From 9fb36e7c73f647d137cda8c480ac67c097cba11a Mon Sep 17 00:00:00 2001 From: Nicolas Vazquez Date: Tue, 10 Jul 2018 03:23:59 -0300 Subject: [PATCH 01/16] db: Update Apache DBCP version (#2718) * Update Apache DBCP version * Fix DB connection * Prevent hang on the db creation --- developer/pom.xml | 8 +- .../com/cloud/upgrade/DatabaseCreator.java | 1 + framework/db/pom.xml | 8 +- .../com/cloud/utils/db/TransactionLegacy.java | 107 +++++++++++------- pom.xml | 16 +-- 5 files changed, 84 insertions(+), 56 deletions(-) diff --git a/developer/pom.xml b/developer/pom.xml index 3f6236fd6903..97ec9ed1b0f7 100644 --- a/developer/pom.xml +++ b/developer/pom.xml @@ -22,12 +22,12 @@ - commons-dbcp - commons-dbcp + org.apache.commons + commons-dbcp2 - commons-pool - commons-pool + org.apache.commons + commons-pool2 org.jasypt diff --git a/engine/schema/src/main/java/com/cloud/upgrade/DatabaseCreator.java b/engine/schema/src/main/java/com/cloud/upgrade/DatabaseCreator.java index 2509d6972c3f..2281e1d2399e 100644 --- a/engine/schema/src/main/java/com/cloud/upgrade/DatabaseCreator.java +++ b/engine/schema/src/main/java/com/cloud/upgrade/DatabaseCreator.java @@ -230,5 +230,6 @@ public static void main(String[] args) { } finally { txn.close(); } + System.exit(0); } } diff --git a/framework/db/pom.xml b/framework/db/pom.xml index 6483f4f9b037..7bf184c6d38e 100644 --- a/framework/db/pom.xml +++ b/framework/db/pom.xml @@ -28,8 +28,8 @@ javax.persistence - commons-dbcp - commons-dbcp + org.apache.commons + commons-dbcp2 commons-io @@ -37,8 +37,8 @@ ${cs.commons-io.version} - commons-pool - commons-pool + org.apache.commons + commons-pool2 org.apache.cloudstack diff --git a/framework/db/src/main/java/com/cloud/utils/db/TransactionLegacy.java b/framework/db/src/main/java/com/cloud/utils/db/TransactionLegacy.java index 6a422d30fc36..6777077c3d17 100644 --- a/framework/db/src/main/java/com/cloud/utils/db/TransactionLegacy.java +++ b/framework/db/src/main/java/com/cloud/utils/db/TransactionLegacy.java @@ -33,13 +33,14 @@ import javax.sql.DataSource; -import org.apache.commons.dbcp.ConnectionFactory; -import org.apache.commons.dbcp.DriverManagerConnectionFactory; -import org.apache.commons.dbcp.PoolableConnectionFactory; -import org.apache.commons.dbcp.PoolingDataSource; -import org.apache.commons.pool.KeyedObjectPoolFactory; -import org.apache.commons.pool.impl.GenericObjectPool; -import org.apache.commons.pool.impl.StackKeyedObjectPoolFactory; +import org.apache.commons.dbcp2.ConnectionFactory; +import org.apache.commons.dbcp2.DriverManagerConnectionFactory; +import org.apache.commons.dbcp2.PoolableConnection; +import org.apache.commons.dbcp2.PoolableConnectionFactory; +import org.apache.commons.dbcp2.PoolingDataSource; +import org.apache.commons.pool2.ObjectPool; +import org.apache.commons.pool2.impl.GenericObjectPool; +import org.apache.commons.pool2.impl.GenericObjectPoolConfig; import org.apache.log4j.Logger; import com.cloud.utils.Pair; @@ -1079,24 +1080,15 @@ public static void initDataSource(Properties dbProps) { System.setProperty("javax.net.ssl.trustStorePassword", dbProps.getProperty("db.cloud.trustStorePassword")); } - final GenericObjectPool cloudConnectionPool = - new GenericObjectPool(null, cloudMaxActive, GenericObjectPool.DEFAULT_WHEN_EXHAUSTED_ACTION, cloudMaxWait, cloudMaxIdle, cloudTestOnBorrow, false, - cloudTimeBtwEvictionRunsMillis, 1, cloudMinEvcitableIdleTimeMillis, cloudTestWhileIdle); - final String cloudConnectionUri = cloudDriver + "://" + cloudHost + (s_dbHAEnabled ? "," + cloudSlaves : "") + ":" + cloudPort + "/" + cloudDbName + "?autoReconnect=" + cloudAutoReconnect + (url != null ? "&" + url : "") + (useSSL ? "&useSSL=true" : "") + (s_dbHAEnabled ? "&" + cloudDbHAParams : "") + (s_dbHAEnabled ? "&loadBalanceStrategy=" + loadBalanceStrategy : ""); DriverLoader.loadDriver(cloudDriver); - final ConnectionFactory cloudConnectionFactory = new DriverManagerConnectionFactory(cloudConnectionUri, cloudUsername, cloudPassword); - - final KeyedObjectPoolFactory poolableObjFactory = (cloudPoolPreparedStatements ? new StackKeyedObjectPoolFactory() : null); - - final PoolableConnectionFactory cloudPoolableConnectionFactory = - new PoolableConnectionFactory(cloudConnectionFactory, cloudConnectionPool, poolableObjFactory, cloudValidationQuery, false, false, isolationLevel); - // Default Data Source for CloudStack - s_ds = new PoolingDataSource(cloudPoolableConnectionFactory.getPool()); + s_ds = createDataSource(cloudConnectionUri, cloudUsername, cloudPassword, cloudMaxActive, cloudMaxIdle, cloudMaxWait, + cloudTimeBtwEvictionRunsMillis, cloudMinEvcitableIdleTimeMillis, cloudTestWhileIdle, cloudTestOnBorrow, + cloudValidationQuery, isolationLevel); // Configure the usage db final int usageMaxActive = Integer.parseInt(dbProps.getProperty("db.usage.maxActive")); @@ -1111,21 +1103,15 @@ public static void initDataSource(Properties dbProps) { final boolean usageAutoReconnect = Boolean.parseBoolean(dbProps.getProperty("db.usage.autoReconnect")); final String usageUrl = dbProps.getProperty("db.usage.url.params"); - final GenericObjectPool usageConnectionPool = - new GenericObjectPool(null, usageMaxActive, GenericObjectPool.DEFAULT_WHEN_EXHAUSTED_ACTION, usageMaxWait, usageMaxIdle); - final String usageConnectionUri = usageDriver + "://" + usageHost + (s_dbHAEnabled ? "," + dbProps.getProperty("db.cloud.slaves") : "") + ":" + usagePort + "/" + usageDbName + "?autoReconnect=" + usageAutoReconnect + (usageUrl != null ? "&" + usageUrl : "") + (s_dbHAEnabled ? "&" + getDBHAParams("usage", dbProps) : "") + (s_dbHAEnabled ? "&loadBalanceStrategy=" + loadBalanceStrategy : ""); DriverLoader.loadDriver(usageDriver); - final ConnectionFactory usageConnectionFactory = new DriverManagerConnectionFactory(usageConnectionUri, usageUsername, usagePassword); - - final PoolableConnectionFactory usagePoolableConnectionFactory = - new PoolableConnectionFactory(usageConnectionFactory, usageConnectionPool, new StackKeyedObjectPoolFactory(), null, false, false); - // Data Source for usage server - s_usageDS = new PoolingDataSource(usagePoolableConnectionFactory.getPool()); + s_usageDS = createDataSource(usageConnectionUri, usageUsername, usagePassword, + usageMaxActive, usageMaxIdle, usageMaxWait, null, null, null, null, + null, isolationLevel); try { // Configure the simulator db @@ -1140,18 +1126,12 @@ public static void initDataSource(Properties dbProps) { final String simulatorDbName = dbProps.getProperty("db.simulator.name"); final boolean simulatorAutoReconnect = Boolean.parseBoolean(dbProps.getProperty("db.simulator.autoReconnect")); - final GenericObjectPool simulatorConnectionPool = - new GenericObjectPool(null, simulatorMaxActive, GenericObjectPool.DEFAULT_WHEN_EXHAUSTED_ACTION, simulatorMaxWait, simulatorMaxIdle); - final String simulatorConnectionUri = simulatorDriver + "://" + simulatorHost + ":" + simulatorPort + "/" + simulatorDbName + "?autoReconnect=" + simulatorAutoReconnect; DriverLoader.loadDriver(simulatorDriver); - final ConnectionFactory simulatorConnectionFactory = new DriverManagerConnectionFactory(simulatorConnectionUri, simulatorUsername, simulatorPassword); - - final PoolableConnectionFactory simulatorPoolableConnectionFactory = - new PoolableConnectionFactory(simulatorConnectionFactory, simulatorConnectionPool, new StackKeyedObjectPoolFactory(), null, false, false); - s_simulatorDS = new PoolingDataSource(simulatorPoolableConnectionFactory.getPool()); + s_simulatorDS = createDataSource(simulatorConnectionUri, simulatorUsername, simulatorPassword, + simulatorMaxActive, simulatorMaxIdle, simulatorMaxWait, null, null, null, null, cloudValidationQuery, isolationLevel); } catch (Exception e) { s_logger.debug("Simulator DB properties are not available. Not initializing simulator DS"); } @@ -1165,6 +1145,54 @@ public static void initDataSource(Properties dbProps) { } } + /** + * Creates a data source + */ + private static DataSource createDataSource(String uri, String username, String password, + Integer maxActive, Integer maxIdle, Long maxWait, + Long timeBtwnEvictionRuns, Long minEvictableIdleTime, + Boolean testWhileIdle, Boolean testOnBorrow, + String validationQuery, Integer isolationLevel) { + ConnectionFactory connectionFactory = new DriverManagerConnectionFactory(uri, username, password); + PoolableConnectionFactory poolableConnectionFactory = new PoolableConnectionFactory(connectionFactory, null); + GenericObjectPoolConfig config = createPoolConfig(maxActive, maxIdle, maxWait, timeBtwnEvictionRuns, minEvictableIdleTime, testWhileIdle, testOnBorrow); + ObjectPool connectionPool = new GenericObjectPool<>(poolableConnectionFactory, config); + poolableConnectionFactory.setPool(connectionPool); + if (validationQuery != null) { + poolableConnectionFactory.setValidationQuery(validationQuery); + } + if (isolationLevel != null) { + poolableConnectionFactory.setDefaultTransactionIsolation(isolationLevel); + } + return new PoolingDataSource<>(connectionPool); + } + + /** + * Return a GenericObjectPoolConfig configuration usable on connection pool creation + */ + private static GenericObjectPoolConfig createPoolConfig(Integer maxActive, Integer maxIdle, Long maxWait, + Long timeBtwnEvictionRuns, Long minEvictableIdleTime, + Boolean testWhileIdle, Boolean testOnBorrow) { + GenericObjectPoolConfig config = new GenericObjectPoolConfig(); + config.setMaxTotal(maxActive); + config.setMaxIdle(maxIdle); + config.setMaxWaitMillis(maxWait); + + if (timeBtwnEvictionRuns != null) { + config.setTimeBetweenEvictionRunsMillis(timeBtwnEvictionRuns); + } + if (minEvictableIdleTime != null) { + config.setMinEvictableIdleTimeMillis(minEvictableIdleTime); + } + if (testWhileIdle != null) { + config.setTestWhileIdle(testWhileIdle); + } + if (testOnBorrow != null) { + config.setTestOnBorrow(testOnBorrow); + } + return config; + } + private static String getDBHAParams(String dbName, Properties dbProps) { StringBuilder sb = new StringBuilder(); sb.append("failOverReadOnly=" + dbProps.getProperty("db." + dbName + ".failOverReadOnly")); @@ -1178,11 +1206,10 @@ private static String getDBHAParams(String dbName, Properties dbProps) { @SuppressWarnings({"unchecked", "rawtypes"}) private static DataSource getDefaultDataSource(final String database) { - final GenericObjectPool connectionPool = new GenericObjectPool(null, 5); final ConnectionFactory connectionFactory = new DriverManagerConnectionFactory("jdbc:mysql://localhost:3306/" + database, "cloud", "cloud"); - final PoolableConnectionFactory poolableConnectionFactory = new PoolableConnectionFactory(connectionFactory, connectionPool, null, null, false, true); - return new PoolingDataSource( - /* connectionPool */poolableConnectionFactory.getPool()); + final PoolableConnectionFactory poolableConnectionFactory = new PoolableConnectionFactory(connectionFactory, null); + final GenericObjectPool connectionPool = new GenericObjectPool(poolableConnectionFactory); + return new PoolingDataSource(connectionPool); } /** diff --git a/pom.xml b/pom.xml index c6e028d76518..cbe422e20792 100644 --- a/pom.xml +++ b/pom.xml @@ -50,8 +50,8 @@ 1.2.17 1.2.17 3.2.5 - 1.4 - 1.6 + 2.2.0 + 2.4.3 1.11 1.10 1.1.1 @@ -271,13 +271,13 @@ ${cs.cglib.version} - commons-dbcp - commons-dbcp + org.apache.commons + commons-dbcp2 ${cs.dbcp.version} - commons-pool - commons-pool + org.apache.commons + commons-pool2 @@ -297,8 +297,8 @@ ${cs.commons-fileupload.version} - commons-pool - commons-pool + org.apache.commons + commons-pool2 ${cs.pool.version} From 2936cb3b4198fe5eb5bc2f7bdcb1309c07e0cebd Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Gabriel=20Beims=20Br=C3=A4scher?= Date: Wed, 11 Jul 2018 13:12:59 -0300 Subject: [PATCH 02/16] Fix typo in VirtualMachineManagerImpl.java (#2738) from "cleanued up" to "cleaned up" --- .../src/main/java/com/cloud/vm/VirtualMachineManagerImpl.java | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/engine/orchestration/src/main/java/com/cloud/vm/VirtualMachineManagerImpl.java b/engine/orchestration/src/main/java/com/cloud/vm/VirtualMachineManagerImpl.java index 542cb4ecad7a..81b4e5bc9dbf 100755 --- a/engine/orchestration/src/main/java/com/cloud/vm/VirtualMachineManagerImpl.java +++ b/engine/orchestration/src/main/java/com/cloud/vm/VirtualMachineManagerImpl.java @@ -1572,7 +1572,7 @@ protected boolean cleanup(final VirtualMachineGuru guru, final VirtualMachinePro } volumeMgr.release(profile); - s_logger.debug("Successfully cleanued up resources for the vm " + vm + " in " + state + " state"); + s_logger.debug(String.format("Successfully cleaned up resources for the VM %s in %s state", vm, state)); } return true; From 4a5fab0573c6d99a79ef3c6cbcf30918c2465ff8 Mon Sep 17 00:00:00 2001 From: Khosrow Moossavi Date: Fri, 13 Jul 2018 07:17:34 -0400 Subject: [PATCH 03/16] packaging: Catch error in packaging script and fail the build (#2649) This is to fix the regression added in #2433. In this fix we're going to fail the build early if --use-timestamp is provided and working directory is *not* clean. And also fail the build if something in the script has returned non-zero value. --- packaging/build-deb.sh | 20 ++++++++++++++++---- 1 file changed, 16 insertions(+), 4 deletions(-) diff --git a/packaging/build-deb.sh b/packaging/build-deb.sh index 52a168a95ba1..e8c178350c71 100755 --- a/packaging/build-deb.sh +++ b/packaging/build-deb.sh @@ -16,7 +16,7 @@ # specific language governing permissions and limitations # under the License. -#set -e +set -e # # This script builds Debian packages for CloudStack and does @@ -100,8 +100,7 @@ while [ -n "$1" ]; do esac done -DCH=$(which dch) -if [ -z "$DCH" ] ; then +if [ -z "$(which dch)" ] ; then echo -e "dch not found, please install devscripts at first. \nDEB Build Failed" exit 1 fi @@ -110,6 +109,17 @@ NOW="$(date +%s)" PWD=$(cd $(dirname "$0") && pwd -P) cd $PWD/../ +# Fail early if working directory is NOT clean and --use-timestamp was provided +if [ "$USE_TIMESTAMP" == "true" ]; then + if [ -n "$(cd $PWD; git status -s)" ]; then + echo "Erro: You have uncommitted changes and asked for --use-timestamp to be used." + echo " --use-timestamp flag is going to temporarily change POM versions and" + echo " revert them at the end of build, and there's no way we can do partial" + echo " revert. Please commit your changes first or omit --use-timestamp flag." + exit 1 + fi +fi + VERSION=$(head -n1 debian/changelog |awk -F [\(\)] '{print $2}') DISTCODE=$(lsb_release -sc) @@ -148,4 +158,6 @@ dpkg-buildpackage -uc -us -b /bin/mv /tmp/changelog.orig debian/changelog -(cd $PWD; git reset --hard) +if [ "$USE_TIMESTAMP" == "true" ]; then + (cd $PWD; git reset --hard) +fi From 07042a67c69174c2ae1f49b3c1cdad2fa810fdc7 Mon Sep 17 00:00:00 2001 From: Khosrow Moossavi Date: Fri, 13 Jul 2018 07:23:29 -0400 Subject: [PATCH 04/16] travis: Enhance Travis to do packaging jobs on different stage (#2640) Two stages are defined in travis job: test and package, where test runs before package. On package stage we're going to do the packaging of final artifacts based on centos7, centos63, ubuntu1804, ubuntu1604 and ubuntu1404. This is to validate that no PR will break packaging artifacts. --- .travis.yml | 51 +++++++++++++++++++++++++++++++++++++++++++++++++-- 1 file changed, 49 insertions(+), 2 deletions(-) diff --git a/.travis.yml b/.travis.yml index f4b52bae9457..2d323244f864 100644 --- a/.travis.yml +++ b/.travis.yml @@ -17,17 +17,21 @@ sudo: required dist: trusty group: edge + language: java jdk: -- oraclejdk8 + - oraclejdk8 python: - "2.7" + cache: directories: - - $HOME/.m2 + - $HOME/.m2 timeout: 500 + notifications: email: false + env: global: - PATH=$HOME/.local/bin:$PATH @@ -171,3 +175,46 @@ script: after_success: ./tools/travis/after_success.sh after_failure: ./tools/travis/after_failure.sh after_script: ./tools/travis/after_script.sh + +# Packaging job definition, will be reused +.package_job: &package_job + before_install: docker pull ${IMAGE} + install: true + before_script: true + script: | + docker run \ + --volume ${TRAVIS_BUILD_DIR}:/mnt/build/cloudstack \ + --volume $HOME/.m2:/root/.m2 \ + --rm \ + ${IMAGE} ${PARAMS} + after_script: true + after_success: true + after_failure: true + +jobs: + include: + - stage: package + services: docker + env: IMAGE=khos2ow/cloudstack-rpm-builder:centos7 PARAMS="--distribution centos7 --pack oss" + <<: *package_job + + - stage: package + services: docker + env: IMAGE=khos2ow/cloudstack-rpm-builder:centos6 PARAMS="--distribution centos63 --pack oss" + <<: *package_job + + - stage: package + services: docker + env: IMAGE=khos2ow/cloudstack-deb-builder:ubuntu1804 PARAMS="" + <<: *package_job + + - stage: package + services: docker + env: IMAGE=khos2ow/cloudstack-deb-builder:ubuntu1604 PARAMS="" + <<: *package_job + + - stage: package + services: docker + env: IMAGE=khos2ow/cloudstack-deb-builder:ubuntu1404 PARAMS="" + <<: *package_job + From 40af32b1b98e5ab6229531a151381b1f4f1f2910 Mon Sep 17 00:00:00 2001 From: Dingane Hlaluku Date: Fri, 13 Jul 2018 13:28:45 +0200 Subject: [PATCH 05/16] diagnostics: new diagnostics admin API for system VMs (#2721) This is a new feature for CS that allows Admin users improved troubleshooting of network issues in CloudStack hosted networks. Description: For troubleshooting purposes, CloudStack administrators may wish to execute network utility commands remotely on system VMs, or request system VMs to ping/traceroute/arping to specific addresses over specific interfaces. An API command to provide such functionalities is being developed without altering any existing APIs. The targeted system VMs for this feature are the Virtual Router (VR), Secondary Storage VM (SSVM) and the Console Proxy VM (CPVM). FS: https://cwiki.apache.org/confluence/display/CLOUDSTACK/CloudStack+Remote+Diagnostics+API ML discussion: https://markmail.org/message/xt7owmb2c6iw7tva --- .travis.yml | 3 +- .../apache/cloudstack/api/ApiConstants.java | 5 + .../admin/diagnostics/RunDiagnosticsCmd.java | 136 +++++ .../api/response/RunDiagnosticsResponse.java | 67 +++ .../diagnostics/DiagnosticsService.java | 29 + .../diagnostics/DiagnosticsType.java | 42 ++ .../resource/virtualnetwork/VRScripts.java | 1 + .../VirtualRoutingResource.java | 18 +- .../diagnostics/DiagnosticsAnswer.java | 54 ++ .../diagnostics/DiagnosticsCommand.java | 44 ++ .../cloud/agent/manager/MockAgentManager.java | 3 + .../agent/manager/MockAgentManagerImpl.java | 56 +- .../agent/manager/SimulatorManagerImpl.java | 5 +- .../diagnostics/DiagnosticsServiceImpl.java | 131 +++++ .../spring-server-core-managers-context.xml | 2 + .../DiagnosticsServiceImplTest.java | 196 +++++++ systemvm/debian/opt/cloud/bin/diagnostics.py | 71 +++ test/integration/smoke/test_diagnostics.py | 539 ++++++++++++++++++ tools/apidoc/gen_toc.py | 3 +- 19 files changed, 1377 insertions(+), 28 deletions(-) create mode 100644 api/src/main/java/org/apache/cloudstack/api/command/admin/diagnostics/RunDiagnosticsCmd.java create mode 100644 api/src/main/java/org/apache/cloudstack/api/response/RunDiagnosticsResponse.java create mode 100644 api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsService.java create mode 100644 api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsType.java create mode 100644 core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsAnswer.java create mode 100644 core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsCommand.java create mode 100644 server/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImpl.java create mode 100644 server/src/test/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImplTest.java create mode 100755 systemvm/debian/opt/cloud/bin/diagnostics.py create mode 100644 test/integration/smoke/test_diagnostics.py diff --git a/.travis.yml b/.travis.yml index 2d323244f864..130e907c5cc1 100644 --- a/.travis.yml +++ b/.travis.yml @@ -38,7 +38,7 @@ env: matrix: # Keep the TESTS sorted by name and grouped by type - TESTS="smoke/test_certauthority_root" - + - TESTS="smoke/test_accounts smoke/test_affinity_groups smoke/test_affinity_groups_projects @@ -47,6 +47,7 @@ env: smoke/test_deploy_vm_root_resize smoke/test_deploy_vm_with_userdata smoke/test_deploy_vms_with_varied_deploymentplanners + smoke/test_diagnostics smoke/test_disk_offerings smoke/test_dynamicroles smoke/test_global_settings diff --git a/api/src/main/java/org/apache/cloudstack/api/ApiConstants.java b/api/src/main/java/org/apache/cloudstack/api/ApiConstants.java index 504b2149837e..1a57313eaa77 100644 --- a/api/src/main/java/org/apache/cloudstack/api/ApiConstants.java +++ b/api/src/main/java/org/apache/cloudstack/api/ApiConstants.java @@ -719,6 +719,11 @@ public class ApiConstants { public static final String LAST_ANNOTATED = "lastannotated"; public static final String LDAP_DOMAIN = "ldapdomain"; + public static final String STDOUT = "stdout"; + public static final String STDERR = "stderr"; + public static final String EXITCODE = "exitcode"; + public static final String TARGET_ID = "targetid"; + public enum HostDetails { all, capacity, events, stats, min; } diff --git a/api/src/main/java/org/apache/cloudstack/api/command/admin/diagnostics/RunDiagnosticsCmd.java b/api/src/main/java/org/apache/cloudstack/api/command/admin/diagnostics/RunDiagnosticsCmd.java new file mode 100644 index 000000000000..bb1ddf57cb7d --- /dev/null +++ b/api/src/main/java/org/apache/cloudstack/api/command/admin/diagnostics/RunDiagnosticsCmd.java @@ -0,0 +1,136 @@ +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +package org.apache.cloudstack.api.command.admin.diagnostics; + +import com.cloud.exception.InsufficientCapacityException; +import com.cloud.exception.ResourceUnavailableException; +import com.cloud.user.Account; +import com.cloud.vm.VirtualMachine; +import org.apache.cloudstack.acl.RoleType; +import org.apache.cloudstack.api.APICommand; +import org.apache.cloudstack.api.ApiArgValidator; +import org.apache.cloudstack.api.ApiConstants; +import org.apache.cloudstack.api.ApiErrorCode; +import org.apache.cloudstack.api.BaseCmd; +import org.apache.cloudstack.api.Parameter; +import org.apache.cloudstack.api.ServerApiException; +import org.apache.cloudstack.api.response.RunDiagnosticsResponse; +import org.apache.cloudstack.api.response.SystemVmResponse; +import org.apache.cloudstack.context.CallContext; +import org.apache.cloudstack.diagnostics.DiagnosticsService; +import org.apache.cloudstack.diagnostics.DiagnosticsType; +import org.apache.commons.collections.CollectionUtils; +import org.apache.log4j.Logger; + +import javax.inject.Inject; +import java.util.Collections; +import java.util.Map; + +@APICommand(name = RunDiagnosticsCmd.APINAME, responseObject = RunDiagnosticsResponse.class, entityType = {VirtualMachine.class}, + responseHasSensitiveInfo = false, + requestHasSensitiveInfo = false, + description = "Execute network-utility command (ping/arping/tracert) on system VMs remotely", + authorized = {RoleType.Admin}, + since = "4.12.0.0") +public class RunDiagnosticsCmd extends BaseCmd { + private static final Logger LOGGER = Logger.getLogger(RunDiagnosticsCmd.class); + public static final String APINAME = "runDiagnostics"; + + @Inject + private DiagnosticsService diagnosticsService; + + ///////////////////////////////////////////////////// + //////////////// API parameters ///////////////////// + ///////////////////////////////////////////////////// + @Parameter(name = ApiConstants.TARGET_ID, type = CommandType.UUID, required = true, entityType = SystemVmResponse.class, + validations = {ApiArgValidator.PositiveNumber}, + description = "The ID of the system VM instance to diagnose") + private Long id; + + @Parameter(name = ApiConstants.IP_ADDRESS, type = CommandType.STRING, required = true, + validations = {ApiArgValidator.NotNullOrEmpty}, + description = "The IP/Domain address to test connection to") + private String address; + + @Parameter(name = ApiConstants.TYPE, type = CommandType.STRING, required = true, + validations = {ApiArgValidator.NotNullOrEmpty}, + description = "The system VM diagnostics type valid options are: ping, traceroute, arping") + private String type; + + @Parameter(name = ApiConstants.PARAMS, type = CommandType.STRING, + authorized = {RoleType.Admin}, + description = "Additional command line options that apply for each command") + private String optionalArguments; + + ///////////////////////////////////////////////////// + /////////////////// Accessors /////////////////////// + ///////////////////////////////////////////////////// + public Long getId() { + return id; + } + + public String getAddress() { + return address; + } + + public DiagnosticsType getType() { + DiagnosticsType diagnosticsType = DiagnosticsType.getCommand(type); + if (diagnosticsType == null) { + throw new IllegalArgumentException(type + " Is not a valid diagnostics command type. "); + } + return diagnosticsType; + } + + public String getOptionalArguments() { + return optionalArguments; + } + + ///////////////////////////////////////////////////// + /////////////////// Implementation ////////////////// + ///////////////////////////////////////////////////// + @Override + public String getCommandName() { + return APINAME.toLowerCase() + BaseCmd.RESPONSE_SUFFIX; + } + + @Override + public long getEntityOwnerId() { + Account account = CallContext.current().getCallingAccount(); + if (account != null) { + return account.getId(); + } + return Account.ACCOUNT_ID_SYSTEM; + } + + @Override + public void execute() throws ResourceUnavailableException, InsufficientCapacityException, ServerApiException { + RunDiagnosticsResponse response = new RunDiagnosticsResponse(); + try { + final Map answerMap = diagnosticsService.runDiagnosticsCommand(this); + if (CollectionUtils.isNotEmpty(Collections.singleton(answerMap))) { + response.setStdout(answerMap.get(ApiConstants.STDOUT)); + response.setStderr(answerMap.get(ApiConstants.STDERR)); + response.setExitCode(answerMap.get(ApiConstants.EXITCODE)); + response.setObjectName("diagnostics"); + response.setResponseName(getCommandName()); + this.setResponseObject(response); + } + } catch (final ServerApiException e) { + throw new ServerApiException(ApiErrorCode.INTERNAL_ERROR, e.getMessage()); + } + } +} \ No newline at end of file diff --git a/api/src/main/java/org/apache/cloudstack/api/response/RunDiagnosticsResponse.java b/api/src/main/java/org/apache/cloudstack/api/response/RunDiagnosticsResponse.java new file mode 100644 index 000000000000..4c8a923613ab --- /dev/null +++ b/api/src/main/java/org/apache/cloudstack/api/response/RunDiagnosticsResponse.java @@ -0,0 +1,67 @@ +// +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +// + +package org.apache.cloudstack.api.response; + +import com.cloud.serializer.Param; +import com.cloud.vm.VirtualMachine; +import com.google.gson.annotations.SerializedName; +import org.apache.cloudstack.api.ApiConstants; +import org.apache.cloudstack.api.BaseResponse; +import org.apache.cloudstack.api.EntityReference; + +@EntityReference(value = VirtualMachine.class) +public class RunDiagnosticsResponse extends BaseResponse { + @SerializedName(ApiConstants.STDOUT) + @Param(description = "the standard output from the command execution") + private String stdout; + + @SerializedName(ApiConstants.STDERR) + @Param(description = "the standard error output from the command execution") + private String stderr; + + @SerializedName(ApiConstants.EXITCODE) + @Param(description = "the command execution return code") + private String exitCode; + + public String getStdout() { + return stdout; + } + + public void setStdout(String stdout) { + this.stdout = stdout; + } + + public String getStderr() { + return stderr; + } + + public void setStderr(String stderr) { + this.stderr = stderr; + } + + public String getExitCode() { + return exitCode; + } + + public void setExitCode(String exitCode) { + this.exitCode = exitCode; + } + +} diff --git a/api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsService.java b/api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsService.java new file mode 100644 index 000000000000..a9177af7e0c9 --- /dev/null +++ b/api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsService.java @@ -0,0 +1,29 @@ +// +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +// +package org.apache.cloudstack.diagnostics; + +import org.apache.cloudstack.api.command.admin.diagnostics.RunDiagnosticsCmd; + +import java.util.Map; + +public interface DiagnosticsService { + + Map runDiagnosticsCommand(RunDiagnosticsCmd cmd); + +} \ No newline at end of file diff --git a/api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsType.java b/api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsType.java new file mode 100644 index 000000000000..0e3a1dad2c62 --- /dev/null +++ b/api/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsType.java @@ -0,0 +1,42 @@ +// +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +// +package org.apache.cloudstack.diagnostics; + +public enum DiagnosticsType { + PING("ping"), TRACEROUTE("traceroute"), ARPING("arping"); + + private String value; + + DiagnosticsType(String value) { + this.value = value; + } + + public String getValue() { + return value; + } + + public static DiagnosticsType getCommand(String cmd) { + for (DiagnosticsType type : DiagnosticsType.values()) { + if (type.value.equalsIgnoreCase(cmd)) { + return type; + } + } + return null; + } +} \ No newline at end of file diff --git a/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VRScripts.java b/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VRScripts.java index 838f0877918f..2c75a78b1a38 100644 --- a/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VRScripts.java +++ b/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VRScripts.java @@ -69,4 +69,5 @@ public class VRScripts { public static final String VR_CFG = "vr_cfg.sh"; + public static final String DIAGNOSTICS = "diagnostics.py"; } \ No newline at end of file diff --git a/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VirtualRoutingResource.java b/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VirtualRoutingResource.java index 0ffe8cc0ea2f..112d9209349e 100644 --- a/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VirtualRoutingResource.java +++ b/core/src/main/java/com/cloud/agent/resource/virtualnetwork/VirtualRoutingResource.java @@ -22,6 +22,9 @@ import java.io.IOException; import java.net.InetSocketAddress; import java.nio.channels.SocketChannel; + +import org.apache.cloudstack.diagnostics.DiagnosticsAnswer; +import org.apache.cloudstack.diagnostics.DiagnosticsCommand; import org.joda.time.Duration; import java.util.ArrayList; import java.util.HashMap; @@ -189,9 +192,11 @@ private Answer executeQueryCommand(NetworkElementCommand cmd) { } else if (cmd instanceof GetDomRVersionCmd) { return execute((GetDomRVersionCmd)cmd); } else if (cmd instanceof CheckS2SVpnConnectionsCommand) { - return execute((CheckS2SVpnConnectionsCommand) cmd); + return execute((CheckS2SVpnConnectionsCommand)cmd); } else if (cmd instanceof GetRouterAlertsCommand) { return execute((GetRouterAlertsCommand)cmd); + } else if (cmd instanceof DiagnosticsCommand) { + return execute((DiagnosticsCommand)cmd); } else { s_logger.error("Unknown query command in VirtualRoutingResource!"); return Answer.createUnsupportedCommandAnswer(cmd); @@ -292,6 +297,15 @@ private Answer execute(CheckRouterCommand cmd) { return new CheckRouterAnswer(cmd, result.getDetails(), true); } + private Answer execute(DiagnosticsCommand cmd) { + _eachTimeout = Duration.standardSeconds(NumbersUtil.parseInt("60", 60)); + final ExecutionResult result = _vrDeployer.executeInVR(cmd.getRouterAccessIp(), VRScripts.DIAGNOSTICS, cmd.getSrciptArguments(), _eachTimeout); + if (!result.isSuccess()) { + return new DiagnosticsAnswer(cmd, false, result.getDetails()); + } + return new DiagnosticsAnswer(cmd, result.isSuccess(), result.getDetails()); + } + private Answer execute(GetDomRVersionCmd cmd) { final ExecutionResult result = _vrDeployer.executeInVR(cmd.getRouterAccessIp(), VRScripts.VERSION, null); if (!result.isSuccess()) { @@ -454,6 +468,6 @@ private Answer execute(AggregationControlCommand cmd) { _vrAggregateCommandsSet.remove(routerName); } } - return new Answer(cmd, false, "Fail to recongize aggregation action " + action.toString()); + return new Answer(cmd, false, "Fail to recognize aggregation action " + action.toString()); } } diff --git a/core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsAnswer.java b/core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsAnswer.java new file mode 100644 index 000000000000..006f0434ab37 --- /dev/null +++ b/core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsAnswer.java @@ -0,0 +1,54 @@ +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. + +package org.apache.cloudstack.diagnostics; + +import com.cloud.agent.api.Answer; +import com.cloud.utils.exception.CloudRuntimeException; +import com.google.common.base.Strings; +import org.apache.cloudstack.api.ApiConstants; +import org.apache.log4j.Logger; + +import java.util.HashMap; +import java.util.Map; + +public class DiagnosticsAnswer extends Answer { + public static final Logger LOGGER = Logger.getLogger(DiagnosticsAnswer.class); + + public DiagnosticsAnswer(DiagnosticsCommand cmd, boolean result, String details) { + super(cmd, result, details); + } + + public Map getExecutionDetails() { + final Map executionDetailsMap = new HashMap<>(); + if (result == true && !Strings.isNullOrEmpty(details)) { + final String[] parseDetails = details.split("&&"); + if (parseDetails.length >= 3) { + executionDetailsMap.put(ApiConstants.STDOUT, parseDetails[0].trim()); + executionDetailsMap.put(ApiConstants.STDERR, parseDetails[1].trim()); + executionDetailsMap.put(ApiConstants.EXITCODE, String.valueOf(parseDetails[2]).trim()); + } else { + throw new CloudRuntimeException("Unsupported diagnostics command type supplied"); + } + } else { + executionDetailsMap.put(ApiConstants.STDOUT, ""); + executionDetailsMap.put(ApiConstants.STDERR, details); + executionDetailsMap.put(ApiConstants.EXITCODE, "-1"); + } + return executionDetailsMap; + } +} \ No newline at end of file diff --git a/core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsCommand.java b/core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsCommand.java new file mode 100644 index 000000000000..14d9da9ab17d --- /dev/null +++ b/core/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsCommand.java @@ -0,0 +1,44 @@ +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +package org.apache.cloudstack.diagnostics; + +import com.cloud.agent.api.routing.NetworkElementCommand; + +public class DiagnosticsCommand extends NetworkElementCommand { + + private final String scriptArguments; + private final boolean executeInSequence; + + public DiagnosticsCommand(String scriptArguments, boolean executeInSequence) { + this.scriptArguments = scriptArguments; + this.executeInSequence = executeInSequence; + } + + public String getSrciptArguments() { + return scriptArguments; + } + + @Override + public boolean isQuery() { + return true; + } + + @Override + public boolean executeInSequence() { + return this.executeInSequence; + } +} \ No newline at end of file diff --git a/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManager.java b/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManager.java index 3a315509b499..6a9e70763a21 100644 --- a/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManager.java +++ b/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManager.java @@ -33,6 +33,7 @@ import com.cloud.resource.AgentResourceBase; import com.cloud.simulator.MockHost; import com.cloud.utils.component.Manager; +import org.apache.cloudstack.diagnostics.DiagnosticsCommand; public interface MockAgentManager extends Manager { public static final long DEFAULT_HOST_MEM_SIZE = 8 * 1024 * 1024 * 1024L; // 8G, unit of Mbytes @@ -64,4 +65,6 @@ boolean handleSystemVMStart(long vmId, String privateIpAddress, String privateMa Answer maintain(MaintainCommand cmd); Answer checkNetworkCommand(CheckNetworkCommand cmd); + + Answer runDiagnostics(DiagnosticsCommand cmd); } diff --git a/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManagerImpl.java b/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManagerImpl.java index 9d1e4079d42e..7af282724b22 100644 --- a/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManagerImpl.java +++ b/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/MockAgentManagerImpl.java @@ -16,29 +16,6 @@ // under the License. package com.cloud.agent.manager; -import java.security.NoSuchAlgorithmException; -import java.security.SecureRandom; -import java.util.HashMap; -import java.util.List; -import java.util.Map; -import java.util.UUID; -import java.util.concurrent.ConcurrentHashMap; -import java.util.concurrent.LinkedBlockingQueue; -import java.util.concurrent.ThreadPoolExecutor; -import java.util.concurrent.TimeUnit; -import java.util.regex.PatternSyntaxException; - -import javax.inject.Inject; -import javax.naming.ConfigurationException; - -import org.apache.cloudstack.ca.SetupCertificateAnswer; -import org.apache.cloudstack.ca.SetupCertificateCommand; -import org.apache.cloudstack.ca.SetupKeyStoreCommand; -import org.apache.cloudstack.ca.SetupKeystoreAnswer; -import org.apache.cloudstack.context.CallContext; -import org.apache.log4j.Logger; -import org.springframework.stereotype.Component; - import com.cloud.agent.AgentManager; import com.cloud.agent.api.Answer; import com.cloud.agent.api.CheckHealthCommand; @@ -49,6 +26,7 @@ import com.cloud.agent.api.HostStatsEntry; import com.cloud.agent.api.MaintainAnswer; import com.cloud.agent.api.PingTestCommand; +import com.cloud.agent.api.routing.NetworkElementCommand; import com.cloud.api.commands.SimulatorAddSecondaryAgent; import com.cloud.dc.dao.HostPodDao; import com.cloud.exception.DiscoveryException; @@ -73,6 +51,29 @@ import com.cloud.utils.db.TransactionLegacy; import com.cloud.utils.exception.CloudRuntimeException; import com.cloud.utils.net.NetUtils; +import org.apache.cloudstack.ca.SetupCertificateAnswer; +import org.apache.cloudstack.ca.SetupCertificateCommand; +import org.apache.cloudstack.ca.SetupKeyStoreCommand; +import org.apache.cloudstack.ca.SetupKeystoreAnswer; +import org.apache.cloudstack.context.CallContext; +import org.apache.cloudstack.diagnostics.DiagnosticsAnswer; +import org.apache.cloudstack.diagnostics.DiagnosticsCommand; +import org.apache.log4j.Logger; +import org.springframework.stereotype.Component; + +import javax.inject.Inject; +import javax.naming.ConfigurationException; +import java.security.NoSuchAlgorithmException; +import java.security.SecureRandom; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import java.util.UUID; +import java.util.concurrent.ConcurrentHashMap; +import java.util.concurrent.LinkedBlockingQueue; +import java.util.concurrent.ThreadPoolExecutor; +import java.util.concurrent.TimeUnit; +import java.util.regex.PatternSyntaxException; @Component public class MockAgentManagerImpl extends ManagerBase implements MockAgentManager { @@ -481,6 +482,7 @@ public Answer setupCertificate(SetupCertificateCommand cmd) { return new SetupCertificateAnswer(true); } + @Override public boolean start() { for (Discoverer discoverer : discoverers) { @@ -520,6 +522,14 @@ public Answer checkNetworkCommand(CheckNetworkCommand cmd) { return new CheckNetworkAnswer(cmd, true, "Network Setup check by names is done"); } + @Override + public Answer runDiagnostics(final DiagnosticsCommand cmd) { + final String vmInstance = cmd.getAccessDetail(NetworkElementCommand.ROUTER_NAME); + final String[] args = cmd.getSrciptArguments().split(" "); + final String mockAnswer = String.format("%s %s executed in %s && && 0", args[0].toUpperCase(), args[1], vmInstance); + return new DiagnosticsAnswer(cmd, true, mockAnswer); + } + public List getDiscoverers() { return discoverers; } diff --git a/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/SimulatorManagerImpl.java b/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/SimulatorManagerImpl.java index 729777312fbd..29ad3cc4969e 100644 --- a/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/SimulatorManagerImpl.java +++ b/plugins/hypervisors/simulator/src/main/java/com/cloud/agent/manager/SimulatorManagerImpl.java @@ -26,6 +26,7 @@ import javax.inject.Inject; import javax.naming.ConfigurationException; +import org.apache.cloudstack.diagnostics.DiagnosticsCommand; import org.apache.log4j.Logger; import org.springframework.stereotype.Component; @@ -293,7 +294,9 @@ public Answer simulate(final Command cmd, final String hostGuid) { } else if (cmd instanceof PingTestCommand) { answer = _mockAgentMgr.pingTest((PingTestCommand)cmd); } else if (cmd instanceof SetupKeyStoreCommand) { - answer = _mockAgentMgr.setupKeyStore((SetupKeyStoreCommand)cmd); + answer = _mockAgentMgr.setupKeyStore((SetupKeyStoreCommand) cmd); + }else if (cmd instanceof DiagnosticsCommand) { + answer = _mockAgentMgr.runDiagnostics((DiagnosticsCommand)cmd); } else if (cmd instanceof SetupCertificateCommand) { answer = _mockAgentMgr.setupCertificate((SetupCertificateCommand)cmd); } else if (cmd instanceof PrepareForMigrationCommand) { diff --git a/server/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImpl.java b/server/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImpl.java new file mode 100644 index 000000000000..a06b5bb13071 --- /dev/null +++ b/server/src/main/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImpl.java @@ -0,0 +1,131 @@ +// +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +package org.apache.cloudstack.diagnostics; + +import com.cloud.agent.AgentManager; +import com.cloud.agent.api.Answer; +import com.cloud.agent.api.routing.NetworkElementCommand; +import com.cloud.exception.InvalidParameterValueException; +import com.cloud.hypervisor.Hypervisor; +import com.cloud.utils.component.ManagerBase; +import com.cloud.utils.component.PluggableService; +import com.cloud.utils.exception.CloudRuntimeException; +import com.cloud.vm.VMInstanceVO; +import com.cloud.vm.VirtualMachine; +import com.cloud.vm.VirtualMachineManager; +import com.cloud.vm.dao.VMInstanceDao; +import com.google.common.base.Strings; +import org.apache.cloudstack.api.command.admin.diagnostics.RunDiagnosticsCmd; +import org.apache.cloudstack.engine.orchestration.service.NetworkOrchestrationService; +import org.apache.log4j.Logger; + +import javax.inject.Inject; +import java.util.ArrayList; +import java.util.List; +import java.util.Map; +import java.util.regex.Pattern; + +public class DiagnosticsServiceImpl extends ManagerBase implements PluggableService, DiagnosticsService { + private static final Logger LOGGER = Logger.getLogger(DiagnosticsServiceImpl.class); + + @Inject + private AgentManager agentManager; + @Inject + private VMInstanceDao instanceDao; + @Inject + private VirtualMachineManager vmManager; + @Inject + private NetworkOrchestrationService networkManager; + + @Override + public Map runDiagnosticsCommand(final RunDiagnosticsCmd cmd) { + final Long vmId = cmd.getId(); + final String cmdType = cmd.getType().getValue(); + final String ipAddress = cmd.getAddress(); + final String optionalArguments = cmd.getOptionalArguments(); + final VMInstanceVO vmInstance = instanceDao.findByIdTypes(vmId, VirtualMachine.Type.ConsoleProxy, VirtualMachine.Type.DomainRouter, VirtualMachine.Type.SecondaryStorageVm); + + if (vmInstance == null) { + throw new InvalidParameterValueException("Unable to find a system vm with id " + vmId); + } + final Long hostId = vmInstance.getHostId(); + + if (hostId == null) { + throw new CloudRuntimeException("Unable to find host for virtual machine instance: " + vmInstance.getInstanceName()); + } + + final String shellCmd = prepareShellCmd(cmdType, ipAddress, optionalArguments); + + if (Strings.isNullOrEmpty(shellCmd)) { + throw new IllegalArgumentException("Optional parameters contain unwanted characters: " + optionalArguments); + } + + final Hypervisor.HypervisorType hypervisorType = vmInstance.getHypervisorType(); + + final DiagnosticsCommand command = new DiagnosticsCommand(shellCmd, vmManager.getExecuteInSequence(hypervisorType)); + final Map accessDetails = networkManager.getSystemVMAccessDetails(vmInstance); + + if (Strings.isNullOrEmpty(accessDetails.get(NetworkElementCommand.ROUTER_IP))) { + throw new CloudRuntimeException("Unable to set system vm ControlIP for system vm with ID: " + vmId); + } + + command.setAccessDetail(accessDetails); + + Map detailsMap; + + final Answer answer = agentManager.easySend(hostId, command); + + if (answer != null && (answer instanceof DiagnosticsAnswer)) { + detailsMap = ((DiagnosticsAnswer) answer).getExecutionDetails(); + return detailsMap; + } else { + throw new CloudRuntimeException("Failed to execute diagnostics command on remote host: " + answer.getDetails()); + } + } + + protected boolean hasValidChars(String optionalArgs) { + if (Strings.isNullOrEmpty(optionalArgs)) { + return true; + } else { + final String regex = "^[\\w\\-\\s.]+$"; + final Pattern pattern = Pattern.compile(regex); + return pattern.matcher(optionalArgs).find(); + } + + } + + protected String prepareShellCmd(String cmdType, String ipAddress, String optionalParams) { + final String CMD_TEMPLATE = String.format("%s %s", cmdType, ipAddress); + if (Strings.isNullOrEmpty(optionalParams)) { + return CMD_TEMPLATE; + } else { + if (hasValidChars(optionalParams)) { + return String.format("%s %s", CMD_TEMPLATE, optionalParams); + } else { + return null; + } + } + } + + @Override + public List> getCommands() { + List> cmdList = new ArrayList<>(); + cmdList.add(RunDiagnosticsCmd.class); + return cmdList; + } +} \ No newline at end of file diff --git a/server/src/main/resources/META-INF/cloudstack/core/spring-server-core-managers-context.xml b/server/src/main/resources/META-INF/cloudstack/core/spring-server-core-managers-context.xml index c7715a866c4f..2f67c4248d35 100644 --- a/server/src/main/resources/META-INF/cloudstack/core/spring-server-core-managers-context.xml +++ b/server/src/main/resources/META-INF/cloudstack/core/spring-server-core-managers-context.xml @@ -298,4 +298,6 @@ + + diff --git a/server/src/test/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImplTest.java b/server/src/test/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImplTest.java new file mode 100644 index 000000000000..d85c5434d9a1 --- /dev/null +++ b/server/src/test/java/org/apache/cloudstack/diagnostics/DiagnosticsServiceImplTest.java @@ -0,0 +1,196 @@ +// +// Licensed to the Apache Software Foundation (ASF) under one +// or more contributor license agreements. See the NOTICE file +// distributed with this work for additional information +// regarding copyright ownership. The ASF licenses this file +// to you under the Apache License, Version 2.0 (the +// "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, +// software distributed under the License is distributed on an +// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +// KIND, either express or implied. See the License for the +// specific language governing permissions and limitations +// under the License. +// +package org.apache.cloudstack.diagnostics; + +import com.cloud.agent.AgentManager; +import com.cloud.agent.api.routing.NetworkElementCommand; +import com.cloud.exception.InvalidParameterValueException; +import com.cloud.utils.exception.CloudRuntimeException; +import com.cloud.vm.VMInstanceVO; +import com.cloud.vm.VirtualMachine; +import com.cloud.vm.VirtualMachineManager; +import com.cloud.vm.dao.VMInstanceDao; +import junit.framework.TestCase; +import org.apache.cloudstack.api.ApiConstants; +import org.apache.cloudstack.api.command.admin.diagnostics.RunDiagnosticsCmd; +import org.apache.cloudstack.engine.orchestration.service.NetworkOrchestrationService; +import org.junit.After; +import org.junit.Before; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.Mockito; +import org.mockito.runners.MockitoJUnitRunner; + +import java.util.HashMap; +import java.util.Map; + +@RunWith(MockitoJUnitRunner.class) +public class DiagnosticsServiceImplTest extends TestCase { + + @Mock + private AgentManager agentManager; + @Mock + private VMInstanceDao instanceDao; + @Mock + private RunDiagnosticsCmd diagnosticsCmd; + @Mock + private DiagnosticsCommand command; + @Mock + private VMInstanceVO instanceVO; + @Mock + private VirtualMachineManager vmManager; + @Mock + private NetworkOrchestrationService networkManager; + + @InjectMocks + private DiagnosticsServiceImpl diagnosticsService = new DiagnosticsServiceImpl(); + + @Before + public void setUp() throws Exception { + Mockito.when(diagnosticsCmd.getId()).thenReturn(1L); + Mockito.when(diagnosticsCmd.getType()).thenReturn(DiagnosticsType.PING); + Mockito.when(instanceDao.findByIdTypes(Mockito.anyLong(), Mockito.any(VirtualMachine.Type.class), + Mockito.any(VirtualMachine.Type.class), Mockito.any(VirtualMachine.Type.class))).thenReturn(instanceVO); + + } + + @After + public void tearDown() throws Exception { + Mockito.reset(diagnosticsCmd); + Mockito.reset(agentManager); + Mockito.reset(instanceDao); + Mockito.reset(instanceVO); + Mockito.reset(command); + } + + @Test + public void testRunDiagnosticsCommandTrue() throws Exception { + Mockito.when(diagnosticsCmd.getAddress()).thenReturn("8.8.8.8"); + Map accessDetailsMap = new HashMap<>(); + accessDetailsMap.put(NetworkElementCommand.ROUTER_IP, "169.20.175.10"); + Mockito.when(networkManager.getSystemVMAccessDetails(Mockito.any(VMInstanceVO.class))).thenReturn(accessDetailsMap); + final String details = "PING 8.8.8.8 (8.8.8.8) 56(84) bytes of data.\n" + + "64 bytes from 8.8.8.8: icmp_seq=1 ttl=125 time=7.88 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=2 ttl=125 time=251 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=3 ttl=125 time=64.9 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=4 ttl=125 time=50.7 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=5 ttl=125 time=67.9 ms\n" + + "\n" + + "--- 8.8.8.8 ping statistics ---\n" + + "5 packets transmitted, 5 received, 0% packet loss, time 4003ms\n" + + "rtt min/avg/max/mdev = 7.881/88.587/251.410/84.191 ms&&\n" + + "&&\n" + + "0\n"; + + Mockito.when(agentManager.easySend(Mockito.anyLong(), Mockito.any(DiagnosticsCommand.class))).thenReturn(new DiagnosticsAnswer(command, true, details)); + + Map detailsMap = diagnosticsService.runDiagnosticsCommand(diagnosticsCmd); + + String stdout = "PING 8.8.8.8 (8.8.8.8) 56(84) bytes of data.\n" + + "64 bytes from 8.8.8.8: icmp_seq=1 ttl=125 time=7.88 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=2 ttl=125 time=251 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=3 ttl=125 time=64.9 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=4 ttl=125 time=50.7 ms\n" + + "64 bytes from 8.8.8.8: icmp_seq=5 ttl=125 time=67.9 ms\n" + + "\n" + + "--- 8.8.8.8 ping statistics ---\n" + + "5 packets transmitted, 5 received, 0% packet loss, time 4003ms\n" + + "rtt min/avg/max/mdev = 7.881/88.587/251.410/84.191 ms"; + + assertEquals(3, detailsMap.size()); + assertEquals("Mismatch between actual and expected STDERR", "", detailsMap.get(ApiConstants.STDERR)); + assertEquals("Mismatch between actual and expected EXITCODE", "0", detailsMap.get(ApiConstants.EXITCODE)); + assertEquals("Mismatch between actual and expected STDOUT", stdout, detailsMap.get(ApiConstants.STDOUT)); + } + + @Test + public void testRunDiagnosticsCommandFalse() throws Exception { + Mockito.when(diagnosticsCmd.getAddress()).thenReturn("192.0.2.2"); + + Map accessDetailsMap = new HashMap<>(); + accessDetailsMap.put(NetworkElementCommand.ROUTER_IP, "169.20.175.10"); + Mockito.when(networkManager.getSystemVMAccessDetails(Mockito.any(VMInstanceVO.class))).thenReturn(accessDetailsMap); + + String details = "PING 192.0.2.2 (192.0.2.2): 56 data bytes\n" + + "76 bytes from 213.130.48.253: Destination Net Unreachable\n" + + "--- 192.0.2.2 ping statistics ---\n" + + "4 packets transmitted, 0 packets received, 100% packet loss&&\n" + + "&&\n" + + "1\n"; + String stdout = "PING 192.0.2.2 (192.0.2.2): 56 data bytes\n" + + "76 bytes from 213.130.48.253: Destination Net Unreachable\n" + + "--- 192.0.2.2 ping statistics ---\n" + + "4 packets transmitted, 0 packets received, 100% packet loss"; + Mockito.when(agentManager.easySend(Mockito.anyLong(), Mockito.any(DiagnosticsCommand.class))).thenReturn(new DiagnosticsAnswer(command, true, details)); + + Map detailsMap = diagnosticsService.runDiagnosticsCommand(diagnosticsCmd); + + assertEquals(3, detailsMap.size()); + assertEquals("Mismatch between actual and expected STDERR", "", detailsMap.get(ApiConstants.STDERR)); + assertTrue("Mismatch between actual and expected EXITCODE", !detailsMap.get(ApiConstants.EXITCODE).equalsIgnoreCase("0")); + assertEquals("Mismatch between actual and expected STDOUT", stdout, detailsMap.get(ApiConstants.STDOUT)); + } + + @Test(expected = InvalidParameterValueException.class) + public void testRunDiagnosticsThrowsInvalidParamException() throws Exception { + Mockito.when(diagnosticsCmd.getAddress()).thenReturn(""); + Mockito.when(instanceDao.findByIdTypes(Mockito.anyLong(), Mockito.any(VirtualMachine.Type.class), + Mockito.any(VirtualMachine.Type.class), Mockito.any(VirtualMachine.Type.class))).thenReturn(null); + + diagnosticsService.runDiagnosticsCommand(diagnosticsCmd); + } + + @Test(expected = CloudRuntimeException.class) + public void testVMControlIPisNull() throws Exception { + Mockito.when(diagnosticsCmd.getAddress()).thenReturn("0.42.42.42"); + + Map accessDetailsMap = new HashMap<>(); + accessDetailsMap.put(NetworkElementCommand.ROUTER_IP, null); + Mockito.when(networkManager.getSystemVMAccessDetails(Mockito.any(VMInstanceVO.class))).thenReturn(accessDetailsMap); + + diagnosticsService.runDiagnosticsCommand(diagnosticsCmd); + } + + @Test + public void testInvalidCharsInParams() throws Exception { + assertFalse(diagnosticsService.hasValidChars("'\\''")); + assertFalse(diagnosticsService.hasValidChars("-I eth0 &")); + assertFalse(diagnosticsService.hasValidChars("-I eth0 ;")); + assertFalse(diagnosticsService.hasValidChars(" &2 > ")); + assertFalse(diagnosticsService.hasValidChars(" &2 >> ")); + assertFalse(diagnosticsService.hasValidChars(" | ")); + assertFalse(diagnosticsService.hasValidChars("|")); + assertFalse(diagnosticsService.hasValidChars(",")); + } + + @Test + public void testValidCharsInParams() throws Exception { + assertTrue(diagnosticsService.hasValidChars("")); + assertTrue(diagnosticsService.hasValidChars(".")); + assertTrue(diagnosticsService.hasValidChars(" ")); + assertTrue(diagnosticsService.hasValidChars("-I eth0 www.google.com")); + assertTrue(diagnosticsService.hasValidChars(" ")); + assertTrue(diagnosticsService.hasValidChars(" -I cloudbr0 --sport ")); + assertTrue(diagnosticsService.hasValidChars(" --back -m20 ")); + assertTrue(diagnosticsService.hasValidChars("-c 5 -4")); + assertTrue(diagnosticsService.hasValidChars("-c 5 -4 -AbDfhqUV")); + } +} \ No newline at end of file diff --git a/systemvm/debian/opt/cloud/bin/diagnostics.py b/systemvm/debian/opt/cloud/bin/diagnostics.py new file mode 100755 index 000000000000..477f99d9d3fb --- /dev/null +++ b/systemvm/debian/opt/cloud/bin/diagnostics.py @@ -0,0 +1,71 @@ +#!/usr/bin/env python +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. + +import shlex +import subprocess +import sys + + +def run_cmd(command): + if command is not None: + try: + p = subprocess.Popen(shlex.split(command), stdout=subprocess.PIPE, stderr=subprocess.PIPE) + stdout, stderr = p.communicate() + return_code = p.returncode + + except OSError as e: + stdout = "Check your command type" + stderr = "Exception occurred: %s" % e + return_code = 1 + + finally: + print('%s&&' % stdout.strip()) + print('%s&&' % stderr.strip()) + print('%s' % return_code) + + +def get_command(): + arguments = sys.argv + cmd = " ".join(arguments[1:]) + cmd_type = sys.argv[1] + + if cmd_type == 'ping': + if '-c' in arguments: + return cmd + else: + return cmd + " -c 4" + + elif cmd_type == 'traceroute': + if '-m' in arguments: + return cmd + else: + return cmd + " -m 20" + + elif cmd_type == 'arping': + if '-c' in arguments: + return cmd + else: + return cmd + " -c 4" + + else: + return None + + +if __name__ == "__main__": + command = get_command() + run_cmd(command) diff --git a/test/integration/smoke/test_diagnostics.py b/test/integration/smoke/test_diagnostics.py new file mode 100644 index 000000000000..6364d83eeee8 --- /dev/null +++ b/test/integration/smoke/test_diagnostics.py @@ -0,0 +1,539 @@ +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +""" BVT tests for remote diagnostics of system VMs +""" +# Import Local Modules +from marvin.codes import FAILED +from marvin.cloudstackTestCase import cloudstackTestCase +from marvin.cloudstackAPI import runDiagnostics +from marvin.lib.utils import (cleanup_resources) +from marvin.lib.base import (Account, + ServiceOffering, + VirtualMachine) +from marvin.lib.common import (get_domain, + get_zone, + get_test_template, + list_ssvms, + list_routers) + +from nose.plugins.attrib import attr + + +class TestRemoteDiagnostics(cloudstackTestCase): + """ + Test remote diagnostics with system VMs and VR as root admin + """ + + @classmethod + def setUpClass(cls): + + testClient = super(TestRemoteDiagnostics, cls).getClsTestClient() + cls.apiclient = testClient.getApiClient() + cls.services = testClient.getParsedTestDataConfig() + + # Get Zone, Domain and templates + cls.domain = get_domain(cls.apiclient) + cls.zone = get_zone(cls.apiclient, testClient.getZoneForTests()) + cls.hypervisor = testClient.getHypervisorInfo() + cls.services['mode'] = cls.zone.networktype + template = get_test_template( + cls.apiclient, + cls.zone.id, + cls.hypervisor + ) + if template == FAILED: + cls.fail("get_test_template() failed to return template") + + cls.services["virtual_machine"]["zoneid"] = cls.zone.id + + # Create an account, network, VM and IP addresses + cls.account = Account.create( + cls.apiclient, + cls.services["account"], + domainid=cls.domain.id + ) + cls.service_offering = ServiceOffering.create( + cls.apiclient, + cls.services["service_offerings"]["tiny"] + ) + cls.vm_1 = VirtualMachine.create( + cls.apiclient, + cls.services["virtual_machine"], + templateid=template.id, + accountid=cls.account.name, + domainid=cls.account.domainid, + serviceofferingid=cls.service_offering.id + ) + cls.cleanup = [ + cls.account, + cls.service_offering + ] + + @classmethod + def tearDownClass(cls): + try: + cls.apiclient = super( + TestRemoteDiagnostics, + cls + ).getClsTestClient().getApiClient() + # Clean up, terminate the created templates + cleanup_resources(cls.apiclient, cls.cleanup) + + except Exception as e: + raise Exception("Warning: Exception during cleanup : %s" % e) + + def setUp(self): + self.apiclient = self.testClient.getApiClient() + self.hypervisor = self.testClient.getHypervisorInfo() + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_01_ping_in_vr_success(self): + ''' + Test Ping command execution in VR + ''' + + # Validate the following: + # 1. Ping command is executed remotely on VR + + list_router_response = list_routers( + self.apiclient, + account=self.account.name, + domainid=self.account.domainid + ) + self.assertEqual( + isinstance(list_router_response, list), + True, + "Check list response returns a valid list" + ) + router = list_router_response[0] + self.debug('Starting the router with ID: %s' % router.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = router.id + cmd.ipaddress = '8.8.8.8' + cmd.type = 'ping' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Ping in VR') + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_02_ping_in_vr_failure(self): + ''' + Test Ping command execution in VR + ''' + + # Validate the following: + # 1. Ping command is executed remotely on VR + # 2. Validate Ping command execution with a non-existent/pingable IP address + + if self.hypervisor.lower() == 'simulator': + raise self.skipTest("Skipping negative test case for Simulator hypervisor") + + list_router_response = list_routers( + self.apiclient, + account=self.account.name, + domainid=self.account.domainid + ) + self.assertEqual( + isinstance(list_router_response, list), + True, + "Check list response returns a valid list" + ) + router = list_router_response[0] + self.debug('Starting the router with ID: %s' % router.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = router.id + cmd.ipaddress = '192.0.2.2' + cmd.type = 'ping' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertNotEqual( + '0', + cmd_response.exitcode, + 'Check diagnostics command returns a non-zero exit code') + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_03_ping_in_ssvm_success(self): + ''' + Test Ping command execution in SSVM + ''' + + # Validate the following: + # 1. Ping command is executed remotely on SSVM + + list_ssvm_response = list_ssvms( + self.apiclient, + systemvmtype='secondarystoragevm', + state='Running', + ) + + self.assertEqual( + isinstance(list_ssvm_response, list), + True, + 'Check list response returns a valid list' + ) + ssvm = list_ssvm_response[0] + + self.debug('Setting up SSVM with ID %s' % ssvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = ssvm.id + cmd.ipaddress = '8.8.8.8' + cmd.type = 'ping' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Ping in SSVM' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_04_ping_in_ssvm_failure(self): + ''' + Test Ping command execution in SSVM + ''' + + # Validate the following: + # 1. Ping command is executed remotely on SSVM + # 2. Validate Ping command execution with a non-existent/pingable IP address + + if self.hypervisor.lower() == 'simulator': + raise self.skipTest("Skipping negative test case for Simulator hypervisor") + + list_ssvm_response = list_ssvms( + self.apiclient, + systemvmtype='secondarystoragevm', + state='Running', + ) + + self.assertEqual( + isinstance(list_ssvm_response, list), + True, + 'Check list response returns a valid list' + ) + ssvm = list_ssvm_response[0] + + self.debug('Setting up SSVM with ID %s' % ssvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = ssvm.id + cmd.ipaddress = '192.0.2.2' + cmd.type = 'ping' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertNotEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Ping in SSVM' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_05_ping_in_cpvm_success(self): + ''' + Test Ping command execution in CPVM + ''' + + # Validate the following: + # 1. Ping command is executed remotely on CPVM + + list_ssvm_response = list_ssvms( + self.apiclient, + systemvmtype='consoleproxy', + state='Running', + ) + + self.assertEqual( + isinstance(list_ssvm_response, list), + True, + 'Check list response returns a valid list' + ) + cpvm = list_ssvm_response[0] + + self.debug('Setting up CPVM with ID %s' % cpvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = cpvm.id + cmd.ipaddress = '8.8.8.8' + cmd.type = 'ping' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Ping in CPVM' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_06_ping_in_cpvm_failure(self): + ''' + Test Ping command execution in CPVM + ''' + + # Validate the following: + # 1. Ping command is executed remotely on CPVM + # 2. Validate Ping command execution with a non-existent/pingable IP address + + if self.hypervisor.lower() == 'simulator': + raise self.skipTest("Skipping negative test case for Simulator hypervisor") + + list_ssvm_response = list_ssvms( + self.apiclient, + systemvmtype='consoleproxy', + state='Running', + ) + + self.assertEqual( + isinstance(list_ssvm_response, list), + True, + 'Check list response returns a valid list' + ) + cpvm = list_ssvm_response[0] + + self.debug('Setting up CPVM with ID %s' % cpvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = cpvm.id + cmd.ipaddress = '192.0.2.2' + cmd.type = 'ping' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertNotEqual( + '0', + cmd_response.exitcode, + 'Check diagnostics command returns a non-zero exit code' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_07_arping_in_vr(self): + ''' + Test Arping command execution in VR + ''' + + # Validate the following: + # 1. Arping command is executed remotely on VR + + list_router_response = list_routers( + self.apiclient, + account=self.account.name, + domainid=self.account.domainid + ) + self.assertEqual( + isinstance(list_router_response, list), + True, + "Check list response returns a valid list" + ) + router = list_router_response[0] + self.debug('Starting the router with ID: %s' % router.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = router.id + cmd.ipaddress = router.gateway + cmd.type = 'arping' + cmd.params = "-I eth2" + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Arping in VR') + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_08_arping_in_ssvm(self): + ''' + Test Arping command execution in SSVM + ''' + + # Validate the following: + # 1. Arping command is executed remotely on SSVM + + list_ssvm_response = list_ssvms( + self.apiclient, + systemvmtype='secondarystoragevm', + state='Running', + ) + + self.assertEqual( + isinstance(list_ssvm_response, list), + True, + 'Check list response returns a valid list' + ) + ssvm = list_ssvm_response[0] + + self.debug('Setting up SSVM with ID %s' % ssvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = ssvm.id + cmd.ipaddress = ssvm.gateway + cmd.type = 'arping' + cmd.params = '-I eth2' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Arping in SSVM' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_09_arping_in_cpvm(self): + ''' + Test Arping command execution in CPVM + ''' + + # Validate the following: + # 1. Arping command is executed remotely on CPVM + + list_cpvm_response = list_ssvms( + self.apiclient, + systemvmtype='secondarystoragevm', + state='Running', + ) + + self.assertEqual( + isinstance(list_cpvm_response, list), + True, + 'Check list response returns a valid list' + ) + cpvm = list_cpvm_response[0] + + self.debug('Setting up CPVM with ID %s' % cpvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = cpvm.id + cmd.ipaddress = cpvm.gateway + cmd.type = 'arping' + cmd.params = '-I eth2' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Arping in CPVM' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_10_traceroute_in_vr(self): + ''' + Test Arping command execution in VR + ''' + + # Validate the following: + # 1. Arping command is executed remotely on VR + + list_router_response = list_routers( + self.apiclient, + account=self.account.name, + domainid=self.account.domainid + ) + self.assertEqual( + isinstance(list_router_response, list), + True, + "Check list response returns a valid list" + ) + router = list_router_response[0] + self.debug('Starting the router with ID: %s' % router.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = router.id + cmd.ipaddress = '8.8.4.4' + cmd.type = 'traceroute' + cmd.params = "-m 10" + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Arping in VR') + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_11_traceroute_in_ssvm(self): + ''' + Test Traceroute command execution in SSVM + ''' + + # Validate the following: + # 1. Traceroute command is executed remotely on SSVM + + list_ssvm_response = list_ssvms( + self.apiclient, + systemvmtype='secondarystoragevm', + state='Running', + ) + + self.assertEqual( + isinstance(list_ssvm_response, list), + True, + 'Check list response returns a valid list' + ) + ssvm = list_ssvm_response[0] + + self.debug('Setting up SSVM with ID %s' % ssvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = ssvm.id + cmd.ipaddress = '8.8.4.4' + cmd.type = 'traceroute' + cmd.params = '-m 10' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Traceroute in SSVM' + ) + + @attr(tags=["advanced", "advancedns", "ssh", "smoke"], required_hardware="true") + def test_12_traceroute_in_cpvm(self): + ''' + Test Traceroute command execution in CPVMM + ''' + + # Validate the following: + # 1. Traceroute command is executed remotely on CPVM + + list_cpvm_response = list_ssvms( + self.apiclient, + systemvmtype='consoleproxy', + state='Running', + ) + + self.assertEqual( + isinstance(list_cpvm_response, list), + True, + 'Check list response returns a valid list' + ) + cpvm = list_cpvm_response[0] + + self.debug('Setting up CPVMM with ID %s' % cpvm.id) + + cmd = runDiagnostics.runDiagnosticsCmd() + cmd.targetid = cpvm.id + cmd.ipaddress = '8.8.4.4' + cmd.type = 'traceroute' + cmd.params = '-m 10' + cmd_response = self.apiclient.runDiagnostics(cmd) + + self.assertEqual( + '0', + cmd_response.exitcode, + 'Failed to run remote Traceroute in CPVM' + ) diff --git a/tools/apidoc/gen_toc.py b/tools/apidoc/gen_toc.py index a025efefcbcb..f45f030ac403 100644 --- a/tools/apidoc/gen_toc.py +++ b/tools/apidoc/gen_toc.py @@ -190,7 +190,8 @@ 'CA': 'Certificate', 'listElastistorInterface': 'Misc', 'cloudian': 'Cloudian', - 'Sioc' : 'Sioc' + 'Sioc' : 'Sioc', + 'Diagnostics': 'Diagnostics' } From d0c6cacd06183b980f7c51e7af956d5e486dc341 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Rafael=20Weing=C3=A4rtner?= Date: Mon, 16 Jul 2018 13:18:55 -0300 Subject: [PATCH 06/16] [CLOUDSTACK-9261] Upgrate jQuery-UI to 1.11 (JQuery UI 1.8.4 prone to XSS) (#2524) * [CLOUDSTACK-9261] Upgrate jQuery-UI to 1.11 (JQuery UI 1.8.4 prone to XSS) * fix problems in the UI for lbCertificatePolicy and StaticNAT * force jenkins build * Fix about dialog * Fix position of network service offering --- scripts/installer/windows/client.wxs | 60 - .../css/images/ui-bg_flat_0_aaaaaa_40x100.png | Bin 180 -> 0 bytes .../images/ui-bg_flat_75_ffffff_40x100.png | Bin 178 -> 0 bytes .../images/ui-bg_glass_55_fbf9ee_1x400.png | Bin 120 -> 0 bytes .../images/ui-bg_glass_65_ffffff_1x400.png | Bin 105 -> 0 bytes .../images/ui-bg_glass_75_dadada_1x400.png | Bin 111 -> 0 bytes .../images/ui-bg_glass_75_e6e6e6_1x400.png | Bin 110 -> 0 bytes .../ui-bg_highlight-hard_75_a7c1d2_1x100.png | Bin 121 -> 0 bytes .../ui-bg_inset-soft_95_fef1ec_1x100.png | Bin 123 -> 0 bytes .../css/images/ui-icons_222222_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_2e83ff_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_454545_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_888888_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_cd0a0a_256x240.png | Bin 4369 -> 0 bytes ui/lib/jquery-ui/css/jquery-ui.css | 568 - ui/lib/jquery-ui/index.html | 367 - ui/lib/jquery-ui/js/jquery-ui.js | 17284 +++++++++++++++- ui/scripts/accounts.js | 1 - ui/scripts/configuration.js | 2 +- ui/scripts/lbCertificatePolicy.js | 7 + ui/scripts/sharedFunctions.js | 5 +- ui/scripts/ui-custom/accountsWizard.js | 9 +- ui/scripts/ui-custom/enableStaticNAT.js | 6 +- ui/scripts/ui-custom/instanceWizard.js | 15 +- ui/scripts/ui-custom/projects.js | 9 +- ui/scripts/ui-custom/zoneWizard.js | 7 +- ui/scripts/ui/core.js | 7 +- ui/scripts/ui/dialog.js | 22 +- ui/scripts/ui/utils.js | 19 + ui/scripts/ui/widgets/detailView.js | 18 +- ui/scripts/ui/widgets/listView.js | 5 +- ui/scripts/ui/widgets/multiEdit.js | 50 +- ui/scripts/ui/widgets/toolTip.js | 22 +- 33 files changed, 16686 insertions(+), 1797 deletions(-) delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_flat_0_aaaaaa_40x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_flat_75_ffffff_40x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_55_fbf9ee_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_65_ffffff_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_75_dadada_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_75_e6e6e6_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_highlight-hard_75_a7c1d2_1x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_inset-soft_95_fef1ec_1x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_222222_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_2e83ff_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_454545_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_888888_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_cd0a0a_256x240.png delete mode 100755 ui/lib/jquery-ui/css/jquery-ui.css delete mode 100755 ui/lib/jquery-ui/index.html diff --git a/scripts/installer/windows/client.wxs b/scripts/installer/windows/client.wxs index 609d720a67e9..8dfec67e462e 100644 --- a/scripts/installer/windows/client.wxs +++ b/scripts/installer/windows/client.wxs @@ -242,52 +242,6 @@ - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1889,20 +1843,6 @@ - - - - - - - - - - - - - - diff --git a/ui/lib/jquery-ui/css/images/ui-bg_flat_0_aaaaaa_40x100.png b/ui/lib/jquery-ui/css/images/ui-bg_flat_0_aaaaaa_40x100.png deleted file mode 100755 index 5b5dab2ab7b1c50dea9cfe73dc5a269a92d2d4b4..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 180 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FscKIb$B>N1x91EQ4=4yQ7#`R^ z$vje}bP0l+XkK DSH>_4 diff --git a/ui/lib/jquery-ui/css/images/ui-bg_flat_75_ffffff_40x100.png b/ui/lib/jquery-ui/css/images/ui-bg_flat_75_ffffff_40x100.png deleted file mode 100755 index ac8b229af950c29356abf64a6c4aa894575445f0..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 178 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FsY*{5$B>N1x91EQ4=4yQYz+E8 zPo9&<{J;c_6SHRil>2s{Zw^OT)6@jj2u|u!(plXsM>LJD`vD!n;OXk;vd$@?2>^GI BH@yG= diff --git a/ui/lib/jquery-ui/css/images/ui-bg_glass_55_fbf9ee_1x400.png b/ui/lib/jquery-ui/css/images/ui-bg_glass_55_fbf9ee_1x400.png deleted file mode 100755 index ad3d6346e00f246102f72f2e026ed0491988b394..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 120 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnour0hLi978O6-<~(*I$*%ybaDOn z{W;e!B}_MSUQoPXhYd^Y6RUoS1yepnPx`2Kz)7OXQG!!=-jY=F+d2OOy?#DnJ32>z UEim$g7SJdLPgg&ebxsLQ09~*s;{X5v diff --git a/ui/lib/jquery-ui/css/images/ui-bg_glass_65_ffffff_1x400.png b/ui/lib/jquery-ui/css/images/ui-bg_glass_65_ffffff_1x400.png deleted file mode 100755 index 42ccba269b6e91bef12ad0fa18be651b5ef0ee68..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 105 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouqzpV=978O6-=0?FV^9z|eBtf= z|7WztIJ;WT>{+tN>ySr~=F{k$>;_x^_y?afmf9pRKH0)6?eSP?3s5hEr>mdKI;Vst E0O;M1& diff --git a/ui/lib/jquery-ui/css/images/ui-bg_glass_75_dadada_1x400.png b/ui/lib/jquery-ui/css/images/ui-bg_glass_75_dadada_1x400.png deleted file mode 100755 index 5a46b47cb16631068aee9e0bd61269fc4e95e5cd..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 111 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouq|7{B978O6lPf+wIa#m9#>Unb zm^4K~wN3Zq+uP>V~E7myXQA@HYA8JKUDsG z{u#?PzmNO7dv`S|n8~xRJhV-o_rU%QLajY^Usjn;N@&CDX#zk diff --git a/ui/lib/jquery-ui/css/images/ui-bg_inset-soft_95_fef1ec_1x100.png b/ui/lib/jquery-ui/css/images/ui-bg_inset-soft_95_fef1ec_1x100.png deleted file mode 100755 index 0e05810fffe0b6b8ac320e55d1eb4ba259b89d92..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 123 zcmeAS@N?(olHy`uVBq!ia0vp^j6j^i!3HGVb)pi0l#{26V~E7myXUR>S{Ou}E*`%9 zKPdOkfrN+ZlHSt7(uY{3{#;wiJb&Ugx1>W4qtrSDm(4hFaaY-$3p3x|sIU3`%J?Qj YcLn#R=pC)AfTl5cy85}Sb4q9e0MP_2(*OVf diff --git a/ui/lib/jquery-ui/css/images/ui-icons_222222_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_222222_256x240.png deleted file mode 100755 index b273ff111d219c9b9a8b96d57683d0075fb7871a..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmPmYTG^FX}c% zlGE{DS1Q;~I7-6ze&TN@+F-xsI6sd%SwK#*O5K|pDRZqEy< zJg0Nd8F@!OxqElm`~U#piM22@u@8B<moyKE%ct`B(jysxK+1m?G)UyIFs1t0}L zemGR&?jGaM1YQblj?v&@0iXS#fi-VbR9zLEnHLP?xQ|=%Ihrc7^yPWR!tW$yH!zrw z#I2}_!JnT^(qk)VgJr`NGdPtT^dmQIZc%=6nTAyJDXk+^3}wUOilJuwq>s=T_!9V) zr1)DT6VQ2~rgd@!Jlrte3}}m~j}juCS`J4(d-5+e-3@EzzTJNCE2z)w(kJ90z*QE) zBtnV@4mM>jTrZZ*$01SnGov0&=A-JrX5Ge%Pce1Vj}=5YQqBD^W@n4KmFxxpFK`uH zP;(xKV+6VJ2|g+?_Lct7`uElL<&jzGS8Gfva2+=8A@#V+xsAj9|Dkg)vL5yhX@~B= zN2KZSAUD%QH`x>H+@Ou(D1~Pyv#0nc&$!1kI?IO01yw3jD0@80qvc?T*Nr8?-%rC8 z@5$|WY?Hqp`ixmEkzeJTz_`_wsSRi1%Zivd`#+T{Aib6-rf$}M8sz6v zb6ERbr-SniO2wbOv!M4)nb}6UVzoVZEh5kQWh_5x4rYy3c!871NeaM(_p=4(kbS6U#x<*k8Wg^KHs2ttCz<+pBxQ$Z zQMv;kVm5_fF_vH`Mzrq$Y&6u?j6~ftIV0Yg)Nw7JysIN_ z-_n*K_v1c&D}-1{NbBwS2h#m1y0a5RiEcYil+58$8IDh49bPnzE7R8In6P%V{2IZU z7#clr=V4yyrRe@oXNqbqo^^LvlLE?%8XaI&N(Np90-psU}7kqmbWk zZ;YBwJNnNs$~d!mx9oMGyT( znaBoj0d}gpQ^aRr?6nW)$4god*`@Uh2e+YpS@0(Mw{|z|6ko3NbTvDiCu3YO+)egL z>uW(^ahKFj>iJ-JF!^KhKQyPTznJa;xyHYwxJgr16&Wid_9)-%*mEwo{B_|M9t@S1 zf@T@q?b2Qgl!~_(Roe;fdK)y|XG0;ls;ZbT)w-aOVttk#daQcY7$cpY496H*`m@+L zeP#$&yRbBjFWv}B)|5-1v=(66M_;V1SWv6MHnO}}1=vby&9l+gaP?|pXwp0AFDe#L z&MRJ^*qX6wgxhA_`*o=LGZ>G_NTX%AKHPz4bO^R72ZYK}ale3lffDgM8H!Wrw{B7A z{?c_|dh2J*y8b04c37OmqUw;#;G<* z@nz@dV`;7&^$)e!B}cd5tl0{g(Q>5_7H^@bEJi7;fQ4B$NGZerH#Ae1#8WDTH`iB&) zC6Et3BYY#mcJxh&)b2C^{aLq~psFN)Q1SucCaBaBUr%5PYX{~-q{KGEh)*;n;?75k z=hq%i^I}rd;z-#YyI`8-OfMpWz5kgJE3I!3ean6=UZi!BxG7i(YBk? z02HM7wS0)Wni{dWbQMRtd-A)_Az!t>F;IwWf~!*)-Az4}yryNkz&9)w>ElA80Oc`6 zHo#9H!Y3*Qx9n@Jn)!w6G^hb;e_n8zpIyXCN`JFkPc)^Q?2MsLNFhMgrcZI-<#1ne zjH;KFf?4eAT9mQZ}ZfHLGA#d%s;SZK4p0FwZT2S^{ zQ2BG1xJsbK6?yrHTjJi|5C0u=!|r!?*4FL%y%3q#(d+e>b_2I9!*iI!30}42Ia0bq zUf`Z?LGSEvtz8s``Tg5o_CP(FbR0X$FlE0yCnB7suDPmI2=yOg^*2#cY9o`X z;NY-3VBHZjnVcGS){GZ98{e+lq~O$u6pEcgd0CrnIsWffN1MbCZDH<7c^hv+Z0Ucf0{w zSzi^qKuUHD9Dgp0EAGg@@$zr32dQx>N=ws`MESEsmzgT2&L;?MSTo&ky&!-JR3g~1 zPGTt515X)wr+Bx(G9lWd;@Y3^Vl}50Wb&6-Tiy;HPS0drF`rC}qYq22K4)G#AoD0X zYw$E+Bz@Zr^50MAwu@$?%f9$r4WHH?*2|67&FXFhXBrVFGmg)6?h3^-1?t;UzH0*I zNVf9wQLNLnG2@q>6CGm>&y|lC`iCFfYd}9i%+xkl^5oBJ?<;aneCfcHqJh7Yl5uLS z9Fx-(kMdcNyZejXh22N{mCw_rX1O!cOE&3>e(ZH81PR95wQC37En4O{w;{3q9n1t&;p)D%&Z%Nw$gSPa!nz8Slh7=ko2am)XARwOWw zpsz0~K!s{(dM$NB=(A=kkp>T(*yU6<_dwIx>cH4+LWl282hXa6-EUq>R3t?G2623< z*RwTN%-fgBmD{fu*ejNn)1@KG?Sg*8z3hYtkQJQjB6 zQ|x>wA=o$=O)+nLmgTXW3_6diA;b4EY{*i*R%6dO2EMg z@6g?M3rpbnfB@hOdUeb96=~I?OIA3@BWAGmTwiQ{x5Cqq<8c10L!P zd@Qk^BseTX%$Q7^s}5n%HB|)gKx}H$d8Sb$bBnq9-AglT2dGR2(+I;_fL|R4p$odJ zllfb0NqI)7=^z~qAm1V{(PkpxXsQ#4*NH9yYZ`Vf@)?#ueGgtCmGGY|9U#v|hRdg- zQ%0#cGIfXCd{Y)JB~qykO;KPvHu|5Ck&(Hn%DF~cct@}j+87xhs2ew;fLm5#2+mb| z8{9e*YI(u|gt|{x1G+U=DA3y)9s2w7@cvQ($ZJIA)x$e~5_3LKFV~ASci8W}jF&VeJoPDUy(BB>ExJpck;%;!`0AAo zAcHgcnT8%OX&UW_n|%{2B|<6Wp2MMGvd5`T2KKv;ltt_~H+w00x6+SlAD`{K4!9zx z*1?EpQ%Lwiik){3n{-+YNrT;fH_niD_Ng9|58@m8RsKFVF!6pk@qxa{BH-&8tsim0 zdAQ(GyC^9ane7_KW*#^vMIoeQdpJqmPp%%px3GIftbwESu#+vPyI*YTuJ6+4`z{s? zpkv~0x4c_PFH`-tqafw5)>4AuQ78SkZ!$8}INLK;Egr;2tS18hEO5=t;QDmZ-qu?I zG+=DN`nR72Xto{{bJp||`k}-2G;5#xg8E~xgz22)^_Z;=K|4@(E&5J)SY2of=olcw z5)@L)_Ntcm!*5nEy0M9v0`S33;pO4TN;>4(Z+19p_0>u#e-vE zXCU(6gAvu~I7Cw(xd%0e59MNLw^U37ZDbsBrj%eDCexw8a3G`nTcXVNL6{B7Hj@i& zbVB{;ApEtHk76q08DJ48dSxd$C(;$K6=FpU<~l9pVoT9arW^Vu{%Bcn4`eIpkOVC| z$)AKYG_`ypM{0@BUb3^9lqi_c?ONH|4UJMJWDowMVjacycX7}9g={O7swOB+{;+?; zjBo!9?+nd)ie#x5IbFW-zBOo0c4q@9wGVt5;pNt`=-~Zgcw#*`m($6ibxtZ`H=e=} zF#GZ~5$%AUn};8U#tRem0J(JTR}d4vR(dgK2ML~lZsPhayJ2h1%sD4FVst| zKF)+@`iNzLRjg4=K8@**0=5cE>%?FDc({I^+g9USk<8$&^qD~@%W0i4b|yMG*p4`N zh}I!ltTRI8Ex$+@V{02Br%xq#O?UlhO{r8WsaZnZCZq0MK9%AXU%MDLT;3=0A9(BV z9VxxxJd7jo$hw3q;3o?yBLmA=azBUrd9>-<_ANs0n3?-Ic*6&ytb@H~?0E(*d>T5n z-HiH2jsDf6uWhID%#n>SzOqrFCPDfUcu5QPd?<(=w6pv1BE#nsxS{n!UnC9qAha1< z;3cpZ9A-e$+Y)%b;w@!!YRA9p%Kf9IHGGg^{+p`mh;q8i7}&e@V3EQaMsItEMS&=X plT@$;k0WcB_jb;cn%_Idz4HO$QU*abf4}+wi?e96N>fbq{{i|W0@(ln diff --git a/ui/lib/jquery-ui/css/images/ui-icons_2e83ff_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_2e83ff_256x240.png deleted file mode 100755 index 09d1cdc856c292c4ab6dd818c7543ac0828bd616..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3@pGmLE*`#M>&Z`mr_kcu#tBo!IbqU=l7VaSrbQrTh%5m}S08Obh0 zGL{*mi8RK}U~J#s@6Y%1S9~7lb?$xLU+y{go_o*h`AW1wUF3v{Kmh;%r@5J_9RL9Q zdj+hqg8o{9`K7(TZrR4t{=9O`!T-(~c=yEWZ{eswJJe->5bP8)t4;f(Y*i_HU*sLM z2=7-8guZ}@*(HhVC)Mqgr$3T8?#a(hu& z?Kzuw!O%PM>AicSW`_U(cbvJYv3{HfpIP~Q>@$^c588E$vv)V2c|Mr% zuFO$+I~Hg@u}wPm17n%}j1Y+Pbu!bt?iPkjGAo7>9eRN0FZz3X2_QZj+V!}+*8oBQ z_=iI^_TCA;Ea2tPmRNOeX3+VM>KL;o1(h`c@`6Ah`vdH<&+$yTg)jGWW72T}6J`kUAv?2CgyV zrs0y@Fpvpj@kWVE0TzL@Cy#qHn~kgensb{hIm6J&I8hkoNHOz6o1QQ3QM4NZyu?;= zLd>`wPT*uGr+6vAxYv3k8{gMDR>tO}UavDKzzyi6hvbuP=XQ4Y|A)r4#B$U(q7{1Z z0iLeSjo3;T*diS*me%4|!s23l@>R}rn@#Zc{<%CFt;?gd5S<)b=8Yz32U zBBLprntW3RE3f|uNX5Aw|I(IlJjW-Byd?QFFRk%hLU}O*YyYQel}WcXilLMJp9cB4 z)E?D+*Y4zai&XY!>niMfTW-2pp-^KFT93%Leig@uoQGPYRCva-`w#orm`is`p8b4s zxD462;f*^XO$=3by=VzN9i@xxr<1w=pcxl!$!fjWt|fYmq1@@badT?v`d zIi$|e$Ji}FXsiVYf)?pN1R0LBw;+)B5aUJj2fP+=m;=_Eho84g%Jq#@MLPSQEX*@T z6sZb)m?)zby>{j1)(;rRML|gKSs+9jorf-XhQJ2Jyt5Cqc*`S3iX@A5C3jvgAns|4 z*|)YQ%Kmsj+YZ53;nMqh|AFvehUV-9R;1ZZ;w5r9l}8hjSw@#k;>)$P*r%)=Extyu zB!$Kd-F?*50aJ2;TNTR-fc8B{KAq3!vW{g$LlGPfGW+%#CXU zJDcMsvyT2`x~v>>w8@yssoA`KuIZ98CLU{Ia%*nW3G4t}@ApsbC@o^WCqL>OXx>Y^ zSuVWEQ;3=A=@RxCnt0>G@#(VWBQ`0$qTwA#e>SX{_N~JWGsBxFHCw|5|?CzDi>92F-^=b*8sMXnhUJdb!>yGD2nhN@{582 zRPcxuDzs&;8De)>_J19z{0xppXQop#T_5ejGCKv@l>$O#DA-@X{y_1B-AsiU)H}DR z3xDZ8G`amV_WmA&8!W=@jgm|%bnwH%qkg(@J$hLaSV zC-rXIFMM%y<|Gb)o?j zpe-`dJ*N5tC-iH)d0CgLdBsw*C!ST9hY1EkI|Y(&=p&dH&q;a&7HXa5#_wtMsenQL zcpyhwx)Ppw@XmVz?P)DI#^ee1oC!i`>>Jq1ESk-OuQ(Pbv=s{A0AjM@rw#FaU;RUh z*At0{U*NtGVY_-JcuG$?zuuf%ZBTWxKU2yf?iN#-MRWs>A*2;p0G1Tp3d29u5RbnY zDOON-G|PidOOGeybnbzu7UVv71l!b=w7eU5l*{EdKuoKu`#LZ}|fnUr-+lSST9(MTT`0tqOG z#+Q_=lXe-=;rE4u8s~;%i~~ z8v&&+VPeXG=2zw9B5sR$e?R(n%nf?p-(BCZ8}x!_-9T+LT;2=Zu?Wv)j3#>35$6dR z4*7xmI)#06qjh#sXvX(%`#D1mD8fn1G~I;l%Dk{pw)}>_{+3^Fv_q)>2#de5qGCId zPz?ix-3954nM&u@vaw{o%-#HU%_bLJMO#@enR^&B{3ihWdoU6%pBJ`o>im+b-c6r-;c{vd0Z_)`75$jApy2?!9G4_FGa)iZ~9`6VELiYM+n!-mUfvfm{jt zC?!1=%pxJhF>vyQ47Q}R;O48pxgMs)rz$SbM&jkp<6X$r4DHWg>ZnGB-$r2o1*nL# zW0^*itcRY_^Uv^XgQP>W#>KQgM~l{;S(GkVW@&vld^AhWzG^m|9#0#USbM>^en{k2 za8~DTL`(Q~=ofsL&Fc`!L6r~qTnnGo8r98<(aG*<0%aNEr!!BIyY>VV82kxhR%d>V(lN&#BId#urK_i~Pe6?>C~J!pU_lRon#&S_cXoQv;poG8FK4atc

N)npz1~X%p6x{M(Gw!!H=!}lmO0Xr*8ewyH(Q+>oy`fxQkxJ zzzB$)%*xM4s_2(O>)T-QXhwP|&DZam#{O+47q|WKfz_ZL-MypRN~o{fE*I#6@eM?I zs%f-6{Lz6j7rB#U$%O$~TIT!j?|Ip1CpSmb=JA9qCY3-mQf|fVCxswPjok|VofUEP zW5^pTd5B;wRkyW%1a;nYHB$ef6Pv8^);`m0jv6p72iNJl+sVBqZugsq6cq_pyNREi z>GN!h6ZQ6`aOMr_2KI@j=XR@$aJj(2jcpY?>f=2kMV@di5W7Swj?ug10zRe}F1nR* ztMm6+T^)LJe^SzGgSxahQajq0h7#|8oMV0>D~*N}jl?9_X`ka42R4@rryDc3o(c$R?1*!1O9zleSOczw zYPS3~xbJ$~C(3+D7Zkrfjs_lneY^zv^kHmxt)aqZ!aeGABHZ`gvA&K`72z}ihI$Ht z9V&)wQy0g@R9irwbf!{uE&_J2l9jXz^Vj#=qA77*3Pd9OjrE_tKDHADd!AjFQv(ji zct-BMUt9()1Ox!dsI_h1(^F_U)_QJrx|%+y`zWWlD4=Nd?JQ=URh0*{fb1!o4tS(H z^r_T(8t1SAHf1oduG+X^*EC_kL(!QnXL6Hp);449yO&1xE>MXGqT)t10lzvALllX;;Q)RiJX$dm zlR8ep5-GdHmRm9?N#QCjNUA);vC03Gw6yds6^?c4;(MH>;O5xmQ2nGK3Dmk8i*v5t z-{jJsQq30%z}0`g7SN-yN`l-`@6rkJ|V|>18`MV zwUeH}DxWw&h+A+Dn|4|YNr&EfKS`Hz_NkeW3*sI5Rq-J&FzG=!{-K`n65#7O%^&f> z`PkqxyC_K)>781~7H${^Nj{`>XEa&OPqqQhySR5%w2{5+sEakXXHazJp6~LP2QKDx zpkvZrkDOa+A4BbqqX6ls&O)5-Q7`qkZ_?6~c-wQ9tseNtET;nhEOL^`*naKwcMX;R zbto&a;oTR0s;vjfj3wigUg)Sj)!OHQfZoJwAsWYI1A4ntz>X=W4s|y?tUk1r=>#Ct zf+?hq^>rQ3$KNboG$UhCdEmp{qAR13DK$f0ES7kAG~7q+g!jfVq`1b5+c62N^0%~o zKw91o@Wv;0EW*7fINAX3O~L-V{`;xB0q()#^HKZOlLrXVL*Dtw-$SUp8*_J{r( zW`6r`cz0yZQ#f0#*y+m64{bs7GP|2V$phf42rswJB?s@9qf;Bfc^pm-ZS#^5dkG{u zzv;l&B$NYcegSqAnjnPN1?17VUQbPummcWry((85IFB(pFQNGN{hhN$Fv?~l_fr?| z9=%dK(+;kZ(8=mwptjwC-ikBD$Z{l2++~*8wq5ynF<+PNlZI7ba5V#fg~L}kE;UH5 zJ;{P(`G{tNl&z5rUiH~e{I>GT8~9&*(J;Myx9z5P!db!F8RTII^I7c)HU=ss*bYB` zgwiIMZ_q>KEC$4lFm+Afvu6^$X1jm1rB*4H)-EIO5Rvz_p24?OkJ zovD4{-1KA6*oL?a;3qR7GZRB!cE5oAdA#M@{w+fGgsJ-lSmQ^-?8E&Q%tbmjd=@gZ z(}Mg*jsDf6Z)|7s%@9pc-tuw5W&zqUXjv2bVkC%-X?O3F72W4EsIl#1e>Mdz=X4k*_>VxCu_2?jjg16N*5fwC-36OW&;Sz}@jMn}hgJdEd pO;bST+>R{W-aENZYk%(=^(_R5N$LmL{Qc?!%+I4tt4z=_{|902Wu5>4 diff --git a/ui/lib/jquery-ui/css/images/ui-icons_454545_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_454545_256x240.png deleted file mode 100755 index 59bd45b907c4fd965697774ce8c5fc6b2fd9c105..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3^p#%>toqJ#RmwV2==ic*rz7lOw=eaq=H~;_ux21)-Jpcgw zdj+hrf&W^f<%Qk9Zpqf#;jH;N^Z%VA?R|9mZ{esQd(2F=?y+!`XZ5CR?ue=UdHIfUDFM*m15I;g=VN2jw zQW9?wOhDI#+P0|`@JQoC3!pu=AzGMtYB>V&?8(2>_B5_p`1Sb1t{^|J%bZYv09RS? zQ*dcs7}$)taJ@vX0E<96P{ur)Eygr{&ALyNoMP%_94m}=qFVT)&CeG1DBBMLUSKP^ zp%%Q3$MEtKll)X*+$)3O_3x`4%cHY0uhy7U;5x^Ir}X1)mv&B%|A)@A$a>f}tP{5X z9-gkti`YyT+hk9)cZW7fAQhjT%$XLLI^&VR=qev36;`WGBOP!^&(?!sK6jSH0Dnz4 zoEMMNu}y&n=rd-GWI?rGBI8!GD*NJ$k&e5-6+~-9F^6tV<=5`FcY~t{iqRcncEU+F zkT~jww!oy(@~b~WGI8!lzjURX&IpJjFGxShOKUunP+rW$I{c|x0qM6!Gxf6n(;$D> z+QYiULqq)Fy4VDk&Mev)NyM@nvF z7O6M*A$C)kBi0HGMT_+xfQ^USTM)>*h_Rx%eSRxA%n|FuC&=F=Pz}E5uCqbcy;7j=%Qh`glqEA-jx0(a<)uKO5Fe|JLD-ndZ-vnW`G=O&^%pa}Ah(2%m?oANs{lJ`?RhrZ8n!`Q97TKw{YAw9 zD)=M{mD(~_jj`LTd%q6Veum)Cnd!7lw}(5h%ubHcg^2O`prn%u9es3C#&%TsnmSD3%3Ik^Yd@6-d%(I7kqT(B@dVX2 zIidXgd>qYT-oTZ=1sGI7^*_E9Q)1F2mooE0R zXopPnh^ci@+wz2ZDjo&Owyxh6t90Gt!u0miLxc!bue^LvHF?)O@Yf!dQUXfW$u8(f_n07^N)-vpIe;TrHv5uKm{h_v`-IN^zwWc>Lk ziGsSr89sDcdOR_wa~DjrqV&Nd*$18(vohPJ3hSzEJPF2d!u}415wrSMtS(zNa7 zbO0G4ajgKNp{`D7DO<(T?wowarQ0dIKLb<}#prQM)ytB73YNTPQgX^xoT zm>;yKSJ*c@QfD8HW`6&+mowOaA|A&~G0fO6&xwj;E3O9^Zu~ZXts~;-d%FyyeXrijORi<_S(dw_5@h&-fTY?#FJo% zQZZ1&ED%$if+n8JVM{s-ZoK@P>p@z4s`AoI6hYxE!Ie_Y)cpjZjc8@~uNMYVfy#J$ z)+sdEX7DK^{}kUAST8U6^p6#c>0Lc>T~9`0}`*2 zizaU)TFS4(u;BenUWZr?s{D)Z)rc9L5&gUvz3iSQaF#J)D)Ts{YgagdDcI1S`dtes zPqb4|h-RIkjhnpmn(Q2Je6Di5C?MkCUL)!WoKn|P#al41v#-Q8`K1$Gh64UhPQj|T zaZb%tJ}O{A?Cvl26!jeKS3OUkp5@8RDBYwh`Loxb5W<^m*R37+v}#*m-G{{ocF-#r z7!k3ZS^4Qu9sNRNZ3`laW2TqV{rsR#~gtVp6C zL0?}~gbLTv^jqtPQD@Cpq6{B6v&*Y)?tx})z=qQNB4Z_59 zpI2L)xQ`!|J8wWgs82jSw_8(;#}y7~Y^&hY9P1G)@`CGtIi*tZ%-%&;$PuG(!M%)E zQ?T#imBH8dCZxUBX^RWPwIh9LcnL3#$befQDr@UJl{=}o0){qIt52vU9X=3L_gvVW zPqp_YhhpM6XiE7Lvn-G0Wzo>0;g|$_-7|ucz~*w%bW@hr6M?~v9dT}L=>UotTj13& z?Uvt0_uOvzMq4iG6)gZqeU;W=P@EVod;}Vr7P*@=C19v;iz$4N+c5ewauTtKK5e;yIx(FQUec0 z`G)VlTUY|m2L=KusMRgMlapu#wt8MohK3=y`!J`tD6nYd%?xIZO`Q)skL)R%3Vf(P z__5Sx3h%fKF=sNdZo2p(w=_|}1M%ri7fO?8))sU1ySG;M4p4;zrr}4l0lzvA!WQ&a zrwX>%lJkv`Gr_u=K>kHOg6(AB(R3FOryElY)-vi|fRsBS<)$1;TC_?BnyScjY6>_ZD=T|bjcbjz@D6V+yfHd4SU+J*2Dh%n;$5ou zHh6R=)$>IH@%5js2KH#JkfFCVI}P>~U;|}>kk|06tA}^~B;|gJ$UvSF-l4GX43DAR z&M2mp8OgiTaK4li0|Q2qmGNYsm+Qq^JM8yfCP>5!31rjh4Mnq~+5X8+_$scfP1Fp!c zcQO*#6cfJ?ZRxn_$Se_|}Xo1oIF7s(7CllypCW@W8-y5%Bel_K*0G zd~8UWeYCWz>~^hF3ond|tQcClJ(8^9FW&&?U)a4O-pE;Y*u|FHGax>F*Kg_beOF5c z&?#xRN5Q?ckEwCnNr-${XC=w-te5%QH(6O~yxke=R!_ns))PU07Pu)CY`<>$+XicZ zCI=g^;q7NZnw=-vf;HoWLD+}`&Bph>kiqyX5jxjI1A41d$R3nahq@CHULV#9ItIwJ z0)^JGy{hB;@SD|}Zel8~2z;UjN96MR@dt;EV`9RP4X&zn8ib=n*107cICSp7z6srZ~4Qg|Vp$OB0By{IxAPaD7HGFw_HTza~wWN1A6 z3`7BZFse2a4{y#V^&;nRVcZOz*2>A?jm$%?)KawLR0cEz24qxxOOo9_2)9MrWpSg7 zPiPz+M7(zPRZ3$#11ti?uI!}bM!Dg%L#+uR+^2L2RX+QlMpL zg_DrR=GIT7C~b+^OZK)?l7*9c-78zWVbLo1oS}bItdscuF80}guwA8c^(47DfaBjV z^V@&JJHxYHqS+e7&X;ezZwsE2+t~n0?*m^(db@WnI{LgAnOqOa<8pRvo0E>*O&~J_ z&A)t2LOG)5=3$3n2_gi2Kpvgv)#LCUh2Y~ z!A&(~-8reT$sJk0=L;m~ES3k}k% zkF%gzzT(+nRU0IeUvuW8pq=8uzr&7HW>K5ZiD*8qL17AI^ zGqo>*mvIChU6+&t{A3|!W?~pi9_O$>k2d|#(Z721wcT{S1)_UFZ+}QS^KZ*u?5Y~bz z^cLI;2{$C_ZwWqM@sYMYwG+^N<^Ivq8ZOwV;7xT+WCh)I9PHC}ut;VNr?w z<@?HsG!Qg3zaV+-xQ3ldtad!U<6iGz_enGH*2akP_r)o1D&8p^5M)_c8IIj6Wy*7HJo&CBLuo~nj>(63pZzO(Vv^ZuB3 zMYigjkwA;FEy|G}1jpiMj6|NTm7Uyiw=@FDE*nX<>jR!W@9XIyf%$Fd*J5*D0Z0Lm z9}ZQxyT|x5ftNy?V>EbJz-K>bV9gs9RaXUP<^=;e?&Fqxj;6{ieR-a-@HycA1KMKhql8GOmcxwZ?_-(3hMK^^a*(gaFvBH ziIC!fgH4$W*NbKIaY&T?%&13``KbD@S-0`xQ%v3TV+B!;RC7O!+1a9QCA$H@3tR;k z)SSoR7(s4)f{zM}eWgFN{(ZH5d1O}l)f$ruT!)Q&NImXyZsTzOf9TwctcSfr+M)aJ z5otO+$jvm-P4)ykH)x|cO5xeb>?!`qGw$(>&axqLL6yoB${vsMXgL_-bz@2J_tS92 zdvZG-+vKl@K4Vr(EL{WQt@Z+Ea-hxX0}nTSZxnpi^#Kn8Ox8FgIS|hc}KJQ4tm*HO16ui{(O9} z1YN)GjiQt6fGq`Cj+^`zUf?8hk^(T{{cOQGWFP98am}is28A!5%{R#ENv8fCN!j69 zlMEK(2z?|BY=Je$XD9mB-Kkem*(d-j^9j$2#6r$Dz?s)-TCDCGCs z8>6Pvj{Y+YIeFA@qY22V$)awy@q!9A4rgk5b9TcC;s9Ig^G|6nDP+5=Fzg&?(L=vc zCbGd>fSu~@6!94td+o#d@sid!EIX$rx7*cawe6 z`dScJ+$HssdOjE)O#Ybs56vm-FQ$7yuJJD^Zqk%hMaIgAJ<2yb_MFQte_i;62ScT$ zpjifYyR_E=rQ+>H)pmlr-Udzg*-!|ssw(D7wJvC+Sf8bb9;;q8#z?0p!!bsd{wy|5 zpBaMHE-Ve>i#LLjHRaMLtp%9&(HCng7Sw96jVv!#0k%?F^K7&=T)mnYn)D9(i;4x5 z^NJTJwq~pv;kH@#ejTd*48~(J(r6j34|m`h9fEDj0im)~+%I5XphWymhT;_Zty|Q& zzjPg#-ufAHZ1M*Gccw?Kf|8Pnhtb0`!{N`Bqsa37J+>wC$!e z00k+2Egzz;rbcWoUB%Jvp8W1}$XD%e3>4y;;OZ1ccT-O#uW6Ys@C}Pa`nZrNKzR(2 z4e%3)@QI4SE&E!lW`5y14QhbepBG%_XBV-O(%5tj)@9#|;sC-MNev!zGDHk}JdpGC`iJF#8=8-P$Xoku_=Dw%Cv3{U7L>gf zRQ?<$t`cZ*MP5GQmbmx#!+*!zu>0MewRO9GFGS{b^m_fJ-N0?j@EqoFf>$khj+E|@ z7r3We&^tR^YZrxKe*d22agXqCO0l44&kqCv{u)T|(lv`~PK@DvE z{QI_TlCH5z*gR!>LO)k67{^R+vWx24U2^2ODXpwT;6y+6+$5m)_*w4WY&#do9dCeE z)>p+Ykdhq($DhmMiaYXey!@N%L26uz($aJ!QT{B^Wu}U$^9e#5)=c+XF9@Ill?ZmM zlNgHiz*9!vDc&uxOo;ZVxb`Q!Sk0*gnfxWzmbZh4(=%CD%qP?0=);n$&zaW_$UKV9 z8axdcN#AyZ{P)wj?V{P}vM)YY!>6@}^>U+iv$`9>nMTCPjN>z%yF&3yf%>+T@0vh4 zlC8Xa6zeo?%=o3}M8{aebLHcO{^1Ar8qiM=Gquf?Jo)q5`-+?sUpg?QXyEUpWSm+n z$K-UyqkIwHLquru~o(OF)hhz$Y*|X>ZIbswnxRvr~ z2=rdOGVuD|xRlpAZE<0!X1F(%Anpl^@V^D3vbM}qxe|NI;TTiZy7(IM;R69RkA>a& z6gwYE2sREzQ_LHmWqB+ogMk(fMaSFeoDq-!HkFB_nXt5+2ncFuk9BQL1I&oB1zZi) zYW{6_&-Ip1l*OVRA##1ILQS;5R{-K^0wGTiJbVSi@LA^$D$;@J>^G{6@&+%4{b3(s zC~LEHiTv(0b#zxt?YJ0r_~pUZM~mQ(??(n#>&tD%+@nq=Abj5*8R!~Ul1`G~=qFJ4 zfl|m8ZDCYgtr`4LcOpgiJYX9qRY5;DcWti~PmS$VB$E-Zt^f4)vLDOe_3XTq5^ylW zJ9PKm!V-8sAOJXnUfuFNIf0R9tK-pNs2hO04zr620}5B(Ok>yB)Of-3sP59qfQNbm zA4{w!2@cB;GbR(~szVrbO%(w=5S!X`o@o@x++wbN_tMPT0Vc)*I;Fgsbf^*g0 z2Di?HTApwKq3+YwfNsqd3iP%{hyK1iyuVZc@*0tO_3+N0#GFsz>8MjeJ2UJ%L!%hi zGYYAthH`E+ywA*u{(eJ=ia3h*%k?779rk-K<0VZAPkl;TFUbmei|$fqWO8!_zIvqt z$ly$VrlH46nnpX~X5Yk0iBJl;=WuA4>~X4-f&K0yWf42h&0b30t@NYX$7egQ1Fp!a zbui-D6cWCWV&|R1CY@G8(qOmWjWeX3eX7UggZPGimA}soOuQdXe4uZ#2>5zN>qlI0 z9xk}lE=tNpX1m6*nFr2EQ3xs79!^sCldDJYE$m(qYv3q7>}1R7?iZW7>$~*%zKaC| z=$N?ME$>#+%T&MZC`dW1wUl6Z)JgyCn~V%K&i0H|iwE%$>xsZW3tTfZxIUePci@p;cRu|d=ItIwF z1clVHy{hH?@SD|(Zfqi^0DQ1hczHN7xq85h)rzQqLHMX2^IkuK7FB!kI40s$|CY7~ zNX^{_UjN8}L%Med;|+=4RNTMozn8KT;2tb77bUPCmioh+rZBfIiM6f_P34cQ__o1G zWqQp3VL~~pE5?qODf%iiQQ3f42YF@09tQ*$4v_EKUx;t1KCPCBtgqg z@+Tn;O)a0uky_%jm+WjNB?=~VyH>V#L!*=l*@OS6SVyt_UEH&NA=?V2stHPyKkVNy z&jg<#cjros){#ji)dK z%)We0L_478=HZ8-@xnwsKrWs8)x`MB;(Y`Cmu2c-&SH(vN-F(*e`l?c%+l$|y_AJJ zhcDGnwLvN+bu;_sX|1AiePhx@u&%P$hf*xE+O=~D?_(_KGWQ!158YL-y9$*6mmPo;Rp*Dl5lm-mVM2i`h- zM@nxv590_tvMwPD_{l=b$iOm|+|S{D9&P%zeT$GgX6Akl-tfUF>tL@Ld!B&{pN39t zH>3Vhqkr}2Yul+jb7UiouWVGPNsxX7Ueba+9|~dz?d*QM$ng0DZfO0`7fAy?2yMm| zcnRzUhZ&IcwgjH9cuU!w+VStYa{p*)4IgBf|E8)sqMYtB2KH_}SfsFq(c9i(Q6S3U oBo%DI*Kv;w;*%(i9W@f3_WCF#rGn diff --git a/ui/lib/jquery-ui/css/images/ui-icons_cd0a0a_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_cd0a0a_256x240.png deleted file mode 100755 index 2ab019b73ec11a485fa09378f3a0e155194f6a5d..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3@pGmLE*`#M>&Z`mr_kcwz5Nh&gy7G+@45H9p05OJ)J0CH2owMSaGIN$+5!N; z<11j56?ANg=9hMl-IBGX-T8hf$N$b*H?$f4Xt&I`oABt1nR=k%#z{{*a!Axm|t}hCz zJg0Ln7;M4Zjx{$mwhMW+kWN;|j>qTx_-zNX!GzqEZRa}QF8_0yk6+=w}$QD^&hM4%OkT=uh$q9;5u~NL-I+NQyaVc|3l+iWI5~|(hA-G z08i8AMr@{uY_cWTxo^y|Qyb33mlZLvc7H2Zm~>mB7&=-1X^@|D z&0*~i?GBE&NM(Pv&Vt^zWu_bD3e|R?wTL{cSFwD^Ij9v%g=aLY@1U2Bxn#Te*{>%D zOOW-O-bfnJ7T8jd<*>8`Z2DsFQi~S$%^npJwXam5>>p zMd}QEjM)@~##n$LXpz1Hkl|2UGXi-JFFePXBWL+-5f%!S>L#KL3>Vl0w#d^21Jn<~_7q zWx^Xg1(>PsPGO&cu{S;(pRQ;=Vw2J<9NdQVWx<+g-`ia=Q@puS)75M+?u>DTa95e9 zt#1T?#a)uWC>Mia!K6>g|InPW{&Kp9$tC_3*;R_Xsz6^Eu|xW1$6j#0?XLs7^l+%O zlxddE)h^|=K(2UqS*0ECuDe0ic|H_^t*VOoTCKx0Qmn_^LyJ|b8l$Jvl3{2=3x8&7 z$1ik&YG>w#@x@y~$r`fhlUDo;yXecc6$`30m`3K8s{k8G&3RVp8n#|l6h(Xw`Axw9 z%6Y^J6k0P@4YAuSd%q7=eg)&u8EMoEmq$CWj1GY|rGQWw3ida!FHk&wCqrQh_0Bcw z!ZBS3CbxgZ+}~wzgGIQ#QId%T_TE~_qdUqxjqS#8#jPxdwO@(@-5_nSP&uT?aGYYD z6km36K9=gjUjImwO=5Hl#u85VF?r0HbW)#h^SR|s_L47Tl$&Z&Rz*ksl!t*(2O2;D z+8`6$qpLn}LchhCmv*X}moGMX5?F@juGeHQAddAn}0~r zS_0|d3*0v%Y)8+8K{ zGyoYPb|W9Grm9M4E?vb^@16ePbI4omZv+(NoZ##fLUmKlB(G_jEbtDCM*27t$v`JovAZa+%*Q5dDXF*Ftt*n!O>#ohCM4lZ)h5rdKV-3A za}2AO6@!`W>ROk5FN*>2Zza^Z%}8KT%*jBGH|rml2X1LR{wZhWx8V4>|5i}; zMnLIHn3!^)`87GYh}&Y`KMwyLbA#^pch}Z!`@P_qH&N^LS9SxpEy8mc!wFusq&Z@` zeO}<6PC@VNaII|=n(^cNUiLseig*$;NjG7;IwvfYCBN>kzv@v-V2eBQZ@oIs^)NLqMR935k|1}U;5<{s(Ebdj4r`?QtrrAPfQooq zmPs_(YTy|??+nitNIFDoR7~qLPPFFCf^_~8OUt{#!|9o*3Q{!@9ZAI$7O~piD!;WX8#v&RxNH27i59$`1{o zEYU_zE{bKEI%f3BbE0Fc;f2!4LjUlC`wgh4@R{1?O78r5t$hWKiLV{#QWWq{QZiPx zm3?x$;&DDRVt0SByRiFczw$-e)GSvpCRbzk^=E zz=(+LjEc{Ps_2(OYg=G(93!oS=IeJ|WA8STv+LgI*Oj1c-QC06N~mvJ&KKx{arGp5 zswvJ6{%BvBYo>#2$%O$~TITuh?Rr^jCpAUXh)}m74`O|aOU>w2KI`k<#efwa5=-l4Xx!o>Z9Evg`RLN5W7SQp3$@D3_hY4EV!0( ztMm6>zBcgY{RvHZ{9Ey&&)jr2B4s0qDPBUh1ITaAp&>rj3ng*B=VGXz* zs@eR<;J(XkpD6Q1U3}#FR)wlafiFMU(-=&e9(eQ`isrS-9aNwJ)7frS8RiXM4*SbC zL|4*c?h^jfYvSOpn%Z$W?C|TuZ;uy2pFWHXuGW`ZkGV&kPJsKqJJQ!NswAE!!cb2k zumi=AE$YIkm})cVlg>nn&PBjBRI*@mfhhRMsa5U8k#A!ztfiw)d7I_UyAif8$5sJ9a7WUv5!o%fL z(J7-8EQzv1YIc)BNeWkLK~m%y4vqe&q@|_ZR5;eC3-9rkf*T{_19jtuWKhdW4Bn|~ zZ-YyFLN!k)0AKg{dO)|v3K?=oy+dzb4%T1F4}JsByncB1Z(`2p@O0!E!JQelouN^* z%Q^YfQUh66D$Zx-RDZvLctsr9`_+1p#tz&4SMd@i_-8()tyg3OyhU~?Gt#-a{NKFN z0VGf+AH%@o6;-_*?$$T4QX-f_>Ny-5CV8Ccq+@>gNSeovbFr0@b}RiTcJbLx>ws&r zsvY!rR{4al#MpVKut~?&kTmF>_v3UaC!gvuxgg%5-{l{20}~&F6CUarF9N=u)BG71 zoQDlAwT+T=mfo&$Xy%4-kmW;4wuh6{{ABClybHV6L>t&k4?9_Ny8A_^?)ff#dEjhL z2RbC~cFVbz^fJ`$I0%prYc0g-9(7X3eUp}^#Mzv)Z1EsGW;qr3cY$+e2HU5d_O9L% zpbljP*1!A0PqpzNo3W&y(hD87qgweq5YQWYEkxrOuSain2-q@Z*P`x*ht-9)Fr5Ho zSTKduvc9h6`S^#$i)LgjDi3_PQ+RbaGP!!di^Y;4kB0lGo$y{if)rJIaXTbpRgO#B z1El6|18;s}$0FRjgK-7~ZwmI`_1{a`32+Y>&O_iTpm%vz6hNkjGR(#*! zpfJ2>OAQbTFba9S3j9BlRHXaG{)Zt(J<3ppA?}j+7F#{bV{M7zU)5e@~R&J_xf$+GKK~ z3{R;Y9fZGe^ifEqKL;!VMXv26=R~^TG(#*2!JKCWoo&c^$utAs#Gfq-?t!c&9TH5- zj&i5L4NWbdNs*djvsY}bC&ddUbh=iyc0;3-@Y#d^s8|Ql{ax(yenFcG#i|K%lRxy| zFys4w!@EPXp2AsbMUGc*eP|7uliAq-O6~(+MR>V(EZTd&9G+MY&gF2lZ=I8j*o`OC z`AxrmOGMeD=H_9Cq47clT|h34>-EI=%;E!my;o&wU(aKV&PymBzrV9q2uA62XS@JrjKYANZAU>;8mag#BU?Nv`+ZVhlAPV`HF_gKY_O zhbV2L`8qvR&f=@M5vH~geD+L&*L2s<)|5)clA0yt9TM{X)iWtx@wJO_!{vR#|AD6t z*OAg2&P_i8jjW5y0DdtOGcqvrCHD*1Uq_q1ZQmngPnf!2fHizH%sSX>#$2Rh!>1ur z+s(*-)abDuePc6~XNG8m@|KMXHVM#G4?~+V z1z!An!D0GD-7WqXE8ddUXLkI%u01$fTEhhy - - - - jQuery UI Example Page - - - - - - - -

Welcome to jQuery UI!

-

This page demonstrates the widgets you downloaded using the theme you selected in the download builder. We've included and linked to minified versions of jQuery, your personalized copy of jQuery UI (js/jquery-ui-1.8.14.custom.min.js), and css/custom-theme/jquery-ui-1.8.14.custom.css which imports the entire jQuery UI CSS Framework. You can choose to link a subset of the CSS Framework depending on your needs.

-

You've downloaded components and a theme that are compatible with jQuery 1.3+. Please make sure you are using jQuery 1.3+ in your production environment.

- -

YOUR COMPONENTS:

- - -

Accordion

-
-
-

First

-
Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet.
-
-
-

Second

-
Phasellus mattis tincidunt nibh.
-
-
-

Third

-
Nam dui erat, auctor a, dignissim quis.
-
-
- - -

Tabs

-
- -
Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.
-
Phasellus mattis tincidunt nibh. Cras orci urna, blandit id, pretium vel, aliquet ornare, felis. Maecenas scelerisque sem non nisl. Fusce sed lorem in enim dictum bibendum.
-
Nam dui erat, auctor a, dignissim quis, sollicitudin eu, felis. Pellentesque nisi urna, interdum eget, sagittis et, consequat vestibulum, lacus. Mauris porttitor ullamcorper augue.
-
- - -

Dialog

-

Open Dialog

- - -

Overlay and Shadow Classes (not currently used in UI widgets)

-
-

Lorem ipsum dolor sit amet, Nulla nec tortor. Donec id elit quis purus consectetur consequat.

Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci.

Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat.

Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam.

Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante.

Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi.

- - -
-
-
-

Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.

-
-
- -
- - - -
-

Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.

-
- - - -

Framework Icons (content color preview)

-
    - -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • -
    • - -
    • -
    • -
    • -
    • -
    • -
- - - -

Slider

-
- - -

Datepicker

-
- - -

Progressbar

-
- - -

Highlight / Error

-
-
-

- Hey! Sample ui-state-highlight style.

-
-
-
-
-
-

- Alert: Sample ui-state-error style.

-
-
- - - - - diff --git a/ui/lib/jquery-ui/js/jquery-ui.js b/ui/lib/jquery-ui/js/jquery-ui.js index 7ec85a5741b1..31ee9cd8116b 100755 --- a/ui/lib/jquery-ui/js/jquery-ui.js +++ b/ui/lib/jquery-ui/js/jquery-ui.js @@ -1,789 +1,16617 @@ +/*! jQuery UI - v1.11.4 - 2015-03-11 +* http://jqueryui.com +* Includes: core.js, widget.js, mouse.js, position.js, accordion.js, autocomplete.js, button.js, datepicker.js, dialog.js, draggable.js, droppable.js, effect.js, effect-blind.js, effect-bounce.js, effect-clip.js, effect-drop.js, effect-explode.js, effect-fade.js, effect-fold.js, effect-highlight.js, effect-puff.js, effect-pulsate.js, effect-scale.js, effect-shake.js, effect-size.js, effect-slide.js, effect-transfer.js, menu.js, progressbar.js, resizable.js, selectable.js, selectmenu.js, slider.js, sortable.js, spinner.js, tabs.js, tooltip.js +* Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */ + +(function( factory ) { + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define([ "jquery" ], factory ); + } else { + + // Browser globals + factory( jQuery ); + } +}(function( $ ) { /*! - * jQuery UI 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); -b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, -"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", -function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, -outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); -return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= -0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Draggable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= -this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= -this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, -_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= -false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| -!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& -a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= -"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), -10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ -this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= -i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== -String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= -false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= -{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; -if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, -_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, -{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: -Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= -null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ -c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); -b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), -10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- -f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? -e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= -e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, -step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= -e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; -var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: -a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- -d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, -f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, -display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= -e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= -d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); -;/* - * jQuery UI Selectable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), -selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, -c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", -c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= -this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); -this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== -"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& -!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, -left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; -this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= -document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); -return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], -e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); -c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): -this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, -dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, -toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); -if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), -this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= -this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= -d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| -0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", -a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- -f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- -this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, -this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", -a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); -a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); -if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", -function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= -this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); -this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); -b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); -a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ -c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; -if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); -if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), -e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| -e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", -"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14", -animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); -f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", -paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); -;/* - * jQuery UI Autocomplete 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.position.js - */ -(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= -false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= -a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; -this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& -a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); -d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& -b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= -this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, -"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); -(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", --1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); -this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, -this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": -"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== -"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); -b.Widget.prototype.destroy.call(this)}})})(jQuery); -;/* - * jQuery UI Dialog 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), -h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", -e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== -b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= -1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== -f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, -function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, -originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", -f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): -[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); -if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): -e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= -this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- -b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), -create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), -height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); -b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j"); -this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", -g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? -(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- -m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; -this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= -this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= -this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); -c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, -_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); -if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, -1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Tabs 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout",function(b){b= -d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover"); -b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults, -a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0, -selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]= -h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c= -this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a, -"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker", -function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput); -a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", -this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus", -this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b= -b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", -cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); -d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c= -d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c= -{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover"); -if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv); -J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); -a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]|| -c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+ -i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b= -this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", -left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&& -d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth= -b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear= -!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a); -a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a)); -d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()% -100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", -TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= -a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), -b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= -this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B= -this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right": -"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'
    ';var z=j?'": -"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+ -this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+r.getDate()+"":''+ -r.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"), -l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()): -g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c== -"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear"); -if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); -c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, -"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= -function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, -[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery); -;/* - * jQuery UI Progressbar 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Effects 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/ - */ -jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], -16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, -a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= -a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", -"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, -0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, -211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, -d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; -f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, -[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); -c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, -a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); -a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", -"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* -((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= -e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= -e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413) +if ( $( "" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) { + $.fn.removeData = (function( removeData ) { + return function( key ) { + if ( arguments.length ) { + return removeData.call( this, $.camelCase( key ) ); + } else { + return removeData.call( this ); + } + }; + })( $.fn.removeData ); +} + +// deprecated +$.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() ); + +$.fn.extend({ + focus: (function( orig ) { + return function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + orig.apply( this, arguments ); + }; + })( $.fn.focus ), + + disableSelection: (function() { + var eventType = "onselectstart" in document.createElement( "div" ) ? + "selectstart" : + "mousedown"; + + return function() { + return this.bind( eventType + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }; + })(), + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
    + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + } +}); + +// $.ui.plugin is deprecated. Use $.widget() extensions instead. +$.ui.plugin = { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args, allowDisconnected ) { + var i, + set = instance.plugins[ name ]; + + if ( !set ) { + return; + } + + if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } +}; + + +/*! + * jQuery UI Widget 1.11.4 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + * http://api.jqueryui.com/jQuery.widget/ */ -(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ -3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = widget_uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( arguments.length === 1 ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( arguments.length === 1 ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled", !!value ); + + // If the widget is becoming disabled, then nothing is interactive + if ( value ) { + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + } + + return this; + }, + + enable: function() { + return this._setOptions({ disabled: false }); + }, + disable: function() { + return this._setOptions({ disabled: true }); + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement, + instance = this; + + // no suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^([\w:-]*)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + delegateElement.delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + + // Clear the stack to avoid memory leaks (#10056) + this.bindings = $( this.bindings.not( element ).get() ); + this.focusable = $( this.focusable.not( element ).get() ); + this.hoverable = $( this.hoverable.not( element ).get() ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +var widget = $.widget; + + +/*! + * jQuery UI Mouse 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Effects/Clip + * http://api.jqueryui.com/mouse/ + */ + + +var mouseHandled = false; +$( document ).mouseup( function() { + mouseHandled = false; +}); + +var mouse = $.widget("ui.mouse", { + version: "1.11.4", + options: { + cancel: "input,textarea,button,select,option", + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .bind("mousedown." + this.widgetName, function(event) { + return that._mouseDown(event); + }) + .bind("click." + this.widgetName, function(event) { + if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) { + $.removeData(event.target, that.widgetName + ".preventClickEvent"); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind("." + this.widgetName); + if ( this._mouseMoveDelegate ) { + this.document + .unbind("mousemove." + this.widgetName, this._mouseMoveDelegate) + .unbind("mouseup." + this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if ( mouseHandled ) { + return; + } + + this._mouseMoved = false; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = (event.which === 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + that.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) { + $.removeData(event.target, this.widgetName + ".preventClickEvent"); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return that._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return that._mouseUp(event); + }; + + this.document + .bind( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .bind( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // Only check for mouseups outside the document if you've moved inside the document + // at least once. This prevents the firing of mouseup in the case of IE<9, which will + // fire a mousemove event if content is placed under the cursor. See #7778 + // Support: IE <9 + if ( this._mouseMoved ) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && !event.button) { + return this._mouseUp(event); + + // Iframe mouseup check - mouseup occurred in another document + } else if ( !event.which ) { + return this._mouseUp( event ); + } + } + + if ( event.which || event.button ) { + this._mouseMoved = true; + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + this.document + .unbind( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .unbind( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target === this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + ".preventClickEvent", true); + } + + this._mouseStop(event); + } + + mouseHandled = false; + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(/* event */) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(/* event */) {}, + _mouseDrag: function(/* event */) {}, + _mouseStop: function(/* event */) {}, + _mouseCapture: function(/* event */) { return true; } +}); + + +/*! + * jQuery UI Position 1.11.4 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license * - * Depends: - * jquery.effects.core.js + * http://api.jqueryui.com/position/ */ -(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, -c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Drop 1.8.14 + +(function() { + +$.ui = $.ui || {}; + +var cachedScrollbarWidth, supportsOffsetFractions, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+(\.[\d]+)?%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} + +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +function getDimensions( elem ) { + var raw = elem[0]; + if ( raw.nodeType === 9 ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: 0, left: 0 } + }; + } + if ( $.isWindow( raw ) ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: elem.scrollTop(), left: elem.scrollLeft() } + }; + } + if ( raw.preventDefault ) { + return { + width: 0, + height: 0, + offset: { top: raw.pageY, left: raw.pageX } + }; + } + return { + width: elem.outerWidth(), + height: elem.outerHeight(), + offset: elem.offset() + }; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "
    " ), + innerDiv = div.children()[0]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[0].clientWidth; + } + + div.remove(); + + return (cachedScrollbarWidth = w1 - w2); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-x" ), + overflowY = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowY ? $.position.scrollbarWidth() : 0, + height: hasOverflowX ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ), + isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9; + return { + element: withinElement, + isWindow: isWindow, + isDocument: isDocument, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + + // support: jQuery 1.6.x + // jQuery 1.6 doesn't support .outerWidth/Height() on documents or windows + width: isWindow || isDocument ? withinElement.width() : withinElement.outerWidth(), + height: isWindow || isDocument ? withinElement.height() : withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + dimensions = getDimensions( target ); + if ( target[0].preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + } + targetWidth = dimensions.width; + targetHeight = dimensions.height; + targetOffset = dimensions.offset; + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + // if the browser doesn't support fractions, then round for consistent results + if ( !supportsOffsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); + } + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem: elem + }); + } + }); + + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; + if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) { + position.top += myOffset + atOffset + offset; + } + } else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; + if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +// fraction support test +(function() { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + supportsOffsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +})(); + +var position = $.ui.position; + + +/*! + * jQuery UI Accordion 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Effects/Drop + * http://api.jqueryui.com/accordion/ + */ + + +var accordion = $.widget( "ui.accordion", { + version: "1.11.4", + options: { + active: 0, + animate: {}, + collapsible: false, + event: "click", + header: "> li > :first-child,> :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // callbacks + activate: null, + beforeActivate: null + }, + + hideProps: { + borderTopWidth: "hide", + borderBottomWidth: "hide", + paddingTop: "hide", + paddingBottom: "hide", + height: "hide" + }, + + showProps: { + borderTopWidth: "show", + borderBottomWidth: "show", + paddingTop: "show", + paddingBottom: "show", + height: "show" + }, + + _create: function() { + var options = this.options; + this.prevShow = this.prevHide = $(); + this.element.addClass( "ui-accordion ui-widget ui-helper-reset" ) + // ARIA + .attr( "role", "tablist" ); + + // don't allow collapsible: false and active: false / null + if ( !options.collapsible && (options.active === false || options.active == null) ) { + options.active = 0; + } + + this._processPanels(); + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this._refresh(); + }, + + _getCreateEventData: function() { + return { + header: this.active, + panel: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icons = this.options.icons; + if ( icons ) { + $( "" ) + .addClass( "ui-accordion-header-icon ui-icon " + icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-accordion-header-icon" ) + .removeClass( icons.header ) + .addClass( icons.activeHeader ); + this.headers.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers + .removeClass( "ui-accordion-icons" ) + .children( ".ui-accordion-header-icon" ) + .remove(); + }, + + _destroy: function() { + var contents; + + // clean up main element + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + // clean up headers + this.headers + .removeClass( "ui-accordion-header ui-accordion-header-active ui-state-default " + + "ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-controls" ) + .removeAttr( "tabIndex" ) + .removeUniqueId(); + + this._destroyIcons(); + + // clean up content panels + contents = this.headers.next() + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom " + + "ui-accordion-content ui-accordion-content-active ui-state-disabled" ) + .css( "display", "" ) + .removeAttr( "role" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-labelledby" ) + .removeUniqueId(); + + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key === "disabled" ) { + this.element + .toggleClass( "ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.headers.add( this.headers.next() ) + .toggleClass( "ui-state-disabled", !!value ); + } + }, + + _keydown: function( event ) { + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + event.preventDefault(); + } + }, + + _panelKeyDown: function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().focus(); + } + }, + + refresh: function() { + var options = this.options; + this._processPanels(); + + // was collapsed or no panel + if ( ( options.active === false && options.collapsible === true ) || !this.headers.length ) { + options.active = false; + this.active = $(); + // active false only when collapsible is true + } else if ( options.active === false ) { + this._activate( 0 ); + // was active, but active panel is gone + } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + // all remaining panel are disabled + if ( this.headers.length === this.headers.find(".ui-state-disabled").length ) { + options.active = false; + this.active = $(); + // activate previous panel + } else { + this._activate( Math.max( 0, options.active - 1 ) ); + } + // was active, active panel still exists + } else { + // make sure active index is correct + options.active = this.headers.index( this.active ); + } + + this._destroyIcons(); + + this._refresh(); + }, + + _processPanels: function() { + var prevHeaders = this.headers, + prevPanels = this.panels; + + this.headers = this.element.find( this.options.header ) + .addClass( "ui-accordion-header ui-state-default ui-corner-all" ); + + this.panels = this.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ) + .filter( ":not(.ui-accordion-content-active)" ) + .hide(); + + // Avoid memory leaks (#10056) + if ( prevPanels ) { + this._off( prevHeaders.not( this.headers ) ); + this._off( prevPanels.not( this.panels ) ); + } + }, + + _refresh: function() { + var maxHeight, + options = this.options, + heightStyle = options.heightStyle, + parent = this.element.parent(); + + this.active = this._findActive( options.active ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ) + .removeClass( "ui-corner-all" ); + this.active.next() + .addClass( "ui-accordion-content-active" ) + .show(); + + this.headers + .attr( "role", "tab" ) + .each(function() { + var header = $( this ), + headerId = header.uniqueId().attr( "id" ), + panel = header.next(), + panelId = panel.uniqueId().attr( "id" ); + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + }) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr({ + "aria-selected": "false", + "aria-expanded": "false", + tabIndex: -1 + }) + .next() + .attr({ + "aria-hidden": "true" + }) + .hide(); + + // make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr({ + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + }) + .next() + .attr({ + "aria-hidden": "false" + }); + } + + this._createIcons(); + + this._setupEvents( options.event ); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + }) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler({ + target: active, + currentTarget: active, + preventDefault: $.noop + }); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = { + keydown: "_keydown" + }; + if ( event ) { + $.each( event.split( " " ), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.headers.add( this.headers.next() ) ); + this._on( this.headers, events ); + this._on( this.headers.next(), { keydown: "_panelKeyDown" }); + this._hoverable( this.headers ); + this._focusable( this.headers ); + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // switch classes + // corner classes on the previously active header stay after the animation + active.removeClass( "ui-accordion-header-active ui-state-active" ); + if ( options.icons ) { + active.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.activeHeader ) + .addClass( options.icons.header ); + } + + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-corner-all" ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ); + if ( options.icons ) { + clicked.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.activeHeader ); + } + + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr({ + "aria-hidden": "true" + }); + toHide.prev().attr({ + "aria-selected": "false", + "aria-expanded": "false" + }); + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr({ + "tabIndex": -1, + "aria-expanded": "false" + }); + } else if ( toShow.length ) { + this.headers.filter(function() { + return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow + .attr( "aria-hidden", "false" ) + .prev() + .attr({ + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + }); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + boxSizing = toShow.css( "box-sizing" ), + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( this.showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( this.hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( this.hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + }); + toShow + .hide() + .animate( this.showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + if ( boxSizing === "content-box" ) { + adjust += fx.now; + } + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + }); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel; + + toHide + .removeClass( "ui-accordion-content-active" ) + .prev() + .removeClass( "ui-corner-top" ) + .addClass( "ui-corner-all" ); + + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[ 0 ].className = toHide.parent()[ 0 ].className; + } + this._trigger( "activate", null, data ); + } +}); + + +/*! + * jQuery UI Menu 1.11.4 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license * - * Depends: - * jquery.effects.core.js + * http://api.jqueryui.com/menu/ */ -(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== -"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Explode 1.8.14 + + +var menu = $.widget( "ui.menu", { + version: "1.11.4", + defaultElement: "
      ", + delay: 300, + options: { + icons: { + submenu: "ui-icon-carat-1-e" + }, + items: "> *", + menus: "ul", + position: { + my: "left-1 top", + at: "right top" + }, + role: "menu", + + // callbacks + blur: null, + focus: null, + select: null + }, + + _create: function() { + this.activeMenu = this.element; + + // Flag used to prevent firing of the click handler + // as the event bubbles up through nested menus + this.mouseHandled = false; + this.element + .uniqueId() + .addClass( "ui-menu ui-widget ui-widget-content" ) + .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ) + .attr({ + role: this.options.role, + tabIndex: 0 + }); + + if ( this.options.disabled ) { + this.element + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } + + this._on({ + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item": function( event ) { + var target = $( event.target ); + if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) { + this.select( event ); + + // Only set the mouseHandled flag if the event will bubble, see #9469. + if ( !event.isPropagationStopped() ) { + this.mouseHandled = true; + } + + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) && $( this.document[ 0 ].activeElement ).closest( ".ui-menu" ).length ) { + + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + // Ignore mouse events while typeahead is active, see #10458. + // Prevents focusing the wrong item when typeahead causes a scroll while the mouse + // is over an item in the menu + if ( this.previousFilter ) { + return; + } + var target = $( event.currentTarget ); + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + target.siblings( ".ui-state-active" ).removeClass( "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.find( this.options.items ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); + } + }, + blur: function( event ) { + this._delay(function() { + if ( !$.contains( this.element[0], this.document[0].activeElement ) ) { + this.collapseAll( event ); + } + }); + }, + keydown: "_keydown" + }); + + this.refresh(); + + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( this._closeOnDocumentClick( event ) ) { + this.collapseAll( event ); + } + + // Reset the mouseHandled flag + this.mouseHandled = false; + } + }); + }, + + _destroy: function() { + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).addBack() + .removeClass( "ui-menu ui-widget ui-widget-content ui-menu-icons ui-front" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .show(); + + // Destroy menu items + this.element.find( ".ui-menu-item" ) + .removeClass( "ui-menu-item" ) + .removeAttr( "role" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .removeClass( "ui-state-hover" ) + .removeAttr( "tabIndex" ) + .removeAttr( "role" ) + .removeAttr( "aria-haspopup" ) + .children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-carat" ) ) { + elem.remove(); + } + }); + + // Destroy menu dividers + this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" ); + }, + + _keydown: function( event ) { + var match, prev, character, skip, + preventDefault = true; + + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + character = String.fromCharCode( event.keyCode ); + skip = false; + + clearTimeout( this.filterTimer ); + + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } + + match = this._filterMenuItems( character ); + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + match = this._filterMenuItems( character ); + } + + if ( match.length ) { + this.focus( event, match ); + this.previousFilter = character; + this.filterTimer = this._delay(function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; + } + } + + if ( preventDefault ) { + event.preventDefault(); + } + }, + + _activate: function( event ) { + if ( !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.is( "[aria-haspopup='true']" ) ) { + this.expand( event ); + } else { + this.select( event ); + } + } + }, + + refresh: function() { + var menus, items, + that = this, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); + + this.element.toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ); + + // Initialize nested menus + submenus.filter( ":not(.ui-menu)" ) + .addClass( "ui-menu ui-widget ui-widget-content ui-front" ) + .hide() + .attr({ + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + }) + .each(function() { + var menu = $( this ), + item = menu.parent(), + submenuCarat = $( "" ) + .addClass( "ui-menu-icon ui-icon " + icon ) + .data( "ui-menu-submenu-carat", true ); + + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCarat ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + }); + + menus = submenus.add( this.element ); + items = menus.find( this.options.items ); + + // Initialize menu-items containing spaces and/or dashes only as dividers + items.not( ".ui-menu-item" ).each(function() { + var item = $( this ); + if ( that._isDivider( item ) ) { + item.addClass( "ui-widget-content ui-menu-divider" ); + } + }); + + // Don't refresh list items that are already adapted + items.not( ".ui-menu-item, .ui-menu-divider" ) + .addClass( "ui-menu-item" ) + .uniqueId() + .attr({ + tabIndex: -1, + role: this._itemRole() + }); + + // Add aria-disabled attribute to any disabled menu item + items.filter( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); + + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } + }, + + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; + }, + + _setOption: function( key, value ) { + if ( key === "icons" ) { + this.element.find( ".ui-menu-icon" ) + .removeClass( this.options.icons.submenu ) + .addClass( value.submenu ); + } + if ( key === "disabled" ) { + this.element + .toggleClass( "ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + } + this._super( key, value ); + }, + + focus: function( event, item ) { + var nested, focused; + this.blur( event, event && event.type === "focus" ); + + this._scrollIntoView( item ); + + this.active = item.first(); + focused = this.active.addClass( "ui-state-focus" ).removeClass( "ui-state-active" ); + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } + + // Highlight active parent menu item, if any + this.active + .parent() + .closest( ".ui-menu-item" ) + .addClass( "ui-state-active" ); + + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay(function() { + this._close(); + }, this.delay ); + } + + nested = item.children( ".ui-menu" ); + if ( nested.length && event && ( /^mouse/.test( event.type ) ) ) { + this._startOpening(nested); + } + this.activeMenu = item.parent(); + + this._trigger( "focus", event, { item: item } ); + }, + + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.outerHeight(); + + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } + } + }, + + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } + + if ( !this.active ) { + return; + } + + this.active.removeClass( "ui-state-focus" ); + this.active = null; + + this._trigger( "blur", event, { item: this.active } ); + }, + + _startOpening: function( submenu ) { + clearTimeout( this.timer ); + + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the carat icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; + } + + this.timer = this._delay(function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, + + _open: function( submenu ) { + var position = $.extend({ + of: this.active + }, this.options.position ); + + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); + + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, + + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay(function() { + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); + + // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; + } + + startMenu + .find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ) + .end() + .find( ".ui-state-active" ).not( ".ui-state-focus" ) + .removeClass( "ui-state-active" ); + }, + + _closeOnDocumentClick: function( event ) { + return !$( event.target ).closest( ".ui-menu" ).length; + }, + + _isDivider: function( item ) { + + // Match hyphen, em dash, en dash + return !/[^\-\u2014\u2013\s]/.test( item.text() ); + }, + + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); + } + }, + + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .find( this.options.items ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay(function() { + this.focus( event, newItem ); + }); + } + }, + + next: function( event ) { + this._move( "next", "first", event ); + }, + + previous: function( event ) { + this._move( "prev", "last", event ); + }, + + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, + + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, + + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); + } + } + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.find( this.options.items )[ filter ](); + } + + this.focus( event, next ); + }, + + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isLastItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base - height < 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.find( this.options.items ) + [ !this.active ? "first" : "last" ]() ); + } + }, + + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isFirstItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base + height > 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.find( this.options.items ).first() ); + } + }, + + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); + }, + + select: function( event ) { + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + }, + + _filterMenuItems: function(character) { + var escapedCharacter = character.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ), + regex = new RegExp( "^" + escapedCharacter, "i" ); + + return this.activeMenu + .find( this.options.items ) + + // Only match on items, not dividers or other content (#10571) + .filter( ".ui-menu-item" ) + .filter(function() { + return regex.test( $.trim( $( this ).text() ) ); + }); + } +}); + + +/*! + * jQuery UI Autocomplete 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Effects/Explode + * http://api.jqueryui.com/autocomplete/ + */ + + +$.widget( "ui.autocomplete", { + version: "1.11.4", + defaultElement: "", + options: { + appendTo: null, + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, + + // callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, + + requestIndex: 0, + pending: 0, + + _create: function() { + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput, + nodeName = this.element[ 0 ].nodeName.toLowerCase(), + isTextarea = nodeName === "textarea", + isInput = nodeName === "input"; + + this.isMultiLine = + // Textareas are always multi-line + isTextarea ? true : + // Inputs are always single-line, even if inside a contentEditable element + // IE also treats inputs as contentEditable + isInput ? false : + // All other element types are determined by whether or not they're contentEditable + this.element.prop( "isContentEditable" ); + + this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ]; + this.isNewMenu = true; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; + } + + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch ( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + // when menu is open and has focus + if ( this.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + if ( !this.isMultiLine ) { + this._value( this.term ); + } + this.close( event ); + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + event.preventDefault(); + } + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch ( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } + }); + + this._initSource(); + this.menu = $( "
        " ) + .addClass( "ui-autocomplete ui-front" ) + .appendTo( this._appendTo() ) + .menu({ + // disable ARIA support, the live region takes care of that + role: null + }) + .hide() + .menu( "instance" ); + + this._on( this.menu.element, { + mousedown: function( event ) { + // prevent moving focus out of the text field + event.preventDefault(); + + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + }); + + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = this.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + this._delay(function() { + var that = this; + this.document.one( "mousedown", function( event ) { + if ( event.target !== that.element[ 0 ] && + event.target !== menuElement && + !$.contains( menuElement, event.target ) ) { + that.close(); + } + }); + }); + } + }, + menufocus: function( event, ui ) { + var label, item; + // support: Firefox + // Prevent accidental activation of menu items in Firefox (#7024 #9118) + if ( this.isNewMenu ) { + this.isNewMenu = false; + if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) { + this.menu.blur(); + + this.document.one( "mousemove", function() { + $( event.target ).trigger( event.originalEvent ); + }); + + return; + } + } + + item = ui.item.data( "ui-autocomplete-item" ); + if ( false !== this._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) { + this._value( item.value ); + } + } + + // Announce the value in the liveRegion + label = ui.item.attr( "aria-label" ) || item.value; + if ( label && $.trim( label ).length ) { + this.liveRegion.children().hide(); + $( "
        " ).text( label ).appendTo( this.liveRegion ); + } + }, + menuselect: function( event, ui ) { + var item = ui.item.data( "ui-autocomplete-item" ), + previous = this.previous; + + // only trigger when focus was lost (click on menu) + if ( this.element[ 0 ] !== this.document[ 0 ].activeElement ) { + this.element.focus(); + this.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + this._delay(function() { + this.previous = previous; + this.selectedItem = item; + }); + } + + if ( false !== this._trigger( "select", event, { item: item } ) ) { + this._value( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + this.term = this._value(); + + this.close( event ); + this.selectedItem = item; + } + }); + + this.liveRegion = $( "", { + role: "status", + "aria-live": "assertive", + "aria-relevant": "additions" + }) + .addClass( "ui-helper-hidden-accessible" ) + .appendTo( this.document[ 0 ].body ); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + }); + }, + + _destroy: function() { + clearTimeout( this.searching ); + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ); + this.menu.element.remove(); + this.liveRegion.remove(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( this._appendTo() ); + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + + if ( element ) { + element = element.jquery || element.nodeType ? + $( element ) : + this.document.find( element ).eq( 0 ); + } + + if ( !element || !element[ 0 ] ) { + element = this.element.closest( ".ui-front" ); + } + + if ( !element.length ) { + element = this.document[ 0 ].body; + } + + return element; + }, + + _initSource: function() { + var array, url, + that = this; + if ( $.isArray( this.options.source ) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter( array, request.term ) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( that.xhr ) { + that.xhr.abort(); + } + that.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data ) { + response( data ); + }, + error: function() { + response([]); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + _searchTimeout: function( event ) { + clearTimeout( this.searching ); + this.searching = this._delay(function() { + + // Search if the value has changed, or if the user retypes the same value (see #7434) + var equalValues = this.term === this._value(), + menuVisible = this.menu.element.is( ":visible" ), + modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey; + + if ( !equalValues || ( equalValues && !menuVisible && !modifierKey ) ) { + this.selectedItem = null; + this.search( null, event ); + } + }, this.options.delay ); + }, + + search: function( value, event ) { + value = value != null ? value : this._value(); + + // always save the actual value, not the one passed as an argument + this.term = this._value(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + this.cancelSearch = false; + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var index = ++this.requestIndex; + + return $.proxy(function( content ) { + if ( index === this.requestIndex ) { + this.__response( content ); + } + + this.pending--; + if ( !this.pending ) { + this.element.removeClass( "ui-autocomplete-loading" ); + } + }, this ); + }, + + __response: function( content ) { + if ( content ) { + content = this._normalize( content ); + } + this._trigger( "response", null, { content: content } ); + if ( !this.options.disabled && content && content.length && !this.cancelSearch ) { + this._suggest( content ); + this._trigger( "open" ); + } else { + // use ._close() instead of .close() so we don't cancel future searches + this._close(); + } + }, + + close: function( event ) { + this.cancelSearch = true; + this._close( event ); + }, + + _close: function( event ) { + if ( this.menu.element.is( ":visible" ) ) { + this.menu.element.hide(); + this.menu.blur(); + this.isNewMenu = true; + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this._value() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[ 0 ].label && items[ 0 ].value ) { + return items; + } + return $.map( items, function( item ) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend( {}, item, { + label: item.label || item.value, + value: item.value || item.label + }); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element.empty(); + this._renderMenu( ul, items ); + this.isNewMenu = true; + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position ) ); + + if ( this.options.autoFocus ) { + this.menu.next(); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var that = this; + $.each( items, function( index, item ) { + that._renderItemData( ul, item ); + }); + }, + + _renderItemData: function( ul, item ) { + return this._renderItem( ul, item ).data( "ui-autocomplete-item", item ); + }, + + _renderItem: function( ul, item ) { + return $( "
      • " ).text( item.label ).appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is( ":visible" ) ) { + this.search( null, event ); + return; + } + if ( this.menu.isFirstItem() && /^previous/.test( direction ) || + this.menu.isLastItem() && /^next/.test( direction ) ) { + + if ( !this.isMultiLine ) { + this._value( this.term ); + } + + this.menu.blur(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + + _value: function() { + return this.valueMethod.apply( this.element, arguments ); + }, + + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ); + }, + filter: function( array, term ) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex( term ), "i" ); + return $.grep( array, function( value ) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +// live region extension, adding a `messages` option +// NOTE: This is an experimental API. We are still investigating +// a full solution for string manipulation and internationalization. +$.widget( "ui.autocomplete", $.ui.autocomplete, { + options: { + messages: { + noResults: "No search results.", + results: function( amount ) { + return amount + ( amount > 1 ? " results are" : " result is" ) + + " available, use up and down arrow keys to navigate."; + } + } + }, + + __response: function( content ) { + var message; + this._superApply( arguments ); + if ( this.options.disabled || this.cancelSearch ) { + return; + } + if ( content && content.length ) { + message = this.options.messages.results( content.length ); + } else { + message = this.options.messages.noResults; + } + this.liveRegion.children().hide(); + $( "
        " ).text( message ).appendTo( this.liveRegion ); + } +}); + +var autocomplete = $.ui.autocomplete; + + +/*! + * jQuery UI Button 1.11.4 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + * http://api.jqueryui.com/button/ + */ + + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var form = $( this ); + setTimeout(function() { + form.find( ":ui-button" ).button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + name = name.replace( /'/g, "\\'" ); + if ( form ) { + radios = $( form ).find( "[name='" + name + "'][type=radio]" ); + } else { + radios = $( "[name='" + name + "'][type=radio]", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + version: "1.11.4", + defaultElement: "").addClass(this._triggerClass). + html(!buttonImage ? buttonText : $("").attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? "before" : "after"](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) { + $.datepicker._hideDatepicker(); + } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else { + $.datepicker._showDatepicker(input[0]); + } + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, "autoSize") && !inst.inline) { + var findMax, max, maxI, i, + date = new Date(2009, 12 - 1, 20), // Ensure double digits + dateFormat = this._get(inst, "dateFormat"); + + if (dateFormat.match(/[DM]/)) { + findMax = function(names) { + max = 0; + maxI = 0; + for (i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + "monthNames" : "monthNamesShort")))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + "dayNames" : "dayNamesShort"))) + 20 - date.getDay()); + } + inst.input.attr("size", this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) { + return; + } + divSpan.addClass(this.markerClassName).append(inst.dpDiv); + $.data(target, "datepicker", inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + * @param input element - ignored + * @param date string or Date - the initial date to display + * @param onSelect function - the function to call when a date is selected + * @param settings object - update the dialog date picker instance's settings (anonymous object) + * @param pos int[2] - coordinates for the dialog's position within the screen or + * event - with x/y coordinates or + * leave empty for default (screen centre) + * @return the manager object + */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var id, browserWidth, browserHeight, scrollX, scrollY, + inst = this._dialogInst; // internal instance + + if (!inst) { + this.uuid += 1; + id = "dp" + this.uuid; + this._dialogInput = $(""); + this._dialogInput.keydown(this._doKeyDown); + $("body").append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], "datepicker", inst); + } + datepicker_extendRemove(inst.settings, settings || {}); + date = (date && date.constructor === Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + browserWidth = document.documentElement.clientWidth; + browserHeight = document.documentElement.clientHeight; + scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px"); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) { + $.blockUI(this.dpDiv); + } + $.data(this._dialogInput[0], "datepicker", inst); + return this; + }, + + /* Detach a datepicker from its control. + * @param target element - the target input field or division or span + */ + _destroyDatepicker: function(target) { + var nodeName, + $target = $(target), + inst = $.data(target, "datepicker"); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + $.removeData(target, "datepicker"); + if (nodeName === "input") { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind("focus", this._showDatepicker). + unbind("keydown", this._doKeyDown). + unbind("keypress", this._doKeyPress). + unbind("keyup", this._doKeyUp); + } else if (nodeName === "div" || nodeName === "span") { + $target.removeClass(this.markerClassName).empty(); + } + + if ( datepicker_instActive === inst ) { + datepicker_instActive = null; + } + }, + + /* Enable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _enableDatepicker: function(target) { + var nodeName, inline, + $target = $(target), + inst = $.data(target, "datepicker"); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if (nodeName === "input") { + target.disabled = false; + inst.trigger.filter("button"). + each(function() { this.disabled = false; }).end(). + filter("img").css({opacity: "1.0", cursor: ""}); + } else if (nodeName === "div" || nodeName === "span") { + inline = $target.children("." + this._inlineClass); + inline.children().removeClass("ui-state-disabled"); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", false); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value === target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _disableDatepicker: function(target) { + var nodeName, inline, + $target = $(target), + inst = $.data(target, "datepicker"); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if (nodeName === "input") { + target.disabled = true; + inst.trigger.filter("button"). + each(function() { this.disabled = true; }).end(). + filter("img").css({opacity: "0.5", cursor: "default"}); + } else if (nodeName === "div" || nodeName === "span") { + inline = $target.children("." + this._inlineClass); + inline.children().addClass("ui-state-disabled"); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", true); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value === target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + * @param target element - the target input field or division or span + * @return boolean - true if disabled, false if enabled + */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] === target) { + return true; + } + } + return false; + }, + + /* Retrieve the instance data for the target control. + * @param target element - the target input field or division or span + * @return object - the associated instance data + * @throws error if a jQuery problem getting data + */ + _getInst: function(target) { + try { + return $.data(target, "datepicker"); + } + catch (err) { + throw "Missing instance data for this datepicker"; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + * @param target element - the target input field or division or span + * @param name object - the new settings to update or + * string - the name of the setting to change or retrieve, + * when retrieving also "all" for all instance settings or + * "defaults" for all global defaults + * @param value any - the new value for the setting + * (omit if above is an object or to retrieve a value) + */ + _optionDatepicker: function(target, name, value) { + var settings, date, minDate, maxDate, + inst = this._getInst(target); + + if (arguments.length === 2 && typeof name === "string") { + return (name === "defaults" ? $.extend({}, $.datepicker._defaults) : + (inst ? (name === "all" ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + + settings = name || {}; + if (typeof name === "string") { + settings = {}; + settings[name] = value; + } + + if (inst) { + if (this._curInst === inst) { + this._hideDatepicker(); + } + + date = this._getDateDatepicker(target, true); + minDate = this._getMinMaxDate(inst, "min"); + maxDate = this._getMinMaxDate(inst, "max"); + datepicker_extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) { + inst.settings.minDate = this._formatDate(inst, minDate); + } + if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) { + inst.settings.maxDate = this._formatDate(inst, maxDate); + } + if ( "disabled" in settings ) { + if ( settings.disabled ) { + this._disableDatepicker(target); + } else { + this._enableDatepicker(target); + } + } + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + * @param target element - the target input field or division or span + */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + * @param target element - the target input field or division or span + * @param date Date - the new date + */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + * @param target element - the target input field or division or span + * @param noDefault boolean - true if no default date is to be used + * @return Date - the current date + */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) { + this._setDateFromField(inst, noDefault); + } + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var onSelect, dateStr, sel, + inst = $.datepicker._getInst(event.target), + handled = true, + isRTL = inst.dpDiv.is(".ui-datepicker-rtl"); + + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) { + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." + + $.datepicker._currentClass + ")", inst.dpDiv); + if (sel[0]) { + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + } + + onSelect = $.datepicker._get(inst, "onSelect"); + if (onSelect) { + dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } else { + $.datepicker._hideDatepicker(); + } + + return false; // don't submit the form + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, "stepBigMonths") : + -$.datepicker._get(inst, "stepMonths")), "M"); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, "stepBigMonths") : + +$.datepicker._get(inst, "stepMonths")), "M"); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) { + $.datepicker._clearDate(event.target); + } + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) { + $.datepicker._gotoToday(event.target); + } + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D"); + } + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) { + $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, "stepBigMonths") : + -$.datepicker._get(inst, "stepMonths")), "M"); + } + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, -7, "D"); + } + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D"); + } + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) { + $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, "stepBigMonths") : + +$.datepicker._get(inst, "stepMonths")), "M"); + } + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, +7, "D"); + } + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + } else { + handled = false; + } + + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var chars, chr, + inst = $.datepicker._getInst(event.target); + + if ($.datepicker._get(inst, "constrainInput")) { + chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat")); + chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var date, + inst = $.datepicker._getInst(event.target); + + if (inst.input.val() !== inst.lastVal) { + try { + date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + * If false returned from beforeShow event handler do not show. + * @param input element - the input field attached to the date picker or + * event - if triggered by focus + */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger + input = $("input", input.parentNode)[0]; + } + + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here + return; + } + + var inst, beforeShow, beforeShowSettings, isFixed, + offset, showAnim, duration; + + inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst !== inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + + beforeShow = $.datepicker._get(inst, "beforeShow"); + beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + return; + } + datepicker_extendRemove(inst.settings, beforeShowSettings); + + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + + if ($.datepicker._inDialog) { // hide cursor + input.value = ""; + } + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + + isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css("position") === "fixed"; + return !isFixed; + }); + + offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: "absolute", display: "block", top: "-1000px"}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + "static" : (isFixed ? "fixed" : "absolute")), display: "none", + left: offset.left + "px", top: offset.top + "px"}); + + if (!inst.inline) { + showAnim = $.datepicker._get(inst, "showAnim"); + duration = $.datepicker._get(inst, "duration"); + inst.dpDiv.css( "z-index", datepicker_getZindex( $( input ) ) + 1 ); + $.datepicker._datepickerShowing = true; + + if ( $.effects && $.effects.effect[ showAnim ] ) { + inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration); + } else { + inst.dpDiv[showAnim || "show"](showAnim ? duration : null); + } + + if ( $.datepicker._shouldFocusInput( inst ) ) { + inst.input.focus(); + } + + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + this.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + datepicker_instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + + var origyearshtml, + numMonths = this._getNumberOfMonths(inst), + cols = numMonths[1], + width = 17, + activeCell = inst.dpDiv.find( "." + this._dayOverClass + " a" ); + + if ( activeCell.length > 0 ) { + datepicker_handleMouseover.apply( activeCell.get( 0 ) ); + } + + inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""); + if (cols > 1) { + inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em"); + } + inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") + + "Class"]("ui-datepicker-multi"); + inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") + + "Class"]("ui-datepicker-rtl"); + + if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput( inst ) ) { + inst.input.focus(); + } + + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + // Support: IE and jQuery <1.9 + _shouldFocusInput: function( inst ) { + return inst.input && inst.input.is( ":visible" ) && !inst.input.is( ":disabled" ) && !inst.input.is( ":focus" ); + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(), + dpHeight = inst.dpDiv.outerHeight(), + inputWidth = inst.input ? inst.input.outerWidth() : 0, + inputHeight = inst.input ? inst.input.outerHeight() : 0, + viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()), + viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var position, + inst = this._getInst(obj), + isRTL = this._get(inst, "isRTL"); + + while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? "previousSibling" : "nextSibling"]; + } + + position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + * @param input element - the input field attached to the date picker + */ + _hideDatepicker: function(input) { + var showAnim, duration, postProcess, onClose, + inst = this._curInst; + + if (!inst || (input && inst !== $.data(input, "datepicker"))) { + return; + } + + if (this._datepickerShowing) { + showAnim = this._get(inst, "showAnim"); + duration = this._get(inst, "duration"); + postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + + // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed + if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) { + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess); + } else { + inst.dpDiv[(showAnim === "slideDown" ? "slideUp" : + (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess); + } + + if (!showAnim) { + postProcess(); + } + this._datepickerShowing = false; + + onClose = this._get(inst, "onClose"); + if (onClose) { + onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]); + } + + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" }); + if ($.blockUI) { + $.unblockUI(); + $("body").append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar"); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) { + return; + } + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id !== $.datepicker._mainDivId && + $target.parents("#" + $.datepicker._mainDivId).length === 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst ) ) { + $.datepicker._hideDatepicker(); + } + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id), + inst = this._getInst(target[0]); + + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var date, + target = $(id), + inst = this._getInst(target[0]); + + if (this._get(inst, "gotoCurrent") && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } else { + date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id), + inst = this._getInst(target[0]); + + inst["selected" + (period === "M" ? "Month" : "Year")] = + inst["draw" + (period === "M" ? "Month" : "Year")] = + parseInt(select.options[select.selectedIndex].value,10); + + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var inst, + target = $(id); + + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + + inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $("a", td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + this._selectDate(target, ""); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var onSelect, + target = $(id), + inst = this._getInst(target[0]); + + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) { + inst.input.val(dateStr); + } + this._updateAlternate(inst); + + onSelect = this._get(inst, "onSelect"); + if (onSelect) { + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + } else if (inst.input) { + inst.input.trigger("change"); // fire the change event + } + + if (inst.inline){ + this._updateDatepicker(inst); + } else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) !== "object") { + inst.input.focus(); // restore focus + } + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altFormat, date, dateStr, + altField = this._get(inst, "altField"); + + if (altField) { // update alternate field too + altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat"); + date = this._getDate(inst); + dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + * @param date Date - the date to customise + * @return [boolean, string] - is this date selectable?, what is its CSS class? + */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), ""]; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + * @param date Date - the date to get the week for + * @return number - the number of the week within the year that contains this date + */ + iso8601Week: function(date) { + var time, + checkDate = new Date(date.getTime()); + + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + + time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + * See formatDate below for the possible formats. + * + * @param format string - the expected format of the date + * @param value string - the date in the above format + * @param settings Object - attributes include: + * shortYearCutoff number - the cutoff year for determining the century (optional) + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return Date - the extracted date value or null if value is blank + */ + parseDate: function (format, value, settings) { + if (format == null || value == null) { + throw "Invalid arguments"; + } + + value = (typeof value === "object" ? value.toString() : value + ""); + if (value === "") { + return null; + } + + var iFormat, dim, extra, + iValue = 0, + shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff, + shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp : + new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)), + dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, + dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, + monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, + monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, + year = -1, + month = -1, + day = -1, + doy = -1, + literal = false, + date, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }, + // Extract a number from the string value + getNumber = function(match) { + var isDoubled = lookAhead(match), + size = (match === "@" ? 14 : (match === "!" ? 20 : + (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))), + minSize = (match === "y" ? size : 1), + digits = new RegExp("^\\d{" + minSize + "," + size + "}"), + num = value.substring(iValue).match(digits); + if (!num) { + throw "Missing number at position " + iValue; + } + iValue += num[0].length; + return parseInt(num[0], 10); + }, + // Extract a name from the string value and convert to an index + getName = function(match, shortNames, longNames) { + var index = -1, + names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index !== -1) { + return index + 1; + } else { + throw "Unknown name at position " + iValue; + } + }, + // Confirm that a literal character matches the string value + checkLiteral = function() { + if (value.charAt(iValue) !== format.charAt(iFormat)) { + throw "Unexpected literal at position " + iValue; + } + iValue++; + }; + + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + checkLiteral(); + } + } else { + switch (format.charAt(iFormat)) { + case "d": + day = getNumber("d"); + break; + case "D": + getName("D", dayNamesShort, dayNames); + break; + case "o": + doy = getNumber("o"); + break; + case "m": + month = getNumber("m"); + break; + case "M": + month = getName("M", monthNamesShort, monthNames); + break; + case "y": + year = getNumber("y"); + break; + case "@": + date = new Date(getNumber("@")); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "!": + date = new Date((getNumber("!") - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")){ + checkLiteral(); + } else { + literal = true; + } + break; + default: + checkLiteral(); + } + } + } + + if (iValue < value.length){ + extra = value.substr(iValue); + if (!/^\s+/.test(extra)) { + throw "Extra/unparsed characters found in date: " + extra; + } + } + + if (year === -1) { + year = new Date().getFullYear(); + } else if (year < 100) { + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + } + + if (doy > -1) { + month = 1; + day = doy; + do { + dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) { + break; + } + month++; + day -= dim; + } while (true); + } + + date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) { + throw "Invalid date"; // E.g. 31/02/00 + } + return date; + }, + + /* Standard date formats. */ + ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601) + COOKIE: "D, dd M yy", + ISO_8601: "yy-mm-dd", + RFC_822: "D, d M y", + RFC_850: "DD, dd-M-y", + RFC_1036: "D, d M y", + RFC_1123: "D, d M yy", + RFC_2822: "D, d M yy", + RSS: "D, d M y", // RFC 822 + TICKS: "!", + TIMESTAMP: "@", + W3C: "yy-mm-dd", // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + * The format can be combinations of the following: + * d - day of month (no leading zero) + * dd - day of month (two digit) + * o - day of year (no leading zeros) + * oo - day of year (three digit) + * D - day name short + * DD - day name long + * m - month of year (no leading zero) + * mm - month of year (two digit) + * M - month name short + * MM - month name long + * y - year (two digit) + * yy - year (four digit) + * @ - Unix timestamp (ms since 01/01/1970) + * ! - Windows ticks (100ns since 01/01/0001) + * "..." - literal text + * '' - single quote + * + * @param format string - the desired format of the date + * @param date Date - the date value to format + * @param settings Object - attributes include: + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return string - the date in the above format + */ + formatDate: function (format, date, settings) { + if (!date) { + return ""; + } + + var iFormat, + dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, + dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, + monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, + monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }, + // Format a number, with leading zero if necessary + formatNumber = function(match, value, len) { + var num = "" + value; + if (lookAhead(match)) { + while (num.length < len) { + num = "0" + num; + } + } + return num; + }, + // Format a name, short or long as requested + formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }, + output = "", + literal = false; + + if (date) { + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + output += format.charAt(iFormat); + } + } else { + switch (format.charAt(iFormat)) { + case "d": + output += formatNumber("d", date.getDate(), 2); + break; + case "D": + output += formatName("D", date.getDay(), dayNamesShort, dayNames); + break; + case "o": + output += formatNumber("o", + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case "m": + output += formatNumber("m", date.getMonth() + 1, 2); + break; + case "M": + output += formatName("M", date.getMonth(), monthNamesShort, monthNames); + break; + case "y": + output += (lookAhead("y") ? date.getFullYear() : + (date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100); + break; + case "@": + output += date.getTime(); + break; + case "!": + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) { + output += "'"; + } else { + literal = true; + } + break; + default: + output += format.charAt(iFormat); + } + } + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var iFormat, + chars = "", + literal = false, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }; + + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + chars += format.charAt(iFormat); + } + } else { + switch (format.charAt(iFormat)) { + case "d": case "m": case "y": case "@": + chars += "0123456789"; + break; + case "D": case "M": + return null; // Accept anything + case "'": + if (lookAhead("'")) { + chars += "'"; + } else { + literal = true; + } + break; + default: + chars += format.charAt(iFormat); + } + } + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() === inst.lastVal) { + return; + } + + var dateFormat = this._get(inst, "dateFormat"), + dates = inst.lastVal = inst.input ? inst.input.val() : null, + defaultDate = this._getDefaultDate(inst), + date = defaultDate, + settings = this._getFormatConfig(inst); + + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + dates = (noDefault ? "" : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, "defaultDate"), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }, + offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(), + year = date.getFullYear(), + month = date.getMonth(), + day = date.getDate(), + pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g, + matches = pattern.exec(offset); + + while (matches) { + switch (matches[2] || "d") { + case "d" : case "D" : + day += parseInt(matches[1],10); break; + case "w" : case "W" : + day += parseInt(matches[1],10) * 7; break; + case "m" : case "M" : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case "y": case "Y" : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }, + newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) : + (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + + newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + * Hours may be non-zero on daylight saving cut-over: + * > 12 when midnight changeover, but then cannot generate + * midnight datetime, so jump to 1AM, otherwise reset. + * @param date (Date) the date to check + * @return (Date) the corrected date + */ + _daylightSavingAdjust: function(date) { + if (!date) { + return null; + } + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date, + origMonth = inst.selectedMonth, + origYear = inst.selectedYear, + newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) { + this._notifyChange(inst); + } + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? "" : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, "stepMonths"), + id = "#" + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find("[data-handler]").map(function () { + var handler = { + prev: function () { + $.datepicker._adjustDate(id, -stepMonths, "M"); + }, + next: function () { + $.datepicker._adjustDate(id, +stepMonths, "M"); + }, + hide: function () { + $.datepicker._hideDatepicker(); + }, + today: function () { + $.datepicker._gotoToday(id); + }, + selectDay: function () { + $.datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this); + return false; + }, + selectMonth: function () { + $.datepicker._selectMonthYear(id, this, "M"); + return false; + }, + selectYear: function () { + $.datepicker._selectMonthYear(id, this, "Y"); + return false; + } + }; + $(this).bind(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var maxDraw, prevText, prev, nextText, next, currentText, gotoDate, + controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin, + monthNames, monthNamesShort, beforeShowDay, showOtherMonths, + selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate, + cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows, + printDate, dRow, tbody, daySettings, otherMonth, unselectable, + tempDate = new Date(), + today = this._daylightSavingAdjust( + new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time + isRTL = this._get(inst, "isRTL"), + showButtonPanel = this._get(inst, "showButtonPanel"), + hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"), + navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"), + numMonths = this._getNumberOfMonths(inst), + showCurrentAtPos = this._get(inst, "showCurrentAtPos"), + stepMonths = this._get(inst, "stepMonths"), + isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1), + currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))), + minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + drawMonth = inst.drawMonth - showCurrentAtPos, + drawYear = inst.drawYear; + + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + + prevText = this._get(inst, "prevText"); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + + prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + "" + prevText + "" : + (hideIfNoPrevNext ? "" : "" + prevText + "")); + + nextText = this._get(inst, "nextText"); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + + next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + "" + nextText + "" : + (hideIfNoPrevNext ? "" : "" + nextText + "")); + + currentText = this._get(inst, "currentText"); + gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + + controls = (!inst.inline ? "" : ""); + + buttonPanel = (showButtonPanel) ? "
        " + (isRTL ? controls : "") + + (this._isInRange(inst, gotoDate) ? "" : "") + (isRTL ? "" : controls) + "
        " : ""; + + firstDay = parseInt(this._get(inst, "firstDay"),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + + showWeek = this._get(inst, "showWeek"); + dayNames = this._get(inst, "dayNames"); + dayNamesMin = this._get(inst, "dayNamesMin"); + monthNames = this._get(inst, "monthNames"); + monthNamesShort = this._get(inst, "monthNamesShort"); + beforeShowDay = this._get(inst, "beforeShowDay"); + showOtherMonths = this._get(inst, "showOtherMonths"); + selectOtherMonths = this._get(inst, "selectOtherMonths"); + defaultDate = this._getDefaultDate(inst); + html = ""; + dow; + for (row = 0; row < numMonths[0]; row++) { + group = ""; + this.maxRows = 4; + for (col = 0; col < numMonths[1]; col++) { + selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + cornerClass = " ui-corner-all"; + calender = ""; + if (isMultiMonth) { + calender += "
        "; + } + calender += "
        " + + (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") + + (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + "
        " + + ""; + thead = (showWeek ? "" : ""); + for (dow = 0; dow < 7; dow++) { // days of the week + day = (dow + firstDay) % 7; + thead += ""; + } + calender += thead + ""; + daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) { + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + } + leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ""; + tbody = (!showWeek ? "" : ""); + for (dow = 0; dow < 7; dow++) { // create date picker days + daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]); + otherMonth = (printDate.getMonth() !== drawMonth); + unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ""; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ""; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += "
        " + this._get(inst, "weekHeader") + "= 5 ? " class='ui-datepicker-week-end'" : "") + ">" + + "" + dayNamesMin[day] + "
        " + + this._get(inst, "calculateWeek")(printDate) + "" + // actions + (otherMonth && !showOtherMonths ? " " : // display for other months + (unselectable ? "" + printDate.getDate() + "" : "" + printDate.getDate() + "")) + "
        " + (isMultiMonth ? "
        " + + ((numMonths[0] > 0 && col === numMonths[1]-1) ? "
        " : "") : ""); + group += calender; + } + html += group; + } + html += buttonPanel; + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + + var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear, + changeMonth = this._get(inst, "changeMonth"), + changeYear = this._get(inst, "changeYear"), + showMonthAfterYear = this._get(inst, "showMonthAfterYear"), + html = "
        ", + monthHtml = ""; + + // month selection + if (secondary || !changeMonth) { + monthHtml += "" + monthNames[drawMonth] + ""; + } else { + inMinYear = (minDate && minDate.getFullYear() === drawYear); + inMaxYear = (maxDate && maxDate.getFullYear() === drawYear); + monthHtml += ""; + } + + if (!showMonthAfterYear) { + html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : ""); + } + + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ""; + if (secondary || !changeYear) { + html += "" + drawYear + ""; + } else { + // determine range of years to display + years = this._get(inst, "yearRange").split(":"); + thisYear = new Date().getFullYear(); + determineYear = function(value) { + var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + year = determineYear(years[0]); + endYear = Math.max(year, determineYear(years[1] || "")); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ""; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + + html += this._get(inst, "yearSuffix"); + if (showMonthAfterYear) { + html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml; + } + html += "
        "; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period === "Y" ? offset : 0), + month = inst.drawMonth + (period === "M" ? offset : 0), + day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0), + date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day))); + + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period === "M" || period === "Y") { + this._notifyChange(inst); + } + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + newDate = (minDate && date < minDate ? minDate : date); + return (maxDate && newDate > maxDate ? maxDate : newDate); + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, "onChangeMonthYear"); + if (onChange) { + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + } + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, "numberOfMonths"); + return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + "Date"), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst), + date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + + if (offset < 0) { + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + } + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var yearSplit, currentYear, + minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + minYear = null, + maxYear = null, + years = this._get(inst, "yearRange"); + if (years){ + yearSplit = years.split(":"); + currentYear = new Date().getFullYear(); + minYear = parseInt(yearSplit[0], 10); + maxYear = parseInt(yearSplit[1], 10); + if ( yearSplit[0].match(/[+\-].*/) ) { + minYear += currentYear; + } + if ( yearSplit[1].match(/[+\-].*/) ) { + maxYear += currentYear; + } + } + + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime()) && + (!minYear || date.getFullYear() >= minYear) && + (!maxYear || date.getFullYear() <= maxYear)); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, "shortYearCutoff"); + shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"), + monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames")}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day === "object" ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. */ -(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e
        ").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ -e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); -;/* - * jQuery UI Effects Fade 1.8.14 +function datepicker_bindHover(dpDiv) { + var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a"; + return dpDiv.delegate(selector, "mouseout", function() { + $(this).removeClass("ui-state-hover"); + if (this.className.indexOf("ui-datepicker-prev") !== -1) { + $(this).removeClass("ui-datepicker-prev-hover"); + } + if (this.className.indexOf("ui-datepicker-next") !== -1) { + $(this).removeClass("ui-datepicker-next-hover"); + } + }) + .delegate( selector, "mouseover", datepicker_handleMouseover ); +} + +function datepicker_handleMouseover() { + if (!$.datepicker._isDisabledDatepicker( datepicker_instActive.inline? datepicker_instActive.dpDiv.parent()[0] : datepicker_instActive.input[0])) { + $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); + $(this).addClass("ui-state-hover"); + if (this.className.indexOf("ui-datepicker-prev") !== -1) { + $(this).addClass("ui-datepicker-prev-hover"); + } + if (this.className.indexOf("ui-datepicker-next") !== -1) { + $(this).addClass("ui-datepicker-next-hover"); + } + } +} + +/* jQuery extend now ignores nulls! */ +function datepicker_extendRemove(target, props) { + $.extend(target, props); + for (var name in props) { + if (props[name] == null) { + target[name] = props[name]; + } + } + return target; +} + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick); + $.datepicker.initialized = true; + } + + /* Append datepicker main container to body if not exist. */ + if ($("#"+$.datepicker._mainDivId).length === 0) { + $("body").append($.datepicker.dpDiv); + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) { + return $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this[0]].concat(otherArgs)); + } + if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") { + return $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this[0]].concat(otherArgs)); + } + return this.each(function() { + typeof options === "string" ? + $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.11.4"; + +var datepicker = $.datepicker; + + +/*! + * jQuery UI Draggable 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Effects/Fade + * http://api.jqueryui.com/draggable/ + */ + + +$.widget("ui.draggable", $.ui.mouse, { + version: "1.11.4", + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false, + + // callbacks + drag: null, + start: null, + stop: null + }, + _create: function() { + + if ( this.options.helper === "original" ) { + this._setPositionRelative(); + } + if (this.options.addClasses){ + this.element.addClass("ui-draggable"); + } + if (this.options.disabled){ + this.element.addClass("ui-draggable-disabled"); + } + this._setHandleClassName(); + + this._mouseInit(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "handle" ) { + this._removeHandleClassName(); + this._setHandleClassName(); + } + }, + + _destroy: function() { + if ( ( this.helper || this.element ).is( ".ui-draggable-dragging" ) ) { + this.destroyOnClear = true; + return; + } + this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" ); + this._removeHandleClassName(); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + var o = this.options; + + this._blurActiveElement( event ); + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) { + return false; + } + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) { + return false; + } + + this._blockFrames( o.iframeFix === true ? "iframe" : o.iframeFix ); + + return true; + + }, + + _blockFrames: function( selector ) { + this.iframeBlocks = this.document.find( selector ).map(function() { + var iframe = $( this ); + + return $( "
        " ) + .css( "position", "absolute" ) + .appendTo( iframe.parent() ) + .outerWidth( iframe.outerWidth() ) + .outerHeight( iframe.outerHeight() ) + .offset( iframe.offset() )[ 0 ]; + }); + }, + + _unblockFrames: function() { + if ( this.iframeBlocks ) { + this.iframeBlocks.remove(); + delete this.iframeBlocks; + } + }, + + _blurActiveElement: function( event ) { + var document = this.document[ 0 ]; + + // Only need to blur if the event occurred on the draggable itself, see #10527 + if ( !this.handleElement.is( event.target ) ) { + return; + } + + // support: IE9 + // IE9 throws an "Unspecified error" accessing document.activeElement from an