Browse files

Updated sample code in README

  • Loading branch information...
1 parent dc18f83 commit 773a09e7b661aa0c5a3e088e51f2bdf359b1a7c8 @nakao committed Jul 22, 2012
Showing with 51 additions and 20 deletions.
  1. +51 −20
@@ -4,10 +4,9 @@
[ChEMBL REST Web Service API]( client, parser and container classes.
-REST API Client
+REST API address
- # Show a web service URI
#=> ""
@@ -16,42 +15,74 @@ REST API Client
#=> ""
#=> ""
- # GET the XML data of the ChEMBL ID CHEMBL1
+Get data in XML
api =
compound = api.compounds("CHEMBL1")
targst = api.targets("CHEMBL2477")
assay = api.assays("CHEMBL1217643")
-Parser and container
+Check the server status
+ BioChEMBL::REST.up? #=> true/false
+REST API client, parser and container: BioChEMBL::Compound
- # Compound
cpd = BioChEMBL::Compound.find("CHEMBL1")
cpd.chemblId #=> "CHEMBL1"
- ba = cpd.bioactivities
smiles = "CC(=O)CC(C1=C(O)c2ccccc2OC1=O)c3ccccc3"
- cpd = BioChEMBL::Compound.find_all_by_smiles(smiles)
- cpd = BioChEMBL::Compound.find_all_by_substructure(smiles)
- cpd = BioChEMBL::Compound.find_all_by_similarity(smiles + "/70")
- # Target
- target = BioChEMBL::Target.find("CHEMBL2477")
- target.chemblId #=> "CHEMBL2477"
+ cpds = BioChEMBL::Compound.find_all_by_smiles(smiles)
+ cpds = BioChEMBL::Compound.find_all_by_substructure(smiles)
+ cpds = BioChEMBL::Compound.find_all_by_similarity(smiles + "/70")
+ cpd.bioactivities[0].parent_compound.chemblId #=> "CHEMBL1"
+ xml ="CHEMBL1")
+ cpd = BioChEMBL::Compound.parse_xml(xml)
+REST API client, parser and container: BioChEMBL::Target
+ target = BioChEMBL::Target.find("CHEMBL1785")
+ target.chemblId #=> "CHEMBL1785"
target.targetType #=> "PROTEIN"
- # Assay
+ target.geneNames #=> "EDNRB; ETRB"
+ BioChEMBL.to_array(target.geneNames) #=> ["EDNRB", "ETRB"]
+ synonyms = BioChEMBL.to_array(target.synonyms)
+ synosyms[0] #=> "Endothelin B receptor"
+ target = BioChEMBL::Target.find_by_uniprot("Q13936")
+ target.bioactivities[0].target.chemblId #=> "CHEMBL1785"
+ xml ="CHEMBL1785")
+ target = BioChEMBL::Target.parse_xml(xml)
+REST API client, parser and container: BioChEMBL::Assay
assay = BioChEMBL::Assay.find("CHEMBL1217643")
assay.chemblId #=> "CHEMBL1217643"
+ assay.bioactivities[0].assay.chemblId #=> "CHEMBL1217643"
- assay.bioactivities[0].assay.chemblID #=> "CHEMBL1217643"
+ xml ="CHEMBL1217643")
+ assay = BioChEMBL::Assay.parse_xml(xml)
+Parser and container: BioChEMBL::Bioactivity
+ cpd.bioactivities[0].parent_compound.chemblId
+ target.bioactivities[0].target.chemblId
+ assay.bioactivities[0].assay.chemblId
+ assay.bioactivities[0].target
+ assay.bioactivities[0].parent_compound
Note: this software is under active development!
## Installation

0 comments on commit 773a09e

Please sign in to comment.