $typeSchema = it.schema.type, + $typeIsArray = Array.isArray($typeSchema); + if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { + if ($typeIsArray) { + if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); + } else if ($typeSchema != 'null') { + $typeSchema = [$typeSchema, 'null']; + $typeIsArray = true; } - var path = self.uri.path - if (opts.bucket && path) { - auth.resource = '/' + opts.bucket + path - } else if (opts.bucket && !path) { - auth.resource = '/' + opts.bucket - } else if (!opts.bucket && path) { - auth.resource = path - } else if (!opts.bucket && !path) { - auth.resource = '/' + } + if ($typeIsArray && $typeSchema.length == 1) { + $typeSchema = $typeSchema[0]; + $typeIsArray = false; + } + if (it.schema.$ref && $refKeywords) { + if (it.opts.extendRefs == 'fail') { + throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); + } else if (it.opts.extendRefs !== true) { + $refKeywords = false; + it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); } - auth.resource = aws2.canonicalizeResource(auth.resource) - self.setHeader('authorization', aws2.authorization(auth)) } - - return self -} -Request.prototype.httpSignature = function (opts) { - var self = this - httpSignature.signRequest({ - getHeader: function (header) { - return self.getHeader(header, self.headers) - }, - setHeader: function (header, value) { - self.setHeader(header, value) - }, - method: self.method, - path: self.path - }, opts) - debug('httpSignature authorization', self.getHeader('authorization')) - - return self -} -Request.prototype.hawk = function (opts) { - var self = this - self.setHeader('Authorization', hawk.header(self.uri, self.method, opts)) -} -Request.prototype.oauth = function (_oauth) { - var self = this - - self._oauth.onRequest(_oauth) - - return self -} - -Request.prototype.jar = function (jar) { - var self = this - var cookies - - if (self._redirect.redirectsFollowed === 0) { - self.originalCookieHeader = self.getHeader('cookie') + if (it.schema.$comment && it.opts.$comment) { + out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); } - - if (!jar) { - // disable cookies - cookies = false - self._disableCookies = true + if ($typeSchema) { + if (it.opts.coerceTypes) { + var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); + } + var $rulesGroup = it.RULES.types[$typeSchema]; + if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type', + $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; + out += ' if (' + (it.util[$method]($typeSchema, $data, true)) + ') { '; + if ($coerceToTypes) { + var $dataType = 'dataType' + $lvl, + $coerced = 'coerced' + $lvl; + out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; '; + if (it.opts.coerceTypes == 'array') { + out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ')) ' + ($dataType) + ' = \'array\'; '; + } + out += ' var ' + ($coerced) + ' = undefined; '; + var $bracesCoercion = ''; + var arr1 = $coerceToTypes; + if (arr1) { + var $type, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $type = arr1[$i += 1]; + if ($i) { + out += ' if (' + ($coerced) + ' === undefined) { '; + $bracesCoercion += '}'; + } + if (it.opts.coerceTypes == 'array' && $type != 'array') { + out += ' if (' + ($dataType) + ' == \'array\' && ' + ($data) + '.length == 1) { ' + ($coerced) + ' = ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; } '; + } + if ($type == 'string') { + out += ' if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; + } else if ($type == 'number' || $type == 'integer') { + out += ' if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; + if ($type == 'integer') { + out += ' && !(' + ($data) + ' % 1)'; + } + out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; + } else if ($type == 'boolean') { + out += ' if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; + } else if ($type == 'null') { + out += ' if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; + } else if (it.opts.coerceTypes == 'array' && $type == 'array') { + out += ' if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; + } + } + } + out += ' ' + ($bracesCoercion) + ' if (' + ($coerced) + ' === undefined) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' ' + ($data) + ' = ' + ($coerced) + '; '; + if (!$dataLvl) { + out += 'if (' + ($parentData) + ' !== undefined)'; + } + out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } + out += ' } '; + } + } + if (it.schema.$ref && !$refKeywords) { + out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; + if ($breakOnError) { + out += ' } if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } } else { - var targetCookieJar = (jar && jar.getCookieString) ? jar : globalCookieJar - var urihref = self.uri.href - // fetch cookie in the Specified host - if (targetCookieJar) { - cookies = targetCookieJar.getCookieString(urihref) + var arr2 = it.RULES; + if (arr2) { + var $rulesGroup, i2 = -1, + l2 = arr2.length - 1; + while (i2 < l2) { + $rulesGroup = arr2[i2 += 1]; + if ($shouldUseGroup($rulesGroup)) { + if ($rulesGroup.type) { + out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data)) + ') { '; + } + if (it.opts.useDefaults) { + if ($rulesGroup.type == 'object' && it.schema.properties) { + var $schema = it.schema.properties, + $schemaKeys = Object.keys($schema); + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ($sch.default !== undefined) { + var $passData = $data + it.util.getProperty($propertyKey); + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } + } + } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { + var arr4 = it.schema.items; + if (arr4) { + var $sch, $i = -1, + l4 = arr4.length - 1; + while ($i < l4) { + $sch = arr4[$i += 1]; + if ($sch.default !== undefined) { + var $passData = $data + '[' + $i + ']'; + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } + } + } + } + var arr5 = $rulesGroup.rules; + if (arr5) { + var $rule, i5 = -1, + l5 = arr5.length - 1; + while (i5 < l5) { + $rule = arr5[i5 += 1]; + if ($shouldUseRule($rule)) { + var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); + if ($code) { + out += ' ' + ($code) + ' '; + if ($breakOnError) { + $closingBraces1 += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces1) + ' '; + $closingBraces1 = ''; + } + if ($rulesGroup.type) { + out += ' } '; + if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { + out += ' else { '; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + } + } + if ($breakOnError) { + out += ' if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } + } + } } } - - // if need cookie and cookie is not empty - if (cookies && cookies.length) { - if (self.originalCookieHeader) { - // Don't overwrite existing Cookie header - self.setHeader('cookie', self.originalCookieHeader + '; ' + cookies) - } else { - self.setHeader('cookie', cookies) - } + if ($breakOnError) { + out += ' ' + ($closingBraces2) + ' '; } - self._jar = jar - return self -} - -// Stream API -Request.prototype.pipe = function (dest, opts) { - var self = this - - if (self.response) { - if (self._destdata) { - self.emit('error', new Error('You cannot pipe after data has been emitted from the response.')) - } else if (self._ended) { - self.emit('error', new Error('You cannot pipe after the response has been ended.')) + if ($top) { + if ($async) { + out += ' if (errors === 0) return data; '; + out += ' else throw new ValidationError(vErrors); '; } else { - stream.Stream.prototype.pipe.call(self, dest, opts) - self.pipeDest(dest) - return dest + out += ' validate.errors = vErrors; '; + out += ' return errors === 0; '; } + out += ' }; return validate;'; } else { - self.dests.push(dest) - stream.Stream.prototype.pipe.call(self, dest, opts) - return dest - } -} -Request.prototype.write = function () { - var self = this - if (self._aborted) { return } - - if (!self._started) { - self.start() + out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; } - if (self.req) { - return self.req.write.apply(self.req, arguments) + out = it.util.cleanUpCode(out); + if ($top) { + out = it.util.finalCleanUpCode(out, $async); } -} -Request.prototype.end = function (chunk) { - var self = this - if (self._aborted) { return } - if (chunk) { - self.write(chunk) - } - if (!self._started) { - self.start() - } - if (self.req) { - self.req.end() - } -} -Request.prototype.pause = function () { - var self = this - if (!self.responseContent) { - self._paused = true - } else { - self.responseContent.pause.apply(self.responseContent, arguments) + function $shouldUseGroup($rulesGroup) { + var rules = $rulesGroup.rules; + for (var i = 0; i < rules.length; i++) + if ($shouldUseRule(rules[i])) return true; } -} -Request.prototype.resume = function () { - var self = this - if (!self.responseContent) { - self._paused = false - } else { - self.responseContent.resume.apply(self.responseContent, arguments) + + function $shouldUseRule($rule) { + return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); } -} -Request.prototype.destroy = function () { - var self = this - if (!self._ended) { - self.end() - } else if (self.response) { - self.response.destroy() + + function $ruleImplementsSomeKeyword($rule) { + var impl = $rule.implements; + for (var i = 0; i < impl.length; i++) + if (it.schema[impl[i]] !== undefined) return true; } + return out; } -Request.defaultProxyHeaderWhiteList = - Tunnel.defaultProxyHeaderWhiteList.slice() - -Request.defaultProxyHeaderExclusiveList = - Tunnel.defaultProxyHeaderExclusiveList.slice() - -// Exports - -Request.prototype.toJSON = requestToJSON -module.exports = Request - /***/ }), -/***/ 976: +/***/ 972: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright (c) 2012, Mark Cavage. All rights reserved. -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(357); -var Stream = __webpack_require__(413).Stream; -var util = __webpack_require__(669); - - -///--- Globals - -/* JSSTYLED */ -var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ +/** + * Module exports. + */ -///--- Internal +module.exports = __webpack_require__(512) -function _capitalize(str) { - return (str.charAt(0).toUpperCase() + str.slice(1)); -} -function _toss(name, expected, oper, arg, actual) { - throw new assert.AssertionError({ - message: util.format('%s (%s) is required', name, expected), - actual: (actual === undefined) ? typeof (arg) : actual(arg), - expected: expected, - operator: oper || '===', - stackStartFunction: _toss.caller - }); -} +/***/ }), -function _getClass(arg) { - return (Object.prototype.toString.call(arg).slice(8, -1)); -} +/***/ 982: +/***/ (function(module, __unusedexports, __webpack_require__) { -function noop() { - // Why even bother with asserts? -} +// Copyright 2017 Joyent, Inc. +module.exports = { + read: read, + write: write +}; -///--- Exports +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var utils = __webpack_require__(270); +var SSHBuffer = __webpack_require__(940); +var Dhe = __webpack_require__(290); -var types = { - bool: { - check: function (arg) { return typeof (arg) === 'boolean'; } - }, - func: { - check: function (arg) { return typeof (arg) === 'function'; } - }, - string: { - check: function (arg) { return typeof (arg) === 'string'; } - }, - object: { - check: function (arg) { - return typeof (arg) === 'object' && arg !== null; - } - }, - number: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg); - } - }, - finite: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); - } - }, - buffer: { - check: function (arg) { return Buffer.isBuffer(arg); }, - operator: 'Buffer.isBuffer' - }, - array: { - check: function (arg) { return Array.isArray(arg); }, - operator: 'Array.isArray' - }, - stream: { - check: function (arg) { return arg instanceof Stream; }, - operator: 'instanceof', - actual: _getClass - }, - date: { - check: function (arg) { return arg instanceof Date; }, - operator: 'instanceof', - actual: _getClass - }, - regexp: { - check: function (arg) { return arg instanceof RegExp; }, - operator: 'instanceof', - actual: _getClass - }, - uuid: { - check: function (arg) { - return typeof (arg) === 'string' && UUID_REGEXP.test(arg); - }, - operator: 'isUUID' - } +var supportedAlgos = { + 'rsa-sha1' : 5, + 'rsa-sha256' : 8, + 'rsa-sha512' : 10, + 'ecdsa-p256-sha256' : 13, + 'ecdsa-p384-sha384' : 14 + /* + * ed25519 is hypothetically supported with id 15 + * but the common tools available don't appear to be + * capable of generating/using ed25519 keys + */ }; -function _setExports(ndebug) { - var keys = Object.keys(types); - var out; - - /* re-export standard assert */ - if (process.env.NODE_NDEBUG) { - out = noop; - } else { - out = function (arg, msg) { - if (!arg) { - _toss(msg, 'true', arg); - } - }; - } +var supportedAlgosById = {}; +Object.keys(supportedAlgos).forEach(function (k) { + supportedAlgosById[supportedAlgos[k]] = k.toUpperCase(); +}); - /* standard checks */ - keys.forEach(function (k) { - if (ndebug) { - out[k] = noop; - return; - } - var type = types[k]; - out[k] = function (arg, msg) { - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); +function read(buf, options) { + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } + var lines = buf.split('\n'); + if (lines[0].match(/^Private-key-format\: v1/)) { + var algElems = lines[1].split(' '); + var algoNum = parseInt(algElems[1], 10); + var algoName = algElems[2]; + if (!supportedAlgosById[algoNum]) + throw (new Error('Unsupported algorithm: ' + algoName)); + return (readDNSSECPrivateKey(algoNum, lines.slice(2))); + } - /* optional checks */ - keys.forEach(function (k) { - var name = 'optional' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); + // skip any comment-lines + var line = 0; + /* JSSTYLED */ + while (lines[line].match(/^\;/)) + line++; + // we should now have *one single* line left with our KEY on it. + if ((lines[line].match(/\. IN KEY /) || + lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) { + return (readRFC3110(lines[line])); + } + throw (new Error('Cannot parse dnssec key')); +} - /* arrayOf checks */ - keys.forEach(function (k) { - var name = 'arrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); +function readRFC3110(keyString) { + var elems = keyString.split(' '); + //unused var flags = parseInt(elems[3], 10); + //unused var protocol = parseInt(elems[4], 10); + var algorithm = parseInt(elems[5], 10); + if (!supportedAlgosById[algorithm]) + throw (new Error('Unsupported algorithm: ' + algorithm)); + var base64key = elems.slice(6, elems.length).join(); + var keyBuffer = Buffer.from(base64key, 'base64'); + if (supportedAlgosById[algorithm].match(/^RSA-/)) { + // join the rest of the body into a single base64-blob + var publicExponentLen = keyBuffer.readUInt8(0); + if (publicExponentLen != 3 && publicExponentLen != 1) + throw (new Error('Cannot parse dnssec key: ' + + 'unsupported exponent length')); - /* optionalArrayOf checks */ - keys.forEach(function (k) { - var name = 'optionalArrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); + var publicExponent = keyBuffer.slice(1, publicExponentLen+1); + publicExponent = utils.mpNormalize(publicExponent); + var modulus = keyBuffer.slice(1+publicExponentLen); + modulus = utils.mpNormalize(modulus); + // now, make the key + var rsaKey = { + type: 'rsa', + parts: [] + }; + rsaKey.parts.push({ name: 'e', data: publicExponent}); + rsaKey.parts.push({ name: 'n', data: modulus}); + return (new Key(rsaKey)); + } + if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' || + supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') { + var curve = 'nistp384'; + var size = 384; + if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) { + curve = 'nistp256'; + size = 256; + } - /* re-export built-in assertions */ - Object.keys(assert).forEach(function (k) { - if (k === 'AssertionError') { - out[k] = assert[k]; - return; - } - if (ndebug) { - out[k] = noop; - return; - } - out[k] = assert[k]; - }); + var ecdsaKey = { + type: 'ecdsa', + curve: curve, + size: size, + parts: [ + {name: 'curve', data: Buffer.from(curve) }, + {name: 'Q', data: utils.ecNormalize(keyBuffer) } + ] + }; + return (new Key(ecdsaKey)); + } + throw (new Error('Unsupported algorithm: ' + + supportedAlgosById[algorithm])); +} - /* export ourselves (for unit tests _only_) */ - out._setExports = _setExports; +function elementToBuf(e) { + return (Buffer.from(e.split(' ')[1], 'base64')); +} - return out; +function readDNSSECRSAPrivateKey(elements) { + var rsaParams = {}; + elements.forEach(function (element) { + if (element.split(' ')[0] === 'Modulus:') + rsaParams['n'] = elementToBuf(element); + else if (element.split(' ')[0] === 'PublicExponent:') + rsaParams['e'] = elementToBuf(element); + else if (element.split(' ')[0] === 'PrivateExponent:') + rsaParams['d'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Prime1:') + rsaParams['p'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Prime2:') + rsaParams['q'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Exponent1:') + rsaParams['dmodp'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Exponent2:') + rsaParams['dmodq'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Coefficient:') + rsaParams['iqmp'] = elementToBuf(element); + }); + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'e', data: utils.mpNormalize(rsaParams['e'])}, + { name: 'n', data: utils.mpNormalize(rsaParams['n'])}, + { name: 'd', data: utils.mpNormalize(rsaParams['d'])}, + { name: 'p', data: utils.mpNormalize(rsaParams['p'])}, + { name: 'q', data: utils.mpNormalize(rsaParams['q'])}, + { name: 'dmodp', + data: utils.mpNormalize(rsaParams['dmodp'])}, + { name: 'dmodq', + data: utils.mpNormalize(rsaParams['dmodq'])}, + { name: 'iqmp', + data: utils.mpNormalize(rsaParams['iqmp'])} + ] + }; + return (new PrivateKey(key)); } -module.exports = _setExports(process.env.NODE_NDEBUG); +function readDNSSECPrivateKey(alg, elements) { + if (supportedAlgosById[alg].match(/^RSA-/)) { + return (readDNSSECRSAPrivateKey(elements)); + } + if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' || + supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { + var d = Buffer.from(elements[0].split(' ')[1], 'base64'); + var curve = 'nistp384'; + var size = 384; + if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { + curve = 'nistp256'; + size = 256; + } + // DNSSEC generates the public-key on the fly (go calculate it) + var publicKey = utils.publicFromPrivateECDSA(curve, d); + var Q = publicKey.part['Q'].data; + var ecdsaKey = { + type: 'ecdsa', + curve: curve, + size: size, + parts: [ + {name: 'curve', data: Buffer.from(curve) }, + {name: 'd', data: d }, + {name: 'Q', data: Q } + ] + }; + return (new PrivateKey(ecdsaKey)); + } + throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg])); +} +function dnssecTimestamp(date) { + var year = date.getFullYear() + ''; //stringify + var month = (date.getMonth() + 1); + var timestampStr = year + month + date.getUTCDate(); + timestampStr += '' + date.getUTCHours() + date.getUTCMinutes(); + timestampStr += date.getUTCSeconds(); + return (timestampStr); +} -/***/ }), +function rsaAlgFromOptions(opts) { + if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1') + return ('5 (RSASHA1)'); + else if (opts.hashAlgo === 'sha256') + return ('8 (RSASHA256)'); + else if (opts.hashAlgo === 'sha512') + return ('10 (RSASHA512)'); + else + throw (new Error('Unknown or unsupported hash: ' + + opts.hashAlgo)); +} -/***/ 981: -/***/ (function(module, __unusedexports, __webpack_require__) { +function writeRSA(key, options) { + // if we're missing parts, add them. + if (!key.part.dmodp || !key.part.dmodq) { + utils.addRSAMissing(key); + } -// Copyright 2015 Joyent, Inc. + var out = ''; + out += 'Private-key-format: v1.3\n'; + out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n'; + var n = utils.mpDenormalize(key.part['n'].data); + out += 'Modulus: ' + n.toString('base64') + '\n'; + var e = utils.mpDenormalize(key.part['e'].data); + out += 'PublicExponent: ' + e.toString('base64') + '\n'; + var d = utils.mpDenormalize(key.part['d'].data); + out += 'PrivateExponent: ' + d.toString('base64') + '\n'; + var p = utils.mpDenormalize(key.part['p'].data); + out += 'Prime1: ' + p.toString('base64') + '\n'; + var q = utils.mpDenormalize(key.part['q'].data); + out += 'Prime2: ' + q.toString('base64') + '\n'; + var dmodp = utils.mpDenormalize(key.part['dmodp'].data); + out += 'Exponent1: ' + dmodp.toString('base64') + '\n'; + var dmodq = utils.mpDenormalize(key.part['dmodq'].data); + out += 'Exponent2: ' + dmodq.toString('base64') + '\n'; + var iqmp = utils.mpDenormalize(key.part['iqmp'].data); + out += 'Coefficient: ' + iqmp.toString('base64') + '\n'; + // Assume that we're valid as-of now + var timestamp = new Date(); + out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; + return (Buffer.from(out, 'ascii')); +} -module.exports = SSHBuffer; +function writeECDSA(key, options) { + var out = ''; + out += 'Private-key-format: v1.3\n'; -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; + if (key.curve === 'nistp256') { + out += 'Algorithm: 13 (ECDSAP256SHA256)\n'; + } else if (key.curve === 'nistp384') { + out += 'Algorithm: 14 (ECDSAP384SHA384)\n'; + } else { + throw (new Error('Unsupported curve')); + } + var base64Key = key.part['d'].data.toString('base64'); + out += 'PrivateKey: ' + base64Key + '\n'; -function SSHBuffer(opts) { - assert.object(opts, 'options'); - if (opts.buffer !== undefined) - assert.buffer(opts.buffer, 'options.buffer'); + // Assume that we're valid as-of now + var timestamp = new Date(); + out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; - this._size = opts.buffer ? opts.buffer.length : 1024; - this._buffer = opts.buffer || Buffer.alloc(this._size); - this._offset = 0; + return (Buffer.from(out, 'ascii')); } -SSHBuffer.prototype.toBuffer = function () { - return (this._buffer.slice(0, this._offset)); -}; - -SSHBuffer.prototype.atEnd = function () { - return (this._offset >= this._buffer.length); -}; +function write(key, options) { + if (PrivateKey.isPrivateKey(key)) { + if (key.type === 'rsa') { + return (writeRSA(key, options)); + } else if (key.type === 'ecdsa') { + return (writeECDSA(key, options)); + } else { + throw (new Error('Unsupported algorithm: ' + key.type)); + } + } else if (Key.isKey(key)) { + /* + * RFC3110 requires a keyname, and a keytype, which we + * don't really have a mechanism for specifying such + * additional metadata. + */ + throw (new Error('Format "dnssec" only supports ' + + 'writing private keys')); + } else { + throw (new Error('key is not a Key or PrivateKey')); + } +} -SSHBuffer.prototype.remainder = function () { - return (this._buffer.slice(this._offset)); -}; -SSHBuffer.prototype.skip = function (n) { - this._offset += n; -}; +/***/ }), -SSHBuffer.prototype.expand = function () { - this._size *= 2; - var buf = Buffer.alloc(this._size); - this._buffer.copy(buf, 0); - this._buffer = buf; -}; +/***/ 985: +/***/ (function(module) { -SSHBuffer.prototype.readPart = function () { - return ({data: this.readBuffer()}); -}; +module.exports = function(size) { + return new LruCache(size) +} -SSHBuffer.prototype.readBuffer = function () { - var len = this._buffer.readUInt32BE(this._offset); - this._offset += 4; - assert.ok(this._offset + len <= this._buffer.length, - 'length out of bounds at +0x' + this._offset.toString(16) + - ' (data truncated?)'); - var buf = this._buffer.slice(this._offset, this._offset + len); - this._offset += len; - return (buf); -}; +function LruCache(size) { + this.capacity = size | 0 + this.map = Object.create(null) + this.list = new DoublyLinkedList() +} -SSHBuffer.prototype.readString = function () { - return (this.readBuffer().toString()); -}; +LruCache.prototype.get = function(key) { + var node = this.map[key] + if (node == null) return undefined + this.used(node) + return node.val +} -SSHBuffer.prototype.readCString = function () { - var offset = this._offset; - while (offset < this._buffer.length && - this._buffer[offset] !== 0x00) - offset++; - assert.ok(offset < this._buffer.length, 'c string does not terminate'); - var str = this._buffer.slice(this._offset, offset).toString(); - this._offset = offset + 1; - return (str); -}; +LruCache.prototype.set = function(key, val) { + var node = this.map[key] + if (node != null) { + node.val = val + } else { + if (!this.capacity) this.prune() + if (!this.capacity) return false + node = new DoublyLinkedNode(key, val) + this.map[key] = node + this.capacity-- + } + this.used(node) + return true +} -SSHBuffer.prototype.readInt = function () { - var v = this._buffer.readUInt32BE(this._offset); - this._offset += 4; - return (v); -}; +LruCache.prototype.used = function(node) { + this.list.moveToFront(node) +} -SSHBuffer.prototype.readInt64 = function () { - assert.ok(this._offset + 8 < this._buffer.length, - 'buffer not long enough to read Int64'); - var v = this._buffer.slice(this._offset, this._offset + 8); - this._offset += 8; - return (v); -}; +LruCache.prototype.prune = function() { + var node = this.list.pop() + if (node != null) { + delete this.map[node.key] + this.capacity++ + } +} -SSHBuffer.prototype.readChar = function () { - var v = this._buffer[this._offset++]; - return (v); -}; -SSHBuffer.prototype.writeBuffer = function (buf) { - while (this._offset + 4 + buf.length > this._size) - this.expand(); - this._buffer.writeUInt32BE(buf.length, this._offset); - this._offset += 4; - buf.copy(this._buffer, this._offset); - this._offset += buf.length; -}; +function DoublyLinkedList() { + this.firstNode = null + this.lastNode = null +} -SSHBuffer.prototype.writeString = function (str) { - this.writeBuffer(Buffer.from(str, 'utf8')); -}; +DoublyLinkedList.prototype.moveToFront = function(node) { + if (this.firstNode == node) return -SSHBuffer.prototype.writeCString = function (str) { - while (this._offset + 1 + str.length > this._size) - this.expand(); - this._buffer.write(str, this._offset); - this._offset += str.length; - this._buffer[this._offset++] = 0; -}; + this.remove(node) -SSHBuffer.prototype.writeInt = function (v) { - while (this._offset + 4 > this._size) - this.expand(); - this._buffer.writeUInt32BE(v, this._offset); - this._offset += 4; -}; + if (this.firstNode == null) { + this.firstNode = node + this.lastNode = node + node.prev = null + node.next = null + } else { + node.prev = null + node.next = this.firstNode + node.next.prev = node + this.firstNode = node + } +} -SSHBuffer.prototype.writeInt64 = function (v) { - assert.buffer(v, 'value'); - if (v.length > 8) { - var lead = v.slice(0, v.length - 8); - for (var i = 0; i < lead.length; ++i) { - assert.strictEqual(lead[i], 0, - 'must fit in 64 bits of precision'); - } - v = v.slice(v.length - 8, v.length); - } - while (this._offset + 8 > this._size) - this.expand(); - v.copy(this._buffer, this._offset); - this._offset += 8; -}; +DoublyLinkedList.prototype.pop = function() { + var lastNode = this.lastNode + if (lastNode != null) { + this.remove(lastNode) + } + return lastNode +} -SSHBuffer.prototype.writeChar = function (v) { - while (this._offset + 1 > this._size) - this.expand(); - this._buffer[this._offset++] = v; -}; +DoublyLinkedList.prototype.remove = function(node) { + if (this.firstNode == node) { + this.firstNode = node.next + } else if (node.prev != null) { + node.prev.next = node.next + } + if (this.lastNode == node) { + this.lastNode = node.prev + } else if (node.next != null) { + node.next.prev = node.prev + } +} -SSHBuffer.prototype.writePart = function (p) { - this.writeBuffer(p.data); -}; -SSHBuffer.prototype.write = function (buf) { - while (this._offset + buf.length > this._size) - this.expand(); - buf.copy(this._buffer, this._offset); - this._offset += buf.length; -}; +function DoublyLinkedNode(key, val) { + this.key = key + this.val = val + this.prev = null + this.next = null +} /***/ }), -/***/ 982: +/***/ 986: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; - -var crypto = __webpack_require__(417) - -function randomString (size) { - var bits = (size + 1) * 6 - var buffer = crypto.randomBytes(Math.ceil(bits / 8)) - var string = buffer.toString('base64').replace(/\+/g, '-').replace(/\//g, '_').replace(/=/g, '') - return string.slice(0, size) -} - -function calculatePayloadHash (payload, algorithm, contentType) { - var hash = crypto.createHash(algorithm) - hash.update('hawk.1.payload\n') - hash.update((contentType ? contentType.split(';')[0].trim().toLowerCase() : '') + '\n') - hash.update(payload || '') - hash.update('\n') - return hash.digest('base64') -} - -exports.calculateMac = function (credentials, opts) { - var normalized = 'hawk.1.header\n' + - opts.ts + '\n' + - opts.nonce + '\n' + - (opts.method || '').toUpperCase() + '\n' + - opts.resource + '\n' + - opts.host.toLowerCase() + '\n' + - opts.port + '\n' + - (opts.hash || '') + '\n' - - if (opts.ext) { - normalized = normalized + opts.ext.replace('\\', '\\\\').replace('\n', '\\n') - } - - normalized = normalized + '\n' - - if (opts.app) { - normalized = normalized + opts.app + '\n' + (opts.dlg || '') + '\n' - } - - var hmac = crypto.createHmac(credentials.algorithm, credentials.key).update(normalized) - var digest = hmac.digest('base64') - return digest +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const tr = __webpack_require__(9); +/** + * Exec a command. + * Output will be streamed to the live console. + * Returns promise with return code + * + * @param commandLine command to execute (can include additional args). Must be correctly escaped. + * @param args optional arguments for tool. Escaping is handled by the lib. + * @param options optional exec options. See ExecOptions + * @returns Promise exit code + */ +function exec(commandLine, args, options) { + return __awaiter(this, void 0, void 0, function* () { + const commandArgs = tr.argStringToArray(commandLine); + if (commandArgs.length === 0) { + throw new Error(`Parameter 'commandLine' cannot be null or empty.`); + } + // Path to tool to execute should be first arg + const toolPath = commandArgs[0]; + args = commandArgs.slice(1).concat(args || []); + const runner = new tr.ToolRunner(toolPath, args, options); + return runner.exec(); + }); } +exports.exec = exec; +//# sourceMappingURL=exec.js.map -exports.header = function (uri, method, opts) { - var timestamp = opts.timestamp || Math.floor((Date.now() + (opts.localtimeOffsetMsec || 0)) / 1000) - var credentials = opts.credentials - if (!credentials || !credentials.id || !credentials.key || !credentials.algorithm) { - return '' - } - - if (['sha1', 'sha256'].indexOf(credentials.algorithm) === -1) { - return '' - } - - var artifacts = { - ts: timestamp, - nonce: opts.nonce || randomString(6), - method: method, - resource: uri.pathname + (uri.search || ''), - host: uri.hostname, - port: uri.port || (uri.protocol === 'http:' ? 80 : 443), - hash: opts.hash, - ext: opts.ext, - app: opts.app, - dlg: opts.dlg - } - - if (!artifacts.hash && (opts.payload || opts.payload === '')) { - artifacts.hash = calculatePayloadHash(opts.payload, credentials.algorithm, opts.contentType) - } +/***/ }), - var mac = exports.calculateMac(credentials, artifacts) +/***/ 993: +/***/ (function(module) { - var hasExt = artifacts.ext !== null && artifacts.ext !== undefined && artifacts.ext !== '' - var header = 'Hawk id="' + credentials.id + - '", ts="' + artifacts.ts + - '", nonce="' + artifacts.nonce + - (artifacts.hash ? '", hash="' + artifacts.hash : '') + - (hasExt ? '", ext="' + artifacts.ext.replace(/\\/g, '\\\\').replace(/"/g, '\\"') : '') + - '", mac="' + mac + '"' +module.exports = {"$id":"cache.json#","$schema":"http://json-schema.org/draft-06/schema#","properties":{"beforeRequest":{"oneOf":[{"type":"null"},{"$ref":"beforeRequest.json#"}]},"afterRequest":{"oneOf":[{"type":"null"},{"$ref":"afterRequest.json#"}]},"comment":{"type":"string"}}}; - if (artifacts.app) { - header = header + ', app="' + artifacts.app + (artifacts.dlg ? '", dlg="' + artifacts.dlg : '') + '"' - } +/***/ }), - return header -} +/***/ 998: +/***/ (function(module, __unusedexports, __webpack_require__) { +// Copyright 2011 Mark Cavage All rights reserved. -/***/ }), +var assert = __webpack_require__(357); +var Buffer = __webpack_require__(215).Buffer; +var ASN1 = __webpack_require__(362); +var errors = __webpack_require__(584); -/***/ 988: -/***/ (function(__unusedmodule, exports, __webpack_require__) { -/* - * extsprintf.js: extended POSIX-style sprintf - */ +// --- Globals -var mod_assert = __webpack_require__(357); -var mod_util = __webpack_require__(669); +var newInvalidAsn1Error = errors.newInvalidAsn1Error; -/* - * Public interface - */ -exports.sprintf = jsSprintf; -exports.printf = jsPrintf; -exports.fprintf = jsFprintf; +var DEFAULT_OPTS = { + size: 1024, + growthFactor: 8 +}; -/* - * Stripped down version of s[n]printf(3c). We make a best effort to throw an - * exception when given a format string we don't understand, rather than - * ignoring it, so that we won't break existing programs if/when we go implement - * the rest of this. - * - * This implementation currently supports specifying - * - field alignment ('-' flag), - * - zero-pad ('0' flag) - * - always show numeric sign ('+' flag), - * - field width - * - conversions for strings, decimal integers, and floats (numbers). - * - argument size specifiers. These are all accepted but ignored, since - * Javascript has no notion of the physical size of an argument. - * - * Everything else is currently unsupported, most notably precision, unsigned - * numbers, non-decimal numbers, and characters. - */ -function jsSprintf(fmt) -{ - var regex = [ - '([^%]*)', /* normal text */ - '%', /* start of format */ - '([\'\\-+ #0]*?)', /* flags (optional) */ - '([1-9]\\d*)?', /* width (optional) */ - '(\\.([1-9]\\d*))?', /* precision (optional) */ - '[lhjztL]*?', /* length mods (ignored) */ - '([diouxXfFeEgGaAcCsSp%jr])' /* conversion */ - ].join(''); - var re = new RegExp(regex); - var args = Array.prototype.slice.call(arguments, 1); - var flags, width, precision, conversion; - var left, pad, sign, arg, match; - var ret = ''; - var argn = 1; +// --- Helpers - mod_assert.equal('string', typeof (fmt)); +function merge(from, to) { + assert.ok(from); + assert.equal(typeof (from), 'object'); + assert.ok(to); + assert.equal(typeof (to), 'object'); - while ((match = re.exec(fmt)) !== null) { - ret += match[1]; - fmt = fmt.substring(match[0].length); + var keys = Object.getOwnPropertyNames(from); + keys.forEach(function (key) { + if (to[key]) + return; - flags = match[2] || ''; - width = match[3] || 0; - precision = match[4] || ''; - conversion = match[6]; - left = false; - sign = false; - pad = ' '; + var value = Object.getOwnPropertyDescriptor(from, key); + Object.defineProperty(to, key, value); + }); - if (conversion == '%') { - ret += '%'; - continue; - } + return to; +} - if (args.length === 0) - throw (new Error('too few args to sprintf')); - arg = args.shift(); - argn++; - if (flags.match(/[\' #]/)) - throw (new Error( - 'unsupported flags: ' + flags)); +// --- API - if (precision.length > 0) - throw (new Error( - 'non-zero precision not supported')); +function Writer(options) { + options = merge(DEFAULT_OPTS, options || {}); - if (flags.match(/-/)) - left = true; + this._buf = Buffer.alloc(options.size || 1024); + this._size = this._buf.length; + this._offset = 0; + this._options = options; - if (flags.match(/0/)) - pad = '0'; + // A list of offsets in the buffer where we need to insert + // sequence tag/len pairs. + this._seq = []; +} - if (flags.match(/\+/)) - sign = true; +Object.defineProperty(Writer.prototype, 'buffer', { + get: function () { + if (this._seq.length) + throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); - switch (conversion) { - case 's': - if (arg === undefined || arg === null) - throw (new Error('argument ' + argn + - ': attempted to print undefined or null ' + - 'as a string')); - ret += doPad(pad, width, left, arg.toString()); - break; + return (this._buf.slice(0, this._offset)); + } +}); - case 'd': - arg = Math.floor(arg); - /*jsl:fallthru*/ - case 'f': - sign = sign && arg > 0 ? '+' : ''; - ret += sign + doPad(pad, width, left, - arg.toString()); - break; +Writer.prototype.writeByte = function (b) { + if (typeof (b) !== 'number') + throw new TypeError('argument must be a Number'); - case 'x': - ret += doPad(pad, width, left, arg.toString(16)); - break; + this._ensure(1); + this._buf[this._offset++] = b; +}; - case 'j': /* non-standard */ - if (width === 0) - width = 10; - ret += mod_util.inspect(arg, false, width); - break; - case 'r': /* non-standard */ - ret += dumpException(arg); - break; +Writer.prototype.writeInt = function (i, tag) { + if (typeof (i) !== 'number') + throw new TypeError('argument must be a Number'); + if (typeof (tag) !== 'number') + tag = ASN1.Integer; - default: - throw (new Error('unsupported conversion: ' + - conversion)); - } - } + var sz = 4; - ret += fmt; - return (ret); -} + while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && + (sz > 1)) { + sz--; + i <<= 8; + } -function jsPrintf() { - var args = Array.prototype.slice.call(arguments); - args.unshift(process.stdout); - jsFprintf.apply(null, args); -} + if (sz > 4) + throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); -function jsFprintf(stream) { - var args = Array.prototype.slice.call(arguments, 1); - return (stream.write(jsSprintf.apply(this, args))); -} + this._ensure(2 + sz); + this._buf[this._offset++] = tag; + this._buf[this._offset++] = sz; -function doPad(chr, width, left, str) -{ - var ret = str; + while (sz-- > 0) { + this._buf[this._offset++] = ((i & 0xff000000) >>> 24); + i <<= 8; + } - while (ret.length < width) { - if (left) - ret += chr; - else - ret = chr + ret; - } +}; - return (ret); -} -/* - * This function dumps long stack traces for exceptions having a cause() method. - * See node-verror for an example. - */ -function dumpException(ex) -{ - var ret; +Writer.prototype.writeNull = function () { + this.writeByte(ASN1.Null); + this.writeByte(0x00); +}; - if (!(ex instanceof Error)) - throw (new Error(jsSprintf('invalid type for %%r: %j', ex))); - /* Note that V8 prepends "ex.stack" with ex.toString(). */ - ret = 'EXCEPTION: ' + ex.constructor.name + ': ' + ex.stack; +Writer.prototype.writeEnumeration = function (i, tag) { + if (typeof (i) !== 'number') + throw new TypeError('argument must be a Number'); + if (typeof (tag) !== 'number') + tag = ASN1.Enumeration; - if (ex.cause && typeof (ex.cause) === 'function') { - var cex = ex.cause(); - if (cex) { - ret += '\nCaused by: ' + dumpException(cex); - } - } + return this.writeInt(i, tag); +}; - return (ret); -} +Writer.prototype.writeBoolean = function (b, tag) { + if (typeof (b) !== 'boolean') + throw new TypeError('argument must be a Boolean'); + if (typeof (tag) !== 'number') + tag = ASN1.Boolean; -/***/ }), + this._ensure(3); + this._buf[this._offset++] = tag; + this._buf[this._offset++] = 0x01; + this._buf[this._offset++] = b ? 0xff : 0x00; +}; -/***/ 991: -/***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2015 Joyent, Inc. +Writer.prototype.writeString = function (s, tag) { + if (typeof (s) !== 'string') + throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); + if (typeof (tag) !== 'number') + tag = ASN1.OctetString; -module.exports = { - read: read, - write: write + var len = Buffer.byteLength(s); + this.writeByte(tag); + this.writeLength(len); + if (len) { + this._ensure(len); + this._buf.write(s, this._offset); + this._offset += len; + } }; -var assert = __webpack_require__(976); -var Buffer = __webpack_require__(601).Buffer; -var rfc4253 = __webpack_require__(563); -var utils = __webpack_require__(57); -var Key = __webpack_require__(501); -var PrivateKey = __webpack_require__(172); - -var sshpriv = __webpack_require__(62); -/*JSSTYLED*/ -var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/; -/*JSSTYLED*/ -var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/; +Writer.prototype.writeBuffer = function (buf, tag) { + if (typeof (tag) !== 'number') + throw new TypeError('tag must be a number'); + if (!Buffer.isBuffer(buf)) + throw new TypeError('argument must be a buffer'); -function read(buf, options) { - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); - } + this.writeByte(tag); + this.writeLength(buf.length); + this._ensure(buf.length); + buf.copy(this._buf, this._offset, 0, buf.length); + this._offset += buf.length; +}; - var trimmed = buf.trim().replace(/[\\\r]/g, ''); - var m = trimmed.match(SSHKEY_RE); - if (!m) - m = trimmed.match(SSHKEY_RE2); - assert.ok(m, 'key must match regex'); - var type = rfc4253.algToKeyType(m[1]); - var kbuf = Buffer.from(m[2], 'base64'); +Writer.prototype.writeStringArray = function (strings) { + if ((!strings instanceof Array)) + throw new TypeError('argument must be an Array[String]'); - /* - * This is a bit tricky. If we managed to parse the key and locate the - * key comment with the regex, then do a non-partial read and assert - * that we have consumed all bytes. If we couldn't locate the key - * comment, though, there may be whitespace shenanigans going on that - * have conjoined the comment to the rest of the key. We do a partial - * read in this case to try to make the best out of a sorry situation. - */ - var key; - var ret = {}; - if (m[4]) { - try { - key = rfc4253.read(kbuf); + var self = this; + strings.forEach(function (s) { + self.writeString(s); + }); +}; - } catch (e) { - m = trimmed.match(SSHKEY_RE2); - assert.ok(m, 'key must match regex'); - kbuf = Buffer.from(m[2], 'base64'); - key = rfc4253.readInternal(ret, 'public', kbuf); - } - } else { - key = rfc4253.readInternal(ret, 'public', kbuf); - } +// This is really to solve DER cases, but whatever for now +Writer.prototype.writeOID = function (s, tag) { + if (typeof (s) !== 'string') + throw new TypeError('argument must be a string'); + if (typeof (tag) !== 'number') + tag = ASN1.OID; - assert.strictEqual(type, key.type); + if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) + throw new Error('argument is not a valid OID string'); - if (m[4] && m[4].length > 0) { - key.comment = m[4]; + function encodeOctet(bytes, octet) { + if (octet < 128) { + bytes.push(octet); + } else if (octet < 16384) { + bytes.push((octet >>> 7) | 0x80); + bytes.push(octet & 0x7F); + } else if (octet < 2097152) { + bytes.push((octet >>> 14) | 0x80); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } else if (octet < 268435456) { + bytes.push((octet >>> 21) | 0x80); + bytes.push(((octet >>> 14) | 0x80) & 0xFF); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } else { + bytes.push(((octet >>> 28) | 0x80) & 0xFF); + bytes.push(((octet >>> 21) | 0x80) & 0xFF); + bytes.push(((octet >>> 14) | 0x80) & 0xFF); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } + } - } else if (ret.consumed) { - /* - * Now the magic: trying to recover the key comment when it's - * gotten conjoined to the key or otherwise shenanigan'd. - * - * Work out how much base64 we used, then drop all non-base64 - * chars from the beginning up to this point in the the string. - * Then offset in this and try to make up for missing = chars. - */ - var data = m[2] + (m[3] ? m[3] : ''); - var realOffset = Math.ceil(ret.consumed / 3) * 4; - data = data.slice(0, realOffset - 2). /*JSSTYLED*/ - replace(/[^a-zA-Z0-9+\/=]/g, '') + - data.slice(realOffset - 2); + var tmp = s.split('.'); + var bytes = []; + bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); + tmp.slice(2).forEach(function (b) { + encodeOctet(bytes, parseInt(b, 10)); + }); - var padding = ret.consumed % 3; - if (padding > 0 && - data.slice(realOffset - 1, realOffset) !== '=') - realOffset--; - while (data.slice(realOffset, realOffset + 1) === '=') - realOffset++; + var self = this; + this._ensure(2 + bytes.length); + this.writeByte(tag); + this.writeLength(bytes.length); + bytes.forEach(function (b) { + self.writeByte(b); + }); +}; - /* Finally, grab what we think is the comment & clean it up. */ - var trailer = data.slice(realOffset); - trailer = trailer.replace(/[\r\n]/g, ' '). - replace(/^\s+/, ''); - if (trailer.match(/^[a-zA-Z0-9]/)) - key.comment = trailer; - } - return (key); -} +Writer.prototype.writeLength = function (len) { + if (typeof (len) !== 'number') + throw new TypeError('argument must be a Number'); -function write(key, options) { - assert.object(key); - if (!Key.isKey(key)) - throw (new Error('Must be a public key')); + this._ensure(4); - var parts = []; - var alg = rfc4253.keyTypeToAlg(key); - parts.push(alg); + if (len <= 0x7f) { + this._buf[this._offset++] = len; + } else if (len <= 0xff) { + this._buf[this._offset++] = 0x81; + this._buf[this._offset++] = len; + } else if (len <= 0xffff) { + this._buf[this._offset++] = 0x82; + this._buf[this._offset++] = len >> 8; + this._buf[this._offset++] = len; + } else if (len <= 0xffffff) { + this._buf[this._offset++] = 0x83; + this._buf[this._offset++] = len >> 16; + this._buf[this._offset++] = len >> 8; + this._buf[this._offset++] = len; + } else { + throw newInvalidAsn1Error('Length too long (> 4 bytes)'); + } +}; - var buf = rfc4253.write(key); - parts.push(buf.toString('base64')); +Writer.prototype.startSequence = function (tag) { + if (typeof (tag) !== 'number') + tag = ASN1.Sequence | ASN1.Constructor; - if (key.comment) - parts.push(key.comment); + this.writeByte(tag); + this._seq.push(this._offset); + this._ensure(3); + this._offset += 3; +}; - return (Buffer.from(parts.join(' '))); -} +Writer.prototype.endSequence = function () { + var seq = this._seq.pop(); + var start = seq + 3; + var len = this._offset - start; -/***/ }), + if (len <= 0x7f) { + this._shift(start, len, -2); + this._buf[seq] = len; + } else if (len <= 0xff) { + this._shift(start, len, -1); + this._buf[seq] = 0x81; + this._buf[seq + 1] = len; + } else if (len <= 0xffff) { + this._buf[seq] = 0x82; + this._buf[seq + 1] = len >> 8; + this._buf[seq + 2] = len; + } else if (len <= 0xffffff) { + this._shift(start, len, 1); + this._buf[seq] = 0x83; + this._buf[seq + 1] = len >> 16; + this._buf[seq + 2] = len >> 8; + this._buf[seq + 3] = len; + } else { + throw newInvalidAsn1Error('Sequence too long'); + } +}; -/***/ 992: -/***/ (function(module) { -module.exports = {"$id":"creator.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; +Writer.prototype._shift = function (start, len, shift) { + assert.ok(start !== undefined); + assert.ok(len !== undefined); + assert.ok(shift); -/***/ }), + this._buf.copy(this._buf, start + shift, start, start + len); + this._offset += shift; +}; -/***/ 995: -/***/ (function(module, __unusedexports, __webpack_require__) { +Writer.prototype._ensure = function (len) { + assert.ok(len); -var serialOrdered = __webpack_require__(375); + if (this._size - this._offset < len) { + var sz = this._size * this._options.growthFactor; + if (sz - this._offset < len) + sz += len; -// Public API -module.exports = serial; + var buf = Buffer.alloc(sz); -/** - * Runs iterator over provided array elements in series - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function serial(list, iterator, callback) -{ - return serialOrdered(list, iterator, null, callback); -} + this._buf.copy(buf, 0, 0, this._offset); + this._buf = buf; + this._size = sz; + } +}; -/***/ }), -/***/ 997: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +// --- Exported API -"use strict"; +module.exports = Writer; -Object.defineProperty(exports, "__esModule", { value: true }); -const os = __webpack_require__(87); -/** - * Commands - * - * Command Format: - * ##[name key=value;key=value]message - * - * Examples: - * ##[warning]This is the user warning message - * ##[set-secret name=mypassword]definitelyNotAPassword! - */ -function issueCommand(command, properties, message) { - const cmd = new Command(command, properties, message); - process.stdout.write(cmd.toString() + os.EOL); -} -exports.issueCommand = issueCommand; -function issue(name, message = '') { - issueCommand(name, {}, message); -} -exports.issue = issue; -const CMD_STRING = '::'; -class Command { - constructor(command, properties, message) { - if (!command) { - command = 'missing.command'; - } - this.command = command; - this.properties = properties; - this.message = message; - } - toString() { - let cmdStr = CMD_STRING + this.command; - if (this.properties && Object.keys(this.properties).length > 0) { - cmdStr += ' '; - for (const key in this.properties) { - if (this.properties.hasOwnProperty(key)) { - const val = this.properties[key]; - if (val) { - // safely append the val - avoid blowing up when attempting to - // call .replace() if message is not a string for some reason - cmdStr += `${key}=${escape(`${val || ''}`)},`; - } - } - } - } - cmdStr += CMD_STRING; - // safely append the message - avoid blowing up when attempting to - // call .replace() if message is not a string for some reason - const message = `${this.message || ''}`; - cmdStr += escapeData(message); - return cmdStr; - } -} -function escapeData(s) { - return s.replace(/\r/g, '%0D').replace(/\n/g, '%0A'); -} -function escape(s) { - return s - .replace(/\r/g, '%0D') - .replace(/\n/g, '%0A') - .replace(/]/g, '%5D') - .replace(/;/g, '%3B'); -} -//# sourceMappingURL=command.js.map /***/ }) diff --git a/index.js b/index.js index fcbc8e8f2..d43200f9f 100644 --- a/index.js +++ b/index.js @@ -55,101 +55,43 @@ try { GITHUB_ACTION: process.env.GITHUB_ACTION, GITHUB_REF: process.env.GITHUB_REF, GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, - GITHUB_SHA: process.env.GITHUB_SHA + GITHUB_SHA: process.env.GITHUB_SHA, + GITHUB_HEAD_REF: process.env.GITHUB_HEAD_REF }; + const execArgs = ["codecov.sh"]; if (file) { - if (fail_ci) { - exec - .exec( - "bash", - [ - "codecov.sh", - "-f", - `${file}`, - "-n", - `${name}`, - "-F", - `${flags}`, - "-y", - `${yml}`, - "-Z" - ], - options - ) - .catch(err => { - core.setFailed( - `Codecov failed with the following error: ${err.message}` - ); - }) - .then(() => { - unlinkFile(); - }); - } else { - exec - .exec( - "bash", - [ - "codecov.sh", - "-f", - `${file}`, - "-n", - `${name}`, - "-F", - `${flags}`, - "-y", - `${yml}` - ], - options - ) - .catch(err => { - core.warning(`Codecov warning: ${err.message}`); - }) - .then(() => { - unlinkFile(); - }); - } - } else { - if (fail_ci) { - exec - .exec( - "bash", - [ - "codecov.sh", - "-n", - `${name}`, - "-F", - `${flags}`, - "-y", - `${yml}`, - "-Z" - ], - options - ) - .catch(err => { - core.setFailed( - `Codecov failed with the following error: ${err.message}` - ); - }) - .then(() => { - unlinkFile(); - }); - } else { - exec - .exec( - "bash", - ["codecov.sh", "-n", `${name}`, "-F", `${flags}`, "-y", `${yml}`], - options - ) - .catch(err => { - core.warning(`Codecov warning: ${err.message}`); - }) - .then(() => { - unlinkFile(); - }); - } + execArgs.push( + "-f", `${file}` + ); + } + + execArgs.push( + "-n", `${name}`, + "-F", `${flags}`, + "-y", `${yml}` + ); + + if (fail_ci) { + execArgs.push( + "-Z" + ); } + exec.exec("bash", execArgs, options) + .catch(err => { + if (fail_ci) { + core.setFailed( + `Codecov failed with the following error: ${err.message}` + ); + } else { + core.warning(`Codecov warning: ${err.message}`); + } + }) + .then(() => { + unlinkFile(); + });; + const unlinkFile = () => { fs.unlink("codecov.sh", err => { if (err && fail_ci) { diff --git a/package-lock.json b/package-lock.json index 057ba94a4..cc33a91ec 100644 --- a/package-lock.json +++ b/package-lock.json @@ -1,6 +1,6 @@ { - "name": "test2", - "version": "1.0.0", + "name": "codecov-action", + "version": "1.0.5", "lockfileVersion": 1, "requires": true, "dependencies": {